/* jquery.nicescroll
-- version 3.4.0
-- copyright 2011-12-13 InuYaksa*2013
-- licensed under the MIT
--
-- http://areaaperta.com/nicescroll
-- https://github.com/inuyaksa/jquery.nicescroll
--
*/
;(function (jQuery) {
// globals
var domfocus = false
var mousefocus = false
var zoomactive = false
var tabindexcounter = 5000
var ascrailcounter = 2000
var globalmaxzindex = 0
var $ = jQuery // sandbox
// http://stackoverflow.com/questions/2161159/get-script-path
function getScriptPath() {
var scripts = document.getElementsByTagName('script')
var path = scripts[scripts.length - 1].src.split('?')[0]
return path.split('/').length > 0 ? path.split('/').slice(0, -1).join('/') + '/' : ''
}
var scriptpath = getScriptPath()
// derived by Paul Irish https://gist.github.com/paulirish/1579671 - thanks for your code!
if (!Array.prototype.forEach) {
// JS 1.6 polyfill
Array.prototype.forEach = function (fn, scope) {
for (var i = 0, len = this.length; i < len; ++i) {
fn.call(scope, this[i], i, this)
}
}
}
var vendors = ['ms', 'moz', 'webkit', 'o']
var setAnimationFrame = window.requestAnimationFrame || false
var clearAnimationFrame = window.cancelAnimationFrame || false
vendors.forEach(function (v) {
if (!setAnimationFrame) setAnimationFrame = window[v + 'RequestAnimationFrame']
if (!clearAnimationFrame)
clearAnimationFrame =
window[v + 'CancelAnimationFrame'] || window[v + 'CancelRequestAnimationFrame']
})
var clsMutationObserver = window.MutationObserver || window.WebKitMutationObserver || false
var _globaloptions = {
zindex: 'auto',
cursoropacitymin: 0,
cursoropacitymax: 1,
cursorcolor: '#424242',
cursorwidth: '5px',
cursorborder: '1px solid #fff',
cursorborderradius: '5px',
scrollspeed: 60,
mousescrollstep: 8 * 3,
touchbehavior: false,
hwacceleration: true,
usetransition: true,
boxzoom: false,
dblclickzoom: true,
gesturezoom: true,
grabcursorenabled: true,
autohidemode: true,
background: '',
iframeautoresize: true,
cursorminheight: 32,
preservenativescrolling: true,
railoffset: false,
bouncescroll: true,
spacebarenabled: true,
railpadding: { top: 0, right: 0, left: 0, bottom: 0 },
disableoutline: true,
horizrailenabled: true,
railalign: 'right',
railvalign: 'bottom',
enabletranslate3d: true,
enablemousewheel: true,
enablekeyboard: true,
smoothscroll: true,
sensitiverail: true,
enablemouselockapi: true,
// cursormaxheight:false,
cursorfixedheight: false,
directionlockdeadzone: 6,
hidecursordelay: 400,
nativeparentscrolling: true,
enablescrollonselection: true,
overflowx: true,
overflowy: true,
cursordragspeed: 0.3,
rtlmode: false,
cursordragontouch: false
}
var browserdetected = false
var getBrowserDetection = function () {
if (browserdetected) return browserdetected
var domtest = document.createElement('DIV')
var d = {}
d.haspointerlock =
'pointerLockElement' in document ||
'mozPointerLockElement' in document ||
'webkitPointerLockElement' in document
d.isopera = 'opera' in window
d.isopera12 = d.isopera && 'getUserMedia' in navigator
d.isie = 'all' in document && 'attachEvent' in domtest && !d.isopera
d.isieold = d.isie && !('msInterpolationMode' in domtest.style) // IE6 and older
d.isie7 = d.isie && !d.isieold && (!('documentMode' in document) || document.documentMode == 7)
d.isie8 = d.isie && 'documentMode' in document && document.documentMode == 8
d.isie9 = d.isie && 'performance' in window && document.documentMode >= 9
d.isie10 = d.isie && 'performance' in window && document.documentMode >= 10
d.isie9mobile = /iemobile.9/i.test(navigator.userAgent) //wp 7.1 mango
if (d.isie9mobile) d.isie9 = false
d.isie7mobile = !d.isie9mobile && d.isie7 && /iemobile/i.test(navigator.userAgent) //wp 7.0
d.ismozilla = 'MozAppearance' in domtest.style
d.iswebkit = 'WebkitAppearance' in domtest.style
d.ischrome = 'chrome' in window
d.ischrome22 = d.ischrome && d.haspointerlock
d.ischrome26 = d.ischrome && 'transition' in domtest.style // issue with transform detection (maintain prefix)
d.cantouch = 'ontouchstart' in document.documentElement || 'ontouchstart' in window // detection for Chrome Touch Emulation
d.hasmstouch = window.navigator.msPointerEnabled || false // IE10+ pointer events
d.ismac = /^mac$/i.test(navigator.platform)
d.isios = d.cantouch && /iphone|ipad|ipod/i.test(navigator.platform)
d.isios4 = d.isios && !('seal' in Object)
d.isandroid = /android/i.test(navigator.userAgent)
d.trstyle = false
d.hastransform = false
d.hastranslate3d = false
d.transitionstyle = false
d.hastransition = false
d.transitionend = false
var check = ['transform', 'msTransform', 'webkitTransform', 'MozTransform', 'OTransform']
for (var a = 0; a < check.length; a++) {
if (typeof domtest.style[check[a]] != 'undefined') {
d.trstyle = check[a]
break
}
}
d.hastransform = d.trstyle != false
if (d.hastransform) {
domtest.style[d.trstyle] = 'translate3d(1px,2px,3px)'
d.hastranslate3d = /translate3d/.test(domtest.style[d.trstyle])
}
d.transitionstyle = false
d.prefixstyle = ''
d.transitionend = false
var check = [
'transition',
'webkitTransition',
'MozTransition',
'OTransition',
'OTransition',
'msTransition',
'KhtmlTransition'
]
var prefix = ['', '-webkit-', '-moz-', '-o-', '-o', '-ms-', '-khtml-']
var evs = [
'transitionend',
'webkitTransitionEnd',
'transitionend',
'otransitionend',
'oTransitionEnd',
'msTransitionEnd',
'KhtmlTransitionEnd'
]
for (var a = 0; a < check.length; a++) {
if (check[a] in domtest.style) {
d.transitionstyle = check[a]
d.prefixstyle = prefix[a]
d.transitionend = evs[a]
break
}
}
if (d.ischrome26) {
// use always prefix
d.prefixstyle = prefix[1]
}
d.hastransition = d.transitionstyle
function detectCursorGrab() {
var lst = ['-moz-grab', '-webkit-grab', 'grab']
if ((d.ischrome && !d.ischrome22) || d.isie) lst = [] // force setting for IE returns false positive and chrome cursor bug
for (var a = 0; a < lst.length; a++) {
var p = lst[a]
domtest.style['cursor'] = p
if (domtest.style['cursor'] == p) return p
}
return 'url(http://www.google.com/intl/en_ALL/mapfiles/openhand.cur),n-resize' // thank you google for custom cursor!
}
d.cursorgrabvalue = detectCursorGrab()
d.hasmousecapture = 'setCapture' in domtest
d.hasMutationObserver = clsMutationObserver !== false
domtest = null //memory released
browserdetected = d
return d
}
var NiceScrollClass = function (myopt, me) {
var self = this
this.version = '3.4.0'
this.name = 'nicescroll'
this.me = me
this.opt = {
doc: $('body'),
win: false
}
$.extend(this.opt, _globaloptions)
// Options for internal use
this.opt.snapbackspeed = 80
if (myopt || false) {
for (var a in self.opt) {
if (typeof myopt[a] != 'undefined') self.opt[a] = myopt[a]
}
}
this.doc = self.opt.doc
this.iddoc = this.doc && this.doc[0] ? this.doc[0].id || '' : ''
this.ispage = /BODY|HTML/.test(self.opt.win ? self.opt.win[0].nodeName : this.doc[0].nodeName)
this.haswrapper = self.opt.win !== false
this.win = self.opt.win || (this.ispage ? $(window) : this.doc)
this.docscroll = this.ispage && !this.haswrapper ? $(window) : this.win
this.body = $('body')
this.viewport = false
this.isfixed = false
this.iframe = false
this.isiframe = this.doc[0].nodeName == 'IFRAME' && this.win[0].nodeName == 'IFRAME'
this.istextarea = this.win[0].nodeName == 'TEXTAREA'
this.forcescreen = false //force to use screen position on events
this.canshowonmouseevent = self.opt.autohidemode != 'scroll'
// Events jump table
this.onmousedown = false
this.onmouseup = false
this.onmousemove = false
this.onmousewheel = false
this.onkeypress = false
this.ongesturezoom = false
this.onclick = false
// Nicescroll custom events
this.onscrollstart = false
this.onscrollend = false
this.onscrollcancel = false
this.onzoomin = false
this.onzoomout = false
// Let's start!
this.view = false
this.page = false
this.scroll = { x: 0, y: 0 }
this.scrollratio = { x: 0, y: 0 }
this.cursorheight = 20
this.scrollvaluemax = 0
this.checkrtlmode = false
this.scrollrunning = false
this.scrollmom = false
this.observer = false
this.observerremover = false // observer on parent for remove detection
do {
this.id = 'ascrail' + ascrailcounter++
} while (document.getElementById(this.id))
this.rail = false
this.cursor = false
this.cursorfreezed = false
this.selectiondrag = false
this.zoom = false
this.zoomactive = false
this.hasfocus = false
this.hasmousefocus = false
this.visibility = true
this.locked = false
this.hidden = false // rails always hidden
this.cursoractive = true // user can interact with cursors
this.overflowx = self.opt.overflowx
this.overflowy = self.opt.overflowy
this.nativescrollingarea = false
this.checkarea = 0
this.events = [] // event list for unbind
this.saved = {}
this.delaylist = {}
this.synclist = {}
this.lastdeltax = 0
this.lastdeltay = 0
this.detected = getBrowserDetection()
var cap = $.extend({}, this.detected)
this.canhwscroll = cap.hastransform && self.opt.hwacceleration
this.ishwscroll = this.canhwscroll && self.haswrapper
this.istouchcapable = false // desktop devices with touch screen support
//## Check Chrome desktop with touch support
if (cap.cantouch && cap.ischrome && !cap.isios && !cap.isandroid) {
this.istouchcapable = true
cap.cantouch = false // parse normal desktop events
}
//## Firefox 18 nightly build (desktop) false positive (or desktop with touch support)
if (cap.cantouch && cap.ismozilla && !cap.isios) {
this.istouchcapable = true
cap.cantouch = false // parse normal desktop events
}
//## disable MouseLock API on user request
if (!self.opt.enablemouselockapi) {
cap.hasmousecapture = false
cap.haspointerlock = false
}
this.delayed = function (name, fn, tm, lazy) {
var dd = self.delaylist[name]
var nw = new Date().getTime()
if (!lazy && dd && dd.tt) return false
if (dd && dd.tt) clearTimeout(dd.tt)
if (dd && dd.last + tm > nw && !dd.tt) {
self.delaylist[name] = {
last: nw + tm,
tt: setTimeout(function () {
self.delaylist[name].tt = 0
fn.call()
}, tm)
}
} else if (!dd || !dd.tt) {
self.delaylist[name] = {
last: nw,
tt: 0
}
setTimeout(function () {
fn.call()
}, 0)
}
}
this.debounced = function (name, fn, tm) {
var dd = self.delaylist[name]
var nw = new Date().getTime()
self.delaylist[name] = fn
if (!dd) {
setTimeout(function () {
var fn = self.delaylist[name]
self.delaylist[name] = false
fn.call()
}, tm)
}
}
this.synched = function (name, fn) {
function requestSync() {
if (self.onsync) return
setAnimationFrame(function () {
self.onsync = false
for (name in self.synclist) {
var fn = self.synclist[name]
if (fn) fn.call(self)
self.synclist[name] = false
}
})
self.onsync = true
}
self.synclist[name] = fn
requestSync()
return name
}
this.unsynched = function (name) {
if (self.synclist[name]) self.synclist[name] = false
}
this.css = function (el, pars) {
// save & set
for (var n in pars) {
self.saved.css.push([el, n, el.css(n)])
el.css(n, pars[n])
}
}
this.scrollTop = function (val) {
return typeof val == 'undefined' ? self.getScrollTop() : self.setScrollTop(val)
}
this.scrollLeft = function (val) {
return typeof val == 'undefined' ? self.getScrollLeft() : self.setScrollLeft(val)
}
// derived by by Dan Pupius www.pupius.net
BezierClass = function (st, ed, spd, p1, p2, p3, p4) {
this.st = st
this.ed = ed
this.spd = spd
this.p1 = p1 || 0
this.p2 = p2 || 1
this.p3 = p3 || 0
this.p4 = p4 || 1
this.ts = new Date().getTime()
this.df = this.ed - this.st
}
BezierClass.prototype = {
B2: function (t) {
return 3 * t * t * (1 - t)
},
B3: function (t) {
return 3 * t * (1 - t) * (1 - t)
},
B4: function (t) {
return (1 - t) * (1 - t) * (1 - t)
},
getNow: function () {
var nw = new Date().getTime()
var pc = 1 - (nw - this.ts) / this.spd
var bz = this.B2(pc) + this.B3(pc) + this.B4(pc)
return pc < 0 ? this.ed : this.st + Math.round(this.df * bz)
},
update: function (ed, spd) {
this.st = this.getNow()
this.ed = ed
this.spd = spd
this.ts = new Date().getTime()
this.df = this.ed - this.st
return this
}
}
if (this.ishwscroll) {
// hw accelerated scroll
this.doc.translate = { x: 0, y: 0, tx: '0px', ty: '0px' }
//this one can help to enable hw accel on ios6 http://indiegamr.com/ios6-html-hardware-acceleration-changes-and-how-to-fix-them/
if (cap.hastranslate3d && cap.isios) this.doc.css('-webkit-backface-visibility', 'hidden') // prevent flickering http://stackoverflow.com/questions/3461441/
//derived from http://stackoverflow.com/questions/11236090/
function getMatrixValues() {
var tr = self.doc.css(cap.trstyle)
if (tr && tr.substr(0, 6) == 'matrix') {
return tr
.replace(/^.*\((.*)\)$/g, '$1')
.replace(/px/g, '')
.split(/, +/)
}
return false
}
this.getScrollTop = function (last) {
if (!last) {
var mtx = getMatrixValues()
if (mtx) return mtx.length == 16 ? -mtx[13] : -mtx[5] //matrix3d 16 on IE10
if (self.timerscroll && self.timerscroll.bz) return self.timerscroll.bz.getNow()
}
return self.doc.translate.y
}
this.getScrollLeft = function (last) {
if (!last) {
var mtx = getMatrixValues()
if (mtx) return mtx.length == 16 ? -mtx[12] : -mtx[4] //matrix3d 16 on IE10
if (self.timerscroll && self.timerscroll.bh) return self.timerscroll.bh.getNow()
}
return self.doc.translate.x
}
if (document.createEvent) {
this.notifyScrollEvent = function (el) {
var e = document.createEvent('UIEvents')
e.initUIEvent('scroll', false, true, window, 1)
el.dispatchEvent(e)
}
} else if (document.fireEvent) {
this.notifyScrollEvent = function (el) {
var e = document.createEventObject()
el.fireEvent('onscroll')
e.cancelBubble = true
}
} else {
this.notifyScrollEvent = function (el, add) {} //NOPE
}
if (cap.hastranslate3d && self.opt.enabletranslate3d) {
this.setScrollTop = function (val, silent) {
self.doc.translate.y = val
self.doc.translate.ty = val * -1 + 'px'
self.doc.css(
cap.trstyle,
'translate3d(' + self.doc.translate.tx + ',' + self.doc.translate.ty + ',0px)'
)
if (!silent) self.notifyScrollEvent(self.win[0])
}
this.setScrollLeft = function (val, silent) {
self.doc.translate.x = val
self.doc.translate.tx = val * -1 + 'px'
self.doc.css(
cap.trstyle,
'translate3d(' + self.doc.translate.tx + ',' + self.doc.translate.ty + ',0px)'
)
if (!silent) self.notifyScrollEvent(self.win[0])
}
} else {
this.setScrollTop = function (val, silent) {
self.doc.translate.y = val
self.doc.translate.ty = val * -1 + 'px'
self.doc.css(
cap.trstyle,
'translate(' + self.doc.translate.tx + ',' + self.doc.translate.ty + ')'
)
if (!silent) self.notifyScrollEvent(self.win[0])
}
this.setScrollLeft = function (val, silent) {
self.doc.translate.x = val
self.doc.translate.tx = val * -1 + 'px'
self.doc.css(
cap.trstyle,
'translate(' + self.doc.translate.tx + ',' + self.doc.translate.ty + ')'
)
if (!silent) self.notifyScrollEvent(self.win[0])
}
}
} else {
// native scroll
this.getScrollTop = function () {
return self.docscroll.scrollTop()
}
this.setScrollTop = function (val) {
return self.docscroll.scrollTop(val)
}
this.getScrollLeft = function () {
return self.docscroll.scrollLeft()
}
this.setScrollLeft = function (val) {
return self.docscroll.scrollLeft(val)
}
}
this.getTarget = function (e) {
if (!e) return false
if (e.target) return e.target
if (e.srcElement) return e.srcElement
return false
}
this.hasParent = function (e, id) {
if (!e) return false
var el = e.target || e.srcElement || e || false
while (el && el.id != id) {
el = el.parentNode || false
}
return el !== false
}
function getZIndex() {
var dom = self.win
if ('zIndex' in dom) return dom.zIndex() // use jQuery UI method when available
while (dom.length > 0) {
if (dom[0].nodeType == 9) return false
var zi = dom.css('zIndex')
if (!isNaN(zi) && zi != 0) return parseInt(zi)
dom = dom.parent()
}
return false
}
//inspired by http://forum.jquery.com/topic/width-includes-border-width-when-set-to-thin-medium-thick-in-ie
var _convertBorderWidth = { thin: 1, medium: 3, thick: 5 }
function getWidthToPixel(dom, prop, chkheight) {
var wd = dom.css(prop)
var px = parseFloat(wd)
if (isNaN(px)) {
px = _convertBorderWidth[wd] || 0
var brd =
px == 3
? chkheight
? self.win.outerHeight() - self.win.innerHeight()
: self.win.outerWidth() - self.win.innerWidth()
: 1 //DON'T TRUST CSS
if (self.isie8 && px) px += 1
return brd ? px : 0
}
return px
}
this.getOffset = function () {
if (self.isfixed)
return { top: parseFloat(self.win.css('top')), left: parseFloat(self.win.css('left')) }
if (!self.viewport) return self.win.offset()
var ww = self.win.offset()
var vp = self.viewport.offset()
return {
top: ww.top - vp.top + self.viewport.scrollTop(),
left: ww.left - vp.left + self.viewport.scrollLeft()
}
}
this.updateScrollBar = function (len) {
if (self.ishwscroll) {
self.rail.css({ height: self.win.innerHeight() })
if (self.railh) self.railh.css({ width: self.win.innerWidth() })
} else {
var wpos = self.getOffset()
var pos = { top: wpos.top, left: wpos.left }
pos.top += getWidthToPixel(self.win, 'border-top-width', true)
var brd = (self.win.outerWidth() - self.win.innerWidth()) / 2
pos.left += self.rail.align
? self.win.outerWidth() -
getWidthToPixel(self.win, 'border-right-width') -
self.rail.width
: getWidthToPixel(self.win, 'border-left-width')
var off = self.opt.railoffset
if (off) {
if (off.top) pos.top += off.top
if (self.rail.align && off.left) pos.left += off.left
}
if (!self.locked)
self.rail.css({
top: pos.top,
left: pos.left,
height: len ? len.h : self.win.innerHeight()
})
if (self.zoom) {
self.zoom.css({
top: pos.top + 1,
left: self.rail.align == 1 ? pos.left - 20 : pos.left + self.rail.width + 4
})
}
if (self.railh && !self.locked) {
var pos = { top: wpos.top, left: wpos.left }
var y = self.railh.align
? pos.top +
getWidthToPixel(self.win, 'border-top-width', true) +
self.win.innerHeight() -
self.railh.height
: pos.top + getWidthToPixel(self.win, 'border-top-width', true)
var x = pos.left + getWidthToPixel(self.win, 'border-left-width')
self.railh.css({ top: y, left: x, width: self.railh.width })
}
}
}
this.doRailClick = function (e, dbl, hr) {
var fn, pg, cur, pos
// if (self.rail.drag&&self.rail.drag.pt!=1) return;
if (self.locked) return
// if (self.rail.drag) return;
// self.cancelScroll();
self.cancelEvent(e)
if (dbl) {
fn = hr ? self.doScrollLeft : self.doScrollTop
cur = hr
? (e.pageX - self.railh.offset().left - self.cursorwidth / 2) * self.scrollratio.x
: (e.pageY - self.rail.offset().top - self.cursorheight / 2) * self.scrollratio.y
fn(cur)
} else {
// console.log(e.pageY);
fn = hr ? self.doScrollLeftBy : self.doScrollBy
cur = hr ? self.scroll.x : self.scroll.y
pos = hr ? e.pageX - self.railh.offset().left : e.pageY - self.rail.offset().top
pg = hr ? self.view.w : self.view.h
cur >= pos ? fn(pg) : fn(-pg)
}
}
self.hasanimationframe = setAnimationFrame
self.hascancelanimationframe = clearAnimationFrame
if (!self.hasanimationframe) {
setAnimationFrame = function (fn) {
return setTimeout(fn, 15 - (Math.floor(+new Date() / 1000) % 16))
} // 1000/60)};
clearAnimationFrame = clearInterval
} else if (!self.hascancelanimationframe)
clearAnimationFrame = function () {
self.cancelAnimationFrame = true
}
this.init = function () {
self.saved.css = []
if (cap.isie7mobile) return true // SORRY, DO NOT WORK!
if (cap.hasmstouch)
self.css(self.ispage ? $('html') : self.win, { '-ms-touch-action': 'none' })
self.zindex = 'auto'
if (!self.ispage && self.opt.zindex == 'auto') {
self.zindex = getZIndex() || 'auto'
} else {
self.zindex = self.opt.zindex
}
if (!self.ispage && self.zindex != 'auto') {
if (self.zindex > globalmaxzindex) globalmaxzindex = self.zindex
}
if (self.isie && self.zindex == 0 && self.opt.zindex == 'auto') {
// fix IE auto == 0
self.zindex = 'auto'
}
/*
self.ispage = true;
self.haswrapper = true;
// self.win = $(window);
self.docscroll = $("body");
// self.doc = $("body");
*/
if (!self.ispage || (!cap.cantouch && !cap.isieold && !cap.isie9mobile)) {
var cont = self.docscroll
if (self.ispage) cont = self.haswrapper ? self.win : self.doc
if (!cap.isie9mobile) self.css(cont, { 'overflow-y': 'hidden' })
if (self.ispage && cap.isie7) {
if (self.doc[0].nodeName == 'BODY')
self.css($('html'), { 'overflow-y': 'hidden' }) //IE7 double scrollbar issue
else if (self.doc[0].nodeName == 'HTML') self.css($('body'), { 'overflow-y': 'hidden' }) //IE7 double scrollbar issue
}
if (cap.isios && !self.ispage && !self.haswrapper)
self.css($('body'), { '-webkit-overflow-scrolling': 'touch' }) //force hw acceleration
var cursor = $(document.createElement('div'))
cursor.css({
position: 'relative',
top: 0,
float: 'right',
width: self.opt.cursorwidth,
height: '0px',
'background-color': self.opt.cursorcolor,
border: self.opt.cursorborder,
'background-clip': 'padding-box',
'-webkit-border-radius': self.opt.cursorborderradius,
'-moz-border-radius': self.opt.cursorborderradius,
'border-radius': self.opt.cursorborderradius
})
cursor.hborder = parseFloat(cursor.outerHeight() - cursor.innerHeight())
self.cursor = cursor
var rail = $(document.createElement('div'))
rail.attr('id', self.id)
rail.addClass('nicescroll-rails')
var v,
a,
kp = ['left', 'right'] //"top","bottom"
for (var n in kp) {
a = kp[n]
v = self.opt.railpadding[a]
v ? rail.css('padding-' + a, v + 'px') : (self.opt.railpadding[a] = 0)
}
rail.append(cursor)
rail.width =
Math.max(parseFloat(self.opt.cursorwidth), cursor.outerWidth()) +
self.opt.railpadding['left'] +
self.opt.railpadding['right']
rail.css({
width: rail.width + 'px',
zIndex: self.zindex,
background: self.opt.background,
cursor: 'default'
})
rail.visibility = true
rail.scrollable = true
rail.align = self.opt.railalign == 'left' ? 0 : 1
self.rail = rail
self.rail.drag = false
var zoom = false
if (self.opt.boxzoom && !self.ispage && !cap.isieold) {
zoom = document.createElement('div')
self.bind(zoom, 'click', self.doZoom)
self.zoom = $(zoom)
self.zoom.css({
cursor: 'pointer',
'z-index': self.zindex,
backgroundImage: 'url(' + scriptpath + 'zoomico.png)',
height: 18,
width: 18,
backgroundPosition: '0px 0px'
})
if (self.opt.dblclickzoom) self.bind(self.win, 'dblclick', self.doZoom)
if (cap.cantouch && self.opt.gesturezoom) {
self.ongesturezoom = function (e) {
if (e.scale > 1.5) self.doZoomIn(e)
if (e.scale < 0.8) self.doZoomOut(e)
return self.cancelEvent(e)
}
self.bind(self.win, 'gestureend', self.ongesturezoom)
}
}
// init HORIZ
self.railh = false
if (self.opt.horizrailenabled) {
self.css(cont, { 'overflow-x': 'hidden' })
var cursor = $(document.createElement('div'))
cursor.css({
position: 'relative',
top: 0,
height: self.opt.cursorwidth,
width: '0px',
'background-color': self.opt.cursorcolor,
border: self.opt.cursorborder,
'background-clip': 'padding-box',
'-webkit-border-radius': self.opt.cursorborderradius,
'-moz-border-radius': self.opt.cursorborderradius,
'border-radius': self.opt.cursorborderradius
})
cursor.wborder = parseFloat(cursor.outerWidth() - cursor.innerWidth())
self.cursorh = cursor
var railh = $(document.createElement('div'))
railh.attr('id', self.id + '-hr')
railh.addClass('nicescroll-rails')
railh.height = Math.max(parseFloat(self.opt.cursorwidth), cursor.outerHeight())
railh.css({
height: railh.height + 'px',
zIndex: self.zindex,
background: self.opt.background
})
railh.append(cursor)
railh.visibility = true
railh.scrollable = true
railh.align = self.opt.railvalign == 'top' ? 0 : 1
self.railh = railh
self.railh.drag = false
}
//
if (self.ispage) {
rail.css({ position: 'fixed', top: '0px', height: '100%' })
rail.align ? rail.css({ right: '0px' }) : rail.css({ left: '0px' })
self.body.append(rail)
if (self.railh) {
railh.css({ position: 'fixed', left: '0px', width: '100%' })
railh.align ? railh.css({ bottom: '0px' }) : railh.css({ top: '0px' })
self.body.append(railh)
}
} else {
if (self.ishwscroll) {
if (self.win.css('position') == 'static') self.css(self.win, { position: 'relative' })
var bd = self.win[0].nodeName == 'HTML' ? self.body : self.win
if (self.zoom) {
self.zoom.css({
position: 'absolute',
top: 1,
right: 0,
'margin-right': rail.width + 4
})
bd.append(self.zoom)
}
rail.css({ position: 'absolute', top: 0 })
rail.align ? rail.css({ right: 0 }) : rail.css({ left: 0 })
bd.append(rail)
if (railh) {
railh.css({ position: 'absolute', left: 0, bottom: 0 })
railh.align ? railh.css({ bottom: 0 }) : railh.css({ top: 0 })
bd.append(railh)
}
} else {
self.isfixed = self.win.css('position') == 'fixed'
var rlpos = self.isfixed ? 'fixed' : 'absolute'
if (!self.isfixed) self.viewport = self.getViewport(self.win[0])
if (self.viewport) {
self.body = self.viewport
if (/relative|absolute/.test(self.viewport.css('position')) == false)
self.css(self.viewport, { position: 'relative' })
}
rail.css({ position: rlpos })
if (self.zoom) self.zoom.css({ position: rlpos })
self.updateScrollBar()
self.body.append(rail)
if (self.zoom) self.body.append(self.zoom)
if (self.railh) {
railh.css({ position: rlpos })
self.body.append(railh)
}
}
if (cap.isios)
self.css(self.win, {
'-webkit-tap-highlight-color': 'rgba(0,0,0,0)',
'-webkit-touch-callout': 'none'
}) // prevent grey layer on click
if (cap.isie && self.opt.disableoutline) self.win.attr('hideFocus', 'true') // IE, prevent dotted rectangle on focused div
if (cap.iswebkit && self.opt.disableoutline) self.win.css({ outline: 'none' })
}
if (self.opt.autohidemode === false) {
self.autohidedom = false
self.rail.css({ opacity: self.opt.cursoropacitymax })
if (self.railh) self.railh.css({ opacity: self.opt.cursoropacitymax })
} else if (self.opt.autohidemode === true) {
self.autohidedom = $().add(self.rail)
if (cap.isie8) self.autohidedom = self.autohidedom.add(self.cursor)
if (self.railh) self.autohidedom = self.autohidedom.add(self.railh)
if (self.railh && cap.isie8) self.autohidedom = self.autohidedom.add(self.cursorh)
} else if (self.opt.autohidemode == 'scroll') {
self.autohidedom = $().add(self.rail)
if (self.railh) self.autohidedom = self.autohidedom.add(self.railh)
} else if (self.opt.autohidemode == 'cursor') {
self.autohidedom = $().add(self.cursor)
if (self.railh) self.autohidedom = self.autohidedom.add(self.cursorh)
} else if (self.opt.autohidemode == 'hidden') {
self.autohidedom = false
self.hide()
self.locked = false
}
if (cap.isie9mobile) {
self.scrollmom = new ScrollMomentumClass2D(self)
/*
var trace = function(msg) {
var db = $("#debug");
if (isNaN(msg)&&(typeof msg != "string")) {
var x = [];
for(var a in msg) {
x.push(a+":"+msg[a]);
}
msg ="{"+x.join(",")+"}";
}
if (db.children().length>0) {
db.children().eq(0).before(""+msg+"
");
} else {
db.append(""+msg+"
");
}
}
window.onerror = function(msg,url,ln) {
trace("ERR: "+msg+" at "+ln);
}
*/
self.onmangotouch = function (e) {
var py = self.getScrollTop()
var px = self.getScrollLeft()
if (py == self.scrollmom.lastscrolly && px == self.scrollmom.lastscrollx) return true
// $("#debug").html('DRAG:'+py);
var dfy = py - self.mangotouch.sy
var dfx = px - self.mangotouch.sx
var df = Math.round(Math.sqrt(Math.pow(dfx, 2) + Math.pow(dfy, 2)))
if (df == 0) return
var dry = dfy < 0 ? -1 : 1
var drx = dfx < 0 ? -1 : 1
var tm = +new Date()
if (self.mangotouch.lazy) clearTimeout(self.mangotouch.lazy)
if (
tm - self.mangotouch.tm > 80 ||
self.mangotouch.dry != dry ||
self.mangotouch.drx != drx
) {
// trace('RESET+'+(tm-self.mangotouch.tm));
self.scrollmom.stop()
self.scrollmom.reset(px, py)
self.mangotouch.sy = py
self.mangotouch.ly = py
self.mangotouch.sx = px
self.mangotouch.lx = px
self.mangotouch.dry = dry
self.mangotouch.drx = drx
self.mangotouch.tm = tm
} else {
self.scrollmom.stop()
self.scrollmom.update(self.mangotouch.sx - dfx, self.mangotouch.sy - dfy)
var gap = tm - self.mangotouch.tm
self.mangotouch.tm = tm
// trace('MOVE:'+df+" - "+gap);
var ds = Math.max(
Math.abs(self.mangotouch.ly - py),
Math.abs(self.mangotouch.lx - px)
)
self.mangotouch.ly = py
self.mangotouch.lx = px
if (ds > 2) {
self.mangotouch.lazy = setTimeout(function () {
// trace('END:'+ds+'+'+gap);
self.mangotouch.lazy = false
self.mangotouch.dry = 0
self.mangotouch.drx = 0
self.mangotouch.tm = 0
self.scrollmom.doMomentum(30)
}, 100)
}
}
}
var top = self.getScrollTop()
var lef = self.getScrollLeft()
self.mangotouch = {
sy: top,
ly: top,
dry: 0,
sx: lef,
lx: lef,
drx: 0,
lazy: false,
tm: 0
}
self.bind(self.docscroll, 'scroll', self.onmangotouch)
} else {
if (cap.cantouch || self.istouchcapable || self.opt.touchbehavior || cap.hasmstouch) {
self.scrollmom = new ScrollMomentumClass2D(self)
self.ontouchstart = function (e) {
if (e.pointerType && e.pointerType != 2) return false
if (!self.locked) {
if (cap.hasmstouch) {
var tg = e.target ? e.target : false
while (tg) {
var nc = $(tg).getNiceScroll()
if (nc.length > 0 && nc[0].me == self.me) break
if (nc.length > 0) return false
if (tg.nodeName == 'DIV' && tg.id == self.id) break
tg = tg.parentNode ? tg.parentNode : false
}
}
self.cancelScroll()
var tg = self.getTarget(e)
if (tg) {
var skp = /INPUT/i.test(tg.nodeName) && /range/i.test(tg.type)
if (skp) return self.stopPropagation(e)
}
if (!('clientX' in e) && 'changedTouches' in e) {
e.clientX = e.changedTouches[0].clientX
e.clientY = e.changedTouches[0].clientY
}
if (self.forcescreen) {
var le = e
var e = { original: e.original ? e.original : e }
e.clientX = le.screenX
e.clientY = le.screenY
}
self.rail.drag = {
x: e.clientX,
y: e.clientY,
sx: self.scroll.x,
sy: self.scroll.y,
st: self.getScrollTop(),
sl: self.getScrollLeft(),
pt: 2,
dl: false
}
if (self.ispage || !self.opt.directionlockdeadzone) {
self.rail.drag.dl = 'f'
} else {
var view = {
w: $(window).width(),
h: $(window).height()
}
var page = {
w: Math.max(document.body.scrollWidth, document.documentElement.scrollWidth),
h: Math.max(document.body.scrollHeight, document.documentElement.scrollHeight)
}
var maxh = Math.max(0, page.h - view.h)
var maxw = Math.max(0, page.w - view.w)
if (!self.rail.scrollable && self.railh.scrollable)
self.rail.drag.ck = maxh > 0 ? 'v' : false
else if (self.rail.scrollable && !self.railh.scrollable)
self.rail.drag.ck = maxw > 0 ? 'h' : false
else self.rail.drag.ck = false
if (!self.rail.drag.ck) self.rail.drag.dl = 'f'
}
if (self.opt.touchbehavior && self.isiframe && cap.isie) {
var wp = self.win.position()
self.rail.drag.x += wp.left
self.rail.drag.y += wp.top
}
self.hasmoving = false
self.lastmouseup = false
self.scrollmom.reset(e.clientX, e.clientY)
if (!cap.cantouch && !this.istouchcapable && !cap.hasmstouch) {
var ip = tg ? /INPUT|SELECT|TEXTAREA/i.test(tg.nodeName) : false
if (!ip) {
if (!self.ispage && cap.hasmousecapture) tg.setCapture()
return self.cancelEvent(e)
}
if (/SUBMIT|CANCEL|BUTTON/i.test($(tg).attr('type'))) {
pc = { tg: tg, click: false }
self.preventclick = pc
}
}
}
}
self.ontouchend = function (e) {
if (e.pointerType && e.pointerType != 2) return false
if (self.rail.drag && self.rail.drag.pt == 2) {
self.scrollmom.doMomentum()
self.rail.drag = false
if (self.hasmoving) {
self.hasmoving = false
self.lastmouseup = true
self.hideCursor()
if (cap.hasmousecapture) document.releaseCapture()
if (!cap.cantouch) return self.cancelEvent(e)
}
}
}
var moveneedoffset = self.opt.touchbehavior && self.isiframe && !cap.hasmousecapture
self.ontouchmove = function (e, byiframe) {
if (e.pointerType && e.pointerType != 2) return false
if (self.rail.drag && self.rail.drag.pt == 2) {
if (cap.cantouch && typeof e.original == 'undefined') return true // prevent ios "ghost" events by clickable elements
self.hasmoving = true
if (self.preventclick && !self.preventclick.click) {
self.preventclick.click = self.preventclick.tg.onclick || false
self.preventclick.tg.onclick = self.onpreventclick
}
var ev = $.extend({ original: e }, e)
e = ev
if ('changedTouches' in e) {
e.clientX = e.changedTouches[0].clientX
e.clientY = e.changedTouches[0].clientY
}
if (self.forcescreen) {
var le = e
var e = { original: e.original ? e.original : e }
e.clientX = le.screenX
e.clientY = le.screenY
}
var ofx = (ofy = 0)
if (moveneedoffset && !byiframe) {
var wp = self.win.position()
ofx = -wp.left
ofy = -wp.top
}
var fy = e.clientY + ofy
var my = fy - self.rail.drag.y
var fx = e.clientX + ofx
var mx = fx - self.rail.drag.x
var ny = self.rail.drag.st - my
if (self.ishwscroll && self.opt.bouncescroll) {
if (ny < 0) {
ny = Math.round(ny / 2)
// fy = 0;
} else if (ny > self.page.maxh) {
ny = self.page.maxh + Math.round((ny - self.page.maxh) / 2)
// fy = 0;
}
} else {
if (ny < 0) {
ny = 0
fy = 0
}
if (ny > self.page.maxh) {
ny = self.page.maxh
fy = 0
}
}
if (self.railh && self.railh.scrollable) {
var nx = self.rail.drag.sl - mx
if (self.ishwscroll && self.opt.bouncescroll) {
if (nx < 0) {
nx = Math.round(nx / 2)
// fx = 0;
} else if (nx > self.page.maxw) {
nx = self.page.maxw + Math.round((nx - self.page.maxw) / 2)
// fx = 0;
}
} else {
if (nx < 0) {
nx = 0
fx = 0
}
if (nx > self.page.maxw) {
nx = self.page.maxw
fx = 0
}
}
}
var grabbed = false
if (self.rail.drag.dl) {
grabbed = true
if (self.rail.drag.dl == 'v') nx = self.rail.drag.sl
else if (self.rail.drag.dl == 'h') ny = self.rail.drag.st
} else {
var ay = Math.abs(my)
var ax = Math.abs(mx)
var dz = self.opt.directionlockdeadzone
if (self.rail.drag.ck == 'v') {
if (ay > dz && ax <= ay * 0.3) {
self.rail.drag = false
return true
} else if (ax > dz) {
self.rail.drag.dl = 'f'
$('body').scrollTop($('body').scrollTop()) // stop iOS native scrolling (when active javascript has blocked)
}
} else if (self.rail.drag.ck == 'h') {
if (ax > dz && ay <= az * 0.3) {
self.rail.drag = false
return true
} else if (ay > dz) {
self.rail.drag.dl = 'f'
$('body').scrollLeft($('body').scrollLeft()) // stop iOS native scrolling (when active javascript has blocked)
}
}
}
self.synched('touchmove', function () {
if (self.rail.drag && self.rail.drag.pt == 2) {
if (self.prepareTransition) self.prepareTransition(0)
if (self.rail.scrollable) self.setScrollTop(ny)
self.scrollmom.update(fx, fy)
if (self.railh && self.railh.scrollable) {
self.setScrollLeft(nx)
self.showCursor(ny, nx)
} else {
self.showCursor(ny)
}
if (cap.isie10) document.selection.clear()
}
})
if (cap.ischrome && self.istouchcapable) grabbed = false //chrome touch emulation doesn't like!
if (grabbed) return self.cancelEvent(e)
}
}
}
self.onmousedown = function (e, hronly) {
if (self.rail.drag && self.rail.drag.pt != 1) return
if (self.locked) return self.cancelEvent(e)
self.cancelScroll()
self.rail.drag = {
x: e.clientX,
y: e.clientY,
sx: self.scroll.x,
sy: self.scroll.y,
pt: 1,
hr: !!hronly
}
var tg = self.getTarget(e)
if (!self.ispage && cap.hasmousecapture) tg.setCapture()
if (self.isiframe && !cap.hasmousecapture) {
self.saved['csspointerevents'] = self.doc.css('pointer-events')
self.css(self.doc, { 'pointer-events': 'none' })
}
return self.cancelEvent(e)
}
self.onmouseup = function (e) {
if (self.rail.drag) {
if (cap.hasmousecapture) document.releaseCapture()
if (self.isiframe && !cap.hasmousecapture)
self.doc.css('pointer-events', self.saved['csspointerevents'])
if (self.rail.drag.pt != 1) return
self.rail.drag = false
//if (!self.rail.active) self.hideCursor();
return self.cancelEvent(e)
}
}
self.onmousemove = function (e) {
if (self.rail.drag) {
if (self.rail.drag.pt != 1) return
if (cap.ischrome && e.which == 0) return self.onmouseup(e)
self.cursorfreezed = true
if (self.rail.drag.hr) {
self.scroll.x = self.rail.drag.sx + (e.clientX - self.rail.drag.x)
if (self.scroll.x < 0) self.scroll.x = 0
var mw = self.scrollvaluemaxw
if (self.scroll.x > mw) self.scroll.x = mw
} else {
self.scroll.y = self.rail.drag.sy + (e.clientY - self.rail.drag.y)
if (self.scroll.y < 0) self.scroll.y = 0
var my = self.scrollvaluemax
if (self.scroll.y > my) self.scroll.y = my
}
self.synched('mousemove', function () {
if (self.rail.drag && self.rail.drag.pt == 1) {
self.showCursor()
if (self.rail.drag.hr)
self.doScrollLeft(
Math.round(self.scroll.x * self.scrollratio.x),
self.opt.cursordragspeed
)
else
self.doScrollTop(
Math.round(self.scroll.y * self.scrollratio.y),
self.opt.cursordragspeed
)
}
})
return self.cancelEvent(e)
}
/*
else {
self.checkarea = true;
}
*/
}
if (cap.cantouch || self.opt.touchbehavior) {
self.onpreventclick = function (e) {
if (self.preventclick) {
self.preventclick.tg.onclick = self.preventclick.click
self.preventclick = false
return self.cancelEvent(e)
}
}
// self.onmousedown = self.ontouchstart;
// self.onmouseup = self.ontouchend;
// self.onmousemove = self.ontouchmove;
self.bind(self.win, 'mousedown', self.ontouchstart) // control content dragging
self.onclick = cap.isios
? false
: function (e) {
if (self.lastmouseup) {
self.lastmouseup = false
return self.cancelEvent(e)
} else {
return true
}
}
if (self.opt.grabcursorenabled && cap.cursorgrabvalue) {
self.css(self.ispage ? self.doc : self.win, { cursor: cap.cursorgrabvalue })
self.css(self.rail, { cursor: cap.cursorgrabvalue })
}
} else {
function checkSelectionScroll(e) {
if (!self.selectiondrag) return
if (e) {
var ww = self.win.outerHeight()
var df = e.pageY - self.selectiondrag.top
if (df > 0 && df < ww) df = 0
if (df >= ww) df -= ww
self.selectiondrag.df = df
}
if (self.selectiondrag.df == 0) return
var rt = -Math.floor(self.selectiondrag.df / 6) * 2
// self.doScrollTop(self.getScrollTop(true)+rt);
self.doScrollBy(rt)
self.debounced(
'doselectionscroll',
function () {
checkSelectionScroll()
},
50
)
}
if ('getSelection' in document) {
// A grade - Major browsers
self.hasTextSelected = function () {
return document.getSelection().rangeCount > 0
}
} else if ('selection' in document) {
//IE9-
self.hasTextSelected = function () {
return document.selection.type != 'None'
}
} else {
self.hasTextSelected = function () {
// no support
return false
}
}
self.onselectionstart = function (e) {
if (self.ispage) return
self.selectiondrag = self.win.offset()
}
self.onselectionend = function (e) {
self.selectiondrag = false
}
self.onselectiondrag = function (e) {
if (!self.selectiondrag) return
if (self.hasTextSelected())
self.debounced(
'selectionscroll',
function () {
checkSelectionScroll(e)
},
250
)
}
}
if (cap.hasmstouch) {
self.css(self.rail, { '-ms-touch-action': 'none' })
self.css(self.cursor, { '-ms-touch-action': 'none' })
self.bind(self.win, 'MSPointerDown', self.ontouchstart)
self.bind(document, 'MSPointerUp', self.ontouchend)
self.bind(document, 'MSPointerMove', self.ontouchmove)
self.bind(self.cursor, 'MSGestureHold', function (e) {
e.preventDefault()
})
self.bind(self.cursor, 'contextmenu', function (e) {
e.preventDefault()
})
}
if (this.istouchcapable) {
//desktop with screen touch enabled
self.bind(self.win, 'touchstart', self.ontouchstart)
self.bind(document, 'touchend', self.ontouchend)
self.bind(document, 'touchcancel', self.ontouchend)
self.bind(document, 'touchmove', self.ontouchmove)
}
self.bind(self.cursor, 'mousedown', self.onmousedown)
self.bind(self.cursor, 'mouseup', self.onmouseup)
if (self.railh) {
self.bind(self.cursorh, 'mousedown', function (e) {
self.onmousedown(e, true)
})
self.bind(self.cursorh, 'mouseup', function (e) {
if (self.rail.drag && self.rail.drag.pt == 2) return
self.rail.drag = false
self.hasmoving = false
self.hideCursor()
if (cap.hasmousecapture) document.releaseCapture()
return self.cancelEvent(e)
})
}
if (self.opt.cursordragontouch || (!cap.cantouch && !self.opt.touchbehavior)) {
self.rail.css({ cursor: 'default' })
self.railh && self.railh.css({ cursor: 'default' })
self.jqbind(self.rail, 'mouseenter', function () {
if (self.canshowonmouseevent) self.showCursor()
self.rail.active = true
})
self.jqbind(self.rail, 'mouseleave', function () {
self.rail.active = false
if (!self.rail.drag) self.hideCursor()
})
if (self.opt.sensitiverail) {
self.bind(self.rail, 'click', function (e) {
self.doRailClick(e, false, false)
})
self.bind(self.rail, 'dblclick', function (e) {
self.doRailClick(e, true, false)
})
self.bind(self.cursor, 'click', function (e) {
self.cancelEvent(e)
})
self.bind(self.cursor, 'dblclick', function (e) {
self.cancelEvent(e)
})
}
if (self.railh) {
self.jqbind(self.railh, 'mouseenter', function () {
if (self.canshowonmouseevent) self.showCursor()
self.rail.active = true
})
self.jqbind(self.railh, 'mouseleave', function () {
self.rail.active = false
if (!self.rail.drag) self.hideCursor()
})
if (self.opt.sensitiverail) {
self.bind(self.railh, 'click', function (e) {
self.doRailClick(e, false, true)
})
self.bind(self.railh, 'dblclick', function (e) {
self.doRailClick(e, true, true)
})
self.bind(self.cursorh, 'click', function (e) {
self.cancelEvent(e)
})
self.bind(self.cursorh, 'dblclick', function (e) {
self.cancelEvent(e)
})
}
}
}
if (!cap.cantouch && !self.opt.touchbehavior) {
self.bind(cap.hasmousecapture ? self.win : document, 'mouseup', self.onmouseup)
self.bind(document, 'mousemove', self.onmousemove)
if (self.onclick) self.bind(document, 'click', self.onclick)
if (!self.ispage && self.opt.enablescrollonselection) {
self.bind(self.win[0], 'mousedown', self.onselectionstart)
self.bind(document, 'mouseup', self.onselectionend)
self.bind(self.cursor, 'mouseup', self.onselectionend)
if (self.cursorh) self.bind(self.cursorh, 'mouseup', self.onselectionend)
self.bind(document, 'mousemove', self.onselectiondrag)
}
if (self.zoom) {
self.jqbind(self.zoom, 'mouseenter', function () {
if (self.canshowonmouseevent) self.showCursor()
self.rail.active = true
})
self.jqbind(self.zoom, 'mouseleave', function () {
self.rail.active = false
if (!self.rail.drag) self.hideCursor()
})
}
} else {
self.bind(cap.hasmousecapture ? self.win : document, 'mouseup', self.ontouchend)
self.bind(document, 'mousemove', self.ontouchmove)
if (self.onclick) self.bind(document, 'click', self.onclick)
if (self.opt.cursordragontouch) {
self.bind(self.cursor, 'mousedown', self.onmousedown)
self.bind(self.cursor, 'mousemove', self.onmousemove)
self.cursorh && self.bind(self.cursorh, 'mousedown', self.onmousedown)
self.cursorh && self.bind(self.cursorh, 'mousemove', self.onmousemove)
}
}
if (self.opt.enablemousewheel) {
if (!self.isiframe)
self.bind(
cap.isie && self.ispage ? document : self.docscroll,
'mousewheel',
self.onmousewheel
)
self.bind(self.rail, 'mousewheel', self.onmousewheel)
if (self.railh) self.bind(self.railh, 'mousewheel', self.onmousewheelhr)
}
if (!self.ispage && !cap.cantouch && !/HTML|BODY/.test(self.win[0].nodeName)) {
if (!self.win.attr('tabindex')) self.win.attr({ tabindex: tabindexcounter++ })
self.jqbind(self.win, 'focus', function (e) {
domfocus = self.getTarget(e).id || true
self.hasfocus = true
if (self.canshowonmouseevent) self.noticeCursor()
})
self.jqbind(self.win, 'blur', function (e) {
domfocus = false
self.hasfocus = false
})
self.jqbind(self.win, 'mouseenter', function (e) {
mousefocus = self.getTarget(e).id || true
self.hasmousefocus = true
if (self.canshowonmouseevent) self.noticeCursor()
})
self.jqbind(self.win, 'mouseleave', function () {
mousefocus = false
self.hasmousefocus = false
})
}
} // !ie9mobile
//Thanks to http://www.quirksmode.org !!
self.onkeypress = function (e) {
if (self.locked && self.page.maxh == 0) return true
e = e ? e : window.e
var tg = self.getTarget(e)
if (tg && /INPUT|TEXTAREA|SELECT|OPTION/.test(tg.nodeName)) {
var tp = tg.getAttribute('type') || tg.type || false
if (!tp || !/submit|button|cancel/i.tp) return true
}
if (
self.hasfocus ||
(self.hasmousefocus && !domfocus) ||
(self.ispage && !domfocus && !mousefocus)
) {
var key = e.keyCode
if (self.locked && key != 27) return self.cancelEvent(e)
var ctrl = e.ctrlKey || false
var shift = e.shiftKey || false
var ret = false
switch (key) {
case 38:
case 63233: //safari
self.doScrollBy(24 * 3)
ret = true
break
case 40:
case 63235: //safari
self.doScrollBy(-24 * 3)
ret = true
break
case 37:
case 63232: //safari
if (self.railh) {
ctrl ? self.doScrollLeft(0) : self.doScrollLeftBy(24 * 3)
ret = true
}
break
case 39:
case 63234: //safari
if (self.railh) {
ctrl ? self.doScrollLeft(self.page.maxw) : self.doScrollLeftBy(-24 * 3)
ret = true
}
break
case 33:
case 63276: // safari
self.doScrollBy(self.view.h)
ret = true
break
case 34:
case 63277: // safari
self.doScrollBy(-self.view.h)
ret = true
break
case 36:
case 63273: // safari
self.railh && ctrl ? self.doScrollPos(0, 0) : self.doScrollTo(0)
ret = true
break
case 35:
case 63275: // safari
self.railh && ctrl
? self.doScrollPos(self.page.maxw, self.page.maxh)
: self.doScrollTo(self.page.maxh)
ret = true
break
case 32:
if (self.opt.spacebarenabled) {
shift ? self.doScrollBy(self.view.h) : self.doScrollBy(-self.view.h)
ret = true
}
break
case 27: // ESC
if (self.zoomactive) {
self.doZoom()
ret = true
}
break
}
if (ret) return self.cancelEvent(e)
}
}
if (self.opt.enablekeyboard)
self.bind(
document,
cap.isopera && !cap.isopera12 ? 'keypress' : 'keydown',
self.onkeypress
)
self.bind(window, 'resize', self.lazyResize)
self.bind(window, 'orientationchange', self.lazyResize)
self.bind(window, 'load', self.lazyResize)
if (cap.ischrome && !self.ispage && !self.haswrapper) {
//chrome void scrollbar bug - it persists in version 26
var tmp = self.win.attr('style')
var ww = parseFloat(self.win.css('width')) + 1
self.win.css('width', ww)
self.synched('chromefix', function () {
self.win.attr('style', tmp)
})
}
// Trying a cross-browser implementation - good luck!
self.onAttributeChange = function (e) {
self.lazyResize(250)
}
if (!self.ispage && !self.haswrapper) {
// redesigned MutationObserver for Chrome18+/Firefox14+/iOS6+ with support for: remove div, add/remove content
if (clsMutationObserver !== false) {
self.observer = new clsMutationObserver(function (mutations) {
mutations.forEach(self.onAttributeChange)
})
self.observer.observe(self.win[0], {
childList: true,
characterData: false,
attributes: true,
subtree: false
})
self.observerremover = new clsMutationObserver(function (mutations) {
mutations.forEach(function (mo) {
if (mo.removedNodes.length > 0) {
for (var dd in mo.removedNodes) {
if (mo.removedNodes[dd] == self.win[0]) return self.remove()
}
}
})
})
self.observerremover.observe(self.win[0].parentNode, {
childList: true,
characterData: false,
attributes: false,
subtree: false
})
} else {
self.bind(
self.win,
cap.isie && !cap.isie9 ? 'propertychange' : 'DOMAttrModified',
self.onAttributeChange
)
if (cap.isie9) self.win[0].attachEvent('onpropertychange', self.onAttributeChange) //IE9 DOMAttrModified bug
self.bind(self.win, 'DOMNodeRemoved', function (e) {
if (e.target == self.win[0]) self.remove()
})
}
}
//
if (!self.ispage && self.opt.boxzoom) self.bind(window, 'resize', self.resizeZoom)
if (self.istextarea) self.bind(self.win, 'mouseup', self.lazyResize)
self.checkrtlmode = true
self.lazyResize(30)
}
if (this.doc[0].nodeName == 'IFRAME') {
function oniframeload(e) {
self.iframexd = false
try {
var doc = 'contentDocument' in this ? this.contentDocument : this.contentWindow.document
var a = doc.domain
} catch (e) {
self.iframexd = true
doc = false
}
if (self.iframexd) {
if ('console' in window) console.log('NiceScroll error: policy restriced iframe')
return true //cross-domain - I can't manage this
}
self.forcescreen = true
if (self.isiframe) {
self.iframe = {
doc: $(doc),
html: self.doc.contents().find('html')[0],
body: self.doc.contents().find('body')[0]
}
self.getContentSize = function () {
return {
w: Math.max(self.iframe.html.scrollWidth, self.iframe.body.scrollWidth),
h: Math.max(self.iframe.html.scrollHeight, self.iframe.body.scrollHeight)
}
}
self.docscroll = $(self.iframe.body) //$(this.contentWindow);
}
if (!cap.isios && self.opt.iframeautoresize && !self.isiframe) {
self.win.scrollTop(0) // reset position
self.doc.height('') //reset height to fix browser bug
var hh = Math.max(
doc.getElementsByTagName('html')[0].scrollHeight,
doc.body.scrollHeight
)
self.doc.height(hh)
}
self.lazyResize(30)
if (cap.isie7) self.css($(self.iframe.html), { 'overflow-y': 'hidden' })
//self.css($(doc.body),{'overflow-y':'hidden'});
self.css($(self.iframe.body), { 'overflow-y': 'hidden' })
if ('contentWindow' in this) {
self.bind(this.contentWindow, 'scroll', self.onscroll) //IE8 & minor
} else {
self.bind(doc, 'scroll', self.onscroll)
}
if (self.opt.enablemousewheel) {
self.bind(doc, 'mousewheel', self.onmousewheel)
}
if (self.opt.enablekeyboard)
self.bind(doc, cap.isopera ? 'keypress' : 'keydown', self.onkeypress)
if (cap.cantouch || self.opt.touchbehavior) {
self.bind(doc, 'mousedown', self.onmousedown)
self.bind(doc, 'mousemove', function (e) {
self.onmousemove(e, true)
})
if (self.opt.grabcursorenabled && cap.cursorgrabvalue)
self.css($(doc.body), { cursor: cap.cursorgrabvalue })
}
self.bind(doc, 'mouseup', self.onmouseup)
if (self.zoom) {
if (self.opt.dblclickzoom) self.bind(doc, 'dblclick', self.doZoom)
if (self.ongesturezoom) self.bind(doc, 'gestureend', self.ongesturezoom)
}
}
if (this.doc[0].readyState && this.doc[0].readyState == 'complete') {
setTimeout(function () {
oniframeload.call(self.doc[0], false)
}, 500)
}
self.bind(this.doc, 'load', oniframeload)
}
}
this.showCursor = function (py, px) {
if (self.cursortimeout) {
clearTimeout(self.cursortimeout)
self.cursortimeout = 0
}
if (!self.rail) return
if (self.autohidedom) {
self.autohidedom.stop().css({ opacity: self.opt.cursoropacitymax })
self.cursoractive = true
}
if (!self.rail.drag || self.rail.drag.pt != 1) {
if (typeof py != 'undefined' && py !== false) {
self.scroll.y = Math.round((py * 1) / self.scrollratio.y)
}
if (typeof px != 'undefined') {
self.scroll.x = Math.round((px * 1) / self.scrollratio.x)
}
}
self.cursor.css({ height: self.cursorheight, top: self.scroll.y })
if (self.cursorh) {
!self.rail.align && self.rail.visibility
? self.cursorh.css({ width: self.cursorwidth, left: self.scroll.x + self.rail.width })
: self.cursorh.css({ width: self.cursorwidth, left: self.scroll.x })
self.cursoractive = true
}
if (self.zoom) self.zoom.stop().css({ opacity: self.opt.cursoropacitymax })
}
this.hideCursor = function (tm) {
if (self.cursortimeout) return
if (!self.rail) return
if (!self.autohidedom) return
self.cursortimeout = setTimeout(function () {
if (!self.rail.active || !self.showonmouseevent) {
self.autohidedom.stop().animate({ opacity: self.opt.cursoropacitymin })
if (self.zoom) self.zoom.stop().animate({ opacity: self.opt.cursoropacitymin })
self.cursoractive = false
}
self.cursortimeout = 0
}, tm || self.opt.hidecursordelay)
}
this.noticeCursor = function (tm, py, px) {
self.showCursor(py, px)
if (!self.rail.active) self.hideCursor(tm)
}
this.getContentSize = self.ispage
? function () {
return {
w: Math.max(document.body.scrollWidth, document.documentElement.scrollWidth),
h: Math.max(document.body.scrollHeight, document.documentElement.scrollHeight)
}
}
: self.haswrapper
? function () {
return {
w:
self.doc.outerWidth() +
parseInt(self.win.css('paddingLeft')) +
parseInt(self.win.css('paddingRight')),
h:
self.doc.outerHeight() +
parseInt(self.win.css('paddingTop')) +
parseInt(self.win.css('paddingBottom'))
}
}
: function () {
return {
w: self.docscroll[0].scrollWidth,
h: self.docscroll[0].scrollHeight
}
}
this.onResize = function (e, page) {
if (!self.win) return false
if (!self.haswrapper && !self.ispage) {
if (self.win.css('display') == 'none') {
if (self.visibility) self.hideRail().hideRailHr()
return false
} else {
if (!self.hidden && !self.visibility) self.showRail().showRailHr()
}
}
var premaxh = self.page.maxh
var premaxw = self.page.maxw
var preview = { h: self.view.h, w: self.view.w }
self.view = {
w: self.ispage ? self.win.width() : parseInt(self.win[0].clientWidth),
h: self.ispage ? self.win.height() : parseInt(self.win[0].clientHeight)
}
self.page = page ? page : self.getContentSize()
self.page.maxh = Math.max(0, self.page.h - self.view.h)
self.page.maxw = Math.max(0, self.page.w - self.view.w)
if (self.page.maxh == premaxh && self.page.maxw == premaxw && self.view.w == preview.w) {
// test position
if (!self.ispage) {
var pos = self.win.offset()
if (self.lastposition) {
var lst = self.lastposition
if (lst.top == pos.top && lst.left == pos.left) return self //nothing to do
}
self.lastposition = pos
} else {
return self //nothing to do
}
}
if (self.page.maxh == 0) {
self.hideRail()
self.scrollvaluemax = 0
self.scroll.y = 0
self.scrollratio.y = 0
self.cursorheight = 0
self.setScrollTop(0)
self.rail.scrollable = false
} else {
self.rail.scrollable = true
}
if (self.page.maxw == 0) {
self.hideRailHr()
self.scrollvaluemaxw = 0
self.scroll.x = 0
self.scrollratio.x = 0
self.cursorwidth = 0
self.setScrollLeft(0)
self.railh.scrollable = false
} else {
self.railh.scrollable = true
}
self.locked = self.page.maxh == 0 && self.page.maxw == 0
if (self.locked) {
if (!self.ispage) self.updateScrollBar(self.view)
return false
}
if (!self.hidden && !self.visibility) {
self.showRail().showRailHr()
} else if (!self.hidden && !self.railh.visibility) self.showRailHr()
if (self.istextarea && self.win.css('resize') && self.win.css('resize') != 'none')
self.view.h -= 20
self.cursorheight = Math.min(
self.view.h,
Math.round(self.view.h * (self.view.h / self.page.h))
)
self.cursorheight = self.opt.cursorfixedheight
? self.opt.cursorfixedheight
: Math.max(self.opt.cursorminheight, self.cursorheight)
self.cursorwidth = Math.min(
self.view.w,
Math.round(self.view.w * (self.view.w / self.page.w))
)
self.cursorwidth = self.opt.cursorfixedheight
? self.opt.cursorfixedheight
: Math.max(self.opt.cursorminheight, self.cursorwidth)
self.scrollvaluemax = self.view.h - self.cursorheight - self.cursor.hborder
if (self.railh) {
self.railh.width = self.page.maxh > 0 ? self.view.w - self.rail.width : self.view.w
self.scrollvaluemaxw = self.railh.width - self.cursorwidth - self.cursorh.wborder
}
if (self.checkrtlmode && self.railh) {
self.checkrtlmode = false
if (self.opt.rtlmode && self.scroll.x == 0) self.setScrollLeft(self.page.maxw)
}
if (!self.ispage) self.updateScrollBar(self.view)
self.scrollratio = {
x: self.page.maxw / self.scrollvaluemaxw,
y: self.page.maxh / self.scrollvaluemax
}
var sy = self.getScrollTop()
if (sy > self.page.maxh) {
self.doScrollTop(self.page.maxh)
} else {
self.scroll.y = Math.round(self.getScrollTop() * (1 / self.scrollratio.y))
self.scroll.x = Math.round(self.getScrollLeft() * (1 / self.scrollratio.x))
if (self.cursoractive) self.noticeCursor()
}
if (self.scroll.y && self.getScrollTop() == 0)
self.doScrollTo(Math.floor(self.scroll.y * self.scrollratio.y))
return self
}
this.resize = self.onResize
this.lazyResize = function (tm) {
// event debounce
tm = isNaN(tm) ? 30 : tm
self.delayed('resize', self.resize, tm)
return self
}
// modified by MDN https://developer.mozilla.org/en-US/docs/DOM/Mozilla_event_reference/wheel
function _modernWheelEvent(dom, name, fn, bubble) {
self._bind(
dom,
name,
function (e) {
var e = e ? e : window.event
var event = {
original: e,
target: e.target || e.srcElement,
type: 'wheel',
deltaMode: e.type == 'MozMousePixelScroll' ? 0 : 1,
deltaX: 0,
deltaZ: 0,
preventDefault: function () {
e.preventDefault ? e.preventDefault() : (e.returnValue = false)
return false
},
stopImmediatePropagation: function () {
e.stopImmediatePropagation ? e.stopImmediatePropagation() : (e.cancelBubble = true)
}
}
if (name == 'mousewheel') {
event.deltaY = (-1 / 40) * e.wheelDelta
e.wheelDeltaX && (event.deltaX = (-1 / 40) * e.wheelDeltaX)
} else {
event.deltaY = e.detail
}
return fn.call(dom, event)
},
bubble
)
}
this._bind = function (el, name, fn, bubble) {
// primitive bind
self.events.push({ e: el, n: name, f: fn, b: bubble, q: false })
if (el.addEventListener) {
el.addEventListener(name, fn, bubble || false)
} else if (el.attachEvent) {
el.attachEvent('on' + name, fn)
} else {
el['on' + name] = fn
}
}
this.jqbind = function (dom, name, fn) {
// use jquery bind for non-native events (mouseenter/mouseleave)
self.events.push({ e: dom, n: name, f: fn, q: true })
$(dom).bind(name, fn)
}
this.bind = function (dom, name, fn, bubble) {
// touch-oriented & fixing jquery bind
var el = 'jquery' in dom ? dom[0] : dom
if (name == 'mousewheel') {
if ('onwheel' in self.win) {
self._bind(el, 'wheel', fn, bubble || false)
} else {
var wname = typeof document.onmousewheel != 'undefined' ? 'mousewheel' : 'DOMMouseScroll' // older IE/Firefox
_modernWheelEvent(el, wname, fn, bubble || false)
if (wname == 'DOMMouseScroll')
_modernWheelEvent(el, 'MozMousePixelScroll', fn, bubble || false) // Firefox legacy
}
} else if (el.addEventListener) {
if (cap.cantouch && /mouseup|mousedown|mousemove/.test(name)) {
// touch device support
var tt = name == 'mousedown' ? 'touchstart' : name == 'mouseup' ? 'touchend' : 'touchmove'
self._bind(
el,
tt,
function (e) {
if (e.touches) {
if (e.touches.length < 2) {
var ev = e.touches.length ? e.touches[0] : e
ev.original = e
fn.call(this, ev)
}
} else if (e.changedTouches) {
var ev = e.changedTouches[0]
ev.original = e
fn.call(this, ev)
} //blackberry
},
bubble || false
)
}
self._bind(el, name, fn, bubble || false)
if (cap.cantouch && name == 'mouseup') self._bind(el, 'touchcancel', fn, bubble || false)
} else {
self._bind(el, name, function (e) {
e = e || window.event || false
if (e) {
if (e.srcElement) e.target = e.srcElement
}
if (!('pageY' in e)) {
e.pageX = e.clientX + document.documentElement.scrollLeft
e.pageY = e.clientY + document.documentElement.scrollTop
}
return fn.call(el, e) === false || bubble === false ? self.cancelEvent(e) : true
})
}
}
this._unbind = function (el, name, fn, bub) {
// primitive unbind
if (el.removeEventListener) {
el.removeEventListener(name, fn, bub)
} else if (el.detachEvent) {
el.detachEvent('on' + name, fn)
} else {
el['on' + name] = false
}
}
this.unbindAll = function () {
for (var a = 0; a < self.events.length; a++) {
var r = self.events[a]
r.q ? r.e.unbind(r.n, r.f) : self._unbind(r.e, r.n, r.f, r.b)
}
}
// Thanks to http://www.switchonthecode.com !!
this.cancelEvent = function (e) {
var e = e.original ? e.original : e ? e : window.event || false
if (!e) return false
if (e.preventDefault) e.preventDefault()
if (e.stopPropagation) e.stopPropagation()
if (e.preventManipulation) e.preventManipulation() //IE10
e.cancelBubble = true
e.cancel = true
e.returnValue = false
return false
}
this.stopPropagation = function (e) {
var e = e.original ? e.original : e ? e : window.event || false
if (!e) return false
if (e.stopPropagation) return e.stopPropagation()
if (e.cancelBubble) e.cancelBubble = true
return false
}
this.showRail = function () {
if (self.page.maxh != 0 && (self.ispage || self.win.css('display') != 'none')) {
self.visibility = true
self.rail.visibility = true
self.rail.css('display', 'block')
}
return self
}
this.showRailHr = function () {
if (!self.railh) return self
if (self.page.maxw != 0 && (self.ispage || self.win.css('display') != 'none')) {
self.railh.visibility = true
self.railh.css('display', 'block')
}
return self
}
this.hideRail = function () {
self.visibility = false
self.rail.visibility = false
self.rail.css('display', 'none')
return self
}
this.hideRailHr = function () {
if (!self.railh) return self
self.railh.visibility = false
self.railh.css('display', 'none')
return self
}
this.show = function () {
self.hidden = false
self.locked = false
return self.showRail().showRailHr()
}
this.hide = function () {
self.hidden = true
self.locked = true
return self.hideRail().hideRailHr()
}
this.toggle = function () {
return self.hidden ? self.show() : self.hide()
}
this.remove = function () {
self.stop()
if (self.cursortimeout) clearTimeout(self.cursortimeout)
self.doZoomOut()
self.unbindAll()
if (self.observer !== false) self.observer.disconnect()
if (self.observerremover !== false) self.observerremover.disconnect()
self.events = []
if (self.cursor) {
self.cursor.remove()
self.cursor = null
}
if (self.cursorh) {
self.cursorh.remove()
self.cursorh = null
}
if (self.rail) {
self.rail.remove()
self.rail = null
}
if (self.railh) {
self.railh.remove()
self.railh = null
}
if (self.zoom) {
self.zoom.remove()
self.zoom = null
}
for (var a = 0; a < self.saved.css.length; a++) {
var d = self.saved.css[a]
d[0].css(d[1], typeof d[2] == 'undefined' ? '' : d[2])
}
self.saved = false
self.me.data('__nicescroll', '') //erase all traces
self.me = null
self.doc = null
self.docscroll = null
self.win = null
return self
}
this.scrollstart = function (fn) {
this.onscrollstart = fn
return self
}
this.scrollend = function (fn) {
this.onscrollend = fn
return self
}
this.scrollcancel = function (fn) {
this.onscrollcancel = fn
return self
}
this.zoomin = function (fn) {
this.onzoomin = fn
return self
}
this.zoomout = function (fn) {
this.onzoomout = fn
return self
}
this.isScrollable = function (e) {
var dom = e.target ? e.target : e
if (dom.nodeName == 'OPTION') return true
while (dom && dom.nodeType == 1 && !/BODY|HTML/.test(dom.nodeName)) {
var dd = $(dom)
var ov = dd.css('overflowY') || dd.css('overflowX') || dd.css('overflow') || ''
if (/scroll|auto/.test(ov)) return dom.clientHeight != dom.scrollHeight
dom = dom.parentNode ? dom.parentNode : false
}
return false
}
this.getViewport = function (me) {
var dom = me && me.parentNode ? me.parentNode : false
while (dom && dom.nodeType == 1 && !/BODY|HTML/.test(dom.nodeName)) {
var dd = $(dom)
var ov = dd.css('overflowY') || dd.css('overflowX') || dd.css('overflow') || ''
if (/scroll|auto/.test(ov) && dom.clientHeight != dom.scrollHeight) return dd
if (dd.getNiceScroll().length > 0) return dd
dom = dom.parentNode ? dom.parentNode : false
}
return false
}
function execScrollWheel(e, hr, chkscroll) {
var px, py
var rt = 1
if (e.deltaMode == 0) {
// PIXEL
px = -Math.floor(e.deltaX * (self.opt.mousescrollstep / (18 * 3)))
py = -Math.floor(e.deltaY * (self.opt.mousescrollstep / (18 * 3)))
} else if (e.deltaMode == 1) {
// LINE
px = -Math.floor(e.deltaX * self.opt.mousescrollstep)
py = -Math.floor(e.deltaY * self.opt.mousescrollstep)
}
if (hr && px == 0 && py) {
// classic vertical-only mousewheel + browser with x/y support
px = py
py = 0
}
if (px) {
if (self.scrollmom) {
self.scrollmom.stop()
}
self.lastdeltax += px
self.debounced(
'mousewheelx',
function () {
var dt = self.lastdeltax
self.lastdeltax = 0
if (!self.rail.drag) {
self.doScrollLeftBy(dt)
}
},
120
)
}
if (py) {
if (self.opt.nativeparentscrolling && chkscroll && !self.ispage && !self.zoomactive) {
if (py < 0) {
if (self.getScrollTop() >= self.page.maxh) return true
} else {
if (self.getScrollTop() <= 0) return true
}
}
if (self.scrollmom) {
self.scrollmom.stop()
}
self.lastdeltay += py
self.debounced(
'mousewheely',
function () {
var dt = self.lastdeltay
self.lastdeltay = 0
if (!self.rail.drag) {
self.doScrollBy(dt)
}
},
120
)
}
e.stopImmediatePropagation()
return e.preventDefault()
// return self.cancelEvent(e);
}
this.onmousewheel = function (e) {
if (self.locked) return true
if (self.rail.drag) return self.cancelEvent(e)
if (!self.rail.scrollable) {
if (self.railh && self.railh.scrollable) {
return self.onmousewheelhr(e)
} else {
return true
}
}
var nw = +new Date()
var chk = false
if (self.opt.preservenativescrolling && self.checkarea + 600 < nw) {
// self.checkarea = false;
self.nativescrollingarea = self.isScrollable(e)
chk = true
}
self.checkarea = nw
if (self.nativescrollingarea) return true // this isn't my business
// if (self.locked) return self.cancelEvent(e);
var ret = execScrollWheel(e, false, chk)
if (ret) self.checkarea = 0
return ret
}
this.onmousewheelhr = function (e) {
if (self.locked || !self.railh.scrollable) return true
if (self.rail.drag) return self.cancelEvent(e)
var nw = +new Date()
var chk = false
if (self.opt.preservenativescrolling && self.checkarea + 600 < nw) {
// self.checkarea = false;
self.nativescrollingarea = self.isScrollable(e)
chk = true
}
self.checkarea = nw
if (self.nativescrollingarea) return true // this isn't my business
if (self.locked) return self.cancelEvent(e)
return execScrollWheel(e, true, chk)
}
this.stop = function () {
self.cancelScroll()
if (self.scrollmon) self.scrollmon.stop()
self.cursorfreezed = false
self.scroll.y = Math.round(self.getScrollTop() * (1 / self.scrollratio.y))
self.noticeCursor()
return self
}
this.getTransitionSpeed = function (dif) {
var sp = Math.round(self.opt.scrollspeed * 10)
var ex = Math.min(sp, Math.round((dif / 20) * self.opt.scrollspeed))
return ex > 20 ? ex : 0
}
if (!self.opt.smoothscroll) {
this.doScrollLeft = function (x, spd) {
//direct
var y = self.getScrollTop()
self.doScrollPos(x, y, spd)
}
this.doScrollTop = function (y, spd) {
//direct
var x = self.getScrollLeft()
self.doScrollPos(x, y, spd)
}
this.doScrollPos = function (x, y, spd) {
//direct
var nx = x > self.page.maxw ? self.page.maxw : x
if (nx < 0) nx = 0
var ny = y > self.page.maxh ? self.page.maxh : y
if (ny < 0) ny = 0
self.synched('scroll', function () {
self.setScrollTop(ny)
self.setScrollLeft(nx)
})
}
this.cancelScroll = function () {} // direct
} else if (self.ishwscroll && cap.hastransition && self.opt.usetransition) {
this.prepareTransition = function (dif, istime) {
var ex = istime ? (dif > 20 ? dif : 0) : self.getTransitionSpeed(dif)
var trans = ex ? cap.prefixstyle + 'transform ' + ex + 'ms ease-out' : ''
if (!self.lasttransitionstyle || self.lasttransitionstyle != trans) {
self.lasttransitionstyle = trans
self.doc.css(cap.transitionstyle, trans)
}
return ex
}
this.doScrollLeft = function (x, spd) {
//trans
var y = self.scrollrunning ? self.newscrolly : self.getScrollTop()
self.doScrollPos(x, y, spd)
}
this.doScrollTop = function (y, spd) {
//trans
var x = self.scrollrunning ? self.newscrollx : self.getScrollLeft()
self.doScrollPos(x, y, spd)
}
this.doScrollPos = function (x, y, spd) {
//trans
var py = self.getScrollTop()
var px = self.getScrollLeft()
if ((self.newscrolly - py) * (y - py) < 0 || (self.newscrollx - px) * (x - px) < 0)
self.cancelScroll() //inverted movement detection
if (self.opt.bouncescroll == false) {
if (y < 0) y = 0
else if (y > self.page.maxh) y = self.page.maxh
if (x < 0) x = 0
else if (x > self.page.maxw) x = self.page.maxw
}
if (self.scrollrunning && x == self.newscrollx && y == self.newscrolly) return false
self.newscrolly = y
self.newscrollx = x
self.newscrollspeed = spd || false
if (self.timer) return false
self.timer = setTimeout(function () {
var top = self.getScrollTop()
var lft = self.getScrollLeft()
var dst = {}
dst.x = x - lft
dst.y = y - top
dst.px = lft
dst.py = top
var dd = Math.round(Math.sqrt(Math.pow(dst.x, 2) + Math.pow(dst.y, 2)))
// var df = (self.newscrollspeed) ? self.newscrollspeed : dd;
var ms =
self.newscrollspeed && self.newscrollspeed > 1
? self.newscrollspeed
: self.getTransitionSpeed(dd)
if (self.newscrollspeed && self.newscrollspeed <= 1) ms *= self.newscrollspeed
self.prepareTransition(ms, true)
if (self.timerscroll && self.timerscroll.tm) clearInterval(self.timerscroll.tm)
if (ms > 0) {
if (!self.scrollrunning && self.onscrollstart) {
var info = {
type: 'scrollstart',
current: { x: lft, y: top },
request: { x: x, y: y },
end: { x: self.newscrollx, y: self.newscrolly },
speed: ms
}
self.onscrollstart.call(self, info)
}
if (cap.transitionend) {
if (!self.scrollendtrapped) {
self.scrollendtrapped = true
self.bind(self.doc, cap.transitionend, self.onScrollEnd, false) //I have got to do something usefull!!
}
} else {
if (self.scrollendtrapped) clearTimeout(self.scrollendtrapped)
self.scrollendtrapped = setTimeout(self.onScrollEnd, ms) // simulate transitionend event
}
var py = top
var px = lft
self.timerscroll = {
bz: new BezierClass(py, self.newscrolly, ms, 0, 0, 0.58, 1),
bh: new BezierClass(px, self.newscrollx, ms, 0, 0, 0.58, 1)
}
if (!self.cursorfreezed)
self.timerscroll.tm = setInterval(function () {
self.showCursor(self.getScrollTop(), self.getScrollLeft())
}, 60)
}
self.synched('doScroll-set', function () {
self.timer = 0
if (self.scrollendtrapped) self.scrollrunning = true
self.setScrollTop(self.newscrolly)
self.setScrollLeft(self.newscrollx)
if (!self.scrollendtrapped) self.onScrollEnd()
})
}, 50)
}
this.cancelScroll = function () {
if (!self.scrollendtrapped) return true
var py = self.getScrollTop()
var px = self.getScrollLeft()
self.scrollrunning = false
if (!cap.transitionend) clearTimeout(cap.transitionend)
self.scrollendtrapped = false
self._unbind(self.doc, cap.transitionend, self.onScrollEnd)
self.prepareTransition(0)
self.setScrollTop(py) // fire event onscroll
if (self.railh) self.setScrollLeft(px)
if (self.timerscroll && self.timerscroll.tm) clearInterval(self.timerscroll.tm)
self.timerscroll = false
self.cursorfreezed = false
//self.noticeCursor(false,py,px);
self.showCursor(py, px)
return self
}
this.onScrollEnd = function () {
if (self.scrollendtrapped) self._unbind(self.doc, cap.transitionend, self.onScrollEnd)
self.scrollendtrapped = false
self.prepareTransition(0)
if (self.timerscroll && self.timerscroll.tm) clearInterval(self.timerscroll.tm)
self.timerscroll = false
var py = self.getScrollTop()
var px = self.getScrollLeft()
self.setScrollTop(py) // fire event onscroll
if (self.railh) self.setScrollLeft(px) // fire event onscroll left
self.noticeCursor(false, py, px)
self.cursorfreezed = false
if (py < 0) py = 0
else if (py > self.page.maxh) py = self.page.maxh
if (px < 0) px = 0
else if (px > self.page.maxw) px = self.page.maxw
if (py != self.newscrolly || px != self.newscrollx)
return self.doScrollPos(px, py, self.opt.snapbackspeed)
if (self.onscrollend && self.scrollrunning) {
var info = {
type: 'scrollend',
current: { x: px, y: py },
end: { x: self.newscrollx, y: self.newscrolly }
}
self.onscrollend.call(self, info)
}
self.scrollrunning = false
}
} else {
this.doScrollLeft = function (x, spd) {
//no-trans
var y = self.scrollrunning ? self.newscrolly : self.getScrollTop()
self.doScrollPos(x, y, spd)
}
this.doScrollTop = function (y, spd) {
//no-trans
var x = self.scrollrunning ? self.newscrollx : self.getScrollLeft()
self.doScrollPos(x, y, spd)
}
this.doScrollPos = function (x, y, spd) {
//no-trans
var y = typeof y == 'undefined' || y === false ? self.getScrollTop(true) : y
if (self.timer && self.newscrolly == y && self.newscrollx == x) return true
if (self.timer) clearAnimationFrame(self.timer)
self.timer = 0
var py = self.getScrollTop()
var px = self.getScrollLeft()
if ((self.newscrolly - py) * (y - py) < 0 || (self.newscrollx - px) * (x - px) < 0)
self.cancelScroll() //inverted movement detection
self.newscrolly = y
self.newscrollx = x
if (!self.bouncescroll || !self.rail.visibility) {
if (self.newscrolly < 0) {
self.newscrolly = 0
} else if (self.newscrolly > self.page.maxh) {
self.newscrolly = self.page.maxh
}
}
if (!self.bouncescroll || !self.railh.visibility) {
if (self.newscrollx < 0) {
self.newscrollx = 0
} else if (self.newscrollx > self.page.maxw) {
self.newscrollx = self.page.maxw
}
}
self.dst = {}
self.dst.x = x - px
self.dst.y = y - py
self.dst.px = px
self.dst.py = py
var dst = Math.round(Math.sqrt(Math.pow(self.dst.x, 2) + Math.pow(self.dst.y, 2)))
self.dst.ax = self.dst.x / dst
self.dst.ay = self.dst.y / dst
var pa = 0
var pe = dst
if (self.dst.x == 0) {
pa = py
pe = y
self.dst.ay = 1
self.dst.py = 0
} else if (self.dst.y == 0) {
pa = px
pe = x
self.dst.ax = 1
self.dst.px = 0
}
var ms = self.getTransitionSpeed(dst)
if (spd && spd <= 1) ms *= spd
if (ms > 0) {
self.bzscroll = self.bzscroll
? self.bzscroll.update(pe, ms)
: new BezierClass(pa, pe, ms, 0, 1, 0, 1)
} else {
self.bzscroll = false
}
if (self.timer) return
if (
(py == self.page.maxh && y >= self.page.maxh) ||
(px == self.page.maxw && x >= self.page.maxw)
)
self.checkContentSize()
var sync = 1
function scrolling() {
if (self.cancelAnimationFrame) return true
self.scrollrunning = true
sync = 1 - sync
if (sync) return (self.timer = setAnimationFrame(scrolling) || 1)
var done = 0
var sc = (sy = self.getScrollTop())
if (self.dst.ay) {
sc = self.bzscroll
? self.dst.py + self.bzscroll.getNow() * self.dst.ay
: self.newscrolly
var dr = sc - sy
if ((dr < 0 && sc < self.newscrolly) || (dr > 0 && sc > self.newscrolly))
sc = self.newscrolly
self.setScrollTop(sc)
if (sc == self.newscrolly) done = 1
} else {
done = 1
}
var scx = (sx = self.getScrollLeft())
if (self.dst.ax) {
scx = self.bzscroll
? self.dst.px + self.bzscroll.getNow() * self.dst.ax
: self.newscrollx
var dr = scx - sx
if ((dr < 0 && scx < self.newscrollx) || (dr > 0 && scx > self.newscrollx))
scx = self.newscrollx
self.setScrollLeft(scx)
if (scx == self.newscrollx) done += 1
} else {
done += 1
}
if (done == 2) {
self.timer = 0
self.cursorfreezed = false
self.bzscroll = false
self.scrollrunning = false
if (sc < 0) sc = 0
else if (sc > self.page.maxh) sc = self.page.maxh
if (scx < 0) scx = 0
else if (scx > self.page.maxw) scx = self.page.maxw
if (scx != self.newscrollx || sc != self.newscrolly) self.doScrollPos(scx, sc)
else {
if (self.onscrollend) {
var info = {
type: 'scrollend',
current: { x: sx, y: sy },
end: { x: self.newscrollx, y: self.newscrolly }
}
self.onscrollend.call(self, info)
}
}
} else {
self.timer = setAnimationFrame(scrolling) || 1
}
}
self.cancelAnimationFrame = false
self.timer = 1
if (self.onscrollstart && !self.scrollrunning) {
var info = {
type: 'scrollstart',
current: { x: px, y: py },
request: { x: x, y: y },
end: { x: self.newscrollx, y: self.newscrolly },
speed: ms
}
self.onscrollstart.call(self, info)
}
scrolling()
if ((py == self.page.maxh && y >= py) || (px == self.page.maxw && x >= px))
self.checkContentSize()
self.noticeCursor()
}
this.cancelScroll = function () {
if (self.timer) clearAnimationFrame(self.timer)
self.timer = 0
self.bzscroll = false
self.scrollrunning = false
return self
}
}
this.doScrollBy = function (stp, relative) {
var ny = 0
if (relative) {
ny = Math.floor((self.scroll.y - stp) * self.scrollratio.y)
} else {
var sy = self.timer ? self.newscrolly : self.getScrollTop(true)
ny = sy - stp
}
if (self.bouncescroll) {
var haf = Math.round(self.view.h / 2)
if (ny < -haf) ny = -haf
else if (ny > self.page.maxh + haf) ny = self.page.maxh + haf
}
self.cursorfreezed = false
py = self.getScrollTop(true)
if (ny < 0 && py <= 0) return self.noticeCursor()
else if (ny > self.page.maxh && py >= self.page.maxh) {
self.checkContentSize()
return self.noticeCursor()
}
self.doScrollTop(ny)
}
this.doScrollLeftBy = function (stp, relative) {
var nx = 0
if (relative) {
nx = Math.floor((self.scroll.x - stp) * self.scrollratio.x)
} else {
var sx = self.timer ? self.newscrollx : self.getScrollLeft(true)
nx = sx - stp
}
if (self.bouncescroll) {
var haf = Math.round(self.view.w / 2)
if (nx < -haf) nx = -haf
else if (nx > self.page.maxw + haf) nx = self.page.maxw + haf
}
self.cursorfreezed = false
px = self.getScrollLeft(true)
if (nx < 0 && px <= 0) return self.noticeCursor()
else if (nx > self.page.maxw && px >= self.page.maxw) return self.noticeCursor()
self.doScrollLeft(nx)
}
this.doScrollTo = function (pos, relative) {
var ny = relative ? Math.round(pos * self.scrollratio.y) : pos
if (ny < 0) ny = 0
else if (ny > self.page.maxh) ny = self.page.maxh
self.cursorfreezed = false
self.doScrollTop(pos)
}
this.checkContentSize = function () {
var pg = self.getContentSize()
if (pg.h != self.page.h || pg.w != self.page.w) self.resize(false, pg)
}
self.onscroll = function (e) {
if (self.rail.drag) return
if (!self.cursorfreezed) {
self.synched('scroll', function () {
self.scroll.y = Math.round(self.getScrollTop() * (1 / self.scrollratio.y))
if (self.railh)
self.scroll.x = Math.round(self.getScrollLeft() * (1 / self.scrollratio.x))
self.noticeCursor()
})
}
}
self.bind(self.docscroll, 'scroll', self.onscroll)
this.doZoomIn = function (e) {
if (self.zoomactive) return
self.zoomactive = true
self.zoomrestore = {
style: {}
}
var lst = [
'position',
'top',
'left',
'zIndex',
'backgroundColor',
'marginTop',
'marginBottom',
'marginLeft',
'marginRight'
]
var win = self.win[0].style
for (var a in lst) {
var pp = lst[a]
self.zoomrestore.style[pp] = typeof win[pp] != 'undefined' ? win[pp] : ''
}
self.zoomrestore.style.width = self.win.css('width')
self.zoomrestore.style.height = self.win.css('height')
self.zoomrestore.padding = {
w: self.win.outerWidth() - self.win.width(),
h: self.win.outerHeight() - self.win.height()
}
if (cap.isios4) {
self.zoomrestore.scrollTop = $(window).scrollTop()
$(window).scrollTop(0)
}
self.win.css({
position: cap.isios4 ? 'absolute' : 'fixed',
top: 0,
left: 0,
'z-index': globalmaxzindex + 100,
margin: '0px'
})
var bkg = self.win.css('backgroundColor')
if (bkg == '' || /transparent|rgba\(0, 0, 0, 0\)|rgba\(0,0,0,0\)/.test(bkg))
self.win.css('backgroundColor', '#fff')
self.rail.css({ 'z-index': globalmaxzindex + 101 })
self.zoom.css({ 'z-index': globalmaxzindex + 102 })
self.zoom.css('backgroundPosition', '0px -18px')
self.resizeZoom()
if (self.onzoomin) self.onzoomin.call(self)
return self.cancelEvent(e)
}
this.doZoomOut = function (e) {
if (!self.zoomactive) return
self.zoomactive = false
self.win.css('margin', '')
self.win.css(self.zoomrestore.style)
if (cap.isios4) {
$(window).scrollTop(self.zoomrestore.scrollTop)
}
self.rail.css({ 'z-index': self.zindex })
self.zoom.css({ 'z-index': self.zindex })
self.zoomrestore = false
self.zoom.css('backgroundPosition', '0px 0px')
self.onResize()
if (self.onzoomout) self.onzoomout.call(self)
return self.cancelEvent(e)
}
this.doZoom = function (e) {
return self.zoomactive ? self.doZoomOut(e) : self.doZoomIn(e)
}
this.resizeZoom = function () {
if (!self.zoomactive) return
var py = self.getScrollTop() //preserve scrolling position
self.win.css({
width: $(window).width() - self.zoomrestore.padding.w + 'px',
height: $(window).height() - self.zoomrestore.padding.h + 'px'
})
self.onResize()
self.setScrollTop(Math.min(self.page.maxh, py))
}
this.init()
$.nicescroll.push(this)
}
// Inspired by the work of Kin Blas
// http://webpro.host.adobe.com/people/jblas/momentum/includes/jquery.momentum.0.7.js
var ScrollMomentumClass2D = function (nc) {
var self = this
this.nc = nc
this.lastx = 0
this.lasty = 0
this.speedx = 0
this.speedy = 0
this.lasttime = 0
this.steptime = 0
this.snapx = false
this.snapy = false
this.demulx = 0
this.demuly = 0
this.lastscrollx = -1
this.lastscrolly = -1
this.chkx = 0
this.chky = 0
this.timer = 0
this.time = function () {
return +new Date() //beautifull hack
}
this.reset = function (px, py) {
self.stop()
var now = self.time()
self.steptime = 0
self.lasttime = now
self.speedx = 0
self.speedy = 0
self.lastx = px
self.lasty = py
self.lastscrollx = -1
self.lastscrolly = -1
}
this.update = function (px, py) {
var now = self.time()
self.steptime = now - self.lasttime
self.lasttime = now
var dy = py - self.lasty
var dx = px - self.lastx
var sy = self.nc.getScrollTop()
var sx = self.nc.getScrollLeft()
var newy = sy + dy
var newx = sx + dx
self.snapx = newx < 0 || newx > self.nc.page.maxw
self.snapy = newy < 0 || newy > self.nc.page.maxh
self.speedx = dx
self.speedy = dy
self.lastx = px
self.lasty = py
}
this.stop = function () {
self.nc.unsynched('domomentum2d')
if (self.timer) clearTimeout(self.timer)
self.timer = 0
self.lastscrollx = -1
self.lastscrolly = -1
}
this.doSnapy = function (nx, ny) {
var snap = false
if (ny < 0) {
ny = 0
snap = true
} else if (ny > self.nc.page.maxh) {
ny = self.nc.page.maxh
snap = true
}
if (nx < 0) {
nx = 0
snap = true
} else if (nx > self.nc.page.maxw) {
nx = self.nc.page.maxw
snap = true
}
if (snap) self.nc.doScrollPos(nx, ny, self.nc.opt.snapbackspeed)
}
this.doMomentum = function (gp) {
var t = self.time()
var l = gp ? t + gp : self.lasttime
var sl = self.nc.getScrollLeft()
var st = self.nc.getScrollTop()
var pageh = self.nc.page.maxh
var pagew = self.nc.page.maxw
self.speedx = pagew > 0 ? Math.min(60, self.speedx) : 0
self.speedy = pageh > 0 ? Math.min(60, self.speedy) : 0
var chk = l && t - l <= 50
if (st < 0 || st > pageh || sl < 0 || sl > pagew) chk = false
var sy = self.speedy && chk ? self.speedy : false
var sx = self.speedx && chk ? self.speedx : false
if (sy || sx) {
var tm = Math.max(16, self.steptime) //timeout granularity
if (tm > 50) {
// do smooth
var xm = tm / 50
self.speedx *= xm
self.speedy *= xm
tm = 50
}
self.demulxy = 0
self.lastscrollx = self.nc.getScrollLeft()
self.chkx = self.lastscrollx
self.lastscrolly = self.nc.getScrollTop()
self.chky = self.lastscrolly
var nx = self.lastscrollx
var ny = self.lastscrolly
var onscroll = function () {
var df = self.time() - t > 600 ? 0.04 : 0.02
if (self.speedx) {
nx = Math.floor(self.lastscrollx - self.speedx * (1 - self.demulxy))
self.lastscrollx = nx
if (nx < 0 || nx > pagew) df = 0.1
}
if (self.speedy) {
ny = Math.floor(self.lastscrolly - self.speedy * (1 - self.demulxy))
self.lastscrolly = ny
if (ny < 0 || ny > pageh) df = 0.1
}
self.demulxy = Math.min(1, self.demulxy + df)
self.nc.synched('domomentum2d', function () {
if (self.speedx) {
var scx = self.nc.getScrollLeft()
if (scx != self.chkx) self.stop()
self.chkx = nx
self.nc.setScrollLeft(nx)
}
if (self.speedy) {
var scy = self.nc.getScrollTop()
if (scy != self.chky) self.stop()
self.chky = ny
self.nc.setScrollTop(ny)
}
if (!self.timer) {
self.nc.hideCursor()
self.doSnapy(nx, ny)
}
})
if (self.demulxy < 1) {
self.timer = setTimeout(onscroll, tm)
} else {
self.stop()
self.nc.hideCursor()
self.doSnapy(nx, ny)
}
}
onscroll()
} else {
self.doSnapy(self.nc.getScrollLeft(), self.nc.getScrollTop())
}
}
}
// override jQuery scrollTop
var _scrollTop = jQuery.fn.scrollTop // preserve original function
jQuery.cssHooks['pageYOffset'] = {
get: function (elem, computed, extra) {
var nice = $.data(elem, '__nicescroll') || false
return nice && nice.ishwscroll ? nice.getScrollTop() : _scrollTop.call(elem)
},
set: function (elem, value) {
var nice = $.data(elem, '__nicescroll') || false
nice && nice.ishwscroll ? nice.setScrollTop(parseInt(value)) : _scrollTop.call(elem, value)
return this
}
}
/*
$.fx.step["scrollTop"] = function(fx){
$.cssHooks["scrollTop"].set( fx.elem, fx.now + fx.unit );
};
*/
jQuery.fn.scrollTop = function (value) {
if (typeof value == 'undefined') {
var nice = this[0] ? $.data(this[0], '__nicescroll') || false : false
return nice && nice.ishwscroll ? nice.getScrollTop() : _scrollTop.call(this)
} else {
return this.each(function () {
var nice = $.data(this, '__nicescroll') || false
nice && nice.ishwscroll
? nice.setScrollTop(parseInt(value))
: _scrollTop.call($(this), value)
})
}
}
// override jQuery scrollLeft
var _scrollLeft = jQuery.fn.scrollLeft // preserve original function
$.cssHooks.pageXOffset = {
get: function (elem, computed, extra) {
var nice = $.data(elem, '__nicescroll') || false
return nice && nice.ishwscroll ? nice.getScrollLeft() : _scrollLeft.call(elem)
},
set: function (elem, value) {
var nice = $.data(elem, '__nicescroll') || false
nice && nice.ishwscroll ? nice.setScrollLeft(parseInt(value)) : _scrollLeft.call(elem, value)
return this
}
}
/*
$.fx.step["scrollLeft"] = function(fx){
$.cssHooks["scrollLeft"].set( fx.elem, fx.now + fx.unit );
};
*/
jQuery.fn.scrollLeft = function (value) {
if (typeof value == 'undefined') {
var nice = this[0] ? $.data(this[0], '__nicescroll') || false : false
return nice && nice.ishwscroll ? nice.getScrollLeft() : _scrollLeft.call(this)
} else {
return this.each(function () {
var nice = $.data(this, '__nicescroll') || false
nice && nice.ishwscroll
? nice.setScrollLeft(parseInt(value))
: _scrollLeft.call($(this), value)
})
}
}
var NiceScrollArray = function (doms) {
var self = this
this.length = 0
this.name = 'nicescrollarray'
this.each = function (fn) {
for (var a = 0; a < self.length; a++) fn.call(self[a])
return self
}
this.push = function (nice) {
self[self.length] = nice
self.length++
}
this.eq = function (idx) {
return self[idx]
}
if (doms) {
for (a = 0; a < doms.length; a++) {
var nice = $.data(doms[a], '__nicescroll') || false
if (nice) {
this[this.length] = nice
this.length++
}
}
}
return this
}
function mplex(el, lst, fn) {
for (var a = 0; a < lst.length; a++) fn(el, lst[a])
}
mplex(
NiceScrollArray.prototype,
['show', 'hide', 'toggle', 'onResize', 'resize', 'remove', 'stop', 'doScrollPos'],
function (e, n) {
e[n] = function () {
var args = arguments
return this.each(function () {
this[n].apply(this, args)
})
}
}
)
jQuery.fn.getNiceScroll = function (index) {
if (typeof index == 'undefined') {
return new NiceScrollArray(this)
} else {
var nice = $.data(this[index], '__nicescroll') || false
return nice
}
}
jQuery.extend(jQuery.expr[':'], {
nicescroll: function (a) {
return $.data(a, '__nicescroll') ? true : false
}
})
$.fn.niceScroll = function (wrapper, opt) {
if (typeof opt == 'undefined') {
if (typeof wrapper == 'object' && !('jquery' in wrapper)) {
opt = wrapper
wrapper = false
}
}
var ret = new NiceScrollArray()
if (typeof opt == 'undefined') opt = {}
if (wrapper || false) {
opt.doc = $(wrapper)
opt.win = $(this)
}
var docundef = !('doc' in opt)
if (!docundef && !('win' in opt)) opt.win = $(this)
this.each(function () {
var nice = $(this).data('__nicescroll') || false
if (!nice) {
opt.doc = docundef ? $(this) : opt.doc
nice = new NiceScrollClass(opt, $(this))
$(this).data('__nicescroll', nice)
}
ret.push(nice)
})
return ret.length == 1 ? ret[0] : ret
}
window.NiceScroll = {
getjQuery: function () {
return jQuery
}
}
if (!$.nicescroll) {
$.nicescroll = new NiceScrollArray()
$.nicescroll.options = _globaloptions
}
})(jQuery)