Merge branch 'master' of http://182.92.203.7:2001/r/testbookLayout
New file |
| | |
| | | MIT License |
| | | |
| | | Copyright (c) 2021 Adam James |
| | | |
| | | Permission is hereby granted, free of charge, to any person obtaining a copy |
| | | of this software and associated documentation files (the "Software"), to deal |
| | | in the Software without restriction, including without limitation the rights |
| | | to use, copy, modify, merge, publish, distribute, sublicense, and/or sell |
| | | copies of the Software, and to permit persons to whom the Software is |
| | | furnished to do so, subject to the following conditions: |
| | | |
| | | The above copyright notice and this permission notice shall be included in all |
| | | copies or substantial portions of the Software. |
| | | |
| | | THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR |
| | | IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, |
| | | FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE |
| | | AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER |
| | | LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, |
| | | OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE |
| | | SOFTWARE. |
New file |
| | |
| | | # Three.js-Model-Viewer |
| | | An application using the Three.js library to allow user to load model files and view them online with multiple viewing options. |
| | | |
| | | <b>Loading Models:</b> |
| | | - Choice of inputs, either load model or load model + textures |
| | | - Models and textures can be dragged and dropped onto the viewer |
| | | - Current formats supported: <b>.obj</b> or obj+mtl(and textures), <b>.dae</b> or dae (+textures), <b>.stl</b>, |
| | | <b>GLTF (+textures)</b> and <b>FBX (+textures)</b> |
| | | |
| | | - If loading a model and textures, make sure the model file and texture files are in the same folder on your system |
| | | |
| | | <b>Features:</b> |
| | | - View sample models from dropdown list |
| | | - View model information (name of model, number of vertices and faces) |
| | | - Add ambient light and alter the colour |
| | | - Alter the colour of the directional Ligt |
| | | - View model in wireframe model and model+wireframe mode |
| | | - Apply phong shading mode and increase/decrease the shininess level |
| | | - View model in x-ray |
| | | - Apply glow outline pass to the model and set the edge colour of the glow |
| | | - Set background colour of the renderer |
| | | - Auto-rotate the model and adjust the rotation speed |
| | | - Add transform controls (when selected, press S:scale, T:translate and R:rotate) |
| | | - Scale the model up and down |
| | | - Add view helpers such as bounding box, square/circular grid underneath model and an axis |
| | | |
| | | <b>Potential Features:</b> |
| | | - Support morph targets |
| | | - ZIP file support |
| | | |
| | | <h2><a href="https://adjam93.github.io/threejs-model-viewer/" target="_blank">View the Project Online</a></h2> |
New file |
| | |
| | | /*! |
| | | * Font Awesome 4.7.0 by @davegandy - http://fontawesome.io - @fontawesome |
| | | * License - http://fontawesome.io/license (Font: SIL OFL 1.1, CSS: MIT License) |
| | | */ |
| | | @font-face { |
| | | font-family: 'FontAwesome'; |
| | | src: url('../fonts/fontawesome-webfont.eot?v=4.7.0'); |
| | | src: |
| | | url('../fonts/fontawesome-webfont.eot?#iefix&v=4.7.0') format('embedded-opentype'), |
| | | url('../fonts/fontawesome-webfont.woff2?v=4.7.0') format('woff2'), |
| | | url('../fonts/fontawesome-webfont.woff?v=4.7.0') format('woff'), |
| | | url('../fonts/fontawesome-webfont.ttf?v=4.7.0') format('truetype'), |
| | | url('../fonts/fontawesome-webfont.svg?v=4.7.0#fontawesomeregular') format('svg'); |
| | | font-weight: normal; |
| | | font-style: normal; |
| | | } |
| | | .fa { |
| | | display: inline-block; |
| | | font: normal normal normal 14px/1 FontAwesome; |
| | | font-size: inherit; |
| | | text-rendering: auto; |
| | | -webkit-font-smoothing: antialiased; |
| | | -moz-osx-font-smoothing: grayscale; |
| | | } |
| | | .fa-lg { |
| | | font-size: 1.33333333em; |
| | | line-height: 0.75em; |
| | | vertical-align: -15%; |
| | | } |
| | | .fa-2x { |
| | | font-size: 2em; |
| | | } |
| | | .fa-3x { |
| | | font-size: 3em; |
| | | } |
| | | .fa-4x { |
| | | font-size: 4em; |
| | | } |
| | | .fa-5x { |
| | | font-size: 5em; |
| | | } |
| | | .fa-fw { |
| | | width: 1.28571429em; |
| | | text-align: center; |
| | | } |
| | | .fa-ul { |
| | | padding-left: 0; |
| | | margin-left: 2.14285714em; |
| | | list-style-type: none; |
| | | } |
| | | .fa-ul > li { |
| | | position: relative; |
| | | } |
| | | .fa-li { |
| | | position: absolute; |
| | | left: -2.14285714em; |
| | | width: 2.14285714em; |
| | | top: 0.14285714em; |
| | | text-align: center; |
| | | } |
| | | .fa-li.fa-lg { |
| | | left: -1.85714286em; |
| | | } |
| | | .fa-border { |
| | | padding: 0.2em 0.25em 0.15em; |
| | | border: solid 0.08em #eee; |
| | | border-radius: 0.1em; |
| | | } |
| | | .fa-pull-left { |
| | | float: left; |
| | | } |
| | | .fa-pull-right { |
| | | float: right; |
| | | } |
| | | .fa.fa-pull-left { |
| | | margin-right: 0.3em; |
| | | } |
| | | .fa.fa-pull-right { |
| | | margin-left: 0.3em; |
| | | } |
| | | .pull-right { |
| | | float: right; |
| | | } |
| | | .pull-left { |
| | | float: left; |
| | | } |
| | | .fa.pull-left { |
| | | margin-right: 0.3em; |
| | | } |
| | | .fa.pull-right { |
| | | margin-left: 0.3em; |
| | | } |
| | | .fa-spin { |
| | | -webkit-animation: fa-spin 2s infinite linear; |
| | | animation: fa-spin 2s infinite linear; |
| | | } |
| | | .fa-pulse { |
| | | -webkit-animation: fa-spin 1s infinite steps(8); |
| | | animation: fa-spin 1s infinite steps(8); |
| | | } |
| | | @-webkit-keyframes fa-spin { |
| | | 0% { |
| | | -webkit-transform: rotate(0deg); |
| | | transform: rotate(0deg); |
| | | } |
| | | 100% { |
| | | -webkit-transform: rotate(359deg); |
| | | transform: rotate(359deg); |
| | | } |
| | | } |
| | | @keyframes fa-spin { |
| | | 0% { |
| | | -webkit-transform: rotate(0deg); |
| | | transform: rotate(0deg); |
| | | } |
| | | 100% { |
| | | -webkit-transform: rotate(359deg); |
| | | transform: rotate(359deg); |
| | | } |
| | | } |
| | | .fa-rotate-90 { |
| | | -ms-filter: 'progid:DXImageTransform.Microsoft.BasicImage(rotation=1)'; |
| | | -webkit-transform: rotate(90deg); |
| | | -ms-transform: rotate(90deg); |
| | | transform: rotate(90deg); |
| | | } |
| | | .fa-rotate-180 { |
| | | -ms-filter: 'progid:DXImageTransform.Microsoft.BasicImage(rotation=2)'; |
| | | -webkit-transform: rotate(180deg); |
| | | -ms-transform: rotate(180deg); |
| | | transform: rotate(180deg); |
| | | } |
| | | .fa-rotate-270 { |
| | | -ms-filter: 'progid:DXImageTransform.Microsoft.BasicImage(rotation=3)'; |
| | | -webkit-transform: rotate(270deg); |
| | | -ms-transform: rotate(270deg); |
| | | transform: rotate(270deg); |
| | | } |
| | | .fa-flip-horizontal { |
| | | -ms-filter: 'progid:DXImageTransform.Microsoft.BasicImage(rotation=0, mirror=1)'; |
| | | -webkit-transform: scale(-1, 1); |
| | | -ms-transform: scale(-1, 1); |
| | | transform: scale(-1, 1); |
| | | } |
| | | .fa-flip-vertical { |
| | | -ms-filter: 'progid:DXImageTransform.Microsoft.BasicImage(rotation=2, mirror=1)'; |
| | | -webkit-transform: scale(1, -1); |
| | | -ms-transform: scale(1, -1); |
| | | transform: scale(1, -1); |
| | | } |
| | | :root .fa-rotate-90, |
| | | :root .fa-rotate-180, |
| | | :root .fa-rotate-270, |
| | | :root .fa-flip-horizontal, |
| | | :root .fa-flip-vertical { |
| | | filter: none; |
| | | } |
| | | .fa-stack { |
| | | position: relative; |
| | | display: inline-block; |
| | | width: 2em; |
| | | height: 2em; |
| | | line-height: 2em; |
| | | vertical-align: middle; |
| | | } |
| | | .fa-stack-1x, |
| | | .fa-stack-2x { |
| | | position: absolute; |
| | | left: 0; |
| | | width: 100%; |
| | | text-align: center; |
| | | } |
| | | .fa-stack-1x { |
| | | line-height: inherit; |
| | | } |
| | | .fa-stack-2x { |
| | | font-size: 2em; |
| | | } |
| | | .fa-inverse { |
| | | color: #fff; |
| | | } |
| | | .fa-glass:before { |
| | | content: '\f000'; |
| | | } |
| | | .fa-music:before { |
| | | content: '\f001'; |
| | | } |
| | | .fa-search:before { |
| | | content: '\f002'; |
| | | } |
| | | .fa-envelope-o:before { |
| | | content: '\f003'; |
| | | } |
| | | .fa-heart:before { |
| | | content: '\f004'; |
| | | } |
| | | .fa-star:before { |
| | | content: '\f005'; |
| | | } |
| | | .fa-star-o:before { |
| | | content: '\f006'; |
| | | } |
| | | .fa-user:before { |
| | | content: '\f007'; |
| | | } |
| | | .fa-film:before { |
| | | content: '\f008'; |
| | | } |
| | | .fa-th-large:before { |
| | | content: '\f009'; |
| | | } |
| | | .fa-th:before { |
| | | content: '\f00a'; |
| | | } |
| | | .fa-th-list:before { |
| | | content: '\f00b'; |
| | | } |
| | | .fa-check:before { |
| | | content: '\f00c'; |
| | | } |
| | | .fa-remove:before, |
| | | .fa-close:before, |
| | | .fa-times:before { |
| | | content: '\f00d'; |
| | | } |
| | | .fa-search-plus:before { |
| | | content: '\f00e'; |
| | | } |
| | | .fa-search-minus:before { |
| | | content: '\f010'; |
| | | } |
| | | .fa-power-off:before { |
| | | content: '\f011'; |
| | | } |
| | | .fa-signal:before { |
| | | content: '\f012'; |
| | | } |
| | | .fa-gear:before, |
| | | .fa-cog:before { |
| | | content: '\f013'; |
| | | } |
| | | .fa-trash-o:before { |
| | | content: '\f014'; |
| | | } |
| | | .fa-home:before { |
| | | content: '\f015'; |
| | | } |
| | | .fa-file-o:before { |
| | | content: '\f016'; |
| | | } |
| | | .fa-clock-o:before { |
| | | content: '\f017'; |
| | | } |
| | | .fa-road:before { |
| | | content: '\f018'; |
| | | } |
| | | .fa-download:before { |
| | | content: '\f019'; |
| | | } |
| | | .fa-arrow-circle-o-down:before { |
| | | content: '\f01a'; |
| | | } |
| | | .fa-arrow-circle-o-up:before { |
| | | content: '\f01b'; |
| | | } |
| | | .fa-inbox:before { |
| | | content: '\f01c'; |
| | | } |
| | | .fa-play-circle-o:before { |
| | | content: '\f01d'; |
| | | } |
| | | .fa-rotate-right:before, |
| | | .fa-repeat:before { |
| | | content: '\f01e'; |
| | | } |
| | | .fa-refresh:before { |
| | | content: '\f021'; |
| | | } |
| | | .fa-list-alt:before { |
| | | content: '\f022'; |
| | | } |
| | | .fa-lock:before { |
| | | content: '\f023'; |
| | | } |
| | | .fa-flag:before { |
| | | content: '\f024'; |
| | | } |
| | | .fa-headphones:before { |
| | | content: '\f025'; |
| | | } |
| | | .fa-volume-off:before { |
| | | content: '\f026'; |
| | | } |
| | | .fa-volume-down:before { |
| | | content: '\f027'; |
| | | } |
| | | .fa-volume-up:before { |
| | | content: '\f028'; |
| | | } |
| | | .fa-qrcode:before { |
| | | content: '\f029'; |
| | | } |
| | | .fa-barcode:before { |
| | | content: '\f02a'; |
| | | } |
| | | .fa-tag:before { |
| | | content: '\f02b'; |
| | | } |
| | | .fa-tags:before { |
| | | content: '\f02c'; |
| | | } |
| | | .fa-book:before { |
| | | content: '\f02d'; |
| | | } |
| | | .fa-bookmark:before { |
| | | content: '\f02e'; |
| | | } |
| | | .fa-print:before { |
| | | content: '\f02f'; |
| | | } |
| | | .fa-camera:before { |
| | | content: '\f030'; |
| | | } |
| | | .fa-font:before { |
| | | content: '\f031'; |
| | | } |
| | | .fa-bold:before { |
| | | content: '\f032'; |
| | | } |
| | | .fa-italic:before { |
| | | content: '\f033'; |
| | | } |
| | | .fa-text-height:before { |
| | | content: '\f034'; |
| | | } |
| | | .fa-text-width:before { |
| | | content: '\f035'; |
| | | } |
| | | .fa-align-left:before { |
| | | content: '\f036'; |
| | | } |
| | | .fa-align-center:before { |
| | | content: '\f037'; |
| | | } |
| | | .fa-align-right:before { |
| | | content: '\f038'; |
| | | } |
| | | .fa-align-justify:before { |
| | | content: '\f039'; |
| | | } |
| | | .fa-list:before { |
| | | content: '\f03a'; |
| | | } |
| | | .fa-dedent:before, |
| | | .fa-outdent:before { |
| | | content: '\f03b'; |
| | | } |
| | | .fa-indent:before { |
| | | content: '\f03c'; |
| | | } |
| | | .fa-video-camera:before { |
| | | content: '\f03d'; |
| | | } |
| | | .fa-photo:before, |
| | | .fa-image:before, |
| | | .fa-picture-o:before { |
| | | content: '\f03e'; |
| | | } |
| | | .fa-pencil:before { |
| | | content: '\f040'; |
| | | } |
| | | .fa-map-marker:before { |
| | | content: '\f041'; |
| | | } |
| | | .fa-adjust:before { |
| | | content: '\f042'; |
| | | } |
| | | .fa-tint:before { |
| | | content: '\f043'; |
| | | } |
| | | .fa-edit:before, |
| | | .fa-pencil-square-o:before { |
| | | content: '\f044'; |
| | | } |
| | | .fa-share-square-o:before { |
| | | content: '\f045'; |
| | | } |
| | | .fa-check-square-o:before { |
| | | content: '\f046'; |
| | | } |
| | | .fa-arrows:before { |
| | | content: '\f047'; |
| | | } |
| | | .fa-step-backward:before { |
| | | content: '\f048'; |
| | | } |
| | | .fa-fast-backward:before { |
| | | content: '\f049'; |
| | | } |
| | | .fa-backward:before { |
| | | content: '\f04a'; |
| | | } |
| | | .fa-play:before { |
| | | content: '\f04b'; |
| | | } |
| | | .fa-pause:before { |
| | | content: '\f04c'; |
| | | } |
| | | .fa-stop:before { |
| | | content: '\f04d'; |
| | | } |
| | | .fa-forward:before { |
| | | content: '\f04e'; |
| | | } |
| | | .fa-fast-forward:before { |
| | | content: '\f050'; |
| | | } |
| | | .fa-step-forward:before { |
| | | content: '\f051'; |
| | | } |
| | | .fa-eject:before { |
| | | content: '\f052'; |
| | | } |
| | | .fa-chevron-left:before { |
| | | content: '\f053'; |
| | | } |
| | | .fa-chevron-right:before { |
| | | content: '\f054'; |
| | | } |
| | | .fa-plus-circle:before { |
| | | content: '\f055'; |
| | | } |
| | | .fa-minus-circle:before { |
| | | content: '\f056'; |
| | | } |
| | | .fa-times-circle:before { |
| | | content: '\f057'; |
| | | } |
| | | .fa-check-circle:before { |
| | | content: '\f058'; |
| | | } |
| | | .fa-question-circle:before { |
| | | content: '\f059'; |
| | | } |
| | | .fa-info-circle:before { |
| | | content: '\f05a'; |
| | | } |
| | | .fa-crosshairs:before { |
| | | content: '\f05b'; |
| | | } |
| | | .fa-times-circle-o:before { |
| | | content: '\f05c'; |
| | | } |
| | | .fa-check-circle-o:before { |
| | | content: '\f05d'; |
| | | } |
| | | .fa-ban:before { |
| | | content: '\f05e'; |
| | | } |
| | | .fa-arrow-left:before { |
| | | content: '\f060'; |
| | | } |
| | | .fa-arrow-right:before { |
| | | content: '\f061'; |
| | | } |
| | | .fa-arrow-up:before { |
| | | content: '\f062'; |
| | | } |
| | | .fa-arrow-down:before { |
| | | content: '\f063'; |
| | | } |
| | | .fa-mail-forward:before, |
| | | .fa-share:before { |
| | | content: '\f064'; |
| | | } |
| | | .fa-expand:before { |
| | | content: '\f065'; |
| | | } |
| | | .fa-compress:before { |
| | | content: '\f066'; |
| | | } |
| | | .fa-plus:before { |
| | | content: '\f067'; |
| | | } |
| | | .fa-minus:before { |
| | | content: '\f068'; |
| | | } |
| | | .fa-asterisk:before { |
| | | content: '\f069'; |
| | | } |
| | | .fa-exclamation-circle:before { |
| | | content: '\f06a'; |
| | | } |
| | | .fa-gift:before { |
| | | content: '\f06b'; |
| | | } |
| | | .fa-leaf:before { |
| | | content: '\f06c'; |
| | | } |
| | | .fa-fire:before { |
| | | content: '\f06d'; |
| | | } |
| | | .fa-eye:before { |
| | | content: '\f06e'; |
| | | } |
| | | .fa-eye-slash:before { |
| | | content: '\f070'; |
| | | } |
| | | .fa-warning:before, |
| | | .fa-exclamation-triangle:before { |
| | | content: '\f071'; |
| | | } |
| | | .fa-plane:before { |
| | | content: '\f072'; |
| | | } |
| | | .fa-calendar:before { |
| | | content: '\f073'; |
| | | } |
| | | .fa-random:before { |
| | | content: '\f074'; |
| | | } |
| | | .fa-comment:before { |
| | | content: '\f075'; |
| | | } |
| | | .fa-magnet:before { |
| | | content: '\f076'; |
| | | } |
| | | .fa-chevron-up:before { |
| | | content: '\f077'; |
| | | } |
| | | .fa-chevron-down:before { |
| | | content: '\f078'; |
| | | } |
| | | .fa-retweet:before { |
| | | content: '\f079'; |
| | | } |
| | | .fa-shopping-cart:before { |
| | | content: '\f07a'; |
| | | } |
| | | .fa-folder:before { |
| | | content: '\f07b'; |
| | | } |
| | | .fa-folder-open:before { |
| | | content: '\f07c'; |
| | | } |
| | | .fa-arrows-v:before { |
| | | content: '\f07d'; |
| | | } |
| | | .fa-arrows-h:before { |
| | | content: '\f07e'; |
| | | } |
| | | .fa-bar-chart-o:before, |
| | | .fa-bar-chart:before { |
| | | content: '\f080'; |
| | | } |
| | | .fa-twitter-square:before { |
| | | content: '\f081'; |
| | | } |
| | | .fa-facebook-square:before { |
| | | content: '\f082'; |
| | | } |
| | | .fa-camera-retro:before { |
| | | content: '\f083'; |
| | | } |
| | | .fa-key:before { |
| | | content: '\f084'; |
| | | } |
| | | .fa-gears:before, |
| | | .fa-cogs:before { |
| | | content: '\f085'; |
| | | } |
| | | .fa-comments:before { |
| | | content: '\f086'; |
| | | } |
| | | .fa-thumbs-o-up:before { |
| | | content: '\f087'; |
| | | } |
| | | .fa-thumbs-o-down:before { |
| | | content: '\f088'; |
| | | } |
| | | .fa-star-half:before { |
| | | content: '\f089'; |
| | | } |
| | | .fa-heart-o:before { |
| | | content: '\f08a'; |
| | | } |
| | | .fa-sign-out:before { |
| | | content: '\f08b'; |
| | | } |
| | | .fa-linkedin-square:before { |
| | | content: '\f08c'; |
| | | } |
| | | .fa-thumb-tack:before { |
| | | content: '\f08d'; |
| | | } |
| | | .fa-external-link:before { |
| | | content: '\f08e'; |
| | | } |
| | | .fa-sign-in:before { |
| | | content: '\f090'; |
| | | } |
| | | .fa-trophy:before { |
| | | content: '\f091'; |
| | | } |
| | | .fa-github-square:before { |
| | | content: '\f092'; |
| | | } |
| | | .fa-upload:before { |
| | | content: '\f093'; |
| | | } |
| | | .fa-lemon-o:before { |
| | | content: '\f094'; |
| | | } |
| | | .fa-phone:before { |
| | | content: '\f095'; |
| | | } |
| | | .fa-square-o:before { |
| | | content: '\f096'; |
| | | } |
| | | .fa-bookmark-o:before { |
| | | content: '\f097'; |
| | | } |
| | | .fa-phone-square:before { |
| | | content: '\f098'; |
| | | } |
| | | .fa-twitter:before { |
| | | content: '\f099'; |
| | | } |
| | | .fa-facebook-f:before, |
| | | .fa-facebook:before { |
| | | content: '\f09a'; |
| | | } |
| | | .fa-github:before { |
| | | content: '\f09b'; |
| | | } |
| | | .fa-unlock:before { |
| | | content: '\f09c'; |
| | | } |
| | | .fa-credit-card:before { |
| | | content: '\f09d'; |
| | | } |
| | | .fa-feed:before, |
| | | .fa-rss:before { |
| | | content: '\f09e'; |
| | | } |
| | | .fa-hdd-o:before { |
| | | content: '\f0a0'; |
| | | } |
| | | .fa-bullhorn:before { |
| | | content: '\f0a1'; |
| | | } |
| | | .fa-bell:before { |
| | | content: '\f0f3'; |
| | | } |
| | | .fa-certificate:before { |
| | | content: '\f0a3'; |
| | | } |
| | | .fa-hand-o-right:before { |
| | | content: '\f0a4'; |
| | | } |
| | | .fa-hand-o-left:before { |
| | | content: '\f0a5'; |
| | | } |
| | | .fa-hand-o-up:before { |
| | | content: '\f0a6'; |
| | | } |
| | | .fa-hand-o-down:before { |
| | | content: '\f0a7'; |
| | | } |
| | | .fa-arrow-circle-left:before { |
| | | content: '\f0a8'; |
| | | } |
| | | .fa-arrow-circle-right:before { |
| | | content: '\f0a9'; |
| | | } |
| | | .fa-arrow-circle-up:before { |
| | | content: '\f0aa'; |
| | | } |
| | | .fa-arrow-circle-down:before { |
| | | content: '\f0ab'; |
| | | } |
| | | .fa-globe:before { |
| | | content: '\f0ac'; |
| | | } |
| | | .fa-wrench:before { |
| | | content: '\f0ad'; |
| | | } |
| | | .fa-tasks:before { |
| | | content: '\f0ae'; |
| | | } |
| | | .fa-filter:before { |
| | | content: '\f0b0'; |
| | | } |
| | | .fa-briefcase:before { |
| | | content: '\f0b1'; |
| | | } |
| | | .fa-arrows-alt:before { |
| | | content: '\f0b2'; |
| | | } |
| | | .fa-group:before, |
| | | .fa-users:before { |
| | | content: '\f0c0'; |
| | | } |
| | | .fa-chain:before, |
| | | .fa-link:before { |
| | | content: '\f0c1'; |
| | | } |
| | | .fa-cloud:before { |
| | | content: '\f0c2'; |
| | | } |
| | | .fa-flask:before { |
| | | content: '\f0c3'; |
| | | } |
| | | .fa-cut:before, |
| | | .fa-scissors:before { |
| | | content: '\f0c4'; |
| | | } |
| | | .fa-copy:before, |
| | | .fa-files-o:before { |
| | | content: '\f0c5'; |
| | | } |
| | | .fa-paperclip:before { |
| | | content: '\f0c6'; |
| | | } |
| | | .fa-save:before, |
| | | .fa-floppy-o:before { |
| | | content: '\f0c7'; |
| | | } |
| | | .fa-square:before { |
| | | content: '\f0c8'; |
| | | } |
| | | .fa-navicon:before, |
| | | .fa-reorder:before, |
| | | .fa-bars:before { |
| | | content: '\f0c9'; |
| | | } |
| | | .fa-list-ul:before { |
| | | content: '\f0ca'; |
| | | } |
| | | .fa-list-ol:before { |
| | | content: '\f0cb'; |
| | | } |
| | | .fa-strikethrough:before { |
| | | content: '\f0cc'; |
| | | } |
| | | .fa-underline:before { |
| | | content: '\f0cd'; |
| | | } |
| | | .fa-table:before { |
| | | content: '\f0ce'; |
| | | } |
| | | .fa-magic:before { |
| | | content: '\f0d0'; |
| | | } |
| | | .fa-truck:before { |
| | | content: '\f0d1'; |
| | | } |
| | | .fa-pinterest:before { |
| | | content: '\f0d2'; |
| | | } |
| | | .fa-pinterest-square:before { |
| | | content: '\f0d3'; |
| | | } |
| | | .fa-google-plus-square:before { |
| | | content: '\f0d4'; |
| | | } |
| | | .fa-google-plus:before { |
| | | content: '\f0d5'; |
| | | } |
| | | .fa-money:before { |
| | | content: '\f0d6'; |
| | | } |
| | | .fa-caret-down:before { |
| | | content: '\f0d7'; |
| | | } |
| | | .fa-caret-up:before { |
| | | content: '\f0d8'; |
| | | } |
| | | .fa-caret-left:before { |
| | | content: '\f0d9'; |
| | | } |
| | | .fa-caret-right:before { |
| | | content: '\f0da'; |
| | | } |
| | | .fa-columns:before { |
| | | content: '\f0db'; |
| | | } |
| | | .fa-unsorted:before, |
| | | .fa-sort:before { |
| | | content: '\f0dc'; |
| | | } |
| | | .fa-sort-down:before, |
| | | .fa-sort-desc:before { |
| | | content: '\f0dd'; |
| | | } |
| | | .fa-sort-up:before, |
| | | .fa-sort-asc:before { |
| | | content: '\f0de'; |
| | | } |
| | | .fa-envelope:before { |
| | | content: '\f0e0'; |
| | | } |
| | | .fa-linkedin:before { |
| | | content: '\f0e1'; |
| | | } |
| | | .fa-rotate-left:before, |
| | | .fa-undo:before { |
| | | content: '\f0e2'; |
| | | } |
| | | .fa-legal:before, |
| | | .fa-gavel:before { |
| | | content: '\f0e3'; |
| | | } |
| | | .fa-dashboard:before, |
| | | .fa-tachometer:before { |
| | | content: '\f0e4'; |
| | | } |
| | | .fa-comment-o:before { |
| | | content: '\f0e5'; |
| | | } |
| | | .fa-comments-o:before { |
| | | content: '\f0e6'; |
| | | } |
| | | .fa-flash:before, |
| | | .fa-bolt:before { |
| | | content: '\f0e7'; |
| | | } |
| | | .fa-sitemap:before { |
| | | content: '\f0e8'; |
| | | } |
| | | .fa-umbrella:before { |
| | | content: '\f0e9'; |
| | | } |
| | | .fa-paste:before, |
| | | .fa-clipboard:before { |
| | | content: '\f0ea'; |
| | | } |
| | | .fa-lightbulb-o:before { |
| | | content: '\f0eb'; |
| | | } |
| | | .fa-exchange:before { |
| | | content: '\f0ec'; |
| | | } |
| | | .fa-cloud-download:before { |
| | | content: '\f0ed'; |
| | | } |
| | | .fa-cloud-upload:before { |
| | | content: '\f0ee'; |
| | | } |
| | | .fa-user-md:before { |
| | | content: '\f0f0'; |
| | | } |
| | | .fa-stethoscope:before { |
| | | content: '\f0f1'; |
| | | } |
| | | .fa-suitcase:before { |
| | | content: '\f0f2'; |
| | | } |
| | | .fa-bell-o:before { |
| | | content: '\f0a2'; |
| | | } |
| | | .fa-coffee:before { |
| | | content: '\f0f4'; |
| | | } |
| | | .fa-cutlery:before { |
| | | content: '\f0f5'; |
| | | } |
| | | .fa-file-text-o:before { |
| | | content: '\f0f6'; |
| | | } |
| | | .fa-building-o:before { |
| | | content: '\f0f7'; |
| | | } |
| | | .fa-hospital-o:before { |
| | | content: '\f0f8'; |
| | | } |
| | | .fa-ambulance:before { |
| | | content: '\f0f9'; |
| | | } |
| | | .fa-medkit:before { |
| | | content: '\f0fa'; |
| | | } |
| | | .fa-fighter-jet:before { |
| | | content: '\f0fb'; |
| | | } |
| | | .fa-beer:before { |
| | | content: '\f0fc'; |
| | | } |
| | | .fa-h-square:before { |
| | | content: '\f0fd'; |
| | | } |
| | | .fa-plus-square:before { |
| | | content: '\f0fe'; |
| | | } |
| | | .fa-angle-double-left:before { |
| | | content: '\f100'; |
| | | } |
| | | .fa-angle-double-right:before { |
| | | content: '\f101'; |
| | | } |
| | | .fa-angle-double-up:before { |
| | | content: '\f102'; |
| | | } |
| | | .fa-angle-double-down:before { |
| | | content: '\f103'; |
| | | } |
| | | .fa-angle-left:before { |
| | | content: '\f104'; |
| | | } |
| | | .fa-angle-right:before { |
| | | content: '\f105'; |
| | | } |
| | | .fa-angle-up:before { |
| | | content: '\f106'; |
| | | } |
| | | .fa-angle-down:before { |
| | | content: '\f107'; |
| | | } |
| | | .fa-desktop:before { |
| | | content: '\f108'; |
| | | } |
| | | .fa-laptop:before { |
| | | content: '\f109'; |
| | | } |
| | | .fa-tablet:before { |
| | | content: '\f10a'; |
| | | } |
| | | .fa-mobile-phone:before, |
| | | .fa-mobile:before { |
| | | content: '\f10b'; |
| | | } |
| | | .fa-circle-o:before { |
| | | content: '\f10c'; |
| | | } |
| | | .fa-quote-left:before { |
| | | content: '\f10d'; |
| | | } |
| | | .fa-quote-right:before { |
| | | content: '\f10e'; |
| | | } |
| | | .fa-spinner:before { |
| | | content: '\f110'; |
| | | } |
| | | .fa-circle:before { |
| | | content: '\f111'; |
| | | } |
| | | .fa-mail-reply:before, |
| | | .fa-reply:before { |
| | | content: '\f112'; |
| | | } |
| | | .fa-github-alt:before { |
| | | content: '\f113'; |
| | | } |
| | | .fa-folder-o:before { |
| | | content: '\f114'; |
| | | } |
| | | .fa-folder-open-o:before { |
| | | content: '\f115'; |
| | | } |
| | | .fa-smile-o:before { |
| | | content: '\f118'; |
| | | } |
| | | .fa-frown-o:before { |
| | | content: '\f119'; |
| | | } |
| | | .fa-meh-o:before { |
| | | content: '\f11a'; |
| | | } |
| | | .fa-gamepad:before { |
| | | content: '\f11b'; |
| | | } |
| | | .fa-keyboard-o:before { |
| | | content: '\f11c'; |
| | | } |
| | | .fa-flag-o:before { |
| | | content: '\f11d'; |
| | | } |
| | | .fa-flag-checkered:before { |
| | | content: '\f11e'; |
| | | } |
| | | .fa-terminal:before { |
| | | content: '\f120'; |
| | | } |
| | | .fa-code:before { |
| | | content: '\f121'; |
| | | } |
| | | .fa-mail-reply-all:before, |
| | | .fa-reply-all:before { |
| | | content: '\f122'; |
| | | } |
| | | .fa-star-half-empty:before, |
| | | .fa-star-half-full:before, |
| | | .fa-star-half-o:before { |
| | | content: '\f123'; |
| | | } |
| | | .fa-location-arrow:before { |
| | | content: '\f124'; |
| | | } |
| | | .fa-crop:before { |
| | | content: '\f125'; |
| | | } |
| | | .fa-code-fork:before { |
| | | content: '\f126'; |
| | | } |
| | | .fa-unlink:before, |
| | | .fa-chain-broken:before { |
| | | content: '\f127'; |
| | | } |
| | | .fa-question:before { |
| | | content: '\f128'; |
| | | } |
| | | .fa-info:before { |
| | | content: '\f129'; |
| | | } |
| | | .fa-exclamation:before { |
| | | content: '\f12a'; |
| | | } |
| | | .fa-superscript:before { |
| | | content: '\f12b'; |
| | | } |
| | | .fa-subscript:before { |
| | | content: '\f12c'; |
| | | } |
| | | .fa-eraser:before { |
| | | content: '\f12d'; |
| | | } |
| | | .fa-puzzle-piece:before { |
| | | content: '\f12e'; |
| | | } |
| | | .fa-microphone:before { |
| | | content: '\f130'; |
| | | } |
| | | .fa-microphone-slash:before { |
| | | content: '\f131'; |
| | | } |
| | | .fa-shield:before { |
| | | content: '\f132'; |
| | | } |
| | | .fa-calendar-o:before { |
| | | content: '\f133'; |
| | | } |
| | | .fa-fire-extinguisher:before { |
| | | content: '\f134'; |
| | | } |
| | | .fa-rocket:before { |
| | | content: '\f135'; |
| | | } |
| | | .fa-maxcdn:before { |
| | | content: '\f136'; |
| | | } |
| | | .fa-chevron-circle-left:before { |
| | | content: '\f137'; |
| | | } |
| | | .fa-chevron-circle-right:before { |
| | | content: '\f138'; |
| | | } |
| | | .fa-chevron-circle-up:before { |
| | | content: '\f139'; |
| | | } |
| | | .fa-chevron-circle-down:before { |
| | | content: '\f13a'; |
| | | } |
| | | .fa-html5:before { |
| | | content: '\f13b'; |
| | | } |
| | | .fa-css3:before { |
| | | content: '\f13c'; |
| | | } |
| | | .fa-anchor:before { |
| | | content: '\f13d'; |
| | | } |
| | | .fa-unlock-alt:before { |
| | | content: '\f13e'; |
| | | } |
| | | .fa-bullseye:before { |
| | | content: '\f140'; |
| | | } |
| | | .fa-ellipsis-h:before { |
| | | content: '\f141'; |
| | | } |
| | | .fa-ellipsis-v:before { |
| | | content: '\f142'; |
| | | } |
| | | .fa-rss-square:before { |
| | | content: '\f143'; |
| | | } |
| | | .fa-play-circle:before { |
| | | content: '\f144'; |
| | | } |
| | | .fa-ticket:before { |
| | | content: '\f145'; |
| | | } |
| | | .fa-minus-square:before { |
| | | content: '\f146'; |
| | | } |
| | | .fa-minus-square-o:before { |
| | | content: '\f147'; |
| | | } |
| | | .fa-level-up:before { |
| | | content: '\f148'; |
| | | } |
| | | .fa-level-down:before { |
| | | content: '\f149'; |
| | | } |
| | | .fa-check-square:before { |
| | | content: '\f14a'; |
| | | } |
| | | .fa-pencil-square:before { |
| | | content: '\f14b'; |
| | | } |
| | | .fa-external-link-square:before { |
| | | content: '\f14c'; |
| | | } |
| | | .fa-share-square:before { |
| | | content: '\f14d'; |
| | | } |
| | | .fa-compass:before { |
| | | content: '\f14e'; |
| | | } |
| | | .fa-toggle-down:before, |
| | | .fa-caret-square-o-down:before { |
| | | content: '\f150'; |
| | | } |
| | | .fa-toggle-up:before, |
| | | .fa-caret-square-o-up:before { |
| | | content: '\f151'; |
| | | } |
| | | .fa-toggle-right:before, |
| | | .fa-caret-square-o-right:before { |
| | | content: '\f152'; |
| | | } |
| | | .fa-euro:before, |
| | | .fa-eur:before { |
| | | content: '\f153'; |
| | | } |
| | | .fa-gbp:before { |
| | | content: '\f154'; |
| | | } |
| | | .fa-dollar:before, |
| | | .fa-usd:before { |
| | | content: '\f155'; |
| | | } |
| | | .fa-rupee:before, |
| | | .fa-inr:before { |
| | | content: '\f156'; |
| | | } |
| | | .fa-cny:before, |
| | | .fa-rmb:before, |
| | | .fa-yen:before, |
| | | .fa-jpy:before { |
| | | content: '\f157'; |
| | | } |
| | | .fa-ruble:before, |
| | | .fa-rouble:before, |
| | | .fa-rub:before { |
| | | content: '\f158'; |
| | | } |
| | | .fa-won:before, |
| | | .fa-krw:before { |
| | | content: '\f159'; |
| | | } |
| | | .fa-bitcoin:before, |
| | | .fa-btc:before { |
| | | content: '\f15a'; |
| | | } |
| | | .fa-file:before { |
| | | content: '\f15b'; |
| | | } |
| | | .fa-file-text:before { |
| | | content: '\f15c'; |
| | | } |
| | | .fa-sort-alpha-asc:before { |
| | | content: '\f15d'; |
| | | } |
| | | .fa-sort-alpha-desc:before { |
| | | content: '\f15e'; |
| | | } |
| | | .fa-sort-amount-asc:before { |
| | | content: '\f160'; |
| | | } |
| | | .fa-sort-amount-desc:before { |
| | | content: '\f161'; |
| | | } |
| | | .fa-sort-numeric-asc:before { |
| | | content: '\f162'; |
| | | } |
| | | .fa-sort-numeric-desc:before { |
| | | content: '\f163'; |
| | | } |
| | | .fa-thumbs-up:before { |
| | | content: '\f164'; |
| | | } |
| | | .fa-thumbs-down:before { |
| | | content: '\f165'; |
| | | } |
| | | .fa-youtube-square:before { |
| | | content: '\f166'; |
| | | } |
| | | .fa-youtube:before { |
| | | content: '\f167'; |
| | | } |
| | | .fa-xing:before { |
| | | content: '\f168'; |
| | | } |
| | | .fa-xing-square:before { |
| | | content: '\f169'; |
| | | } |
| | | .fa-youtube-play:before { |
| | | content: '\f16a'; |
| | | } |
| | | .fa-dropbox:before { |
| | | content: '\f16b'; |
| | | } |
| | | .fa-stack-overflow:before { |
| | | content: '\f16c'; |
| | | } |
| | | .fa-instagram:before { |
| | | content: '\f16d'; |
| | | } |
| | | .fa-flickr:before { |
| | | content: '\f16e'; |
| | | } |
| | | .fa-adn:before { |
| | | content: '\f170'; |
| | | } |
| | | .fa-bitbucket:before { |
| | | content: '\f171'; |
| | | } |
| | | .fa-bitbucket-square:before { |
| | | content: '\f172'; |
| | | } |
| | | .fa-tumblr:before { |
| | | content: '\f173'; |
| | | } |
| | | .fa-tumblr-square:before { |
| | | content: '\f174'; |
| | | } |
| | | .fa-long-arrow-down:before { |
| | | content: '\f175'; |
| | | } |
| | | .fa-long-arrow-up:before { |
| | | content: '\f176'; |
| | | } |
| | | .fa-long-arrow-left:before { |
| | | content: '\f177'; |
| | | } |
| | | .fa-long-arrow-right:before { |
| | | content: '\f178'; |
| | | } |
| | | .fa-apple:before { |
| | | content: '\f179'; |
| | | } |
| | | .fa-windows:before { |
| | | content: '\f17a'; |
| | | } |
| | | .fa-android:before { |
| | | content: '\f17b'; |
| | | } |
| | | .fa-linux:before { |
| | | content: '\f17c'; |
| | | } |
| | | .fa-dribbble:before { |
| | | content: '\f17d'; |
| | | } |
| | | .fa-skype:before { |
| | | content: '\f17e'; |
| | | } |
| | | .fa-foursquare:before { |
| | | content: '\f180'; |
| | | } |
| | | .fa-trello:before { |
| | | content: '\f181'; |
| | | } |
| | | .fa-female:before { |
| | | content: '\f182'; |
| | | } |
| | | .fa-male:before { |
| | | content: '\f183'; |
| | | } |
| | | .fa-gittip:before, |
| | | .fa-gratipay:before { |
| | | content: '\f184'; |
| | | } |
| | | .fa-sun-o:before { |
| | | content: '\f185'; |
| | | } |
| | | .fa-moon-o:before { |
| | | content: '\f186'; |
| | | } |
| | | .fa-archive:before { |
| | | content: '\f187'; |
| | | } |
| | | .fa-bug:before { |
| | | content: '\f188'; |
| | | } |
| | | .fa-vk:before { |
| | | content: '\f189'; |
| | | } |
| | | .fa-weibo:before { |
| | | content: '\f18a'; |
| | | } |
| | | .fa-renren:before { |
| | | content: '\f18b'; |
| | | } |
| | | .fa-pagelines:before { |
| | | content: '\f18c'; |
| | | } |
| | | .fa-stack-exchange:before { |
| | | content: '\f18d'; |
| | | } |
| | | .fa-arrow-circle-o-right:before { |
| | | content: '\f18e'; |
| | | } |
| | | .fa-arrow-circle-o-left:before { |
| | | content: '\f190'; |
| | | } |
| | | .fa-toggle-left:before, |
| | | .fa-caret-square-o-left:before { |
| | | content: '\f191'; |
| | | } |
| | | .fa-dot-circle-o:before { |
| | | content: '\f192'; |
| | | } |
| | | .fa-wheelchair:before { |
| | | content: '\f193'; |
| | | } |
| | | .fa-vimeo-square:before { |
| | | content: '\f194'; |
| | | } |
| | | .fa-turkish-lira:before, |
| | | .fa-try:before { |
| | | content: '\f195'; |
| | | } |
| | | .fa-plus-square-o:before { |
| | | content: '\f196'; |
| | | } |
| | | .fa-space-shuttle:before { |
| | | content: '\f197'; |
| | | } |
| | | .fa-slack:before { |
| | | content: '\f198'; |
| | | } |
| | | .fa-envelope-square:before { |
| | | content: '\f199'; |
| | | } |
| | | .fa-wordpress:before { |
| | | content: '\f19a'; |
| | | } |
| | | .fa-openid:before { |
| | | content: '\f19b'; |
| | | } |
| | | .fa-institution:before, |
| | | .fa-bank:before, |
| | | .fa-university:before { |
| | | content: '\f19c'; |
| | | } |
| | | .fa-mortar-board:before, |
| | | .fa-graduation-cap:before { |
| | | content: '\f19d'; |
| | | } |
| | | .fa-yahoo:before { |
| | | content: '\f19e'; |
| | | } |
| | | .fa-google:before { |
| | | content: '\f1a0'; |
| | | } |
| | | .fa-reddit:before { |
| | | content: '\f1a1'; |
| | | } |
| | | .fa-reddit-square:before { |
| | | content: '\f1a2'; |
| | | } |
| | | .fa-stumbleupon-circle:before { |
| | | content: '\f1a3'; |
| | | } |
| | | .fa-stumbleupon:before { |
| | | content: '\f1a4'; |
| | | } |
| | | .fa-delicious:before { |
| | | content: '\f1a5'; |
| | | } |
| | | .fa-digg:before { |
| | | content: '\f1a6'; |
| | | } |
| | | .fa-pied-piper-pp:before { |
| | | content: '\f1a7'; |
| | | } |
| | | .fa-pied-piper-alt:before { |
| | | content: '\f1a8'; |
| | | } |
| | | .fa-drupal:before { |
| | | content: '\f1a9'; |
| | | } |
| | | .fa-joomla:before { |
| | | content: '\f1aa'; |
| | | } |
| | | .fa-language:before { |
| | | content: '\f1ab'; |
| | | } |
| | | .fa-fax:before { |
| | | content: '\f1ac'; |
| | | } |
| | | .fa-building:before { |
| | | content: '\f1ad'; |
| | | } |
| | | .fa-child:before { |
| | | content: '\f1ae'; |
| | | } |
| | | .fa-paw:before { |
| | | content: '\f1b0'; |
| | | } |
| | | .fa-spoon:before { |
| | | content: '\f1b1'; |
| | | } |
| | | .fa-cube:before { |
| | | content: '\f1b2'; |
| | | } |
| | | .fa-cubes:before { |
| | | content: '\f1b3'; |
| | | } |
| | | .fa-behance:before { |
| | | content: '\f1b4'; |
| | | } |
| | | .fa-behance-square:before { |
| | | content: '\f1b5'; |
| | | } |
| | | .fa-steam:before { |
| | | content: '\f1b6'; |
| | | } |
| | | .fa-steam-square:before { |
| | | content: '\f1b7'; |
| | | } |
| | | .fa-recycle:before { |
| | | content: '\f1b8'; |
| | | } |
| | | .fa-automobile:before, |
| | | .fa-car:before { |
| | | content: '\f1b9'; |
| | | } |
| | | .fa-cab:before, |
| | | .fa-taxi:before { |
| | | content: '\f1ba'; |
| | | } |
| | | .fa-tree:before { |
| | | content: '\f1bb'; |
| | | } |
| | | .fa-spotify:before { |
| | | content: '\f1bc'; |
| | | } |
| | | .fa-deviantart:before { |
| | | content: '\f1bd'; |
| | | } |
| | | .fa-soundcloud:before { |
| | | content: '\f1be'; |
| | | } |
| | | .fa-database:before { |
| | | content: '\f1c0'; |
| | | } |
| | | .fa-file-pdf-o:before { |
| | | content: '\f1c1'; |
| | | } |
| | | .fa-file-word-o:before { |
| | | content: '\f1c2'; |
| | | } |
| | | .fa-file-excel-o:before { |
| | | content: '\f1c3'; |
| | | } |
| | | .fa-file-powerpoint-o:before { |
| | | content: '\f1c4'; |
| | | } |
| | | .fa-file-photo-o:before, |
| | | .fa-file-picture-o:before, |
| | | .fa-file-image-o:before { |
| | | content: '\f1c5'; |
| | | } |
| | | .fa-file-zip-o:before, |
| | | .fa-file-archive-o:before { |
| | | content: '\f1c6'; |
| | | } |
| | | .fa-file-sound-o:before, |
| | | .fa-file-audio-o:before { |
| | | content: '\f1c7'; |
| | | } |
| | | .fa-file-movie-o:before, |
| | | .fa-file-video-o:before { |
| | | content: '\f1c8'; |
| | | } |
| | | .fa-file-code-o:before { |
| | | content: '\f1c9'; |
| | | } |
| | | .fa-vine:before { |
| | | content: '\f1ca'; |
| | | } |
| | | .fa-codepen:before { |
| | | content: '\f1cb'; |
| | | } |
| | | .fa-jsfiddle:before { |
| | | content: '\f1cc'; |
| | | } |
| | | .fa-life-bouy:before, |
| | | .fa-life-buoy:before, |
| | | .fa-life-saver:before, |
| | | .fa-support:before, |
| | | .fa-life-ring:before { |
| | | content: '\f1cd'; |
| | | } |
| | | .fa-circle-o-notch:before { |
| | | content: '\f1ce'; |
| | | } |
| | | .fa-ra:before, |
| | | .fa-resistance:before, |
| | | .fa-rebel:before { |
| | | content: '\f1d0'; |
| | | } |
| | | .fa-ge:before, |
| | | .fa-empire:before { |
| | | content: '\f1d1'; |
| | | } |
| | | .fa-git-square:before { |
| | | content: '\f1d2'; |
| | | } |
| | | .fa-git:before { |
| | | content: '\f1d3'; |
| | | } |
| | | .fa-y-combinator-square:before, |
| | | .fa-yc-square:before, |
| | | .fa-hacker-news:before { |
| | | content: '\f1d4'; |
| | | } |
| | | .fa-tencent-weibo:before { |
| | | content: '\f1d5'; |
| | | } |
| | | .fa-qq:before { |
| | | content: '\f1d6'; |
| | | } |
| | | .fa-wechat:before, |
| | | .fa-weixin:before { |
| | | content: '\f1d7'; |
| | | } |
| | | .fa-send:before, |
| | | .fa-paper-plane:before { |
| | | content: '\f1d8'; |
| | | } |
| | | .fa-send-o:before, |
| | | .fa-paper-plane-o:before { |
| | | content: '\f1d9'; |
| | | } |
| | | .fa-history:before { |
| | | content: '\f1da'; |
| | | } |
| | | .fa-circle-thin:before { |
| | | content: '\f1db'; |
| | | } |
| | | .fa-header:before { |
| | | content: '\f1dc'; |
| | | } |
| | | .fa-paragraph:before { |
| | | content: '\f1dd'; |
| | | } |
| | | .fa-sliders:before { |
| | | content: '\f1de'; |
| | | } |
| | | .fa-share-alt:before { |
| | | content: '\f1e0'; |
| | | } |
| | | .fa-share-alt-square:before { |
| | | content: '\f1e1'; |
| | | } |
| | | .fa-bomb:before { |
| | | content: '\f1e2'; |
| | | } |
| | | .fa-soccer-ball-o:before, |
| | | .fa-futbol-o:before { |
| | | content: '\f1e3'; |
| | | } |
| | | .fa-tty:before { |
| | | content: '\f1e4'; |
| | | } |
| | | .fa-binoculars:before { |
| | | content: '\f1e5'; |
| | | } |
| | | .fa-plug:before { |
| | | content: '\f1e6'; |
| | | } |
| | | .fa-slideshare:before { |
| | | content: '\f1e7'; |
| | | } |
| | | .fa-twitch:before { |
| | | content: '\f1e8'; |
| | | } |
| | | .fa-yelp:before { |
| | | content: '\f1e9'; |
| | | } |
| | | .fa-newspaper-o:before { |
| | | content: '\f1ea'; |
| | | } |
| | | .fa-wifi:before { |
| | | content: '\f1eb'; |
| | | } |
| | | .fa-calculator:before { |
| | | content: '\f1ec'; |
| | | } |
| | | .fa-paypal:before { |
| | | content: '\f1ed'; |
| | | } |
| | | .fa-google-wallet:before { |
| | | content: '\f1ee'; |
| | | } |
| | | .fa-cc-visa:before { |
| | | content: '\f1f0'; |
| | | } |
| | | .fa-cc-mastercard:before { |
| | | content: '\f1f1'; |
| | | } |
| | | .fa-cc-discover:before { |
| | | content: '\f1f2'; |
| | | } |
| | | .fa-cc-amex:before { |
| | | content: '\f1f3'; |
| | | } |
| | | .fa-cc-paypal:before { |
| | | content: '\f1f4'; |
| | | } |
| | | .fa-cc-stripe:before { |
| | | content: '\f1f5'; |
| | | } |
| | | .fa-bell-slash:before { |
| | | content: '\f1f6'; |
| | | } |
| | | .fa-bell-slash-o:before { |
| | | content: '\f1f7'; |
| | | } |
| | | .fa-trash:before { |
| | | content: '\f1f8'; |
| | | } |
| | | .fa-copyright:before { |
| | | content: '\f1f9'; |
| | | } |
| | | .fa-at:before { |
| | | content: '\f1fa'; |
| | | } |
| | | .fa-eyedropper:before { |
| | | content: '\f1fb'; |
| | | } |
| | | .fa-paint-brush:before { |
| | | content: '\f1fc'; |
| | | } |
| | | .fa-birthday-cake:before { |
| | | content: '\f1fd'; |
| | | } |
| | | .fa-area-chart:before { |
| | | content: '\f1fe'; |
| | | } |
| | | .fa-pie-chart:before { |
| | | content: '\f200'; |
| | | } |
| | | .fa-line-chart:before { |
| | | content: '\f201'; |
| | | } |
| | | .fa-lastfm:before { |
| | | content: '\f202'; |
| | | } |
| | | .fa-lastfm-square:before { |
| | | content: '\f203'; |
| | | } |
| | | .fa-toggle-off:before { |
| | | content: '\f204'; |
| | | } |
| | | .fa-toggle-on:before { |
| | | content: '\f205'; |
| | | } |
| | | .fa-bicycle:before { |
| | | content: '\f206'; |
| | | } |
| | | .fa-bus:before { |
| | | content: '\f207'; |
| | | } |
| | | .fa-ioxhost:before { |
| | | content: '\f208'; |
| | | } |
| | | .fa-angellist:before { |
| | | content: '\f209'; |
| | | } |
| | | .fa-cc:before { |
| | | content: '\f20a'; |
| | | } |
| | | .fa-shekel:before, |
| | | .fa-sheqel:before, |
| | | .fa-ils:before { |
| | | content: '\f20b'; |
| | | } |
| | | .fa-meanpath:before { |
| | | content: '\f20c'; |
| | | } |
| | | .fa-buysellads:before { |
| | | content: '\f20d'; |
| | | } |
| | | .fa-connectdevelop:before { |
| | | content: '\f20e'; |
| | | } |
| | | .fa-dashcube:before { |
| | | content: '\f210'; |
| | | } |
| | | .fa-forumbee:before { |
| | | content: '\f211'; |
| | | } |
| | | .fa-leanpub:before { |
| | | content: '\f212'; |
| | | } |
| | | .fa-sellsy:before { |
| | | content: '\f213'; |
| | | } |
| | | .fa-shirtsinbulk:before { |
| | | content: '\f214'; |
| | | } |
| | | .fa-simplybuilt:before { |
| | | content: '\f215'; |
| | | } |
| | | .fa-skyatlas:before { |
| | | content: '\f216'; |
| | | } |
| | | .fa-cart-plus:before { |
| | | content: '\f217'; |
| | | } |
| | | .fa-cart-arrow-down:before { |
| | | content: '\f218'; |
| | | } |
| | | .fa-diamond:before { |
| | | content: '\f219'; |
| | | } |
| | | .fa-ship:before { |
| | | content: '\f21a'; |
| | | } |
| | | .fa-user-secret:before { |
| | | content: '\f21b'; |
| | | } |
| | | .fa-motorcycle:before { |
| | | content: '\f21c'; |
| | | } |
| | | .fa-street-view:before { |
| | | content: '\f21d'; |
| | | } |
| | | .fa-heartbeat:before { |
| | | content: '\f21e'; |
| | | } |
| | | .fa-venus:before { |
| | | content: '\f221'; |
| | | } |
| | | .fa-mars:before { |
| | | content: '\f222'; |
| | | } |
| | | .fa-mercury:before { |
| | | content: '\f223'; |
| | | } |
| | | .fa-intersex:before, |
| | | .fa-transgender:before { |
| | | content: '\f224'; |
| | | } |
| | | .fa-transgender-alt:before { |
| | | content: '\f225'; |
| | | } |
| | | .fa-venus-double:before { |
| | | content: '\f226'; |
| | | } |
| | | .fa-mars-double:before { |
| | | content: '\f227'; |
| | | } |
| | | .fa-venus-mars:before { |
| | | content: '\f228'; |
| | | } |
| | | .fa-mars-stroke:before { |
| | | content: '\f229'; |
| | | } |
| | | .fa-mars-stroke-v:before { |
| | | content: '\f22a'; |
| | | } |
| | | .fa-mars-stroke-h:before { |
| | | content: '\f22b'; |
| | | } |
| | | .fa-neuter:before { |
| | | content: '\f22c'; |
| | | } |
| | | .fa-genderless:before { |
| | | content: '\f22d'; |
| | | } |
| | | .fa-facebook-official:before { |
| | | content: '\f230'; |
| | | } |
| | | .fa-pinterest-p:before { |
| | | content: '\f231'; |
| | | } |
| | | .fa-whatsapp:before { |
| | | content: '\f232'; |
| | | } |
| | | .fa-server:before { |
| | | content: '\f233'; |
| | | } |
| | | .fa-user-plus:before { |
| | | content: '\f234'; |
| | | } |
| | | .fa-user-times:before { |
| | | content: '\f235'; |
| | | } |
| | | .fa-hotel:before, |
| | | .fa-bed:before { |
| | | content: '\f236'; |
| | | } |
| | | .fa-viacoin:before { |
| | | content: '\f237'; |
| | | } |
| | | .fa-train:before { |
| | | content: '\f238'; |
| | | } |
| | | .fa-subway:before { |
| | | content: '\f239'; |
| | | } |
| | | .fa-medium:before { |
| | | content: '\f23a'; |
| | | } |
| | | .fa-yc:before, |
| | | .fa-y-combinator:before { |
| | | content: '\f23b'; |
| | | } |
| | | .fa-optin-monster:before { |
| | | content: '\f23c'; |
| | | } |
| | | .fa-opencart:before { |
| | | content: '\f23d'; |
| | | } |
| | | .fa-expeditedssl:before { |
| | | content: '\f23e'; |
| | | } |
| | | .fa-battery-4:before, |
| | | .fa-battery:before, |
| | | .fa-battery-full:before { |
| | | content: '\f240'; |
| | | } |
| | | .fa-battery-3:before, |
| | | .fa-battery-three-quarters:before { |
| | | content: '\f241'; |
| | | } |
| | | .fa-battery-2:before, |
| | | .fa-battery-half:before { |
| | | content: '\f242'; |
| | | } |
| | | .fa-battery-1:before, |
| | | .fa-battery-quarter:before { |
| | | content: '\f243'; |
| | | } |
| | | .fa-battery-0:before, |
| | | .fa-battery-empty:before { |
| | | content: '\f244'; |
| | | } |
| | | .fa-mouse-pointer:before { |
| | | content: '\f245'; |
| | | } |
| | | .fa-i-cursor:before { |
| | | content: '\f246'; |
| | | } |
| | | .fa-object-group:before { |
| | | content: '\f247'; |
| | | } |
| | | .fa-object-ungroup:before { |
| | | content: '\f248'; |
| | | } |
| | | .fa-sticky-note:before { |
| | | content: '\f249'; |
| | | } |
| | | .fa-sticky-note-o:before { |
| | | content: '\f24a'; |
| | | } |
| | | .fa-cc-jcb:before { |
| | | content: '\f24b'; |
| | | } |
| | | .fa-cc-diners-club:before { |
| | | content: '\f24c'; |
| | | } |
| | | .fa-clone:before { |
| | | content: '\f24d'; |
| | | } |
| | | .fa-balance-scale:before { |
| | | content: '\f24e'; |
| | | } |
| | | .fa-hourglass-o:before { |
| | | content: '\f250'; |
| | | } |
| | | .fa-hourglass-1:before, |
| | | .fa-hourglass-start:before { |
| | | content: '\f251'; |
| | | } |
| | | .fa-hourglass-2:before, |
| | | .fa-hourglass-half:before { |
| | | content: '\f252'; |
| | | } |
| | | .fa-hourglass-3:before, |
| | | .fa-hourglass-end:before { |
| | | content: '\f253'; |
| | | } |
| | | .fa-hourglass:before { |
| | | content: '\f254'; |
| | | } |
| | | .fa-hand-grab-o:before, |
| | | .fa-hand-rock-o:before { |
| | | content: '\f255'; |
| | | } |
| | | .fa-hand-stop-o:before, |
| | | .fa-hand-paper-o:before { |
| | | content: '\f256'; |
| | | } |
| | | .fa-hand-scissors-o:before { |
| | | content: '\f257'; |
| | | } |
| | | .fa-hand-lizard-o:before { |
| | | content: '\f258'; |
| | | } |
| | | .fa-hand-spock-o:before { |
| | | content: '\f259'; |
| | | } |
| | | .fa-hand-pointer-o:before { |
| | | content: '\f25a'; |
| | | } |
| | | .fa-hand-peace-o:before { |
| | | content: '\f25b'; |
| | | } |
| | | .fa-trademark:before { |
| | | content: '\f25c'; |
| | | } |
| | | .fa-registered:before { |
| | | content: '\f25d'; |
| | | } |
| | | .fa-creative-commons:before { |
| | | content: '\f25e'; |
| | | } |
| | | .fa-gg:before { |
| | | content: '\f260'; |
| | | } |
| | | .fa-gg-circle:before { |
| | | content: '\f261'; |
| | | } |
| | | .fa-tripadvisor:before { |
| | | content: '\f262'; |
| | | } |
| | | .fa-odnoklassniki:before { |
| | | content: '\f263'; |
| | | } |
| | | .fa-odnoklassniki-square:before { |
| | | content: '\f264'; |
| | | } |
| | | .fa-get-pocket:before { |
| | | content: '\f265'; |
| | | } |
| | | .fa-wikipedia-w:before { |
| | | content: '\f266'; |
| | | } |
| | | .fa-safari:before { |
| | | content: '\f267'; |
| | | } |
| | | .fa-chrome:before { |
| | | content: '\f268'; |
| | | } |
| | | .fa-firefox:before { |
| | | content: '\f269'; |
| | | } |
| | | .fa-opera:before { |
| | | content: '\f26a'; |
| | | } |
| | | .fa-internet-explorer:before { |
| | | content: '\f26b'; |
| | | } |
| | | .fa-tv:before, |
| | | .fa-television:before { |
| | | content: '\f26c'; |
| | | } |
| | | .fa-contao:before { |
| | | content: '\f26d'; |
| | | } |
| | | .fa-500px:before { |
| | | content: '\f26e'; |
| | | } |
| | | .fa-amazon:before { |
| | | content: '\f270'; |
| | | } |
| | | .fa-calendar-plus-o:before { |
| | | content: '\f271'; |
| | | } |
| | | .fa-calendar-minus-o:before { |
| | | content: '\f272'; |
| | | } |
| | | .fa-calendar-times-o:before { |
| | | content: '\f273'; |
| | | } |
| | | .fa-calendar-check-o:before { |
| | | content: '\f274'; |
| | | } |
| | | .fa-industry:before { |
| | | content: '\f275'; |
| | | } |
| | | .fa-map-pin:before { |
| | | content: '\f276'; |
| | | } |
| | | .fa-map-signs:before { |
| | | content: '\f277'; |
| | | } |
| | | .fa-map-o:before { |
| | | content: '\f278'; |
| | | } |
| | | .fa-map:before { |
| | | content: '\f279'; |
| | | } |
| | | .fa-commenting:before { |
| | | content: '\f27a'; |
| | | } |
| | | .fa-commenting-o:before { |
| | | content: '\f27b'; |
| | | } |
| | | .fa-houzz:before { |
| | | content: '\f27c'; |
| | | } |
| | | .fa-vimeo:before { |
| | | content: '\f27d'; |
| | | } |
| | | .fa-black-tie:before { |
| | | content: '\f27e'; |
| | | } |
| | | .fa-fonticons:before { |
| | | content: '\f280'; |
| | | } |
| | | .fa-reddit-alien:before { |
| | | content: '\f281'; |
| | | } |
| | | .fa-edge:before { |
| | | content: '\f282'; |
| | | } |
| | | .fa-credit-card-alt:before { |
| | | content: '\f283'; |
| | | } |
| | | .fa-codiepie:before { |
| | | content: '\f284'; |
| | | } |
| | | .fa-modx:before { |
| | | content: '\f285'; |
| | | } |
| | | .fa-fort-awesome:before { |
| | | content: '\f286'; |
| | | } |
| | | .fa-usb:before { |
| | | content: '\f287'; |
| | | } |
| | | .fa-product-hunt:before { |
| | | content: '\f288'; |
| | | } |
| | | .fa-mixcloud:before { |
| | | content: '\f289'; |
| | | } |
| | | .fa-scribd:before { |
| | | content: '\f28a'; |
| | | } |
| | | .fa-pause-circle:before { |
| | | content: '\f28b'; |
| | | } |
| | | .fa-pause-circle-o:before { |
| | | content: '\f28c'; |
| | | } |
| | | .fa-stop-circle:before { |
| | | content: '\f28d'; |
| | | } |
| | | .fa-stop-circle-o:before { |
| | | content: '\f28e'; |
| | | } |
| | | .fa-shopping-bag:before { |
| | | content: '\f290'; |
| | | } |
| | | .fa-shopping-basket:before { |
| | | content: '\f291'; |
| | | } |
| | | .fa-hashtag:before { |
| | | content: '\f292'; |
| | | } |
| | | .fa-bluetooth:before { |
| | | content: '\f293'; |
| | | } |
| | | .fa-bluetooth-b:before { |
| | | content: '\f294'; |
| | | } |
| | | .fa-percent:before { |
| | | content: '\f295'; |
| | | } |
| | | .fa-gitlab:before { |
| | | content: '\f296'; |
| | | } |
| | | .fa-wpbeginner:before { |
| | | content: '\f297'; |
| | | } |
| | | .fa-wpforms:before { |
| | | content: '\f298'; |
| | | } |
| | | .fa-envira:before { |
| | | content: '\f299'; |
| | | } |
| | | .fa-universal-access:before { |
| | | content: '\f29a'; |
| | | } |
| | | .fa-wheelchair-alt:before { |
| | | content: '\f29b'; |
| | | } |
| | | .fa-question-circle-o:before { |
| | | content: '\f29c'; |
| | | } |
| | | .fa-blind:before { |
| | | content: '\f29d'; |
| | | } |
| | | .fa-audio-description:before { |
| | | content: '\f29e'; |
| | | } |
| | | .fa-volume-control-phone:before { |
| | | content: '\f2a0'; |
| | | } |
| | | .fa-braille:before { |
| | | content: '\f2a1'; |
| | | } |
| | | .fa-assistive-listening-systems:before { |
| | | content: '\f2a2'; |
| | | } |
| | | .fa-asl-interpreting:before, |
| | | .fa-american-sign-language-interpreting:before { |
| | | content: '\f2a3'; |
| | | } |
| | | .fa-deafness:before, |
| | | .fa-hard-of-hearing:before, |
| | | .fa-deaf:before { |
| | | content: '\f2a4'; |
| | | } |
| | | .fa-glide:before { |
| | | content: '\f2a5'; |
| | | } |
| | | .fa-glide-g:before { |
| | | content: '\f2a6'; |
| | | } |
| | | .fa-signing:before, |
| | | .fa-sign-language:before { |
| | | content: '\f2a7'; |
| | | } |
| | | .fa-low-vision:before { |
| | | content: '\f2a8'; |
| | | } |
| | | .fa-viadeo:before { |
| | | content: '\f2a9'; |
| | | } |
| | | .fa-viadeo-square:before { |
| | | content: '\f2aa'; |
| | | } |
| | | .fa-snapchat:before { |
| | | content: '\f2ab'; |
| | | } |
| | | .fa-snapchat-ghost:before { |
| | | content: '\f2ac'; |
| | | } |
| | | .fa-snapchat-square:before { |
| | | content: '\f2ad'; |
| | | } |
| | | .fa-pied-piper:before { |
| | | content: '\f2ae'; |
| | | } |
| | | .fa-first-order:before { |
| | | content: '\f2b0'; |
| | | } |
| | | .fa-yoast:before { |
| | | content: '\f2b1'; |
| | | } |
| | | .fa-themeisle:before { |
| | | content: '\f2b2'; |
| | | } |
| | | .fa-google-plus-circle:before, |
| | | .fa-google-plus-official:before { |
| | | content: '\f2b3'; |
| | | } |
| | | .fa-fa:before, |
| | | .fa-font-awesome:before { |
| | | content: '\f2b4'; |
| | | } |
| | | .fa-handshake-o:before { |
| | | content: '\f2b5'; |
| | | } |
| | | .fa-envelope-open:before { |
| | | content: '\f2b6'; |
| | | } |
| | | .fa-envelope-open-o:before { |
| | | content: '\f2b7'; |
| | | } |
| | | .fa-linode:before { |
| | | content: '\f2b8'; |
| | | } |
| | | .fa-address-book:before { |
| | | content: '\f2b9'; |
| | | } |
| | | .fa-address-book-o:before { |
| | | content: '\f2ba'; |
| | | } |
| | | .fa-vcard:before, |
| | | .fa-address-card:before { |
| | | content: '\f2bb'; |
| | | } |
| | | .fa-vcard-o:before, |
| | | .fa-address-card-o:before { |
| | | content: '\f2bc'; |
| | | } |
| | | .fa-user-circle:before { |
| | | content: '\f2bd'; |
| | | } |
| | | .fa-user-circle-o:before { |
| | | content: '\f2be'; |
| | | } |
| | | .fa-user-o:before { |
| | | content: '\f2c0'; |
| | | } |
| | | .fa-id-badge:before { |
| | | content: '\f2c1'; |
| | | } |
| | | .fa-drivers-license:before, |
| | | .fa-id-card:before { |
| | | content: '\f2c2'; |
| | | } |
| | | .fa-drivers-license-o:before, |
| | | .fa-id-card-o:before { |
| | | content: '\f2c3'; |
| | | } |
| | | .fa-quora:before { |
| | | content: '\f2c4'; |
| | | } |
| | | .fa-free-code-camp:before { |
| | | content: '\f2c5'; |
| | | } |
| | | .fa-telegram:before { |
| | | content: '\f2c6'; |
| | | } |
| | | .fa-thermometer-4:before, |
| | | .fa-thermometer:before, |
| | | .fa-thermometer-full:before { |
| | | content: '\f2c7'; |
| | | } |
| | | .fa-thermometer-3:before, |
| | | .fa-thermometer-three-quarters:before { |
| | | content: '\f2c8'; |
| | | } |
| | | .fa-thermometer-2:before, |
| | | .fa-thermometer-half:before { |
| | | content: '\f2c9'; |
| | | } |
| | | .fa-thermometer-1:before, |
| | | .fa-thermometer-quarter:before { |
| | | content: '\f2ca'; |
| | | } |
| | | .fa-thermometer-0:before, |
| | | .fa-thermometer-empty:before { |
| | | content: '\f2cb'; |
| | | } |
| | | .fa-shower:before { |
| | | content: '\f2cc'; |
| | | } |
| | | .fa-bathtub:before, |
| | | .fa-s15:before, |
| | | .fa-bath:before { |
| | | content: '\f2cd'; |
| | | } |
| | | .fa-podcast:before { |
| | | content: '\f2ce'; |
| | | } |
| | | .fa-window-maximize:before { |
| | | content: '\f2d0'; |
| | | } |
| | | .fa-window-minimize:before { |
| | | content: '\f2d1'; |
| | | } |
| | | .fa-window-restore:before { |
| | | content: '\f2d2'; |
| | | } |
| | | .fa-times-rectangle:before, |
| | | .fa-window-close:before { |
| | | content: '\f2d3'; |
| | | } |
| | | .fa-times-rectangle-o:before, |
| | | .fa-window-close-o:before { |
| | | content: '\f2d4'; |
| | | } |
| | | .fa-bandcamp:before { |
| | | content: '\f2d5'; |
| | | } |
| | | .fa-grav:before { |
| | | content: '\f2d6'; |
| | | } |
| | | .fa-etsy:before { |
| | | content: '\f2d7'; |
| | | } |
| | | .fa-imdb:before { |
| | | content: '\f2d8'; |
| | | } |
| | | .fa-ravelry:before { |
| | | content: '\f2d9'; |
| | | } |
| | | .fa-eercast:before { |
| | | content: '\f2da'; |
| | | } |
| | | .fa-microchip:before { |
| | | content: '\f2db'; |
| | | } |
| | | .fa-snowflake-o:before { |
| | | content: '\f2dc'; |
| | | } |
| | | .fa-superpowers:before { |
| | | content: '\f2dd'; |
| | | } |
| | | .fa-wpexplorer:before { |
| | | content: '\f2de'; |
| | | } |
| | | .fa-meetup:before { |
| | | content: '\f2e0'; |
| | | } |
| | | .sr-only { |
| | | position: absolute; |
| | | width: 1px; |
| | | height: 1px; |
| | | padding: 0; |
| | | margin: -1px; |
| | | overflow: hidden; |
| | | clip: rect(0, 0, 0, 0); |
| | | border: 0; |
| | | } |
| | | .sr-only-focusable:active, |
| | | .sr-only-focusable:focus { |
| | | position: static; |
| | | width: auto; |
| | | height: auto; |
| | | margin: 0; |
| | | overflow: visible; |
| | | clip: auto; |
| | | } |
New file |
| | |
| | | /*! jQuery UI - v1.12.1 - 2016-09-14 |
| | | * http://jqueryui.com |
| | | * Includes: core.css, accordion.css, autocomplete.css, menu.css, button.css, controlgroup.css, checkboxradio.css, datepicker.css, dialog.css, draggable.css, resizable.css, progressbar.css, selectable.css, selectmenu.css, slider.css, sortable.css, spinner.css, tabs.css, tooltip.css, theme.css |
| | | * To view and modify this theme, visit http://jqueryui.com/themeroller/?ffDefault=Arial%2CHelvetica%2Csans-serif&fsDefault=1em&fwDefault=normal&cornerRadius=3px&bgColorHeader=e9e9e9&bgTextureHeader=flat&borderColorHeader=dddddd&fcHeader=333333&iconColorHeader=444444&bgColorContent=ffffff&bgTextureContent=flat&borderColorContent=dddddd&fcContent=333333&iconColorContent=444444&bgColorDefault=f6f6f6&bgTextureDefault=flat&borderColorDefault=c5c5c5&fcDefault=454545&iconColorDefault=777777&bgColorHover=ededed&bgTextureHover=flat&borderColorHover=cccccc&fcHover=2b2b2b&iconColorHover=555555&bgColorActive=007fff&bgTextureActive=flat&borderColorActive=003eff&fcActive=ffffff&iconColorActive=ffffff&bgColorHighlight=fffa90&bgTextureHighlight=flat&borderColorHighlight=dad55e&fcHighlight=777620&iconColorHighlight=777620&bgColorError=fddfdf&bgTextureError=flat&borderColorError=f1a899&fcError=5f3f3f&iconColorError=cc0000&bgColorOverlay=aaaaaa&bgTextureOverlay=flat&bgImgOpacityOverlay=0&opacityOverlay=30&bgColorShadow=666666&bgTextureShadow=flat&bgImgOpacityShadow=0&opacityShadow=30&thicknessShadow=5px&offsetTopShadow=0px&offsetLeftShadow=0px&cornerRadiusShadow=8px |
| | | * Copyright jQuery Foundation and other contributors; Licensed MIT */ |
| | | |
| | | /* Layout helpers |
| | | ----------------------------------*/ |
| | | .ui-helper-hidden { |
| | | display: none; |
| | | } |
| | | .ui-helper-hidden-accessible { |
| | | border: 0; |
| | | clip: rect(0 0 0 0); |
| | | height: 1px; |
| | | margin: -1px; |
| | | overflow: hidden; |
| | | padding: 0; |
| | | position: absolute; |
| | | width: 1px; |
| | | } |
| | | .ui-helper-reset { |
| | | margin: 0; |
| | | padding: 0; |
| | | border: 0; |
| | | outline: 0; |
| | | line-height: 1.3; |
| | | text-decoration: none; |
| | | font-size: 100%; |
| | | list-style: none; |
| | | } |
| | | .ui-helper-clearfix:before, |
| | | .ui-helper-clearfix:after { |
| | | content: ''; |
| | | display: table; |
| | | border-collapse: collapse; |
| | | } |
| | | .ui-helper-clearfix:after { |
| | | clear: both; |
| | | } |
| | | .ui-helper-zfix { |
| | | width: 100%; |
| | | height: 100%; |
| | | top: 0; |
| | | left: 0; |
| | | position: absolute; |
| | | opacity: 0; |
| | | filter: Alpha(Opacity=0); /* support: IE8 */ |
| | | } |
| | | |
| | | .ui-front { |
| | | z-index: 100; |
| | | } |
| | | |
| | | /* Interaction Cues |
| | | ----------------------------------*/ |
| | | .ui-state-disabled { |
| | | cursor: default !important; |
| | | pointer-events: none; |
| | | } |
| | | |
| | | /* Icons |
| | | ----------------------------------*/ |
| | | .ui-icon { |
| | | display: inline-block; |
| | | vertical-align: middle; |
| | | margin-top: -0.25em; |
| | | position: relative; |
| | | text-indent: -99999px; |
| | | overflow: hidden; |
| | | background-repeat: no-repeat; |
| | | } |
| | | |
| | | .ui-widget-icon-block { |
| | | left: 50%; |
| | | margin-left: -8px; |
| | | display: block; |
| | | } |
| | | |
| | | /* Misc visuals |
| | | ----------------------------------*/ |
| | | |
| | | /* Overlays */ |
| | | .ui-widget-overlay { |
| | | position: fixed; |
| | | top: 0; |
| | | left: 0; |
| | | width: 100%; |
| | | height: 100%; |
| | | } |
| | | .ui-accordion .ui-accordion-header { |
| | | display: block; |
| | | cursor: pointer; |
| | | position: relative; |
| | | margin: 2px 0 0 0; |
| | | padding: 0.5em 0.5em 0.5em 0.7em; |
| | | font-size: 100%; |
| | | } |
| | | .ui-accordion .ui-accordion-content { |
| | | padding: 1em 2.2em; |
| | | border-top: 0; |
| | | overflow: auto; |
| | | } |
| | | .ui-autocomplete { |
| | | position: absolute; |
| | | top: 0; |
| | | left: 0; |
| | | cursor: default; |
| | | } |
| | | .ui-menu { |
| | | list-style: none; |
| | | padding: 0; |
| | | margin: 0; |
| | | display: block; |
| | | outline: 0; |
| | | } |
| | | .ui-menu .ui-menu { |
| | | position: absolute; |
| | | } |
| | | .ui-menu .ui-menu-item { |
| | | margin: 0; |
| | | cursor: pointer; |
| | | /* support: IE10, see #8844 */ |
| | | list-style-image: url('data:image/gif;base64,R0lGODlhAQABAIAAAAAAAP///yH5BAEAAAAALAAAAAABAAEAAAIBRAA7'); |
| | | } |
| | | .ui-menu .ui-menu-item-wrapper { |
| | | position: relative; |
| | | padding: 3px 1em 3px 0.4em; |
| | | } |
| | | .ui-menu .ui-menu-divider { |
| | | margin: 5px 0; |
| | | height: 0; |
| | | font-size: 0; |
| | | line-height: 0; |
| | | border-width: 1px 0 0 0; |
| | | } |
| | | .ui-menu .ui-state-focus, |
| | | .ui-menu .ui-state-active { |
| | | margin: -1px; |
| | | } |
| | | |
| | | /* icon support */ |
| | | .ui-menu-icons { |
| | | position: relative; |
| | | } |
| | | .ui-menu-icons .ui-menu-item-wrapper { |
| | | padding-left: 2em; |
| | | } |
| | | |
| | | /* left-aligned */ |
| | | .ui-menu .ui-icon { |
| | | position: absolute; |
| | | top: 0; |
| | | bottom: 0; |
| | | left: 0.2em; |
| | | margin: auto 0; |
| | | } |
| | | |
| | | /* right-aligned */ |
| | | .ui-menu .ui-menu-icon { |
| | | left: auto; |
| | | right: 0; |
| | | } |
| | | .ui-button { |
| | | padding: 0.4em 1em; |
| | | display: inline-block; |
| | | position: relative; |
| | | line-height: normal; |
| | | margin-right: 0.1em; |
| | | cursor: pointer; |
| | | vertical-align: middle; |
| | | text-align: center; |
| | | -webkit-user-select: none; |
| | | -moz-user-select: none; |
| | | -ms-user-select: none; |
| | | user-select: none; |
| | | |
| | | /* Support: IE <= 11 */ |
| | | overflow: visible; |
| | | } |
| | | |
| | | .ui-button, |
| | | .ui-button:link, |
| | | .ui-button:visited, |
| | | .ui-button:hover, |
| | | .ui-button:active { |
| | | text-decoration: none; |
| | | } |
| | | |
| | | /* to make room for the icon, a width needs to be set here */ |
| | | .ui-button-icon-only { |
| | | width: 2em; |
| | | box-sizing: border-box; |
| | | text-indent: -9999px; |
| | | white-space: nowrap; |
| | | } |
| | | |
| | | /* no icon support for input elements */ |
| | | input.ui-button.ui-button-icon-only { |
| | | text-indent: 0; |
| | | } |
| | | |
| | | /* button icon element(s) */ |
| | | .ui-button-icon-only .ui-icon { |
| | | position: absolute; |
| | | top: 50%; |
| | | left: 50%; |
| | | margin-top: -8px; |
| | | margin-left: -8px; |
| | | } |
| | | |
| | | .ui-button.ui-icon-notext .ui-icon { |
| | | padding: 0; |
| | | width: 2.1em; |
| | | height: 2.1em; |
| | | text-indent: -9999px; |
| | | white-space: nowrap; |
| | | } |
| | | |
| | | input.ui-button.ui-icon-notext .ui-icon { |
| | | width: auto; |
| | | height: auto; |
| | | text-indent: 0; |
| | | white-space: normal; |
| | | padding: 0.4em 1em; |
| | | } |
| | | |
| | | /* workarounds */ |
| | | /* Support: Firefox 5 - 40 */ |
| | | input.ui-button::-moz-focus-inner, |
| | | button.ui-button::-moz-focus-inner { |
| | | border: 0; |
| | | padding: 0; |
| | | } |
| | | .ui-controlgroup { |
| | | vertical-align: middle; |
| | | display: inline-block; |
| | | } |
| | | .ui-controlgroup > .ui-controlgroup-item { |
| | | float: left; |
| | | margin-left: 0; |
| | | margin-right: 0; |
| | | } |
| | | .ui-controlgroup > .ui-controlgroup-item:focus, |
| | | .ui-controlgroup > .ui-controlgroup-item.ui-visual-focus { |
| | | z-index: 9999; |
| | | } |
| | | .ui-controlgroup-vertical > .ui-controlgroup-item { |
| | | display: block; |
| | | float: none; |
| | | width: 100%; |
| | | margin-top: 0; |
| | | margin-bottom: 0; |
| | | text-align: left; |
| | | } |
| | | .ui-controlgroup-vertical .ui-controlgroup-item { |
| | | box-sizing: border-box; |
| | | } |
| | | .ui-controlgroup .ui-controlgroup-label { |
| | | padding: 0.4em 1em; |
| | | } |
| | | .ui-controlgroup .ui-controlgroup-label span { |
| | | font-size: 80%; |
| | | } |
| | | .ui-controlgroup-horizontal .ui-controlgroup-label + .ui-controlgroup-item { |
| | | border-left: none; |
| | | } |
| | | .ui-controlgroup-vertical .ui-controlgroup-label + .ui-controlgroup-item { |
| | | border-top: none; |
| | | } |
| | | .ui-controlgroup-horizontal .ui-controlgroup-label.ui-widget-content { |
| | | border-right: none; |
| | | } |
| | | .ui-controlgroup-vertical .ui-controlgroup-label.ui-widget-content { |
| | | border-bottom: none; |
| | | } |
| | | |
| | | /* Spinner specific style fixes */ |
| | | .ui-controlgroup-vertical .ui-spinner-input { |
| | | /* Support: IE8 only, Android < 4.4 only */ |
| | | width: 75%; |
| | | width: calc(100% - 2.4em); |
| | | } |
| | | .ui-controlgroup-vertical .ui-spinner .ui-spinner-up { |
| | | border-top-style: solid; |
| | | } |
| | | |
| | | .ui-checkboxradio-label .ui-icon-background { |
| | | box-shadow: inset 1px 1px 1px #ccc; |
| | | border-radius: 0.12em; |
| | | border: none; |
| | | } |
| | | .ui-checkboxradio-radio-label .ui-icon-background { |
| | | width: 16px; |
| | | height: 16px; |
| | | border-radius: 1em; |
| | | overflow: visible; |
| | | border: none; |
| | | } |
| | | .ui-checkboxradio-radio-label.ui-checkboxradio-checked .ui-icon, |
| | | .ui-checkboxradio-radio-label.ui-checkboxradio-checked:hover .ui-icon { |
| | | background-image: none; |
| | | width: 8px; |
| | | height: 8px; |
| | | border-width: 4px; |
| | | border-style: solid; |
| | | } |
| | | .ui-checkboxradio-disabled { |
| | | pointer-events: none; |
| | | } |
| | | .ui-datepicker { |
| | | width: 17em; |
| | | padding: 0.2em 0.2em 0; |
| | | display: none; |
| | | } |
| | | .ui-datepicker .ui-datepicker-header { |
| | | position: relative; |
| | | padding: 0.2em 0; |
| | | } |
| | | .ui-datepicker .ui-datepicker-prev, |
| | | .ui-datepicker .ui-datepicker-next { |
| | | position: absolute; |
| | | top: 2px; |
| | | width: 1.8em; |
| | | height: 1.8em; |
| | | } |
| | | .ui-datepicker .ui-datepicker-prev-hover, |
| | | .ui-datepicker .ui-datepicker-next-hover { |
| | | top: 1px; |
| | | } |
| | | .ui-datepicker .ui-datepicker-prev { |
| | | left: 2px; |
| | | } |
| | | .ui-datepicker .ui-datepicker-next { |
| | | right: 2px; |
| | | } |
| | | .ui-datepicker .ui-datepicker-prev-hover { |
| | | left: 1px; |
| | | } |
| | | .ui-datepicker .ui-datepicker-next-hover { |
| | | right: 1px; |
| | | } |
| | | .ui-datepicker .ui-datepicker-prev span, |
| | | .ui-datepicker .ui-datepicker-next span { |
| | | display: block; |
| | | position: absolute; |
| | | left: 50%; |
| | | margin-left: -8px; |
| | | top: 50%; |
| | | margin-top: -8px; |
| | | } |
| | | .ui-datepicker .ui-datepicker-title { |
| | | margin: 0 2.3em; |
| | | line-height: 1.8em; |
| | | text-align: center; |
| | | } |
| | | .ui-datepicker .ui-datepicker-title select { |
| | | font-size: 1em; |
| | | margin: 1px 0; |
| | | } |
| | | .ui-datepicker select.ui-datepicker-month, |
| | | .ui-datepicker select.ui-datepicker-year { |
| | | width: 45%; |
| | | } |
| | | .ui-datepicker table { |
| | | width: 100%; |
| | | font-size: 0.9em; |
| | | border-collapse: collapse; |
| | | margin: 0 0 0.4em; |
| | | } |
| | | .ui-datepicker th { |
| | | padding: 0.7em 0.3em; |
| | | text-align: center; |
| | | font-weight: bold; |
| | | border: 0; |
| | | } |
| | | .ui-datepicker td { |
| | | border: 0; |
| | | padding: 1px; |
| | | } |
| | | .ui-datepicker td span, |
| | | .ui-datepicker td a { |
| | | display: block; |
| | | padding: 0.2em; |
| | | text-align: right; |
| | | text-decoration: none; |
| | | } |
| | | .ui-datepicker .ui-datepicker-buttonpane { |
| | | background-image: none; |
| | | margin: 0.7em 0 0 0; |
| | | padding: 0 0.2em; |
| | | border-left: 0; |
| | | border-right: 0; |
| | | border-bottom: 0; |
| | | } |
| | | .ui-datepicker .ui-datepicker-buttonpane button { |
| | | float: right; |
| | | margin: 0.5em 0.2em 0.4em; |
| | | cursor: pointer; |
| | | padding: 0.2em 0.6em 0.3em 0.6em; |
| | | width: auto; |
| | | overflow: visible; |
| | | } |
| | | .ui-datepicker .ui-datepicker-buttonpane button.ui-datepicker-current { |
| | | float: left; |
| | | } |
| | | |
| | | /* with multiple calendars */ |
| | | .ui-datepicker.ui-datepicker-multi { |
| | | width: auto; |
| | | } |
| | | .ui-datepicker-multi .ui-datepicker-group { |
| | | float: left; |
| | | } |
| | | .ui-datepicker-multi .ui-datepicker-group table { |
| | | width: 95%; |
| | | margin: 0 auto 0.4em; |
| | | } |
| | | .ui-datepicker-multi-2 .ui-datepicker-group { |
| | | width: 50%; |
| | | } |
| | | .ui-datepicker-multi-3 .ui-datepicker-group { |
| | | width: 33.3%; |
| | | } |
| | | .ui-datepicker-multi-4 .ui-datepicker-group { |
| | | width: 25%; |
| | | } |
| | | .ui-datepicker-multi .ui-datepicker-group-last .ui-datepicker-header, |
| | | .ui-datepicker-multi .ui-datepicker-group-middle .ui-datepicker-header { |
| | | border-left-width: 0; |
| | | } |
| | | .ui-datepicker-multi .ui-datepicker-buttonpane { |
| | | clear: left; |
| | | } |
| | | .ui-datepicker-row-break { |
| | | clear: both; |
| | | width: 100%; |
| | | font-size: 0; |
| | | } |
| | | |
| | | /* RTL support */ |
| | | .ui-datepicker-rtl { |
| | | direction: rtl; |
| | | } |
| | | .ui-datepicker-rtl .ui-datepicker-prev { |
| | | right: 2px; |
| | | left: auto; |
| | | } |
| | | .ui-datepicker-rtl .ui-datepicker-next { |
| | | left: 2px; |
| | | right: auto; |
| | | } |
| | | .ui-datepicker-rtl .ui-datepicker-prev:hover { |
| | | right: 1px; |
| | | left: auto; |
| | | } |
| | | .ui-datepicker-rtl .ui-datepicker-next:hover { |
| | | left: 1px; |
| | | right: auto; |
| | | } |
| | | .ui-datepicker-rtl .ui-datepicker-buttonpane { |
| | | clear: right; |
| | | } |
| | | .ui-datepicker-rtl .ui-datepicker-buttonpane button { |
| | | float: left; |
| | | } |
| | | .ui-datepicker-rtl .ui-datepicker-buttonpane button.ui-datepicker-current, |
| | | .ui-datepicker-rtl .ui-datepicker-group { |
| | | float: right; |
| | | } |
| | | .ui-datepicker-rtl .ui-datepicker-group-last .ui-datepicker-header, |
| | | .ui-datepicker-rtl .ui-datepicker-group-middle .ui-datepicker-header { |
| | | border-right-width: 0; |
| | | border-left-width: 1px; |
| | | } |
| | | |
| | | /* Icons */ |
| | | .ui-datepicker .ui-icon { |
| | | display: block; |
| | | text-indent: -99999px; |
| | | overflow: hidden; |
| | | background-repeat: no-repeat; |
| | | left: 0.5em; |
| | | top: 0.3em; |
| | | } |
| | | .ui-dialog { |
| | | position: absolute; |
| | | top: 0; |
| | | left: 0; |
| | | padding: 0.2em; |
| | | outline: 0; |
| | | } |
| | | .ui-dialog .ui-dialog-titlebar { |
| | | padding: 0.4em 1em; |
| | | position: relative; |
| | | } |
| | | .ui-dialog .ui-dialog-title { |
| | | float: left; |
| | | margin: 0.1em 0; |
| | | white-space: nowrap; |
| | | width: 90%; |
| | | overflow: hidden; |
| | | text-overflow: ellipsis; |
| | | } |
| | | .ui-dialog .ui-dialog-titlebar-close { |
| | | position: absolute; |
| | | right: 0.3em; |
| | | top: 50%; |
| | | width: 20px; |
| | | margin: -10px 0 0 0; |
| | | padding: 1px; |
| | | height: 20px; |
| | | } |
| | | .ui-dialog .ui-dialog-content { |
| | | position: relative; |
| | | border: 0; |
| | | padding: 0.5em 1em; |
| | | background: none; |
| | | overflow: auto; |
| | | } |
| | | .ui-dialog .ui-dialog-buttonpane { |
| | | text-align: left; |
| | | border-width: 1px 0 0 0; |
| | | background-image: none; |
| | | margin-top: 0.5em; |
| | | padding: 0.3em 1em 0.5em 0.4em; |
| | | } |
| | | .ui-dialog .ui-dialog-buttonpane .ui-dialog-buttonset { |
| | | float: right; |
| | | } |
| | | .ui-dialog .ui-dialog-buttonpane button { |
| | | margin: 0.5em 0.4em 0.5em 0; |
| | | cursor: pointer; |
| | | } |
| | | .ui-dialog .ui-resizable-n { |
| | | height: 2px; |
| | | top: 0; |
| | | } |
| | | .ui-dialog .ui-resizable-e { |
| | | width: 2px; |
| | | right: 0; |
| | | } |
| | | .ui-dialog .ui-resizable-s { |
| | | height: 2px; |
| | | bottom: 0; |
| | | } |
| | | .ui-dialog .ui-resizable-w { |
| | | width: 2px; |
| | | left: 0; |
| | | } |
| | | .ui-dialog .ui-resizable-se, |
| | | .ui-dialog .ui-resizable-sw, |
| | | .ui-dialog .ui-resizable-ne, |
| | | .ui-dialog .ui-resizable-nw { |
| | | width: 7px; |
| | | height: 7px; |
| | | } |
| | | .ui-dialog .ui-resizable-se { |
| | | right: 0; |
| | | bottom: 0; |
| | | } |
| | | .ui-dialog .ui-resizable-sw { |
| | | left: 0; |
| | | bottom: 0; |
| | | } |
| | | .ui-dialog .ui-resizable-ne { |
| | | right: 0; |
| | | top: 0; |
| | | } |
| | | .ui-dialog .ui-resizable-nw { |
| | | left: 0; |
| | | top: 0; |
| | | } |
| | | .ui-draggable .ui-dialog-titlebar { |
| | | cursor: move; |
| | | } |
| | | .ui-draggable-handle { |
| | | -ms-touch-action: none; |
| | | touch-action: none; |
| | | } |
| | | .ui-resizable { |
| | | position: relative; |
| | | } |
| | | .ui-resizable-handle { |
| | | position: absolute; |
| | | font-size: 0.1px; |
| | | display: block; |
| | | -ms-touch-action: none; |
| | | touch-action: none; |
| | | } |
| | | .ui-resizable-disabled .ui-resizable-handle, |
| | | .ui-resizable-autohide .ui-resizable-handle { |
| | | display: none; |
| | | } |
| | | .ui-resizable-n { |
| | | cursor: n-resize; |
| | | height: 7px; |
| | | width: 100%; |
| | | top: -5px; |
| | | left: 0; |
| | | } |
| | | .ui-resizable-s { |
| | | cursor: s-resize; |
| | | height: 7px; |
| | | width: 100%; |
| | | bottom: -5px; |
| | | left: 0; |
| | | } |
| | | .ui-resizable-e { |
| | | cursor: e-resize; |
| | | width: 7px; |
| | | right: -5px; |
| | | top: 0; |
| | | height: 100%; |
| | | } |
| | | .ui-resizable-w { |
| | | cursor: w-resize; |
| | | width: 7px; |
| | | left: -5px; |
| | | top: 0; |
| | | height: 100%; |
| | | } |
| | | .ui-resizable-se { |
| | | cursor: se-resize; |
| | | width: 12px; |
| | | height: 12px; |
| | | right: 1px; |
| | | bottom: 1px; |
| | | } |
| | | .ui-resizable-sw { |
| | | cursor: sw-resize; |
| | | width: 9px; |
| | | height: 9px; |
| | | left: -5px; |
| | | bottom: -5px; |
| | | } |
| | | .ui-resizable-nw { |
| | | cursor: nw-resize; |
| | | width: 9px; |
| | | height: 9px; |
| | | left: -5px; |
| | | top: -5px; |
| | | } |
| | | .ui-resizable-ne { |
| | | cursor: ne-resize; |
| | | width: 9px; |
| | | height: 9px; |
| | | right: -5px; |
| | | top: -5px; |
| | | } |
| | | .ui-progressbar { |
| | | height: 2em; |
| | | text-align: left; |
| | | overflow: hidden; |
| | | } |
| | | .ui-progressbar .ui-progressbar-value { |
| | | margin: -1px; |
| | | height: 100%; |
| | | } |
| | | .ui-progressbar .ui-progressbar-overlay { |
| | | background: url('data:image/gif;base64,R0lGODlhKAAoAIABAAAAAP///yH/C05FVFNDQVBFMi4wAwEAAAAh+QQJAQABACwAAAAAKAAoAAACkYwNqXrdC52DS06a7MFZI+4FHBCKoDeWKXqymPqGqxvJrXZbMx7Ttc+w9XgU2FB3lOyQRWET2IFGiU9m1frDVpxZZc6bfHwv4c1YXP6k1Vdy292Fb6UkuvFtXpvWSzA+HycXJHUXiGYIiMg2R6W459gnWGfHNdjIqDWVqemH2ekpObkpOlppWUqZiqr6edqqWQAAIfkECQEAAQAsAAAAACgAKAAAApSMgZnGfaqcg1E2uuzDmmHUBR8Qil95hiPKqWn3aqtLsS18y7G1SzNeowWBENtQd+T1JktP05nzPTdJZlR6vUxNWWjV+vUWhWNkWFwxl9VpZRedYcflIOLafaa28XdsH/ynlcc1uPVDZxQIR0K25+cICCmoqCe5mGhZOfeYSUh5yJcJyrkZWWpaR8doJ2o4NYq62lAAACH5BAkBAAEALAAAAAAoACgAAAKVDI4Yy22ZnINRNqosw0Bv7i1gyHUkFj7oSaWlu3ovC8GxNso5fluz3qLVhBVeT/Lz7ZTHyxL5dDalQWPVOsQWtRnuwXaFTj9jVVh8pma9JjZ4zYSj5ZOyma7uuolffh+IR5aW97cHuBUXKGKXlKjn+DiHWMcYJah4N0lYCMlJOXipGRr5qdgoSTrqWSq6WFl2ypoaUAAAIfkECQEAAQAsAAAAACgAKAAAApaEb6HLgd/iO7FNWtcFWe+ufODGjRfoiJ2akShbueb0wtI50zm02pbvwfWEMWBQ1zKGlLIhskiEPm9R6vRXxV4ZzWT2yHOGpWMyorblKlNp8HmHEb/lCXjcW7bmtXP8Xt229OVWR1fod2eWqNfHuMjXCPkIGNileOiImVmCOEmoSfn3yXlJWmoHGhqp6ilYuWYpmTqKUgAAIfkECQEAAQAsAAAAACgAKAAAApiEH6kb58biQ3FNWtMFWW3eNVcojuFGfqnZqSebuS06w5V80/X02pKe8zFwP6EFWOT1lDFk8rGERh1TTNOocQ61Hm4Xm2VexUHpzjymViHrFbiELsefVrn6XKfnt2Q9G/+Xdie499XHd2g4h7ioOGhXGJboGAnXSBnoBwKYyfioubZJ2Hn0RuRZaflZOil56Zp6iioKSXpUAAAh+QQJAQABACwAAAAAKAAoAAACkoQRqRvnxuI7kU1a1UU5bd5tnSeOZXhmn5lWK3qNTWvRdQxP8qvaC+/yaYQzXO7BMvaUEmJRd3TsiMAgswmNYrSgZdYrTX6tSHGZO73ezuAw2uxuQ+BbeZfMxsexY35+/Qe4J1inV0g4x3WHuMhIl2jXOKT2Q+VU5fgoSUI52VfZyfkJGkha6jmY+aaYdirq+lQAACH5BAkBAAEALAAAAAAoACgAAAKWBIKpYe0L3YNKToqswUlvznigd4wiR4KhZrKt9Upqip61i9E3vMvxRdHlbEFiEXfk9YARYxOZZD6VQ2pUunBmtRXo1Lf8hMVVcNl8JafV38aM2/Fu5V16Bn63r6xt97j09+MXSFi4BniGFae3hzbH9+hYBzkpuUh5aZmHuanZOZgIuvbGiNeomCnaxxap2upaCZsq+1kAACH5BAkBAAEALAAAAAAoACgAAAKXjI8By5zf4kOxTVrXNVlv1X0d8IGZGKLnNpYtm8Lr9cqVeuOSvfOW79D9aDHizNhDJidFZhNydEahOaDH6nomtJjp1tutKoNWkvA6JqfRVLHU/QUfau9l2x7G54d1fl995xcIGAdXqMfBNadoYrhH+Mg2KBlpVpbluCiXmMnZ2Sh4GBqJ+ckIOqqJ6LmKSllZmsoq6wpQAAAh+QQJAQABACwAAAAAKAAoAAAClYx/oLvoxuJDkU1a1YUZbJ59nSd2ZXhWqbRa2/gF8Gu2DY3iqs7yrq+xBYEkYvFSM8aSSObE+ZgRl1BHFZNr7pRCavZ5BW2142hY3AN/zWtsmf12p9XxxFl2lpLn1rseztfXZjdIWIf2s5dItwjYKBgo9yg5pHgzJXTEeGlZuenpyPmpGQoKOWkYmSpaSnqKileI2FAAACH5BAkBAAEALAAAAAAoACgAAAKVjB+gu+jG4kORTVrVhRlsnn2dJ3ZleFaptFrb+CXmO9OozeL5VfP99HvAWhpiUdcwkpBH3825AwYdU8xTqlLGhtCosArKMpvfa1mMRae9VvWZfeB2XfPkeLmm18lUcBj+p5dnN8jXZ3YIGEhYuOUn45aoCDkp16hl5IjYJvjWKcnoGQpqyPlpOhr3aElaqrq56Bq7VAAAOw=='); |
| | | height: 100%; |
| | | filter: alpha(opacity=25); /* support: IE8 */ |
| | | opacity: 0.25; |
| | | } |
| | | .ui-progressbar-indeterminate .ui-progressbar-value { |
| | | background-image: none; |
| | | } |
| | | .ui-selectable { |
| | | -ms-touch-action: none; |
| | | touch-action: none; |
| | | } |
| | | .ui-selectable-helper { |
| | | position: absolute; |
| | | z-index: 100; |
| | | border: 1px dotted black; |
| | | } |
| | | .ui-selectmenu-menu { |
| | | padding: 0; |
| | | margin: 0; |
| | | position: absolute; |
| | | top: 0; |
| | | left: 0; |
| | | display: none; |
| | | } |
| | | .ui-selectmenu-menu .ui-menu { |
| | | overflow: auto; |
| | | overflow-x: hidden; |
| | | padding-bottom: 1px; |
| | | } |
| | | .ui-selectmenu-menu .ui-menu .ui-selectmenu-optgroup { |
| | | font-size: 1em; |
| | | font-weight: bold; |
| | | line-height: 1.5; |
| | | padding: 2px 0.4em; |
| | | margin: 0.5em 0 0 0; |
| | | height: auto; |
| | | border: 0; |
| | | } |
| | | .ui-selectmenu-open { |
| | | display: block; |
| | | } |
| | | .ui-selectmenu-text { |
| | | display: block; |
| | | margin-right: 20px; |
| | | overflow: hidden; |
| | | text-overflow: ellipsis; |
| | | } |
| | | .ui-selectmenu-button.ui-button { |
| | | text-align: left; |
| | | white-space: nowrap; |
| | | width: 14em; |
| | | } |
| | | .ui-selectmenu-icon.ui-icon { |
| | | float: right; |
| | | margin-top: 0; |
| | | } |
| | | .ui-slider { |
| | | position: relative; |
| | | text-align: left; |
| | | } |
| | | .ui-slider .ui-slider-handle { |
| | | position: absolute; |
| | | z-index: 2; |
| | | width: 1.2em; |
| | | height: 1.2em; |
| | | cursor: default; |
| | | -ms-touch-action: none; |
| | | touch-action: none; |
| | | } |
| | | .ui-slider .ui-slider-range { |
| | | position: absolute; |
| | | z-index: 1; |
| | | font-size: 0.7em; |
| | | display: block; |
| | | border: 0; |
| | | background-position: 0 0; |
| | | } |
| | | |
| | | /* support: IE8 - See #6727 */ |
| | | .ui-slider.ui-state-disabled .ui-slider-handle, |
| | | .ui-slider.ui-state-disabled .ui-slider-range { |
| | | filter: inherit; |
| | | } |
| | | |
| | | .ui-slider-horizontal { |
| | | height: 0.8em; |
| | | } |
| | | .ui-slider-horizontal .ui-slider-handle { |
| | | top: -0.3em; |
| | | margin-left: -0.6em; |
| | | } |
| | | .ui-slider-horizontal .ui-slider-range { |
| | | top: 0; |
| | | height: 100%; |
| | | } |
| | | .ui-slider-horizontal .ui-slider-range-min { |
| | | left: 0; |
| | | } |
| | | .ui-slider-horizontal .ui-slider-range-max { |
| | | right: 0; |
| | | } |
| | | |
| | | .ui-slider-vertical { |
| | | width: 0.8em; |
| | | height: 100px; |
| | | } |
| | | .ui-slider-vertical .ui-slider-handle { |
| | | left: -0.3em; |
| | | margin-left: 0; |
| | | margin-bottom: -0.6em; |
| | | } |
| | | .ui-slider-vertical .ui-slider-range { |
| | | left: 0; |
| | | width: 100%; |
| | | } |
| | | .ui-slider-vertical .ui-slider-range-min { |
| | | bottom: 0; |
| | | } |
| | | .ui-slider-vertical .ui-slider-range-max { |
| | | top: 0; |
| | | } |
| | | .ui-sortable-handle { |
| | | -ms-touch-action: none; |
| | | touch-action: none; |
| | | } |
| | | .ui-spinner { |
| | | position: relative; |
| | | display: inline-block; |
| | | overflow: hidden; |
| | | padding: 0; |
| | | vertical-align: middle; |
| | | } |
| | | .ui-spinner-input { |
| | | border: none; |
| | | background: none; |
| | | color: inherit; |
| | | padding: 0.222em 0; |
| | | margin: 0.2em 0; |
| | | vertical-align: middle; |
| | | margin-left: 0.4em; |
| | | margin-right: 2em; |
| | | } |
| | | .ui-spinner-button { |
| | | width: 1.6em; |
| | | height: 50%; |
| | | font-size: 0.5em; |
| | | padding: 0; |
| | | margin: 0; |
| | | text-align: center; |
| | | position: absolute; |
| | | cursor: default; |
| | | display: block; |
| | | overflow: hidden; |
| | | right: 0; |
| | | } |
| | | /* more specificity required here to override default borders */ |
| | | .ui-spinner a.ui-spinner-button { |
| | | border-top-style: none; |
| | | border-bottom-style: none; |
| | | border-right-style: none; |
| | | } |
| | | .ui-spinner-up { |
| | | top: 0; |
| | | } |
| | | .ui-spinner-down { |
| | | bottom: 0; |
| | | } |
| | | .ui-tabs { |
| | | position: relative; /* position: relative prevents IE scroll bug (element with position: relative inside container with overflow: auto appear as "fixed") */ |
| | | padding: 0.2em; |
| | | } |
| | | .ui-tabs .ui-tabs-nav { |
| | | margin: 0; |
| | | padding: 0.2em 0.2em 0; |
| | | } |
| | | .ui-tabs .ui-tabs-nav li { |
| | | list-style: none; |
| | | float: left; |
| | | position: relative; |
| | | top: 0; |
| | | margin: 1px 0.2em 0 0; |
| | | border-bottom-width: 0; |
| | | padding: 0; |
| | | white-space: nowrap; |
| | | } |
| | | .ui-tabs .ui-tabs-nav .ui-tabs-anchor { |
| | | float: left; |
| | | padding: 0.5em 1em; |
| | | text-decoration: none; |
| | | } |
| | | .ui-tabs .ui-tabs-nav li.ui-tabs-active { |
| | | margin-bottom: -1px; |
| | | padding-bottom: 1px; |
| | | } |
| | | .ui-tabs .ui-tabs-nav li.ui-tabs-active .ui-tabs-anchor, |
| | | .ui-tabs .ui-tabs-nav li.ui-state-disabled .ui-tabs-anchor, |
| | | .ui-tabs .ui-tabs-nav li.ui-tabs-loading .ui-tabs-anchor { |
| | | cursor: text; |
| | | } |
| | | .ui-tabs-collapsible .ui-tabs-nav li.ui-tabs-active .ui-tabs-anchor { |
| | | cursor: pointer; |
| | | } |
| | | .ui-tabs .ui-tabs-panel { |
| | | display: block; |
| | | border-width: 0; |
| | | padding: 1em 1.4em; |
| | | background: none; |
| | | } |
| | | .ui-tooltip { |
| | | padding: 8px; |
| | | position: absolute; |
| | | z-index: 9999; |
| | | max-width: 300px; |
| | | } |
| | | body .ui-tooltip { |
| | | border-width: 2px; |
| | | } |
| | | /* Component containers |
| | | ----------------------------------*/ |
| | | .ui-widget { |
| | | font-family: Arial, Helvetica, sans-serif; |
| | | font-size: 1em; |
| | | } |
| | | .ui-widget .ui-widget { |
| | | font-size: 1em; |
| | | } |
| | | .ui-widget input, |
| | | .ui-widget select, |
| | | .ui-widget textarea, |
| | | .ui-widget button { |
| | | font-family: Arial, Helvetica, sans-serif; |
| | | font-size: 1em; |
| | | } |
| | | .ui-widget.ui-widget-content { |
| | | border: 1px solid #c5c5c5; |
| | | } |
| | | .ui-widget-content { |
| | | border: 1px solid #dddddd; |
| | | background: #ffffff; |
| | | color: #333333; |
| | | } |
| | | .ui-widget-content a { |
| | | color: #333333; |
| | | } |
| | | .ui-widget-header { |
| | | border: 1px solid #dddddd; |
| | | background: #e9e9e9; |
| | | color: #333333; |
| | | font-weight: bold; |
| | | } |
| | | .ui-widget-header a { |
| | | color: #333333; |
| | | } |
| | | |
| | | /* Interaction states |
| | | ----------------------------------*/ |
| | | .ui-state-default, |
| | | .ui-widget-content .ui-state-default, |
| | | .ui-widget-header .ui-state-default, |
| | | .ui-button, |
| | | |
| | | /* We use html here because we need a greater specificity to make sure disabled |
| | | works properly when clicked or hovered */ |
| | | html .ui-button.ui-state-disabled:hover, |
| | | html .ui-button.ui-state-disabled:active { |
| | | border: 1px solid #c5c5c5; |
| | | background: #f6f6f6; |
| | | font-weight: normal; |
| | | color: #454545; |
| | | } |
| | | .ui-state-default a, |
| | | .ui-state-default a:link, |
| | | .ui-state-default a:visited, |
| | | a.ui-button, |
| | | a:link.ui-button, |
| | | a:visited.ui-button, |
| | | .ui-button { |
| | | color: #454545; |
| | | text-decoration: none; |
| | | } |
| | | .ui-state-hover, |
| | | .ui-widget-content .ui-state-hover, |
| | | .ui-widget-header .ui-state-hover, |
| | | .ui-state-focus, |
| | | .ui-widget-content .ui-state-focus, |
| | | .ui-widget-header .ui-state-focus, |
| | | .ui-button:hover, |
| | | .ui-button:focus { |
| | | border: 1px solid #cccccc; |
| | | background: #ededed; |
| | | font-weight: normal; |
| | | color: #2b2b2b; |
| | | } |
| | | .ui-state-hover a, |
| | | .ui-state-hover a:hover, |
| | | .ui-state-hover a:link, |
| | | .ui-state-hover a:visited, |
| | | .ui-state-focus a, |
| | | .ui-state-focus a:hover, |
| | | .ui-state-focus a:link, |
| | | .ui-state-focus a:visited, |
| | | a.ui-button:hover, |
| | | a.ui-button:focus { |
| | | color: #2b2b2b; |
| | | text-decoration: none; |
| | | } |
| | | |
| | | .ui-visual-focus { |
| | | box-shadow: 0 0 3px 1px rgb(94, 158, 214); |
| | | } |
| | | .ui-state-active, |
| | | .ui-widget-content .ui-state-active, |
| | | .ui-widget-header .ui-state-active, |
| | | a.ui-button:active, |
| | | .ui-button:active, |
| | | .ui-button.ui-state-active:hover { |
| | | border: 1px solid #003eff; |
| | | background: #007fff; |
| | | font-weight: normal; |
| | | color: #ffffff; |
| | | } |
| | | .ui-icon-background, |
| | | .ui-state-active .ui-icon-background { |
| | | border: #003eff; |
| | | background-color: #ffffff; |
| | | } |
| | | .ui-state-active a, |
| | | .ui-state-active a:link, |
| | | .ui-state-active a:visited { |
| | | color: #ffffff; |
| | | text-decoration: none; |
| | | } |
| | | |
| | | /* Interaction Cues |
| | | ----------------------------------*/ |
| | | .ui-state-highlight, |
| | | .ui-widget-content .ui-state-highlight, |
| | | .ui-widget-header .ui-state-highlight { |
| | | border: 1px solid #dad55e; |
| | | background: #fffa90; |
| | | color: #777620; |
| | | } |
| | | .ui-state-checked { |
| | | border: 1px solid #dad55e; |
| | | background: #fffa90; |
| | | } |
| | | .ui-state-highlight a, |
| | | .ui-widget-content .ui-state-highlight a, |
| | | .ui-widget-header .ui-state-highlight a { |
| | | color: #777620; |
| | | } |
| | | .ui-state-error, |
| | | .ui-widget-content .ui-state-error, |
| | | .ui-widget-header .ui-state-error { |
| | | border: 1px solid #f1a899; |
| | | background: #fddfdf; |
| | | color: #5f3f3f; |
| | | } |
| | | .ui-state-error a, |
| | | .ui-widget-content .ui-state-error a, |
| | | .ui-widget-header .ui-state-error a { |
| | | color: #5f3f3f; |
| | | } |
| | | .ui-state-error-text, |
| | | .ui-widget-content .ui-state-error-text, |
| | | .ui-widget-header .ui-state-error-text { |
| | | color: #5f3f3f; |
| | | } |
| | | .ui-priority-primary, |
| | | .ui-widget-content .ui-priority-primary, |
| | | .ui-widget-header .ui-priority-primary { |
| | | font-weight: bold; |
| | | } |
| | | .ui-priority-secondary, |
| | | .ui-widget-content .ui-priority-secondary, |
| | | .ui-widget-header .ui-priority-secondary { |
| | | opacity: 0.7; |
| | | filter: Alpha(Opacity=70); /* support: IE8 */ |
| | | font-weight: normal; |
| | | } |
| | | .ui-state-disabled, |
| | | .ui-widget-content .ui-state-disabled, |
| | | .ui-widget-header .ui-state-disabled { |
| | | opacity: 0.35; |
| | | filter: Alpha(Opacity=35); /* support: IE8 */ |
| | | background-image: none; |
| | | } |
| | | .ui-state-disabled .ui-icon { |
| | | filter: Alpha(Opacity=35); /* support: IE8 - See #6059 */ |
| | | } |
| | | |
| | | /* Icons |
| | | ----------------------------------*/ |
| | | |
| | | /* states and images */ |
| | | .ui-icon { |
| | | width: 16px; |
| | | height: 16px; |
| | | } |
| | | .ui-icon, |
| | | .ui-widget-content .ui-icon { |
| | | background-image: url('images/ui-icons_444444_256x240.png'); |
| | | } |
| | | .ui-widget-header .ui-icon { |
| | | background-image: url('images/ui-icons_444444_256x240.png'); |
| | | } |
| | | .ui-state-hover .ui-icon, |
| | | .ui-state-focus .ui-icon, |
| | | .ui-button:hover .ui-icon, |
| | | .ui-button:focus .ui-icon { |
| | | background-image: url('images/ui-icons_555555_256x240.png'); |
| | | } |
| | | .ui-state-active .ui-icon, |
| | | .ui-button:active .ui-icon { |
| | | background-image: url('images/ui-icons_ffffff_256x240.png'); |
| | | } |
| | | .ui-state-highlight .ui-icon, |
| | | .ui-button .ui-state-highlight.ui-icon { |
| | | background-image: url('images/ui-icons_777620_256x240.png'); |
| | | } |
| | | .ui-state-error .ui-icon, |
| | | .ui-state-error-text .ui-icon { |
| | | background-image: url('images/ui-icons_cc0000_256x240.png'); |
| | | } |
| | | .ui-button .ui-icon { |
| | | background-image: url('images/ui-icons_777777_256x240.png'); |
| | | } |
| | | |
| | | /* positioning */ |
| | | .ui-icon-blank { |
| | | background-position: 16px 16px; |
| | | } |
| | | .ui-icon-caret-1-n { |
| | | background-position: 0 0; |
| | | } |
| | | .ui-icon-caret-1-ne { |
| | | background-position: -16px 0; |
| | | } |
| | | .ui-icon-caret-1-e { |
| | | background-position: -32px 0; |
| | | } |
| | | .ui-icon-caret-1-se { |
| | | background-position: -48px 0; |
| | | } |
| | | .ui-icon-caret-1-s { |
| | | background-position: -65px 0; |
| | | } |
| | | .ui-icon-caret-1-sw { |
| | | background-position: -80px 0; |
| | | } |
| | | .ui-icon-caret-1-w { |
| | | background-position: -96px 0; |
| | | } |
| | | .ui-icon-caret-1-nw { |
| | | background-position: -112px 0; |
| | | } |
| | | .ui-icon-caret-2-n-s { |
| | | background-position: -128px 0; |
| | | } |
| | | .ui-icon-caret-2-e-w { |
| | | background-position: -144px 0; |
| | | } |
| | | .ui-icon-triangle-1-n { |
| | | background-position: 0 -16px; |
| | | } |
| | | .ui-icon-triangle-1-ne { |
| | | background-position: -16px -16px; |
| | | } |
| | | .ui-icon-triangle-1-e { |
| | | background-position: -32px -16px; |
| | | } |
| | | .ui-icon-triangle-1-se { |
| | | background-position: -48px -16px; |
| | | } |
| | | .ui-icon-triangle-1-s { |
| | | background-position: -65px -16px; |
| | | } |
| | | .ui-icon-triangle-1-sw { |
| | | background-position: -80px -16px; |
| | | } |
| | | .ui-icon-triangle-1-w { |
| | | background-position: -96px -16px; |
| | | } |
| | | .ui-icon-triangle-1-nw { |
| | | background-position: -112px -16px; |
| | | } |
| | | .ui-icon-triangle-2-n-s { |
| | | background-position: -128px -16px; |
| | | } |
| | | .ui-icon-triangle-2-e-w { |
| | | background-position: -144px -16px; |
| | | } |
| | | .ui-icon-arrow-1-n { |
| | | background-position: 0 -32px; |
| | | } |
| | | .ui-icon-arrow-1-ne { |
| | | background-position: -16px -32px; |
| | | } |
| | | .ui-icon-arrow-1-e { |
| | | background-position: -32px -32px; |
| | | } |
| | | .ui-icon-arrow-1-se { |
| | | background-position: -48px -32px; |
| | | } |
| | | .ui-icon-arrow-1-s { |
| | | background-position: -65px -32px; |
| | | } |
| | | .ui-icon-arrow-1-sw { |
| | | background-position: -80px -32px; |
| | | } |
| | | .ui-icon-arrow-1-w { |
| | | background-position: -96px -32px; |
| | | } |
| | | .ui-icon-arrow-1-nw { |
| | | background-position: -112px -32px; |
| | | } |
| | | .ui-icon-arrow-2-n-s { |
| | | background-position: -128px -32px; |
| | | } |
| | | .ui-icon-arrow-2-ne-sw { |
| | | background-position: -144px -32px; |
| | | } |
| | | .ui-icon-arrow-2-e-w { |
| | | background-position: -160px -32px; |
| | | } |
| | | .ui-icon-arrow-2-se-nw { |
| | | background-position: -176px -32px; |
| | | } |
| | | .ui-icon-arrowstop-1-n { |
| | | background-position: -192px -32px; |
| | | } |
| | | .ui-icon-arrowstop-1-e { |
| | | background-position: -208px -32px; |
| | | } |
| | | .ui-icon-arrowstop-1-s { |
| | | background-position: -224px -32px; |
| | | } |
| | | .ui-icon-arrowstop-1-w { |
| | | background-position: -240px -32px; |
| | | } |
| | | .ui-icon-arrowthick-1-n { |
| | | background-position: 1px -48px; |
| | | } |
| | | .ui-icon-arrowthick-1-ne { |
| | | background-position: -16px -48px; |
| | | } |
| | | .ui-icon-arrowthick-1-e { |
| | | background-position: -32px -48px; |
| | | } |
| | | .ui-icon-arrowthick-1-se { |
| | | background-position: -48px -48px; |
| | | } |
| | | .ui-icon-arrowthick-1-s { |
| | | background-position: -64px -48px; |
| | | } |
| | | .ui-icon-arrowthick-1-sw { |
| | | background-position: -80px -48px; |
| | | } |
| | | .ui-icon-arrowthick-1-w { |
| | | background-position: -96px -48px; |
| | | } |
| | | .ui-icon-arrowthick-1-nw { |
| | | background-position: -112px -48px; |
| | | } |
| | | .ui-icon-arrowthick-2-n-s { |
| | | background-position: -128px -48px; |
| | | } |
| | | .ui-icon-arrowthick-2-ne-sw { |
| | | background-position: -144px -48px; |
| | | } |
| | | .ui-icon-arrowthick-2-e-w { |
| | | background-position: -160px -48px; |
| | | } |
| | | .ui-icon-arrowthick-2-se-nw { |
| | | background-position: -176px -48px; |
| | | } |
| | | .ui-icon-arrowthickstop-1-n { |
| | | background-position: -192px -48px; |
| | | } |
| | | .ui-icon-arrowthickstop-1-e { |
| | | background-position: -208px -48px; |
| | | } |
| | | .ui-icon-arrowthickstop-1-s { |
| | | background-position: -224px -48px; |
| | | } |
| | | .ui-icon-arrowthickstop-1-w { |
| | | background-position: -240px -48px; |
| | | } |
| | | .ui-icon-arrowreturnthick-1-w { |
| | | background-position: 0 -64px; |
| | | } |
| | | .ui-icon-arrowreturnthick-1-n { |
| | | background-position: -16px -64px; |
| | | } |
| | | .ui-icon-arrowreturnthick-1-e { |
| | | background-position: -32px -64px; |
| | | } |
| | | .ui-icon-arrowreturnthick-1-s { |
| | | background-position: -48px -64px; |
| | | } |
| | | .ui-icon-arrowreturn-1-w { |
| | | background-position: -64px -64px; |
| | | } |
| | | .ui-icon-arrowreturn-1-n { |
| | | background-position: -80px -64px; |
| | | } |
| | | .ui-icon-arrowreturn-1-e { |
| | | background-position: -96px -64px; |
| | | } |
| | | .ui-icon-arrowreturn-1-s { |
| | | background-position: -112px -64px; |
| | | } |
| | | .ui-icon-arrowrefresh-1-w { |
| | | background-position: -128px -64px; |
| | | } |
| | | .ui-icon-arrowrefresh-1-n { |
| | | background-position: -144px -64px; |
| | | } |
| | | .ui-icon-arrowrefresh-1-e { |
| | | background-position: -160px -64px; |
| | | } |
| | | .ui-icon-arrowrefresh-1-s { |
| | | background-position: -176px -64px; |
| | | } |
| | | .ui-icon-arrow-4 { |
| | | background-position: 0 -80px; |
| | | } |
| | | .ui-icon-arrow-4-diag { |
| | | background-position: -16px -80px; |
| | | } |
| | | .ui-icon-extlink { |
| | | background-position: -32px -80px; |
| | | } |
| | | .ui-icon-newwin { |
| | | background-position: -48px -80px; |
| | | } |
| | | .ui-icon-refresh { |
| | | background-position: -64px -80px; |
| | | } |
| | | .ui-icon-shuffle { |
| | | background-position: -80px -80px; |
| | | } |
| | | .ui-icon-transfer-e-w { |
| | | background-position: -96px -80px; |
| | | } |
| | | .ui-icon-transferthick-e-w { |
| | | background-position: -112px -80px; |
| | | } |
| | | .ui-icon-folder-collapsed { |
| | | background-position: 0 -96px; |
| | | } |
| | | .ui-icon-folder-open { |
| | | background-position: -16px -96px; |
| | | } |
| | | .ui-icon-document { |
| | | background-position: -32px -96px; |
| | | } |
| | | .ui-icon-document-b { |
| | | background-position: -48px -96px; |
| | | } |
| | | .ui-icon-note { |
| | | background-position: -64px -96px; |
| | | } |
| | | .ui-icon-mail-closed { |
| | | background-position: -80px -96px; |
| | | } |
| | | .ui-icon-mail-open { |
| | | background-position: -96px -96px; |
| | | } |
| | | .ui-icon-suitcase { |
| | | background-position: -112px -96px; |
| | | } |
| | | .ui-icon-comment { |
| | | background-position: -128px -96px; |
| | | } |
| | | .ui-icon-person { |
| | | background-position: -144px -96px; |
| | | } |
| | | .ui-icon-print { |
| | | background-position: -160px -96px; |
| | | } |
| | | .ui-icon-trash { |
| | | background-position: -176px -96px; |
| | | } |
| | | .ui-icon-locked { |
| | | background-position: -192px -96px; |
| | | } |
| | | .ui-icon-unlocked { |
| | | background-position: -208px -96px; |
| | | } |
| | | .ui-icon-bookmark { |
| | | background-position: -224px -96px; |
| | | } |
| | | .ui-icon-tag { |
| | | background-position: -240px -96px; |
| | | } |
| | | .ui-icon-home { |
| | | background-position: 0 -112px; |
| | | } |
| | | .ui-icon-flag { |
| | | background-position: -16px -112px; |
| | | } |
| | | .ui-icon-calendar { |
| | | background-position: -32px -112px; |
| | | } |
| | | .ui-icon-cart { |
| | | background-position: -48px -112px; |
| | | } |
| | | .ui-icon-pencil { |
| | | background-position: -64px -112px; |
| | | } |
| | | .ui-icon-clock { |
| | | background-position: -80px -112px; |
| | | } |
| | | .ui-icon-disk { |
| | | background-position: -96px -112px; |
| | | } |
| | | .ui-icon-calculator { |
| | | background-position: -112px -112px; |
| | | } |
| | | .ui-icon-zoomin { |
| | | background-position: -128px -112px; |
| | | } |
| | | .ui-icon-zoomout { |
| | | background-position: -144px -112px; |
| | | } |
| | | .ui-icon-search { |
| | | background-position: -160px -112px; |
| | | } |
| | | .ui-icon-wrench { |
| | | background-position: -176px -112px; |
| | | } |
| | | .ui-icon-gear { |
| | | background-position: -192px -112px; |
| | | } |
| | | .ui-icon-heart { |
| | | background-position: -208px -112px; |
| | | } |
| | | .ui-icon-star { |
| | | background-position: -224px -112px; |
| | | } |
| | | .ui-icon-link { |
| | | background-position: -240px -112px; |
| | | } |
| | | .ui-icon-cancel { |
| | | background-position: 0 -128px; |
| | | } |
| | | .ui-icon-plus { |
| | | background-position: -16px -128px; |
| | | } |
| | | .ui-icon-plusthick { |
| | | background-position: -32px -128px; |
| | | } |
| | | .ui-icon-minus { |
| | | background-position: -48px -128px; |
| | | } |
| | | .ui-icon-minusthick { |
| | | background-position: -64px -128px; |
| | | } |
| | | .ui-icon-close { |
| | | background-position: -80px -128px; |
| | | } |
| | | .ui-icon-closethick { |
| | | background-position: -96px -128px; |
| | | } |
| | | .ui-icon-key { |
| | | background-position: -112px -128px; |
| | | } |
| | | .ui-icon-lightbulb { |
| | | background-position: -128px -128px; |
| | | } |
| | | .ui-icon-scissors { |
| | | background-position: -144px -128px; |
| | | } |
| | | .ui-icon-clipboard { |
| | | background-position: -160px -128px; |
| | | } |
| | | .ui-icon-copy { |
| | | background-position: -176px -128px; |
| | | } |
| | | .ui-icon-contact { |
| | | background-position: -192px -128px; |
| | | } |
| | | .ui-icon-image { |
| | | background-position: -208px -128px; |
| | | } |
| | | .ui-icon-video { |
| | | background-position: -224px -128px; |
| | | } |
| | | .ui-icon-script { |
| | | background-position: -240px -128px; |
| | | } |
| | | .ui-icon-alert { |
| | | background-position: 0 -144px; |
| | | } |
| | | .ui-icon-info { |
| | | background-position: -16px -144px; |
| | | } |
| | | .ui-icon-notice { |
| | | background-position: -32px -144px; |
| | | } |
| | | .ui-icon-help { |
| | | background-position: -48px -144px; |
| | | } |
| | | .ui-icon-check { |
| | | background-position: -64px -144px; |
| | | } |
| | | .ui-icon-bullet { |
| | | background-position: -80px -144px; |
| | | } |
| | | .ui-icon-radio-on { |
| | | background-position: -96px -144px; |
| | | } |
| | | .ui-icon-radio-off { |
| | | background-position: -112px -144px; |
| | | } |
| | | .ui-icon-pin-w { |
| | | background-position: -128px -144px; |
| | | } |
| | | .ui-icon-pin-s { |
| | | background-position: -144px -144px; |
| | | } |
| | | .ui-icon-play { |
| | | background-position: 0 -160px; |
| | | } |
| | | .ui-icon-pause { |
| | | background-position: -16px -160px; |
| | | } |
| | | .ui-icon-seek-next { |
| | | background-position: -32px -160px; |
| | | } |
| | | .ui-icon-seek-prev { |
| | | background-position: -48px -160px; |
| | | } |
| | | .ui-icon-seek-end { |
| | | background-position: -64px -160px; |
| | | } |
| | | .ui-icon-seek-start { |
| | | background-position: -80px -160px; |
| | | } |
| | | /* ui-icon-seek-first is deprecated, use ui-icon-seek-start instead */ |
| | | .ui-icon-seek-first { |
| | | background-position: -80px -160px; |
| | | } |
| | | .ui-icon-stop { |
| | | background-position: -96px -160px; |
| | | } |
| | | .ui-icon-eject { |
| | | background-position: -112px -160px; |
| | | } |
| | | .ui-icon-volume-off { |
| | | background-position: -128px -160px; |
| | | } |
| | | .ui-icon-volume-on { |
| | | background-position: -144px -160px; |
| | | } |
| | | .ui-icon-power { |
| | | background-position: 0 -176px; |
| | | } |
| | | .ui-icon-signal-diag { |
| | | background-position: -16px -176px; |
| | | } |
| | | .ui-icon-signal { |
| | | background-position: -32px -176px; |
| | | } |
| | | .ui-icon-battery-0 { |
| | | background-position: -48px -176px; |
| | | } |
| | | .ui-icon-battery-1 { |
| | | background-position: -64px -176px; |
| | | } |
| | | .ui-icon-battery-2 { |
| | | background-position: -80px -176px; |
| | | } |
| | | .ui-icon-battery-3 { |
| | | background-position: -96px -176px; |
| | | } |
| | | .ui-icon-circle-plus { |
| | | background-position: 0 -192px; |
| | | } |
| | | .ui-icon-circle-minus { |
| | | background-position: -16px -192px; |
| | | } |
| | | .ui-icon-circle-close { |
| | | background-position: -32px -192px; |
| | | } |
| | | .ui-icon-circle-triangle-e { |
| | | background-position: -48px -192px; |
| | | } |
| | | .ui-icon-circle-triangle-s { |
| | | background-position: -64px -192px; |
| | | } |
| | | .ui-icon-circle-triangle-w { |
| | | background-position: -80px -192px; |
| | | } |
| | | .ui-icon-circle-triangle-n { |
| | | background-position: -96px -192px; |
| | | } |
| | | .ui-icon-circle-arrow-e { |
| | | background-position: -112px -192px; |
| | | } |
| | | .ui-icon-circle-arrow-s { |
| | | background-position: -128px -192px; |
| | | } |
| | | .ui-icon-circle-arrow-w { |
| | | background-position: -144px -192px; |
| | | } |
| | | .ui-icon-circle-arrow-n { |
| | | background-position: -160px -192px; |
| | | } |
| | | .ui-icon-circle-zoomin { |
| | | background-position: -176px -192px; |
| | | } |
| | | .ui-icon-circle-zoomout { |
| | | background-position: -192px -192px; |
| | | } |
| | | .ui-icon-circle-check { |
| | | background-position: -208px -192px; |
| | | } |
| | | .ui-icon-circlesmall-plus { |
| | | background-position: 0 -208px; |
| | | } |
| | | .ui-icon-circlesmall-minus { |
| | | background-position: -16px -208px; |
| | | } |
| | | .ui-icon-circlesmall-close { |
| | | background-position: -32px -208px; |
| | | } |
| | | .ui-icon-squaresmall-plus { |
| | | background-position: -48px -208px; |
| | | } |
| | | .ui-icon-squaresmall-minus { |
| | | background-position: -64px -208px; |
| | | } |
| | | .ui-icon-squaresmall-close { |
| | | background-position: -80px -208px; |
| | | } |
| | | .ui-icon-grip-dotted-vertical { |
| | | background-position: 0 -224px; |
| | | } |
| | | .ui-icon-grip-dotted-horizontal { |
| | | background-position: -16px -224px; |
| | | } |
| | | .ui-icon-grip-solid-vertical { |
| | | background-position: -32px -224px; |
| | | } |
| | | .ui-icon-grip-solid-horizontal { |
| | | background-position: -48px -224px; |
| | | } |
| | | .ui-icon-gripsmall-diagonal-se { |
| | | background-position: -64px -224px; |
| | | } |
| | | .ui-icon-grip-diagonal-se { |
| | | background-position: -80px -224px; |
| | | } |
| | | |
| | | /* Misc visuals |
| | | ----------------------------------*/ |
| | | |
| | | /* Corner radius */ |
| | | .ui-corner-all, |
| | | .ui-corner-top, |
| | | .ui-corner-left, |
| | | .ui-corner-tl { |
| | | border-top-left-radius: 3px; |
| | | } |
| | | .ui-corner-all, |
| | | .ui-corner-top, |
| | | .ui-corner-right, |
| | | .ui-corner-tr { |
| | | border-top-right-radius: 3px; |
| | | } |
| | | .ui-corner-all, |
| | | .ui-corner-bottom, |
| | | .ui-corner-left, |
| | | .ui-corner-bl { |
| | | border-bottom-left-radius: 3px; |
| | | } |
| | | .ui-corner-all, |
| | | .ui-corner-bottom, |
| | | .ui-corner-right, |
| | | .ui-corner-br { |
| | | border-bottom-right-radius: 3px; |
| | | } |
| | | |
| | | /* Overlays */ |
| | | .ui-widget-overlay { |
| | | background: #aaaaaa; |
| | | opacity: 0.3; |
| | | filter: Alpha(Opacity=30); /* support: IE8 */ |
| | | } |
| | | .ui-widget-shadow { |
| | | -webkit-box-shadow: 0px 0px 5px #666666; |
| | | box-shadow: 0px 0px 5px #666666; |
| | | } |
New file |
| | |
| | | /* latin-ext */ |
| | | @font-face { |
| | | font-family: 'Titillium Web'; |
| | | font-style: normal; |
| | | font-weight: 400; |
| | | src: url('/static/modelView/fonts/fontawesome-webfont.woff2') format('woff2'); |
| | | unicode-range: U+0100-02AF, U+0304, U+0308, U+0329, U+1E00-1E9F, U+1EF2-1EFF, U+2020, U+20A0-20AB, U+20AD-20C0, U+2113, U+2C60-2C7F, U+A720-A7FF; |
| | | } |
| | | /* latin */ |
| | | @font-face { |
| | | font-family: 'Titillium Web'; |
| | | font-style: normal; |
| | | font-weight: 400; |
| | | src: url('/static/modelView/fonts/fontawesome-webfont.woff2') format('woff2'); |
| | | unicode-range: U+0000-00FF, U+0131, U+0152-0153, U+02BB-02BC, U+02C6, U+02DA, U+02DC, U+0304, U+0308, U+0329, U+2000-206F, U+2074, U+20AC, U+2122, U+2191, U+2193, U+2212, U+2215, U+FEFF, U+FFFD; |
| | | } |
| | | |
| | | body { |
| | | font-family: Helvetica, Arial, sans-serif; |
| | | font-size: 10px; |
| | | background-color: #292121; /*565646*/ |
| | | margin: 0; |
| | | padding: 0; |
| | | } |
| | | |
| | | .loading{ |
| | | width: 100%; |
| | | height: 100%; |
| | | display: flex; |
| | | justify-content: center; |
| | | align-items: center; |
| | | color: red; |
| | | position: absolute; |
| | | top: 0; |
| | | left: 0; |
| | | z-index: 9999; |
| | | } |
| | | |
| | | #stats { |
| | | position: absolute; |
| | | right: 10px; |
| | | top: 5px; |
| | | color: #fff; |
| | | text-align: left; |
| | | background: rgba(0, 0, 0, 0.5); |
| | | padding: 10px; |
| | | width: 200px; |
| | | height: 80px; |
| | | border: solid 1px black; |
| | | border-radius: 5px; |
| | | font-family: 'Titillium Web', sans-serif; |
| | | font-size: 14px; |
| | | overflow-x: hidden; |
| | | } |
| | | |
| | | .statsText { |
| | | color: #fff27f; |
| | | } |
| | | |
| | | #sampleMods { |
| | | position: absolute; |
| | | right: 10px; |
| | | top: 5px; |
| | | margin-top: 108px; |
| | | font-family: 'Titillium Web', sans-serif; |
| | | font-size: 14px; |
| | | color: white; |
| | | } |
| | | |
| | | #anims { |
| | | position: absolute; |
| | | right: 10px; |
| | | top: 5px; |
| | | margin-top: 200px; |
| | | font-family: 'Titillium Web', sans-serif; |
| | | font-size: 14px; |
| | | color: white; |
| | | display: none; |
| | | } |
| | | |
| | | .animBtn { |
| | | box-shadow: inset 0px 1px 0px 0px #030100; |
| | | background-color: #2c3e50; |
| | | border-radius: 3px; |
| | | border: 1px solid #ffffff; |
| | | font-family: 'Titillium Web', sans-serif; |
| | | cursor: pointer; |
| | | color: #ffffff; |
| | | font-size: 14.5px; |
| | | padding: 10px; |
| | | margin-right: 15px; |
| | | } |
| | | |
| | | .animBtn:hover { |
| | | background-color: #527aa3; |
| | | } |
| | | |
| | | #stop { |
| | | background-color: #e23636; |
| | | } |
| | | #stop:hover { |
| | | background-color: #ad2626; |
| | | } |
| | | |
| | | /* Reset Select */ |
| | | select { |
| | | -webkit-appearance: none; |
| | | -moz-appearance: none; |
| | | -ms-appearance: none; |
| | | appearance: none; |
| | | outline: 0; |
| | | box-shadow: none; |
| | | border: 0 !important; |
| | | background: #2c3e50; |
| | | background-image: none; |
| | | } |
| | | |
| | | .select { |
| | | position: relative; |
| | | display: block; |
| | | width: 15.7em; |
| | | height: 3em; |
| | | line-height: 3; |
| | | background: #2c3e50; |
| | | overflow: hidden; |
| | | border-radius: 0.25em; |
| | | } |
| | | |
| | | select { |
| | | width: 100%; |
| | | height: 100%; |
| | | margin: 0; |
| | | padding: 0 0 0 0.5em; |
| | | color: #fff; |
| | | cursor: pointer; |
| | | } |
| | | |
| | | select::-ms-expand { |
| | | display: none; |
| | | } |
| | | |
| | | /* Arrow */ |
| | | .select::after { |
| | | content: '\25BC'; |
| | | position: absolute; |
| | | top: 0; |
| | | right: 0; |
| | | bottom: 0; |
| | | padding: 0 1em; |
| | | background: #34495e; |
| | | pointer-events: none; |
| | | } |
| | | |
| | | /* Transition */ |
| | | .select:hover::after { |
| | | color: #fff27f; |
| | | } |
| | | .select::after { |
| | | -webkit-transition: 0.25s all ease; |
| | | -o-transition: 0.25s all ease; |
| | | transition: 0.25s all ease; |
| | | } |
| | | |
| | | #collapse_side { |
| | | position: absolute; |
| | | left: 20%; |
| | | top: 5px; |
| | | color: #fff; |
| | | background: rgba(0, 0, 0, 0); |
| | | padding: 3px; |
| | | border: none; |
| | | outline: none; |
| | | border-radius: 5px; |
| | | font-size: 30px; |
| | | } |
| | | |
| | | #collapse_btm { |
| | | position: absolute; |
| | | left: 20%; |
| | | top: 73%; |
| | | color: #fff; |
| | | background: rgba(0, 0, 0, 0); |
| | | padding: 3px; |
| | | border: none; |
| | | outline: none; |
| | | border-radius: 5px; |
| | | font-size: 30px; |
| | | } |
| | | |
| | | #fullscreen { |
| | | position: absolute; |
| | | right: 0; |
| | | bottom: 0; |
| | | } |
| | | |
| | | button:focus { |
| | | outline: none; /*Remove blue border when clicking buttons*/ |
| | | } |
| | | button:hover { |
| | | cursor: pointer; |
| | | } |
| | | |
| | | #container { |
| | | display: block; |
| | | margin: 0 auto; |
| | | float: right; |
| | | } |
| | | |
| | | #red, |
| | | #green, |
| | | #blue, |
| | | #ambient_red, |
| | | #ambient_green, |
| | | #ambient_blue, |
| | | #shine, |
| | | #point_light, |
| | | #edgeStrength { |
| | | width: 98%; |
| | | margin-top: 4px; |
| | | font-size: 7.5px; |
| | | } |
| | | |
| | | #rot_slider { |
| | | width: 100%; |
| | | float: right; |
| | | font-size: 7.5px; |
| | | } |
| | | |
| | | #shine .ui-slider-handle, |
| | | #point_light .ui-slider-handle, |
| | | #edgeStrength .ui-slider-handle { |
| | | font-size: 10px; |
| | | border-radius: 34px; |
| | | outline: none; |
| | | } |
| | | |
| | | #red .ui-slider-range { |
| | | background: #ef2929; |
| | | } |
| | | #red .ui-slider-handle { |
| | | border-color: #ef2929; |
| | | border-radius: 34px; |
| | | outline: none; |
| | | } |
| | | |
| | | #ambient_red .ui-slider-range { |
| | | background: #ef2929; |
| | | } |
| | | #ambient_red .ui-slider-handle { |
| | | border-color: #ef2929; |
| | | border-radius: 34px; |
| | | outline: none; |
| | | } |
| | | |
| | | #green .ui-slider-range { |
| | | background: #8ae234; |
| | | } |
| | | #green .ui-slider-handle { |
| | | border-color: #8ae234; |
| | | border-radius: 34px; |
| | | outline: none; |
| | | } |
| | | |
| | | #ambient_green .ui-slider-range { |
| | | background: #8ae234; |
| | | } |
| | | #ambient_green .ui-slider-handle { |
| | | border-color: #8ae234; |
| | | border-radius: 34px; |
| | | outline: none; |
| | | } |
| | | |
| | | #blue .ui-slider-range { |
| | | background: #729fcf; |
| | | } |
| | | #blue .ui-slider-handle { |
| | | border-color: #729fcf; |
| | | border-radius: 34px; |
| | | outline: none; |
| | | } |
| | | |
| | | #ambient_blue .ui-slider-range { |
| | | background: #729fcf; |
| | | } |
| | | #ambient_blue .ui-slider-handle { |
| | | border-color: #729fcf; |
| | | border-radius: 34px; |
| | | outline: none; |
| | | } |
| | | |
| | | .switch { |
| | | position: relative; |
| | | display: inline-block; |
| | | width: 90px; |
| | | height: 34px; |
| | | } |
| | | |
| | | .switch.helper { |
| | | position: relative; |
| | | display: inline-block; |
| | | width: 55px; |
| | | height: 24px; |
| | | margin-left: 10px; |
| | | } |
| | | |
| | | .switch input { |
| | | display: none; |
| | | } |
| | | |
| | | .toggle { |
| | | position: absolute; |
| | | cursor: pointer; |
| | | top: 0; |
| | | left: 0; |
| | | right: 0; |
| | | bottom: 0; |
| | | background-color: #ca2222; |
| | | -webkit-transition: 0.4s; |
| | | transition: 0.4s; |
| | | border-radius: 34px; |
| | | } |
| | | |
| | | .toggle:before { |
| | | position: absolute; |
| | | content: ''; |
| | | height: 26px; |
| | | width: 26px; |
| | | left: 4px; |
| | | bottom: 4px; |
| | | background-color: white; |
| | | -webkit-transition: 0.4s; |
| | | transition: 0.4s; |
| | | border-radius: 50%; |
| | | } |
| | | |
| | | .grid:before { |
| | | height: 16px; |
| | | width: 16px; |
| | | } |
| | | |
| | | .toggle:after { |
| | | content: 'OFF'; |
| | | color: white; |
| | | display: block; |
| | | position: absolute; |
| | | transform: translate(-50%, -50%); |
| | | top: 50%; |
| | | left: 70%; |
| | | font-size: 12px; |
| | | font-family: Verdana, sans-serif; |
| | | } |
| | | |
| | | input:checked + .toggle:after { |
| | | content: 'ON'; |
| | | left: 30%; |
| | | } |
| | | |
| | | input:checked + .toggle { |
| | | background-color: #2ab934; |
| | | } |
| | | |
| | | input:focus + .toggle { |
| | | box-shadow: 0 0 1px #2196f3; |
| | | } |
| | | |
| | | input:checked + .toggle:before { |
| | | -webkit-transform: translateX(55px); |
| | | -ms-transform: translateX(55px); |
| | | transform: translateX(55px); |
| | | } |
| | | |
| | | input:checked + .grid:before { |
| | | -webkit-transform: translateX(30px); |
| | | -ms-transform: translateX(30px); |
| | | transform: translateX(30px); |
| | | } |
| | | |
| | | .side_menu { |
| | | width: 19%; |
| | | height: 100%; |
| | | position: absolute; |
| | | border: 3px groove #e5e5e5; |
| | | background-color: #494a4c; |
| | | bottom: 0; |
| | | top: 0; |
| | | left: 0; |
| | | overflow: auto; |
| | | overflow-x: hidden; |
| | | box-sizing: border-box; |
| | | } |
| | | |
| | | .menu_item { |
| | | width: 100%; |
| | | margin: 0; |
| | | margin-top: 5px; |
| | | padding: 0; |
| | | list-style: none; |
| | | font-family: "Titillium Web",sans-serif; |
| | | font-size: 15px; |
| | | } |
| | | |
| | | .menu_item li#header { |
| | | color: #fff; |
| | | background-color: #3d5c5c; |
| | | padding: 4px 12px; |
| | | border: 3px double #bbb; |
| | | text-align: center; |
| | | } |
| | | |
| | | #lightSkin, |
| | | #darkSkin { |
| | | color: #fff; |
| | | background-color: #3d5c5c; |
| | | outline: none; |
| | | /* border-style: ridge; */ |
| | | } |
| | | #lightSkin:hover, |
| | | #darkSkin:hover { |
| | | background: #494a4c; |
| | | text-decoration: none; |
| | | } |
| | | |
| | | .menu_item li.dropdown { |
| | | color: #fff; |
| | | padding: 4px 12px; |
| | | border: 3px solid #bbb; |
| | | } |
| | | |
| | | .customMenu { |
| | | display: flex; |
| | | justify-content: space-between; |
| | | align-items: center; |
| | | } |
| | | |
| | | .menu_item li, |
| | | .bottom_menu_item li { |
| | | border-top: 0; |
| | | margin: 0; |
| | | /* background: #1d1e1e; */ |
| | | margin-top: 8px; |
| | | } |
| | | .menu_item li a, |
| | | .bottom_menu_item li a { |
| | | text-decoration: none; |
| | | color: #fff; |
| | | display: inline-block; |
| | | padding: 5px 12px; |
| | | width: 93%; |
| | | display: flex; |
| | | align-items: center; |
| | | } |
| | | .menu_item li a:hover, |
| | | .bottom_menu_item li a:hover { |
| | | background: #494a4c; |
| | | text-decoration: none; |
| | | } |
| | | .menu_item li ul, |
| | | .bottom_menu_item li ul { |
| | | list-style: none; |
| | | display: none; |
| | | margin: 0; |
| | | padding: 0; |
| | | } |
| | | |
| | | .menu_item li ul li, |
| | | .bottom_menu_item li ul li { |
| | | /* background: #1d1e1e; */ |
| | | margin: 0; |
| | | border: 0; |
| | | } |
| | | |
| | | .image { |
| | | float: left; |
| | | padding-right: 25px; |
| | | } |
| | | |
| | | #bottom_menu { |
| | | width: 80%; |
| | | height: 15%; |
| | | font-size: 15px; |
| | | color: #fff; |
| | | position: absolute; |
| | | border: 3px groove #e5e5e5; |
| | | background-color: #494a4c; |
| | | bottom: 0; |
| | | left: 19.5%; |
| | | overflow: auto; |
| | | } |
| | | |
| | | .bottom_menu_item { |
| | | width: 100%; |
| | | margin: 0; |
| | | margin-top: 0.5px; |
| | | padding: 0; |
| | | list-style: none; |
| | | font-family: 'Titillium Web', sans-serif; |
| | | font-size: 15px; |
| | | } |
| | | |
| | | .bottom_menu_item li.dropdown { |
| | | color: #fff; |
| | | padding: 4px 12px; |
| | | border: 3px solid #bbb; |
| | | display: inline-block; |
| | | float: left; |
| | | width: 30%; |
| | | } |
| | | |
| | | .resetRotateButton { |
| | | -moz-box-shadow: inset 0px 1px 0px 0px #030100; |
| | | -webkit-box-shadow: inset 0px 1px 0px 0px #030100; |
| | | box-shadow: inset 0px 1px 0px 0px #030100; |
| | | background-color: #28ad57; |
| | | -moz-border-radius: 3px; |
| | | -webkit-border-radius: 3px; |
| | | border-radius: 3px; |
| | | border: 1px solid #ffffff; |
| | | display: inline-block; |
| | | cursor: pointer; |
| | | color: #ffffff; |
| | | font-family: Arial; |
| | | font-size: 13px; |
| | | padding: 6px 24px; |
| | | text-decoration: none; |
| | | text-shadow: 0px 1px 0px #9e5351; |
| | | margin-right: 5px; |
| | | } |
| | | |
| | | .radioBtn { |
| | | display: inline-block; |
| | | margin-right: 11px; |
| | | background-color: #28ad57; |
| | | padding: 6px; |
| | | border: 2px solid #ffffff; |
| | | } |
| | | |
| | | .resetRotateButton { |
| | | background-color: #dd3d0c; |
| | | margin-top: 5px; |
| | | width: 97%; |
| | | font-size: 15px; |
| | | } |
| | | |
| | | .resetRotateButton:hover { |
| | | background-color: #b43008; |
| | | } |
| | | |
| | | #transformKey { |
| | | display: none; |
| | | margin-left: 25px; |
| | | font-size: 15px; |
| | | } |
| | | |
| | | #scale_up, |
| | | #scale_down { |
| | | background-color: #000099; |
| | | border-radius: 7px; |
| | | text-shadow: 0px 1px 3px #666666; |
| | | font-family: Arial; |
| | | color: #ffffff; |
| | | font-size: 17px; |
| | | padding: 4px 12px 4px 12px; |
| | | border: solid #000033 4px; |
| | | text-decoration: none; |
| | | } |
| | | |
| | | #scale_up:hover, |
| | | #scale_down:hover { |
| | | background-color: #4d4dff; |
| | | } |
| | | |
| | | #obj_file, |
| | | #modelPlusTexture { |
| | | display: none; |
| | | } |
| | | .model-upload, |
| | | #remove { |
| | | border: 1px solid #ccc; |
| | | display: inline-block; |
| | | padding: 6px 12px; |
| | | cursor: pointer; |
| | | color: #fff; |
| | | background: #4b5f83; |
| | | } |
| | | |
| | | .model-upload:hover { |
| | | background: #009999; |
| | | } |
| | | |
| | | #remove { |
| | | padding: 9px 12.5px; |
| | | font-size: 14px; |
| | | background: #b90a0a; |
| | | } |
| | | #remove:hover { |
| | | background: #e23636; |
| | | } |
| | | |
| | | .qBtn { |
| | | background: #1d1e1e; |
| | | border: none; |
| | | outline: none; |
| | | margin-left: 16px; |
| | | } |
| | | |
| | | .q_mark { |
| | | background-color: #fff; |
| | | border-radius: 50%; |
| | | color: #76bdd5; |
| | | font-size: 25px; |
| | | height: 17px; |
| | | line-height: 17px; |
| | | width: 19px; |
| | | } |
| | | |
| | | .ui-dialog-title { |
| | | font-size: 20px; |
| | | } |
New file |
| | |
| | | /*** |
| | | Spectrum Colorpicker v1.5.1 |
| | | https://github.com/bgrins/spectrum |
| | | Author: Brian Grinstead |
| | | License: MIT |
| | | ***/ |
| | | |
| | | .sp-container { |
| | | position:absolute; |
| | | top:0; |
| | | left:0; |
| | | display:inline-block; |
| | | *display: inline; |
| | | *zoom: 1; |
| | | /* https://github.com/bgrins/spectrum/issues/40 */ |
| | | z-index: 9999994; |
| | | overflow: hidden; |
| | | } |
| | | .sp-container.sp-flat { |
| | | position: relative; |
| | | } |
| | | |
| | | /* Fix for * { box-sizing: border-box; } */ |
| | | .sp-container, |
| | | .sp-container * { |
| | | -webkit-box-sizing: content-box; |
| | | -moz-box-sizing: content-box; |
| | | box-sizing: content-box; |
| | | } |
| | | |
| | | /* http://ansciath.tumblr.com/post/7347495869/css-aspect-ratio */ |
| | | .sp-top { |
| | | position:relative; |
| | | width: 100%; |
| | | display:inline-block; |
| | | } |
| | | .sp-top-inner { |
| | | position:absolute; |
| | | top:0; |
| | | left:0; |
| | | bottom:0; |
| | | right:0; |
| | | } |
| | | .sp-color { |
| | | position: absolute; |
| | | top:0; |
| | | left:0; |
| | | bottom:0; |
| | | right:20%; |
| | | } |
| | | .sp-hue { |
| | | position: absolute; |
| | | top:0; |
| | | right:0; |
| | | bottom:0; |
| | | left:84%; |
| | | height: 100%; |
| | | } |
| | | |
| | | .sp-clear-enabled .sp-hue { |
| | | top:33px; |
| | | height: 77.5%; |
| | | } |
| | | |
| | | .sp-fill { |
| | | padding-top: 80%; |
| | | } |
| | | .sp-sat, .sp-val { |
| | | position: absolute; |
| | | top:0; |
| | | left:0; |
| | | right:0; |
| | | bottom:0; |
| | | } |
| | | |
| | | .sp-alpha-enabled .sp-top { |
| | | margin-bottom: 18px; |
| | | } |
| | | .sp-alpha-enabled .sp-alpha { |
| | | display: block; |
| | | } |
| | | .sp-alpha-handle { |
| | | position:absolute; |
| | | top:-4px; |
| | | bottom: -4px; |
| | | width: 6px; |
| | | left: 50%; |
| | | cursor: pointer; |
| | | border: 1px solid black; |
| | | background: white; |
| | | opacity: .8; |
| | | } |
| | | .sp-alpha { |
| | | display: none; |
| | | position: absolute; |
| | | bottom: -14px; |
| | | right: 0; |
| | | left: 0; |
| | | height: 8px; |
| | | } |
| | | .sp-alpha-inner { |
| | | border: solid 1px #333; |
| | | } |
| | | |
| | | .sp-clear { |
| | | display: none; |
| | | } |
| | | |
| | | .sp-clear.sp-clear-display { |
| | | background-position: center; |
| | | } |
| | | |
| | | .sp-clear-enabled .sp-clear { |
| | | display: block; |
| | | position:absolute; |
| | | top:0px; |
| | | right:0; |
| | | bottom:0; |
| | | left:84%; |
| | | height: 28px; |
| | | } |
| | | |
| | | /* Don't allow text selection */ |
| | | .sp-container, .sp-replacer, .sp-preview, .sp-dragger, .sp-slider, .sp-alpha, .sp-clear, .sp-alpha-handle, .sp-container.sp-dragging .sp-input, .sp-container button { |
| | | -webkit-user-select:none; |
| | | -moz-user-select: -moz-none; |
| | | -o-user-select:none; |
| | | user-select: none; |
| | | } |
| | | |
| | | .sp-container.sp-input-disabled .sp-input-container { |
| | | display: none; |
| | | } |
| | | .sp-container.sp-buttons-disabled .sp-button-container { |
| | | display: none; |
| | | } |
| | | .sp-container.sp-palette-buttons-disabled .sp-palette-button-container { |
| | | display: none; |
| | | } |
| | | .sp-palette-only .sp-picker-container { |
| | | display: none; |
| | | } |
| | | .sp-palette-disabled .sp-palette-container { |
| | | display: none; |
| | | } |
| | | |
| | | .sp-initial-disabled .sp-initial { |
| | | display: none; |
| | | } |
| | | |
| | | |
| | | /* Gradients for hue, saturation and value instead of images. Not pretty... but it works */ |
| | | .sp-sat { |
| | | background-image: -webkit-gradient(linear, 0 0, 100% 0, from(#FFF), to(rgba(204, 154, 129, 0))); |
| | | background-image: -webkit-linear-gradient(left, #FFF, rgba(204, 154, 129, 0)); |
| | | background-image: -moz-linear-gradient(left, #fff, rgba(204, 154, 129, 0)); |
| | | background-image: -o-linear-gradient(left, #fff, rgba(204, 154, 129, 0)); |
| | | background-image: -ms-linear-gradient(left, #fff, rgba(204, 154, 129, 0)); |
| | | background-image: linear-gradient(to right, #fff, rgba(204, 154, 129, 0)); |
| | | -ms-filter: "progid:DXImageTransform.Microsoft.gradient(GradientType = 1, startColorstr=#FFFFFFFF, endColorstr=#00CC9A81)"; |
| | | filter : progid:DXImageTransform.Microsoft.gradient(GradientType = 1, startColorstr='#FFFFFFFF', endColorstr='#00CC9A81'); |
| | | } |
| | | .sp-val { |
| | | background-image: -webkit-gradient(linear, 0 100%, 0 0, from(#000000), to(rgba(204, 154, 129, 0))); |
| | | background-image: -webkit-linear-gradient(bottom, #000000, rgba(204, 154, 129, 0)); |
| | | background-image: -moz-linear-gradient(bottom, #000, rgba(204, 154, 129, 0)); |
| | | background-image: -o-linear-gradient(bottom, #000, rgba(204, 154, 129, 0)); |
| | | background-image: -ms-linear-gradient(bottom, #000, rgba(204, 154, 129, 0)); |
| | | background-image: linear-gradient(to top, #000, rgba(204, 154, 129, 0)); |
| | | -ms-filter: "progid:DXImageTransform.Microsoft.gradient(startColorstr=#00CC9A81, endColorstr=#FF000000)"; |
| | | filter : progid:DXImageTransform.Microsoft.gradient(startColorstr='#00CC9A81', endColorstr='#FF000000'); |
| | | } |
| | | |
| | | .sp-hue { |
| | | background: -moz-linear-gradient(top, #ff0000 0%, #ffff00 17%, #00ff00 33%, #00ffff 50%, #0000ff 67%, #ff00ff 83%, #ff0000 100%); |
| | | background: -ms-linear-gradient(top, #ff0000 0%, #ffff00 17%, #00ff00 33%, #00ffff 50%, #0000ff 67%, #ff00ff 83%, #ff0000 100%); |
| | | background: -o-linear-gradient(top, #ff0000 0%, #ffff00 17%, #00ff00 33%, #00ffff 50%, #0000ff 67%, #ff00ff 83%, #ff0000 100%); |
| | | background: -webkit-gradient(linear, left top, left bottom, from(#ff0000), color-stop(0.17, #ffff00), color-stop(0.33, #00ff00), color-stop(0.5, #00ffff), color-stop(0.67, #0000ff), color-stop(0.83, #ff00ff), to(#ff0000)); |
| | | background: -webkit-linear-gradient(top, #ff0000 0%, #ffff00 17%, #00ff00 33%, #00ffff 50%, #0000ff 67%, #ff00ff 83%, #ff0000 100%); |
| | | background: linear-gradient(to bottom, #ff0000 0%, #ffff00 17%, #00ff00 33%, #00ffff 50%, #0000ff 67%, #ff00ff 83%, #ff0000 100%); |
| | | } |
| | | |
| | | /* IE filters do not support multiple color stops. |
| | | Generate 6 divs, line them up, and do two color gradients for each. |
| | | Yes, really. |
| | | */ |
| | | .sp-1 { |
| | | height:17%; |
| | | filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff0000', endColorstr='#ffff00'); |
| | | } |
| | | .sp-2 { |
| | | height:16%; |
| | | filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ffff00', endColorstr='#00ff00'); |
| | | } |
| | | .sp-3 { |
| | | height:17%; |
| | | filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#00ff00', endColorstr='#00ffff'); |
| | | } |
| | | .sp-4 { |
| | | height:17%; |
| | | filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#00ffff', endColorstr='#0000ff'); |
| | | } |
| | | .sp-5 { |
| | | height:16%; |
| | | filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#0000ff', endColorstr='#ff00ff'); |
| | | } |
| | | .sp-6 { |
| | | height:17%; |
| | | filter: progid:DXImageTransform.Microsoft.gradient(startColorstr='#ff00ff', endColorstr='#ff0000'); |
| | | } |
| | | |
| | | .sp-hidden { |
| | | display: none !important; |
| | | } |
| | | |
| | | /* Clearfix hack */ |
| | | .sp-cf:before, .sp-cf:after { content: ""; display: table; } |
| | | .sp-cf:after { clear: both; } |
| | | .sp-cf { *zoom: 1; } |
| | | |
| | | /* Mobile devices, make hue slider bigger so it is easier to slide */ |
| | | @media (max-device-width: 480px) { |
| | | .sp-color { right: 40%; } |
| | | .sp-hue { left: 63%; } |
| | | .sp-fill { padding-top: 60%; } |
| | | } |
| | | .sp-dragger { |
| | | border-radius: 5px; |
| | | height: 5px; |
| | | width: 5px; |
| | | border: 1px solid #fff; |
| | | background: #000; |
| | | cursor: pointer; |
| | | position:absolute; |
| | | top:0; |
| | | left: 0; |
| | | } |
| | | .sp-slider { |
| | | position: absolute; |
| | | top:0; |
| | | cursor:pointer; |
| | | height: 3px; |
| | | left: -1px; |
| | | right: -1px; |
| | | border: 1px solid #000; |
| | | background: white; |
| | | opacity: .8; |
| | | } |
| | | |
| | | /* |
| | | Theme authors: |
| | | Here are the basic themeable display options (colors, fonts, global widths). |
| | | See http://bgrins.github.io/spectrum/themes/ for instructions. |
| | | */ |
| | | |
| | | .sp-container { |
| | | border-radius: 0; |
| | | background-color: #ECECEC; |
| | | border: solid 1px #f0c49B; |
| | | padding: 0; |
| | | } |
| | | .sp-container, .sp-container button, .sp-container input, .sp-color, .sp-hue, .sp-clear { |
| | | font: normal 12px "Lucida Grande", "Lucida Sans Unicode", "Lucida Sans", Geneva, Verdana, sans-serif; |
| | | -webkit-box-sizing: border-box; |
| | | -moz-box-sizing: border-box; |
| | | -ms-box-sizing: border-box; |
| | | box-sizing: border-box; |
| | | } |
| | | .sp-top { |
| | | margin-bottom: 3px; |
| | | } |
| | | .sp-color, .sp-hue, .sp-clear { |
| | | border: solid 1px #666; |
| | | } |
| | | |
| | | /* Input */ |
| | | .sp-input-container { |
| | | float:right; |
| | | width: 100px; |
| | | margin-bottom: 4px; |
| | | } |
| | | .sp-initial-disabled .sp-input-container { |
| | | width: 100%; |
| | | } |
| | | .sp-input { |
| | | font-size: 12px !important; |
| | | border: 1px inset; |
| | | padding: 4px 5px; |
| | | margin: 0; |
| | | width: 100%; |
| | | background:transparent; |
| | | border-radius: 3px; |
| | | color: #222; |
| | | } |
| | | .sp-input:focus { |
| | | border: 1px solid orange; |
| | | } |
| | | .sp-input.sp-validation-error { |
| | | border: 1px solid red; |
| | | background: #fdd; |
| | | } |
| | | .sp-picker-container , .sp-palette-container { |
| | | float:left; |
| | | position: relative; |
| | | padding: 10px; |
| | | padding-bottom: 300px; |
| | | margin-bottom: -290px; |
| | | } |
| | | .sp-picker-container { |
| | | width: 172px; |
| | | border-left: solid 1px #fff; |
| | | } |
| | | |
| | | /* Palettes */ |
| | | .sp-palette-container { |
| | | border-right: solid 1px #ccc; |
| | | } |
| | | |
| | | .sp-palette-only .sp-palette-container { |
| | | border: 0; |
| | | } |
| | | |
| | | .sp-palette .sp-thumb-el { |
| | | display: block; |
| | | position:relative; |
| | | float:left; |
| | | width: 24px; |
| | | height: 15px; |
| | | margin: 3px; |
| | | cursor: pointer; |
| | | border:solid 2px transparent; |
| | | } |
| | | .sp-palette .sp-thumb-el:hover, .sp-palette .sp-thumb-el.sp-thumb-active { |
| | | border-color: orange; |
| | | } |
| | | .sp-thumb-el { |
| | | position:relative; |
| | | } |
| | | |
| | | /* Initial */ |
| | | .sp-initial { |
| | | float: left; |
| | | border: solid 1px #333; |
| | | } |
| | | .sp-initial span { |
| | | width: 30px; |
| | | height: 25px; |
| | | border:none; |
| | | display:block; |
| | | float:left; |
| | | margin:0; |
| | | } |
| | | |
| | | .sp-initial .sp-clear-display { |
| | | background-position: center; |
| | | } |
| | | |
| | | /* Buttons */ |
| | | .sp-palette-button-container, |
| | | .sp-button-container { |
| | | float: right; |
| | | } |
| | | |
| | | /* Replacer (the little preview div that shows up instead of the <input>) */ |
| | | .sp-replacer { |
| | | margin:0; |
| | | overflow:hidden; |
| | | cursor:pointer; |
| | | padding: 4px; |
| | | display:inline-block; |
| | | *zoom: 1; |
| | | *display: inline; |
| | | border: solid 1px #91765d; |
| | | background: #eee; |
| | | color: #333; |
| | | vertical-align: middle; |
| | | } |
| | | .sp-replacer:hover, .sp-replacer.sp-active { |
| | | border-color: #F0C49B; |
| | | color: #111; |
| | | } |
| | | .sp-replacer.sp-disabled { |
| | | cursor:default; |
| | | border-color: silver; |
| | | color: silver; |
| | | } |
| | | .sp-dd { |
| | | padding: 2px 0; |
| | | height: 16px; |
| | | line-height: 16px; |
| | | float:left; |
| | | font-size:10px; |
| | | } |
| | | .sp-preview { |
| | | position:relative; |
| | | width:25px; |
| | | height: 20px; |
| | | border: solid 1px #222; |
| | | margin-right: 5px; |
| | | float:left; |
| | | z-index: 0; |
| | | } |
| | | |
| | | .sp-palette { |
| | | *width: 220px; |
| | | max-width: 220px; |
| | | } |
| | | .sp-palette .sp-thumb-el { |
| | | width:16px; |
| | | height: 16px; |
| | | margin:2px 1px; |
| | | border: solid 1px #d0d0d0; |
| | | } |
| | | |
| | | .sp-container { |
| | | padding-bottom:0; |
| | | } |
| | | |
| | | |
| | | /* Buttons: http://hellohappy.org/css3-buttons/ */ |
| | | .sp-container button { |
| | | background-color: #eeeeee; |
| | | background-image: -webkit-linear-gradient(top, #eeeeee, #cccccc); |
| | | background-image: -moz-linear-gradient(top, #eeeeee, #cccccc); |
| | | background-image: -ms-linear-gradient(top, #eeeeee, #cccccc); |
| | | background-image: -o-linear-gradient(top, #eeeeee, #cccccc); |
| | | background-image: linear-gradient(to bottom, #eeeeee, #cccccc); |
| | | border: 1px solid #ccc; |
| | | border-bottom: 1px solid #bbb; |
| | | border-radius: 3px; |
| | | color: #333; |
| | | font-size: 14px; |
| | | line-height: 1; |
| | | padding: 5px 4px; |
| | | text-align: center; |
| | | text-shadow: 0 1px 0 #eee; |
| | | vertical-align: middle; |
| | | } |
| | | .sp-container button:hover { |
| | | background-color: #dddddd; |
| | | background-image: -webkit-linear-gradient(top, #dddddd, #bbbbbb); |
| | | background-image: -moz-linear-gradient(top, #dddddd, #bbbbbb); |
| | | background-image: -ms-linear-gradient(top, #dddddd, #bbbbbb); |
| | | background-image: -o-linear-gradient(top, #dddddd, #bbbbbb); |
| | | background-image: linear-gradient(to bottom, #dddddd, #bbbbbb); |
| | | border: 1px solid #bbb; |
| | | border-bottom: 1px solid #999; |
| | | cursor: pointer; |
| | | text-shadow: 0 1px 0 #ddd; |
| | | } |
| | | .sp-container button:active { |
| | | border: 1px solid #aaa; |
| | | border-bottom: 1px solid #888; |
| | | -webkit-box-shadow: inset 0 0 5px 2px #aaaaaa, 0 1px 0 0 #eeeeee; |
| | | -moz-box-shadow: inset 0 0 5px 2px #aaaaaa, 0 1px 0 0 #eeeeee; |
| | | -ms-box-shadow: inset 0 0 5px 2px #aaaaaa, 0 1px 0 0 #eeeeee; |
| | | -o-box-shadow: inset 0 0 5px 2px #aaaaaa, 0 1px 0 0 #eeeeee; |
| | | box-shadow: inset 0 0 5px 2px #aaaaaa, 0 1px 0 0 #eeeeee; |
| | | } |
| | | .sp-cancel { |
| | | font-size: 11px; |
| | | color: #d93f3f !important; |
| | | margin:0; |
| | | padding:2px; |
| | | margin-right: 5px; |
| | | vertical-align: middle; |
| | | text-decoration:none; |
| | | |
| | | } |
| | | .sp-cancel:hover { |
| | | color: #d93f3f !important; |
| | | text-decoration: underline; |
| | | } |
| | | |
| | | |
| | | .sp-palette span:hover, .sp-palette span.sp-thumb-active { |
| | | border-color: #000; |
| | | } |
| | | |
| | | .sp-preview, .sp-alpha, .sp-thumb-el { |
| | | position:relative; |
| | | background-image: url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAAwAAAAMCAIAAADZF8uwAAAAGUlEQVQYV2M4gwH+YwCGIasIUwhT25BVBADtzYNYrHvv4gAAAABJRU5ErkJggg==); |
| | | } |
| | | .sp-preview-inner, .sp-alpha-inner, .sp-thumb-inner { |
| | | display:block; |
| | | position:absolute; |
| | | top:0;left:0;bottom:0;right:0; |
| | | } |
| | | |
| | | .sp-palette .sp-thumb-inner { |
| | | background-position: 50% 50%; |
| | | background-repeat: no-repeat; |
| | | } |
| | | |
| | | .sp-palette .sp-thumb-light.sp-thumb-active .sp-thumb-inner { |
| | | background-image: url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAABIAAAASCAYAAABWzo5XAAAAGXRFWHRTb2Z0d2FyZQBBZG9iZSBJbWFnZVJlYWR5ccllPAAAAIVJREFUeNpiYBhsgJFMffxAXABlN5JruT4Q3wfi/0DsT64h8UD8HmpIPCWG/KemIfOJCUB+Aoacx6EGBZyHBqI+WsDCwuQ9mhxeg2A210Ntfo8klk9sOMijaURm7yc1UP2RNCMbKE9ODK1HM6iegYLkfx8pligC9lCD7KmRof0ZhjQACDAAceovrtpVBRkAAAAASUVORK5CYII=); |
| | | } |
| | | |
| | | .sp-palette .sp-thumb-dark.sp-thumb-active .sp-thumb-inner { |
| | | background-image: url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAABIAAAASCAYAAABWzo5XAAAAAXNSR0IArs4c6QAAAARnQU1BAACxjwv8YQUAAAAJcEhZcwAADsMAAA7DAcdvqGQAAAAadEVYdFNvZnR3YXJlAFBhaW50Lk5FVCB2My41LjEwMPRyoQAAAMdJREFUOE+tkgsNwzAMRMugEAahEAahEAZhEAqlEAZhEAohEAYh81X2dIm8fKpEspLGvudPOsUYpxE2BIJCroJmEW9qJ+MKaBFhEMNabSy9oIcIPwrB+afvAUFoK4H0tMaQ3XtlrggDhOVVMuT4E5MMG0FBbCEYzjYT7OxLEvIHQLY2zWwQ3D+9luyOQTfKDiFD3iUIfPk8VqrKjgAiSfGFPecrg6HN6m/iBcwiDAo7WiBeawa+Kwh7tZoSCGLMqwlSAzVDhoK+6vH4G0P5wdkAAAAASUVORK5CYII=); |
| | | } |
| | | |
| | | .sp-clear-display { |
| | | background-repeat:no-repeat; |
| | | background-position: center; |
| | | background-image: url(data:image/gif;base64,R0lGODlhFAAUAPcAAAAAAJmZmZ2dnZ6enqKioqOjo6SkpKWlpaampqenp6ioqKmpqaqqqqurq/Hx8fLy8vT09PX19ff39/j4+Pn5+fr6+vv7+wAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAAACH5BAEAAP8ALAAAAAAUABQAAAihAP9FoPCvoMGDBy08+EdhQAIJCCMybCDAAYUEARBAlFiQQoMABQhKUJBxY0SPICEYHBnggEmDKAuoPMjS5cGYMxHW3IiT478JJA8M/CjTZ0GgLRekNGpwAsYABHIypcAgQMsITDtWJYBR6NSqMico9cqR6tKfY7GeBCuVwlipDNmefAtTrkSzB1RaIAoXodsABiZAEFB06gIBWC1mLVgBa0AAOw==); |
| | | } |
New file |
| | |
| | | {"glyphs":{" ":{"ha":347,"x_min":0,"x_max":0,"o":""},"¨":{"ha":1389,"x_min":0,"x_max":0,"o":""},"©":{"ha":1389,"x_min":0,"x_max":0,"o":""},"®":{"ha":1389,"x_min":0,"x_max":0,"o":""},"´":{"ha":1389,"x_min":0,"x_max":0,"o":""},"Æ":{"ha":1389,"x_min":0,"x_max":0,"o":""},"Ø":{"ha":1389,"x_min":0,"x_max":0,"o":""},"™":{"ha":1389,"x_min":0,"x_max":0,"o":""},"∞":{"ha":1389,"x_min":0,"x_max":0,"o":""},"≠":{"ha":1389,"x_min":0,"x_max":0,"o":""},"":{"ha":1389,"x_min":72,"x_max":1317,"o":"m 1317 1046 q 1283 986 1317 1019 l 794 496 l 794 -99 l 1042 -99 q 1077 -114 1062 -99 q 1091 -149 1091 -129 q 1077 -184 1091 -169 q 1042 -198 1062 -198 l 347 -198 q 312 -184 327 -198 q 298 -149 298 -169 q 312 -114 298 -129 q 347 -99 327 -99 l 595 -99 l 595 496 l 105 986 q 72 1046 72 1019 q 86 1075 72 1064 q 115 1088 100 1085 q 149 1091 131 1091 l 1240 1091 q 1273 1088 1258 1091 q 1303 1075 1289 1085 q 1317 1046 1317 1064 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 1190 1017 l 1190 149 q 1164 80 1190 110 q 1097 33 1138 50 q 1017 8 1057 16 q 942 0 977 0 q 868 8 908 0 q 787 33 828 16 q 721 80 747 50 q 694 149 694 110 q 721 218 694 188 q 787 265 747 248 q 868 289 828 281 q 942 298 908 298 q 1091 267 1024 298 l 1091 684 l 496 500 l 496 -50 q 470 -119 496 -88 q 403 -165 443 -149 q 323 -190 363 -182 q 248 -198 283 -198 q 173 -190 213 -198 q 93 -165 133 -182 q 26 -119 53 -149 q 0 -50 0 -88 q 26 19 0 -11 q 93 66 53 50 q 173 91 133 83 q 248 99 213 99 q 397 69 329 99 l 397 818 q 412 862 397 842 q 450 890 426 882 l 1094 1088 q 1116 1091 1104 1091 q 1169 1070 1147 1091 q 1190 1017 1190 1048 z "},"":{"ha":1290,"x_min":0,"x_max":1290,"o":"m 791 300 q 842 351 791 300 q 893 546 893 402 q 791 791 893 689 q 546 893 689 893 q 300 791 402 893 q 198 546 198 689 q 300 300 198 402 q 546 198 402 198 q 791 300 689 198 m 1290 -99 q 1260 -169 1290 -140 q 1190 -198 1231 -198 q 1121 -169 1149 -198 l 855 96 q 546 0 716 0 q 334 43 435 0 q 159 159 233 86 q 43 334 86 233 q 0 546 0 435 q 43 758 0 656 q 159 932 86 859 q 334 1048 233 1005 q 546 1091 435 1091 q 758 1048 656 1091 q 932 932 859 1005 q 1048 758 1005 859 q 1091 546 1091 656 q 995 236 1091 375 l 1261 -29 q 1290 -99 1290 -58 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 1290 25 l 1290 620 q 1236 569 1265 592 q 906 307 1028 409 q 842 255 867 274 q 775 217 817 236 q 695 198 732 198 l 694 198 l 694 198 q 614 217 656 198 q 547 255 572 236 q 483 307 522 274 q 153 569 360 409 q 99 620 124 592 l 99 25 q 107 7 99 15 q 124 0 114 0 l 1265 0 q 1282 7 1275 0 q 1290 25 1290 15 m 1290 839 q 1290 848 1290 841 q 1290 858 1290 855 q 1289 868 1290 862 q 1287 878 1289 875 q 1283 885 1285 881 q 1276 891 1280 889 q 1265 893 1271 893 l 124 893 q 107 885 114 893 q 99 868 99 878 q 213 648 99 738 q 524 402 363 530 q 551 379 529 398 q 587 350 574 360 q 621 326 600 340 q 660 305 643 312 q 694 298 678 298 l 694 298 l 695 298 q 729 305 711 298 q 768 326 746 312 q 802 350 789 340 q 838 379 815 360 q 865 402 860 398 q 1176 648 1026 530 q 1254 737 1218 681 q 1290 839 1290 794 m 1389 868 l 1389 25 q 1352 -63 1389 -26 q 1265 -99 1316 -99 l 124 -99 q 36 -63 73 -99 q 0 25 0 -26 l 0 868 q 36 956 0 919 q 124 992 73 992 l 1265 992 q 1352 956 1316 992 q 1389 868 1389 919 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 729 -85 q 694 -99 715 -99 q 660 -85 674 -99 l 177 381 q 155 401 169 388 q 112 452 142 415 q 60 528 83 489 q 18 622 36 567 q 0 729 0 677 q 98 995 0 899 q 370 1091 197 1091 q 469 1075 419 1091 q 562 1030 519 1058 q 636 977 605 1001 q 694 924 667 952 q 753 977 722 952 q 827 1030 784 1001 q 920 1075 870 1058 q 1018 1091 970 1091 q 1290 995 1192 1091 q 1389 729 1389 899 q 1211 380 1389 557 l 729 -85 z "},"":{"ha":1290,"x_min":0,"x_max":1290,"o":"m 1290 689 q 1270 652 1290 672 l 988 377 l 1055 -10 q 1056 -26 1056 -16 q 1047 -53 1056 -42 q 1024 -64 1039 -64 q 993 -55 1009 -64 l 645 128 l 297 -55 q 266 -64 280 -64 q 241 -53 250 -64 q 233 -26 233 -42 q 235 -10 233 -21 l 301 377 l 19 652 q 0 689 0 673 q 43 725 0 718 l 432 781 l 607 1134 q 645 1166 622 1166 q 683 1134 668 1166 l 857 781 l 1246 725 q 1290 689 1290 718 z "},"":{"ha":1290,"x_min":0,"x_max":1290,"o":"m 881 412 l 1118 643 l 791 691 l 645 987 l 498 691 l 171 643 l 408 412 l 352 86 l 645 240 l 937 86 l 881 412 m 1290 689 q 1270 652 1290 672 l 988 377 l 1055 -10 q 1056 -26 1056 -16 q 1024 -64 1056 -64 q 993 -55 1009 -64 l 645 128 l 297 -55 q 266 -64 280 -64 q 241 -53 250 -64 q 233 -26 233 -42 q 235 -10 233 -21 l 301 377 l 19 652 q 0 689 0 673 q 43 725 0 718 l 432 781 l 607 1134 q 645 1166 622 1166 q 683 1134 668 1166 l 857 781 l 1246 725 q 1290 689 1290 718 z "},"":{"ha":992,"x_min":0,"x_max":992,"o":"m 992 106 q 944 -39 992 22 q 827 -99 895 -99 l 165 -99 q 48 -39 97 -99 q 0 106 0 22 q 7 231 0 172 q 31 348 13 289 q 76 450 49 408 q 149 519 104 492 q 253 546 195 546 q 496 446 355 446 q 739 546 637 446 q 843 519 798 546 q 916 450 888 492 q 961 348 943 408 q 985 231 979 289 q 992 106 992 172 m 706 1004 q 750 960 706 1004 q 794 794 794 917 q 706 583 794 670 q 496 496 619 496 q 286 583 373 496 q 198 794 198 670 q 286 1004 198 917 q 496 1091 373 1091 q 706 1004 619 1091 z "},"":{"ha":1488,"x_min":0,"x_max":1488,"o":"m 298 -50 l 298 50 q 283 84 298 70 q 248 99 268 99 l 149 99 q 114 84 129 99 q 99 50 99 70 l 99 -50 q 114 -84 99 -70 q 149 -99 129 -99 l 248 -99 q 283 -84 268 -99 q 298 -50 298 -70 m 298 248 l 298 347 q 283 382 298 367 q 248 397 268 397 l 149 397 q 114 382 129 397 q 99 347 99 367 l 99 248 q 114 213 99 228 q 149 198 129 198 l 248 198 q 283 213 268 198 q 298 248 298 228 m 298 546 l 298 645 q 283 680 298 665 q 248 694 268 694 l 149 694 q 114 680 129 694 q 99 645 99 665 l 99 546 q 114 511 99 525 q 149 496 129 496 l 248 496 q 283 511 268 496 q 298 546 298 525 m 1091 -50 l 1091 347 q 1077 382 1091 367 q 1042 397 1062 397 l 446 397 q 412 382 426 397 q 397 347 397 367 l 397 -50 q 412 -84 397 -70 q 446 -99 426 -99 l 1042 -99 q 1077 -84 1062 -99 q 1091 -50 1091 -70 m 298 843 l 298 942 q 283 977 298 963 q 248 992 268 992 l 149 992 q 114 977 129 992 q 99 942 99 963 l 99 843 q 114 808 99 823 q 149 794 129 794 l 248 794 q 283 808 268 794 q 298 843 298 823 m 1389 -50 l 1389 50 q 1374 84 1389 70 q 1339 99 1359 99 l 1240 99 q 1205 84 1220 99 q 1190 50 1190 70 l 1190 -50 q 1205 -84 1190 -70 q 1240 -99 1220 -99 l 1339 -99 q 1374 -84 1359 -99 q 1389 -50 1389 -70 m 1091 546 l 1091 942 q 1077 977 1091 963 q 1042 992 1062 992 l 446 992 q 412 977 426 992 q 397 942 397 963 l 397 546 q 412 511 397 525 q 446 496 426 496 l 1042 496 q 1077 511 1062 496 q 1091 546 1091 525 m 1389 248 l 1389 347 q 1374 382 1389 367 q 1339 397 1359 397 l 1240 397 q 1205 382 1220 397 q 1190 347 1190 367 l 1190 248 q 1205 213 1190 228 q 1240 198 1220 198 l 1339 198 q 1374 213 1359 198 q 1389 248 1389 228 m 1389 546 l 1389 645 q 1374 680 1389 665 q 1339 694 1359 694 l 1240 694 q 1205 680 1220 694 q 1190 645 1190 665 l 1190 546 q 1205 511 1190 525 q 1240 496 1220 496 l 1339 496 q 1374 511 1359 496 q 1389 546 1389 525 m 1389 843 l 1389 942 q 1374 977 1389 963 q 1339 992 1359 992 l 1240 992 q 1205 977 1220 992 q 1190 942 1190 963 l 1190 843 q 1205 808 1190 823 q 1240 794 1220 794 l 1339 794 q 1374 808 1359 794 q 1389 843 1389 823 m 1488 967 l 1488 -74 q 1452 -162 1488 -126 q 1364 -198 1415 -198 l 124 -198 q 36 -162 73 -198 q 0 -74 0 -126 l 0 967 q 36 1055 0 1018 q 124 1091 73 1091 l 1364 1091 q 1452 1055 1415 1091 q 1488 967 1488 1018 z "},"":{"ha":1290,"x_min":0,"x_max":1290,"o":"m 595 397 l 595 99 q 566 29 595 59 q 496 0 536 0 l 99 0 q 29 29 59 0 q 0 99 0 59 l 0 397 q 29 467 0 437 q 99 496 59 496 l 496 496 q 566 467 536 496 q 595 397 595 437 m 595 992 l 595 694 q 566 625 595 654 q 496 595 536 595 l 99 595 q 29 625 59 595 q 0 694 0 654 l 0 992 q 29 1062 0 1032 q 99 1091 59 1091 l 496 1091 q 566 1062 536 1091 q 595 992 595 1032 m 1290 397 l 1290 99 q 1260 29 1290 59 q 1190 0 1231 0 l 794 0 q 724 29 753 0 q 694 99 694 59 l 694 397 q 724 467 694 437 q 794 496 753 496 l 1190 496 q 1260 467 1231 496 q 1290 397 1290 437 m 1290 992 l 1290 694 q 1260 625 1290 654 q 1190 595 1231 595 l 794 595 q 724 625 753 595 q 694 694 694 654 l 694 992 q 724 1062 694 1032 q 794 1091 753 1091 l 1190 1091 q 1260 1062 1231 1091 q 1290 992 1290 1032 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 397 223 l 397 74 q 375 22 397 43 q 322 0 353 0 l 74 0 q 22 22 43 0 q 0 74 0 43 l 0 223 q 22 276 0 254 q 74 298 43 298 l 322 298 q 375 276 353 298 q 397 223 397 254 m 397 620 l 397 471 q 375 419 397 440 q 322 397 353 397 l 74 397 q 22 419 43 397 q 0 471 0 440 l 0 620 q 22 673 0 651 q 74 694 43 694 l 322 694 q 375 673 353 694 q 397 620 397 651 m 893 223 l 893 74 q 871 22 893 43 q 818 0 849 0 l 570 0 q 518 22 539 0 q 496 74 496 43 l 496 223 q 518 276 496 254 q 570 298 539 298 l 818 298 q 871 276 849 298 q 893 223 893 254 m 397 1017 l 397 868 q 375 815 397 837 q 322 794 353 794 l 74 794 q 22 815 43 794 q 0 868 0 837 l 0 1017 q 22 1070 0 1048 q 74 1091 43 1091 l 322 1091 q 375 1070 353 1091 q 397 1017 397 1048 m 893 620 l 893 471 q 871 419 893 440 q 818 397 849 397 l 570 397 q 518 419 539 397 q 496 471 496 440 l 496 620 q 518 673 496 651 q 570 694 539 694 l 818 694 q 871 673 849 694 q 893 620 893 651 m 1389 223 l 1389 74 q 1367 22 1389 43 q 1314 0 1345 0 l 1066 0 q 1014 22 1035 0 q 992 74 992 43 l 992 223 q 1014 276 992 254 q 1066 298 1035 298 l 1314 298 q 1367 276 1345 298 q 1389 223 1389 254 m 893 1017 l 893 868 q 871 815 893 837 q 818 794 849 794 l 570 794 q 518 815 539 794 q 496 868 496 837 l 496 1017 q 518 1070 496 1048 q 570 1091 539 1091 l 818 1091 q 871 1070 849 1091 q 893 1017 893 1048 m 1389 620 l 1389 471 q 1367 419 1389 440 q 1314 397 1345 397 l 1066 397 q 1014 419 1035 397 q 992 471 992 440 l 992 620 q 1014 673 992 651 q 1066 694 1035 694 l 1314 694 q 1367 673 1345 694 q 1389 620 1389 651 m 1389 1017 l 1389 868 q 1367 815 1389 837 q 1314 794 1345 794 l 1066 794 q 1014 815 1035 794 q 992 868 992 837 l 992 1017 q 1014 1070 992 1048 q 1066 1091 1035 1091 l 1314 1091 q 1367 1070 1345 1091 q 1389 1017 1389 1048 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 397 223 l 397 74 q 375 22 397 43 q 322 0 353 0 l 74 0 q 22 22 43 0 q 0 74 0 43 l 0 223 q 22 276 0 254 q 74 298 43 298 l 322 298 q 375 276 353 298 q 397 223 397 254 m 397 620 l 397 471 q 375 419 397 440 q 322 397 353 397 l 74 397 q 22 419 43 397 q 0 471 0 440 l 0 620 q 22 673 0 651 q 74 694 43 694 l 322 694 q 375 673 353 694 q 397 620 397 651 m 1389 223 l 1389 74 q 1367 22 1389 43 q 1314 0 1345 0 l 570 0 q 518 22 539 0 q 496 74 496 43 l 496 223 q 518 276 496 254 q 570 298 539 298 l 1314 298 q 1367 276 1345 298 q 1389 223 1389 254 m 397 1017 l 397 868 q 375 815 397 837 q 322 794 353 794 l 74 794 q 22 815 43 794 q 0 868 0 837 l 0 1017 q 22 1070 0 1048 q 74 1091 43 1091 l 322 1091 q 375 1070 353 1091 q 397 1017 397 1048 m 1389 620 l 1389 471 q 1367 419 1389 440 q 1314 397 1345 397 l 570 397 q 518 419 539 397 q 496 471 496 440 l 496 620 q 518 673 496 651 q 570 694 539 694 l 1314 694 q 1367 673 1345 694 q 1389 620 1389 651 m 1389 1017 l 1389 868 q 1367 815 1389 837 q 1314 794 1345 794 l 570 794 q 518 815 539 794 q 496 868 496 837 l 496 1017 q 518 1070 496 1048 q 570 1091 539 1091 l 1314 1091 q 1367 1070 1345 1091 q 1389 1017 1389 1048 z "},"":{"ha":1389,"x_min":94,"x_max":1295,"o":"m 1273 805 q 1295 752 1295 783 q 1273 699 1295 721 l 712 138 l 607 33 q 554 11 585 11 q 501 33 523 11 l 396 138 l 115 419 q 94 471 94 440 q 115 524 94 502 l 221 629 q 274 651 243 651 q 326 629 305 651 l 554 401 l 1063 910 q 1115 932 1084 932 q 1168 910 1146 932 l 1273 805 z "},"":{"ha":1091,"x_min":85,"x_max":1006,"o":"m 984 219 q 1006 166 1006 197 q 984 113 1006 135 l 879 8 q 826 -14 857 -14 q 773 8 795 -14 l 546 236 l 318 8 q 265 -14 296 -14 q 212 8 234 -14 l 107 113 q 85 166 85 135 q 107 219 85 197 l 335 446 l 107 674 q 85 727 85 696 q 107 780 85 758 l 212 885 q 265 907 234 907 q 318 885 296 907 l 546 657 l 773 885 q 826 907 795 907 q 879 885 857 907 l 984 780 q 1006 727 1006 758 q 984 674 1006 696 l 756 446 l 984 219 z "},"":{"ha":1290,"x_min":0,"x_max":1290,"o":"m 794 570 l 794 521 q 786 503 794 511 q 769 496 779 496 l 595 496 l 595 322 q 588 305 595 312 q 570 298 581 298 l 521 298 q 503 305 511 298 q 496 322 496 312 l 496 496 l 322 496 q 305 503 312 496 q 298 521 298 511 l 298 570 q 305 588 298 581 q 322 595 312 595 l 496 595 l 496 769 q 503 786 496 779 q 521 794 511 794 l 570 794 q 588 786 581 794 q 595 769 595 779 l 595 595 l 769 595 q 786 588 779 595 q 794 570 794 581 m 791 300 q 842 351 791 300 q 893 546 893 402 q 791 791 893 689 q 546 893 689 893 q 300 791 402 893 q 198 546 198 689 q 300 300 198 402 q 546 198 402 198 q 791 300 689 198 m 1261 -29 q 1290 -99 1290 -58 q 1261 -169 1290 -140 q 1190 -198 1232 -198 q 1121 -169 1149 -198 l 855 96 q 546 0 716 0 q 334 43 435 0 q 159 159 233 86 q 43 334 86 233 q 0 546 0 435 q 43 758 0 656 q 159 932 86 859 q 334 1048 233 1005 q 546 1091 435 1091 q 758 1048 656 1091 q 932 932 859 1005 q 1048 758 1005 859 q 1091 546 1091 656 q 995 236 1091 375 l 1261 -29 z "},"":{"ha":1290,"x_min":0,"x_max":1290,"o":"m 794 570 l 794 521 q 786 503 794 511 q 769 496 779 496 l 322 496 q 305 503 312 496 q 298 521 298 511 l 298 570 q 305 588 298 581 q 322 595 312 595 l 769 595 q 786 588 779 595 q 794 570 794 581 m 791 300 q 842 351 791 300 q 893 546 893 402 q 791 791 893 689 q 546 893 689 893 q 300 791 402 893 q 198 546 198 689 q 300 300 198 402 q 546 198 402 198 q 791 300 689 198 m 1261 -29 q 1290 -99 1290 -58 q 1261 -169 1290 -140 q 1190 -198 1232 -198 q 1121 -169 1149 -198 l 855 96 q 546 0 716 0 q 334 43 435 0 q 159 159 233 86 q 43 334 86 233 q 0 546 0 435 q 43 758 0 656 q 159 932 86 859 q 334 1048 233 1005 q 546 1091 435 1091 q 758 1048 656 1091 q 932 932 859 1005 q 1048 758 1005 859 q 1091 546 1091 656 q 995 236 1091 375 l 1261 -29 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 1190 496 q 1143 265 1190 375 q 1016 75 1096 155 q 826 -52 936 -5 q 595 -99 716 -99 q 364 -52 474 -99 q 174 75 254 -5 q 47 265 95 155 q 0 496 0 375 q 62 762 0 637 q 238 971 125 887 q 312 991 271 996 q 377 952 353 985 q 396 879 401 919 q 357 813 390 838 q 240 673 281 756 q 198 496 198 590 q 230 342 198 415 q 315 215 261 269 q 441 131 368 162 q 595 99 515 99 q 749 131 676 99 q 876 215 822 162 q 961 342 929 269 q 992 496 992 415 q 951 673 992 590 q 833 813 909 756 q 795 879 801 838 q 814 952 789 919 q 879 991 838 985 q 953 971 920 996 q 1128 762 1066 887 q 1190 496 1190 637 m 694 1091 l 694 595 q 665 525 694 555 q 595 496 636 496 q 525 525 555 496 q 496 595 496 555 l 496 1091 q 525 1161 496 1132 q 595 1190 555 1190 q 665 1161 636 1190 q 694 1091 694 1132 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 198 74 l 198 -74 q 191 -92 198 -85 q 174 -99 184 -99 l 25 -99 q 7 -92 14 -99 q 0 -74 0 -85 l 0 74 q 7 92 0 85 q 25 99 14 99 l 174 99 q 191 92 184 99 q 198 74 198 85 m 496 174 l 496 -74 q 489 -92 496 -85 q 471 -99 482 -99 l 322 -99 q 305 -92 312 -99 q 298 -74 298 -85 l 298 174 q 305 191 298 184 q 322 198 312 198 l 471 198 q 489 191 482 198 q 496 174 496 184 m 794 372 l 794 -74 q 787 -92 794 -85 q 769 -99 780 -99 l 620 -99 q 602 -92 609 -99 q 595 -74 595 -85 l 595 372 q 602 390 595 383 q 620 397 609 397 l 769 397 q 787 390 780 397 q 794 372 794 383 m 1091 670 l 1091 -74 q 1084 -92 1091 -85 q 1066 -99 1077 -99 l 918 -99 q 900 -92 907 -99 q 893 -74 893 -85 l 893 670 q 900 687 893 680 q 918 694 907 694 l 1066 694 q 1084 687 1077 694 q 1091 670 1091 680 m 1389 1066 l 1389 -74 q 1382 -92 1389 -85 q 1364 -99 1375 -99 l 1215 -99 q 1197 -92 1204 -99 q 1190 -74 1190 -85 l 1190 1066 q 1197 1084 1190 1077 q 1215 1091 1204 1091 l 1364 1091 q 1382 1084 1375 1091 q 1389 1066 1389 1077 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 736 356 q 765 385 736 356 q 794 496 794 414 q 736 636 794 578 q 595 694 677 694 q 455 636 513 694 q 397 496 397 578 q 455 356 397 414 q 595 298 513 298 q 736 356 677 298 m 1190 581 l 1190 408 q 1184 391 1190 399 q 1169 381 1178 382 l 1025 359 q 995 288 1011 317 q 1078 181 1022 250 q 1086 162 1086 172 q 1079 144 1086 152 q 1002 60 1058 115 q 929 5 946 5 q 909 12 920 5 l 802 96 q 732 67 768 78 q 709 -78 719 -39 q 681 -99 704 -99 l 509 -99 q 490 -93 498 -99 q 481 -76 482 -86 l 460 67 q 390 95 422 79 l 281 12 q 261 5 273 5 q 242 14 250 5 q 114 144 144 102 q 109 162 109 152 q 115 180 109 171 q 154 231 126 196 q 196 286 182 267 q 164 363 175 325 l 22 384 q 6 393 12 385 q 0 412 0 401 l 0 584 q 6 601 0 593 q 21 612 12 610 l 165 633 q 195 705 176 669 q 112 811 164 749 q 105 830 105 821 q 112 848 105 838 q 188 931 132 876 q 261 987 244 987 q 281 979 271 987 l 388 896 q 459 925 422 914 q 481 1070 471 1031 q 509 1091 487 1091 l 681 1091 q 700 1085 692 1091 q 709 1068 708 1078 l 731 925 q 801 897 769 913 l 911 980 q 929 987 918 987 q 949 979 939 987 q 1077 847 1049 887 q 1082 830 1082 841 q 1076 812 1082 821 q 1036 761 1064 796 q 994 706 1008 725 q 1026 630 1015 667 l 1168 608 q 1184 599 1178 607 q 1190 581 1190 591 z "},"":{"ha":1091,"x_min":0,"x_max":1091,"o":"m 397 620 l 397 174 q 390 156 397 163 q 372 149 383 149 l 322 149 q 305 156 312 149 q 298 174 298 163 l 298 620 q 305 638 298 631 q 322 645 312 645 l 372 645 q 390 638 383 645 q 397 620 397 631 m 595 620 l 595 174 q 588 156 595 163 q 570 149 581 149 l 521 149 q 503 156 510 149 q 496 174 496 163 l 496 620 q 503 638 496 631 q 521 645 510 645 l 570 645 q 588 638 581 645 q 595 620 595 631 m 794 620 l 794 174 q 787 156 794 163 q 769 149 780 149 l 719 149 q 701 156 708 149 q 694 174 694 163 l 694 620 q 701 638 694 631 q 719 645 708 645 l 769 645 q 787 638 780 645 q 794 620 794 631 m 893 59 l 893 794 l 198 794 l 198 59 q 204 28 198 42 q 215 7 209 13 q 223 0 221 0 l 868 0 q 876 7 870 0 q 887 28 882 13 q 893 59 893 42 m 372 893 l 719 893 l 682 984 q 669 992 677 991 l 423 992 q 410 984 415 991 l 372 893 m 1091 868 l 1091 818 q 1084 801 1091 808 q 1066 794 1077 794 l 992 794 l 992 59 q 956 -52 992 -5 q 868 -99 919 -99 l 223 -99 q 136 -54 172 -99 q 99 56 99 -9 l 99 794 l 25 794 q 7 801 14 794 q 0 818 0 808 l 0 868 q 7 886 0 879 q 25 893 14 893 l 264 893 l 319 1022 q 360 1071 330 1051 q 422 1091 391 1091 l 670 1091 q 731 1071 701 1091 q 773 1022 761 1051 l 827 893 l 1066 893 q 1084 886 1077 893 q 1091 868 1091 879 z "},"":{"ha":1290,"x_min":20,"x_max":1270,"o":"m 1091 422 l 1091 50 q 1077 15 1091 29 q 1042 0 1062 0 l 744 0 l 744 298 l 546 298 l 546 0 l 248 0 q 213 15 228 0 q 198 50 198 29 l 198 422 q 199 424 198 422 q 199 426 199 426 l 645 794 l 1090 426 q 1091 422 1091 425 m 1264 475 l 1216 418 q 1200 409 1210 411 l 1197 409 q 1181 415 1187 409 l 645 862 l 109 415 q 90 409 99 408 q 74 418 80 411 l 26 475 q 20 493 19 483 q 29 510 21 504 l 586 974 q 645 994 611 994 q 704 974 679 994 l 893 816 l 893 967 q 900 985 893 978 q 918 992 907 992 l 1066 992 q 1084 985 1077 992 q 1091 967 1091 978 l 1091 651 l 1261 510 q 1270 493 1269 504 q 1264 475 1270 483 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 1138 896 q 1175 837 1159 874 q 1190 769 1190 800 l 1190 -124 q 1169 -177 1190 -155 q 1116 -198 1147 -198 l 74 -198 q 22 -177 43 -198 q 0 -124 0 -155 l 0 1116 q 22 1169 0 1147 q 74 1190 43 1190 l 769 1190 q 837 1175 800 1190 q 896 1138 874 1159 l 1138 896 m 794 1085 l 794 794 l 1085 794 q 1068 825 1077 816 l 825 1068 q 794 1085 816 1077 m 1091 -99 l 1091 694 l 769 694 q 716 716 738 694 q 694 769 694 738 l 694 1091 l 99 1091 l 99 -99 l 1091 -99 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 694 769 l 694 422 q 687 404 694 411 q 670 397 680 397 l 422 397 q 404 404 411 397 q 397 422 397 411 l 397 471 q 404 489 397 482 q 422 496 411 496 l 595 496 l 595 769 q 602 787 595 780 q 620 794 609 794 l 670 794 q 687 787 680 794 q 694 769 694 780 m 960 284 q 989 333 960 284 q 1017 496 1017 381 q 960 708 1017 611 q 807 861 904 805 q 595 918 710 918 q 384 861 481 918 q 230 708 287 805 q 174 496 174 611 q 230 284 174 381 q 384 131 287 188 q 595 74 481 74 q 807 131 710 74 q 960 284 904 188 m 1111 795 q 1151 726 1111 795 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 z "},"":{"ha":1488,"x_min":39,"x_max":1449,"o":"m 861 419 l 861 422 l 842 670 q 834 687 842 680 q 816 694 826 694 l 672 694 q 654 687 662 694 q 646 670 646 680 l 627 422 l 627 419 q 633 403 626 409 q 649 397 640 397 l 839 397 q 855 403 848 397 q 861 419 862 409 m 1449 57 q 1414 0 1449 0 l 868 0 q 885 7 878 0 q 891 25 892 15 l 876 223 q 867 241 875 233 q 849 248 860 248 l 639 248 q 621 241 629 248 q 612 223 613 233 l 597 25 q 603 7 596 15 q 620 0 610 0 l 74 0 q 39 57 39 0 q 59 146 39 98 l 382 956 q 402 981 388 970 q 432 992 416 992 l 694 992 q 677 985 684 992 q 668 967 669 977 l 656 818 q 663 801 656 808 q 680 794 670 794 l 808 794 q 825 801 818 794 q 832 818 832 808 l 820 967 q 811 985 819 977 q 794 992 804 992 l 1056 992 q 1086 981 1072 992 q 1106 956 1100 970 l 1429 146 q 1449 57 1449 98 z "},"":{"ha":1290,"x_min":0,"x_max":1290,"o":"m 977 114 q 985 121 977 114 q 992 149 992 129 q 977 184 992 169 q 942 198 963 198 q 908 184 922 198 q 893 149 893 169 q 908 114 893 129 q 942 99 922 99 q 977 114 963 99 m 1176 114 q 1183 121 1176 114 q 1190 149 1190 129 q 1176 184 1190 169 q 1141 198 1161 198 q 1106 184 1121 198 q 1091 149 1091 169 q 1106 114 1091 129 q 1141 99 1121 99 q 1176 114 1161 99 m 1290 322 l 1290 74 q 1268 22 1290 43 q 1215 0 1246 0 l 74 0 q 22 22 43 0 q 0 74 0 43 l 0 322 q 22 375 0 353 q 74 397 43 397 l 435 397 l 539 291 q 645 248 584 248 q 750 291 705 248 l 856 397 l 1215 397 q 1268 375 1246 397 q 1290 322 1290 353 m 1038 763 q 1027 709 1051 732 l 680 362 q 645 347 666 347 q 610 362 624 347 l 263 709 q 252 763 239 732 q 298 794 265 794 l 496 794 l 496 1141 q 511 1176 496 1161 q 546 1190 525 1190 l 744 1190 q 779 1176 764 1190 q 794 1141 794 1161 l 794 794 l 992 794 q 1038 763 1025 794 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 868 471 q 860 453 868 462 l 613 205 q 595 198 605 198 q 577 205 586 198 l 329 453 q 324 481 318 466 q 347 496 330 496 l 496 496 l 496 769 q 503 787 496 780 q 521 794 510 794 l 670 794 q 687 787 680 794 q 694 769 694 780 l 694 496 l 843 496 q 861 489 854 496 q 868 471 868 482 m 807 861 q 758 889 807 861 q 595 918 710 918 q 384 861 481 918 q 230 708 287 805 q 174 496 174 611 q 230 284 174 381 q 384 131 287 188 q 595 74 481 74 q 807 131 710 74 q 960 284 904 188 q 1017 496 1017 381 q 960 708 1017 611 q 807 861 904 805 m 1111 795 q 1151 726 1111 795 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 867 512 q 843 496 860 496 l 694 496 l 694 223 q 687 205 694 212 q 670 198 680 198 l 521 198 q 503 205 510 198 q 496 223 496 212 l 496 496 l 347 496 q 329 503 336 496 q 322 521 322 510 q 330 539 322 530 l 577 787 q 595 794 586 794 q 613 787 605 794 l 861 539 q 867 512 873 526 m 807 861 q 758 889 807 861 q 595 918 710 918 q 384 861 481 918 q 230 708 287 805 q 174 496 174 611 q 230 284 174 381 q 384 131 287 188 q 595 74 481 74 q 807 131 710 74 q 960 284 904 188 q 1017 496 1017 381 q 960 708 1017 611 q 807 861 904 805 m 1111 795 q 1151 726 1111 795 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 793 446 l 1038 446 q 1036 453 1037 449 q 1034 459 1035 457 l 870 843 l 321 843 l 157 459 q 155 452 156 457 q 153 446 153 448 l 398 446 l 471 298 l 719 298 l 793 446 m 1190 423 l 1190 50 q 1176 15 1190 29 q 1141 0 1161 0 l 50 0 q 15 15 29 0 q 0 50 0 29 l 0 423 q 19 519 0 471 l 204 946 q 232 979 212 966 q 273 992 253 992 l 918 992 q 958 979 938 992 q 987 946 979 966 l 1171 519 q 1190 423 1190 471 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 893 539 q 918 496 918 525 q 893 453 918 467 l 471 205 q 446 198 460 198 q 422 205 434 198 q 397 248 397 219 l 397 744 q 422 787 397 773 q 471 787 447 801 l 893 539 m 960 284 q 989 333 960 284 q 1017 496 1017 381 q 960 708 1017 611 q 807 861 904 805 q 595 918 710 918 q 384 861 481 918 q 230 708 287 805 q 174 496 174 611 q 230 284 174 381 q 384 131 287 188 q 595 74 481 74 q 807 131 710 74 q 960 284 904 188 m 1111 795 q 1151 726 1111 795 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 1190 992 l 1190 645 q 1176 610 1190 625 q 1141 595 1161 595 l 794 595 q 748 626 761 595 q 759 680 735 656 l 866 787 q 595 893 751 893 q 441 861 515 893 q 315 777 368 830 q 230 650 261 723 q 198 496 198 577 q 230 342 198 415 q 315 215 261 269 q 441 131 368 162 q 595 99 515 99 q 770 140 687 99 q 908 253 852 180 q 926 263 914 261 q 946 256 938 263 l 1052 149 q 1059 133 1059 143 q 1053 115 1059 123 q 849 -43 969 13 q 595 -99 729 -99 q 364 -52 474 -99 q 174 75 254 -5 q 47 265 95 155 q 0 496 0 375 q 47 727 0 617 q 174 917 95 837 q 364 1044 254 997 q 595 1091 474 1091 q 816 1048 709 1091 q 1005 927 922 1005 l 1106 1027 q 1160 1038 1128 1051 q 1190 992 1190 1025 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 1171 372 q 1170 367 1171 368 q 963 30 1121 159 q 592 -99 805 -99 q 373 -57 479 -99 q 184 65 267 -14 l 84 -35 q 50 -50 70 -50 q 15 -35 29 -50 q 0 0 0 -20 l 0 347 q 15 382 0 367 q 50 397 29 397 l 397 397 q 432 382 417 397 q 446 347 446 367 q 432 312 446 327 l 326 206 q 450 127 381 155 q 595 99 520 99 q 789 150 699 99 q 933 288 879 200 q 974 379 942 301 q 997 397 980 397 l 1146 397 q 1164 389 1156 397 q 1171 372 1171 382 m 1190 992 l 1190 645 q 1176 610 1190 625 q 1141 595 1161 595 l 794 595 q 759 610 773 595 q 744 645 744 625 q 759 680 744 665 l 866 787 q 595 893 751 893 q 401 842 491 893 q 257 704 312 792 q 216 613 249 691 q 193 595 210 595 l 39 595 q 21 603 29 595 q 14 620 14 610 l 14 625 q 223 962 64 833 q 595 1091 382 1091 q 815 1048 708 1091 q 1005 927 922 1005 l 1106 1027 q 1141 1042 1121 1042 q 1176 1027 1161 1042 q 1190 992 1190 1012 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 298 273 l 298 223 q 290 206 298 213 q 273 198 283 198 l 223 198 q 206 206 213 198 q 198 223 198 213 l 198 273 q 206 290 198 283 q 223 298 213 298 l 273 298 q 290 290 283 298 q 298 273 298 283 m 298 471 l 298 422 q 290 404 298 412 q 273 397 283 397 l 223 397 q 206 404 213 397 q 198 422 198 412 l 198 471 q 206 489 198 481 q 223 496 213 496 l 273 496 q 290 489 283 496 q 298 471 298 481 m 298 670 l 298 620 q 290 603 298 610 q 273 595 283 595 l 223 595 q 206 603 213 595 q 198 620 198 610 l 198 670 q 206 687 198 680 q 223 694 213 694 l 273 694 q 290 687 283 694 q 298 670 298 680 m 1190 273 l 1190 223 q 1183 206 1190 213 q 1166 198 1176 198 l 422 198 q 404 206 412 198 q 397 223 397 213 l 397 273 q 404 290 397 283 q 422 298 412 298 l 1166 298 q 1183 290 1176 298 q 1190 273 1190 283 m 1190 471 l 1190 422 q 1183 404 1190 412 q 1166 397 1176 397 l 422 397 q 404 404 412 397 q 397 422 397 412 l 397 471 q 404 489 397 481 q 422 496 412 496 l 1166 496 q 1183 489 1176 496 q 1190 471 1190 481 m 1190 670 l 1190 620 q 1183 603 1190 610 q 1166 595 1176 595 l 422 595 q 404 603 412 595 q 397 620 397 610 l 397 670 q 404 687 397 680 q 422 694 412 694 l 1166 694 q 1183 687 1176 694 q 1190 670 1190 680 m 1290 124 l 1290 769 q 1282 786 1290 779 q 1265 794 1275 794 l 124 794 q 107 786 114 794 q 99 769 99 779 l 99 124 q 107 107 99 114 q 124 99 114 99 l 1265 99 q 1282 107 1275 99 q 1290 124 1290 114 m 1389 967 l 1389 124 q 1352 36 1389 73 q 1265 0 1316 0 l 124 0 q 36 36 73 0 q 0 124 0 73 l 0 967 q 36 1055 0 1018 q 124 1091 73 1091 l 1265 1091 q 1352 1055 1316 1091 q 1389 967 1389 1018 z "},"":{"ha":893,"x_min":0,"x_max":893,"o":"m 248 595 l 645 595 l 645 744 q 587 884 645 826 q 446 942 529 942 q 306 884 364 942 q 248 744 248 826 l 248 595 m 893 521 l 893 74 q 871 22 893 43 q 818 0 849 0 l 74 0 q 22 22 43 0 q 0 74 0 43 l 0 521 q 22 574 0 552 q 74 595 43 595 l 99 595 l 99 744 q 202 989 99 887 q 446 1091 304 1091 q 691 989 589 1091 q 794 744 794 887 l 794 595 l 818 595 q 871 574 849 595 q 893 521 893 552 z "},"":{"ha":1389,"x_min":50,"x_max":1389,"o":"m 248 992 q 198 907 248 936 l 198 -74 q 191 -92 198 -84 q 174 -99 184 -99 l 124 -99 q 107 -92 114 -99 q 99 -74 99 -84 l 99 907 q 50 992 50 936 q 79 1062 50 1033 q 149 1091 108 1091 q 219 1062 190 1091 q 248 992 248 1033 m 1389 942 l 1389 351 q 1379 321 1389 332 q 1349 300 1370 311 q 1063 210 1182 210 q 967 227 1015 210 q 883 264 918 244 q 793 301 847 284 q 683 319 739 319 q 323 205 534 319 q 298 198 310 198 q 263 213 277 198 q 248 248 248 228 l 248 823 q 272 866 248 848 q 333 899 288 877 q 660 992 516 992 q 815 970 742 992 q 984 901 887 947 q 1053 887 1014 887 q 1144 903 1094 887 q 1229 939 1193 919 q 1297 976 1265 960 q 1339 992 1329 992 q 1374 977 1359 992 q 1389 942 1389 963 z "},"":{"ha":1290,"x_min":0,"x_max":1290,"o":"m 1290 504 q 1243 260 1290 375 l 1228 222 l 1084 197 q 1014 91 1067 133 q 893 50 961 50 l 893 25 q 886 7 893 14 q 868 0 879 0 l 818 0 q 801 7 808 0 q 794 25 794 14 l 794 471 q 801 489 794 482 q 818 496 808 496 l 868 496 q 886 489 879 496 q 893 471 893 482 l 893 446 q 994 419 948 446 q 1066 345 1039 391 l 1118 354 q 1141 504 1141 428 q 1073 720 1141 618 q 889 882 1004 822 q 645 942 774 942 q 400 882 515 942 q 217 720 285 822 q 149 504 149 618 q 171 354 149 428 l 224 345 q 296 419 250 391 q 397 446 342 446 l 397 471 q 404 489 397 482 q 422 496 411 496 l 471 496 q 489 489 482 496 q 496 471 496 482 l 496 25 q 489 7 496 14 q 471 0 482 0 l 422 0 q 404 7 411 0 q 397 25 397 14 l 397 50 q 276 91 329 50 q 205 197 222 133 l 62 222 l 47 260 q 0 504 0 375 q 52 729 0 621 q 191 917 104 838 q 397 1044 277 997 q 645 1091 516 1091 q 893 1044 773 1091 q 1099 917 1012 997 q 1238 729 1186 838 q 1290 504 1290 621 z "},"":{"ha":595,"x_min":0,"x_max":595,"o":"m 595 918 l 595 74 q 581 40 595 54 q 546 25 566 25 q 511 40 525 25 l 253 298 l 50 298 q 15 312 29 298 q 0 347 0 327 l 0 645 q 15 680 0 665 q 50 694 29 694 l 253 694 l 511 953 q 546 967 525 967 q 581 953 566 967 q 595 918 595 938 z "},"":{"ha":893,"x_min":0,"x_max":893,"o":"m 595 918 l 595 74 q 581 40 595 54 q 546 25 566 25 q 511 40 525 25 l 253 298 l 50 298 q 15 312 29 298 q 0 347 0 327 l 0 645 q 15 680 0 665 q 50 694 29 694 l 253 694 l 511 953 q 546 967 525 967 q 581 953 566 967 q 595 918 595 938 m 860 606 q 876 581 860 606 q 893 496 893 555 q 860 386 893 437 q 773 314 827 336 q 753 310 765 310 q 718 324 733 310 q 704 360 704 339 q 713 387 704 376 q 736 407 722 398 q 762 424 749 415 q 784 452 775 434 q 794 496 794 470 q 784 540 794 522 q 762 568 775 558 q 736 586 749 577 q 713 605 722 594 q 704 632 704 616 q 718 668 704 653 q 753 682 733 682 q 773 678 765 682 q 860 606 827 657 z "},"":{"ha":1290,"x_min":0,"x_max":1290,"o":"m 595 918 l 595 74 q 581 40 595 54 q 546 25 566 25 q 511 40 525 25 l 253 298 l 50 298 q 15 312 29 298 q 0 347 0 327 l 0 645 q 15 680 0 665 q 50 694 29 694 l 253 694 l 511 953 q 546 967 525 967 q 581 953 566 967 q 595 918 595 938 m 860 606 q 876 581 860 606 q 893 496 893 555 q 860 386 893 437 q 773 314 827 336 q 753 310 765 310 q 718 324 733 310 q 704 360 704 339 q 713 387 704 376 q 736 407 722 398 q 762 424 749 415 q 784 452 775 434 q 794 496 794 470 q 784 540 794 522 q 762 568 775 558 q 736 586 749 577 q 713 605 722 594 q 704 632 704 616 q 718 668 704 653 q 753 682 733 682 q 773 678 765 682 q 860 606 827 657 m 1025 715 q 1058 665 1025 715 q 1091 496 1091 615 q 1025 277 1091 377 q 851 131 960 177 q 832 127 841 127 q 796 142 811 127 q 781 177 781 157 q 811 222 781 207 q 870 257 855 245 q 960 362 928 298 q 992 496 992 425 q 960 631 992 567 q 870 736 928 694 q 811 770 855 747 q 781 815 781 785 q 796 850 781 836 q 831 865 811 865 q 851 861 841 865 q 1025 715 960 815 m 1191 823 q 1240 749 1191 823 q 1290 496 1290 674 q 1191 169 1290 318 q 929 -51 1093 19 q 909 -55 919 -55 q 874 -40 889 -55 q 860 -5 860 -26 q 890 40 860 22 q 907 48 895 43 q 925 57 919 53 q 988 96 960 76 q 1137 272 1084 167 q 1190 496 1190 377 q 1137 720 1190 615 q 988 896 1084 825 q 925 935 960 916 q 907 944 919 939 q 890 952 895 949 q 860 997 860 970 q 874 1032 860 1018 q 909 1047 889 1047 q 929 1043 919 1047 q 1191 823 1093 973 z "},"":{"ha":1091,"x_min":0,"x_max":1091,"o":"m 298 298 l 298 198 l 198 198 l 198 298 l 298 298 m 298 893 l 298 794 l 198 794 l 198 893 l 298 893 m 893 893 l 893 794 l 794 794 l 794 893 l 893 893 m 99 100 l 397 100 l 397 397 l 99 397 l 99 100 m 99 694 l 397 694 l 397 992 l 99 992 l 99 694 m 694 694 l 992 694 l 992 992 l 694 992 l 694 694 m 496 496 l 496 0 l 0 0 l 0 496 l 496 496 m 893 99 l 893 0 l 794 0 l 794 99 l 893 99 m 1091 99 l 1091 0 l 992 0 l 992 99 l 1091 99 m 1091 496 l 1091 198 l 794 198 l 794 298 l 694 298 l 694 0 l 595 0 l 595 496 l 893 496 l 893 397 l 992 397 l 992 496 l 1091 496 m 496 1091 l 496 595 l 0 595 l 0 1091 l 496 1091 m 1091 1091 l 1091 595 l 595 595 l 595 1091 l 1091 1091 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 49 0 l 0 0 l 0 1091 l 49 1091 l 49 0 m 98 1 l 73 1 l 73 1091 l 98 1091 l 98 1 m 171 1 l 146 1 l 146 1091 l 171 1091 l 171 1 m 292 1 l 268 1 l 268 1091 l 292 1091 l 292 1 m 414 1 l 366 1 l 366 1091 l 414 1091 l 414 1 m 512 1 l 488 1 l 488 1091 l 512 1091 l 512 1 m 560 1 l 536 1 l 536 1091 l 560 1091 l 560 1 m 609 1 l 585 1 l 585 1091 l 609 1091 l 609 1 m 731 1 l 682 1 l 682 1091 l 731 1091 l 731 1 m 853 1 l 804 1 l 804 1091 l 853 1091 l 853 1 m 950 1 l 901 1 l 901 1091 l 950 1091 l 950 1 m 1048 1 l 999 1 l 999 1091 l 1048 1091 l 1048 1 m 1121 1 l 1072 1 l 1072 1091 l 1121 1091 l 1121 1 m 1267 1 l 1194 1 l 1194 1091 l 1267 1091 l 1267 1 m 1316 1 l 1291 1 l 1291 1091 l 1316 1091 l 1316 1 m 1389 0 l 1340 0 l 1340 1091 l 1389 1091 l 1389 0 z "},"":{"ha":1190,"x_min":0,"x_max":1174,"o":"m 318 773 q 333 788 318 773 q 347 843 347 802 q 318 913 347 884 q 248 942 289 942 q 178 913 207 942 q 149 843 149 884 q 178 773 149 802 q 248 744 207 744 q 318 773 289 744 m 1174 397 q 1146 327 1174 356 l 765 -54 q 694 -83 735 -83 q 625 -54 653 -83 l 71 501 q 21 579 41 529 q 0 670 0 629 l 0 992 q 29 1062 0 1032 q 99 1091 59 1091 l 422 1091 q 512 1071 463 1091 q 591 1021 562 1050 l 1146 467 q 1174 397 1174 437 z "},"":{"ha":1488,"x_min":0,"x_max":1472,"o":"m 318 773 q 333 788 318 773 q 347 843 347 802 q 318 913 347 884 q 248 942 289 942 q 178 913 207 942 q 149 843 149 884 q 178 773 149 802 q 248 744 207 744 q 318 773 289 744 m 1174 397 q 1146 327 1174 356 l 765 -54 q 694 -83 735 -83 q 625 -54 653 -83 l 71 501 q 21 579 41 529 q 0 670 0 629 l 0 992 q 29 1062 0 1032 q 99 1091 59 1091 l 422 1091 q 512 1071 463 1091 q 591 1021 562 1050 l 1146 467 q 1174 397 1174 437 m 1472 397 q 1443 327 1472 356 l 1063 -54 q 992 -83 1032 -83 q 946 -72 964 -83 q 905 -37 929 -61 l 1270 327 q 1298 397 1298 356 q 1270 467 1298 437 l 715 1021 q 636 1071 686 1050 q 546 1091 587 1091 l 719 1091 q 810 1071 760 1091 q 889 1021 860 1050 l 1443 467 q 1472 397 1472 437 z "},"":{"ha":1290,"x_min":8,"x_max":1284,"o":"m 1270 820 q 1284 720 1301 776 l 1071 18 q 1012 -65 1056 -32 q 917 -99 967 -99 l 202 -99 q 86 -58 142 -99 q 9 44 31 -16 q 8 143 -9 96 q 10 164 8 146 q 13 192 12 181 q 11 209 14 198 q 9 224 8 219 q 15 240 10 233 q 28 258 19 248 q 40 277 36 269 q 75 348 58 306 q 98 419 92 389 q 99 442 101 426 q 98 463 97 457 q 112 485 101 472 q 125 503 122 498 q 157 574 141 531 q 177 644 174 618 q 175 669 177 651 q 175 691 172 687 q 192 714 178 701 q 209 732 206 728 q 242 797 224 752 q 264 872 260 842 q 261 892 264 878 q 260 912 258 905 q 267 926 261 918 q 281 944 272 934 q 294 960 289 954 q 307 984 300 970 q 318 1011 313 998 q 331 1039 323 1024 q 346 1064 338 1054 q 366 1082 353 1073 q 394 1091 379 1090 q 431 1087 409 1091 l 430 1084 q 470 1091 460 1091 l 1059 1091 q 1148 1048 1117 1091 q 1162 947 1179 1004 l 949 245 q 894 126 922 153 q 794 99 867 99 l 121 99 q 91 88 100 99 q 91 54 83 75 q 202 0 109 0 l 918 0 q 961 12 940 0 q 988 44 982 24 l 1221 809 q 1225 853 1226 826 q 1270 820 1254 842 m 446 818 q 447 801 443 808 q 463 794 452 794 l 934 794 q 954 801 944 794 q 966 818 963 808 l 983 868 q 981 885 986 878 q 966 893 977 893 l 494 893 q 475 885 484 893 q 462 868 465 878 l 446 818 m 381 620 q 383 603 378 610 q 398 595 388 595 l 870 595 q 889 603 880 595 q 902 620 899 610 l 918 670 q 917 687 922 680 q 901 694 912 694 l 430 694 q 410 687 420 694 q 398 670 401 680 l 381 620 z "},"":{"ha":992,"x_min":0,"x_max":992,"o":"m 902 1091 q 936 1084 920 1091 q 977 1053 962 1074 q 992 1004 992 1031 l 992 5 q 977 -43 992 -21 q 936 -74 962 -64 q 902 -81 922 -81 q 838 -56 865 -81 l 496 273 l 154 -56 q 90 -81 126 -81 q 56 -74 72 -81 q 15 -43 30 -64 q 0 5 0 -21 l 0 1004 q 15 1053 0 1031 q 56 1084 30 1074 q 90 1091 72 1091 l 902 1091 z "},"":{"ha":1290,"x_min":0,"x_max":1290,"o":"m 298 0 l 992 0 l 992 198 l 298 198 l 298 0 m 298 496 l 992 496 l 992 794 l 868 794 q 815 815 837 794 q 794 868 794 837 l 794 992 l 298 992 l 298 496 m 1176 412 q 1183 419 1176 412 q 1190 446 1190 426 q 1176 481 1190 467 q 1141 496 1161 496 q 1106 481 1121 496 q 1091 446 1091 467 q 1106 412 1091 426 q 1141 397 1121 397 q 1176 412 1161 397 m 1290 446 l 1290 124 q 1282 107 1290 114 q 1265 99 1275 99 l 1091 99 l 1091 -25 q 1070 -78 1091 -56 q 1017 -99 1048 -99 l 273 -99 q 220 -78 242 -99 q 198 -25 198 -56 l 198 99 l 25 99 q 7 107 15 99 q 0 124 0 114 l 0 446 q 44 551 0 508 q 149 595 88 595 l 198 595 l 198 1017 q 220 1070 198 1048 q 273 1091 242 1091 l 794 1091 q 862 1076 825 1091 q 921 1039 899 1060 l 1039 921 q 1076 862 1060 899 q 1091 794 1091 825 l 1091 595 l 1141 595 q 1246 551 1202 595 q 1290 446 1290 508 z "},"":{"ha":1488,"x_min":0,"x_max":1488,"o":"m 586 604 q 619 637 586 604 q 744 670 652 670 q 902 604 836 670 q 967 446 967 539 q 902 289 967 354 q 744 223 836 223 q 586 289 652 223 q 521 446 521 354 q 586 604 521 539 m 1290 992 q 1430 934 1372 992 q 1488 794 1488 876 l 1488 99 q 1430 -41 1488 17 q 1290 -99 1372 -99 l 198 -99 q 58 -41 116 -99 q 0 99 0 17 l 0 794 q 58 934 0 876 q 198 992 116 992 l 372 992 l 412 1097 q 465 1163 426 1135 q 546 1190 505 1190 l 942 1190 q 1023 1163 984 1190 q 1077 1097 1062 1135 l 1116 992 l 1290 992 m 499 201 q 550 150 499 201 q 744 99 601 99 q 989 201 887 99 q 1091 446 1091 303 q 989 692 1091 590 q 744 794 887 794 q 499 692 601 794 q 397 446 397 590 q 499 201 397 303 z "},"":{"ha":1290,"x_min":0,"x_max":1290,"o":"m 562 757 l 430 408 q 536 407 456 408 q 660 405 616 405 q 705 407 675 405 q 562 757 637 603 m 0 -99 l 2 -38 q 45 -28 19 -33 q 89 -20 71 -24 q 127 -9 108 -16 q 162 14 147 -2 q 186 53 177 29 l 370 530 l 587 1091 l 645 1091 l 686 1091 q 694 1075 692 1080 l 853 703 q 935 503 879 643 q 1024 291 992 364 q 1069 179 1035 264 q 1125 48 1102 93 q 1152 4 1140 13 q 1220 -19 1166 -8 q 1285 -35 1273 -30 q 1290 -79 1290 -64 q 1289 -90 1290 -83 q 1289 -99 1289 -96 q 1142 -93 1240 -99 q 994 -87 1043 -87 q 827 -92 935 -87 q 689 -98 719 -98 q 692 -38 689 -65 l 794 -16 q 803 -14 794 -16 q 815 -12 812 -12 q 827 -8 818 -11 q 838 -3 835 -5 q 847 3 842 -1 q 854 12 852 7 q 856 22 856 16 q 832 97 856 35 q 776 235 808 160 q 743 312 744 310 l 395 314 q 335 162 374 269 q 296 36 296 56 q 307 7 296 19 q 341 -12 318 -5 q 378 -22 363 -19 q 422 -29 393 -26 q 454 -32 452 -32 q 455 -77 455 -47 q 453 -98 455 -84 q 318 -90 408 -98 q 183 -82 228 -82 q 162 -85 177 -82 q 146 -88 148 -88 q 0 -99 84 -99 z "},"":{"ha":1091,"x_min":0,"x_max":1091,"o":"m 430 12 q 539 -13 488 -13 q 830 246 830 -13 q 798 386 830 335 q 751 443 777 420 q 698 479 724 467 q 636 499 673 492 q 571 507 599 505 q 498 508 543 508 q 419 501 441 508 q 419 377 419 460 q 419 255 419 295 q 418 203 419 249 q 417 128 417 157 q 421 63 418 99 q 430 12 424 27 m 419 590 q 504 584 452 584 q 615 594 567 584 q 700 629 662 605 q 758 698 738 653 q 777 808 777 743 q 755 903 777 863 q 694 967 732 944 q 610 1001 655 990 q 514 1011 565 1011 q 413 1001 475 1011 q 416 884 413 963 q 419 767 419 806 q 419 705 419 746 q 419 643 419 663 q 419 590 419 608 m 0 -99 l 2 -26 q 67 -14 13 -23 q 150 7 122 -5 q 159 28 155 16 q 166 54 164 40 q 170 79 168 68 q 172 108 172 90 q 173 134 173 126 q 173 162 173 143 q 173 185 173 181 q 156 980 173 946 q 139 991 153 986 q 104 999 125 996 q 66 1005 84 1003 q 28 1008 48 1007 q 5 1011 9 1010 l 2 1075 q 265 1084 78 1077 q 554 1091 453 1091 q 607 1091 572 1091 q 660 1090 642 1090 q 765 1080 714 1090 q 865 1048 817 1070 q 949 993 913 1025 q 1006 912 984 960 q 1028 805 1028 863 q 1015 731 1028 765 q 985 675 1002 698 q 935 631 967 653 q 878 596 902 608 q 813 565 854 584 q 1012 461 932 538 q 1091 269 1091 384 q 1064 130 1091 191 q 992 29 1037 68 q 885 -38 946 -11 q 758 -75 823 -64 q 622 -86 693 -86 q 519 -84 587 -86 q 417 -81 451 -81 q 179 -90 335 -81 q 0 -99 23 -98 z "},"":{"ha":794,"x_min":0,"x_max":794,"o":"m 0 -98 l 13 -32 q 61 -19 30 -26 q 117 -4 91 -12 q 163 14 142 3 q 195 92 184 41 q 243 316 195 98 q 331 737 290 535 q 371 967 372 940 l 371 987 q 329 1001 353 997 q 275 1007 305 1005 q 230 1011 245 1009 l 245 1091 q 338 1086 270 1090 q 454 1081 405 1083 q 547 1079 502 1079 q 624 1081 584 1079 q 717 1086 663 1083 q 794 1091 772 1090 q 779 1022 790 1061 q 700 1000 756 1015 q 616 974 645 986 q 605 941 610 960 q 598 910 601 923 q 593 875 596 898 q 587 842 589 853 q 520 517 567 728 q 460 242 473 307 q 450 197 458 235 q 434 127 441 159 q 422 62 427 95 q 417 18 416 29 l 418 4 q 561 -20 431 1 q 549 -97 559 -54 q 524 -98 540 -97 q 498 -99 507 -99 q 431 -91 476 -99 q 364 -84 386 -84 q 205 -82 257 -82 q 94 -89 165 -82 q 0 -98 22 -96 z "},"":{"ha":1389,"x_min":0,"x_max":1384,"o":"m 1352 99 q 1384 85 1377 99 q 1376 50 1391 71 l 1278 -75 q 1240 -95 1263 -95 q 1202 -75 1218 -95 l 1104 50 q 1096 85 1089 71 q 1128 99 1103 99 l 1190 99 l 1190 893 l 1128 893 q 1096 907 1103 893 q 1104 942 1089 922 l 1202 1067 q 1240 1087 1218 1087 q 1278 1067 1263 1087 l 1376 942 q 1384 907 1391 922 q 1352 893 1377 893 l 1290 893 l 1290 99 l 1352 99 m 63 1090 l 105 1070 q 268 1066 114 1066 q 370 1067 302 1066 q 473 1069 439 1069 q 556 1068 501 1069 q 639 1068 612 1068 l 867 1068 q 883 1068 871 1068 q 899 1068 894 1067 q 911 1070 903 1068 q 925 1077 919 1072 q 936 1090 930 1082 l 969 1091 q 980 1091 972 1091 q 991 1090 987 1090 q 992 830 992 1004 q 988 746 992 768 q 935 732 958 735 q 894 831 916 766 q 885 868 891 838 q 874 925 879 898 q 868 953 869 952 q 859 962 863 959 q 847 967 854 966 q 837 969 839 968 q 823 969 834 970 q 810 969 811 969 q 758 969 797 969 q 701 970 720 970 q 651 968 681 970 q 596 963 621 966 q 590 858 589 901 q 591 557 590 785 q 593 205 593 329 q 591 149 593 192 q 591 78 589 106 q 601 25 593 50 q 697 -8 632 9 q 790 -37 762 -25 q 794 -76 794 -68 q 791 -98 794 -87 l 765 -99 q 596 -93 706 -101 q 436 -85 486 -85 q 319 -92 397 -85 q 201 -99 240 -99 q 198 -59 198 -60 l 198 -52 q 246 -19 212 -31 q 322 4 281 -6 q 383 25 364 14 q 398 322 398 57 q 395 556 398 400 q 393 791 393 713 l 393 882 q 393 894 393 884 q 394 913 394 904 q 393 933 394 922 q 391 952 392 944 q 387 963 389 960 q 261 972 378 972 q 189 963 236 972 q 127 942 143 953 q 101 886 112 932 q 76 800 89 840 q 43 759 64 760 q 0 793 11 779 l 0 1090 l 63 1090 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 63 1090 l 105 1070 q 268 1066 114 1066 q 370 1067 302 1066 q 473 1069 439 1069 q 664 1070 527 1069 q 900 1070 801 1070 q 1091 1066 999 1070 q 1135 1090 1117 1066 l 1167 1091 q 1178 1091 1170 1091 q 1189 1090 1186 1090 q 1190 830 1190 1004 q 1187 746 1190 768 q 1134 732 1156 735 q 1092 831 1115 766 q 1084 868 1090 838 q 1072 925 1077 898 q 1066 953 1066 952 q 1046 967 1059 963 q 994 969 1042 969 q 922 970 971 969 q 842 970 873 970 q 770 969 811 970 q 695 963 728 967 q 689 858 688 901 l 690 740 l 690 780 q 691 661 690 738 q 692 522 691 584 q 692 403 692 459 q 690 348 692 391 q 690 277 688 305 q 700 223 692 249 q 796 190 731 207 q 889 161 861 174 q 893 122 893 130 q 891 100 893 112 l 864 99 q 695 105 805 98 q 535 113 585 113 q 418 106 496 113 q 300 99 339 99 q 298 140 298 139 l 298 146 q 345 180 311 167 q 422 202 380 192 q 482 223 463 212 q 491 281 488 236 q 496 393 494 326 q 497 513 497 461 q 496 632 497 566 q 496 701 496 699 q 494 718 496 707 q 492 736 492 729 q 493 770 492 741 q 493 826 493 798 q 493 885 494 854 q 491 938 493 917 q 486 963 489 959 q 360 972 477 972 q 234 961 329 972 q 127 942 140 951 q 101 887 112 933 q 76 801 89 841 q 43 759 64 760 q 0 793 11 779 l 0 1090 l 63 1090 m 1015 97 q 1048 82 1025 97 q 1092 50 1071 67 q 1139 12 1114 33 q 1166 -12 1163 -9 q 1187 -50 1187 -28 q 1166 -88 1187 -71 q 1139 -111 1163 -90 q 1092 -149 1114 -132 q 1048 -181 1071 -166 q 1015 -196 1025 -196 q 999 -188 1005 -196 q 992 -166 994 -180 q 990 -140 990 -152 q 991 -114 990 -128 q 992 -99 992 -101 l 198 -99 q 200 -114 198 -101 q 201 -140 201 -128 q 199 -166 201 -152 q 191 -188 197 -180 q 175 -196 185 -196 q 143 -181 166 -196 q 98 -149 119 -166 q 52 -111 77 -132 q 24 -88 27 -90 q 4 -50 4 -71 q 24 -12 4 -28 q 52 12 27 -9 q 98 50 77 33 q 143 82 119 67 q 175 97 166 97 q 191 89 185 97 q 199 67 197 81 q 201 41 201 53 q 200 15 201 29 q 198 0 198 2 l 992 0 q 991 15 992 2 q 990 41 990 29 q 992 67 990 53 q 999 89 994 81 q 1015 97 1005 97 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 1389 149 l 1389 50 q 1374 15 1389 29 q 1339 0 1359 0 l 50 0 q 15 15 29 0 q 0 50 0 29 l 0 149 q 15 184 0 169 q 50 198 29 198 l 1339 198 q 1374 184 1359 198 q 1389 149 1389 169 m 1091 446 l 1091 347 q 1077 312 1091 327 q 1042 298 1062 298 l 50 298 q 15 312 29 298 q 0 347 0 327 l 0 446 q 15 481 0 467 q 50 496 29 496 l 1042 496 q 1077 481 1062 496 q 1091 446 1091 467 m 1290 744 l 1290 645 q 1275 610 1290 625 q 1240 595 1260 595 l 50 595 q 15 610 29 595 q 0 645 0 625 l 0 744 q 15 779 0 764 q 50 794 29 794 l 1240 794 q 1275 779 1260 794 q 1290 744 1290 764 m 992 1042 l 992 942 q 977 908 992 922 q 942 893 963 893 l 50 893 q 15 908 29 893 q 0 942 0 922 l 0 1042 q 15 1077 0 1062 q 50 1091 29 1091 l 942 1091 q 977 1077 963 1091 q 992 1042 992 1062 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 1389 149 l 1389 50 q 1374 15 1389 29 q 1339 0 1359 0 l 50 0 q 15 15 29 0 q 0 50 0 29 l 0 149 q 15 184 0 169 q 50 198 29 198 l 1339 198 q 1374 184 1359 198 q 1389 149 1389 169 m 1091 446 l 1091 347 q 1077 312 1091 327 q 1042 298 1062 298 l 347 298 q 312 312 327 298 q 298 347 298 327 l 298 446 q 312 481 298 467 q 347 496 327 496 l 1042 496 q 1077 481 1062 496 q 1091 446 1091 467 m 1290 744 l 1290 645 q 1275 610 1290 625 q 1240 595 1260 595 l 149 595 q 114 610 129 595 q 99 645 99 625 l 99 744 q 114 779 99 764 q 149 794 129 794 l 1240 794 q 1275 779 1260 794 q 1290 744 1290 764 m 992 1042 l 992 942 q 977 908 992 922 q 942 893 963 893 l 446 893 q 412 908 426 893 q 397 942 397 922 l 397 1042 q 412 1077 397 1062 q 446 1091 426 1091 l 942 1091 q 977 1077 963 1091 q 992 1042 992 1062 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 1389 149 l 1389 50 q 1374 15 1389 29 q 1339 0 1359 0 l 50 0 q 15 15 29 0 q 0 50 0 29 l 0 149 q 15 184 0 169 q 50 198 29 198 l 1339 198 q 1374 184 1359 198 q 1389 149 1389 169 m 1389 446 l 1389 347 q 1374 312 1389 327 q 1339 298 1359 298 l 347 298 q 312 312 327 298 q 298 347 298 327 l 298 446 q 312 481 298 467 q 347 496 327 496 l 1339 496 q 1374 481 1359 496 q 1389 446 1389 467 m 1389 744 l 1389 645 q 1374 610 1389 625 q 1339 595 1359 595 l 149 595 q 114 610 129 595 q 99 645 99 625 l 99 744 q 114 779 99 764 q 149 794 129 794 l 1339 794 q 1374 779 1359 794 q 1389 744 1389 764 m 1389 1042 l 1389 942 q 1374 908 1389 922 q 1339 893 1359 893 l 446 893 q 412 908 426 893 q 397 942 397 922 l 397 1042 q 412 1077 397 1062 q 446 1091 426 1091 l 1339 1091 q 1374 1077 1359 1091 q 1389 1042 1389 1062 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 1389 149 l 1389 50 q 1374 15 1389 29 q 1339 0 1359 0 l 50 0 q 15 15 29 0 q 0 50 0 29 l 0 149 q 15 184 0 169 q 50 198 29 198 l 1339 198 q 1374 184 1359 198 q 1389 149 1389 169 m 1389 446 l 1389 347 q 1374 312 1389 327 q 1339 298 1359 298 l 50 298 q 15 312 29 298 q 0 347 0 327 l 0 446 q 15 481 0 467 q 50 496 29 496 l 1339 496 q 1374 481 1359 496 q 1389 446 1389 467 m 1389 744 l 1389 645 q 1374 610 1389 625 q 1339 595 1359 595 l 50 595 q 15 610 29 595 q 0 645 0 625 l 0 744 q 15 779 0 764 q 50 794 29 794 l 1339 794 q 1374 779 1359 794 q 1389 744 1389 764 m 1389 1042 l 1389 942 q 1374 908 1389 922 q 1339 893 1359 893 l 50 893 q 15 908 29 893 q 0 942 0 922 l 0 1042 q 15 1077 0 1062 q 50 1091 29 1091 l 1339 1091 q 1374 1077 1359 1091 q 1389 1042 1389 1062 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 198 174 l 198 25 q 191 7 198 15 q 174 0 184 0 l 25 0 q 7 7 15 0 q 0 25 0 15 l 0 174 q 7 191 0 184 q 25 198 15 198 l 174 198 q 191 191 184 198 q 198 174 198 184 m 198 471 l 198 322 q 191 305 198 312 q 174 298 184 298 l 25 298 q 7 305 15 298 q 0 322 0 312 l 0 471 q 7 489 0 481 q 25 496 15 496 l 174 496 q 191 489 184 496 q 198 471 198 481 m 198 769 l 198 620 q 191 603 198 610 q 174 595 184 595 l 25 595 q 7 603 15 595 q 0 620 0 610 l 0 769 q 7 786 0 779 q 25 794 15 794 l 174 794 q 191 786 184 794 q 198 769 198 779 m 1389 174 l 1389 25 q 1382 7 1389 15 q 1364 0 1374 0 l 322 0 q 305 7 312 0 q 298 25 298 15 l 298 174 q 305 191 298 184 q 322 198 312 198 l 1364 198 q 1382 191 1374 198 q 1389 174 1389 184 m 198 1066 l 198 918 q 191 900 198 908 q 174 893 184 893 l 25 893 q 7 900 15 893 q 0 918 0 908 l 0 1066 q 7 1084 0 1077 q 25 1091 15 1091 l 174 1091 q 191 1084 184 1091 q 198 1066 198 1077 m 1389 471 l 1389 322 q 1382 305 1389 312 q 1364 298 1374 298 l 322 298 q 305 305 312 298 q 298 322 298 312 l 298 471 q 305 489 298 481 q 322 496 312 496 l 1364 496 q 1382 489 1374 496 q 1389 471 1389 481 m 1389 769 l 1389 620 q 1382 603 1389 610 q 1364 595 1374 595 l 322 595 q 305 603 312 595 q 298 620 298 610 l 298 769 q 305 786 298 779 q 322 794 312 794 l 1364 794 q 1382 786 1374 794 q 1389 769 1389 779 m 1389 1066 l 1389 918 q 1382 900 1389 908 q 1364 893 1374 893 l 322 893 q 305 900 312 893 q 298 918 298 908 l 298 1066 q 305 1084 298 1077 q 322 1091 312 1091 l 1364 1091 q 1382 1084 1374 1091 q 1389 1066 1389 1077 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 298 769 l 298 322 q 290 305 298 312 q 273 298 283 298 q 255 305 262 298 l 32 528 q 25 546 25 535 q 32 563 25 556 l 255 787 q 273 794 262 794 q 290 786 283 794 q 298 769 298 779 m 1389 174 l 1389 25 q 1382 7 1389 15 q 1364 0 1374 0 l 25 0 q 7 7 15 0 q 0 25 0 15 l 0 174 q 7 191 0 184 q 25 198 15 198 l 1364 198 q 1382 191 1374 198 q 1389 174 1389 184 m 1389 471 l 1389 322 q 1382 305 1389 312 q 1364 298 1374 298 l 521 298 q 503 305 511 298 q 496 322 496 312 l 496 471 q 503 489 496 481 q 521 496 511 496 l 1364 496 q 1382 489 1374 496 q 1389 471 1389 481 m 1389 769 l 1389 620 q 1382 603 1389 610 q 1364 595 1374 595 l 521 595 q 503 603 511 595 q 496 620 496 610 l 496 769 q 503 786 496 779 q 521 794 511 794 l 1364 794 q 1382 786 1374 794 q 1389 769 1389 779 m 1389 1066 l 1389 918 q 1382 900 1389 908 q 1364 893 1374 893 l 25 893 q 7 900 15 893 q 0 918 0 908 l 0 1066 q 7 1084 0 1077 q 25 1091 15 1091 l 1364 1091 q 1382 1084 1374 1091 q 1389 1066 1389 1077 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 266 563 q 273 546 273 556 q 266 528 273 535 l 43 305 q 25 298 36 298 q 7 305 15 298 q 0 322 0 312 l 0 769 q 7 786 0 779 q 25 794 15 794 q 43 787 36 794 l 266 563 m 1389 174 l 1389 25 q 1382 7 1389 15 q 1364 0 1374 0 l 25 0 q 7 7 15 0 q 0 25 0 15 l 0 174 q 7 191 0 184 q 25 198 15 198 l 1364 198 q 1382 191 1374 198 q 1389 174 1389 184 m 1389 471 l 1389 322 q 1382 305 1389 312 q 1364 298 1374 298 l 521 298 q 503 305 511 298 q 496 322 496 312 l 496 471 q 503 489 496 481 q 521 496 511 496 l 1364 496 q 1382 489 1374 496 q 1389 471 1389 481 m 1389 769 l 1389 620 q 1382 603 1389 610 q 1364 595 1374 595 l 521 595 q 503 603 511 595 q 496 620 496 610 l 496 769 q 503 786 496 779 q 521 794 511 794 l 1364 794 q 1382 786 1374 794 q 1389 769 1389 779 m 1389 1066 l 1389 918 q 1382 900 1389 908 q 1364 893 1374 893 l 25 893 q 7 900 15 893 q 0 918 0 908 l 0 1066 q 7 1084 0 1077 q 25 1091 15 1091 l 1364 1091 q 1382 1084 1374 1091 q 1389 1066 1389 1077 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 1389 918 l 1389 74 q 1359 29 1389 42 q 1339 25 1349 25 q 1304 40 1318 25 l 992 352 l 992 223 q 927 65 992 131 q 769 0 861 0 l 223 0 q 65 65 131 0 q 0 223 0 131 l 0 769 q 65 927 0 861 q 223 992 131 992 l 769 992 q 927 927 861 992 q 992 769 992 861 l 992 641 l 1304 953 q 1339 967 1318 967 q 1359 963 1349 967 q 1389 918 1389 950 z "},"":{"ha":1488,"x_min":0,"x_max":1488,"o":"m 453 849 q 474 828 453 849 q 496 744 496 806 q 453 639 496 682 q 347 595 409 595 q 242 639 285 595 q 198 744 198 682 q 242 849 198 806 q 347 893 285 893 q 453 849 409 893 m 1290 446 l 1290 99 l 198 99 l 198 248 l 446 496 l 570 372 l 967 769 l 1290 446 m 1364 992 l 124 992 q 107 985 114 992 q 99 967 99 977 l 99 25 q 107 7 99 15 q 124 0 114 0 l 1364 0 q 1382 7 1374 0 q 1389 25 1389 15 l 1389 967 q 1382 985 1389 977 q 1364 992 1374 992 m 1488 967 l 1488 25 q 1452 -63 1488 -26 q 1364 -99 1415 -99 l 124 -99 q 36 -63 73 -99 q 0 25 0 -26 l 0 967 q 36 1055 0 1018 q 124 1091 73 1091 l 1364 1091 q 1452 1055 1415 1091 q 1488 967 1488 1018 z "},"":{"ha":1190,"x_min":0,"x_max":1174,"o":"m 281 0 l 352 71 l 170 253 l 99 182 l 99 99 l 198 99 l 198 0 l 281 0 m 687 719 q 670 736 687 736 q 656 731 662 736 l 236 311 q 231 298 231 305 q 248 281 231 281 q 261 286 256 281 l 681 706 q 687 719 687 711 m 645 868 l 967 546 l 322 -99 l 0 -99 l 0 223 l 645 868 m 1174 794 q 1146 724 1174 753 l 1017 595 l 694 918 l 823 1046 q 893 1075 851 1075 q 963 1046 934 1075 l 1146 864 q 1174 794 1174 834 z "},"":{"ha":794,"x_min":0,"x_max":794,"o":"m 537 554 q 566 583 537 554 q 595 694 595 612 q 537 835 595 777 q 397 893 479 893 q 257 835 315 893 q 198 694 198 777 q 257 554 198 612 q 397 496 315 496 q 537 554 479 496 m 794 694 q 768 556 794 610 l 486 -44 q 449 -84 474 -70 q 397 -99 425 -99 q 345 -84 369 -99 q 308 -44 320 -70 l 26 556 q 0 694 0 610 q 116 975 0 859 q 397 1091 233 1091 q 677 975 561 1091 q 794 694 794 859 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 595 74 l 595 918 q 384 861 481 918 q 230 708 287 805 q 174 496 174 611 q 230 284 174 381 q 384 131 287 188 q 595 74 481 74 m 1111 795 q 1151 726 1111 795 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 z "},"":{"ha":794,"x_min":0,"x_max":794,"o":"m 397 298 q 381 351 397 326 q 369 369 381 352 q 350 398 358 385 q 330 432 341 411 q 314 471 319 453 q 298 484 311 484 q 281 471 284 484 q 265 432 276 453 q 246 398 254 411 q 226 369 237 385 q 214 351 215 352 q 198 298 198 326 q 227 227 198 257 q 298 198 257 198 q 368 227 339 198 q 397 298 397 257 m 794 397 q 677 116 794 233 q 397 0 561 0 q 116 116 233 0 q 0 397 0 233 q 63 610 0 509 q 111 680 67 617 q 189 797 155 743 q 267 935 224 851 q 331 1091 309 1019 q 357 1128 338 1115 q 397 1141 377 1141 q 437 1128 417 1141 q 463 1091 457 1115 q 527 935 484 1019 q 604 797 570 851 q 682 680 639 743 q 731 610 726 617 q 794 397 794 512 z "},"":{"ha":1389,"x_min":0,"x_max":1383,"o":"m 688 273 l 778 363 l 660 481 l 570 391 l 570 347 l 645 347 l 645 273 l 688 273 m 1028 805 q 1029 831 1042 818 q 1004 830 1017 843 l 732 559 q 732 533 719 546 q 757 534 744 521 l 1028 805 m 1091 370 l 1091 223 q 1026 65 1091 131 q 868 0 960 0 l 223 0 q 65 65 131 0 q 0 223 0 131 l 0 868 q 65 1026 0 960 q 223 1091 131 1091 l 868 1091 q 959 1072 917 1091 q 973 1054 970 1066 q 966 1032 975 1041 l 928 994 q 903 987 917 983 q 868 992 885 992 l 223 992 q 136 956 172 992 q 99 868 99 919 l 99 223 q 136 136 99 172 q 223 99 172 99 l 868 99 q 956 136 919 99 q 992 223 992 172 l 992 321 q 999 338 992 331 l 1049 388 q 1076 393 1060 399 q 1091 370 1091 387 m 1017 942 l 1240 719 l 719 198 l 496 198 l 496 422 l 1017 942 m 1361 840 l 1290 769 l 1066 992 l 1138 1063 q 1190 1085 1159 1085 q 1243 1063 1221 1085 l 1361 946 q 1383 893 1383 924 q 1361 840 1383 862 z "},"":{"ha":1290,"x_min":0,"x_max":1290,"o":"m 1091 424 l 1091 223 q 1026 65 1091 131 q 868 0 960 0 l 223 0 q 65 65 131 0 q 0 223 0 131 l 0 868 q 65 1026 0 960 q 223 1091 131 1091 l 421 1091 l 421 1091 q 438 1084 431 1091 q 446 1066 446 1077 q 426 1042 446 1046 q 322 995 366 1022 q 310 992 315 992 l 223 992 q 136 956 172 992 q 99 868 99 919 l 99 223 q 136 136 99 172 q 223 99 172 99 l 868 99 q 956 136 919 99 q 992 223 992 172 l 992 389 q 1006 412 992 404 q 1048 440 1028 422 q 1075 446 1060 453 q 1091 424 1091 439 m 1275 808 l 977 511 q 942 496 963 496 q 923 500 933 496 q 893 546 893 513 l 893 694 l 769 694 q 429 593 519 694 q 372 226 337 487 q 357 200 374 208 q 347 198 350 198 q 327 208 335 198 q 311 233 319 219 q 280 286 302 246 q 242 363 258 326 q 212 451 226 400 q 198 546 198 502 q 201 616 198 584 q 212 686 204 649 q 234 754 220 723 q 270 817 247 785 q 323 875 293 849 q 396 922 353 900 q 493 960 439 945 q 617 984 546 975 q 769 992 687 992 l 893 992 l 893 1141 q 923 1187 893 1173 q 942 1190 933 1190 q 977 1176 963 1190 l 1275 878 q 1290 843 1290 863 q 1275 808 1290 823 z "},"":{"ha":1290,"x_min":0,"x_max":1289,"o":"m 1091 470 l 1091 223 q 1026 65 1091 131 q 868 0 960 0 l 223 0 q 65 65 131 0 q 0 223 0 131 l 0 868 q 65 1026 0 960 q 223 1091 131 1091 l 868 1091 q 959 1072 917 1091 q 973 1054 970 1066 q 966 1032 975 1041 l 928 994 q 910 986 920 986 q 903 987 908 986 q 868 992 885 992 l 223 992 q 136 956 172 992 q 99 868 99 919 l 99 223 q 136 136 99 172 q 223 99 172 99 l 868 99 q 956 136 919 99 q 992 223 992 172 l 992 420 q 999 437 992 430 l 1049 487 q 1066 494 1056 494 q 1076 492 1071 494 q 1091 470 1091 486 m 1270 849 l 639 218 q 595 199 621 199 q 551 218 570 199 l 218 551 q 199 595 199 570 q 218 639 199 621 l 303 725 q 347 743 322 743 q 391 725 373 743 l 595 521 l 1097 1022 q 1141 1041 1115 1041 q 1185 1022 1166 1041 l 1270 937 q 1289 893 1289 918 q 1270 849 1289 867 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 1374 531 q 1389 496 1389 516 q 1374 461 1389 476 l 1176 263 q 1141 248 1161 248 q 1106 263 1121 248 q 1091 298 1091 277 l 1091 397 l 794 397 l 794 99 l 893 99 q 928 84 913 99 q 942 50 942 70 q 928 15 942 29 l 729 -184 q 694 -198 715 -198 q 660 -184 674 -198 l 461 15 q 446 50 446 29 q 461 84 446 70 q 496 99 476 99 l 595 99 l 595 397 l 298 397 l 298 298 q 283 263 298 277 q 248 248 268 248 q 213 263 228 248 l 15 461 q 0 496 0 476 q 15 531 0 516 l 213 729 q 248 744 228 744 q 283 729 268 744 q 298 694 298 715 l 298 595 l 595 595 l 595 893 l 496 893 q 461 908 476 893 q 446 942 446 922 q 461 977 446 963 l 660 1176 q 694 1190 674 1190 q 729 1176 715 1190 l 928 977 q 942 942 942 963 q 928 908 942 922 q 893 893 913 893 l 794 893 l 794 595 l 1091 595 l 1091 694 q 1106 729 1091 715 q 1141 744 1121 744 q 1176 729 1161 744 l 1374 531 z "},"":{"ha":794,"x_min":0,"x_max":794,"o":"m 759 1081 q 784 1091 773 1096 q 794 1066 794 1087 l 794 -74 q 784 -99 794 -95 q 759 -89 773 -104 l 208 461 q 198 476 202 468 l 198 -50 q 184 -84 198 -70 q 149 -99 169 -99 l 50 -99 q 15 -84 29 -99 q 0 -50 0 -70 l 0 1042 q 15 1077 0 1062 q 50 1091 29 1091 l 149 1091 q 184 1077 169 1091 q 198 1042 198 1062 l 198 516 q 208 531 202 524 l 759 1081 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 1354 1081 q 1379 1091 1369 1096 q 1389 1066 1389 1087 l 1389 -74 q 1379 -99 1389 -95 q 1354 -89 1369 -104 l 804 461 q 794 476 797 468 l 794 -74 q 784 -99 794 -95 q 759 -89 773 -104 l 208 461 q 198 476 202 468 l 198 -50 q 184 -84 198 -70 q 149 -99 169 -99 l 50 -99 q 15 -84 29 -99 q 0 -50 0 -70 l 0 1042 q 15 1077 0 1062 q 50 1091 29 1091 l 149 1091 q 184 1077 169 1091 q 198 1042 198 1062 l 198 516 q 208 531 202 524 l 759 1081 q 784 1091 773 1096 q 794 1066 794 1087 l 794 516 q 804 531 797 524 l 1354 1081 z "},"":{"ha":1290,"x_min":95,"x_max":1290,"o":"m 1255 1081 q 1280 1091 1270 1096 q 1290 1066 1290 1087 l 1290 -74 q 1280 -99 1290 -95 q 1255 -89 1270 -104 l 705 461 q 694 476 698 468 l 694 -74 q 684 -99 694 -95 q 660 -89 674 -104 l 109 461 q 95 496 95 476 q 109 531 95 516 l 660 1081 q 684 1091 674 1096 q 694 1066 694 1087 l 694 516 q 705 531 698 524 l 1255 1081 z "},"":{"ha":1091,"x_min":0,"x_max":1090,"o":"m 1073 472 l 43 -100 q 13 -102 26 -110 q 0 -74 0 -95 l 0 1066 q 13 1094 0 1087 q 43 1092 26 1102 l 1073 520 q 1090 496 1090 510 q 1073 472 1090 482 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 1190 1042 l 1190 -50 q 1176 -84 1190 -70 q 1141 -99 1161 -99 l 744 -99 q 709 -84 724 -99 q 694 -50 694 -70 l 694 1042 q 709 1077 694 1062 q 744 1091 724 1091 l 1141 1091 q 1176 1077 1161 1091 q 1190 1042 1190 1062 m 496 1042 l 496 -50 q 481 -84 496 -70 q 446 -99 467 -99 l 50 -99 q 15 -84 29 -99 q 0 -50 0 -70 l 0 1042 q 15 1077 0 1062 q 50 1091 29 1091 l 446 1091 q 481 1077 467 1091 q 496 1042 496 1062 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 1190 1042 l 1190 -50 q 1176 -84 1190 -70 q 1141 -99 1161 -99 l 50 -99 q 15 -84 29 -99 q 0 -50 0 -70 l 0 1042 q 15 1077 0 1062 q 50 1091 29 1091 l 1141 1091 q 1176 1077 1161 1091 q 1190 1042 1190 1062 z "},"":{"ha":1290,"x_min":0,"x_max":1195,"o":"m 35 -89 q 10 -99 20 -104 q 0 -74 0 -95 l 0 1066 q 10 1091 0 1087 q 35 1081 20 1096 l 585 531 q 595 516 592 524 l 595 1066 q 605 1091 595 1087 q 630 1081 615 1096 l 1180 531 q 1195 496 1195 516 q 1180 461 1195 476 l 630 -89 q 605 -99 615 -104 q 595 -74 595 -95 l 595 476 q 585 461 592 468 l 35 -89 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 35 -89 q 10 -99 20 -104 q 0 -74 0 -95 l 0 1066 q 10 1091 0 1087 q 35 1081 20 1096 l 585 531 q 595 516 592 524 l 595 1066 q 605 1091 595 1087 q 630 1081 615 1096 l 1180 531 q 1190 516 1187 524 l 1190 1042 q 1205 1077 1190 1062 q 1240 1091 1220 1091 l 1339 1091 q 1374 1077 1359 1091 q 1389 1042 1389 1062 l 1389 -50 q 1374 -84 1389 -70 q 1339 -99 1359 -99 l 1240 -99 q 1205 -84 1220 -99 q 1190 -50 1190 -70 l 1190 476 q 1180 461 1187 468 l 630 -89 q 605 -99 615 -104 q 595 -74 595 -95 l 595 476 q 585 461 592 468 l 35 -89 z "},"":{"ha":794,"x_min":0,"x_max":794,"o":"m 35 -89 q 10 -99 20 -104 q 0 -74 0 -95 l 0 1066 q 10 1091 0 1087 q 35 1081 20 1096 l 585 531 q 595 516 592 524 l 595 1042 q 610 1077 595 1062 q 645 1091 625 1091 l 744 1091 q 779 1077 764 1091 q 794 1042 794 1062 l 794 -50 q 779 -84 794 -70 q 744 -99 764 -99 l 645 -99 q 610 -84 625 -99 q 595 -50 595 -70 l 595 476 q 585 461 592 468 l 35 -89 z "},"":{"ha":1192,"x_min":1,"x_max":1191,"o":"m 11 432 l 561 982 q 596 997 576 997 q 631 982 616 997 l 1181 432 q 1191 407 1196 417 q 1166 397 1187 397 l 26 397 q 1 407 5 397 q 11 432 -4 417 m 1142 0 l 50 0 q 16 15 30 0 q 1 50 1 29 l 1 248 q 16 283 1 268 q 50 298 30 298 l 1142 298 q 1177 283 1162 298 q 1191 248 1191 268 l 1191 50 q 1177 15 1191 29 q 1142 0 1162 0 z "},"":{"ha":992,"x_min":119,"x_max":922,"o":"m 908 957 l 496 546 l 908 134 q 922 99 922 119 q 908 64 922 79 l 779 -64 q 744 -79 764 -79 q 709 -64 724 -79 l 134 511 q 119 546 119 525 q 134 581 119 566 l 709 1156 q 744 1170 724 1170 q 779 1156 764 1170 l 908 1027 q 922 992 922 1012 q 908 957 922 972 z "},"":{"ha":992,"x_min":70,"x_max":873,"o":"m 858 511 l 283 -64 q 248 -79 268 -79 q 213 -64 228 -79 l 84 64 q 70 99 70 79 q 84 134 70 119 l 496 546 l 84 957 q 70 992 70 972 q 84 1027 70 1012 l 213 1156 q 248 1170 228 1170 q 283 1156 268 1170 l 858 581 q 873 546 873 566 q 858 511 873 525 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 942 446 l 942 546 q 928 581 942 566 q 893 595 913 595 l 694 595 l 694 794 q 680 829 694 814 q 645 843 665 843 l 546 843 q 511 829 525 843 q 496 794 496 814 l 496 595 l 298 595 q 263 581 277 595 q 248 546 248 566 l 248 446 q 263 412 248 426 q 298 397 277 397 l 496 397 l 496 198 q 511 164 496 178 q 546 149 525 149 l 645 149 q 680 164 665 149 q 694 198 694 178 l 694 397 l 893 397 q 928 412 913 397 q 942 446 942 426 m 1111 795 q 1151 726 1111 795 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 942 446 l 942 546 q 928 581 942 566 q 893 595 913 595 l 298 595 q 263 581 277 595 q 248 546 248 566 l 248 446 q 263 412 248 426 q 298 397 277 397 l 893 397 q 928 412 913 397 q 942 446 942 426 m 1111 795 q 1151 726 1111 795 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 891 321 q 876 356 891 341 l 736 496 l 876 636 q 891 671 891 651 q 876 707 891 692 l 806 777 q 770 791 791 791 q 736 777 750 791 l 595 636 l 455 777 q 420 791 440 791 q 384 777 399 791 l 315 707 q 300 671 300 692 q 315 636 300 651 l 455 496 l 315 356 q 300 321 300 341 q 315 285 300 300 l 384 215 q 420 201 399 201 q 455 215 440 201 l 595 356 l 736 215 q 770 201 750 201 q 806 215 791 201 l 876 285 q 891 321 891 300 m 1111 795 q 1151 726 1111 795 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 995 622 q 981 657 995 643 l 911 727 q 876 742 896 742 q 841 727 856 742 l 525 412 l 350 587 q 315 601 335 601 q 280 587 295 601 l 209 517 q 195 481 195 503 q 209 446 195 460 l 490 166 q 525 151 505 151 q 560 166 546 151 l 981 587 q 995 622 995 601 m 1111 795 q 1151 726 1111 795 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 694 124 l 694 273 q 687 291 694 284 q 670 298 680 298 l 521 298 q 503 291 510 298 q 496 273 496 284 l 496 124 q 503 106 496 113 q 521 99 510 99 l 670 99 q 687 106 680 99 q 694 124 694 113 m 893 645 q 850 771 893 713 q 742 861 807 829 q 611 893 678 893 q 323 728 422 893 q 329 695 312 709 l 432 618 q 446 613 437 613 q 466 622 459 613 q 532 694 507 675 q 599 712 559 712 q 665 692 636 712 q 694 646 694 672 q 679 599 694 617 q 626 564 663 581 q 537 497 577 543 q 496 400 496 452 l 496 372 q 503 354 496 361 q 521 347 510 347 l 670 347 q 687 354 680 347 q 694 372 694 361 q 711 410 694 387 q 753 449 728 434 q 791 471 778 463 q 827 498 805 479 q 861 535 849 517 q 883 582 873 553 q 893 645 893 611 m 1111 795 q 1151 726 1111 795 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 794 124 l 794 248 q 787 266 794 259 q 769 273 780 273 l 694 273 l 694 670 q 687 687 694 680 q 670 694 680 694 l 422 694 q 404 687 411 694 q 397 670 397 680 l 397 546 q 404 528 397 535 q 422 521 411 521 l 496 521 l 496 273 l 422 273 q 404 266 411 273 q 397 248 397 259 l 397 124 q 404 106 397 113 q 422 99 411 99 l 769 99 q 787 106 780 99 q 794 124 794 113 m 694 818 l 694 942 q 687 960 694 953 q 670 967 680 967 l 521 967 q 503 960 510 967 q 496 942 496 953 l 496 818 q 503 801 496 808 q 521 794 510 794 l 670 794 q 687 801 680 794 q 694 818 694 808 m 1111 795 q 1151 726 1111 795 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 928 397 l 843 397 q 808 412 823 397 q 794 446 794 426 l 794 546 q 808 581 794 566 q 843 595 823 595 l 928 595 q 841 741 903 679 q 694 829 778 804 l 694 744 q 680 709 694 724 q 645 694 665 694 l 546 694 q 511 709 525 694 q 496 744 496 724 l 496 829 q 350 741 412 804 q 263 595 288 679 l 347 595 q 382 581 367 595 q 397 546 397 566 l 397 446 q 382 412 397 426 q 347 397 367 397 l 263 397 q 350 251 288 313 q 496 164 412 188 l 496 248 q 511 283 496 268 q 546 298 525 298 l 645 298 q 680 283 665 298 q 694 248 694 268 l 694 164 q 841 251 778 188 q 928 397 903 313 m 1190 546 l 1190 446 q 1176 412 1190 426 q 1141 397 1161 397 l 1030 397 q 910 181 1001 272 q 694 61 819 90 l 694 -50 q 680 -84 694 -70 q 645 -99 665 -99 l 546 -99 q 511 -84 525 -99 q 496 -50 496 -70 l 496 61 q 280 181 371 90 q 160 397 189 272 l 50 397 q 15 412 29 397 q 0 446 0 426 l 0 546 q 15 581 0 566 q 50 595 29 595 l 160 595 q 280 811 189 720 q 496 931 371 902 l 496 1042 q 511 1077 496 1062 q 546 1091 525 1091 l 645 1091 q 680 1077 665 1091 q 694 1042 694 1062 l 694 931 q 910 811 819 902 q 1030 595 1001 720 l 1141 595 q 1176 581 1161 595 q 1190 546 1190 566 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 850 354 l 737 241 q 719 233 729 233 q 701 241 709 233 l 595 347 l 489 241 q 471 233 481 233 q 453 241 461 233 l 340 354 q 332 372 332 362 q 340 390 332 382 l 446 496 l 340 602 q 332 620 332 610 q 340 638 332 630 l 453 751 q 471 759 461 759 q 489 751 481 759 l 595 645 l 701 751 q 719 759 709 759 q 737 751 729 759 l 850 638 q 858 620 858 630 q 850 602 858 610 l 744 496 l 850 390 q 858 372 858 382 q 850 354 858 362 m 960 284 q 989 333 960 284 q 1017 496 1017 381 q 960 708 1017 611 q 807 861 904 805 q 595 918 710 918 q 384 861 481 918 q 230 708 287 805 q 174 496 174 611 q 230 284 174 381 q 384 131 287 188 q 595 74 481 74 q 807 131 710 74 q 960 284 904 188 m 1111 795 q 1151 726 1111 795 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 908 560 l 581 233 q 546 219 566 219 q 511 233 525 219 l 283 461 q 268 496 268 476 q 283 531 268 516 l 362 610 q 397 625 377 625 q 432 610 417 625 l 546 496 l 759 709 q 794 724 773 724 q 829 709 814 724 l 908 630 q 922 595 922 615 q 908 560 922 575 m 960 284 q 989 333 960 284 q 1017 496 1017 381 q 960 708 1017 611 q 807 861 904 805 q 595 918 710 918 q 384 861 481 918 q 230 708 287 805 q 174 496 174 611 q 230 284 174 381 q 384 131 287 188 q 595 74 481 74 q 807 131 710 74 q 960 284 904 188 m 1111 795 q 1151 726 1111 795 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 1017 498 q 949 727 1017 623 l 365 143 q 595 74 471 74 q 759 108 681 74 q 894 198 837 142 q 984 334 950 255 q 1017 498 1017 412 m 243 267 l 828 851 q 595 922 723 922 q 384 865 481 922 q 230 711 287 808 q 174 498 174 613 q 243 267 174 373 m 1143 730 q 1167 675 1143 730 q 1190 498 1190 620 q 1143 266 1190 377 q 1016 75 1096 155 q 827 -52 937 -5 q 595 -99 716 -99 q 364 -52 474 -99 q 174 75 253 -5 q 47 266 95 155 q 0 498 0 377 q 47 730 0 620 q 174 921 95 841 q 364 1048 253 1001 q 595 1095 474 1095 q 827 1048 716 1095 q 1016 921 937 1001 q 1143 730 1096 841 z "},"":{"ha":1190,"x_min":50,"x_max":1190,"o":"m 1190 496 l 1190 397 q 1165 327 1190 356 q 1100 298 1140 298 l 554 298 l 781 70 q 811 0 811 42 q 781 -70 811 -42 l 723 -129 q 653 -157 694 -157 q 583 -129 613 -157 l 78 377 q 50 446 50 405 q 78 517 50 487 l 583 1021 q 653 1050 612 1050 q 723 1021 694 1050 l 781 963 q 811 893 811 934 q 781 822 811 852 l 554 595 l 1100 595 q 1165 566 1140 595 q 1190 496 1190 537 z "},"":{"ha":1190,"x_min":0,"x_max":1141,"o":"m 1141 446 q 1112 376 1141 405 l 608 -129 q 537 -157 577 -157 q 467 -129 498 -157 l 409 -71 q 380 0 380 -41 q 409 71 380 41 l 636 298 l 91 298 q 25 327 50 298 q 0 397 0 356 l 0 496 q 25 566 0 537 q 91 595 50 595 l 636 595 l 409 823 q 380 893 380 851 q 409 963 380 935 l 467 1021 q 537 1050 497 1050 q 608 1021 578 1050 l 1112 516 q 1141 446 1141 489 z "},"":{"ha":1290,"x_min":41,"x_max":1249,"o":"m 1249 438 q 1220 368 1249 398 l 1162 310 q 1091 281 1132 281 q 1022 310 1049 281 l 794 537 l 794 -9 q 765 -74 794 -49 q 694 -99 736 -99 l 595 -99 q 525 -74 554 -99 q 496 -9 496 -49 l 496 537 l 268 310 q 198 281 240 281 q 129 310 157 281 l 71 368 q 41 438 41 398 q 71 508 41 479 l 575 1013 q 645 1042 602 1042 q 715 1013 687 1042 l 1220 508 q 1249 438 1249 478 z "},"":{"ha":1290,"x_min":41,"x_max":1249,"o":"m 1249 546 q 1220 476 1249 505 l 715 -29 q 645 -58 685 -58 q 575 -29 604 -58 l 71 476 q 41 546 41 504 q 71 616 41 587 l 128 674 q 198 703 158 703 q 268 674 239 703 l 496 446 l 496 992 q 525 1062 496 1032 q 595 1091 555 1091 l 694 1091 q 764 1062 735 1091 q 794 992 794 1032 l 794 446 l 1022 674 q 1091 703 1050 703 q 1162 674 1132 703 l 1220 616 q 1249 546 1249 586 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 1374 729 q 1389 694 1389 715 q 1374 660 1389 674 l 977 263 q 942 248 963 248 q 908 263 922 248 q 893 298 893 277 l 893 496 l 719 496 q 583 491 643 496 q 464 475 523 487 q 361 442 405 463 q 279 388 317 421 q 217 310 241 355 q 179 202 193 264 q 166 62 166 140 q 170 -33 166 19 q 172 -52 170 -38 q 174 -72 174 -65 q 167 -91 174 -84 q 149 -99 160 -99 q 127 -86 136 -99 q 117 -69 122 -79 q 107 -46 112 -59 q 98 -27 101 -33 q 0 322 0 194 q 41 581 0 477 q 719 893 167 893 l 893 893 l 893 1091 q 908 1126 893 1111 q 942 1141 922 1141 q 977 1126 963 1141 l 1374 729 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 577 390 q 585 372 585 382 q 577 354 585 362 l 320 97 l 432 -15 q 446 -50 446 -29 q 432 -84 446 -70 q 397 -99 417 -99 l 50 -99 q 15 -84 29 -99 q 0 -50 0 -70 l 0 298 q 15 332 0 318 q 50 347 29 347 q 84 332 70 347 l 196 221 l 453 478 q 471 486 461 486 q 489 478 481 486 l 577 390 m 1190 1042 l 1190 694 q 1176 660 1190 674 q 1141 645 1161 645 q 1106 660 1121 645 l 994 771 l 737 514 q 719 506 729 506 q 701 514 709 506 l 613 602 q 605 620 605 610 q 613 638 605 630 l 870 895 l 759 1007 q 744 1042 744 1022 q 759 1077 744 1062 q 794 1091 773 1091 l 1141 1091 q 1176 1077 1161 1091 q 1190 1042 1190 1062 z "},"":{"ha":1190,"x_min":10,"x_max":1180,"o":"m 595 446 l 595 99 q 581 64 595 79 q 546 50 566 50 q 511 64 525 50 l 399 176 l 142 -81 q 124 -89 134 -89 q 106 -81 114 -89 l 18 7 q 10 25 10 15 q 18 43 10 35 l 275 300 l 164 412 q 149 446 149 426 q 164 481 149 467 q 198 496 178 496 l 546 496 q 581 481 566 496 q 595 446 595 467 m 1173 985 q 1180 967 1180 977 q 1173 949 1180 957 l 915 692 l 1027 581 q 1042 546 1042 566 q 1027 511 1042 525 q 992 496 1012 496 l 645 496 q 610 511 625 496 q 595 546 595 525 l 595 893 q 610 928 595 913 q 645 942 625 942 q 680 928 665 942 l 791 816 l 1049 1073 q 1066 1081 1056 1081 q 1084 1073 1077 1081 l 1173 985 z "},"":{"ha":1091,"x_min":0,"x_max":1091,"o":"m 1091 620 l 1091 471 q 1070 419 1091 440 q 1017 397 1048 397 l 694 397 l 694 74 q 673 22 694 43 q 620 0 651 0 l 471 0 q 419 22 440 0 q 397 74 397 43 l 397 397 l 74 397 q 22 419 43 397 q 0 471 0 440 l 0 620 q 22 673 0 651 q 74 694 43 694 l 397 694 l 397 1017 q 419 1070 397 1048 q 471 1091 440 1091 l 620 1091 q 673 1070 651 1091 q 694 1017 694 1048 l 694 694 l 1017 694 q 1070 673 1048 694 q 1091 620 1091 651 z "},"":{"ha":1091,"x_min":0,"x_max":1091,"o":"m 1091 620 l 1091 471 q 1070 419 1091 440 q 1017 397 1048 397 l 74 397 q 22 419 43 397 q 0 471 0 440 l 0 620 q 22 673 0 651 q 74 694 43 694 l 1017 694 q 1070 673 1048 694 q 1091 620 1091 651 z "},"":{"ha":1290,"x_min":95,"x_max":1195,"o":"m 1149 377 q 1195 317 1184 357 q 1185 241 1205 277 l 1135 156 q 1075 110 1115 120 q 1000 119 1035 99 l 794 238 l 794 0 q 764 -70 794 -40 q 694 -99 735 -99 l 595 -99 q 525 -70 555 -99 q 496 0 496 -40 l 496 238 l 290 119 q 214 110 254 99 q 154 156 174 120 l 105 241 q 95 317 84 277 q 141 377 105 357 l 347 496 l 141 615 q 95 675 105 636 q 105 751 84 715 l 154 836 q 214 882 174 872 q 290 873 254 893 l 496 754 l 496 992 q 525 1062 496 1032 q 595 1091 555 1091 l 694 1091 q 764 1062 735 1091 q 794 992 794 1032 l 794 754 l 1000 873 q 1075 882 1035 893 q 1135 836 1115 872 l 1185 751 q 1195 675 1205 715 q 1149 615 1184 636 l 942 496 l 1149 377 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 296 1011 q 365 1051 296 1011 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 m 694 125 l 694 272 q 687 290 694 283 q 670 298 680 298 l 522 298 q 504 290 512 298 q 496 272 496 282 l 496 125 q 504 107 496 115 q 522 99 512 99 l 670 99 q 687 107 680 99 q 694 125 694 114 m 693 391 l 707 873 q 699 887 707 882 q 680 893 691 893 l 510 893 q 491 887 499 893 q 484 873 484 882 l 497 391 q 505 378 497 384 q 523 372 512 372 l 667 372 q 685 378 677 372 q 693 391 692 384 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 719 140 l 719 183 l 719 546 l 719 694 l 471 694 l 471 546 l 471 183 l 471 140 q 485 110 471 120 q 521 99 499 99 l 670 99 q 705 110 691 99 q 719 140 719 120 m 366 794 l 517 794 l 419 918 q 366 942 399 942 q 313 921 335 942 q 291 868 291 899 q 313 815 291 837 q 366 794 335 794 m 877 815 q 888 826 877 815 q 899 868 899 837 q 877 921 899 899 q 825 942 856 942 q 771 918 791 942 l 674 794 l 825 794 q 877 815 856 794 m 1190 670 l 1190 422 q 1184 404 1190 411 q 1166 397 1177 397 l 1091 397 l 1091 74 q 1070 22 1091 43 q 1017 0 1048 0 l 174 0 q 121 22 143 0 q 99 74 99 43 l 99 397 l 25 397 q 7 404 14 397 q 0 422 0 411 l 0 670 q 7 687 0 680 q 25 694 14 694 l 366 694 q 243 745 294 694 q 192 868 192 796 q 243 991 192 940 q 366 1042 294 1042 q 496 982 449 1042 l 595 854 l 694 982 q 825 1042 742 1042 q 947 991 897 1042 q 998 868 998 940 q 947 745 998 796 q 825 694 897 694 l 1166 694 q 1184 687 1177 694 q 1190 670 1190 680 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 977 610 q 985 617 977 610 q 992 645 992 625 q 977 680 992 665 q 942 694 963 694 q 696 656 809 694 q 495 552 583 618 q 312 382 407 487 q 298 347 298 366 q 312 312 298 327 q 347 298 327 298 q 382 312 366 298 q 439 367 403 331 q 491 419 476 404 q 699 555 598 515 q 942 595 801 595 q 977 610 963 595 m 1389 798 q 1373 649 1389 725 q 1230 352 1338 475 q 953 144 1123 229 q 614 60 787 60 q 392 97 499 60 q 324 129 381 101 q 250 158 267 158 q 219 133 237 158 q 184 79 201 109 q 143 25 167 50 q 97 0 119 0 q 48 14 64 0 q 12 60 32 27 q 8 68 11 63 q 3 76 5 74 q 1 83 2 78 q 0 94 0 88 q 24 151 0 121 q 77 202 48 181 q 129 245 105 222 q 153 282 153 267 q 143 312 153 285 q 130 346 132 338 q 123 426 123 385 q 157 597 123 515 q 249 740 191 678 q 381 848 308 801 q 539 922 455 894 q 652 941 582 935 q 791 948 722 947 q 929 953 860 949 q 1056 972 998 956 q 1144 1015 1114 987 q 1167 1038 1152 1023 q 1190 1060 1182 1053 q 1211 1075 1197 1066 q 1239 1088 1224 1084 q 1273 1091 1254 1091 q 1327 1056 1303 1091 q 1364 969 1352 1020 q 1383 873 1376 918 q 1389 798 1389 828 z "},"":{"ha":1091,"x_min":0,"x_max":1091,"o":"m 1091 -124 l 1091 -174 q 1084 -191 1091 -184 q 1066 -198 1077 -198 l 25 -198 q 7 -191 15 -198 q 0 -174 0 -184 l 0 -124 q 7 -107 0 -114 q 25 -99 15 -99 l 1066 -99 q 1084 -107 1077 -99 q 1091 -124 1091 -114 m 893 694 q 874 583 893 634 q 824 496 855 532 q 756 427 794 460 q 682 367 719 395 q 614 312 645 339 q 565 248 584 284 q 546 174 546 213 q 598 0 546 99 l 594 1 l 595 0 q 471 64 525 32 q 364 142 417 97 q 276 237 311 187 q 220 353 241 287 q 198 496 198 420 q 217 608 198 556 q 267 695 236 659 q 335 763 298 731 q 409 823 372 795 q 477 879 446 851 q 527 942 508 907 q 546 1017 546 977 q 494 1190 546 1090 l 497 1190 l 496 1190 q 620 1126 566 1159 q 727 1049 674 1094 q 815 954 780 1004 q 872 837 850 904 q 893 694 893 770 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 1290 446 q 994 720 1172 629 q 1042 546 1042 639 q 940 300 1042 402 q 694 198 838 198 q 449 300 551 198 q 347 546 347 402 q 395 720 347 639 q 99 446 217 629 q 358 193 202 288 q 694 99 513 99 q 1031 193 876 99 q 1290 446 1187 288 m 721 718 q 726 723 721 718 q 732 744 732 729 q 721 770 732 760 q 694 781 710 781 q 528 712 598 781 q 459 546 459 643 q 470 519 459 530 q 496 508 481 508 q 522 519 512 508 q 533 546 533 530 q 581 660 533 612 q 694 707 628 707 q 721 718 710 707 m 1373 500 q 1389 446 1389 473 q 1373 393 1389 420 q 1082 107 1265 215 q 694 0 898 0 q 307 108 491 0 q 16 393 124 215 q 0 446 0 420 q 16 500 0 473 q 307 785 124 677 q 694 893 491 893 q 1082 785 898 893 q 1373 500 1265 677 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 430 156 l 491 265 q 385 388 423 314 q 347 546 347 463 q 395 720 347 639 q 99 446 217 629 q 430 156 229 246 m 721 718 q 726 723 721 718 q 732 744 732 729 q 721 770 732 760 q 694 781 710 781 q 528 712 598 781 q 459 546 459 643 q 470 519 459 530 q 496 508 481 508 q 522 519 512 508 q 533 546 533 530 q 581 660 533 612 q 694 707 628 707 q 721 718 710 707 m 1013 892 q 1012 885 1013 887 q 767 446 930 739 q 523 7 605 153 l 485 -62 q 463 -74 477 -74 q 360 -20 454 -74 q 347 2 347 -12 q 381 69 347 11 q 177 203 270 119 q 16 393 84 287 q 0 446 0 417 q 16 500 0 476 q 310 787 134 682 q 694 893 486 893 q 834 880 763 893 l 876 955 q 898 967 884 967 q 911 963 901 967 q 935 951 922 958 q 961 936 949 943 q 985 922 973 929 q 1001 913 998 915 q 1013 892 1013 905 m 1042 546 q 980 349 1042 438 q 818 222 919 260 l 1035 611 q 1042 546 1042 576 m 1373 500 q 1389 446 1389 474 q 1373 393 1389 419 q 1289 281 1343 343 q 1020 74 1173 147 q 694 0 867 0 l 752 102 q 1056 208 916 116 q 1290 446 1196 301 q 1071 674 1201 585 l 1120 761 q 1261 643 1194 711 q 1373 500 1329 574 z "},"":{"ha":1389,"x_min":12,"x_max":1376,"o":"m 794 125 l 794 272 q 786 290 794 283 q 769 298 779 298 l 620 298 q 603 290 610 298 q 595 272 595 283 l 595 125 q 603 107 595 114 q 620 99 610 99 l 769 99 q 786 107 779 99 q 794 125 794 114 m 792 415 l 806 770 q 798 785 806 780 q 780 794 788 794 l 609 794 q 591 785 601 794 q 583 769 583 780 l 596 415 q 604 402 596 407 q 622 397 612 397 l 766 397 q 784 402 777 397 q 792 415 791 407 m 781 1139 l 1376 47 q 1375 -50 1404 -2 q 1339 -86 1362 -73 q 1290 -99 1316 -99 l 99 -99 q 50 -86 73 -99 q 14 -50 27 -73 q 12 47 -15 -2 l 608 1139 q 644 1177 621 1163 q 694 1190 667 1190 q 745 1177 722 1190 q 781 1139 768 1163 z "},"":{"ha":1091,"x_min":0,"x_max":1076,"o":"m 1066 1066 q 1076 952 1101 1026 q 992 818 1051 877 l 867 694 l 991 154 q 982 129 995 140 l 883 54 q 868 50 877 50 q 863 50 865 50 q 846 63 851 53 l 630 457 l 429 256 l 470 105 q 464 81 474 92 l 390 7 q 372 0 383 0 l 370 0 q 352 10 359 2 l 205 205 l 10 352 q 0 370 2 357 q 7 389 -1 380 l 81 464 q 99 471 88 471 q 105 470 104 471 l 256 429 l 457 630 l 63 846 q 50 865 52 853 q 57 886 48 877 l 156 985 q 179 991 167 995 l 694 868 l 818 992 q 952 1076 877 1051 q 1066 1066 1026 1101 z "},"":{"ha":1290,"x_min":0,"x_max":1290,"o":"m 99 -99 l 322 -99 l 322 124 l 99 124 l 99 -99 m 372 -99 l 620 -99 l 620 124 l 372 124 l 372 -99 m 99 174 l 322 174 l 322 422 l 99 422 l 99 174 m 372 174 l 620 174 l 620 422 l 372 422 l 372 174 m 99 471 l 322 471 l 322 694 l 99 694 l 99 471 m 670 -99 l 918 -99 l 918 124 l 670 124 l 670 -99 m 372 471 l 620 471 l 620 694 l 372 694 l 372 471 m 967 -99 l 1190 -99 l 1190 124 l 967 124 l 967 -99 m 670 174 l 918 174 l 918 422 l 670 422 l 670 174 m 397 843 l 397 1066 q 389 1084 397 1077 q 372 1091 382 1091 l 322 1091 q 305 1084 312 1091 q 298 1066 298 1077 l 298 843 q 305 826 298 833 q 322 818 312 818 l 372 818 q 389 826 382 818 q 397 843 397 833 m 967 174 l 1190 174 l 1190 422 l 967 422 l 967 174 m 670 471 l 918 471 l 918 694 l 670 694 l 670 471 m 967 471 l 1190 471 l 1190 694 l 967 694 l 967 471 m 992 843 l 992 1066 q 985 1084 992 1077 q 967 1091 977 1091 l 918 1091 q 900 1084 908 1091 q 893 1066 893 1077 l 893 843 q 900 826 893 833 q 918 818 908 818 l 967 818 q 985 826 977 818 q 992 843 992 833 m 1290 893 l 1290 -99 q 1260 -169 1290 -140 q 1190 -198 1231 -198 l 99 -198 q 29 -169 59 -198 q 0 -99 0 -140 l 0 893 q 29 963 0 933 q 99 992 59 992 l 198 992 l 198 1066 q 235 1154 198 1118 q 322 1190 271 1190 l 372 1190 q 460 1154 423 1190 q 496 1066 496 1118 l 496 992 l 794 992 l 794 1066 q 830 1154 794 1118 q 918 1190 867 1190 l 967 1190 q 1055 1154 1018 1190 q 1091 1066 1091 1118 l 1091 992 l 1190 992 q 1260 963 1231 992 q 1290 893 1290 933 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 516 818 q 410 606 470 746 q 381 662 393 641 q 350 711 370 684 q 310 755 330 739 q 262 782 291 771 q 198 794 233 794 l 25 794 q 7 801 14 794 q 0 818 0 808 l 0 967 q 7 985 0 978 q 25 992 14 992 l 198 992 q 516 818 392 992 m 1382 216 q 1389 198 1389 209 q 1382 181 1389 188 l 1134 -67 q 1116 -74 1127 -74 q 1099 -67 1106 -74 q 1091 -50 1091 -60 l 1091 99 q 1025 99 1066 99 q 963 98 984 98 q 906 99 941 98 q 851 103 871 100 q 801 111 831 105 q 753 125 772 116 q 708 147 733 134 q 662 178 682 160 q 619 220 642 196 q 576 274 597 243 q 681 485 622 346 q 710 429 698 450 q 741 380 722 408 q 781 336 761 352 q 830 309 801 320 q 893 298 859 298 l 1091 298 l 1091 446 q 1098 464 1091 457 q 1116 471 1105 471 q 1135 463 1125 471 l 1382 216 m 1382 911 q 1389 893 1389 904 q 1382 875 1389 882 l 1134 627 q 1116 620 1127 620 q 1099 627 1106 620 q 1091 645 1091 635 l 1091 794 l 893 794 q 825 782 856 794 q 772 747 795 770 q 732 699 749 724 q 698 639 716 675 q 637 507 673 591 q 599 421 615 456 q 557 339 583 386 q 507 262 531 293 q 450 198 484 231 q 380 145 416 164 q 298 112 344 125 q 198 99 251 99 l 25 99 q 7 106 14 99 q 0 124 0 113 l 0 273 q 7 291 0 284 q 25 298 14 298 l 198 298 q 266 309 236 298 q 319 344 296 321 q 359 392 343 367 q 394 452 375 416 q 454 584 419 500 q 493 670 477 636 q 534 752 508 705 q 584 829 560 798 q 641 894 608 860 q 711 947 675 927 q 794 979 747 966 q 893 992 840 992 l 1091 992 l 1091 1141 q 1098 1159 1091 1152 q 1116 1166 1105 1166 q 1135 1158 1125 1166 l 1382 911 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 1296 745 q 1342 688 1296 745 q 1389 496 1389 631 q 1296 247 1389 361 q 1043 66 1203 133 q 694 0 884 0 q 582 6 640 0 q 226 -181 429 -129 q 137 -198 188 -192 q 114 -191 124 -200 q 100 -169 103 -183 l 100 -168 q 100 -159 98 -165 q 101 -151 102 -153 q 105 -144 101 -150 q 109 -137 109 -138 q 115 -130 110 -136 q 121 -123 119 -125 q 145 -96 126 -117 q 172 -67 164 -76 q 196 -36 180 -58 q 221 3 212 -15 q 242 49 230 21 q 262 108 253 77 q 70 278 140 177 q 0 496 0 380 q 55 689 0 597 q 203 847 110 780 q 425 953 296 914 q 694 992 553 992 q 1043 926 884 992 q 1296 745 1203 860 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 1190 546 l 1190 446 q 1114 166 1190 291 q 902 -29 1038 41 q 595 -99 766 -99 q 289 -29 425 -99 q 76 166 153 41 q 0 446 0 291 l 0 546 q 15 581 0 566 q 50 595 29 595 l 347 595 q 382 581 367 595 q 397 546 397 566 l 397 446 q 415 377 397 406 q 457 332 433 347 q 512 309 480 318 q 561 299 543 301 q 595 298 579 298 q 629 299 612 298 q 679 309 647 301 q 734 332 711 318 q 775 377 757 347 q 794 446 794 406 l 794 546 q 808 581 794 566 q 843 595 823 595 l 1141 595 q 1176 581 1161 595 q 1190 546 1190 566 m 397 1042 l 397 744 q 382 709 397 724 q 347 694 367 694 l 50 694 q 15 709 29 694 q 0 744 0 724 l 0 1042 q 15 1077 0 1062 q 50 1091 29 1091 l 347 1091 q 382 1077 367 1091 q 397 1042 397 1062 m 1190 1042 l 1190 744 q 1176 709 1190 724 q 1141 694 1161 694 l 843 694 q 808 709 823 694 q 794 744 794 724 l 794 1042 q 808 1077 794 1062 q 843 1091 823 1091 l 1141 1091 q 1176 1077 1161 1091 q 1190 1042 1190 1062 z "},"":{"ha":1389,"x_min":70,"x_max":1319,"o":"m 1304 159 l 1176 31 q 1141 16 1161 16 q 1106 31 1121 16 l 694 443 l 283 31 q 248 16 268 16 q 213 31 228 16 l 84 159 q 70 194 70 174 q 84 229 70 215 l 660 804 q 694 818 674 818 q 729 804 715 818 l 1304 229 q 1319 194 1319 215 q 1304 159 1319 174 z "},"":{"ha":1389,"x_min":70,"x_max":1319,"o":"m 1304 564 l 729 -10 q 694 -25 715 -25 q 660 -10 674 -25 l 84 564 q 70 600 70 579 q 84 635 70 620 l 213 763 q 248 777 228 777 q 283 763 268 777 l 694 351 l 1106 763 q 1141 777 1121 777 q 1176 763 1161 777 l 1304 635 q 1319 600 1319 620 q 1304 564 1319 579 z "},"":{"ha":1488,"x_min":0,"x_max":1488,"o":"m 992 25 q 985 7 992 15 q 967 0 977 0 l 223 0 q 213 2 217 0 q 206 7 208 3 q 202 13 203 11 q 199 22 200 16 q 198 31 198 29 q 198 41 198 33 q 198 50 198 49 l 198 174 l 198 496 l 50 496 q 15 511 29 496 q 0 546 0 525 q 12 577 0 564 l 260 875 q 298 892 274 892 q 336 875 321 892 l 584 577 q 595 546 595 564 q 581 511 595 525 q 546 496 566 496 l 397 496 l 397 198 l 843 198 q 863 190 856 198 l 987 41 q 992 25 992 33 m 1488 347 q 1476 315 1488 329 l 1228 18 q 1190 0 1213 0 q 1152 18 1168 0 l 904 315 q 893 347 893 329 q 908 382 893 367 q 942 397 922 397 l 1091 397 l 1091 694 l 645 694 q 625 704 632 694 l 501 853 q 496 868 496 860 q 503 885 496 878 q 521 893 511 893 l 1265 893 q 1275 891 1271 893 q 1282 886 1280 890 q 1287 880 1285 882 q 1289 871 1288 877 q 1290 862 1290 864 q 1290 852 1290 860 q 1290 843 1290 844 l 1290 719 l 1290 397 l 1438 397 q 1473 382 1459 397 q 1488 347 1488 367 z "},"":{"ha":1290,"x_min":0,"x_max":1290,"o":"m 467 70 q 481 55 467 70 q 496 0 496 40 q 467 -70 496 -40 q 397 -99 437 -99 q 327 -70 357 -99 q 298 0 298 -40 q 327 70 298 40 q 397 99 357 99 q 467 70 437 99 m 1161 70 q 1176 55 1161 70 q 1190 0 1190 40 q 1161 -70 1190 -40 q 1091 -99 1132 -99 q 1022 -70 1051 -99 q 992 0 992 -40 q 1022 70 992 40 q 1091 99 1051 99 q 1161 70 1132 99 m 1290 843 l 1290 446 q 1277 413 1290 428 q 1246 397 1264 399 l 436 302 q 446 248 446 256 q 428 198 446 236 l 1141 198 q 1176 184 1161 198 q 1190 149 1190 169 q 1176 114 1190 129 q 1141 99 1161 99 l 347 99 q 312 114 327 99 q 298 149 298 129 q 304 173 298 157 q 316 201 310 189 q 333 232 322 213 q 345 255 343 251 l 208 893 l 50 893 q 15 908 29 893 q 0 942 0 922 q 15 977 0 963 q 50 992 29 992 l 248 992 q 270 987 260 992 q 285 975 280 982 q 295 956 291 968 q 301 936 300 944 q 306 913 303 928 q 309 893 308 898 l 1240 893 q 1275 878 1260 893 q 1290 843 1290 863 z "},"":{"ha":1290,"x_min":0,"x_max":1290,"o":"m 1290 719 l 1290 174 q 1239 51 1290 102 q 1116 0 1187 0 l 174 0 q 51 51 102 0 q 0 174 0 102 l 0 918 q 51 1040 0 989 q 174 1091 102 1091 l 422 1091 q 544 1040 493 1091 q 595 918 595 989 l 595 893 l 1116 893 q 1239 842 1187 893 q 1290 719 1290 791 z "},"":{"ha":1488,"x_min":0,"x_max":1456,"o":"m 1456 453 q 1432 401 1456 429 l 1172 95 q 1078 28 1139 55 q 967 0 1018 0 l 124 0 q 77 10 98 0 q 57 43 57 20 q 81 95 57 67 l 341 401 q 434 469 374 441 q 546 496 494 496 l 1389 496 q 1436 486 1415 496 q 1456 453 1456 476 m 1190 719 l 1190 595 l 546 595 q 393 558 473 595 q 266 466 313 522 l 5 159 l 1 154 q 0 164 1 157 q 0 174 0 171 l 0 918 q 51 1040 0 989 q 174 1091 102 1091 l 422 1091 q 544 1040 493 1091 q 595 918 595 989 l 595 893 l 1017 893 q 1139 842 1088 893 q 1190 719 1190 791 z "},"":{"ha":595,"x_min":50,"x_max":546,"o":"m 531 977 q 546 942 546 963 q 531 908 546 922 q 496 893 516 893 l 397 893 l 397 99 l 496 99 q 531 84 516 99 q 546 50 546 70 q 531 15 546 29 l 332 -184 q 298 -198 318 -198 q 263 -184 277 -198 l 64 15 q 50 50 50 29 q 64 84 50 70 q 99 99 79 99 l 198 99 l 198 893 l 99 893 q 64 908 79 893 q 50 942 50 922 q 64 977 50 963 l 263 1176 q 298 1190 277 1190 q 332 1176 318 1190 l 531 977 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 1374 531 q 1389 496 1389 516 q 1374 461 1389 476 l 1176 263 q 1141 248 1161 248 q 1106 263 1121 248 q 1091 298 1091 277 l 1091 397 l 298 397 l 298 298 q 283 263 298 277 q 248 248 268 248 q 213 263 228 248 l 15 461 q 0 496 0 476 q 15 531 0 516 l 213 729 q 248 744 228 744 q 283 729 268 744 q 298 694 298 715 l 298 595 l 1091 595 l 1091 694 q 1106 729 1091 715 q 1141 744 1121 744 q 1176 729 1161 744 l 1374 531 z "},"":{"ha":1587,"x_min":0,"x_max":1587,"o":"m 496 496 l 496 99 l 298 99 l 298 496 l 496 496 m 794 893 l 794 99 l 595 99 l 595 893 l 794 893 m 1587 0 l 1587 -99 l 0 -99 l 0 1091 l 99 1091 l 99 0 l 1587 0 m 1091 694 l 1091 99 l 893 99 l 893 694 l 1091 694 m 1389 992 l 1389 99 l 1190 99 l 1190 992 l 1389 992 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 992 718 q 898 691 949 698 q 970 782 951 722 q 867 742 920 753 q 748 794 819 794 q 633 746 680 794 q 585 631 585 698 q 589 594 585 608 q 401 644 489 599 q 253 764 314 689 q 230 682 230 725 q 301 546 230 594 q 223 567 264 547 l 223 565 q 262 462 223 507 q 357 405 301 416 q 318 399 335 399 q 288 402 308 399 q 345 322 304 353 q 439 289 387 290 q 237 219 350 219 q 198 222 217 219 q 448 149 313 149 q 611 176 535 149 q 741 250 687 204 q 834 356 795 296 q 892 482 873 416 q 911 612 911 547 q 911 633 911 626 q 992 718 960 668 m 1190 868 l 1190 124 q 1125 -34 1190 32 q 967 -99 1059 -99 l 223 -99 q 65 -34 131 -99 q 0 124 0 32 l 0 868 q 65 1026 0 960 q 223 1091 131 1091 l 967 1091 q 1125 1026 1059 1091 q 1190 868 1190 960 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 967 1091 q 1125 1026 1059 1091 q 1190 868 1190 960 l 1190 124 q 1125 -34 1190 32 q 967 -99 1059 -99 l 822 -99 l 822 362 l 976 362 l 999 542 l 822 542 l 822 656 q 840 722 822 700 q 911 743 858 743 l 1005 744 l 1005 904 q 867 911 956 911 q 699 849 762 911 q 636 674 636 787 l 636 542 l 481 542 l 481 362 l 636 362 l 636 -99 l 223 -99 q 65 -34 131 -99 q 0 124 0 32 l 0 868 q 65 1026 0 960 q 223 1091 131 1091 l 967 1091 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 712 528 q 716 531 712 528 q 719 546 719 535 q 712 563 719 556 q 694 570 705 570 q 607 534 643 570 q 570 446 570 498 q 577 429 570 436 q 595 422 584 422 q 613 429 606 422 q 620 446 620 436 q 642 499 620 477 q 694 521 663 521 q 712 528 705 521 m 835 585 q 864 556 835 585 q 893 445 893 527 q 835 305 893 363 q 694 246 777 246 q 554 305 612 246 q 496 445 496 363 q 554 585 496 527 q 694 643 612 643 q 835 585 777 643 m 99 0 l 1290 0 l 1290 99 l 99 99 l 99 0 m 905 234 q 948 278 905 234 q 992 445 992 322 q 905 655 992 568 q 694 742 818 742 q 484 655 571 742 q 397 445 397 568 q 484 234 397 322 q 694 147 571 147 q 905 234 818 147 m 198 942 l 496 942 l 496 1042 l 198 1042 l 198 942 m 99 794 l 1290 794 l 1290 885 l 1290 992 l 648 992 l 598 893 l 99 893 l 99 794 m 1389 992 l 1389 0 q 1360 -70 1389 -41 q 1290 -99 1331 -99 l 99 -99 q 29 -70 58 -99 q 0 0 0 -41 l 0 992 q 29 1062 0 1033 q 99 1091 58 1091 l 1290 1091 q 1360 1062 1331 1091 q 1389 992 1389 1033 z "},"":{"ha":1389,"x_min":0,"x_max":1304,"o":"m 601 688 q 623 710 601 688 q 645 794 645 732 q 601 899 645 856 q 496 942 558 942 q 391 899 434 942 q 347 794 347 856 q 362 729 347 761 q 298 744 330 744 q 192 701 236 744 q 149 595 149 657 q 192 490 149 533 q 298 446 236 446 q 403 490 360 446 q 446 595 446 533 q 432 660 446 628 q 496 645 463 645 q 601 688 558 645 m 1304 248 q 1266 197 1304 235 q 1215 159 1228 159 q 1193 171 1208 159 q 1165 197 1178 184 q 1135 228 1152 210 q 1116 248 1118 246 l 1042 174 l 1212 3 q 1234 -50 1234 -19 q 1204 -112 1234 -82 q 1141 -143 1173 -143 q 1088 -121 1110 -143 l 568 399 q 285 298 432 298 q 79 377 159 298 q 0 583 0 457 q 74 825 0 707 q 266 1018 147 944 q 508 1091 384 1091 q 714 1012 635 1091 q 794 806 794 932 q 692 523 794 660 l 967 248 l 1042 322 q 1022 341 1039 325 q 991 371 1004 358 q 965 400 977 384 q 953 422 953 415 q 991 473 953 435 q 1042 511 1028 511 q 1059 503 1052 511 q 1095 469 1064 498 q 1159 407 1126 439 q 1226 340 1191 375 q 1282 280 1260 305 q 1304 248 1304 254 z "},"":{"ha":1488,"x_min":0,"x_max":1488,"o":"m 636 356 q 665 385 636 356 q 694 496 694 414 q 636 636 694 578 q 496 694 578 694 q 356 636 414 694 q 298 496 298 578 q 356 356 298 414 q 496 298 414 298 q 636 356 578 298 m 1290 99 q 1260 169 1290 140 q 1190 198 1231 198 q 1121 169 1150 198 q 1091 99 1091 140 q 1120 29 1091 58 q 1190 0 1149 0 q 1261 29 1232 0 q 1290 99 1290 58 m 1290 893 q 1260 963 1290 933 q 1190 992 1231 992 q 1121 963 1150 992 q 1091 893 1091 933 q 1120 823 1091 852 q 1190 794 1149 794 q 1261 823 1232 794 q 1290 893 1290 852 m 992 567 l 992 423 q 987 408 992 415 q 974 400 981 401 l 854 381 q 829 322 846 354 q 899 233 856 285 q 904 218 904 225 q 899 203 904 208 q 835 134 881 180 q 774 88 789 88 q 758 93 766 88 l 669 163 q 609 139 640 148 q 591 19 601 55 q 568 0 586 0 l 424 0 q 408 6 415 0 q 401 19 401 12 l 383 138 q 325 162 357 146 l 233 93 q 218 88 228 88 q 202 94 209 88 q 90 218 90 197 q 95 233 90 225 q 127 274 103 243 q 164 321 151 304 q 136 384 146 355 l 19 403 q 5 410 11 404 q 0 426 0 417 l 0 569 q 5 584 0 577 q 18 592 11 591 l 138 611 q 163 670 146 638 q 93 759 136 707 q 88 774 88 767 q 93 790 88 784 q 157 859 110 813 q 218 904 203 904 q 234 899 226 904 l 323 829 q 383 854 350 843 q 401 973 391 938 q 424 992 406 992 l 568 992 q 584 986 577 992 q 591 973 591 980 l 609 854 q 667 830 636 846 l 759 899 q 774 904 765 904 q 791 898 783 904 q 902 774 902 795 q 897 760 902 768 q 864 718 887 747 q 829 671 841 688 q 856 608 847 634 l 973 590 q 987 582 981 588 q 992 567 992 575 m 1488 153 l 1488 45 q 1373 21 1488 33 q 1349 -19 1363 0 q 1389 -126 1389 -107 q 1386 -132 1389 -129 q 1290 -187 1291 -187 q 1254 -150 1283 -187 q 1214 -98 1225 -114 q 1190 -99 1198 -99 q 1167 -98 1183 -99 q 1127 -150 1156 -114 q 1091 -187 1097 -187 q 995 -132 1090 -187 q 992 -126 992 -129 q 1032 -19 992 -107 q 1008 21 1018 0 q 893 45 893 33 l 893 153 q 1008 177 893 166 q 1032 218 1018 200 q 992 325 992 305 q 995 330 992 328 q 1022 346 998 332 q 1068 372 1046 360 q 1091 384 1090 384 q 1127 348 1097 384 q 1167 296 1156 312 q 1190 298 1183 298 q 1214 296 1198 298 q 1285 383 1253 351 l 1290 384 q 1386 330 1293 384 q 1389 325 1389 328 q 1349 218 1389 305 q 1373 177 1363 200 q 1488 153 1488 166 m 1488 947 l 1488 839 q 1373 815 1488 826 q 1349 774 1363 794 q 1389 667 1389 687 q 1386 662 1389 664 q 1290 607 1291 607 q 1254 643 1283 607 q 1214 696 1225 680 q 1190 694 1198 694 q 1167 696 1183 694 q 1127 643 1156 680 q 1091 607 1097 607 q 995 662 1090 607 q 992 667 992 664 q 1032 774 992 687 q 1008 815 1018 794 q 893 839 893 826 l 893 947 q 1008 971 893 960 q 1032 1011 1018 994 q 992 1118 992 1099 q 995 1124 992 1121 q 1022 1139 998 1125 q 1068 1166 1046 1153 q 1091 1178 1090 1178 q 1127 1142 1097 1178 q 1167 1090 1156 1106 q 1190 1091 1183 1091 q 1214 1090 1198 1091 q 1285 1177 1253 1145 l 1290 1178 q 1386 1124 1293 1178 q 1389 1118 1389 1121 q 1349 1011 1389 1099 q 1373 971 1363 994 q 1488 947 1488 960 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 1018 794 q 1055 749 1018 794 q 1091 595 1091 703 q 1018 396 1091 488 q 820 252 946 305 q 546 198 694 198 q 409 211 479 198 q 194 112 313 143 q 127 99 166 105 l 125 99 q 109 105 116 99 q 100 122 102 112 q 99 127 99 124 q 100 132 99 129 q 101 136 100 134 q 103 140 102 139 q 106 145 104 142 q 109 148 108 147 q 112 152 110 150 q 115 156 115 155 q 133 175 119 160 q 153 198 147 190 q 171 221 160 206 q 190 250 182 235 q 206 284 198 266 q 55 422 110 340 q 0 595 0 503 q 73 794 0 703 q 272 939 146 886 q 546 992 398 992 q 820 939 694 992 q 1018 794 946 886 m 1389 397 q 1334 223 1389 304 q 1183 86 1279 142 q 1199 52 1190 67 q 1218 22 1207 36 q 1235 0 1229 8 q 1256 -23 1242 -9 q 1273 -43 1270 -38 q 1277 -46 1274 -43 q 1280 -50 1279 -49 q 1283 -54 1281 -51 q 1286 -58 1285 -57 q 1288 -62 1287 -60 q 1289 -67 1289 -64 q 1290 -72 1290 -69 q 1289 -77 1290 -74 q 1279 -94 1287 -88 q 1262 -99 1271 -100 q 1195 -87 1223 -94 q 980 12 1076 -56 q 843 0 910 0 q 477 102 633 0 q 546 99 522 99 q 785 134 670 99 q 990 234 900 169 q 1139 398 1087 305 q 1190 595 1190 491 q 1173 713 1190 655 q 1331 575 1273 658 q 1389 397 1389 492 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 184 114 q 191 121 184 114 q 198 149 198 129 q 184 184 198 169 q 149 198 169 198 q 114 184 129 198 q 99 149 99 169 q 114 114 99 129 q 149 99 129 99 q 184 114 169 99 m 1091 595 q 1061 665 1091 635 q 992 694 1031 694 l 719 694 q 756 818 719 739 q 794 942 794 897 q 769 1055 794 1018 q 670 1091 744 1091 q 640 1025 649 1071 q 617 928 631 980 q 570 843 602 877 q 511 773 553 825 q 493 749 508 769 q 469 718 478 730 q 442 685 459 705 q 411 651 425 664 q 381 623 397 637 q 350 602 365 609 q 322 595 335 595 l 298 595 l 298 99 l 322 99 q 347 97 332 99 q 372 92 361 95 q 402 83 384 89 q 429 74 420 78 q 457 65 438 71 q 479 57 475 58 q 744 0 643 0 l 838 0 q 987 129 987 0 q 983 173 987 150 q 1020 214 1006 185 q 1033 270 1033 242 q 1019 324 1033 299 q 1060 416 1060 363 q 1053 459 1060 436 q 1033 496 1045 483 q 1075 532 1058 497 q 1091 595 1091 568 m 1190 596 q 1152 470 1190 527 q 1159 416 1159 444 q 1130 305 1159 357 q 1132 271 1132 288 q 1086 133 1132 193 q 1020 -37 1087 26 q 844 -99 953 -99 l 816 -99 l 744 -99 q 597 -82 670 -99 q 429 -31 525 -64 q 322 0 339 0 l 99 0 q 29 29 58 0 q 0 99 0 58 l 0 595 q 29 665 0 636 q 99 694 58 694 l 312 694 q 418 815 339 713 q 501 914 463 873 q 528 980 519 933 q 552 1078 537 1027 q 600 1162 567 1129 q 670 1190 630 1190 q 787 1165 735 1190 q 866 1087 839 1140 q 893 942 893 1033 q 856 794 893 870 l 992 794 q 1132 735 1073 794 q 1190 596 1190 676 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 184 808 q 191 816 184 808 q 198 843 198 823 q 184 878 198 863 q 149 893 169 893 q 114 878 129 893 q 99 843 99 863 q 114 808 99 823 q 149 794 129 794 q 184 808 169 794 m 1091 397 q 1075 460 1091 424 q 1033 496 1058 495 q 1053 533 1045 509 q 1060 576 1060 556 q 1019 668 1060 629 q 1033 722 1033 692 q 1020 779 1033 750 q 983 819 1006 807 q 987 863 987 842 q 949 960 987 929 q 843 992 911 992 l 744 992 q 479 935 643 992 q 457 927 475 934 q 429 918 438 921 q 402 909 420 915 q 372 900 384 903 q 347 895 361 898 q 322 893 332 893 l 298 893 l 298 397 l 322 397 q 350 390 335 397 q 381 369 365 383 q 411 341 397 355 q 442 307 425 328 q 469 274 459 287 q 493 243 478 262 q 511 219 508 223 q 570 149 553 167 q 617 64 602 115 q 640 -33 631 12 q 670 -99 649 -79 q 769 -63 744 -99 q 794 50 794 -26 q 756 174 794 95 q 719 298 719 253 l 992 298 q 1061 327 1031 298 q 1091 397 1091 357 m 1190 396 q 1132 257 1190 316 q 992 198 1073 198 l 856 198 q 893 50 893 122 q 866 -95 893 -42 q 787 -173 839 -148 q 670 -198 735 -198 q 600 -170 630 -198 q 558 -106 574 -144 q 538 -36 543 -68 q 525 29 534 -4 q 501 79 515 63 q 418 177 463 118 q 312 298 339 279 l 99 298 q 29 327 58 298 q 0 397 0 356 l 0 893 q 29 963 0 934 q 99 992 58 992 l 322 992 q 429 1023 339 992 q 602 1074 529 1057 q 757 1091 676 1091 l 844 1091 q 1020 1030 953 1091 q 1086 863 1087 969 l 1086 859 q 1132 721 1132 799 q 1130 687 1132 704 q 1159 576 1159 636 q 1152 522 1159 548 q 1190 396 1190 466 z "},"":{"ha":694,"x_min":0,"x_max":645,"o":"m 645 1166 l 645 128 l 297 -55 q 266 -64 280 -64 q 241 -53 250 -64 q 233 -26 233 -42 q 235 -10 233 -21 l 301 377 l 19 652 q 0 689 0 673 q 43 725 0 718 l 432 781 l 607 1134 q 645 1166 622 1166 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 1290 729 q 1273 839 1290 791 q 1230 916 1256 887 q 1167 962 1204 944 q 1094 986 1130 980 q 1018 992 1059 992 q 932 972 978 992 q 846 923 885 953 q 779 867 807 893 q 732 819 751 841 q 694 802 718 802 q 656 819 670 802 q 610 867 638 841 q 543 923 582 893 q 457 972 504 953 q 370 992 411 992 q 295 986 330 992 q 222 962 259 980 q 158 916 184 944 q 116 839 133 887 q 99 729 99 791 q 244 453 99 598 l 694 19 l 1144 453 q 1290 729 1290 598 m 1389 729 q 1211 380 1389 557 l 729 -85 q 694 -99 715 -99 q 660 -85 674 -99 l 177 381 q 155 401 169 388 q 112 452 142 415 q 60 528 83 489 q 18 622 36 567 q 0 729 0 677 q 98 995 0 899 q 370 1091 197 1091 q 469 1075 419 1091 q 562 1030 519 1058 q 636 977 605 1001 q 694 924 667 952 q 753 977 722 952 q 827 1030 784 1001 q 920 1075 870 1058 q 1018 1091 970 1091 q 1290 995 1192 1091 q 1389 729 1389 899 z "},"":{"ha":1290,"x_min":0,"x_max":1215,"o":"m 496 74 q 497 59 496 71 q 497 38 498 47 q 495 20 497 30 q 487 5 493 10 q 471 0 481 0 l 223 0 q 65 65 131 0 q 0 223 0 131 l 0 769 q 65 927 0 861 q 223 992 131 992 l 471 992 q 489 985 481 992 q 496 967 496 977 q 497 952 496 964 q 497 931 498 939 q 495 913 497 923 q 487 898 493 903 q 471 893 481 893 l 223 893 q 136 856 172 893 q 99 769 99 820 l 99 223 q 136 136 99 172 q 223 99 172 99 l 446 99 q 455 99 447 99 q 465 99 463 99 q 474 98 467 99 q 483 96 481 98 q 489 92 485 95 q 494 85 493 89 q 496 74 496 81 m 1201 531 q 1215 496 1215 516 q 1201 461 1215 476 l 779 40 q 744 25 764 25 q 709 40 724 25 q 694 74 694 54 l 694 298 l 347 298 q 312 312 327 298 q 298 347 298 327 l 298 645 q 312 680 298 665 q 347 694 327 694 l 694 694 l 694 918 q 709 953 694 938 q 744 967 724 967 q 779 953 764 967 l 1201 531 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 184 95 l 363 95 l 363 632 l 184 632 l 184 95 m 374 798 q 346 865 374 839 q 274 891 319 891 q 201 865 229 891 q 173 798 173 839 q 200 732 173 759 q 272 705 228 705 l 273 705 q 346 732 319 705 q 374 798 374 759 m 828 95 l 1007 95 l 1007 403 q 950 584 1007 522 q 801 645 894 645 q 639 554 695 645 l 640 554 l 640 632 l 461 632 q 461 95 463 581 l 640 95 l 640 395 q 646 439 640 425 q 680 485 657 466 q 738 504 704 504 q 828 382 828 504 l 828 95 m 1190 868 l 1190 124 q 1125 -34 1190 32 q 967 -99 1059 -99 l 223 -99 q 65 -34 131 -99 q 0 124 0 32 l 0 868 q 65 1026 0 960 q 223 1091 131 1091 l 967 1091 q 1125 1026 1059 1091 q 1190 868 1190 960 z "},"":{"ha":893,"x_min":0,"x_max":893,"o":"m 372 521 l 372 868 q 365 886 372 879 q 347 893 358 893 q 329 886 336 893 q 322 868 322 879 l 322 521 q 329 503 322 510 q 347 496 336 496 q 365 503 358 496 q 372 521 372 510 m 893 248 q 878 213 893 228 q 843 198 863 198 l 511 198 l 471 -176 q 463 -192 470 -185 q 447 -198 457 -198 l 446 -198 q 422 -177 426 -198 l 363 198 l 50 198 q 15 213 29 198 q 0 248 0 228 q 61 420 0 343 q 198 496 122 496 l 198 893 q 129 922 158 893 q 99 992 99 952 q 129 1062 99 1032 q 198 1091 158 1091 l 694 1091 q 764 1062 735 1091 q 794 992 794 1032 q 764 922 794 952 q 694 893 735 893 l 694 496 q 832 420 771 496 q 893 248 893 343 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 1091 471 l 1091 223 q 1026 65 1091 131 q 868 0 960 0 l 223 0 q 65 65 131 0 q 0 223 0 131 l 0 868 q 65 1026 0 960 q 223 1091 131 1091 l 769 1091 q 787 1084 780 1091 q 794 1066 794 1077 l 794 1017 q 787 999 794 1006 q 769 992 780 992 l 223 992 q 136 956 172 992 q 99 868 99 919 l 99 223 q 136 136 99 172 q 223 99 172 99 l 868 99 q 956 136 919 99 q 992 223 992 172 l 992 471 q 999 489 992 482 q 1017 496 1006 496 l 1066 496 q 1084 489 1077 496 q 1091 471 1091 482 m 1389 1141 l 1389 744 q 1374 709 1389 724 q 1339 694 1359 694 q 1304 709 1319 694 l 1168 846 l 663 340 q 645 332 655 332 q 627 340 635 332 l 539 429 q 531 446 531 436 q 539 464 531 457 l 1044 970 l 908 1106 q 893 1141 893 1121 q 908 1176 893 1161 q 942 1190 922 1190 l 1339 1190 q 1374 1176 1359 1190 q 1389 1141 1389 1161 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 903 531 q 918 496 918 516 q 903 461 918 476 l 481 40 q 446 25 467 25 q 412 40 426 25 q 397 74 397 54 l 397 298 l 50 298 q 15 312 29 298 q 0 347 0 327 l 0 645 q 15 680 0 665 q 50 694 29 694 l 397 694 l 397 918 q 412 953 397 938 q 446 967 426 967 q 481 953 467 967 l 903 531 m 1190 769 l 1190 223 q 1125 65 1190 131 q 967 0 1059 0 l 719 0 q 702 7 709 0 q 694 25 694 15 q 694 40 694 28 q 693 61 693 53 q 696 79 694 69 q 703 94 698 89 q 719 99 709 99 l 967 99 q 1055 136 1018 99 q 1091 223 1091 172 l 1091 769 q 1055 856 1091 820 q 967 893 1018 893 l 744 893 q 736 893 743 893 q 725 893 728 893 q 717 894 723 893 q 708 896 710 894 q 701 900 705 898 q 696 907 698 903 q 694 918 694 911 q 694 933 694 921 q 693 954 693 946 q 696 972 694 962 q 703 987 698 982 q 719 992 709 992 l 967 992 q 1125 927 1059 992 q 1190 769 1190 861 z "},"":{"ha":1290,"x_min":0,"x_max":1290,"o":"m 355 506 q 298 794 298 632 l 99 794 l 99 719 q 172 594 99 659 q 355 506 246 529 m 1190 719 l 1190 794 l 992 794 q 935 506 992 632 q 1117 594 1044 529 q 1190 719 1190 659 m 1290 818 l 1290 719 q 1258 608 1290 664 q 1171 508 1225 553 q 1037 432 1116 463 q 870 398 957 401 q 796 324 837 356 q 755 268 767 298 q 744 198 744 238 q 768 128 744 157 q 843 99 791 99 q 947 64 901 99 q 992 -25 992 29 l 992 -74 q 985 -92 992 -85 q 967 -99 978 -99 l 322 -99 q 305 -92 312 -99 q 298 -74 298 -85 l 298 -25 q 343 64 298 29 q 446 99 388 99 q 522 128 498 99 q 546 198 546 157 q 534 268 546 238 q 494 324 523 298 q 420 398 453 356 q 253 432 332 401 q 119 508 174 463 q 32 608 64 553 q 0 719 0 664 l 0 818 q 22 871 0 849 q 74 893 43 893 l 298 893 l 298 967 q 334 1055 298 1018 q 422 1091 370 1091 l 868 1091 q 956 1055 919 1091 q 992 967 992 1018 l 992 893 l 1215 893 q 1268 871 1246 893 q 1290 818 1290 849 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 402 260 q 400 270 405 265 q 389 272 393 276 q 391 262 386 267 q 402 260 398 257 m 381 292 q 371 295 377 298 q 371 286 367 292 q 381 282 377 280 q 381 292 385 285 m 349 323 q 345 329 350 326 q 339 328 339 331 q 342 322 336 324 q 349 323 348 320 m 365 305 q 366 309 367 306 q 363 313 366 312 q 356 315 359 319 q 357 307 353 312 q 365 305 361 302 m 432 247 q 425 256 433 253 q 415 253 418 258 q 422 244 413 247 q 432 247 429 242 m 456 239 q 460 239 456 239 q 464 245 464 239 q 455 251 464 251 q 447 245 447 251 q 456 239 447 239 m 494 250 q 484 254 493 256 q 477 247 476 253 q 487 243 479 241 q 494 250 494 244 m 992 496 q 876 777 992 660 q 595 893 760 893 q 315 777 431 893 q 198 496 198 660 q 274 263 198 367 q 470 119 350 160 q 490 123 484 117 q 497 139 497 129 q 496 212 497 179 q 484 210 491 212 q 457 209 477 209 q 419 212 436 208 q 386 227 402 215 q 363 260 369 239 q 319 317 345 305 q 315 320 317 318 q 309 326 313 322 q 303 333 305 330 q 307 339 302 336 q 322 342 311 342 q 333 340 326 342 q 357 328 340 339 q 382 301 373 318 q 411 268 395 279 q 445 257 428 257 q 474 260 462 257 q 498 267 487 263 q 523 321 503 304 q 457 335 485 326 q 400 365 428 345 q 357 424 372 386 q 342 517 342 463 q 383 623 342 578 q 387 729 364 671 q 429 723 401 733 q 476 700 457 712 l 496 687 q 595 701 541 701 q 694 687 649 701 q 717 701 703 693 q 760 722 730 710 q 804 729 789 733 q 808 623 826 671 q 849 517 849 578 q 838 439 849 473 q 810 385 827 405 q 769 350 794 364 q 720 330 744 336 q 667 321 697 324 q 694 247 694 297 q 694 178 694 216 q 694 139 694 140 q 700 123 694 129 q 721 119 707 117 q 916 263 840 160 q 992 496 992 367 m 1190 868 l 1190 124 q 1125 -34 1190 32 q 967 -99 1059 -99 l 223 -99 q 65 -34 131 -99 q 0 124 0 32 l 0 868 q 65 1026 0 960 q 223 1091 131 1091 l 967 1091 q 1125 1026 1059 1091 q 1190 868 1190 960 z "},"":{"ha":1290,"x_min":0,"x_max":1290,"o":"m 977 15 q 985 22 977 15 q 992 50 992 29 q 977 84 992 70 q 942 99 963 99 q 908 84 922 99 q 893 50 893 70 q 908 15 893 29 q 942 0 922 0 q 977 15 963 0 m 1176 15 q 1183 22 1176 15 q 1190 50 1190 29 q 1176 84 1190 70 q 1141 99 1161 99 q 1106 84 1121 99 q 1091 50 1091 70 q 1106 15 1091 29 q 1141 0 1121 0 q 1176 15 1161 0 m 1290 223 l 1290 -25 q 1268 -78 1290 -56 q 1215 -99 1246 -99 l 74 -99 q 22 -78 43 -99 q 0 -25 0 -56 l 0 223 q 22 276 0 254 q 74 298 43 298 l 405 298 q 460 226 422 254 q 546 198 498 198 l 744 198 q 830 226 791 198 q 884 298 868 254 l 1215 298 q 1268 276 1246 298 q 1290 223 1290 254 m 1038 725 q 992 694 1025 694 l 794 694 l 794 347 q 779 312 794 327 q 744 298 764 298 l 546 298 q 511 312 525 298 q 496 347 496 327 l 496 694 l 298 694 q 252 725 265 694 q 263 779 239 756 l 610 1126 q 645 1141 624 1141 q 680 1126 666 1141 l 1027 779 q 1038 725 1051 756 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 1090 550 q 1085 638 1090 584 q 1071 713 1080 692 q 1058 747 1062 736 q 1051 775 1054 758 q 1048 813 1048 793 q 1052 866 1048 831 q 1056 918 1056 901 q 1048 961 1056 947 q 1038 962 1045 962 q 993 958 1023 962 q 947 955 963 955 q 811 973 901 955 q 675 992 721 992 q 602 983 642 992 q 536 965 562 974 q 467 939 510 956 q 310 859 360 897 q 186 712 236 802 q 118 529 137 622 q 99 336 99 436 q 109 243 99 305 q 119 150 119 181 q 110 98 119 132 q 102 47 102 64 q 111 19 102 30 q 137 8 120 8 q 193 16 156 8 q 250 25 231 25 q 382 13 295 25 q 513 1 469 1 q 733 29 653 1 q 916 147 833 64 q 1044 337 998 230 q 1090 550 1090 444 m 1190 552 q 1135 298 1190 424 q 984 75 1081 172 q 766 -65 886 -22 q 513 -99 670 -99 q 381 -88 469 -99 q 250 -77 294 -77 q 194 -88 232 -77 q 137 -99 157 -99 q 41 -56 81 -99 q 2 43 2 -13 q 11 96 2 62 q 19 148 19 130 q 10 241 19 179 q 0 336 0 304 q 14 504 0 422 q 56 667 28 587 q 134 817 84 746 q 250 938 184 887 q 430 1031 311 984 q 675 1091 581 1091 q 811 1073 722 1091 q 946 1054 901 1054 q 990 1058 960 1054 q 1035 1062 1019 1062 q 1126 1023 1097 1062 q 1155 918 1155 984 q 1151 866 1155 901 q 1147 813 1147 831 q 1149 794 1147 803 q 1151 781 1150 784 q 1157 765 1152 777 q 1163 749 1162 753 q 1183 658 1176 718 q 1190 552 1190 597 z "},"":{"ha":1091,"x_min":0,"x_max":1091,"o":"m 1091 229 q 1084 175 1091 208 q 1067 122 1076 141 q 973 40 1051 83 q 829 0 900 0 q 787 3 808 0 q 743 12 767 5 q 706 24 718 19 q 663 40 694 28 q 625 53 632 51 q 490 118 550 81 q 285 285 391 179 q 118 490 179 391 q 53 625 81 550 q 40 663 51 632 q 24 706 28 694 q 12 743 19 718 q 3 787 5 767 q 0 829 0 808 q 40 973 0 900 q 122 1067 83 1051 q 175 1084 141 1076 q 229 1091 208 1091 q 246 1089 240 1091 q 287 1030 260 1084 q 310 988 295 1015 q 337 939 325 961 q 361 898 350 917 q 375 878 363 894 q 391 851 386 862 q 397 829 397 839 q 375 790 397 813 q 327 747 353 767 q 279 706 301 728 q 257 670 257 684 q 260 653 257 663 q 267 637 264 643 q 278 618 270 632 q 287 604 286 605 q 422 422 346 498 q 604 287 498 346 q 618 278 605 286 q 637 267 632 270 q 653 260 643 264 q 670 257 663 257 q 706 279 684 257 q 747 327 728 301 q 790 375 767 353 q 829 397 813 397 q 851 391 839 397 q 878 375 862 386 q 898 361 894 363 q 939 337 917 350 q 988 310 961 325 q 1030 287 1015 295 q 1089 246 1084 260 q 1091 229 1091 240 z "},"":{"ha":1091,"x_min":0,"x_max":1091,"o":"m 868 992 l 223 992 q 136 956 172 992 q 99 868 99 919 l 99 223 q 136 136 99 172 q 223 99 172 99 l 868 99 q 956 136 919 99 q 992 223 992 172 l 992 868 q 956 956 992 919 q 868 992 919 992 m 1091 868 l 1091 223 q 1026 65 1091 131 q 868 0 960 0 l 223 0 q 65 65 131 0 q 0 223 0 131 l 0 868 q 65 1026 0 960 q 223 1091 131 1091 l 868 1091 q 1026 1026 960 1091 q 1091 868 1091 960 z "},"":{"ha":992,"x_min":0,"x_max":992,"o":"m 893 992 l 99 992 l 99 29 l 427 344 l 496 410 l 565 344 l 893 29 l 893 992 m 902 1091 q 936 1084 920 1091 q 977 1053 962 1074 q 992 1004 992 1031 l 992 5 q 977 -43 992 -21 q 936 -74 962 -64 q 902 -81 922 -81 q 838 -56 865 -81 l 496 273 l 154 -56 q 90 -81 126 -81 q 56 -74 72 -81 q 15 -43 30 -64 q 0 5 0 -21 l 0 1004 q 15 1053 0 1031 q 56 1084 30 1074 q 90 1091 72 1091 l 902 1091 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 992 266 q 991 278 992 274 q 977 291 989 282 q 945 310 964 300 q 908 331 926 321 q 873 350 891 341 q 851 362 856 360 q 836 372 847 364 q 817 384 825 380 q 801 388 808 388 q 772 372 789 388 q 742 337 756 356 q 712 302 728 318 q 686 286 696 286 q 673 289 680 286 q 661 294 666 291 q 648 301 656 296 q 637 308 639 306 q 505 406 560 350 q 407 538 450 461 q 400 549 405 540 q 393 562 395 557 q 388 574 391 567 q 385 587 385 581 q 401 613 385 597 q 436 643 417 629 q 471 673 455 656 q 487 701 487 690 q 483 718 487 709 q 471 737 479 726 q 461 752 463 748 q 450 774 459 756 q 430 809 440 791 q 410 846 420 827 q 390 877 399 865 q 377 891 381 890 q 365 893 374 893 q 287 876 328 893 q 225 803 251 860 q 198 701 198 746 q 200 675 198 689 q 204 651 202 661 q 211 626 206 642 q 219 603 216 610 q 229 577 222 596 q 237 554 236 559 q 405 306 284 427 q 653 138 526 184 q 677 129 658 136 q 702 120 695 122 q 725 112 709 117 q 751 105 741 107 q 774 101 760 103 q 801 99 788 99 q 902 126 845 99 q 975 188 959 152 q 992 266 992 229 m 1190 868 l 1190 124 q 1125 -34 1190 32 q 967 -99 1059 -99 l 223 -99 q 65 -34 131 -99 q 0 124 0 32 l 0 868 q 65 1026 0 960 q 223 1091 131 1091 l 967 1091 q 1125 1026 1059 1091 q 1190 868 1190 960 z "},"":{"ha":1290,"x_min":34,"x_max":1256,"o":"m 1256 874 q 1130 745 1204 798 q 1131 712 1131 734 q 1101 511 1131 612 q 1012 319 1072 411 q 869 155 952 226 q 669 42 786 84 q 419 0 552 0 q 34 112 208 0 q 95 109 61 109 q 405 216 269 109 q 260 266 324 218 q 171 390 195 315 q 219 386 197 386 q 284 395 252 386 q 141 481 198 412 q 84 640 84 550 l 84 643 q 197 612 136 614 q 115 701 146 646 q 85 820 85 756 q 119 946 85 888 q 348 761 213 831 q 636 684 482 692 q 629 742 629 714 q 703 919 629 846 q 880 992 776 992 q 1063 913 988 992 q 1221 973 1147 929 q 1111 836 1193 884 q 1256 874 1184 843 z "},"":{"ha":794,"x_min":74,"x_max":743,"o":"m 743 1181 l 743 977 l 622 977 q 532 949 555 977 q 508 865 508 921 l 508 718 l 736 718 l 705 489 l 508 489 l 508 -99 l 271 -99 l 271 489 l 74 489 l 74 718 l 271 718 l 271 887 q 352 1111 271 1032 q 567 1190 432 1190 q 743 1181 680 1190 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 296 1011 q 365 1051 296 1011 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 q 1190 496 1190 658 q 1077 146 1190 301 q 784 -69 963 -9 q 753 -64 763 -73 q 742 -40 742 -54 q 743 19 742 -38 q 743 123 743 76 q 703 233 743 198 q 782 247 747 238 q 855 277 818 257 q 918 329 893 298 q 959 410 943 360 q 975 527 975 461 q 914 687 975 619 q 908 845 942 757 q 845 836 886 852 q 773 802 804 821 l 744 784 q 595 804 672 804 q 446 784 519 804 q 413 805 434 792 q 349 834 393 817 q 283 845 305 852 q 277 687 248 757 q 215 527 215 619 q 231 411 215 461 q 272 329 247 360 q 334 277 297 298 q 407 247 372 257 q 487 233 443 238 q 449 153 457 205 q 414 142 432 146 q 370 138 395 138 q 319 155 344 138 q 276 203 294 171 q 238 243 261 228 q 200 262 215 259 l 184 264 q 162 261 168 264 q 158 252 156 257 q 165 241 160 246 q 175 232 170 236 l 181 228 q 214 198 198 220 q 239 159 231 177 l 246 141 q 281 93 257 112 q 332 70 305 75 q 386 65 360 65 q 429 67 412 64 l 447 71 q 448 2 447 41 q 448 -40 448 -37 q 438 -64 448 -54 q 407 -69 428 -73 q 114 146 227 -9 q 0 496 0 301 q 80 795 0 658 q 296 1011 160 932 m 226 236 q 220 246 228 242 q 210 244 212 248 q 215 235 208 239 q 226 236 222 230 m 250 210 q 248 222 255 214 q 236 225 240 229 q 237 212 230 221 q 250 210 245 205 m 273 175 q 273 190 280 181 q 260 195 267 200 q 260 181 253 191 q 273 175 267 171 m 305 143 q 302 157 312 149 q 287 160 293 167 q 290 145 280 153 q 305 143 299 136 m 350 123 q 339 136 352 132 q 325 130 328 139 q 335 119 322 122 q 350 123 346 114 m 398 119 q 385 128 398 129 q 373 119 373 128 q 386 111 373 109 q 398 119 398 111 m 443 127 q 429 134 442 136 q 419 122 417 132 q 432 116 420 113 q 443 127 445 119 z "},"":{"ha":1290,"x_min":0,"x_max":1290,"o":"m 1290 744 l 1290 546 q 1275 511 1290 525 q 1240 496 1260 496 l 1190 496 q 1156 511 1170 496 q 1141 546 1141 525 l 1141 744 q 1083 884 1141 826 q 942 942 1025 942 q 802 884 860 942 q 744 744 744 826 l 744 595 l 818 595 q 871 574 849 595 q 893 521 893 552 l 893 74 q 871 22 893 43 q 818 0 849 0 l 74 0 q 22 22 43 0 q 0 74 0 43 l 0 521 q 22 574 0 552 q 74 595 43 595 l 595 595 l 595 744 q 697 989 595 887 q 942 1091 799 1091 q 1188 989 1086 1091 q 1290 744 1290 887 z "},"":{"ha":1488,"x_min":0,"x_max":1488,"o":"m 1364 1091 q 1452 1055 1415 1091 q 1488 967 1488 1018 l 1488 25 q 1452 -63 1488 -26 q 1364 -99 1415 -99 l 124 -99 q 36 -63 73 -99 q 0 25 0 -26 l 0 967 q 36 1055 0 1018 q 124 1091 73 1091 l 1364 1091 m 124 992 q 107 985 114 992 q 99 967 99 977 l 99 794 l 1389 794 l 1389 967 q 1382 985 1389 977 q 1364 992 1374 992 l 124 992 m 1364 0 q 1382 7 1374 0 q 1389 25 1389 15 l 1389 496 l 99 496 l 99 25 q 107 7 99 15 q 124 0 114 0 l 1364 0 m 198 99 l 198 198 l 397 198 l 397 99 l 198 99 m 496 99 l 496 198 l 794 198 l 794 99 l 496 99 z "},"":{"ha":1091,"x_min":0,"x_max":1091,"o":"m 254 254 q 276 233 254 254 q 298 149 298 211 q 254 43 298 87 q 149 0 211 0 q 43 43 87 0 q 0 149 0 87 q 43 254 0 211 q 149 298 87 298 q 254 254 211 298 m 694 53 q 681 16 696 32 q 645 0 667 0 l 540 0 q 507 13 521 0 q 491 45 493 26 q 348 348 474 222 q 45 491 222 474 q 13 507 26 493 q 0 540 0 521 l 0 645 q 16 681 0 667 q 50 694 29 694 l 53 694 q 291 632 177 684 q 491 491 404 580 q 632 291 580 404 q 694 53 684 177 m 1091 52 q 1077 16 1093 31 q 1042 0 1063 0 l 931 0 q 896 14 911 0 q 881 47 882 27 q 803 363 872 213 q 624 624 734 513 q 363 803 513 734 q 47 882 213 872 q 14 897 27 883 q 0 931 0 911 l 0 1042 q 16 1077 0 1063 q 50 1091 29 1091 l 52 1091 q 441 998 255 1081 q 770 770 626 915 q 998 441 915 626 q 1091 52 1081 255 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 788 292 q 797 283 788 292 q 806 248 806 274 q 788 204 806 222 q 744 186 770 186 q 700 204 718 186 q 682 248 682 222 q 700 292 682 274 q 744 310 718 310 q 788 292 770 310 m 986 292 q 995 283 986 292 q 1004 248 1004 274 q 986 204 1004 222 q 942 186 968 186 q 899 204 917 186 q 880 248 880 222 q 899 292 880 274 q 942 310 917 310 q 986 292 968 310 m 1091 124 l 1091 372 q 1084 389 1091 382 q 1066 397 1077 397 l 124 397 q 107 389 114 397 q 99 372 99 382 l 99 124 q 107 107 99 114 q 124 99 114 99 l 1066 99 q 1084 107 1077 99 q 1091 124 1091 114 m 138 496 l 1053 496 l 931 870 q 918 886 928 880 q 898 893 909 893 l 292 893 q 272 886 281 893 q 260 870 263 880 l 138 496 m 1190 372 l 1190 124 q 1154 36 1190 73 q 1066 0 1118 0 l 124 0 q 36 36 73 0 q 0 124 0 73 l 0 372 q 12 430 0 391 l 165 900 q 214 966 178 941 q 292 992 250 992 l 898 992 q 977 966 941 992 q 1025 900 1012 941 l 1178 430 q 1190 372 1190 391 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 1290 694 q 1360 665 1331 694 q 1389 595 1389 636 q 1360 525 1389 554 q 1290 496 1331 496 l 1290 198 q 1260 129 1290 158 q 1190 99 1231 99 q 561 394 867 368 q 491 343 516 379 q 467 265 465 306 q 498 193 468 223 q 480 142 482 167 q 484 97 477 117 q 510 55 491 78 q 548 16 529 32 q 595 -23 566 0 q 509 -88 573 -68 q 378 -96 445 -107 q 276 -53 312 -86 q 253 14 270 -36 q 228 88 236 64 q 210 157 221 111 q 199 235 200 202 q 202 311 198 267 q 219 397 205 355 l 124 397 q 36 433 73 397 q 0 521 0 470 l 0 670 q 36 757 0 721 q 124 794 73 794 l 496 794 q 1190 1091 833 794 q 1260 1062 1231 1091 q 1290 992 1290 1032 l 1290 694 m 1190 226 l 1190 966 q 595 700 885 732 l 595 491 q 1190 226 887 458 z "},"":{"ha":1389,"x_min":50,"x_max":1339,"o":"m 694 -136 q 707 -124 707 -136 q 694 -112 707 -112 q 616 -79 649 -112 q 583 0 583 -46 q 570 12 583 12 q 558 0 558 12 q 598 -96 558 -57 q 694 -136 638 -136 m 191 99 l 1198 99 q 992 744 992 332 q 973 825 992 784 q 920 905 955 867 q 826 968 885 943 q 694 992 767 992 q 563 968 622 992 q 469 905 504 943 q 415 825 434 867 q 397 744 397 784 q 191 99 397 332 m 1339 99 q 1310 29 1339 59 q 1240 0 1280 0 l 893 0 q 835 -140 893 -82 q 694 -198 777 -198 q 554 -140 612 -198 q 496 0 496 -82 l 149 0 q 79 29 109 0 q 50 99 50 59 q 120 167 88 132 q 186 260 152 203 q 244 383 220 317 q 283 543 267 449 q 298 744 298 636 q 388 963 298 862 q 626 1086 479 1064 q 620 1116 620 1101 q 642 1169 620 1147 q 694 1190 663 1190 q 747 1169 725 1190 q 769 1116 769 1147 q 763 1086 769 1101 q 1001 963 910 1064 q 1091 744 1091 862 q 1106 543 1091 636 q 1145 383 1121 449 q 1203 260 1169 317 q 1269 167 1237 203 q 1339 99 1301 132 z "},"":{"ha":1190,"x_min":2,"x_max":1189,"o":"m 1066 496 l 1173 391 q 1189 337 1197 370 q 1149 298 1180 305 l 1003 260 l 1044 116 q 1029 62 1053 84 q 975 47 1007 38 l 831 88 l 794 -57 q 754 -98 786 -88 q 739 -99 745 -99 q 700 -82 715 -99 l 595 25 l 491 -82 q 436 -98 469 -105 q 397 -57 405 -89 l 360 88 l 215 47 q 161 62 184 38 q 146 116 137 84 l 188 260 l 42 298 q 2 337 11 305 q 17 391 -6 370 l 124 496 l 17 601 q 2 655 -6 622 q 42 694 11 687 l 188 732 l 146 876 q 161 930 137 908 q 215 945 184 954 l 360 904 l 397 1049 q 436 1089 405 1081 q 491 1074 468 1098 l 595 966 l 700 1074 q 754 1089 722 1097 q 794 1049 786 1081 l 831 904 l 975 945 q 1029 930 1007 954 q 1044 876 1053 908 l 1003 732 l 1149 694 q 1189 655 1180 687 q 1173 601 1197 622 l 1066 496 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 184 114 q 191 121 184 114 q 198 149 198 129 q 184 184 198 169 q 149 198 169 198 q 114 184 129 198 q 99 149 99 169 q 114 114 99 129 q 149 99 129 99 q 184 114 169 99 m 1290 595 q 1259 665 1290 635 q 1190 694 1229 694 l 744 694 q 756 732 744 710 q 781 775 767 754 q 807 827 795 795 q 818 893 818 860 q 784 968 818 945 q 694 992 749 992 q 625 884 676 992 q 596 834 606 850 q 509 722 565 784 q 431 639 454 659 q 322 595 377 595 l 298 595 l 298 99 l 322 99 q 452 74 378 99 q 602 25 525 50 q 741 0 678 0 q 887 129 887 0 q 884 173 887 150 q 920 214 907 185 q 934 270 934 242 q 920 324 934 299 q 961 416 961 363 q 953 459 961 436 q 934 496 946 483 l 1190 496 q 1260 525 1231 496 q 1290 595 1290 555 m 1389 596 q 1330 456 1389 515 q 1190 397 1272 397 l 1059 397 q 1031 305 1056 349 q 1033 271 1033 288 q 987 133 1033 193 q 921 -37 987 26 q 745 -99 854 -99 q 495 -46 642 -99 q 322 0 368 0 l 99 0 q 29 29 58 0 q 0 99 0 58 l 0 595 q 29 665 0 636 q 99 694 58 694 l 322 694 q 339 698 330 694 q 357 709 348 701 q 375 723 367 716 q 393 740 383 729 q 409 757 404 751 q 424 773 415 763 q 435 787 433 784 q 512 887 485 844 q 538 935 522 903 q 567 991 553 966 q 598 1039 580 1015 q 641 1078 616 1064 q 694 1091 665 1091 q 854 1039 791 1091 q 918 893 918 987 q 901 794 918 840 l 1190 794 q 1330 735 1271 794 q 1389 596 1389 676 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 1066 99 l 1091 99 l 1091 595 l 1066 595 q 1014 605 1039 595 q 966 633 989 614 q 927 669 942 653 q 889 711 911 685 q 880 722 883 718 q 793 834 824 784 q 763 887 782 851 q 755 904 763 889 q 741 932 748 919 q 725 960 734 945 q 709 983 717 974 q 694 992 701 992 q 605 968 639 992 q 570 893 570 945 q 582 827 570 860 q 608 775 594 795 q 633 732 622 754 q 645 694 645 710 l 198 694 q 129 665 160 694 q 99 595 99 635 q 129 525 99 555 q 198 496 158 496 l 455 496 q 436 459 443 483 q 428 416 428 436 q 469 324 428 363 q 455 270 455 299 q 469 214 455 242 q 505 173 482 185 q 502 129 502 154 q 540 32 502 64 q 645 0 577 0 q 787 25 710 0 q 937 74 863 50 q 1066 99 1011 99 m 1275 114 q 1282 121 1275 114 q 1290 149 1290 129 q 1275 184 1290 169 q 1240 198 1260 198 q 1205 184 1220 198 q 1190 149 1190 169 q 1205 114 1190 129 q 1240 99 1220 99 q 1275 114 1260 99 m 1389 595 l 1389 99 q 1360 29 1389 58 q 1290 0 1331 0 l 1066 0 q 894 -46 1021 0 q 648 -99 746 -99 q 470 -39 538 -99 q 402 129 401 21 l 403 133 q 356 271 356 192 q 358 305 356 288 q 329 397 332 349 l 198 397 q 59 456 117 397 q 0 596 0 515 q 59 735 0 676 q 198 794 118 794 l 488 794 q 471 893 471 840 q 534 1039 471 987 q 694 1091 598 1091 q 748 1078 724 1091 q 791 1039 773 1064 q 822 991 809 1015 q 851 935 836 966 q 877 887 867 903 q 954 787 904 844 q 965 773 956 784 q 980 757 974 763 q 996 740 985 751 q 1014 723 1006 729 q 1032 709 1022 716 q 1050 698 1041 701 q 1066 694 1059 694 l 1290 694 q 1360 665 1331 694 q 1389 595 1389 636 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 977 -84 q 985 -77 977 -84 q 992 -50 992 -70 q 977 -15 992 -29 q 942 0 963 0 q 908 -15 922 0 q 893 -50 893 -29 q 908 -84 893 -70 q 942 -99 922 -99 q 977 -84 963 -99 m 1091 543 q 962 689 1091 689 q 918 685 942 689 q 878 722 906 708 q 821 736 849 736 q 767 722 792 736 q 675 763 729 763 q 632 755 656 763 q 595 736 608 747 l 595 992 q 566 1062 595 1032 q 496 1091 536 1091 q 427 1061 457 1091 q 397 992 397 1031 l 397 546 q 359 557 381 546 q 317 583 337 569 q 264 608 296 597 q 198 620 232 620 q 123 586 146 620 q 99 496 99 551 q 207 426 99 477 q 257 398 241 408 q 370 311 307 367 q 452 233 432 256 q 496 124 496 179 l 496 99 l 992 99 l 992 124 q 1017 253 992 180 q 1066 403 1042 327 q 1091 543 1091 480 m 1190 546 q 1137 297 1190 443 q 1091 124 1091 170 l 1091 -99 q 1062 -169 1091 -140 q 992 -198 1033 -198 l 496 -198 q 426 -169 455 -198 q 397 -99 397 -140 l 397 124 q 393 141 397 132 q 382 159 390 150 q 369 176 375 168 q 351 195 362 184 q 334 211 340 205 q 318 226 329 216 q 305 236 307 235 q 205 314 247 287 q 157 339 188 324 q 101 368 125 355 q 52 400 77 381 q 14 442 27 418 q 0 496 0 467 q 52 656 0 593 q 198 719 104 719 q 298 702 251 719 l 298 992 q 357 1132 298 1073 q 495 1190 415 1190 q 636 1132 577 1190 q 694 992 694 1073 l 694 861 q 787 832 742 858 q 820 835 803 835 q 958 788 898 835 q 1128 722 1066 789 q 1190 546 1190 656 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 1091 446 q 1066 588 1091 512 q 1017 739 1042 665 q 992 868 992 812 l 992 893 l 496 893 l 496 868 q 487 816 496 841 q 458 767 477 791 q 422 729 439 744 q 381 691 406 713 q 370 681 374 684 q 257 594 307 625 q 205 565 240 584 q 187 557 202 564 q 159 543 172 550 q 132 527 146 536 q 108 510 117 519 q 99 496 99 502 q 123 407 99 441 q 198 372 146 372 q 264 384 232 372 q 317 409 296 395 q 359 435 337 423 q 397 446 381 446 l 397 0 q 427 -69 397 -39 q 496 -99 457 -99 q 566 -70 536 -99 q 595 0 595 -40 l 595 257 q 675 229 631 229 q 767 270 729 229 q 821 257 792 257 q 878 270 849 257 q 918 307 906 284 q 962 304 937 304 q 1059 341 1028 304 q 1091 446 1091 379 m 977 1007 q 985 1014 977 1007 q 992 1042 992 1022 q 977 1077 992 1062 q 942 1091 963 1091 q 908 1077 922 1091 q 893 1042 893 1062 q 908 1007 893 1022 q 942 992 922 992 q 977 1007 963 992 m 1190 450 q 1130 271 1190 339 q 962 204 1070 203 l 958 205 q 820 157 899 157 q 787 160 803 157 q 694 131 745 136 l 694 0 q 636 -140 694 -81 q 495 -198 577 -198 q 357 -140 415 -198 q 298 0 298 -81 l 298 290 q 198 273 256 273 q 52 336 105 273 q 0 496 0 399 q 14 550 0 525 q 52 593 27 574 q 101 624 77 611 q 157 653 125 637 q 205 678 188 668 q 305 756 247 705 q 318 767 307 757 q 334 781 329 776 q 351 797 340 787 q 369 816 362 808 q 382 833 375 824 q 393 851 390 842 q 397 868 397 860 l 397 1091 q 426 1161 397 1132 q 496 1190 455 1190 l 992 1190 q 1062 1161 1033 1190 q 1091 1091 1091 1132 l 1091 868 q 1137 695 1091 822 q 1190 450 1190 548 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 992 446 l 992 546 q 977 581 992 566 q 942 595 963 595 l 553 595 l 700 742 q 715 777 715 756 q 700 811 715 797 l 629 882 q 594 896 615 896 q 560 882 574 896 l 279 601 l 208 531 q 195 496 195 517 q 208 461 195 475 l 279 391 l 560 110 q 594 96 574 96 q 629 110 615 96 l 700 181 q 714 215 714 195 q 700 250 714 236 l 553 397 l 942 397 q 977 412 963 397 q 992 446 992 426 m 1111 795 q 1151 726 1111 795 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 982 461 q 996 496 996 475 q 982 531 996 517 l 911 601 l 631 882 q 596 896 617 896 q 561 882 575 896 l 491 811 q 477 777 477 798 q 491 742 477 756 l 637 595 l 248 595 q 213 581 228 595 q 198 546 198 566 l 198 446 q 213 412 198 426 q 248 397 228 397 l 637 397 l 491 250 q 476 215 476 236 q 491 181 476 195 l 561 110 q 596 96 575 96 q 631 110 617 96 l 911 391 l 982 461 m 1111 795 q 1151 726 1111 795 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 981 462 q 995 497 995 476 q 981 532 995 518 l 701 812 l 630 883 q 595 897 616 897 q 560 883 574 897 l 490 812 l 209 532 q 195 497 195 518 q 209 462 195 476 l 280 391 q 315 377 294 377 q 350 391 336 377 l 496 538 l 496 149 q 511 114 496 129 q 546 99 525 99 l 645 99 q 680 114 665 99 q 694 149 694 129 l 694 538 l 841 391 q 876 377 856 377 q 911 391 896 377 l 981 462 m 1111 795 q 1151 726 1111 795 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 981 460 q 995 495 995 474 q 981 530 995 516 l 911 601 q 876 615 897 615 q 841 601 855 615 l 694 454 l 694 843 q 680 878 694 863 q 645 893 665 893 l 546 893 q 511 878 525 893 q 496 843 496 863 l 496 454 l 350 601 q 315 615 335 615 q 280 601 295 615 l 209 530 q 195 495 195 516 q 209 460 195 474 l 490 180 l 560 109 q 595 95 574 95 q 630 109 616 95 l 701 180 l 981 460 m 1111 795 q 1151 726 1111 795 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 296 1011 q 365 1051 296 1011 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 m 808 687 q 800 680 806 687 q 790 673 794 674 q 793 677 791 673 q 797 685 795 680 q 800 691 799 690 q 817 702 805 696 q 857 711 828 707 q 897 703 884 718 q 904 713 895 705 q 915 722 913 722 q 927 726 918 724 q 939 732 936 728 l 940 749 q 927 754 931 748 q 922 770 922 760 q 917 764 922 769 q 913 770 917 770 q 904 770 910 771 q 898 769 899 768 q 886 775 890 771 q 880 787 882 778 q 877 799 877 797 q 869 808 875 803 q 862 815 863 812 q 860 820 861 817 q 858 825 859 822 q 854 829 856 827 q 850 831 853 831 q 845 827 848 831 q 839 819 842 823 q 836 815 836 815 q 831 817 833 817 q 827 816 829 816 q 824 813 826 815 q 820 811 822 811 q 813 808 818 809 q 807 807 809 808 q 806 815 818 811 q 794 818 798 818 q 799 827 801 821 q 793 838 798 833 l 797 838 q 790 844 796 841 q 777 851 784 848 q 767 856 769 854 q 740 863 760 860 q 715 863 720 867 q 711 855 711 859 q 714 844 711 852 q 717 835 717 837 q 713 825 718 830 q 708 815 708 819 q 718 803 708 810 q 726 787 729 797 q 714 774 724 780 q 701 765 704 768 q 700 751 698 759 q 708 738 703 742 q 710 735 710 736 q 707 731 709 733 q 703 728 705 729 q 698 725 701 727 l 695 724 q 679 729 687 720 q 669 749 672 737 q 656 772 663 768 q 634 771 639 778 q 602 791 630 781 q 557 794 583 798 q 557 806 562 795 q 543 815 552 818 q 546 829 545 820 q 546 839 546 838 q 556 857 549 849 q 561 864 556 858 q 568 874 566 870 q 569 879 571 879 q 608 887 596 876 q 617 901 612 891 q 625 914 622 910 q 636 918 632 918 q 647 914 639 918 q 658 910 654 910 q 670 918 669 909 q 664 934 671 928 q 667 947 674 933 q 660 954 663 953 q 639 950 651 957 q 641 944 633 947 q 634 936 640 945 q 621 922 627 927 q 608 926 615 918 q 604 937 608 927 q 597 947 601 946 q 584 935 591 947 q 576 947 587 942 q 557 953 565 953 q 551 974 572 963 q 535 978 546 977 q 520 975 525 979 q 516 966 516 970 q 520 960 515 963 q 528 956 524 957 q 537 953 532 954 q 543 950 542 951 q 550 939 554 942 q 543 937 548 939 q 534 933 538 935 q 529 930 530 932 q 529 919 527 927 q 528 908 532 911 q 521 922 524 912 q 515 935 518 932 q 496 930 521 928 l 488 931 q 476 929 485 931 q 460 929 467 928 q 450 935 453 929 q 450 950 446 941 q 453 952 450 953 q 444 959 450 954 q 436 966 439 964 q 363 934 401 954 q 373 935 368 933 q 383 940 377 936 q 391 944 389 943 q 423 949 417 955 l 427 953 q 443 934 438 941 q 419 935 437 937 q 402 925 404 930 q 406 911 408 916 q 397 919 403 914 q 386 928 391 925 q 374 932 381 931 q 357 931 362 932 q 175 759 244 869 q 184 753 181 753 q 188 746 188 752 q 190 737 189 739 q 199 739 191 735 q 202 725 206 733 q 236 704 202 725 q 252 687 250 691 q 244 674 254 679 q 237 680 243 675 q 230 684 231 686 q 231 669 228 680 q 239 660 233 659 q 231 647 233 660 q 229 620 229 635 q 229 601 229 605 l 230 601 q 234 574 228 591 q 251 559 241 556 q 267 525 241 556 q 273 519 271 519 q 282 513 275 517 q 294 505 289 508 q 301 497 298 501 q 309 479 305 493 q 320 461 314 466 q 327 446 319 457 q 336 428 336 435 q 334 427 335 428 q 332 426 332 426 q 344 415 334 421 q 356 405 353 410 q 357 398 357 403 q 360 389 358 392 q 366 388 361 386 q 347 436 367 403 q 334 458 336 455 q 330 470 332 462 q 326 481 328 478 q 331 480 328 481 q 338 477 334 479 q 343 474 341 476 q 345 472 346 473 q 346 458 343 467 q 356 444 350 450 q 369 429 361 438 q 378 419 377 421 q 389 404 383 415 q 389 394 395 394 q 405 386 396 394 q 418 370 413 377 q 424 350 422 364 q 428 332 426 336 q 434 321 429 326 q 444 314 439 316 q 457 308 449 312 q 467 302 464 304 q 481 294 470 301 q 498 285 491 288 q 510 282 505 282 q 521 284 515 282 q 532 287 528 286 q 554 275 543 288 q 570 259 565 262 q 613 250 598 244 q 613 245 612 250 q 620 233 615 239 q 627 221 624 226 q 631 215 629 217 q 645 203 635 210 q 659 191 655 196 q 664 198 663 195 q 670 183 662 192 q 684 175 677 174 q 694 200 694 177 q 656 214 670 188 q 655 218 656 215 q 651 225 653 222 q 649 231 650 228 q 649 237 649 235 q 653 239 650 239 q 661 242 660 239 q 660 252 662 245 q 656 262 657 259 q 648 277 656 268 q 639 289 640 287 q 626 283 635 282 q 614 290 618 284 q 613 286 614 289 q 612 281 612 282 q 600 281 601 281 q 602 295 601 284 q 605 312 603 306 q 609 322 605 315 q 615 333 612 328 q 618 343 617 338 q 614 350 618 347 q 601 352 610 353 q 581 336 586 351 q 578 328 580 334 q 574 319 577 322 q 567 314 572 316 q 549 312 562 312 q 530 316 536 313 q 513 339 520 322 q 505 367 505 355 q 507 388 505 375 q 510 407 509 401 q 505 426 510 414 q 512 434 508 428 q 520 442 517 439 q 524 443 522 443 q 527 443 525 443 q 530 444 529 443 q 532 449 532 446 q 529 451 532 450 q 526 453 527 453 q 548 455 532 451 q 570 453 565 458 q 587 455 581 445 q 585 462 587 456 q 584 473 583 469 q 607 466 588 452 q 619 462 609 463 q 632 458 629 460 q 638 454 635 457 q 642 450 641 451 q 646 451 643 450 q 653 456 649 452 q 662 437 660 445 q 677 403 670 406 q 685 401 682 401 q 689 409 688 402 q 689 420 689 415 q 687 429 688 424 l 687 436 q 687 450 687 443 l 686 456 q 672 465 674 458 q 673 479 669 472 q 684 494 677 487 q 691 496 685 494 q 703 501 696 498 q 712 508 709 505 q 724 535 729 522 q 732 542 729 535 q 729 544 732 542 q 723 548 725 546 q 719 550 720 550 q 721 562 726 553 q 727 570 725 564 q 732 578 729 577 q 749 577 739 569 q 749 589 755 583 q 765 597 753 594 q 780 605 777 600 q 786 606 785 603 q 787 615 787 609 q 789 625 787 622 q 801 632 792 629 q 811 636 809 635 l 824 644 q 824 647 826 647 q 848 656 838 646 q 843 671 856 664 q 841 679 846 676 q 829 683 836 681 q 838 683 832 684 q 846 684 845 683 q 841 697 858 692 q 808 687 828 701 m 681 8 q 953 154 841 36 q 944 158 951 157 q 934 160 936 159 q 915 167 920 166 q 913 177 916 172 q 907 184 911 181 q 898 190 904 186 q 889 195 891 194 q 884 200 887 197 q 878 204 880 203 q 872 208 877 205 q 866 209 868 210 q 858 208 863 208 l 856 208 q 851 206 853 207 q 847 203 849 205 q 844 201 845 202 q 844 199 843 200 q 816 216 828 212 q 808 221 812 217 q 799 226 803 224 q 792 227 796 228 q 783 222 787 226 q 778 210 779 218 q 777 200 777 202 q 777 214 771 204 q 778 228 782 223 q 770 231 776 233 q 761 228 764 230 q 752 221 757 226 q 745 216 746 217 q 738 212 743 215 q 732 206 733 208 q 727 197 729 203 q 723 188 725 191 q 714 193 722 191 q 707 198 707 195 q 710 171 708 190 q 714 141 711 151 q 705 104 719 117 q 682 73 684 84 q 691 53 679 56 q 685 37 691 47 q 680 20 679 26 q 681 8 680 16 z "},"":{"ha":1290,"x_min":16,"x_max":1288,"o":"m 283 15 q 290 22 283 15 q 298 50 298 29 q 283 84 298 70 q 248 99 268 99 q 213 84 228 99 q 198 50 198 70 q 213 15 198 29 q 248 0 228 0 q 283 15 268 0 m 797 375 l 268 -153 q 198 -182 239 -182 q 128 -153 158 -182 l 46 -70 q 16 0 16 -42 q 46 71 16 41 l 574 598 q 662 464 604 522 q 797 375 721 405 m 1288 712 q 1270 630 1288 682 q 1143 462 1234 526 q 942 397 1052 397 q 697 499 799 397 q 595 744 595 601 q 697 989 595 887 q 942 1091 799 1091 q 1037 1078 987 1091 q 1120 1042 1086 1066 q 1132 1021 1132 1034 q 1120 999 1132 1008 l 893 868 l 893 694 l 1042 612 q 1104 649 1046 614 q 1209 712 1161 684 q 1263 739 1256 739 q 1282 732 1275 739 q 1288 712 1288 724 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 794 99 l 1290 99 l 1290 198 l 794 198 l 794 99 m 496 496 l 1290 496 l 1290 595 l 496 595 l 496 496 m 992 893 l 1290 893 l 1290 992 l 992 992 l 992 893 m 1389 248 l 1389 50 q 1374 15 1389 29 q 1339 0 1359 0 l 50 0 q 15 15 29 0 q 0 50 0 29 l 0 248 q 15 283 0 268 q 50 298 29 298 l 1339 298 q 1374 283 1359 298 q 1389 248 1389 268 m 1389 645 l 1389 446 q 1374 412 1389 426 q 1339 397 1359 397 l 50 397 q 15 412 29 397 q 0 446 0 426 l 0 645 q 15 680 0 665 q 50 694 29 694 l 1339 694 q 1374 680 1359 694 q 1389 645 1389 665 m 1389 1042 l 1389 843 q 1374 808 1389 823 q 1339 794 1359 794 l 50 794 q 15 808 29 794 q 0 843 0 823 l 0 1042 q 15 1077 0 1062 q 50 1091 29 1091 l 1339 1091 q 1374 1077 1359 1091 q 1389 1042 1389 1062 z "},"":{"ha":1091,"x_min":4,"x_max":1087,"o":"m 1087 962 q 1077 908 1101 930 l 694 525 l 694 -50 q 664 -95 694 -82 q 645 -99 654 -99 q 610 -84 624 -99 l 412 114 q 397 149 397 129 l 397 525 l 15 908 q 4 962 -9 930 q 50 992 17 992 l 1042 992 q 1087 962 1074 992 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 496 992 l 893 992 l 893 1091 l 496 1091 l 496 992 m 1389 496 l 1389 124 q 1352 36 1389 73 q 1265 0 1316 0 l 124 0 q 36 36 73 0 q 0 124 0 73 l 0 496 l 521 496 l 521 372 q 536 337 521 352 q 570 322 550 322 l 818 322 q 853 337 839 322 q 868 372 868 352 l 868 496 l 1389 496 m 794 496 l 794 397 l 595 397 l 595 496 l 794 496 m 1389 868 l 1389 570 l 0 570 l 0 868 q 36 956 0 919 q 124 992 73 992 l 397 992 l 397 1116 q 419 1169 397 1147 q 471 1190 440 1190 l 918 1190 q 970 1169 949 1190 q 992 1116 992 1147 l 992 992 l 1265 992 q 1352 956 1316 992 q 1389 868 1389 919 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 994 771 l 719 496 l 994 221 l 1106 332 q 1160 343 1128 357 q 1190 298 1190 330 l 1190 -50 q 1176 -84 1190 -70 q 1141 -99 1161 -99 l 794 -99 q 748 -68 761 -99 q 759 -15 735 -38 l 870 97 l 595 372 l 320 97 l 432 -15 q 443 -68 456 -38 q 397 -99 429 -99 l 50 -99 q 15 -84 29 -99 q 0 -50 0 -70 l 0 298 q 31 343 0 330 q 84 332 61 357 l 196 221 l 471 496 l 196 771 l 84 660 q 50 645 70 645 q 31 649 40 645 q 0 694 0 662 l 0 1042 q 15 1077 0 1062 q 50 1091 29 1091 l 397 1091 q 443 1060 429 1091 q 432 1007 456 1030 l 320 895 l 595 620 l 870 895 l 759 1007 q 748 1060 735 1030 q 794 1091 761 1091 l 1141 1091 q 1176 1077 1161 1091 q 1190 1042 1190 1062 l 1190 694 q 1160 649 1190 662 q 1141 645 1150 645 q 1106 660 1121 645 l 994 771 z "},"":{"ha":1488,"x_min":0,"x_max":1488,"o":"m 460 496 q 254 397 334 492 l 150 397 q 43 428 87 397 q 0 520 0 460 q 96 794 0 794 q 130 777 101 794 q 205 744 159 761 q 298 728 252 728 q 401 746 350 728 q 397 694 397 717 q 460 496 397 587 m 1290 2 q 1233 -145 1290 -91 q 1083 -198 1177 -198 l 405 -198 q 255 -145 312 -198 q 198 2 198 -91 q 201 83 198 43 q 212 167 204 122 q 233 251 220 212 q 266 327 245 290 q 314 389 287 363 q 380 431 341 415 q 467 446 419 446 q 500 430 474 446 q 556 393 525 413 q 639 355 587 372 q 744 339 691 339 q 849 355 797 339 q 932 393 901 372 q 988 430 963 413 q 1022 446 1014 446 q 1108 431 1069 446 q 1174 389 1147 415 q 1222 327 1201 363 q 1256 251 1243 290 q 1276 167 1268 212 q 1287 83 1284 122 q 1290 2 1290 43 m 438 1132 q 467 1103 438 1132 q 496 992 496 1074 q 438 852 496 910 q 298 794 380 794 q 157 852 215 794 q 99 992 99 910 q 157 1132 99 1074 q 298 1190 215 1190 q 438 1132 380 1190 m 954 905 q 998 861 954 905 q 1042 694 1042 818 q 954 484 1042 571 q 744 397 867 397 q 534 484 621 397 q 446 694 446 571 q 534 905 446 818 q 744 992 621 992 q 954 905 867 992 m 1488 520 q 1445 428 1488 460 q 1338 397 1401 397 l 1234 397 q 1028 496 1154 492 q 1091 694 1091 587 q 1087 746 1091 717 q 1190 728 1139 728 q 1283 744 1236 728 q 1358 777 1329 761 q 1392 794 1387 794 q 1488 520 1488 794 m 1331 1132 q 1360 1103 1331 1132 q 1389 992 1389 1074 q 1331 852 1389 910 q 1190 794 1273 794 q 1050 852 1108 794 q 992 992 992 910 q 1050 1132 992 1074 q 1190 1190 1108 1190 q 1331 1132 1273 1190 z "},"":{"ha":1290,"x_min":12,"x_max":1277,"o":"m 1128 248 q 1107 301 1128 279 l 946 462 q 893 484 924 484 q 837 459 860 484 q 852 444 839 457 q 868 428 864 432 q 880 413 873 423 q 890 393 887 403 q 893 372 893 384 q 871 319 893 341 q 818 298 849 298 q 797 300 807 298 q 777 310 787 303 q 763 322 767 318 q 746 339 758 326 q 732 353 734 351 q 706 297 706 329 q 728 244 706 266 l 887 84 q 940 63 908 63 q 993 83 971 63 l 1107 196 q 1128 248 1128 218 m 584 794 q 562 847 584 825 l 402 1008 q 350 1029 381 1029 q 297 1008 319 1029 l 183 895 q 161 843 161 873 q 183 791 161 812 l 344 629 q 397 608 365 608 q 453 632 429 608 q 438 647 450 635 q 421 663 426 659 q 410 678 417 668 q 400 698 402 688 q 397 719 397 708 q 419 772 397 750 q 471 794 440 794 q 493 791 483 794 q 512 781 502 788 q 527 769 522 773 q 544 753 532 765 q 558 738 556 740 q 584 794 584 762 m 1212 406 q 1277 248 1277 341 q 1211 91 1277 155 l 1097 -22 q 940 -87 1033 -87 q 782 -21 846 -87 l 622 140 q 558 297 558 204 q 626 459 558 392 l 558 527 q 397 459 491 459 q 239 524 304 459 l 78 685 q 12 843 12 750 q 78 1001 12 936 l 192 1114 q 350 1178 257 1178 q 508 1112 443 1178 l 667 952 q 732 794 732 887 q 663 632 732 699 l 732 564 q 893 632 798 632 q 1051 567 986 632 l 1212 406 z "},"":{"ha":1488,"x_min":0,"x_max":1488,"o":"m 1488 298 q 1401 87 1488 174 q 1190 0 1314 0 l 347 0 q 102 102 204 0 q 0 347 0 204 q 55 534 0 450 q 200 661 110 619 q 198 694 198 683 q 315 975 198 859 q 595 1091 431 1091 q 817 1023 718 1091 q 963 845 917 955 q 1091 893 1017 893 q 1232 835 1173 893 q 1290 694 1290 777 q 1258 587 1290 636 q 1423 483 1358 564 q 1488 298 1488 402 z "},"":{"ha":1290,"x_min":89,"x_max":1201,"o":"m 1184 68 q 1200 -50 1227 -1 q 1091 -99 1173 -99 l 198 -99 q 90 -50 116 -99 q 106 68 63 -1 l 496 683 l 496 992 l 446 992 q 412 1007 426 992 q 397 1042 397 1022 q 412 1077 397 1062 q 446 1091 426 1091 l 843 1091 q 878 1077 863 1091 q 893 1042 893 1062 q 878 1007 893 1022 q 843 992 863 992 l 794 992 l 794 683 l 1184 68 m 580 630 l 369 298 l 921 298 l 710 630 l 694 654 l 694 683 l 694 992 l 595 992 l 595 683 l 595 654 l 580 630 z "},"":{"ha":1389,"x_min":1,"x_max":1389,"o":"m 709 481 q 717 489 709 481 q 744 496 724 496 q 779 481 764 496 q 794 446 794 467 q 779 412 794 426 q 744 397 764 397 q 709 412 724 397 q 694 446 694 426 q 709 481 694 467 m 977 446 l 1370 138 q 1389 95 1391 122 q 1362 55 1385 67 l 1263 5 q 1240 0 1252 0 q 1216 6 1227 0 l 681 306 l 596 255 q 587 251 590 252 q 594 176 598 213 q 551 62 589 116 q 449 -34 513 7 q 234 -99 346 -99 q 62 -39 129 -99 q 1 122 -8 26 q 44 236 6 181 q 146 332 82 291 q 361 397 248 397 q 478 373 426 397 q 495 390 485 383 l 590 446 l 495 503 q 478 520 485 510 q 361 496 426 496 q 146 561 248 496 q 44 657 82 602 q 1 771 6 712 q 13 859 -3 817 q 62 931 29 901 q 234 992 128 992 q 449 927 346 992 q 551 832 513 887 q 594 717 589 777 q 587 642 598 680 q 596 638 590 641 l 681 587 l 1216 887 q 1240 893 1227 893 q 1263 887 1252 893 l 1362 838 q 1389 798 1385 825 q 1370 755 1391 770 l 977 446 m 449 648 q 465 732 484 680 q 383 822 446 783 q 234 868 312 868 q 146 840 177 868 q 130 756 111 808 q 212 666 150 705 q 361 620 284 620 q 449 648 419 620 m 383 71 q 465 161 446 110 q 449 245 484 212 q 361 273 419 273 q 212 227 284 273 q 130 136 150 188 q 146 53 111 85 q 234 25 177 25 q 383 71 312 25 m 521 546 l 595 501 l 595 509 q 621 553 595 537 l 632 559 l 570 595 l 550 575 q 543 567 548 573 q 533 557 537 560 q 530 555 532 556 q 528 553 529 553 l 521 546 m 694 372 l 769 347 l 1339 794 l 1240 843 l 645 509 l 645 422 l 521 347 l 528 341 q 533 336 529 339 q 542 327 536 333 q 550 318 547 321 l 570 298 l 694 372 m 1240 50 l 1339 99 l 936 415 l 799 308 q 789 303 798 306 l 1240 50 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 1314 893 q 1367 871 1345 893 q 1389 818 1389 849 l 1389 -124 q 1367 -177 1389 -155 q 1314 -198 1345 -198 l 570 -198 q 518 -177 539 -198 q 496 -124 496 -155 l 496 99 l 74 99 q 22 121 43 99 q 0 174 0 143 l 0 694 q 16 763 0 725 q 53 822 31 800 l 369 1138 q 428 1175 391 1159 q 496 1190 465 1190 l 818 1190 q 871 1169 849 1190 q 893 1116 893 1147 l 893 862 q 992 893 946 893 l 1314 893 m 893 728 l 661 496 l 893 496 l 893 728 m 397 1025 l 165 794 l 397 794 l 397 1025 m 549 524 l 794 769 l 794 1091 l 496 1091 l 496 769 q 474 716 496 738 q 422 694 453 694 l 99 694 l 99 198 l 496 198 l 496 397 q 512 465 496 428 q 549 524 527 502 m 1290 -99 l 1290 794 l 992 794 l 992 471 q 970 419 992 440 q 918 397 949 397 l 595 397 l 595 -99 l 1290 -99 z "},"":{"ha":1091,"x_min":3,"x_max":1088,"o":"m 1088 117 q 1027 -35 1088 26 q 875 -96 966 -96 q 693 -19 770 -96 l 91 583 q 3 793 3 672 q 88 1002 3 916 q 297 1088 174 1088 q 508 1001 419 1088 l 977 531 q 985 514 985 523 q 961 478 985 501 q 925 454 938 454 q 908 462 915 454 l 438 932 q 298 992 377 992 q 159 934 215 992 q 102 794 102 876 q 161 653 102 712 l 763 51 q 875 2 811 2 q 957 35 925 2 q 990 117 990 67 q 941 229 990 181 l 491 680 q 444 698 470 698 q 407 684 422 698 q 392 646 392 669 q 412 601 392 622 l 729 283 q 737 266 737 275 q 713 229 737 253 q 677 205 689 205 q 660 213 667 205 l 342 531 q 293 646 293 578 q 337 754 293 710 q 445 798 381 798 q 560 749 513 798 l 1011 299 q 1088 117 1088 223 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 298 0 l 893 0 l 893 298 l 298 298 l 298 0 m 992 0 l 1091 0 l 1091 694 q 1084 724 1091 705 q 1068 751 1076 743 l 850 969 q 824 984 842 977 q 794 992 805 992 l 794 670 q 772 617 794 639 q 719 595 750 595 l 273 595 q 220 617 242 595 q 198 670 198 639 l 198 992 l 99 992 l 99 0 l 198 0 l 198 322 q 220 375 198 353 q 273 397 242 397 l 918 397 q 970 375 949 397 q 992 322 992 353 l 992 0 m 694 719 l 694 967 q 687 985 694 977 q 670 992 680 992 l 521 992 q 503 985 511 992 q 496 967 496 977 l 496 719 q 503 702 496 709 q 521 694 511 694 l 670 694 q 687 702 680 694 q 694 719 694 709 m 1190 694 l 1190 -25 q 1169 -78 1190 -56 q 1116 -99 1147 -99 l 74 -99 q 22 -78 43 -99 q 0 -25 0 -56 l 0 1017 q 22 1070 0 1048 q 74 1091 43 1091 l 794 1091 q 862 1076 825 1091 q 921 1039 899 1060 l 1138 822 q 1175 763 1159 800 q 1190 694 1190 725 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 1190 868 l 1190 124 q 1125 -34 1190 32 q 967 -99 1059 -99 l 223 -99 q 65 -34 131 -99 q 0 124 0 32 l 0 868 q 65 1026 0 960 q 223 1091 131 1091 l 967 1091 q 1125 1026 1059 1091 q 1190 868 1190 960 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 1190 149 l 1190 50 q 1176 15 1190 29 q 1141 0 1161 0 l 50 0 q 15 15 29 0 q 0 50 0 29 l 0 149 q 15 184 0 169 q 50 198 29 198 l 1141 198 q 1176 184 1161 198 q 1190 149 1190 169 m 1190 546 l 1190 446 q 1176 412 1190 426 q 1141 397 1161 397 l 50 397 q 15 412 29 397 q 0 446 0 426 l 0 546 q 15 581 0 566 q 50 595 29 595 l 1141 595 q 1176 581 1161 595 q 1190 546 1190 566 m 1190 942 l 1190 843 q 1176 808 1190 823 q 1141 794 1161 794 l 50 794 q 15 808 29 794 q 0 843 0 823 l 0 942 q 15 977 0 963 q 50 992 29 992 l 1141 992 q 1176 977 1161 992 q 1190 942 1190 963 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 254 205 q 276 183 254 205 q 298 99 298 161 q 254 -6 298 37 q 149 -50 211 -50 q 43 -6 87 -50 q 0 99 0 37 q 43 205 0 161 q 149 248 87 248 q 254 205 211 248 m 254 601 q 276 580 254 601 q 298 496 298 558 q 254 391 298 434 q 149 347 211 347 q 43 391 87 347 q 0 496 0 434 q 43 601 0 558 q 149 645 87 645 q 254 601 211 645 m 1389 174 l 1389 25 q 1382 7 1389 15 q 1364 0 1374 0 l 422 0 q 404 7 412 0 q 397 25 397 15 l 397 174 q 404 191 397 184 q 422 198 412 198 l 1364 198 q 1382 191 1374 198 q 1389 174 1389 184 m 254 998 q 276 977 254 998 q 298 893 298 955 q 254 787 298 831 q 149 744 211 744 q 43 787 87 744 q 0 893 0 831 q 43 998 0 955 q 149 1042 87 1042 q 254 998 211 1042 m 1389 570 l 1389 422 q 1382 404 1389 412 q 1364 397 1374 397 l 422 397 q 404 404 412 397 q 397 422 397 412 l 397 570 q 404 588 397 581 q 422 595 412 595 l 1364 595 q 1382 588 1374 595 q 1389 570 1389 581 m 1389 967 l 1389 818 q 1382 801 1389 808 q 1364 794 1374 794 l 422 794 q 404 801 412 794 q 397 818 397 808 l 397 967 q 404 985 397 977 q 422 992 412 992 l 1364 992 q 1382 985 1374 992 q 1389 967 1389 977 z "},"":{"ha":1389,"x_min":12,"x_max":1389,"o":"m 295 -65 q 253 -163 295 -127 q 148 -198 211 -198 q 15 -147 66 -198 l 59 -79 q 141 -114 97 -114 q 180 -103 164 -114 q 197 -70 197 -91 q 115 -26 197 -20 l 95 17 q 121 51 102 25 q 153 93 140 77 q 182 122 167 109 l 182 123 q 145 122 170 123 q 107 122 119 122 l 107 81 l 25 81 l 25 198 l 283 198 l 283 130 l 209 41 q 272 3 249 32 q 295 -65 295 -26 m 297 421 l 297 298 l 16 298 q 12 339 12 326 q 30 412 12 379 q 74 464 48 444 q 125 501 99 484 q 169 535 150 518 q 187 570 187 552 q 176 600 187 589 q 145 610 164 610 q 82 565 109 610 l 16 611 q 72 672 35 650 q 153 694 109 694 q 249 662 210 694 q 288 575 288 630 q 261 504 288 536 q 203 454 235 472 q 145 415 171 436 q 117 374 118 394 l 215 374 l 215 421 l 297 421 m 1389 174 l 1389 25 q 1382 7 1389 15 q 1364 0 1374 0 l 422 0 q 404 7 412 0 q 397 25 397 15 l 397 174 q 404 191 397 184 q 422 198 411 198 l 1364 198 q 1382 191 1374 198 q 1389 174 1389 184 m 298 870 l 298 794 l 38 794 l 38 870 l 121 870 q 121 965 121 902 q 122 1059 122 1027 l 122 1068 l 120 1068 q 81 1026 114 1055 l 26 1085 l 132 1184 l 214 1184 l 214 870 l 298 870 m 1389 570 l 1389 422 q 1382 404 1389 412 q 1364 397 1374 397 l 422 397 q 404 404 412 397 q 397 422 397 412 l 397 570 q 404 588 397 581 q 422 595 411 595 l 1364 595 q 1382 588 1374 595 q 1389 570 1389 581 m 1389 967 l 1389 818 q 1382 801 1389 808 q 1364 794 1374 794 l 422 794 q 404 801 412 794 q 397 818 397 808 l 397 967 q 404 985 397 977 q 422 992 412 992 l 1364 992 q 1382 985 1374 992 q 1389 967 1389 977 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 1364 496 q 1382 489 1375 496 q 1389 471 1389 482 l 1389 422 q 1382 404 1389 411 q 1364 397 1375 397 l 25 397 q 7 404 14 397 q 0 422 0 411 l 0 471 q 7 489 0 482 q 25 496 14 496 l 1364 496 m 374 546 q 335 608 353 573 q 298 753 298 684 q 401 993 298 894 q 706 1091 505 1091 q 836 1077 745 1091 q 973 1039 887 1067 q 989 948 980 1010 q 1000 806 1000 853 q 996 771 1000 792 l 987 769 l 922 773 l 911 775 q 831 934 872 891 q 668 1004 763 1004 q 527 959 580 1004 q 475 846 475 914 q 526 737 475 789 q 742 637 577 685 q 877 586 796 622 q 950 546 922 564 l 374 546 m 767 347 l 1086 347 q 1091 276 1091 317 q 1059 112 1091 190 q 1004 31 1042 68 q 920 -32 976 4 q 801 -83 858 -69 q 644 -99 739 -99 q 493 -81 556 -99 l 384 -50 q 329 -29 340 -38 q 322 -12 322 -22 l 322 -2 q 321 119 322 82 q 321 172 320 143 l 322 201 l 322 235 l 401 236 q 425 181 413 210 q 442 138 436 153 q 452 117 448 123 q 514 44 479 73 q 595 0 547 16 q 698 -17 641 -17 q 805 4 747 -17 q 900 71 865 24 q 936 171 936 118 q 873 292 936 236 q 767 347 847 315 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 37 1018 q 2 1021 9 1019 l 0 1089 q 31 1090 10 1090 q 118 1087 78 1090 q 246 1081 220 1081 q 377 1084 313 1081 q 490 1087 467 1087 q 556 1089 533 1087 l 556 1078 l 557 1028 l 557 1022 q 461 1015 511 1015 q 400 995 415 1015 q 390 893 390 984 q 390 868 390 883 q 391 848 391 853 l 391 670 l 402 453 q 442 297 407 357 q 516 226 469 251 q 653 189 584 189 q 801 211 734 189 q 878 250 845 225 q 929 300 915 278 q 970 388 956 343 q 986 566 986 445 q 983 665 986 627 q 975 760 980 703 q 964 884 969 817 l 961 929 q 942 997 957 981 q 883 1024 916 1025 l 805 1022 l 794 1025 l 796 1091 l 861 1091 l 1020 1084 q 1172 1091 1079 1081 l 1186 1090 q 1190 1050 1190 1060 q 1187 1026 1190 1045 q 1122 1016 1152 1017 q 1061 1003 1066 1008 q 1049 971 1049 991 q 1051 950 1049 966 q 1052 926 1052 935 q 1069 619 1058 911 q 1057 384 1073 468 q 1025 289 1046 325 q 939 194 996 239 q 798 125 880 150 q 600 99 713 99 q 380 135 470 99 q 241 229 288 171 q 177 381 194 288 q 164 564 164 443 l 164 822 q 151 987 164 968 q 37 1018 132 1015 m 1190 -74 l 1190 -25 q 1184 -7 1190 -14 q 1166 0 1177 0 l 25 0 q 7 -7 14 0 q 0 -25 0 -14 l 0 -74 q 7 -92 0 -85 q 25 -99 14 -99 l 1166 -99 q 1184 -92 1177 -99 q 1190 -74 1190 -85 z "},"":{"ha":1290,"x_min":0,"x_max":1290,"o":"m 397 124 l 397 273 q 390 291 397 284 q 372 298 383 298 l 124 298 q 106 291 113 298 q 99 273 99 284 l 99 124 q 106 106 99 113 q 124 99 113 99 l 372 99 q 390 106 383 99 q 397 124 397 113 m 397 422 l 397 570 q 390 588 397 581 q 372 595 383 595 l 124 595 q 106 588 113 595 q 99 570 99 581 l 99 422 q 106 404 99 411 q 124 397 113 397 l 372 397 q 390 404 383 397 q 397 422 397 411 m 794 124 l 794 273 q 787 291 794 284 q 769 298 780 298 l 521 298 q 503 291 510 298 q 496 273 496 284 l 496 124 q 503 106 496 113 q 521 99 510 99 l 769 99 q 787 106 780 99 q 794 124 794 113 m 397 719 l 397 868 q 390 886 397 879 q 372 893 383 893 l 124 893 q 106 886 113 893 q 99 868 99 879 l 99 719 q 106 701 99 708 q 124 694 113 694 l 372 694 q 390 701 383 694 q 397 719 397 708 m 794 422 l 794 570 q 787 588 794 581 q 769 595 780 595 l 521 595 q 503 588 510 595 q 496 570 496 581 l 496 422 q 503 404 496 411 q 521 397 510 397 l 769 397 q 787 404 780 397 q 794 422 794 411 m 1190 124 l 1190 273 q 1184 291 1190 284 q 1166 298 1177 298 l 918 298 q 900 291 907 298 q 893 273 893 284 l 893 124 q 900 106 893 113 q 918 99 907 99 l 1166 99 q 1184 106 1177 99 q 1190 124 1190 113 m 794 719 l 794 868 q 787 886 794 879 q 769 893 780 893 l 521 893 q 503 886 510 893 q 496 868 496 879 l 496 719 q 503 701 496 708 q 521 694 510 694 l 769 694 q 787 701 780 694 q 794 719 794 708 m 1190 422 l 1190 570 q 1184 588 1190 581 q 1166 595 1177 595 l 918 595 q 900 588 907 595 q 893 570 893 581 l 893 422 q 900 404 893 411 q 918 397 907 397 l 1166 397 q 1184 404 1177 397 q 1190 422 1190 411 m 1190 719 l 1190 868 q 1184 886 1190 879 q 1166 893 1177 893 l 918 893 q 900 886 907 893 q 893 868 893 879 l 893 719 q 900 701 893 708 q 918 694 907 694 l 1166 694 q 1184 701 1177 694 q 1190 719 1190 708 m 1290 967 l 1290 124 q 1253 36 1290 73 q 1166 0 1217 0 l 124 0 q 36 36 73 0 q 0 124 0 73 l 0 967 q 36 1055 0 1018 q 124 1091 73 1091 l 1166 1091 q 1253 1055 1217 1091 q 1290 967 1290 1018 z "},"":{"ha":1290,"x_min":21,"x_max":1290,"o":"m 922 740 l 1149 967 l 1066 1050 l 839 823 l 922 740 m 1255 1002 q 1269 967 1269 988 q 1255 932 1269 946 l 258 -64 q 223 -78 244 -78 q 188 -64 202 -78 l 35 89 q 21 124 21 103 q 35 159 21 145 l 1032 1156 q 1066 1170 1046 1170 q 1101 1156 1087 1170 l 1255 1002 m 222 1115 l 298 1091 l 222 1068 l 198 992 l 175 1068 l 99 1091 l 175 1115 l 198 1190 l 222 1115 m 493 989 l 645 942 l 493 896 l 446 744 l 400 896 l 248 942 l 400 989 l 446 1141 l 493 989 m 1214 618 l 1290 595 l 1214 572 l 1190 496 l 1167 572 l 1091 595 l 1167 618 l 1190 694 l 1214 618 m 718 1115 l 794 1091 l 718 1068 l 694 992 l 671 1068 l 595 1091 l 671 1115 l 694 1190 l 718 1115 z "},"":{"ha":1389,"x_min":50,"x_max":1389,"o":"m 467 29 q 481 44 467 29 q 496 99 496 59 q 467 169 496 140 q 397 198 437 198 q 327 169 357 198 q 298 99 298 140 q 327 29 298 59 q 397 0 357 0 q 467 29 437 0 m 198 496 l 496 496 l 496 694 l 374 694 q 357 687 363 694 l 205 536 q 198 519 198 529 l 198 496 m 1161 29 q 1176 44 1161 29 q 1190 99 1190 59 q 1161 169 1190 140 q 1091 198 1132 198 q 1022 169 1051 198 q 992 99 992 140 q 1022 29 992 59 q 1091 0 1051 0 q 1161 29 1132 0 m 1389 942 l 1389 149 q 1386 128 1389 137 q 1375 114 1383 119 q 1363 105 1368 109 q 1344 100 1357 102 q 1327 99 1332 99 q 1307 99 1322 98 q 1290 99 1292 99 q 1232 -41 1290 17 q 1091 -99 1173 -99 q 951 -41 1009 -99 q 893 99 893 17 l 595 99 q 537 -41 595 17 q 397 -99 479 -99 q 257 -41 315 -99 q 198 99 198 17 l 149 99 q 131 99 146 99 q 112 99 116 98 q 94 100 107 99 q 76 105 81 102 q 63 114 71 109 q 53 128 56 119 q 50 149 50 137 q 64 184 50 169 q 99 198 79 198 l 99 446 q 99 474 99 453 q 99 503 98 494 q 101 530 99 512 q 106 558 102 548 q 117 582 109 569 q 134 605 124 595 l 288 759 q 327 784 302 773 q 372 794 351 794 l 496 794 l 496 942 q 511 977 496 963 q 546 992 525 992 l 1339 992 q 1374 977 1359 992 q 1389 942 1389 963 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 1111 795 q 1151 726 1111 795 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 426 -74 509 -99 q 487 53 472 -2 q 529 216 494 79 q 585 164 544 186 q 674 142 626 142 q 841 195 767 142 q 955 341 915 248 q 995 550 995 434 q 949 716 995 639 q 815 842 903 794 q 618 891 728 891 q 466 869 536 891 q 346 809 395 846 q 262 724 297 772 q 210 623 226 675 q 193 519 193 571 q 224 377 193 439 q 315 291 255 316 q 344 307 338 282 q 350 331 346 312 q 357 354 355 350 q 348 388 361 372 q 308 505 308 435 q 389 706 308 622 q 601 790 470 790 q 784 726 718 790 q 849 561 849 663 q 796 337 849 429 q 660 245 743 245 q 584 279 613 245 q 567 360 556 312 q 587 432 573 387 q 610 512 601 477 q 619 570 619 546 q 598 635 619 609 q 539 660 577 660 q 457 616 491 660 q 424 506 424 572 q 443 412 424 450 l 367 88 q 357 -50 353 33 q 98 168 197 21 q 0 496 0 315 q 80 795 0 658 q 296 1011 160 932 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 967 1091 q 1125 1026 1059 1091 q 1190 868 1190 960 l 1190 124 q 1125 -34 1190 32 q 967 -99 1059 -99 l 405 -99 q 489 64 471 -5 q 530 226 496 90 q 587 174 546 195 q 674 152 628 152 q 903 266 815 152 q 992 556 992 381 q 965 682 992 621 q 890 789 938 742 q 772 865 842 836 q 619 893 701 893 q 469 871 539 893 q 350 811 398 849 q 267 727 301 774 q 215 627 232 679 q 198 525 198 576 q 229 385 198 446 q 319 300 260 325 q 338 300 329 296 q 349 315 346 304 q 360 362 357 349 q 352 395 365 380 q 313 511 313 443 q 393 710 313 627 q 603 792 474 792 q 783 729 718 792 q 848 567 848 667 q 796 345 848 436 q 661 253 743 253 q 586 287 615 253 q 568 367 557 321 q 589 439 574 394 q 612 518 603 484 q 620 576 620 552 q 600 639 620 614 q 541 664 579 664 q 461 620 494 664 q 428 512 428 577 q 446 419 428 457 l 370 98 q 365 -99 352 20 l 223 -99 q 65 -34 131 -99 q 0 124 0 32 l 0 868 q 65 1026 0 960 q 223 1091 131 1091 l 967 1091 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 711 489 q 706 539 711 509 l 426 539 l 426 436 l 594 436 q 581 398 591 418 q 552 357 570 377 q 500 322 533 336 q 426 308 467 308 q 295 363 349 308 q 240 496 240 419 q 295 629 240 574 q 426 684 349 684 q 544 638 497 684 l 625 716 q 426 794 541 794 q 215 706 301 794 q 128 496 128 619 q 215 286 128 373 q 426 198 301 198 q 632 280 553 198 q 711 489 711 361 m 978 453 l 1063 453 l 1063 539 l 978 539 l 978 624 l 893 624 l 893 539 l 808 539 l 808 453 l 893 453 l 893 368 l 978 368 l 978 453 m 1190 868 l 1190 124 q 1125 -34 1190 32 q 967 -99 1059 -99 l 223 -99 q 65 -34 131 -99 q 0 124 0 32 l 0 868 q 65 1026 0 960 q 223 1091 131 1091 l 967 1091 q 1125 1026 1059 1091 q 1190 868 1190 960 z "},"":{"ha":1786,"x_min":0,"x_max":1786,"o":"m 1114 483 q 1046 196 1114 322 q 854 -1 979 70 q 568 -72 729 -72 q 347 -27 453 -72 q 166 94 242 18 q 45 275 90 170 q 0 496 0 381 q 45 717 0 612 q 166 898 90 822 q 347 1019 242 974 q 568 1064 453 1064 q 949 915 790 1064 l 794 767 q 568 855 704 855 q 392 807 473 855 q 264 676 311 759 q 216 496 216 594 q 264 316 216 398 q 392 185 311 233 q 568 137 473 137 q 686 155 632 137 q 775 200 740 173 q 836 260 810 226 q 874 325 862 295 q 891 382 886 355 l 568 382 l 568 577 l 1104 577 q 1114 483 1114 529 m 1786 577 l 1786 415 l 1624 415 l 1624 253 l 1461 253 l 1461 415 l 1299 415 l 1299 577 l 1461 577 l 1461 739 l 1624 739 l 1624 577 l 1786 577 z "},"":{"ha":1488,"x_min":0,"x_max":1488,"o":"m 595 298 l 893 298 l 893 372 l 794 372 l 794 719 l 705 719 l 591 613 l 650 551 q 693 595 683 580 l 694 595 l 694 372 l 595 372 l 595 298 m 976 606 q 984 578 976 606 q 992 496 992 550 q 976 386 992 442 q 930 282 960 330 q 851 204 900 234 q 744 174 802 174 q 637 204 686 174 q 558 282 588 234 q 512 386 529 330 q 496 496 496 442 q 512 606 496 550 q 558 710 529 662 q 637 788 588 758 q 744 818 686 818 q 851 788 802 818 q 930 710 900 758 q 976 606 960 662 m 1389 298 l 1389 694 q 1249 753 1307 694 q 1190 893 1190 811 l 298 893 q 239 753 298 811 q 99 694 181 694 l 99 298 q 239 239 181 298 q 298 99 298 181 l 1190 99 q 1249 239 1190 181 q 1389 298 1307 298 m 1488 942 l 1488 50 q 1473 15 1488 29 q 1438 0 1459 0 l 50 0 q 15 15 29 0 q 0 50 0 29 l 0 942 q 15 977 0 963 q 50 992 29 992 l 1438 992 q 1473 977 1459 992 q 1488 942 1488 963 z "},"":{"ha":794,"x_min":0,"x_max":794,"o":"m 779 680 q 786 672 779 680 q 794 645 794 665 q 779 610 794 625 l 432 263 q 397 248 417 248 q 362 263 377 248 l 15 610 q 0 645 0 625 q 15 680 0 665 q 50 694 29 694 l 744 694 q 779 680 764 694 z "},"":{"ha":794,"x_min":0,"x_max":794,"o":"m 779 283 q 794 248 794 268 q 779 213 794 228 q 744 198 764 198 l 50 198 q 15 213 29 198 q 0 248 0 228 q 15 283 0 268 l 362 630 q 397 645 377 645 q 432 630 417 645 l 779 283 z "},"":{"ha":496,"x_min":50,"x_max":496,"o":"m 496 843 l 496 149 q 481 114 496 129 q 446 99 467 99 q 412 114 426 99 l 64 461 q 50 496 50 476 q 64 531 50 516 l 412 878 q 446 893 426 893 q 481 878 467 893 q 496 843 496 863 z "},"":{"ha":496,"x_min":0,"x_max":446,"o":"m 432 531 q 446 496 446 516 q 432 461 446 476 l 84 114 q 50 99 70 99 q 15 114 29 99 q 0 149 0 129 l 0 843 q 15 878 0 863 q 50 893 29 893 q 84 878 70 893 l 432 531 z "},"":{"ha":1290,"x_min":0,"x_max":1290,"o":"m 124 0 l 595 0 l 595 893 l 99 893 l 99 25 q 107 7 99 15 q 124 0 114 0 m 1190 25 l 1190 893 l 694 893 l 694 0 l 1166 0 q 1183 7 1176 0 q 1190 25 1190 15 m 1290 967 l 1290 25 q 1253 -63 1290 -26 q 1166 -99 1217 -99 l 124 -99 q 36 -63 73 -99 q 0 25 0 -26 l 0 967 q 36 1055 0 1018 q 124 1091 73 1091 l 1166 1091 q 1253 1055 1217 1091 q 1290 967 1290 1018 z "},"":{"ha":794,"x_min":0,"x_max":794,"o":"m 779 382 q 786 375 779 382 q 794 347 794 367 q 779 312 794 327 l 432 -35 q 397 -50 417 -50 q 362 -35 377 -50 l 15 312 q 0 347 0 327 q 15 382 0 367 q 50 397 29 397 l 744 397 q 779 382 764 397 m 779 680 q 794 645 794 665 q 779 610 794 625 q 744 595 764 595 l 50 595 q 15 610 29 595 q 0 645 0 625 q 15 680 0 665 l 362 1027 q 397 1042 377 1042 q 432 1027 417 1042 l 779 680 z "},"":{"ha":794,"x_min":0,"x_max":794,"o":"m 779 382 q 786 375 779 382 q 794 347 794 367 q 779 312 794 327 l 432 -35 q 397 -50 417 -50 q 362 -35 377 -50 l 15 312 q 0 347 0 327 q 15 382 0 367 q 50 397 29 397 l 744 397 q 779 382 764 397 z "},"":{"ha":794,"x_min":0,"x_max":794,"o":"m 779 680 q 794 645 794 665 q 779 610 794 625 q 744 595 764 595 l 50 595 q 15 610 29 595 q 0 645 0 625 q 15 680 0 665 l 362 1027 q 397 1042 377 1042 q 432 1027 417 1042 l 779 680 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 1389 640 l 1389 25 q 1352 -63 1389 -26 q 1265 -99 1316 -99 l 124 -99 q 36 -63 73 -99 q 0 25 0 -26 l 0 640 q 78 573 34 602 q 463 305 359 382 q 535 255 508 273 q 608 217 563 236 q 694 198 654 198 l 694 198 l 695 198 q 780 217 735 198 q 854 255 826 236 q 925 305 881 273 q 1311 573 1057 401 q 1389 640 1356 603 m 1389 868 q 1351 751 1389 807 q 1256 656 1313 695 q 894 404 965 453 q 861 380 886 398 q 819 351 836 362 q 779 326 802 339 q 734 305 755 312 q 695 298 713 298 l 694 298 l 694 298 q 655 305 676 298 q 610 326 634 312 q 570 351 587 339 q 528 380 553 362 q 495 404 503 398 q 292 545 425 453 q 133 656 160 637 q 43 745 85 688 q 0 851 0 802 q 32 952 0 911 q 124 992 64 992 l 1265 992 q 1352 956 1315 992 q 1389 868 1389 919 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 270 706 l 270 -62 l 15 -62 l 15 706 l 270 706 m 287 943 q 248 849 288 887 q 143 811 208 811 l 141 811 q 39 849 78 811 q 0 943 0 887 q 40 1038 0 1001 q 144 1076 80 1076 q 247 1038 208 1076 q 287 943 286 1001 m 1190 378 l 1190 -62 l 935 -62 l 935 349 q 904 476 935 430 q 806 522 873 522 q 724 496 757 522 q 675 429 691 469 q 667 367 667 406 l 667 -62 l 412 -62 q 413 439 413 247 q 412 669 413 632 l 412 706 l 667 706 l 667 594 l 665 594 q 697 638 680 619 q 741 678 713 656 q 808 712 768 700 q 897 724 848 724 q 1110 636 1029 724 q 1190 378 1190 548 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 1143 727 q 1167 672 1143 727 q 1190 496 1190 617 q 1143 265 1190 375 q 1016 75 1096 155 q 826 -52 936 -5 q 595 -99 716 -99 q 342 -43 462 -99 q 137 115 222 13 q 132 133 132 123 q 139 149 133 143 l 245 256 q 264 263 253 263 q 282 253 277 261 q 421 140 339 180 q 595 99 503 99 q 749 131 676 99 q 876 215 822 162 q 961 342 929 269 q 992 496 992 415 q 961 650 992 577 q 876 777 929 723 q 749 861 822 830 q 595 893 676 893 q 450 865 519 893 q 326 787 380 838 l 432 680 q 443 626 456 656 q 397 595 429 595 l 50 595 q 15 610 29 595 q 0 645 0 625 l 0 992 q 31 1038 0 1025 q 84 1027 61 1051 l 185 927 q 375 1048 268 1005 q 595 1091 481 1091 q 826 1044 716 1091 q 1016 917 936 997 q 1143 727 1096 837 z "},"":{"ha":1389,"x_min":31,"x_max":1373,"o":"m 1373 0 q 1344 -70 1373 -41 l 1261 -153 q 1190 -182 1231 -182 q 1121 -153 1149 -182 l 839 129 q 810 198 810 157 q 843 273 810 239 l 645 471 l 547 374 q 521 363 536 363 q 494 374 505 363 q 504 364 496 372 q 514 354 512 357 q 522 345 515 352 q 529 335 528 339 q 534 324 531 331 q 538 312 537 318 q 539 298 539 305 q 518 245 539 268 q 505 231 515 243 q 490 215 494 219 q 476 202 486 211 q 459 190 466 194 q 442 183 452 187 q 422 180 432 180 q 369 202 391 180 l 53 518 q 31 570 31 539 q 34 591 31 581 q 41 608 38 601 q 53 625 45 615 q 66 639 62 635 q 82 654 71 643 q 96 667 94 664 q 149 688 119 688 q 163 687 157 688 q 176 683 169 686 q 186 678 182 680 q 196 670 190 677 q 205 663 203 664 q 215 653 208 661 q 225 643 223 645 q 214 670 214 654 q 225 696 214 685 l 494 966 q 521 977 505 977 q 547 966 536 977 q 537 975 546 967 q 528 985 529 983 q 520 994 526 987 q 512 1004 514 1001 q 508 1015 511 1008 q 503 1028 505 1022 q 502 1042 502 1034 q 524 1094 502 1071 q 537 1108 526 1097 q 551 1124 547 1120 q 566 1137 556 1128 q 583 1149 576 1146 q 600 1156 590 1152 q 620 1159 610 1159 q 673 1138 651 1159 l 989 822 q 1011 769 1011 800 q 1007 749 1011 759 q 1000 732 1004 739 q 988 715 997 725 q 975 700 980 705 q 960 686 971 696 q 946 673 948 675 q 893 651 922 651 q 879 652 885 651 q 866 656 873 653 q 856 661 860 660 q 845 669 852 663 q 836 677 839 675 q 826 686 834 678 q 817 696 818 694 q 828 670 828 685 q 817 643 828 654 l 719 546 l 918 347 q 992 381 951 381 q 1063 352 1032 381 l 1344 71 q 1373 0 1373 40 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 269 227 q 283 242 269 227 q 298 298 298 257 q 269 368 298 339 q 198 397 239 397 q 128 368 157 397 q 99 298 99 339 q 128 227 99 257 q 198 198 157 198 q 269 227 239 198 m 417 575 q 432 589 417 575 q 446 645 446 604 q 417 715 446 686 q 347 744 388 744 q 277 715 306 744 q 248 645 248 686 q 277 575 248 604 q 347 546 306 546 q 417 575 388 546 m 778 272 l 856 568 q 851 606 861 588 q 821 629 840 623 q 784 624 801 634 q 760 593 766 613 l 682 297 q 599 263 636 293 q 550 187 563 233 q 566 74 535 127 q 656 5 597 20 q 770 20 716 -11 q 839 111 823 51 q 834 202 851 157 q 778 272 817 246 m 1261 227 q 1275 242 1261 227 q 1290 298 1290 257 q 1261 368 1290 339 q 1190 397 1232 397 q 1120 368 1149 397 q 1091 298 1091 339 q 1120 227 1091 257 q 1190 198 1149 198 q 1261 227 1232 198 m 765 724 q 779 738 765 724 q 794 794 794 753 q 765 864 794 835 q 694 893 736 893 q 624 864 653 893 q 595 794 595 835 q 624 724 595 753 q 694 694 653 694 q 765 724 736 694 m 1112 575 q 1126 589 1112 575 q 1141 645 1141 604 q 1112 715 1141 686 q 1042 744 1083 744 q 972 715 1001 744 q 942 645 942 686 q 972 575 942 604 q 1042 546 1001 546 q 1112 575 1083 546 m 1389 298 q 1280 -77 1389 95 q 1238 -99 1265 -99 l 151 -99 q 109 -77 124 -99 q 0 298 0 95 q 55 567 0 439 q 203 789 110 696 q 425 937 296 882 q 694 992 553 992 q 964 937 836 992 q 1186 789 1093 882 q 1334 567 1279 696 q 1389 298 1389 439 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 990 839 q 921 866 990 839 q 694 893 853 893 q 399 839 536 893 q 180 694 261 785 q 99 496 99 602 q 155 331 99 409 q 311 195 210 252 l 378 156 l 357 81 q 303 -52 339 11 q 516 81 421 -3 l 550 110 l 594 105 q 694 99 647 99 q 990 153 853 99 q 1209 298 1128 207 q 1290 496 1290 390 q 1209 694 1290 602 q 990 839 1128 785 m 1296 745 q 1342 688 1296 745 q 1389 496 1389 631 q 1296 247 1389 361 q 1043 66 1203 133 q 694 0 884 0 q 582 6 640 0 q 226 -181 429 -129 q 137 -198 188 -192 l 133 -198 q 112 -190 122 -198 q 100 -169 103 -182 l 100 -168 q 100 -159 98 -165 q 101 -151 102 -153 q 105 -144 101 -150 q 109 -137 109 -138 q 115 -130 110 -136 q 121 -123 119 -125 q 145 -96 126 -117 q 172 -67 164 -76 q 196 -36 180 -58 q 221 3 212 -15 q 242 49 230 21 q 262 108 253 77 q 70 278 140 177 q 0 496 0 380 q 93 745 0 631 q 346 926 186 860 q 694 992 505 992 q 1043 926 884 992 q 1296 745 1203 860 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 767 853 q 716 873 767 853 q 546 893 664 893 q 324 853 427 893 q 160 743 221 812 q 99 595 99 674 q 140 473 99 532 q 256 370 181 414 l 331 327 l 304 262 q 352 292 330 277 l 386 316 l 427 308 q 546 298 488 298 q 767 338 664 298 q 931 447 870 378 q 992 595 992 516 q 931 743 992 674 q 767 853 870 812 m 272 939 q 335 966 272 939 q 546 992 398 992 q 820 939 694 992 q 1018 794 946 886 q 1091 595 1091 703 q 1018 396 1091 488 q 820 252 946 305 q 546 198 694 198 q 409 211 479 198 q 194 112 313 143 q 127 99 166 105 l 125 99 q 109 105 116 99 q 100 122 102 112 q 99 127 99 124 q 100 132 99 129 q 101 136 100 134 q 103 140 102 139 q 106 145 104 142 q 109 148 108 147 q 112 152 110 150 q 115 156 115 155 q 133 175 119 160 q 153 198 147 190 q 171 221 160 206 q 190 250 182 235 q 206 284 198 266 q 55 422 110 340 q 0 595 0 503 q 73 794 0 703 q 272 939 146 886 m 1183 86 q 1199 52 1190 67 q 1218 22 1207 36 q 1235 0 1229 8 q 1256 -23 1242 -9 q 1273 -43 1270 -38 q 1277 -46 1274 -43 q 1280 -50 1279 -49 q 1283 -54 1281 -51 q 1286 -58 1285 -57 q 1288 -62 1287 -60 q 1289 -67 1289 -64 q 1290 -72 1290 -69 q 1289 -77 1290 -74 q 1279 -94 1287 -88 q 1262 -99 1271 -100 q 1195 -87 1223 -94 q 980 12 1076 -56 q 843 0 910 0 q 477 102 633 0 q 546 99 522 99 q 785 134 670 99 q 990 234 900 169 q 1139 398 1087 305 q 1190 595 1190 491 q 1173 713 1190 655 q 1331 575 1273 658 q 1389 397 1389 492 q 1334 223 1389 304 q 1183 86 1279 142 z "},"":{"ha":694,"x_min":1,"x_max":691,"o":"m 686 752 q 691 718 700 736 l 273 -179 q 240 -198 263 -198 q 229 -197 237 -198 q 210 -182 216 -193 q 206 -159 203 -171 l 359 467 l 44 389 q 35 388 41 388 q 11 397 21 388 q 1 427 -3 408 l 157 1066 q 169 1084 160 1077 q 191 1091 178 1091 l 445 1091 q 470 1082 460 1091 q 480 1059 480 1072 q 476 1045 480 1053 l 343 686 l 650 762 q 660 763 656 763 q 686 752 674 763 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 1389 223 l 1389 -25 q 1367 -78 1389 -56 q 1314 -99 1345 -99 l 1066 -99 q 1014 -78 1035 -99 q 992 -25 992 -56 l 992 223 q 1014 276 992 254 q 1066 298 1035 298 l 1141 298 l 1141 446 l 744 446 l 744 298 l 818 298 q 871 276 849 298 q 893 223 893 254 l 893 -25 q 871 -78 893 -56 q 818 -99 849 -99 l 570 -99 q 518 -78 539 -99 q 496 -25 496 -56 l 496 223 q 518 276 496 254 q 570 298 539 298 l 645 298 l 645 446 l 248 446 l 248 298 l 322 298 q 375 276 353 298 q 397 223 397 254 l 397 -25 q 375 -78 397 -56 q 322 -99 353 -99 l 74 -99 q 22 -78 43 -99 q 0 -25 0 -56 l 0 223 q 22 276 0 254 q 74 298 43 298 l 149 298 l 149 446 q 178 516 149 487 q 248 546 208 546 l 645 546 l 645 694 l 570 694 q 518 716 539 694 q 496 769 496 738 l 496 1017 q 518 1070 496 1048 q 570 1091 539 1091 l 818 1091 q 871 1070 849 1091 q 893 1017 893 1048 l 893 769 q 871 716 893 738 q 818 694 849 694 l 744 694 l 744 546 l 1141 546 q 1211 516 1181 546 q 1240 446 1240 487 l 1240 298 l 1314 298 q 1367 276 1345 298 q 1389 223 1389 254 z "},"":{"ha":1290,"x_min":0,"x_max":1290,"o":"m 694 549 l 694 99 q 636 -40 694 19 q 496 -99 577 -99 q 357 -40 415 -99 q 298 99 298 19 q 312 134 298 119 q 347 149 327 149 q 382 134 367 149 q 397 99 397 119 q 427 30 397 60 q 496 0 457 0 q 565 30 535 0 q 595 99 595 60 l 595 549 q 645 557 621 557 q 694 549 669 557 m 1290 528 q 1282 510 1290 518 q 1265 503 1275 503 q 1247 511 1256 503 q 1175 564 1209 546 q 1096 582 1141 582 q 997 553 1043 582 q 917 478 950 525 q 903 457 911 470 q 892 438 895 443 q 870 425 884 425 q 848 438 856 425 q 837 457 845 443 q 823 478 829 470 q 744 553 790 525 q 645 582 698 582 q 546 553 592 582 q 467 478 500 525 q 453 457 461 470 q 442 438 445 443 q 419 425 433 425 q 398 438 406 425 q 386 457 395 443 q 373 478 378 470 q 293 553 339 525 q 194 582 246 582 q 115 564 149 582 q 43 511 81 546 q 25 503 33 503 q 7 510 15 503 q 0 528 0 518 q 1 533 0 532 q 134 781 36 675 q 365 939 233 887 q 645 992 498 992 q 858 961 753 992 q 1049 873 962 930 q 1199 728 1135 816 q 1289 533 1263 640 q 1290 528 1290 532 m 694 1091 l 694 1015 q 645 1017 662 1017 q 595 1015 628 1017 l 595 1091 q 610 1126 595 1111 q 645 1141 625 1141 q 680 1126 665 1141 q 694 1091 694 1111 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 595 -99 l 1290 -99 l 1290 397 l 967 397 q 915 419 936 397 q 893 471 893 440 l 893 794 l 595 794 l 595 -99 m 794 1017 l 794 1066 q 786 1084 794 1077 q 769 1091 779 1091 l 223 1091 q 206 1084 213 1091 q 198 1066 198 1077 l 198 1017 q 206 999 198 1007 q 223 992 213 992 l 769 992 q 786 999 779 992 q 794 1017 794 1007 m 992 496 l 1224 496 l 992 728 l 992 496 m 1389 397 l 1389 -124 q 1367 -177 1389 -155 q 1314 -198 1345 -198 l 570 -198 q 518 -177 539 -198 q 496 -124 496 -155 l 496 0 l 74 0 q 22 22 43 0 q 0 74 0 43 l 0 1116 q 22 1169 0 1147 q 74 1190 43 1190 l 918 1190 q 970 1169 949 1190 q 992 1116 992 1147 l 992 862 q 1020 840 1008 852 l 1336 524 q 1373 465 1358 502 q 1389 397 1389 428 z "},"":{"ha":794,"x_min":0,"x_max":794,"o":"m 570 744 q 563 727 570 734 q 546 719 556 719 q 528 727 536 719 q 521 744 521 734 q 479 799 521 780 q 397 818 437 818 q 379 826 387 818 q 372 843 372 833 q 379 861 372 853 q 397 868 387 868 q 474 856 436 868 q 541 814 512 843 q 570 744 570 784 m 694 744 q 668 848 694 800 q 598 927 641 896 q 503 975 555 957 q 397 992 450 992 q 291 975 343 992 q 196 927 239 957 q 126 848 153 896 q 99 744 99 800 q 152 605 99 666 q 176 579 160 596 q 199 553 191 562 q 308 322 298 435 l 485 322 q 594 553 495 435 q 618 579 602 562 q 642 605 634 596 q 694 744 694 666 m 794 744 q 714 536 794 624 q 656 469 679 498 q 610 395 633 439 q 584 312 587 350 q 620 248 620 290 q 601 198 620 219 q 620 149 620 177 q 585 86 620 109 q 595 50 595 68 q 571 -5 595 14 q 511 -25 546 -25 q 464 -79 495 -59 q 397 -99 433 -99 q 329 -79 360 -99 q 283 -25 298 -59 q 223 -5 247 -25 q 198 50 198 14 q 208 86 198 68 q 174 149 174 109 q 193 198 174 177 q 174 248 174 219 q 210 312 174 290 q 184 395 207 350 q 138 469 160 439 q 80 536 115 498 q 0 744 0 624 q 34 887 0 821 q 125 997 69 953 q 252 1066 181 1041 q 397 1091 323 1091 q 541 1066 470 1091 q 668 997 612 1041 q 759 887 725 953 q 794 744 794 821 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 1389 273 l 1389 124 q 1382 107 1389 114 q 1364 99 1374 99 l 298 99 l 298 -50 q 290 -67 298 -60 q 273 -74 283 -74 q 254 -67 264 -74 l 7 181 q 0 198 0 188 q 7 216 0 209 l 255 464 q 273 471 262 471 q 290 464 283 471 q 298 446 298 457 l 298 298 l 1364 298 q 1382 290 1374 298 q 1389 273 1389 283 m 1382 712 q 1389 694 1389 705 q 1382 677 1389 684 l 1134 429 q 1116 422 1127 422 q 1099 429 1106 422 q 1091 446 1091 436 l 1091 595 l 25 595 q 7 603 15 595 q 0 620 0 610 l 0 769 q 7 786 0 779 q 25 794 15 794 l 1091 794 l 1091 942 q 1098 960 1091 953 q 1116 967 1105 967 q 1135 960 1125 967 l 1382 712 z "},"":{"ha":1488,"x_min":0,"x_max":1488,"o":"m 992 471 q 985 489 992 482 q 967 496 978 496 l 794 496 l 794 769 q 786 786 794 779 q 769 794 779 794 l 620 794 q 603 786 610 794 q 595 769 595 779 l 595 496 l 422 496 q 404 489 412 496 q 397 471 397 481 q 404 453 397 460 l 677 181 q 694 174 684 174 q 712 181 705 174 l 984 453 q 992 471 992 462 m 1488 298 q 1401 87 1488 174 q 1190 0 1314 0 l 347 0 q 102 102 204 0 q 0 347 0 204 q 54 533 0 448 q 200 661 109 618 q 198 694 198 684 q 315 975 198 859 q 595 1091 431 1091 q 817 1024 716 1091 q 963 845 917 956 q 1091 893 1018 893 q 1232 835 1173 893 q 1290 694 1290 777 q 1258 587 1290 636 q 1423 482 1359 563 q 1488 298 1488 401 z "},"":{"ha":1488,"x_min":0,"x_max":1488,"o":"m 992 521 q 985 539 992 532 l 712 811 q 694 818 705 818 q 677 811 684 818 l 405 539 q 397 521 397 530 q 404 503 397 510 q 422 496 411 496 l 595 496 l 595 223 q 603 206 595 213 q 620 198 610 198 l 769 198 q 786 206 779 198 q 794 223 794 213 l 794 496 l 967 496 q 985 503 977 496 q 992 521 992 511 m 1488 298 q 1401 87 1488 174 q 1190 0 1314 0 l 347 0 q 102 102 204 0 q 0 347 0 204 q 54 533 0 448 q 200 661 109 618 q 198 694 198 684 q 315 975 198 859 q 595 1091 431 1091 q 817 1024 716 1091 q 963 845 917 956 q 1091 893 1018 893 q 1232 835 1173 893 q 1290 694 1290 777 q 1258 587 1290 636 q 1423 482 1359 563 q 1488 298 1488 401 z "},"":{"ha":1091,"x_min":0,"x_max":1091,"o":"m 283 184 q 290 176 283 184 q 298 149 298 169 q 283 114 298 129 q 248 99 268 99 q 213 114 228 99 q 198 149 198 129 q 213 184 198 169 q 248 198 228 198 q 283 184 268 198 m 1091 102 q 1035 -46 1091 8 q 884 -99 978 -99 l 207 -99 q 57 -46 113 -99 q 0 102 0 8 q 4 203 0 154 q 23 310 9 252 q 60 413 37 368 q 122 493 82 457 q 215 539 163 528 q 198 446 198 499 l 198 289 q 126 235 153 274 q 99 149 99 196 q 143 43 99 87 q 248 0 186 0 q 353 43 310 0 q 397 149 397 87 q 369 235 397 196 q 298 289 342 274 l 298 446 q 317 519 298 494 q 546 438 419 438 q 774 519 672 438 q 794 446 794 494 l 794 397 q 653 339 711 397 q 595 198 595 281 l 595 129 q 570 74 570 107 q 592 22 570 43 q 645 0 614 0 q 698 22 676 0 q 719 74 719 43 q 694 129 719 107 l 694 198 q 724 268 694 239 q 794 298 753 298 q 863 268 834 298 q 893 198 893 239 l 893 129 q 868 74 868 107 q 890 22 868 43 q 942 0 911 0 q 995 22 973 0 q 1017 74 1017 43 q 992 129 1017 107 l 992 198 q 965 297 992 251 q 893 370 939 343 q 893 403 893 377 q 893 440 894 428 q 891 472 893 452 q 886 508 890 492 q 876 539 882 525 q 969 493 929 528 q 1032 413 1009 457 q 1068 310 1054 368 q 1087 203 1083 252 q 1091 102 1091 154 m 756 1004 q 800 960 756 1004 q 843 794 843 917 q 756 583 843 670 q 546 496 669 496 q 335 583 422 496 q 248 794 248 670 q 335 1004 248 917 q 546 1091 422 1091 q 756 1004 669 1091 z "},"":{"ha":1091,"x_min":0,"x_max":1091,"o":"m 977 610 q 985 617 977 610 q 992 645 992 625 q 977 680 992 665 q 942 694 963 694 q 908 680 922 694 q 893 645 893 665 q 908 610 893 625 q 942 595 922 595 q 977 610 963 595 m 1091 645 q 1064 559 1091 597 q 992 505 1036 521 l 992 198 q 890 -12 992 75 q 645 -99 788 -99 q 400 -12 501 -99 q 298 198 298 75 l 298 301 q 85 400 171 316 q 0 595 0 484 l 0 992 q 15 1027 0 1012 q 50 1042 29 1042 q 62 1040 54 1042 q 98 1077 75 1063 q 149 1091 122 1091 q 219 1062 190 1091 q 248 992 248 1033 q 219 922 248 951 q 149 893 190 893 q 99 907 123 893 l 99 595 q 172 455 99 513 q 347 397 245 397 q 522 455 450 397 q 595 595 595 513 l 595 907 q 546 893 571 893 q 475 922 505 893 q 446 992 446 951 q 475 1062 446 1033 q 546 1091 505 1091 q 596 1077 573 1091 q 632 1040 619 1063 q 645 1042 640 1042 q 680 1027 665 1042 q 694 992 694 1012 l 694 595 q 609 400 694 484 q 397 301 524 316 l 397 198 q 470 58 397 116 q 645 0 543 0 q 820 58 747 0 q 893 198 893 116 l 893 505 q 821 559 849 521 q 794 645 794 597 q 837 750 794 707 q 942 794 880 794 q 1048 750 1004 794 q 1091 645 1091 707 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 496 893 l 893 893 l 893 992 l 496 992 l 496 893 m 223 893 l 223 -99 l 174 -99 q 51 -48 102 -99 q 0 74 0 3 l 0 719 q 51 842 0 791 q 174 893 102 893 l 223 893 m 1091 893 l 1091 -99 l 298 -99 l 298 893 l 397 893 l 397 1017 q 419 1070 397 1048 q 471 1091 440 1091 l 918 1091 q 970 1070 949 1091 q 992 1017 992 1048 l 992 893 l 1091 893 m 1389 719 l 1389 74 q 1338 -48 1389 3 q 1215 -99 1287 -99 l 1166 -99 l 1166 893 l 1215 893 q 1338 842 1287 893 q 1389 719 1389 791 z "},"":{"ha":1389,"x_min":50,"x_max":1339,"o":"m 694 -136 q 707 -124 707 -136 q 694 -112 707 -112 q 616 -79 649 -112 q 583 0 583 -46 q 570 12 583 12 q 558 0 558 12 q 598 -96 558 -57 q 694 -136 638 -136 m 1339 99 q 1310 29 1339 59 q 1240 0 1280 0 l 893 0 q 835 -140 893 -82 q 694 -198 777 -198 q 554 -140 612 -198 q 496 0 496 -82 l 149 0 q 79 29 109 0 q 50 99 50 59 q 120 167 88 132 q 186 260 152 203 q 244 383 220 317 q 283 543 267 449 q 298 744 298 636 q 388 963 298 862 q 626 1086 479 1064 q 620 1116 620 1101 q 642 1169 620 1147 q 694 1190 663 1190 q 747 1169 725 1190 q 769 1116 769 1147 q 763 1086 769 1101 q 1001 963 910 1064 q 1091 744 1091 862 q 1106 543 1091 636 q 1145 383 1121 449 q 1203 260 1169 317 q 1269 167 1237 203 q 1339 99 1301 132 z "},"":{"ha":1488,"x_min":0,"x_max":1438,"o":"m 1246 589 q 1268 611 1246 589 q 1290 694 1290 632 q 1246 800 1290 756 q 1141 843 1203 843 l 1091 843 l 1091 546 l 1141 546 q 1246 589 1203 546 m 0 99 l 1389 99 q 1331 -41 1389 17 q 1190 -99 1273 -99 l 198 -99 q 58 -41 116 -99 q 0 99 0 17 m 1351 905 q 1395 861 1351 905 q 1438 694 1438 818 q 1351 484 1438 571 q 1141 397 1264 397 l 1091 397 l 1091 372 q 1040 250 1091 301 q 918 198 989 198 l 372 198 q 250 250 301 198 q 198 372 198 301 l 198 942 q 213 977 198 963 q 248 992 228 992 l 1141 992 q 1351 905 1264 992 z "},"":{"ha":1091,"x_min":0,"x_max":1091,"o":"m 496 1141 l 496 645 q 469 559 496 598 q 397 505 441 520 l 397 -99 q 367 -169 397 -140 q 298 -198 338 -198 l 198 -198 q 129 -169 158 -198 q 99 -99 99 -140 l 99 505 q 28 559 55 520 q 0 645 0 598 l 0 1141 q 15 1176 0 1161 q 50 1190 29 1190 q 84 1176 70 1190 q 99 1141 99 1161 l 99 818 q 114 784 99 798 q 149 769 129 769 q 184 784 169 769 q 198 818 198 798 l 198 1141 q 213 1176 198 1161 q 248 1190 228 1190 q 283 1176 268 1190 q 298 1141 298 1161 l 298 818 q 312 784 298 798 q 347 769 327 769 q 382 784 367 769 q 397 818 397 798 l 397 1141 q 412 1176 397 1161 q 446 1190 426 1190 q 481 1176 467 1190 q 496 1141 496 1161 m 1091 1141 l 1091 -99 q 1062 -169 1091 -140 q 992 -198 1032 -198 l 893 -198 q 823 -169 853 -198 q 794 -99 794 -140 l 794 298 l 620 298 q 603 305 610 298 q 595 322 595 312 l 595 942 q 668 1118 595 1045 q 843 1190 741 1190 l 1042 1190 q 1077 1176 1062 1190 q 1091 1141 1091 1161 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 1138 896 q 1175 837 1159 874 q 1190 769 1190 800 l 1190 -124 q 1169 -177 1190 -155 q 1116 -198 1147 -198 l 74 -198 q 22 -177 43 -198 q 0 -124 0 -155 l 0 1116 q 22 1169 0 1147 q 74 1190 43 1190 l 769 1190 q 837 1175 800 1190 q 896 1138 874 1159 l 1138 896 m 794 1085 l 794 794 l 1085 794 q 1068 825 1077 816 l 825 1068 q 794 1085 816 1077 m 1091 -99 l 1091 694 l 769 694 q 716 716 738 694 q 694 769 694 738 l 694 1091 l 99 1091 l 99 -99 l 1091 -99 m 298 570 q 305 588 298 581 q 322 595 312 595 l 868 595 q 886 588 879 595 q 893 570 893 581 l 893 521 q 886 503 893 510 q 868 496 879 496 l 322 496 q 305 503 312 496 q 298 521 298 510 l 298 570 m 868 397 q 886 390 879 397 q 893 372 893 383 l 893 322 q 886 305 893 312 q 868 298 879 298 l 322 298 q 305 305 312 298 q 298 322 298 312 l 298 372 q 305 390 298 383 q 322 397 312 397 l 868 397 m 868 198 q 886 191 879 198 q 893 174 893 184 l 893 124 q 886 106 893 113 q 868 99 879 99 l 322 99 q 305 106 312 99 q 298 124 298 113 l 298 174 q 305 191 298 184 q 322 198 312 198 l 868 198 z "},"":{"ha":1091,"x_min":0,"x_max":1091,"o":"m 298 174 l 298 124 q 290 107 298 114 q 273 99 283 99 l 223 99 q 206 107 213 99 q 198 124 198 114 l 198 174 q 206 191 198 184 q 223 198 213 198 l 273 198 q 290 191 283 198 q 298 174 298 184 m 298 372 l 298 322 q 290 305 298 312 q 273 298 283 298 l 223 298 q 206 305 213 298 q 198 322 198 312 l 198 372 q 206 389 198 382 q 223 397 213 397 l 273 397 q 290 389 283 397 q 298 372 298 382 m 496 372 l 496 322 q 489 305 496 312 q 471 298 481 298 l 422 298 q 404 305 412 298 q 397 322 397 312 l 397 372 q 404 389 397 382 q 422 397 412 397 l 471 397 q 489 389 481 397 q 496 372 496 382 m 298 570 l 298 521 q 290 503 298 511 q 273 496 283 496 l 223 496 q 206 503 213 496 q 198 521 198 511 l 198 570 q 206 588 198 581 q 223 595 213 595 l 273 595 q 290 588 283 595 q 298 570 298 581 m 893 174 l 893 124 q 885 107 893 114 q 868 99 878 99 l 818 99 q 801 107 808 99 q 794 124 794 114 l 794 174 q 801 191 794 184 q 818 198 808 198 l 868 198 q 885 191 878 198 q 893 174 893 184 m 694 372 l 694 322 q 687 305 694 312 q 670 298 680 298 l 620 298 q 603 305 610 298 q 595 322 595 312 l 595 372 q 603 389 595 382 q 620 397 610 397 l 670 397 q 687 389 680 397 q 694 372 694 382 m 496 570 l 496 521 q 489 503 496 511 q 471 496 481 496 l 422 496 q 404 503 412 496 q 397 521 397 511 l 397 570 q 404 588 397 581 q 422 595 412 595 l 471 595 q 489 588 481 595 q 496 570 496 581 m 298 769 l 298 719 q 290 702 298 709 q 273 694 283 694 l 223 694 q 206 702 213 694 q 198 719 198 709 l 198 769 q 206 786 198 779 q 223 794 213 794 l 273 794 q 290 786 283 794 q 298 769 298 779 m 893 372 l 893 322 q 885 305 893 312 q 868 298 878 298 l 818 298 q 801 305 808 298 q 794 322 794 312 l 794 372 q 801 389 794 382 q 818 397 808 397 l 868 397 q 885 389 878 397 q 893 372 893 382 m 694 570 l 694 521 q 687 503 694 511 q 670 496 680 496 l 620 496 q 603 503 610 496 q 595 521 595 511 l 595 570 q 603 588 595 581 q 620 595 610 595 l 670 595 q 687 588 680 595 q 694 570 694 581 m 496 769 l 496 719 q 489 702 496 709 q 471 694 481 694 l 422 694 q 404 702 412 694 q 397 719 397 709 l 397 769 q 404 786 397 779 q 422 794 412 794 l 471 794 q 489 786 481 794 q 496 769 496 779 m 298 967 l 298 918 q 290 900 298 908 q 273 893 283 893 l 223 893 q 206 900 213 893 q 198 918 198 908 l 198 967 q 206 985 198 977 q 223 992 213 992 l 273 992 q 290 985 283 992 q 298 967 298 977 m 893 570 l 893 521 q 885 503 893 511 q 868 496 878 496 l 818 496 q 801 503 808 496 q 794 521 794 511 l 794 570 q 801 588 794 581 q 818 595 808 595 l 868 595 q 885 588 878 595 q 893 570 893 581 m 694 769 l 694 719 q 687 702 694 709 q 670 694 680 694 l 620 694 q 603 702 610 694 q 595 719 595 709 l 595 769 q 603 786 595 779 q 620 794 610 794 l 670 794 q 687 786 680 794 q 694 769 694 779 m 496 967 l 496 918 q 489 900 496 908 q 471 893 481 893 l 422 893 q 404 900 412 893 q 397 918 397 908 l 397 967 q 404 985 397 977 q 422 992 412 992 l 471 992 q 489 985 481 992 q 496 967 496 977 m 893 769 l 893 719 q 885 702 893 709 q 868 694 878 694 l 818 694 q 801 702 808 694 q 794 719 794 709 l 794 769 q 801 786 794 779 q 818 794 808 794 l 868 794 q 885 786 878 794 q 893 769 893 779 m 694 967 l 694 918 q 687 900 694 908 q 670 893 680 893 l 620 893 q 603 900 610 893 q 595 918 595 908 l 595 967 q 603 985 595 977 q 620 992 610 992 l 670 992 q 687 985 680 992 q 694 967 694 977 m 893 967 l 893 918 q 885 900 893 908 q 868 893 878 893 l 818 893 q 801 900 808 893 q 794 918 794 908 l 794 967 q 801 985 794 977 q 818 992 808 992 l 868 992 q 885 985 878 992 q 893 967 893 977 m 694 -99 l 992 -99 l 992 1091 l 99 1091 l 99 -99 l 397 -99 l 397 74 q 404 92 397 84 q 422 99 412 99 l 670 99 q 687 92 680 99 q 694 74 694 84 l 694 -99 m 1091 1141 l 1091 -149 q 1077 -184 1091 -169 q 1042 -198 1062 -198 l 50 -198 q 15 -184 29 -198 q 0 -149 0 -169 l 0 1141 q 15 1176 0 1161 q 50 1190 29 1190 l 1042 1190 q 1077 1176 1062 1190 q 1091 1141 1091 1161 z "},"":{"ha":1091,"x_min":0,"x_max":1091,"o":"m 298 174 l 298 124 q 290 107 298 114 q 273 99 283 99 l 223 99 q 206 107 213 99 q 198 124 198 114 l 198 174 q 206 191 198 184 q 223 198 213 198 l 273 198 q 290 191 283 198 q 298 174 298 184 m 298 372 l 298 322 q 290 305 298 312 q 273 298 283 298 l 223 298 q 206 305 213 298 q 198 322 198 312 l 198 372 q 206 389 198 382 q 223 397 213 397 l 273 397 q 290 389 283 397 q 298 372 298 382 m 496 372 l 496 322 q 489 305 496 312 q 471 298 481 298 l 422 298 q 404 305 412 298 q 397 322 397 312 l 397 372 q 404 389 397 382 q 422 397 412 397 l 471 397 q 489 389 481 397 q 496 372 496 382 m 298 570 l 298 521 q 290 503 298 511 q 273 496 283 496 l 223 496 q 206 503 213 496 q 198 521 198 511 l 198 570 q 206 588 198 581 q 223 595 213 595 l 273 595 q 290 588 283 595 q 298 570 298 581 m 893 174 l 893 124 q 885 107 893 114 q 868 99 878 99 l 818 99 q 801 107 808 99 q 794 124 794 114 l 794 174 q 801 191 794 184 q 818 198 808 198 l 868 198 q 885 191 878 198 q 893 174 893 184 m 694 372 l 694 322 q 687 305 694 312 q 670 298 680 298 l 620 298 q 603 305 610 298 q 595 322 595 312 l 595 372 q 603 389 595 382 q 620 397 610 397 l 670 397 q 687 389 680 397 q 694 372 694 382 m 496 570 l 496 521 q 489 503 496 511 q 471 496 481 496 l 422 496 q 404 503 412 496 q 397 521 397 511 l 397 570 q 404 588 397 581 q 422 595 412 595 l 471 595 q 489 588 481 595 q 496 570 496 581 m 893 372 l 893 322 q 885 305 893 312 q 868 298 878 298 l 818 298 q 801 305 808 298 q 794 322 794 312 l 794 372 q 801 389 794 382 q 818 397 808 397 l 868 397 q 885 389 878 397 q 893 372 893 382 m 694 570 l 694 521 q 687 503 694 511 q 670 496 680 496 l 620 496 q 603 503 610 496 q 595 521 595 511 l 595 570 q 603 588 595 581 q 620 595 610 595 l 670 595 q 687 588 680 595 q 694 570 694 581 m 893 570 l 893 521 q 885 503 893 511 q 868 496 878 496 l 818 496 q 801 503 808 496 q 794 521 794 511 l 794 570 q 801 588 794 581 q 818 595 808 595 l 868 595 q 885 588 878 595 q 893 570 893 581 m 694 -99 l 992 -99 l 992 794 l 794 794 l 794 769 q 772 716 794 738 q 719 694 750 694 l 372 694 q 319 716 341 694 q 298 769 298 738 l 298 794 l 99 794 l 99 -99 l 397 -99 l 397 74 q 404 92 397 84 q 422 99 412 99 l 670 99 q 687 92 680 99 q 694 74 694 84 l 694 -99 m 694 818 l 694 1066 q 687 1084 694 1077 q 670 1091 680 1091 l 620 1091 q 603 1084 610 1091 q 595 1066 595 1077 l 595 992 l 496 992 l 496 1066 q 489 1084 496 1077 q 471 1091 481 1091 l 422 1091 q 404 1084 412 1091 q 397 1066 397 1077 l 397 818 q 404 801 397 808 q 422 794 412 794 l 471 794 q 489 801 481 794 q 496 818 496 808 l 496 893 l 595 893 l 595 818 q 603 801 595 808 q 620 794 610 794 l 670 794 q 687 801 680 794 q 694 818 694 808 m 1091 843 l 1091 -149 q 1077 -184 1091 -169 q 1042 -198 1062 -198 l 50 -198 q 15 -184 29 -198 q 0 -149 0 -169 l 0 843 q 15 878 0 863 q 50 893 29 893 l 298 893 l 298 1116 q 319 1169 298 1147 q 372 1190 341 1190 l 719 1190 q 772 1169 750 1190 q 794 1116 794 1147 l 794 893 l 1042 893 q 1077 878 1062 893 q 1091 843 1091 863 z "},"":{"ha":1488,"x_min":50,"x_max":1488,"o":"m 467 29 q 481 44 467 29 q 496 99 496 58 q 467 169 496 140 q 397 198 438 198 q 327 169 356 198 q 298 99 298 140 q 327 29 298 58 q 397 0 356 0 q 467 29 438 0 m 198 496 l 496 496 l 496 694 l 374 694 q 357 687 363 693 l 205 536 q 198 519 200 527 l 198 496 m 1161 29 q 1176 44 1161 29 q 1190 99 1190 58 q 1161 169 1190 140 q 1091 198 1132 198 q 1021 169 1050 198 q 992 99 992 140 q 1021 29 992 58 q 1091 0 1050 0 q 1161 29 1132 0 m 1290 620 l 1290 769 q 1283 787 1290 780 q 1265 794 1276 794 l 1091 794 l 1091 967 q 1084 985 1091 978 q 1066 992 1077 992 l 918 992 q 900 985 907 992 q 893 967 893 978 l 893 794 l 719 794 q 701 787 708 794 q 694 769 694 780 l 694 620 q 701 602 694 609 q 719 595 708 595 l 893 595 l 893 422 q 900 404 893 411 q 918 397 907 397 l 1066 397 q 1084 404 1077 397 q 1091 422 1091 411 l 1091 595 l 1265 595 q 1283 602 1276 595 q 1290 620 1290 609 m 1488 1042 l 1488 149 q 1473 114 1488 129 q 1438 99 1459 99 l 1290 99 q 1232 -41 1290 17 q 1091 -99 1173 -99 q 951 -41 1009 -99 q 893 99 893 17 l 595 99 q 537 -41 595 17 q 397 -99 479 -99 q 257 -41 315 -99 q 198 99 198 17 l 99 99 q 64 114 79 99 q 50 149 50 129 q 64 184 50 169 q 99 198 79 198 l 99 521 q 109 566 99 541 q 134 605 119 591 l 288 759 q 327 784 302 773 q 372 794 352 794 l 496 794 l 496 1042 q 511 1077 496 1062 q 546 1091 525 1091 l 1438 1091 q 1473 1077 1459 1091 q 1488 1042 1488 1062 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 992 322 l 992 471 q 985 489 992 482 q 967 496 978 496 l 794 496 l 794 670 q 787 687 794 680 q 769 694 780 694 l 620 694 q 602 687 609 694 q 595 670 595 680 l 595 496 l 422 496 q 404 489 411 496 q 397 471 397 482 l 397 322 q 404 305 397 312 q 422 298 411 298 l 595 298 l 595 124 q 602 106 595 113 q 620 99 609 99 l 769 99 q 787 106 780 99 q 794 124 794 113 l 794 298 l 967 298 q 985 305 978 298 q 992 322 992 312 m 496 893 l 893 893 l 893 992 l 496 992 l 496 893 m 198 893 l 198 -99 l 174 -99 q 51 -48 102 -99 q 0 74 0 3 l 0 719 q 51 842 0 791 q 174 893 102 893 l 198 893 m 1116 893 l 1116 -99 l 273 -99 l 273 893 l 397 893 l 397 1017 q 419 1070 397 1048 q 471 1091 440 1091 l 918 1091 q 970 1070 949 1091 q 992 1017 992 1048 l 992 893 l 1116 893 m 1389 719 l 1389 74 q 1338 -48 1389 3 q 1215 -99 1287 -99 l 1190 -99 l 1190 893 l 1215 893 q 1338 842 1287 893 q 1389 719 1389 791 z "},"":{"ha":1488,"x_min":0,"x_max":1488,"o":"m 1488 446 q 1265 372 1487 422 l 992 347 l 818 298 l 769 298 l 542 25 l 595 25 q 630 21 615 25 q 645 12 645 18 q 630 3 645 7 q 595 0 615 0 l 521 0 l 397 0 l 347 0 l 347 25 l 397 25 l 397 347 l 273 347 l 124 174 l 50 174 l 25 198 l 25 347 l 50 347 l 50 372 l 149 372 l 149 378 l 0 397 l 0 496 l 149 515 l 149 521 l 50 521 l 50 546 l 25 546 l 25 694 l 50 719 l 124 719 l 273 546 l 397 546 l 397 868 l 347 868 l 347 893 l 397 893 l 521 893 l 595 893 q 630 889 615 893 q 645 880 645 886 q 630 872 645 875 q 595 868 615 868 l 542 868 l 769 595 l 818 595 l 992 546 l 1265 521 q 1420 481 1364 499 q 1482 454 1476 462 l 1488 446 z "},"":{"ha":1290,"x_min":50,"x_max":1290,"o":"m 496 496 l 496 794 l 298 794 l 298 595 q 327 525 298 554 q 397 496 356 496 l 496 496 m 1290 149 l 1290 0 l 397 0 l 397 149 l 496 298 l 397 298 q 186 385 274 298 q 99 595 99 472 l 99 843 l 50 893 l 74 992 l 446 992 l 471 1091 l 1215 1091 l 1240 942 l 1190 918 l 1190 298 l 1290 149 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 992 149 l 992 843 q 977 878 992 863 q 942 893 963 893 l 843 893 q 808 878 823 893 q 794 843 794 863 l 794 595 l 397 595 l 397 843 q 382 878 397 863 q 347 893 367 893 l 248 893 q 213 878 228 893 q 198 843 198 863 l 198 149 q 213 114 198 129 q 248 99 228 99 l 347 99 q 382 114 367 99 q 397 149 397 129 l 397 397 l 794 397 l 794 149 q 808 114 794 129 q 843 99 823 99 l 942 99 q 977 114 963 99 q 992 149 992 129 m 1190 868 l 1190 124 q 1125 -34 1190 32 q 967 -99 1059 -99 l 223 -99 q 65 -34 131 -99 q 0 124 0 32 l 0 868 q 65 1026 0 960 q 223 1091 131 1091 l 967 1091 q 1125 1026 1059 1091 q 1190 868 1190 960 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 992 446 l 992 546 q 977 581 992 566 q 942 595 963 595 l 694 595 l 694 843 q 680 878 694 863 q 645 893 665 893 l 546 893 q 511 878 525 893 q 496 843 496 863 l 496 595 l 248 595 q 213 581 228 595 q 198 546 198 566 l 198 446 q 213 412 198 426 q 248 397 228 397 l 496 397 l 496 149 q 511 114 496 129 q 546 99 525 99 l 645 99 q 680 114 665 99 q 694 149 694 129 l 694 397 l 942 397 q 977 412 963 397 q 992 446 992 426 m 1190 868 l 1190 124 q 1125 -34 1190 32 q 967 -99 1059 -99 l 223 -99 q 65 -34 131 -99 q 0 124 0 32 l 0 868 q 65 1026 0 960 q 223 1091 131 1091 l 967 1091 q 1125 1026 1059 1091 q 1190 868 1190 960 z "},"":{"ha":794,"x_min":35,"x_max":784,"o":"m 478 142 q 486 124 486 134 q 478 106 486 114 l 439 67 q 422 60 432 60 q 404 67 412 60 l 43 429 q 35 446 35 436 q 43 464 35 457 l 404 825 q 422 833 412 833 q 439 825 432 833 l 478 787 q 486 769 486 779 q 478 751 486 759 l 174 446 l 478 142 m 776 142 q 784 124 784 134 q 776 106 784 114 l 737 67 q 719 60 729 60 q 701 67 709 60 l 340 429 q 332 446 332 436 q 340 464 332 457 l 701 825 q 719 833 709 833 q 737 825 729 833 l 776 787 q 784 769 784 779 q 776 751 784 759 l 471 446 l 776 142 z "},"":{"ha":794,"x_min":10,"x_max":759,"o":"m 453 464 q 461 446 461 457 q 453 429 461 436 l 92 67 q 74 60 84 60 q 57 67 64 60 l 18 106 q 10 124 10 114 q 18 142 10 134 l 322 446 l 18 751 q 10 769 10 759 q 18 787 10 779 l 57 825 q 74 833 64 833 q 92 825 84 833 l 453 464 m 751 464 q 759 446 759 457 q 751 429 759 436 l 390 67 q 372 60 382 60 q 354 67 362 60 l 315 106 q 308 124 308 114 q 315 142 308 134 l 620 446 l 315 751 q 308 769 308 759 q 315 787 308 779 l 354 825 q 372 833 362 833 q 390 825 382 833 l 751 464 z "},"":{"ha":893,"x_min":60,"x_max":833,"o":"m 825 191 q 833 174 833 184 q 825 156 833 164 l 787 117 q 769 109 779 109 q 751 117 759 109 l 446 422 l 142 117 q 124 109 134 109 q 106 117 114 109 l 67 156 q 60 174 60 164 q 67 191 60 184 l 429 553 q 446 560 436 560 q 464 553 457 560 l 825 191 m 825 489 q 833 471 833 481 q 825 453 833 461 l 787 415 q 769 407 779 407 q 751 415 759 407 l 446 719 l 142 415 q 124 407 134 407 q 106 415 114 407 l 67 453 q 60 471 60 461 q 67 489 60 481 l 429 850 q 446 858 436 858 q 464 850 457 858 l 825 489 z "},"":{"ha":893,"x_min":60,"x_max":833,"o":"m 825 539 q 833 521 833 531 q 825 503 833 511 l 464 142 q 446 134 457 134 q 429 142 436 134 l 67 503 q 60 521 60 511 q 67 539 60 531 l 106 577 q 124 585 114 585 q 142 577 134 585 l 446 273 l 751 577 q 769 585 759 585 q 787 577 779 585 l 825 539 m 825 836 q 833 818 833 829 q 825 801 833 808 l 464 439 q 446 432 457 432 q 429 439 436 432 l 67 801 q 60 818 60 808 q 67 836 60 829 l 106 875 q 124 883 114 883 q 142 875 134 883 l 446 570 l 751 875 q 769 883 759 883 q 787 875 779 883 l 825 836 z "},"":{"ha":496,"x_min":35,"x_max":486,"o":"m 478 787 q 486 769 486 779 q 478 751 486 759 l 174 446 l 478 142 q 486 124 486 134 q 478 106 486 114 l 439 67 q 422 60 432 60 q 404 67 412 60 l 43 429 q 35 446 35 436 q 43 464 35 457 l 404 825 q 422 833 412 833 q 439 825 432 833 l 478 787 z "},"":{"ha":496,"x_min":10,"x_max":461,"o":"m 453 464 q 461 446 461 457 q 453 429 461 436 l 92 67 q 74 60 84 60 q 57 67 64 60 l 18 106 q 10 124 10 114 q 18 142 10 134 l 322 446 l 18 751 q 10 769 10 759 q 18 787 10 779 l 57 825 q 74 833 64 833 q 92 825 84 833 l 453 464 z "},"":{"ha":893,"x_min":60,"x_max":833,"o":"m 825 291 q 833 273 833 283 q 825 255 833 263 l 787 216 q 769 208 779 208 q 751 216 759 208 l 446 521 l 142 216 q 124 208 134 208 q 106 216 114 208 l 67 255 q 60 273 60 263 q 67 291 60 283 l 429 652 q 446 660 436 660 q 464 652 457 660 l 825 291 z "},"":{"ha":893,"x_min":60,"x_max":833,"o":"m 825 638 q 833 620 833 630 q 825 602 833 610 l 464 241 q 446 233 457 233 q 429 241 436 233 l 67 602 q 60 620 60 610 q 67 638 60 630 l 106 677 q 124 684 114 684 q 142 677 134 684 l 446 372 l 751 677 q 769 684 759 684 q 787 677 779 684 l 825 638 z "},"":{"ha":1488,"x_min":0,"x_max":1488,"o":"m 1389 422 l 1389 1066 q 1382 1084 1389 1077 q 1364 1091 1374 1091 l 124 1091 q 107 1084 114 1091 q 99 1066 99 1077 l 99 422 q 107 404 99 412 q 124 397 114 397 l 1364 397 q 1382 404 1374 397 q 1389 422 1389 412 m 1488 1066 l 1488 223 q 1452 136 1488 172 q 1364 99 1415 99 l 942 99 q 955 39 942 71 q 980 -16 967 8 q 992 -50 992 -40 q 977 -84 992 -70 q 942 -99 963 -99 l 546 -99 q 511 -84 525 -99 q 496 -50 496 -70 q 508 -16 496 -39 q 533 39 521 8 q 546 99 546 70 l 124 99 q 36 136 73 99 q 0 223 0 172 l 0 1066 q 36 1154 0 1118 q 124 1190 73 1190 l 1364 1190 q 1452 1154 1415 1190 q 1488 1066 1488 1118 z "},"":{"ha":1488,"x_min":0,"x_max":1488,"o":"m 322 198 q 235 235 271 198 q 198 322 198 271 l 198 868 q 235 956 198 919 q 322 992 271 992 l 1166 992 q 1253 956 1217 992 q 1290 868 1290 919 l 1290 322 q 1253 235 1290 271 q 1166 198 1217 198 l 322 198 m 298 868 l 298 322 q 305 305 298 312 q 322 298 312 298 l 1166 298 q 1183 305 1176 298 q 1190 322 1190 312 l 1190 868 q 1183 885 1190 878 q 1166 893 1176 893 l 322 893 q 305 885 312 893 q 298 868 298 878 m 1364 149 l 1488 149 l 1488 74 q 1452 22 1488 43 q 1364 0 1415 0 l 124 0 q 36 22 73 0 q 0 74 0 43 l 0 149 l 124 149 l 1364 149 m 806 74 q 818 87 818 74 q 806 99 818 99 l 682 99 q 670 87 670 99 q 682 74 670 74 l 806 74 z "},"":{"ha":893,"x_min":0,"x_max":893,"o":"m 481 64 q 489 72 481 64 q 496 99 496 79 q 481 134 496 119 q 446 149 467 149 q 412 134 426 149 q 397 99 397 119 q 412 64 397 79 q 446 50 426 50 q 481 64 467 50 m 794 223 l 794 967 q 786 985 794 977 q 769 992 779 992 l 124 992 q 107 985 114 992 q 99 967 99 977 l 99 223 q 107 206 99 213 q 124 198 114 198 l 769 198 q 786 206 779 198 q 794 223 794 213 m 893 967 l 893 124 q 856 36 893 73 q 769 0 820 0 l 124 0 q 36 36 73 0 q 0 124 0 73 l 0 967 q 36 1055 0 1018 q 124 1091 73 1091 l 769 1091 q 856 1055 820 1091 q 893 967 893 1018 z "},"":{"ha":595,"x_min":0,"x_max":595,"o":"m 341 55 q 351 65 341 55 q 360 99 360 74 q 341 143 360 125 q 298 161 323 161 q 254 143 272 161 q 236 99 236 125 q 254 55 236 74 q 298 37 272 37 q 341 55 323 37 m 521 223 l 521 769 q 513 786 521 779 q 496 794 506 794 l 99 794 q 82 786 89 794 q 74 769 74 779 l 74 223 q 82 206 74 213 q 99 198 89 198 l 496 198 q 513 206 506 198 q 521 223 521 213 m 360 868 q 372 880 372 868 q 360 893 372 893 l 236 893 q 223 880 223 893 q 236 868 223 868 l 360 868 m 595 893 l 595 99 q 566 29 595 59 q 496 0 536 0 l 99 0 q 29 29 59 0 q 0 99 0 59 l 0 893 q 29 963 0 933 q 99 992 59 992 l 496 992 q 566 963 536 992 q 595 893 595 933 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 807 861 q 758 889 807 861 q 595 918 710 918 q 384 861 481 918 q 230 708 287 805 q 174 496 174 611 q 230 284 174 381 q 384 131 287 188 q 595 74 481 74 q 807 131 710 74 q 960 284 904 188 q 1017 496 1017 381 q 960 708 1017 611 q 807 861 904 805 m 1111 795 q 1151 726 1111 795 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 z "},"":{"ha":1290,"x_min":0,"x_max":1290,"o":"m 595 446 l 595 149 q 552 43 595 87 q 446 0 508 0 l 149 0 q 43 43 87 0 q 0 149 0 87 l 0 694 q 31 848 0 775 q 116 975 63 922 q 243 1060 170 1028 q 397 1091 316 1091 l 446 1091 q 481 1077 467 1091 q 496 1042 496 1062 l 496 942 q 481 908 496 922 q 446 893 467 893 l 397 893 q 257 835 315 893 q 198 694 198 777 l 198 670 q 220 617 198 639 q 273 595 242 595 l 446 595 q 552 552 508 595 q 595 446 595 508 m 1290 446 l 1290 149 q 1246 43 1290 87 q 1141 0 1203 0 l 843 0 q 738 43 781 0 q 694 149 694 87 l 694 694 q 726 848 694 775 q 811 975 757 922 q 937 1060 864 1028 q 1091 1091 1011 1091 l 1141 1091 q 1176 1077 1161 1091 q 1190 1042 1190 1062 l 1190 942 q 1176 908 1190 922 q 1141 893 1161 893 l 1091 893 q 951 835 1009 893 q 893 694 893 777 l 893 670 q 915 617 893 639 q 967 595 936 595 l 1141 595 q 1246 552 1203 595 q 1290 446 1290 508 z "},"":{"ha":1290,"x_min":0,"x_max":1290,"o":"m 595 942 l 595 397 q 564 243 595 316 q 479 116 532 170 q 352 31 426 63 q 198 0 279 0 l 149 0 q 114 15 129 0 q 99 50 99 29 l 99 149 q 114 184 99 169 q 149 198 129 198 l 198 198 q 339 257 281 198 q 397 397 397 315 l 397 422 q 375 474 397 453 q 322 496 353 496 l 149 496 q 43 539 87 496 q 0 645 0 583 l 0 942 q 43 1048 0 1004 q 149 1091 87 1091 l 446 1091 q 552 1048 508 1091 q 595 942 595 1004 m 1290 942 l 1290 397 q 1258 243 1290 316 q 1173 116 1227 170 q 1047 31 1120 63 q 893 0 973 0 l 843 0 q 808 15 823 0 q 794 50 794 29 l 794 149 q 808 184 794 169 q 843 198 823 198 l 893 198 q 1033 257 975 198 q 1091 397 1091 315 l 1091 422 q 1070 474 1091 453 q 1017 496 1048 496 l 843 496 q 738 539 781 496 q 694 645 694 583 l 694 942 q 738 1048 694 1004 q 843 1091 781 1091 l 1141 1091 q 1246 1048 1203 1091 q 1290 942 1290 1004 z "},"":{"ha":1389,"x_min":50,"x_max":1339,"o":"m 379 180 q 393 166 379 180 q 408 110 408 151 q 379 40 408 69 q 308 11 350 11 q 239 40 268 11 q 209 110 209 70 q 238 180 209 151 q 308 209 267 209 q 379 180 350 209 m 765 21 q 779 6 765 21 q 794 -50 794 -9 q 765 -120 794 -91 q 694 -149 736 -149 q 624 -120 653 -149 q 595 -50 595 -91 q 624 21 595 -9 q 694 50 653 50 q 765 21 736 50 m 219 566 q 233 552 219 566 q 248 496 248 537 q 219 426 248 455 q 149 397 190 397 q 79 426 108 397 q 50 496 50 455 q 79 566 50 537 q 149 595 108 595 q 219 566 190 595 m 1180 110 q 1150 40 1180 70 q 1080 11 1121 11 q 1010 40 1039 11 q 981 110 981 69 q 1010 180 981 151 q 1080 209 1039 209 q 1151 180 1121 209 q 1180 110 1180 151 m 396 970 q 414 951 396 970 q 432 882 432 933 q 396 794 432 831 q 308 758 360 758 q 221 794 257 758 q 184 882 184 831 q 221 970 184 933 q 308 1006 257 1006 q 396 970 360 1006 m 1310 566 q 1325 552 1310 566 q 1339 496 1339 537 q 1310 426 1339 455 q 1240 397 1281 397 q 1170 426 1199 397 q 1141 496 1141 455 q 1170 566 1141 537 q 1240 595 1199 595 q 1310 566 1281 595 m 800 1147 q 822 1125 800 1147 q 843 1042 843 1104 q 800 936 843 980 q 694 893 756 893 q 589 936 632 893 q 546 1042 546 980 q 589 1147 546 1104 q 694 1190 632 1190 q 800 1147 756 1190 m 1254 882 q 1203 759 1254 810 q 1080 708 1152 708 q 958 759 1008 708 q 907 882 907 810 q 958 1004 907 953 q 1080 1056 1008 1056 q 1203 1004 1152 1056 q 1254 882 1254 953 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 1111 795 q 1151 726 1111 795 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 1389 322 q 1290 -27 1389 194 q 1282 -46 1288 -33 q 1272 -69 1277 -59 q 1262 -86 1267 -79 q 1240 -99 1252 -99 q 1222 -91 1228 -99 q 1215 -72 1215 -84 q 1217 -52 1215 -65 q 1219 -33 1219 -38 q 1223 62 1223 19 q 1209 202 1223 140 q 1172 310 1196 264 q 1110 388 1148 355 q 1028 442 1072 421 q 925 475 984 463 q 806 491 866 487 q 670 496 746 496 l 496 496 l 496 298 q 481 263 496 277 q 446 248 467 248 q 412 263 426 248 l 15 660 q 0 694 0 674 q 15 729 0 715 l 412 1126 q 446 1141 426 1141 q 481 1126 467 1141 q 496 1091 496 1111 l 496 893 l 670 893 q 1348 581 1222 893 q 1389 322 1389 477 z "},"":{"ha":1290,"x_min":0,"x_max":1290,"o":"m 486 312 q 491 295 486 312 q 496 248 496 279 q 486 184 496 217 q 453 126 477 152 q 397 99 429 99 q 341 126 364 99 q 307 184 317 152 q 298 248 298 217 q 307 312 298 279 q 341 370 317 344 q 397 397 364 397 q 453 370 429 397 q 486 312 477 344 m 982 312 q 987 295 982 312 q 992 248 992 279 q 982 184 992 217 q 949 126 973 152 q 893 99 925 99 q 837 126 860 99 q 803 184 813 152 q 794 248 794 217 q 803 312 794 279 q 837 370 813 344 q 893 397 860 397 q 949 370 925 397 q 982 312 973 344 m 1116 248 q 1063 406 1116 341 q 918 471 1009 471 q 767 455 886 471 q 645 446 711 446 q 523 455 578 446 q 372 471 405 471 q 227 406 281 471 q 174 248 174 341 q 198 129 174 180 q 261 49 223 78 q 356 3 299 20 q 464 -20 412 -15 q 580 -26 516 -26 l 710 -26 q 825 -20 773 -26 q 934 3 877 -15 q 1028 49 991 20 q 1091 129 1066 78 q 1116 248 1116 180 m 1290 384 q 1242 128 1290 224 q 1161 25 1213 68 q 1051 -42 1108 -19 q 920 -79 994 -65 q 787 -96 845 -92 q 657 -99 729 -99 q 547 -97 597 -99 q 433 -87 498 -95 q 315 -64 368 -80 q 208 -24 261 -48 q 115 39 156 0 q 48 128 74 78 q 0 384 0 223 q 105 691 0 568 q 84 823 84 755 q 124 992 84 913 q 271 961 208 992 q 418 866 335 931 q 657 893 532 893 q 874 868 772 893 q 1019 962 956 932 q 1166 992 1083 992 q 1205 823 1205 913 q 1184 693 1205 756 q 1290 384 1290 569 z "},"":{"ha":1290,"x_min":0,"x_max":1290,"o":"m 1190 174 l 1190 719 q 1169 772 1190 750 q 1116 794 1147 794 l 570 794 q 518 815 539 794 q 496 868 496 837 l 496 918 q 474 970 496 949 q 422 992 453 992 l 174 992 q 121 970 143 992 q 99 918 99 949 l 99 174 q 121 121 99 143 q 174 99 143 99 l 1116 99 q 1169 121 1147 99 q 1190 174 1190 143 m 1290 719 l 1290 174 q 1239 51 1290 102 q 1116 0 1187 0 l 174 0 q 51 51 102 0 q 0 174 0 102 l 0 918 q 51 1040 0 989 q 174 1091 102 1091 l 422 1091 q 544 1040 493 1091 q 595 918 595 989 l 595 893 l 1116 893 q 1239 842 1187 893 q 1290 719 1290 791 z "},"":{"ha":1488,"x_min":0,"x_max":1480,"o":"m 1380 469 q 1339 496 1380 496 l 496 496 q 430 479 465 496 q 374 439 395 463 l 146 157 q 133 126 133 139 q 174 99 133 99 l 1017 99 q 1084 116 1048 99 q 1139 157 1119 133 l 1366 439 q 1380 469 1380 456 m 496 595 l 1091 595 l 1091 719 q 1070 772 1091 750 q 1017 794 1048 794 l 570 794 q 518 815 539 794 q 496 868 496 837 l 496 918 q 474 970 496 949 q 422 992 453 992 l 174 992 q 121 970 143 992 q 99 918 99 949 l 99 257 l 298 501 q 388 568 332 542 q 496 595 443 595 m 1480 469 q 1444 376 1480 421 l 1215 95 q 1125 27 1182 53 q 1017 0 1069 0 l 174 0 q 51 51 102 0 q 0 174 0 102 l 0 918 q 51 1040 0 989 q 174 1091 102 1091 l 422 1091 q 544 1040 493 1091 q 595 918 595 989 l 595 893 l 1017 893 q 1139 842 1088 893 q 1190 719 1190 791 l 1190 595 l 1339 595 q 1416 576 1381 595 q 1468 522 1451 557 q 1480 469 1480 497 z "},"":{"ha":1389,"x_min":0,"x_max":0,"o":""},"":{"ha":1389,"x_min":0,"x_max":0,"o":""},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 879 357 q 772 206 850 264 q 595 149 694 149 q 419 206 497 149 q 312 357 340 264 q 315 395 305 377 q 344 419 324 413 q 382 416 363 426 q 406 387 400 407 q 478 286 426 325 q 595 248 530 248 q 713 286 660 248 q 784 387 765 325 q 809 416 791 407 q 847 419 828 426 q 876 395 867 413 q 879 357 885 377 m 467 765 q 481 750 467 765 q 496 694 496 736 q 467 624 496 653 q 397 595 438 595 q 327 624 356 595 q 298 694 298 653 q 327 765 298 736 q 397 794 356 794 q 467 765 438 794 m 864 765 q 878 750 864 765 q 893 694 893 736 q 864 624 893 653 q 794 595 835 595 q 724 624 753 595 q 694 694 694 653 q 724 765 694 736 q 794 794 753 794 q 864 765 835 794 m 1052 303 q 1072 349 1052 303 q 1091 496 1091 395 q 1052 689 1091 597 q 946 847 1012 780 q 788 953 880 913 q 595 992 696 992 q 403 953 494 992 q 245 847 311 913 q 139 689 178 780 q 99 496 99 597 q 139 303 99 395 q 245 145 178 212 q 403 40 311 79 q 595 0 494 0 q 788 40 696 0 q 946 145 880 79 q 1052 303 1012 212 m 1111 795 q 1151 726 1111 795 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 879 238 q 876 200 885 219 q 847 176 867 182 q 809 179 828 170 q 784 208 791 188 q 713 309 765 270 q 595 347 660 347 q 478 309 530 347 q 406 208 426 270 q 382 179 400 188 q 344 176 363 170 q 315 200 324 182 q 312 238 305 219 q 419 389 340 332 q 595 446 497 446 q 772 389 694 446 q 879 238 850 332 m 467 765 q 481 750 467 765 q 496 694 496 736 q 467 624 496 653 q 397 595 438 595 q 327 624 356 595 q 298 694 298 653 q 327 765 298 736 q 397 794 356 794 q 467 765 438 794 m 864 765 q 878 750 864 765 q 893 694 893 736 q 864 624 893 653 q 794 595 835 595 q 724 624 753 595 q 694 694 694 653 q 724 765 694 736 q 794 794 753 794 q 864 765 835 794 m 1052 303 q 1072 349 1052 303 q 1091 496 1091 395 q 1052 689 1091 597 q 946 847 1012 780 q 788 953 880 913 q 595 992 696 992 q 403 953 494 992 q 245 847 311 913 q 139 689 178 780 q 99 496 99 597 q 139 303 99 395 q 245 145 178 212 q 403 40 311 79 q 595 0 494 0 q 788 40 696 0 q 946 145 880 79 q 1052 303 1012 212 m 1111 795 q 1151 726 1111 795 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 878 382 q 885 375 878 382 q 893 347 893 367 q 878 312 893 327 q 843 298 863 298 l 347 298 q 312 312 327 298 q 298 347 298 327 q 312 382 298 367 q 347 397 327 397 l 843 397 q 878 382 863 397 m 467 765 q 481 750 467 765 q 496 694 496 736 q 467 624 496 653 q 397 595 438 595 q 327 624 356 595 q 298 694 298 653 q 327 765 298 736 q 397 794 356 794 q 467 765 438 794 m 864 765 q 878 750 864 765 q 893 694 893 736 q 864 624 893 653 q 794 595 835 595 q 724 624 753 595 q 694 694 694 653 q 724 765 694 736 q 794 794 753 794 q 864 765 835 794 m 1052 303 q 1072 349 1052 303 q 1091 496 1091 395 q 1052 689 1091 597 q 946 847 1012 780 q 788 953 880 913 q 595 992 696 992 q 403 953 494 992 q 245 847 311 913 q 139 689 178 780 q 99 496 99 597 q 139 303 99 395 q 245 145 178 212 q 403 40 311 79 q 595 0 494 0 q 788 40 696 0 q 946 145 880 79 q 1052 303 1012 212 m 1111 795 q 1151 726 1111 795 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 z "},"":{"ha":1488,"x_min":0,"x_max":1488,"o":"m 645 347 l 645 446 q 638 464 645 457 q 620 471 631 471 l 471 471 l 471 620 q 464 638 471 631 q 446 645 457 645 l 347 645 q 329 638 336 645 q 322 620 322 631 l 322 471 l 174 471 q 156 464 163 471 q 149 446 149 457 l 149 347 q 156 329 149 336 q 174 322 163 322 l 322 322 l 322 174 q 329 156 322 163 q 347 149 336 149 l 446 149 q 464 156 457 149 q 471 174 471 163 l 471 322 l 620 322 q 638 329 631 322 q 645 347 645 336 m 1062 227 q 1077 242 1062 227 q 1091 298 1091 257 q 1062 368 1091 339 q 992 397 1033 397 q 922 368 951 397 q 893 298 893 339 q 922 227 893 257 q 992 198 951 198 q 1062 227 1033 198 m 1261 426 q 1275 440 1261 426 q 1290 496 1290 455 q 1261 566 1290 537 q 1190 595 1232 595 q 1120 566 1149 595 q 1091 496 1091 537 q 1120 426 1091 455 q 1190 397 1149 397 q 1261 426 1232 397 m 1372 677 q 1430 619 1372 677 q 1488 397 1488 561 q 1372 116 1488 233 q 1091 0 1256 0 q 829 99 942 0 l 659 99 q 397 0 546 0 q 116 116 233 0 q 0 397 0 233 q 116 677 0 561 q 397 794 233 794 l 1091 794 q 1372 677 1256 794 z "},"":{"ha":1488,"x_min":0,"x_max":1488,"o":"m 298 285 l 298 211 q 285 198 298 198 l 211 198 q 198 211 198 198 l 198 285 q 211 298 198 298 l 285 298 q 298 285 298 298 m 397 484 l 397 409 q 384 397 397 397 l 211 397 q 198 409 198 397 l 198 484 q 211 496 198 496 l 384 496 q 397 484 397 496 m 298 682 l 298 608 q 285 595 298 595 l 211 595 q 198 608 198 595 l 198 682 q 211 694 198 694 l 285 694 q 298 682 298 694 m 1091 285 l 1091 211 q 1079 198 1091 198 l 409 198 q 397 211 397 198 l 397 285 q 409 298 397 298 l 1079 298 q 1091 285 1091 298 m 595 484 l 595 409 q 583 397 595 397 l 508 397 q 496 409 496 397 l 496 484 q 508 496 496 496 l 583 496 q 595 484 595 496 m 496 682 l 496 608 q 484 595 496 595 l 409 595 q 397 608 397 595 l 397 682 q 409 694 397 694 l 484 694 q 496 682 496 694 m 794 484 l 794 409 q 781 397 794 397 l 707 397 q 694 409 694 397 l 694 484 q 707 496 694 496 l 781 496 q 794 484 794 496 m 694 682 l 694 608 q 682 595 694 595 l 608 595 q 595 608 595 595 l 595 682 q 608 694 595 694 l 682 694 q 694 682 694 694 m 992 484 l 992 409 q 980 397 992 397 l 905 397 q 893 409 893 397 l 893 484 q 905 496 893 496 l 980 496 q 992 484 992 496 m 1290 285 l 1290 211 q 1277 198 1290 198 l 1203 198 q 1190 211 1190 198 l 1190 285 q 1203 298 1190 298 l 1277 298 q 1290 285 1290 298 m 893 682 l 893 608 q 880 595 893 595 l 806 595 q 794 608 794 595 l 794 682 q 806 694 794 694 l 880 694 q 893 682 893 694 m 1091 682 l 1091 608 q 1079 595 1091 595 l 1004 595 q 992 608 992 595 l 992 682 q 1004 694 992 694 l 1079 694 q 1091 682 1091 694 m 1290 682 l 1290 409 q 1277 397 1290 397 l 1104 397 q 1091 409 1091 397 l 1091 484 q 1104 496 1091 496 l 1190 496 l 1190 682 q 1203 694 1190 694 l 1277 694 q 1290 682 1290 694 m 1389 99 l 1389 794 l 99 794 l 99 99 l 1389 99 m 1488 794 l 1488 99 q 1459 29 1488 58 q 1389 0 1430 0 l 99 0 q 29 29 58 0 q 0 99 0 58 l 0 794 q 29 864 0 835 q 99 893 58 893 l 1389 893 q 1459 864 1430 893 q 1488 794 1488 835 z "},"":{"ha":1389,"x_min":50,"x_max":1389,"o":"m 1290 381 l 1290 858 q 1053 787 1159 787 q 940 812 989 787 q 798 872 863 850 q 660 893 732 893 q 347 794 525 893 l 347 330 q 683 418 537 418 q 763 412 725 418 q 839 392 801 406 q 899 368 877 377 q 963 337 920 358 l 984 326 q 1063 309 1018 309 q 1290 381 1156 309 m 248 992 q 234 942 248 965 q 198 907 221 920 l 198 -74 q 191 -92 198 -85 q 174 -99 184 -99 l 124 -99 q 106 -92 113 -99 q 99 -74 99 -85 l 99 907 q 63 942 77 920 q 50 992 50 965 q 79 1062 50 1033 q 149 1091 108 1091 q 219 1062 190 1091 q 248 992 248 1033 m 1389 942 l 1389 351 q 1362 307 1389 321 q 1349 300 1354 303 q 1063 210 1180 210 q 940 237 994 210 l 918 248 q 842 285 869 274 q 771 308 815 297 q 683 319 728 319 q 500 284 604 319 q 323 205 397 250 q 298 198 312 198 q 273 205 285 198 q 248 248 248 219 l 248 823 q 272 866 248 850 q 333 899 299 882 q 421 939 367 915 q 539 977 476 963 q 660 992 603 992 q 822 968 746 992 q 984 901 897 944 q 1053 887 1013 887 q 1293 973 1147 887 q 1317 987 1310 983 q 1365 985 1341 999 q 1389 942 1389 970 z "},"":{"ha":1389,"x_min":50,"x_max":1389,"o":"m 645 415 l 645 564 q 347 474 505 552 l 347 330 q 645 415 506 405 m 645 739 l 645 892 q 347 794 512 886 l 347 648 q 645 739 514 734 m 1290 381 l 1290 523 q 992 468 1108 433 l 992 642 q 962 653 977 646 q 936 667 958 656 q 910 680 915 677 q 885 691 904 682 q 858 703 866 701 q 833 713 851 706 q 805 723 815 721 q 778 730 795 725 q 748 736 761 734 q 717 739 734 737 q 683 740 700 740 q 645 738 665 740 l 645 566 l 660 566 q 809 543 739 566 q 962 480 879 521 q 992 468 977 473 l 992 322 q 1063 309 1025 309 q 1290 381 1156 309 m 1290 711 l 1290 858 q 1053 787 1159 787 q 992 794 1018 787 l 992 642 q 1290 711 1107 609 m 248 992 q 234 942 248 965 q 198 907 221 920 l 198 -74 q 191 -92 198 -85 q 174 -99 184 -99 l 124 -99 q 106 -92 113 -99 q 99 -74 99 -85 l 99 907 q 63 942 77 920 q 50 992 50 965 q 79 1062 50 1033 q 149 1091 108 1091 q 219 1062 190 1091 q 248 992 248 1033 m 1389 942 l 1389 351 q 1362 307 1389 321 q 1349 300 1354 303 q 1063 210 1180 210 q 940 237 994 210 l 918 248 q 842 285 869 274 q 771 308 815 297 q 683 319 728 319 q 500 284 604 319 q 323 205 397 250 q 298 198 312 198 q 273 205 285 198 q 248 248 248 219 l 248 823 q 272 866 248 850 q 333 899 299 882 q 421 939 367 915 q 539 977 476 963 q 660 992 603 992 q 822 968 746 992 q 984 901 897 944 q 1053 887 1013 887 q 1293 973 1147 887 q 1317 987 1310 983 q 1365 985 1341 999 q 1389 942 1389 970 z "},"":{"ha":1290,"x_min":10,"x_max":1290,"o":"m 453 429 l 92 67 q 74 60 84 60 q 57 67 64 60 l 18 106 q 10 124 10 114 q 18 142 10 134 l 322 446 l 18 751 q 10 769 10 759 q 18 787 10 779 l 57 825 q 74 833 64 833 q 92 825 84 833 l 453 464 q 461 446 461 457 q 453 429 461 436 m 1290 74 l 1290 25 q 1283 7 1290 14 q 1265 0 1276 0 l 521 0 q 503 7 510 0 q 496 25 496 14 l 496 74 q 503 92 496 85 q 521 99 510 99 l 1265 99 q 1283 92 1276 99 q 1290 74 1290 85 z "},"":{"ha":1488,"x_min":35,"x_max":1453,"o":"m 478 106 l 439 67 q 422 60 432 60 q 404 67 412 60 l 43 429 q 35 446 35 436 q 43 464 35 457 l 404 825 q 422 833 412 833 q 439 825 432 833 l 478 787 q 486 769 486 779 q 478 751 486 759 l 174 446 l 478 142 q 486 124 486 134 q 478 106 486 114 m 936 933 l 647 -67 q 635 -83 644 -78 q 617 -84 626 -88 l 569 -71 q 554 -59 559 -68 q 552 -40 549 -50 l 841 960 q 853 975 844 970 q 871 977 862 980 l 919 964 q 934 952 929 961 q 936 933 939 943 m 1445 429 l 1084 67 q 1066 60 1077 60 q 1049 67 1056 60 l 1010 106 q 1002 124 1002 114 q 1010 142 1002 134 l 1314 446 l 1010 751 q 1002 769 1002 759 q 1010 787 1002 779 l 1049 825 q 1066 833 1056 833 q 1084 825 1077 833 l 1445 464 q 1453 446 1453 457 q 1445 429 1453 436 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 496 352 l 496 298 q 466 252 496 265 q 446 248 456 248 q 412 263 426 248 l 15 660 q 0 694 0 674 q 15 729 0 715 l 412 1126 q 466 1137 434 1150 q 496 1091 496 1124 l 496 1038 l 188 729 q 174 694 174 715 q 188 660 174 674 l 496 352 m 1389 322 q 1376 219 1389 277 q 1346 112 1363 160 q 1309 15 1329 64 q 1277 -55 1288 -33 q 1262 -86 1266 -77 q 1240 -99 1256 -99 q 1233 -98 1235 -99 q 1215 -72 1214 -92 q 1133 366 1249 238 q 1001 451 1084 421 q 794 492 918 482 l 794 298 q 763 252 794 265 q 744 248 753 248 q 709 263 723 248 l 312 660 q 298 694 298 674 q 312 729 298 715 l 709 1126 q 763 1137 732 1150 q 794 1091 794 1124 l 794 888 q 1258 717 1112 867 q 1389 322 1389 583 z "},"":{"ha":1290,"x_min":2,"x_max":1288,"o":"m 919 449 l 1118 643 l 842 683 l 791 691 l 768 737 l 645 987 l 645 240 l 691 216 l 937 86 l 891 361 l 881 412 l 919 449 m 1270 652 l 988 377 l 1055 -10 q 1050 -50 1059 -36 q 1024 -64 1042 -64 q 993 -55 1011 -64 l 645 128 l 297 -55 q 266 -64 279 -64 q 239 -50 248 -64 q 235 -10 231 -36 l 301 377 l 19 652 q 2 698 -5 677 q 43 725 9 719 l 432 781 l 607 1134 q 645 1166 622 1166 q 683 1134 667 1166 l 857 781 l 1246 725 q 1288 698 1281 719 q 1270 652 1295 677 z "},"":{"ha":1091,"x_min":2,"x_max":1091,"o":"m 1086 920 l 590 -72 q 546 -99 577 -99 q 534 -98 542 -99 q 506 -80 517 -94 q 496 -50 496 -67 l 496 397 l 50 397 q 19 407 33 397 q 2 435 5 418 q 5 467 -2 452 q 27 491 12 483 l 1019 987 q 1042 992 1029 992 q 1077 977 1063 992 q 1091 951 1088 966 q 1086 920 1094 935 z "},"":{"ha":1290,"x_min":0,"x_max":1290,"o":"m 432 198 l 893 198 l 893 660 l 432 198 m 397 233 l 858 694 l 397 694 l 397 233 m 1290 174 l 1290 25 q 1283 7 1290 14 q 1265 0 1276 0 l 1091 0 l 1091 -174 q 1084 -191 1091 -184 q 1066 -198 1077 -198 l 918 -198 q 900 -191 907 -198 q 893 -174 893 -184 l 893 0 l 223 0 q 205 7 212 0 q 198 25 198 14 l 198 694 l 25 694 q 7 701 14 694 q 0 719 0 708 l 0 868 q 7 886 0 879 q 25 893 14 893 l 198 893 l 198 1066 q 205 1084 198 1077 q 223 1091 212 1091 l 372 1091 q 390 1084 383 1091 q 397 1066 397 1077 l 397 893 l 1056 893 l 1247 1084 q 1265 1091 1255 1091 q 1283 1084 1275 1091 q 1290 1066 1290 1077 q 1283 1049 1290 1056 l 1091 858 l 1091 198 l 1265 198 q 1283 191 1276 198 q 1290 174 1290 184 z "},"":{"ha":794,"x_min":0,"x_max":794,"o":"m 202 -3 q 212 8 202 -3 q 223 50 223 19 q 202 102 223 81 q 149 124 180 124 q 96 102 118 124 q 74 50 74 81 q 96 -3 74 19 q 149 -25 118 -25 q 202 -3 180 -25 m 202 890 q 212 901 202 890 q 223 942 223 911 q 202 995 223 973 q 149 1017 180 1017 q 96 995 118 1017 q 74 942 74 973 q 96 890 74 911 q 149 868 118 868 q 202 890 180 868 m 698 791 q 708 801 698 791 q 719 843 719 812 q 698 896 719 874 q 645 918 676 918 q 592 896 614 918 q 570 843 570 874 q 592 791 570 812 q 645 769 614 769 q 698 791 676 769 m 794 843 q 773 768 794 803 q 719 715 753 734 q 544 394 718 492 q 387 331 492 364 q 255 276 288 300 q 223 198 223 252 l 223 178 q 277 124 257 159 q 298 50 298 90 q 254 -56 298 -12 q 149 -99 211 -99 q 43 -56 87 -99 q 0 50 0 -12 q 20 124 0 90 q 74 178 40 159 l 74 814 q 20 868 40 833 q 0 942 0 902 q 43 1048 0 1004 q 149 1091 87 1091 q 254 1048 211 1091 q 298 942 298 1004 q 277 868 298 902 q 223 814 257 833 l 223 429 q 343 473 265 449 q 410 496 385 486 q 465 520 436 505 q 511 550 494 534 q 542 590 527 567 q 564 644 557 613 q 570 715 570 674 q 516 768 536 734 q 496 843 496 803 q 539 949 496 905 q 645 992 583 992 q 750 949 707 992 q 794 843 794 905 z "},"":{"ha":1290,"x_min":0,"x_max":1290,"o":"m 340 205 l 142 7 q 124 0 133 0 q 106 7 115 0 q 99 25 99 15 q 106 43 99 35 l 305 241 q 322 248 312 248 q 340 241 332 248 q 347 223 347 233 q 340 205 347 213 m 471 174 l 471 -74 q 464 -92 471 -85 q 446 -99 457 -99 q 429 -92 436 -99 q 422 -74 422 -85 l 422 174 q 429 191 422 184 q 446 198 436 198 q 464 191 457 198 q 471 174 471 184 m 291 365 q 294 362 291 365 q 298 347 298 358 q 291 329 298 336 q 273 322 284 322 l 25 322 q 7 329 14 322 q 0 347 0 336 q 7 365 0 358 q 25 372 14 372 l 273 372 q 291 365 284 372 m 1277 248 q 1211 91 1277 155 l 1097 -22 q 940 -87 1033 -87 q 782 -21 846 -87 l 523 239 q 491 282 507 255 l 676 296 l 887 84 q 940 62 908 63 q 993 83 972 62 l 1107 196 q 1128 248 1128 218 q 1107 301 1128 279 l 894 514 l 908 699 q 952 667 935 683 l 1212 406 q 1277 248 1277 339 m 799 809 l 614 795 l 402 1008 q 350 1029 381 1029 q 297 1008 319 1029 l 183 895 q 161 843 161 873 q 183 791 161 812 l 395 578 l 381 392 q 338 425 354 408 l 78 685 q 12 843 12 752 q 78 1001 12 936 l 192 1114 q 350 1178 257 1178 q 508 1112 443 1178 l 767 853 q 799 809 783 836 m 1283 762 q 1286 758 1283 762 q 1290 744 1290 755 q 1283 726 1290 733 q 1265 719 1276 719 l 1017 719 q 999 726 1006 719 q 992 744 992 733 q 999 762 992 755 q 1017 769 1006 769 l 1265 769 q 1283 762 1276 769 m 868 1166 l 868 918 q 861 900 868 907 q 843 893 854 893 q 825 900 832 893 q 818 918 818 907 l 818 1166 q 825 1184 818 1177 q 843 1190 832 1190 q 861 1184 854 1190 q 868 1166 868 1177 m 1184 1049 l 985 850 q 967 843 977 843 q 949 850 958 843 q 942 868 942 858 q 949 886 942 878 l 1148 1084 q 1166 1091 1156 1091 q 1184 1084 1176 1091 q 1190 1066 1190 1077 q 1184 1049 1190 1056 z "},"":{"ha":794,"x_min":74,"x_max":791,"o":"m 546 217 l 546 31 q 536 9 546 19 q 515 0 527 0 l 329 0 q 307 9 316 0 q 298 31 298 19 l 298 217 q 307 239 298 229 q 329 248 316 248 l 515 248 q 536 239 527 248 q 546 217 546 229 m 791 682 q 779 604 791 640 q 751 544 767 567 q 709 498 736 522 q 664 465 681 475 q 617 437 647 454 q 564 387 585 419 q 543 335 543 354 q 533 310 543 322 q 512 298 524 298 l 326 298 q 306 312 314 298 q 298 341 298 326 l 298 376 q 348 497 298 440 q 459 581 398 554 q 524 625 505 602 q 543 684 543 647 q 507 741 543 716 q 424 766 471 766 q 340 743 374 766 q 257 654 313 724 q 233 642 247 642 q 214 648 224 642 l 87 745 q 75 764 77 753 q 79 786 73 776 q 439 992 203 992 q 563 968 501 992 q 677 904 626 944 q 759 805 727 863 q 791 682 791 746 z "},"":{"ha":496,"x_min":0,"x_max":496,"o":"m 496 149 l 496 50 q 481 15 496 29 q 446 0 467 0 l 50 0 q 15 15 29 0 q 0 50 0 29 l 0 149 q 15 184 0 169 q 50 198 29 198 l 99 198 l 99 496 l 50 496 q 15 511 29 496 q 0 546 0 525 l 0 645 q 15 680 0 665 q 50 694 29 694 l 347 694 q 382 680 367 694 q 397 645 397 665 l 397 198 l 446 198 q 481 184 467 198 q 496 149 496 169 m 397 1042 l 397 893 q 382 858 397 873 q 347 843 367 843 l 149 843 q 114 858 129 843 q 99 893 99 873 l 99 1042 q 114 1077 99 1062 q 149 1091 129 1091 l 347 1091 q 382 1077 367 1091 q 397 1042 397 1062 z "},"":{"ha":496,"x_min":76,"x_max":420,"o":"m 397 223 l 397 50 q 382 15 397 29 q 347 0 367 0 l 149 0 q 114 15 129 0 q 99 50 99 29 l 99 223 q 114 258 99 243 q 149 273 129 273 l 347 273 q 382 258 367 273 q 397 223 397 243 m 420 1042 l 398 446 q 382 412 398 426 q 347 397 367 397 l 149 397 q 114 412 129 397 q 98 446 98 426 l 76 1042 q 90 1077 75 1062 q 124 1091 104 1091 l 372 1091 q 407 1077 392 1091 q 420 1042 421 1062 z "},"":{"ha":1190,"x_min":4,"x_max":1189,"o":"m 695 129 l 695 0 l 503 0 l 380 195 l 361 228 q 353 244 355 235 l 350 244 q 348 239 350 242 q 346 233 347 236 q 343 228 344 229 q 324 194 336 212 l 204 0 l 4 0 l 4 129 l 103 129 l 256 355 l 112 566 l 6 566 l 6 696 l 220 696 l 328 519 q 346 487 329 516 q 354 470 352 480 l 357 470 q 365 487 359 477 l 384 519 l 493 696 l 692 696 l 692 566 l 595 566 l 453 359 l 611 129 l 695 129 m 1189 656 l 1189 496 l 791 496 l 788 517 q 785 553 785 539 q 805 643 785 602 q 856 710 825 684 q 921 761 886 736 q 986 803 956 785 q 1036 845 1016 821 q 1056 894 1056 869 q 1034 943 1056 924 q 979 962 1011 962 q 904 932 939 962 q 876 902 893 923 l 794 973 q 843 1025 815 1002 q 989 1075 908 1075 q 1127 1029 1074 1075 q 1180 906 1180 983 q 1161 826 1180 863 q 1113 767 1142 790 q 1049 722 1084 744 q 986 682 1015 699 q 935 643 956 666 q 911 594 914 619 l 1091 594 l 1091 656 l 1189 656 z "},"":{"ha":1190,"x_min":4,"x_max":1190,"o":"m 695 129 l 695 0 l 503 0 l 380 195 l 361 228 q 353 244 355 235 l 350 244 q 348 239 350 242 q 346 233 347 236 q 343 228 344 229 q 324 194 336 212 l 204 0 l 4 0 l 4 129 l 103 129 l 256 355 l 112 566 l 6 566 l 6 696 l 220 696 l 328 519 q 346 487 329 516 q 354 470 352 480 l 357 470 q 365 487 359 477 l 384 519 l 493 696 l 692 696 l 692 566 l 595 566 l 453 359 l 611 129 l 695 129 m 1190 -39 l 1190 -198 l 792 -198 l 789 -177 q 787 -142 787 -143 q 807 -51 787 -92 q 857 16 827 -10 q 922 66 887 42 q 987 109 957 91 q 1038 150 1018 126 q 1058 200 1058 174 q 1035 248 1058 229 q 980 267 1012 267 q 905 237 941 267 q 877 208 894 229 l 796 279 q 845 330 816 308 q 991 381 907 381 q 1128 334 1076 381 q 1181 212 1181 288 q 1154 120 1181 160 q 1089 53 1128 79 q 1012 5 1051 27 q 945 -44 973 -18 q 913 -101 916 -71 l 1093 -101 l 1093 -39 l 1190 -39 z "},"":{"ha":1488,"x_min":1,"x_max":1487,"o":"m 694 99 l 955 397 l 360 397 l 99 99 l 694 99 m 1480 934 q 1487 879 1491 908 q 1463 828 1483 849 l 769 34 q 694 0 739 0 l 99 0 q 45 16 70 0 q 9 58 21 32 q 1 114 -3 84 q 25 164 5 143 l 719 958 q 794 992 749 992 l 1389 992 q 1443 976 1418 992 q 1480 934 1467 960 z "},"":{"ha":1290,"x_min":0,"x_max":1290,"o":"m 1290 339 q 1255 235 1290 277 q 1159 193 1221 193 q 1099 207 1128 193 q 1054 236 1071 220 q 1010 265 1036 252 q 955 279 984 279 q 870 183 870 279 q 882 94 870 153 q 894 5 894 35 l 894 1 q 868 0 877 1 q 792 -9 842 -2 q 703 -19 743 -16 q 627 -23 663 -23 q 547 -3 580 -23 q 515 62 515 18 q 528 117 515 91 q 558 161 542 143 q 587 207 574 178 q 601 267 601 235 q 559 362 601 328 q 454 397 517 397 q 343 362 389 397 q 298 263 298 326 q 309 198 298 229 q 335 148 321 167 q 361 107 350 129 q 373 68 373 85 q 337 -1 373 33 q 246 -28 308 -28 q 57 -9 173 -28 q 35 -6 50 -8 q 14 -3 21 -5 l 4 -2 q 2 -1 3 -2 q 0 0 0 -1 l 0 794 q 14 791 2 793 q 40 787 26 789 q 57 784 54 785 q 246 766 173 766 q 337 793 308 766 q 373 862 373 827 q 361 901 373 879 q 335 942 350 923 q 309 992 321 961 q 298 1056 298 1023 q 343 1155 298 1120 q 455 1190 389 1190 q 559 1156 517 1190 q 601 1060 601 1121 q 587 1000 601 1028 q 558 954 574 972 q 528 911 542 937 q 515 856 515 884 q 547 791 515 811 q 627 770 580 770 q 767 782 677 770 q 893 795 856 794 l 893 794 q 890 780 892 792 q 886 754 888 768 q 884 737 884 739 q 865 547 865 621 q 892 457 865 485 q 961 421 926 421 q 1000 432 978 421 q 1041 458 1022 444 q 1091 484 1060 473 q 1156 496 1122 496 q 1254 450 1219 496 q 1290 339 1290 405 z "},"":{"ha":893,"x_min":0,"x_max":893,"o":"m 893 645 l 893 546 q 779 248 893 374 q 496 102 664 121 l 496 0 l 694 0 q 729 -15 715 0 q 744 -50 744 -29 q 729 -84 744 -70 q 694 -99 715 -99 l 198 -99 q 164 -84 178 -99 q 149 -50 149 -70 q 164 -15 149 -29 q 198 0 178 0 l 397 0 l 397 102 q 114 248 229 121 q 0 546 0 374 l 0 645 q 15 680 0 665 q 50 694 29 694 q 84 680 70 694 q 99 645 99 665 l 99 546 q 201 300 99 402 q 446 198 303 198 q 692 300 590 198 q 794 546 794 402 l 794 645 q 808 680 794 665 q 843 694 823 694 q 878 680 863 694 q 893 645 893 665 m 694 942 l 694 546 q 622 370 694 443 q 446 298 549 298 q 271 370 344 298 q 198 546 198 443 l 198 942 q 271 1118 198 1045 q 446 1190 344 1190 q 622 1118 549 1190 q 694 942 694 1045 z "},"":{"ha":1091,"x_min":10,"x_max":1081,"o":"m 210 458 l 132 380 q 99 546 99 460 l 99 645 q 114 680 99 665 q 149 694 129 694 q 184 680 169 694 q 198 645 198 665 l 198 546 q 210 458 198 505 m 1073 925 l 794 645 l 794 546 q 721 370 794 443 q 546 298 648 298 q 461 312 503 298 l 387 238 q 546 198 462 198 q 791 300 689 198 q 893 546 893 402 l 893 645 q 908 680 893 665 q 942 694 922 694 q 977 680 963 694 q 992 645 992 665 l 992 546 q 878 248 992 374 q 595 102 763 121 l 595 0 l 794 0 q 829 -15 814 0 q 843 -50 843 -29 q 829 -84 843 -70 q 794 -99 814 -99 l 298 -99 q 263 -84 277 -99 q 248 -50 248 -70 q 263 -15 248 -29 q 298 0 277 0 l 496 0 l 496 102 q 314 165 399 112 l 117 -32 q 99 -40 109 -40 q 81 -32 89 -40 l 18 32 q 10 50 10 40 q 18 67 10 60 l 974 1024 q 992 1032 982 1032 q 1010 1024 1002 1032 l 1073 960 q 1081 942 1081 953 q 1073 925 1081 932 m 779 1027 l 298 546 l 298 942 q 370 1118 298 1045 q 546 1190 443 1190 q 689 1145 625 1190 q 779 1027 753 1099 z "},"":{"ha":992,"x_min":0,"x_max":992,"o":"m 843 446 l 843 942 l 496 942 l 496 61 q 661 167 588 110 q 843 446 843 310 m 992 1042 l 992 446 q 966 314 992 380 q 902 198 940 249 q 810 99 863 147 q 712 19 757 51 q 618 -41 667 -12 q 549 -79 570 -69 q 516 -95 529 -89 q 496 -99 507 -99 q 476 -95 485 -99 q 443 -79 463 -89 q 374 -41 422 -69 q 280 19 325 -12 q 182 99 235 51 q 90 198 129 147 q 26 314 52 249 q 0 446 0 380 l 0 1042 q 15 1077 0 1062 q 50 1091 29 1091 l 942 1091 q 977 1077 963 1091 q 992 1042 992 1062 z "},"":{"ha":1290,"x_min":0,"x_max":1290,"o":"m 99 -99 l 1190 -99 l 1190 694 l 99 694 l 99 -99 m 397 843 l 397 1066 q 390 1084 397 1077 q 372 1091 383 1091 l 322 1091 q 305 1084 312 1091 q 298 1066 298 1077 l 298 843 q 305 825 298 832 q 322 818 312 818 l 372 818 q 390 825 383 818 q 397 843 397 832 m 992 843 l 992 1066 q 985 1084 992 1077 q 967 1091 978 1091 l 918 1091 q 900 1084 907 1091 q 893 1066 893 1077 l 893 843 q 900 825 893 832 q 918 818 907 818 l 967 818 q 985 825 978 818 q 992 843 992 832 m 1290 893 l 1290 -99 q 1260 -169 1290 -140 q 1190 -198 1231 -198 l 99 -198 q 29 -169 59 -198 q 0 -99 0 -140 l 0 893 q 29 963 0 933 q 99 992 59 992 l 198 992 l 198 1066 q 235 1154 198 1118 q 322 1190 271 1190 l 372 1190 q 460 1154 423 1190 q 496 1066 496 1118 l 496 992 l 794 992 l 794 1066 q 830 1154 794 1118 q 918 1190 867 1190 l 967 1190 q 1055 1154 1018 1190 q 1091 1066 1091 1118 l 1091 992 l 1190 992 q 1260 963 1231 992 q 1290 893 1290 933 z "},"":{"ha":1091,"x_min":2,"x_max":1091,"o":"m 382 1007 q 389 1014 382 1007 q 397 1042 397 1022 q 382 1077 397 1062 q 347 1091 367 1091 q 312 1077 327 1091 q 298 1042 298 1062 q 312 1007 298 1022 q 347 992 327 992 q 382 1007 367 992 m 1091 1066 l 1091 818 q 1082 799 1091 806 q 1066 794 1076 794 q 1061 794 1063 794 l 714 869 q 700 877 705 870 q 694 893 694 884 l 496 893 l 496 814 q 638 728 582 796 q 694 570 694 660 l 694 -50 q 680 -84 694 -70 q 645 -99 665 -99 l 248 -99 q 213 -84 228 -99 q 198 -50 198 -70 l 198 570 q 247 718 198 653 q 372 807 295 784 l 372 893 l 347 893 q 258 875 301 893 q 187 834 215 856 q 136 782 160 811 q 105 741 112 753 q 94 722 97 728 q 50 694 81 694 q 27 700 37 694 q 3 729 9 709 q 5 767 -4 748 q 17 787 9 774 q 46 828 24 799 q 93 882 67 857 q 158 934 118 908 q 243 975 199 961 q 223 1042 223 1008 q 260 1129 223 1093 q 347 1166 296 1166 q 435 1129 398 1166 q 471 1042 471 1093 q 460 992 471 1016 l 694 992 q 700 1008 694 1001 q 714 1016 705 1015 l 1061 1090 q 1066 1091 1063 1091 q 1082 1086 1076 1091 q 1091 1066 1091 1079 z "},"":{"ha":1290,"x_min":28,"x_max":1290,"o":"m 1094 791 q 1105 801 1094 791 q 1116 843 1116 812 q 1094 896 1116 874 q 1042 918 1073 918 q 989 896 1011 918 q 967 843 967 874 q 989 791 967 812 q 1042 769 1011 769 q 1094 791 1073 769 m 1290 1066 q 1231 733 1290 873 q 1035 453 1173 592 q 884 317 972 391 l 868 23 q 856 3 867 11 l 558 -171 q 546 -174 553 -174 q 528 -167 536 -174 l 478 -117 q 472 -92 468 -106 l 538 122 l 320 339 l 106 274 q 99 273 104 273 q 81 280 88 273 l 32 329 q 28 360 19 344 l 202 657 q 222 670 209 668 l 515 685 q 652 836 590 773 q 929 1036 798 981 q 1263 1091 1061 1091 q 1282 1084 1274 1091 q 1290 1066 1290 1077 z "},"":{"ha":1389,"x_min":0,"x_max":1352,"o":"m 1352 591 l 1225 0 l 966 0 l 1104 645 q 1093 713 1115 688 q 1028 739 1072 739 l 898 739 l 739 0 l 481 0 l 639 739 l 417 739 l 259 0 l 0 0 l 158 739 l 40 992 l 1028 992 q 1175 961 1107 992 q 1290 873 1244 929 q 1352 742 1336 816 q 1352 591 1369 668 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 705 109 l 784 188 q 798 223 798 203 q 784 258 798 243 l 546 496 l 784 734 q 798 769 798 749 q 784 804 798 789 l 705 883 q 670 898 690 898 q 635 883 649 898 l 283 531 q 268 496 268 516 q 283 461 268 476 l 635 109 q 670 95 649 95 q 705 109 690 95 m 1111 795 q 1151 726 1111 795 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 556 109 l 908 461 q 922 496 922 476 q 908 531 922 516 l 556 883 q 521 898 541 898 q 486 883 501 898 l 407 804 q 392 769 392 789 q 407 734 392 749 l 645 496 l 407 258 q 392 223 392 243 q 407 188 392 203 l 486 109 q 521 95 501 95 q 556 109 541 95 m 1111 795 q 1151 726 1111 795 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 903 308 l 982 387 q 997 422 997 401 q 982 457 997 442 l 630 808 q 595 823 615 823 q 560 808 575 823 l 208 457 q 194 422 194 442 q 208 387 194 401 l 288 308 q 322 293 302 293 q 357 308 343 293 l 595 546 l 833 308 q 868 293 848 293 q 903 308 888 293 m 1111 795 q 1151 726 1111 795 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 630 184 l 982 536 q 997 570 997 550 q 982 605 997 591 l 903 684 q 868 699 888 699 q 833 684 848 699 l 595 446 l 357 684 q 322 699 343 699 q 288 684 302 699 l 208 605 q 194 570 194 591 q 208 536 194 550 l 560 184 q 595 169 575 169 q 630 184 615 169 m 1111 795 q 1151 726 1111 795 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 z "},"":{"ha":1091,"x_min":0,"x_max":1091,"o":"m 876 728 l 888 863 l 203 863 l 239 450 l 714 450 l 697 273 l 544 232 l 392 273 l 382 381 l 246 381 l 264 166 l 544 88 l 547 88 l 547 89 l 825 166 l 864 587 l 365 587 l 353 728 l 876 728 m 0 1091 l 1091 1091 l 992 -23 l 544 -149 l 99 -23 l 0 1091 z "},"":{"ha":1389,"x_min":9,"x_max":1380,"o":"m 213 1091 l 1380 1091 l 1173 58 l 550 -149 l 9 58 l 64 334 l 295 334 l 272 220 l 599 95 l 976 220 l 1028 483 l 92 483 l 137 713 l 1074 713 l 1104 861 l 167 861 l 213 1091 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 729 957 q 737 965 729 957 q 744 992 744 972 q 729 1027 744 1012 q 694 1042 715 1042 q 660 1027 674 1042 q 645 992 645 1012 q 660 957 645 972 q 694 942 674 942 q 729 957 715 942 m 1389 273 l 1389 0 q 1373 -23 1389 -17 q 1364 -25 1367 -25 q 1346 -18 1355 -25 l 1274 54 q 1027 -121 1182 -57 q 694 -186 873 -186 q 362 -121 516 -186 q 115 54 207 -57 l 43 -18 q 25 -25 36 -25 q 16 -23 22 -25 q 0 0 0 -17 l 0 273 q 7 291 0 284 q 25 298 14 298 l 298 298 q 321 282 315 298 q 315 255 327 267 l 238 177 q 385 59 290 107 q 595 -5 480 10 l 595 496 l 446 496 q 412 511 426 496 q 397 546 397 525 l 397 645 q 412 680 397 665 q 446 694 426 694 l 595 694 l 595 821 q 523 892 550 847 q 496 992 496 938 q 554 1132 496 1074 q 694 1190 612 1190 q 835 1132 777 1190 q 893 992 893 1074 q 866 892 893 938 q 794 821 839 847 l 794 694 l 942 694 q 977 680 963 694 q 992 645 992 665 l 992 546 q 977 511 992 525 q 942 496 963 496 l 794 496 l 794 -5 q 1004 59 909 10 q 1151 177 1099 107 l 1073 255 q 1068 282 1062 267 q 1091 298 1074 298 l 1364 298 q 1382 291 1375 298 q 1389 273 1389 284 z "},"":{"ha":893,"x_min":0,"x_max":893,"o":"m 818 595 q 871 574 849 595 q 893 521 893 552 l 893 74 q 871 22 893 43 q 818 0 849 0 l 74 0 q 22 22 43 0 q 0 74 0 43 l 0 521 q 22 574 0 552 q 74 595 43 595 l 99 595 l 99 843 q 201 1089 99 987 q 446 1190 303 1190 q 692 1089 590 1190 q 794 843 794 987 q 779 808 794 823 q 744 794 764 794 l 694 794 q 660 808 674 794 q 645 843 645 823 q 587 984 645 925 q 446 1042 529 1042 q 306 984 364 1042 q 248 843 248 925 l 248 595 l 818 595 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 736 636 q 765 607 736 636 q 794 496 794 578 q 736 356 794 414 q 595 298 677 298 q 455 356 513 298 q 397 496 397 414 q 455 636 397 578 q 595 694 513 694 q 736 636 677 694 m 806 286 q 849 329 806 286 q 893 496 893 373 q 806 706 893 619 q 595 794 718 794 q 385 706 472 794 q 298 496 298 619 q 385 286 298 373 q 595 198 472 198 q 806 286 718 198 m 876 777 q 934 718 876 777 q 992 496 992 660 q 876 215 992 332 q 595 99 760 99 q 315 215 431 99 q 198 496 198 332 q 315 777 198 660 q 595 893 431 893 q 876 777 760 893 m 1052 303 q 1072 349 1052 303 q 1091 496 1091 395 q 1052 689 1091 597 q 946 847 1012 780 q 788 953 880 913 q 595 992 696 992 q 403 953 494 992 q 245 847 311 913 q 139 689 178 780 q 99 496 99 597 q 139 303 99 395 q 245 145 178 212 q 403 40 311 79 q 595 0 494 0 q 788 40 696 0 q 946 145 880 79 q 1052 303 1012 212 m 1111 795 q 1151 726 1111 795 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 z "},"":{"ha":1091,"x_min":0,"x_max":1091,"o":"m 298 620 l 298 471 q 276 419 298 440 q 223 397 254 397 l 74 397 q 22 419 43 397 q 0 471 0 440 l 0 620 q 22 673 0 651 q 74 694 43 694 l 223 694 q 276 673 254 694 q 298 620 298 651 m 694 620 l 694 471 q 673 419 694 440 q 620 397 651 397 l 471 397 q 419 419 440 397 q 397 471 397 440 l 397 620 q 419 673 397 651 q 471 694 440 694 l 620 694 q 673 673 651 694 q 694 620 694 651 m 1091 620 l 1091 471 q 1070 419 1091 440 q 1017 397 1048 397 l 868 397 q 815 419 837 397 q 794 471 794 440 l 794 620 q 815 673 794 651 q 868 694 837 694 l 1017 694 q 1070 673 1048 694 q 1091 620 1091 651 z "},"":{"ha":298,"x_min":0,"x_max":298,"o":"m 298 223 l 298 74 q 276 22 298 43 q 223 0 254 0 l 74 0 q 22 22 43 0 q 0 74 0 43 l 0 223 q 22 276 0 254 q 74 298 43 298 l 223 298 q 276 276 254 298 q 298 223 298 254 m 298 620 l 298 471 q 276 419 298 440 q 223 397 254 397 l 74 397 q 22 419 43 397 q 0 471 0 440 l 0 620 q 22 673 0 651 q 74 694 43 694 l 223 694 q 276 673 254 694 q 298 620 298 651 m 298 1017 l 298 868 q 276 815 298 837 q 223 794 254 794 l 74 794 q 22 815 43 794 q 0 868 0 837 l 0 1017 q 22 1070 0 1048 q 74 1091 43 1091 l 223 1091 q 276 1070 254 1091 q 298 1017 298 1048 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 368 128 q 382 143 368 128 q 397 198 397 157 q 368 269 397 239 q 298 298 339 298 q 227 269 257 298 q 198 198 198 239 q 227 128 198 157 q 298 99 257 99 q 368 128 339 99 m 669 126 q 532 433 659 306 q 225 570 405 560 q 206 563 214 570 q 198 545 198 555 l 198 446 q 205 429 198 436 q 222 421 212 422 q 426 327 341 412 q 520 122 512 242 q 528 106 521 112 q 545 99 535 99 l 644 99 q 662 107 654 99 q 669 126 670 115 m 966 125 q 923 355 963 244 q 815 557 884 467 q 656 716 746 647 q 455 824 566 784 q 224 867 343 863 q 206 860 213 868 q 198 842 198 853 l 198 743 q 205 726 198 733 q 222 718 212 719 q 515 632 381 713 q 731 416 650 551 q 818 123 812 281 q 825 106 818 113 q 842 99 832 99 l 942 99 q 960 107 952 99 q 966 125 968 114 m 1190 868 l 1190 124 q 1125 -34 1190 32 q 967 -99 1059 -99 l 223 -99 q 65 -34 131 -99 q 0 124 0 32 l 0 868 q 65 1026 0 960 q 223 1091 131 1091 l 967 1091 q 1125 1026 1059 1091 q 1190 868 1190 960 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 296 1011 q 365 1051 296 1011 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 m 893 453 q 918 496 918 467 q 893 539 918 525 l 471 787 q 422 787 447 801 q 397 744 397 773 l 397 248 q 422 205 397 219 q 446 198 434 198 q 471 205 460 198 l 893 453 z "},"":{"ha":1389,"x_min":42,"x_max":1348,"o":"m 794 840 l 1039 595 l 595 152 l 350 397 l 794 840 m 630 81 l 1109 560 q 1124 595 1124 575 q 1109 630 1124 615 l 829 911 q 794 925 815 925 q 759 911 773 925 l 280 432 q 265 397 265 417 q 280 362 265 377 l 560 81 q 595 67 574 67 q 630 81 616 67 m 1319 575 l 616 -129 q 546 -157 587 -157 q 476 -129 505 -157 l 378 -31 q 422 74 422 12 q 378 180 422 136 q 273 223 335 223 q 167 180 211 223 l 71 277 q 42 348 42 306 q 71 418 42 389 l 773 1120 q 844 1149 802 1149 q 914 1120 885 1149 l 1011 1023 q 967 918 967 980 q 1011 812 967 856 q 1116 769 1054 769 q 1221 812 1178 769 l 1319 715 q 1348 645 1348 687 q 1319 575 1348 604 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 992 446 l 992 546 q 977 581 992 566 q 942 595 963 595 l 248 595 q 213 581 228 595 q 198 546 198 566 l 198 446 q 213 412 198 426 q 248 397 228 397 l 942 397 q 977 412 963 397 q 992 446 992 426 m 1190 868 l 1190 124 q 1125 -34 1190 32 q 967 -99 1059 -99 l 223 -99 q 65 -34 131 -99 q 0 124 0 32 l 0 868 q 65 1026 0 960 q 223 1091 131 1091 l 967 1091 q 1125 1026 1059 1091 q 1190 868 1190 960 z "},"":{"ha":1091,"x_min":0,"x_max":1091,"o":"m 893 570 l 893 521 q 886 503 893 510 q 868 496 879 496 l 223 496 q 205 503 212 496 q 198 521 198 510 l 198 570 q 205 588 198 581 q 223 595 212 595 l 868 595 q 886 588 879 595 q 893 570 893 581 m 992 223 l 992 868 q 956 956 992 919 q 868 992 919 992 l 223 992 q 136 956 172 992 q 99 868 99 919 l 99 223 q 136 136 99 172 q 223 99 172 99 l 868 99 q 956 136 919 99 q 992 223 992 172 m 1091 868 l 1091 223 q 1026 65 1091 131 q 868 0 960 0 l 223 0 q 65 65 131 0 q 0 223 0 131 l 0 868 q 65 1026 0 960 q 223 1091 131 1091 l 868 1091 q 1026 1026 960 1091 q 1091 868 1091 960 z "},"":{"ha":794,"x_min":2,"x_max":789,"o":"m 789 723 q 744 694 775 694 l 595 694 l 595 25 q 588 7 595 14 q 570 0 581 0 l 25 0 q 2 14 9 0 q 5 41 -4 29 l 129 190 q 149 198 136 198 l 397 198 l 397 694 l 248 694 q 203 723 217 694 q 210 776 190 752 l 458 1073 q 496 1090 472 1090 q 534 1073 520 1090 l 782 776 q 789 723 803 751 z "},"":{"ha":794,"x_min":2,"x_max":789,"o":"m 25 992 l 570 992 q 588 985 581 992 q 595 966 595 977 l 595 298 l 744 298 q 789 269 775 298 q 782 215 803 240 l 534 -82 q 496 -99 520 -99 q 458 -82 472 -99 l 210 215 q 203 269 190 239 q 248 298 217 298 l 397 298 l 397 794 l 149 794 q 129 802 138 794 l 5 951 q 2 977 -5 962 q 25 992 9 992 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 531 184 l 1007 660 q 1022 694 1022 674 q 1007 729 1022 715 l 928 808 q 893 823 913 823 q 858 808 873 823 l 496 446 l 332 610 q 298 625 318 625 q 263 610 277 625 l 184 531 q 169 496 169 516 q 184 461 169 476 l 461 184 q 496 169 476 169 q 531 184 516 169 m 1190 868 l 1190 124 q 1125 -34 1190 32 q 967 -99 1059 -99 l 223 -99 q 65 -34 131 -99 q 0 124 0 32 l 0 868 q 65 1026 0 960 q 223 1091 131 1091 l 967 1091 q 1125 1026 1059 1091 q 1190 868 1190 960 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 313 332 l 431 214 l 391 174 l 347 174 l 347 248 l 273 248 l 273 291 l 313 332 m 634 634 q 632 611 645 624 l 406 385 q 383 383 393 372 q 385 406 372 393 l 611 632 q 634 634 624 645 m 422 99 l 843 521 l 620 744 l 198 322 l 198 99 l 422 99 m 893 570 l 964 642 q 986 694 986 663 q 964 747 986 725 l 846 865 q 794 887 825 887 q 741 865 763 887 l 670 794 l 893 570 m 1190 868 l 1190 124 q 1125 -34 1190 32 q 967 -99 1059 -99 l 223 -99 q 65 -34 131 -99 q 0 124 0 32 l 0 868 q 65 1026 0 960 q 223 1091 131 1091 l 967 1091 q 1125 1026 1059 1091 q 1190 868 1190 960 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 992 471 l 992 843 q 977 878 992 863 q 942 893 963 893 l 570 893 q 525 863 538 893 q 536 808 512 831 l 647 697 l 233 283 q 219 248 219 268 q 233 213 219 228 l 312 134 q 347 119 327 119 q 382 134 367 119 l 796 548 l 908 436 q 942 422 922 422 q 962 426 952 422 q 992 471 992 439 m 1190 868 l 1190 124 q 1125 -34 1190 32 q 967 -99 1059 -99 l 223 -99 q 65 -34 131 -99 q 0 124 0 32 l 0 868 q 65 1026 0 960 q 223 1091 131 1091 l 967 1091 q 1125 1026 1059 1091 q 1190 868 1190 960 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 779 337 l 1052 610 q 1066 645 1066 625 q 1052 680 1066 665 l 779 953 q 725 963 756 977 q 694 918 694 950 l 694 794 q 527 779 602 794 q 401 739 452 763 q 313 678 350 715 q 253 604 275 641 q 219 519 232 567 q 202 433 206 472 q 198 347 198 394 q 328 34 198 207 q 347 25 336 25 q 357 27 353 25 q 372 53 374 34 q 420 419 338 327 q 521 478 456 460 q 694 496 586 496 l 694 372 q 725 326 694 339 q 744 322 735 322 q 779 337 764 322 m 1190 868 l 1190 124 q 1125 -34 1190 32 q 967 -99 1059 -99 l 223 -99 q 65 -34 131 -99 q 0 124 0 32 l 0 868 q 65 1026 0 960 q 223 1091 131 1091 l 967 1091 q 1125 1026 1059 1091 q 1190 868 1190 960 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 496 347 l 694 446 l 496 546 l 496 347 m 794 805 l 794 385 l 397 187 l 397 607 l 794 805 m 960 284 q 989 333 960 284 q 1017 496 1017 381 q 960 708 1017 611 q 807 861 904 805 q 595 918 710 918 q 384 861 481 918 q 230 708 287 805 q 174 496 174 611 q 230 284 174 381 q 384 131 287 188 q 595 74 481 74 q 807 131 710 74 q 960 284 904 188 m 1111 795 q 1151 726 1111 795 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 887 667 q 884 616 901 640 l 636 269 q 595 248 621 248 q 555 269 570 248 l 307 616 q 303 667 289 640 q 347 694 316 694 l 843 694 q 887 667 874 694 m 992 124 l 992 868 q 985 885 992 878 q 967 893 977 893 l 223 893 q 206 885 213 893 q 198 868 198 878 l 198 124 q 206 107 198 114 q 223 99 213 99 l 967 99 q 985 107 977 99 q 992 124 992 114 m 1190 868 l 1190 124 q 1125 -34 1190 32 q 967 -99 1059 -99 l 223 -99 q 65 -34 131 -99 q 0 124 0 32 l 0 868 q 65 1026 0 960 q 223 1091 131 1091 l 967 1091 q 1125 1026 1059 1091 q 1190 868 1190 960 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 887 325 q 843 298 874 298 l 347 298 q 303 325 316 298 q 307 376 289 352 l 555 723 q 595 744 570 744 q 636 723 621 744 l 884 376 q 887 325 901 352 m 992 124 l 992 868 q 985 885 992 878 q 967 893 977 893 l 223 893 q 206 885 213 893 q 198 868 198 878 l 198 124 q 206 107 198 114 q 223 99 213 99 l 967 99 q 985 107 977 99 q 992 124 992 114 m 1190 868 l 1190 124 q 1125 -34 1190 32 q 967 -99 1059 -99 l 223 -99 q 65 -34 131 -99 q 0 124 0 32 l 0 868 q 65 1026 0 960 q 223 1091 131 1091 l 967 1091 q 1125 1026 1059 1091 q 1190 868 1190 960 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 822 536 q 843 496 843 522 q 822 456 843 470 l 475 208 q 424 204 451 190 q 397 248 397 217 l 397 744 q 424 788 397 775 q 475 784 451 802 l 822 536 m 992 124 l 992 868 q 985 886 992 879 q 967 893 978 893 l 223 893 q 205 886 212 893 q 198 868 198 879 l 198 124 q 205 106 198 113 q 223 99 212 99 l 967 99 q 985 106 978 99 q 992 124 992 113 m 1190 868 l 1190 124 q 1125 -34 1190 32 q 967 -99 1059 -99 l 223 -99 q 65 -34 131 -99 q 0 124 0 32 l 0 868 q 65 1026 0 960 q 223 1091 131 1091 l 967 1091 q 1125 1026 1059 1091 q 1190 868 1190 960 z "},"":{"ha":794,"x_min":0,"x_max":784,"o":"m 756 177 l 784 54 q 781 37 786 45 q 768 26 777 29 l 764 25 q 756 22 761 23 q 744 19 751 21 q 727 14 736 16 q 707 10 718 12 q 684 7 697 9 q 658 3 671 5 q 630 1 645 2 q 600 0 615 0 q 283 101 419 0 q 98 374 147 202 l 25 374 q 7 381 15 374 q 0 398 0 388 l 0 486 q 7 503 0 496 q 25 511 15 511 l 76 511 q 77 592 74 555 l 25 592 q 7 599 14 592 q 0 617 0 606 l 0 705 q 7 723 0 716 q 25 730 14 730 l 101 730 q 289 992 153 893 q 600 1091 426 1091 q 750 1073 679 1091 q 766 1062 759 1071 q 768 1043 770 1053 l 735 920 q 724 905 732 910 q 705 903 715 900 l 702 904 q 693 906 699 904 q 680 908 687 907 q 662 911 672 910 q 642 913 653 912 q 620 915 632 915 q 597 916 608 916 q 422 867 499 916 q 305 730 344 817 l 668 730 q 687 721 680 730 q 693 701 695 711 l 674 612 q 649 592 670 592 l 271 592 q 271 511 269 563 l 627 511 q 646 501 639 511 q 651 481 653 492 l 632 394 q 624 379 631 385 q 608 374 617 374 l 308 374 q 424 230 346 283 q 601 177 503 177 q 629 178 615 177 q 655 181 643 179 q 678 184 667 182 q 697 188 689 186 q 711 191 705 190 q 721 194 718 193 l 725 195 q 745 194 735 199 q 756 177 754 188 z "},"":{"ha":794,"x_min":0,"x_max":791,"o":"m 791 309 l 791 25 q 784 7 791 14 q 766 0 777 0 l 25 0 q 7 7 14 0 q 0 25 0 14 l 0 141 q 7 158 0 151 q 25 166 15 166 l 100 166 l 100 463 l 26 463 q 9 470 16 463 q 2 488 2 477 l 2 589 q 9 607 2 600 q 26 614 16 614 l 100 614 l 100 787 q 196 1005 100 919 q 439 1091 291 1091 q 699 994 583 1091 q 707 979 706 988 q 701 961 708 969 l 622 863 q 605 853 615 854 q 587 859 594 852 q 567 873 583 863 q 513 898 550 884 q 441 912 476 912 q 335 876 375 912 q 295 780 295 839 l 295 614 l 531 614 q 548 607 541 614 q 556 589 556 600 l 556 488 q 548 470 556 477 q 531 463 541 463 l 295 463 l 295 169 l 615 169 l 615 309 q 622 327 615 319 q 640 334 629 334 l 766 334 q 784 327 777 334 q 791 309 791 319 z "},"":{"ha":794,"x_min":40,"x_max":758,"o":"m 758 272 q 681 68 758 153 q 481 -38 604 -18 l 481 -174 q 474 -191 481 -184 q 456 -198 467 -198 l 351 -198 q 334 -191 341 -198 q 326 -174 326 -184 l 326 -38 q 227 -14 275 -31 q 149 21 180 3 q 91 58 118 38 q 55 87 65 78 q 42 101 46 96 q 40 133 29 117 l 120 237 q 138 246 126 245 q 157 239 150 248 q 158 238 157 239 q 346 141 246 161 q 404 135 375 135 q 514 168 467 135 q 562 263 562 202 q 550 304 562 284 q 524 336 539 323 q 479 365 510 350 q 428 390 448 381 q 366 415 408 399 q 318 435 336 428 q 270 455 301 442 q 222 479 240 469 q 178 507 204 490 q 137 540 153 524 q 103 578 121 556 q 76 623 85 600 q 59 674 66 646 q 53 735 53 703 q 129 922 53 842 q 326 1026 205 1003 l 326 1166 q 334 1183 326 1176 q 351 1190 341 1190 l 456 1190 q 474 1184 467 1190 q 481 1166 481 1177 l 481 1029 q 566 1011 525 1025 q 634 985 608 998 q 683 956 660 973 q 713 934 706 940 q 725 923 720 928 q 729 894 738 909 l 666 780 q 648 768 660 769 q 627 773 637 766 q 616 783 625 776 q 586 803 607 790 q 540 828 564 817 q 482 848 516 839 q 416 857 449 857 q 296 824 343 857 q 250 738 250 791 q 256 701 250 718 q 279 668 263 684 q 310 643 295 653 q 353 619 324 632 q 400 598 382 605 q 454 577 418 591 q 517 552 495 561 q 576 525 539 543 q 634 492 613 507 q 682 453 656 477 q 724 404 709 429 q 748 345 738 379 q 758 272 758 311 z "},"":{"ha":696,"x_min":0,"x_max":696,"o":"m 696 826 l 696 747 q 689 729 696 736 q 671 722 682 722 l 541 722 q 441 541 523 611 q 227 456 359 471 q 583 40 357 318 q 586 14 594 28 q 563 0 580 0 l 412 0 q 393 9 400 0 q 7 452 156 294 q 0 469 0 459 l 0 567 q 7 585 0 577 q 25 592 15 592 l 112 592 q 276 625 214 592 q 356 722 339 659 l 25 722 q 7 729 14 722 q 0 747 0 736 l 0 826 q 7 844 0 837 q 25 851 14 851 l 345 851 q 137 939 301 939 l 25 939 q 7 946 15 939 q 0 963 0 953 l 0 1066 q 7 1084 0 1077 q 25 1091 14 1091 l 670 1091 q 687 1084 680 1091 q 694 1066 694 1077 l 694 987 q 687 970 694 977 q 670 963 680 963 l 489 963 q 539 851 525 915 l 671 851 q 689 844 682 851 q 696 826 696 837 z "},"":{"ha":796,"x_min":3,"x_max":793,"o":"m 467 0 l 334 0 q 317 7 324 0 q 309 25 309 14 l 309 281 l 86 281 q 69 288 76 281 q 61 305 61 295 l 61 385 q 69 403 61 395 q 86 410 76 410 l 309 410 l 309 476 l 86 476 q 69 483 76 476 q 61 501 61 490 l 61 581 q 69 599 61 591 q 86 606 76 606 l 252 606 l 3 1054 q 3 1079 -3 1066 q 25 1091 11 1091 l 175 1091 q 198 1077 190 1091 l 364 748 q 408 651 379 718 q 431 704 415 670 q 453 751 447 738 l 601 1077 q 623 1091 607 1091 l 771 1091 q 792 1079 784 1091 q 793 1055 799 1068 l 550 606 l 717 606 q 734 599 727 606 q 742 581 742 591 l 742 501 q 734 483 742 490 q 717 476 727 476 l 492 476 l 492 410 l 717 410 q 734 403 727 410 q 742 385 742 395 l 742 305 q 734 288 742 295 q 717 281 727 281 l 492 281 l 492 25 q 485 7 492 15 q 467 0 477 0 z "},"":{"ha":992,"x_min":0,"x_max":992,"o":"m 758 627 q 783 651 758 627 q 808 753 808 675 q 758 878 808 830 q 625 926 708 926 l 377 926 l 377 579 l 625 579 q 758 627 708 579 m 894 997 q 943 949 894 997 q 992 753 992 902 q 894 508 992 603 q 641 414 796 414 l 377 414 l 377 322 l 769 322 q 787 315 780 322 q 794 298 794 308 l 794 198 q 787 181 794 188 q 769 174 780 174 l 377 174 l 377 25 q 370 7 377 14 q 353 0 363 0 l 223 0 q 205 7 212 0 q 198 25 198 14 l 198 174 l 25 174 q 7 181 14 174 q 0 198 0 188 l 0 298 q 7 315 0 308 q 25 322 14 322 l 198 322 l 198 414 l 25 414 q 7 421 14 414 q 0 439 0 428 l 0 554 q 7 572 0 564 q 25 579 14 579 l 198 579 l 198 1066 q 205 1084 198 1077 q 223 1091 212 1091 l 641 1091 q 894 997 796 1091 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 398 264 l 461 496 l 338 496 l 396 264 q 397 261 397 263 q 398 259 397 260 q 398 262 398 260 q 398 264 398 264 m 488 595 l 515 694 l 289 694 l 314 595 l 488 595 m 637 595 l 745 595 l 718 694 l 663 694 l 637 595 m 985 264 l 1046 496 l 920 496 l 983 264 q 983 262 983 264 q 984 259 984 260 q 985 261 984 260 q 985 264 985 263 m 1071 595 l 1097 694 l 867 694 l 893 595 l 1071 595 m 1389 570 l 1389 521 q 1382 503 1389 510 q 1364 496 1375 496 l 1199 496 l 1072 19 q 1048 0 1066 0 l 925 0 q 901 19 906 0 l 772 496 l 610 496 l 481 19 q 457 0 475 0 l 333 0 q 318 5 325 0 q 310 19 312 11 l 186 496 l 25 496 q 7 503 14 496 q 0 521 0 510 l 0 570 q 7 588 0 581 q 25 595 14 595 l 160 595 l 135 694 l 25 694 q 7 701 14 694 q 0 719 0 708 l 0 769 q 7 787 0 780 q 25 794 14 794 l 109 794 l 40 1060 q 44 1082 36 1072 q 64 1091 52 1091 l 171 1091 q 195 1073 191 1091 l 264 794 l 543 794 l 618 1073 q 642 1091 623 1091 l 739 1091 q 763 1073 758 1091 l 839 794 l 1122 794 l 1194 1073 q 1218 1091 1198 1091 l 1325 1091 q 1345 1082 1337 1091 q 1349 1060 1352 1072 l 1278 794 l 1364 794 q 1382 787 1375 794 q 1389 769 1389 780 l 1389 719 q 1382 701 1389 708 q 1364 694 1375 694 l 1252 694 l 1225 595 l 1364 595 q 1382 588 1375 595 q 1389 570 1389 581 z "},"":{"ha":992,"x_min":43,"x_max":973,"o":"m 904 694 q 803 494 918 553 q 939 415 894 473 q 973 249 984 357 q 948 152 968 194 q 898 83 929 110 q 823 38 868 56 q 729 11 778 19 q 616 -1 680 2 l 616 -198 l 497 -198 l 497 -4 q 402 -3 435 -4 l 402 -198 l 283 -198 l 283 -1 q 241 0 269 -1 q 198 0 213 0 l 43 0 l 67 142 l 153 142 q 198 181 192 142 l 198 493 l 211 493 q 198 494 206 494 l 198 716 q 129 769 188 769 l 43 769 l 43 896 l 208 895 q 283 896 257 895 l 283 1091 l 402 1091 l 402 900 q 497 901 466 901 l 497 1091 l 616 1091 l 616 896 q 725 879 677 891 q 812 844 772 867 q 876 783 853 821 q 904 694 900 746 m 738 272 q 726 322 738 300 q 698 357 715 343 q 653 381 680 371 q 602 395 625 391 q 545 402 579 400 q 491 405 511 405 q 441 404 472 405 q 405 403 411 403 l 405 141 q 433 141 411 141 q 470 140 456 140 q 512 141 485 140 q 557 145 538 143 q 601 151 576 146 q 644 162 626 156 q 681 178 662 168 q 711 202 700 188 q 730 233 723 215 q 738 272 738 250 m 683 641 q 673 686 683 667 q 649 719 663 706 q 612 741 636 732 q 570 753 589 749 q 522 760 550 757 q 477 761 494 762 q 435 761 460 761 q 405 760 410 760 l 405 522 q 431 522 408 522 q 467 522 454 522 q 506 524 481 522 q 549 528 532 525 q 589 536 566 531 q 626 551 612 542 q 655 572 641 560 q 676 601 669 584 q 683 641 683 619 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 794 794 l 794 1159 q 822 1138 811 1149 l 1138 822 q 1159 794 1149 811 l 794 794 m 694 769 q 716 716 694 738 q 769 694 738 694 l 1190 694 l 1190 -124 q 1169 -177 1190 -155 q 1116 -198 1147 -198 l 74 -198 q 22 -177 43 -198 q 0 -124 0 -155 l 0 1116 q 22 1169 0 1147 q 74 1190 43 1190 l 694 1190 l 694 769 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 1138 822 q 1159 794 1149 811 l 794 794 l 794 1159 q 822 1138 811 1149 l 1138 822 m 769 694 l 1190 694 l 1190 -124 q 1169 -177 1190 -155 q 1116 -198 1147 -198 l 74 -198 q 22 -177 43 -198 q 0 -124 0 -155 l 0 1116 q 22 1169 0 1147 q 74 1190 43 1190 l 694 1190 l 694 769 q 716 716 694 738 q 769 694 738 694 m 893 124 l 893 174 q 886 191 893 184 q 868 198 879 198 l 322 198 q 305 191 312 198 q 298 174 298 184 l 298 124 q 305 106 298 113 q 322 99 312 99 l 868 99 q 886 106 879 99 q 893 124 893 113 m 893 322 l 893 372 q 886 390 893 383 q 868 397 879 397 l 322 397 q 305 390 312 397 q 298 372 298 383 l 298 322 q 305 305 298 312 q 322 298 312 298 l 868 298 q 886 305 879 298 q 893 322 893 312 m 893 521 l 893 570 q 886 588 893 581 q 868 595 879 595 l 322 595 q 305 588 312 595 q 298 570 298 581 l 298 521 q 305 503 298 510 q 322 496 312 496 l 868 496 q 886 503 879 496 q 893 521 893 510 z "},"":{"ha":1290,"x_min":26,"x_max":1287,"o":"m 923 874 l 1060 874 l 1004 1043 l 995 1080 q 994 1095 994 1092 l 991 1095 l 988 1080 q 985 1066 988 1079 q 980 1043 983 1053 l 923 874 m 570 74 q 563 56 570 65 l 315 -191 q 298 -198 308 -198 q 280 -191 288 -198 l 32 57 q 26 84 20 69 q 50 99 33 99 l 198 99 l 198 1166 q 205 1184 198 1177 q 223 1190 212 1190 l 372 1190 q 390 1184 383 1190 q 397 1166 397 1177 l 397 99 l 546 99 q 563 92 556 99 q 570 74 570 85 m 1218 -18 l 1218 -198 l 766 -198 l 766 -129 l 1052 281 q 1068 302 1061 295 l 1077 309 l 1077 312 q 1072 311 1075 312 q 1066 311 1068 311 q 1042 308 1056 308 l 863 308 l 863 219 l 770 219 l 770 397 l 1209 397 l 1209 328 l 923 -83 q 907 -103 918 -89 l 898 -112 l 898 -113 l 909 -112 q 932 -110 916 -110 l 1125 -110 l 1125 -18 l 1218 -18 m 1287 677 l 1287 595 l 1064 595 l 1064 677 l 1122 677 l 1086 789 l 898 789 l 861 677 l 919 677 l 919 595 l 697 595 l 697 677 l 751 677 l 929 1190 l 1055 1190 l 1233 677 l 1287 677 z "},"":{"ha":1290,"x_min":26,"x_max":1287,"o":"m 923 81 l 1060 81 l 1004 250 l 995 286 q 994 301 994 298 l 991 301 l 988 286 q 985 272 988 285 q 980 250 983 259 l 923 81 m 570 74 q 563 56 570 65 l 315 -191 q 298 -198 308 -198 q 280 -191 288 -198 l 32 57 q 26 84 20 69 q 50 99 33 99 l 198 99 l 198 1166 q 205 1184 198 1177 q 223 1190 212 1190 l 372 1190 q 390 1184 383 1190 q 397 1166 397 1177 l 397 99 l 546 99 q 563 92 556 99 q 570 74 570 85 m 1287 -116 l 1287 -198 l 1064 -198 l 1064 -116 l 1122 -116 l 1086 -5 l 898 -5 l 861 -116 l 919 -116 l 919 -198 l 697 -198 l 697 -116 l 751 -116 l 929 397 l 1055 397 l 1233 -116 l 1287 -116 m 1218 776 l 1218 595 l 766 595 l 766 665 l 1052 1075 q 1068 1096 1061 1089 l 1077 1103 l 1077 1105 q 1072 1105 1075 1105 q 1066 1104 1068 1104 q 1042 1102 1056 1102 l 863 1102 l 863 1013 l 770 1013 l 770 1190 l 1209 1190 l 1209 1121 l 923 711 q 907 691 918 705 l 898 683 l 898 680 l 909 683 q 932 684 916 684 l 1125 684 l 1125 776 l 1218 776 z "},"":{"ha":1389,"x_min":26,"x_max":1389,"o":"m 570 74 q 563 56 570 65 l 315 -191 q 298 -198 308 -198 q 280 -191 288 -198 l 32 57 q 26 84 20 69 q 50 99 33 99 l 198 99 l 198 1166 q 205 1184 198 1177 q 223 1190 212 1190 l 372 1190 q 390 1184 383 1190 q 397 1166 397 1177 l 397 99 l 546 99 q 563 92 556 99 q 570 74 570 85 m 1389 -25 l 1389 -174 q 1382 -191 1389 -184 q 1364 -198 1375 -198 l 719 -198 q 701 -191 708 -198 q 694 -174 694 -184 l 694 -25 q 701 -7 694 -14 q 719 0 708 0 l 1364 0 q 1382 -7 1375 0 q 1389 -25 1389 -14 m 1240 372 l 1240 223 q 1233 205 1240 212 q 1215 198 1226 198 l 719 198 q 701 205 708 198 q 694 223 694 212 l 694 372 q 701 390 694 383 q 719 397 708 397 l 1215 397 q 1233 390 1226 397 q 1240 372 1240 383 m 1091 769 l 1091 620 q 1084 602 1091 609 q 1066 595 1077 595 l 719 595 q 701 602 708 595 q 694 620 694 609 l 694 769 q 701 787 694 780 q 719 794 708 794 l 1066 794 q 1084 787 1077 794 q 1091 769 1091 780 m 942 1166 l 942 1017 q 935 999 942 1006 q 918 992 929 992 l 719 992 q 701 999 708 992 q 694 1017 694 1006 l 694 1166 q 701 1184 694 1177 q 719 1190 708 1190 l 918 1190 q 935 1184 929 1190 q 942 1166 942 1177 z "},"":{"ha":1389,"x_min":26,"x_max":1389,"o":"m 942 -25 l 942 -174 q 935 -191 942 -184 q 918 -198 929 -198 l 719 -198 q 701 -191 708 -198 q 694 -174 694 -184 l 694 -25 q 701 -7 694 -14 q 719 0 708 0 l 918 0 q 935 -7 929 0 q 942 -25 942 -14 m 570 74 q 563 56 570 65 l 315 -191 q 298 -198 308 -198 q 280 -191 288 -198 l 32 57 q 26 84 20 69 q 50 99 33 99 l 198 99 l 198 1166 q 205 1184 198 1177 q 223 1190 212 1190 l 372 1190 q 390 1184 383 1190 q 397 1166 397 1177 l 397 99 l 546 99 q 563 92 556 99 q 570 74 570 85 m 1091 372 l 1091 223 q 1084 205 1091 212 q 1066 198 1077 198 l 719 198 q 701 205 708 198 q 694 223 694 212 l 694 372 q 701 390 694 383 q 719 397 708 397 l 1066 397 q 1084 390 1077 397 q 1091 372 1091 383 m 1240 769 l 1240 620 q 1233 602 1240 609 q 1215 595 1226 595 l 719 595 q 701 602 708 595 q 694 620 694 609 l 694 769 q 701 787 694 780 q 719 794 708 794 l 1215 794 q 1233 787 1226 794 q 1240 769 1240 780 m 1389 1166 l 1389 1017 q 1382 999 1389 1006 q 1364 992 1375 992 l 719 992 q 701 999 708 992 q 694 1017 694 1006 l 694 1166 q 701 1184 694 1177 q 719 1190 708 1190 l 1364 1190 q 1382 1184 1375 1190 q 1389 1166 1389 1177 z "},"":{"ha":1190,"x_min":26,"x_max":1152,"o":"m 1043 173 q 1009 263 1043 222 q 929 304 975 304 q 865 275 889 304 q 841 202 841 246 q 869 129 841 158 q 950 99 898 99 q 1016 120 989 99 q 1043 173 1043 141 m 570 74 q 563 56 570 65 l 315 -191 q 298 -198 308 -198 q 280 -191 288 -198 l 32 57 q 26 84 20 69 q 50 99 33 99 l 198 99 l 198 1166 q 205 1184 198 1177 q 223 1190 212 1190 l 372 1190 q 390 1184 383 1190 q 397 1166 397 1177 l 397 99 l 546 99 q 563 92 556 99 q 570 74 570 85 m 1152 128 q 1142 34 1152 80 q 1110 -55 1132 -12 q 1057 -129 1088 -97 q 981 -179 1026 -160 q 882 -198 935 -198 q 798 -186 834 -198 q 766 -174 780 -180 l 796 -87 q 820 -95 808 -92 q 878 -105 849 -105 q 982 -60 943 -105 q 1034 53 1022 -15 l 1032 53 q 985 24 1016 35 q 919 13 953 13 q 785 69 837 13 q 733 202 733 124 q 789 340 733 284 q 929 397 845 397 q 1088 324 1025 397 q 1152 128 1152 250 m 1128 684 l 1128 595 l 765 595 l 765 684 l 894 684 l 894 1018 q 895 1033 894 1024 q 895 1046 895 1042 l 895 1059 l 894 1059 l 888 1049 q 868 1025 882 1039 l 820 980 l 756 1047 l 905 1190 l 1001 1190 l 1001 684 l 1128 684 z "},"":{"ha":1190,"x_min":26,"x_max":1152,"o":"m 1043 966 q 1009 1056 1043 1015 q 929 1097 975 1097 q 865 1069 889 1097 q 841 996 841 1040 q 869 922 841 952 q 950 893 898 893 q 1016 914 989 893 q 1043 966 1043 935 m 570 74 q 563 56 570 65 l 315 -191 q 298 -198 308 -198 q 280 -191 288 -198 l 32 57 q 26 84 20 69 q 50 99 33 99 l 198 99 l 198 1166 q 205 1184 198 1177 q 223 1190 212 1190 l 372 1190 q 390 1184 383 1190 q 397 1166 397 1177 l 397 99 l 546 99 q 563 92 556 99 q 570 74 570 85 m 1128 -110 l 1128 -198 l 765 -198 l 765 -110 l 894 -110 l 894 225 q 895 239 894 230 q 895 253 895 249 l 895 265 l 894 265 l 888 256 q 868 232 882 246 l 820 187 l 756 253 l 905 397 l 1001 397 l 1001 -110 l 1128 -110 m 1152 922 q 1142 827 1152 873 q 1110 739 1132 781 q 1057 665 1088 697 q 981 614 1026 633 q 882 595 935 595 q 798 608 834 595 q 766 619 780 614 l 796 707 q 820 698 808 701 q 878 688 849 688 q 982 734 943 688 q 1034 846 1022 779 l 1032 846 q 985 818 1016 829 q 919 807 953 807 q 785 862 837 807 q 733 996 733 918 q 789 1134 733 1077 q 929 1190 845 1190 q 1088 1117 1025 1190 q 1152 922 1152 1044 z "},"":{"ha":1290,"x_min":0,"x_max":1240,"o":"m 198 149 q 184 184 198 169 q 149 198 169 198 q 114 184 128 198 q 99 149 99 169 q 114 114 99 128 q 149 99 128 99 q 184 114 169 99 q 198 149 198 128 m 322 546 l 322 50 q 308 15 322 29 q 273 0 293 0 l 50 0 q 15 15 29 0 q 0 50 0 29 l 0 546 q 15 581 0 566 q 50 595 29 595 l 273 595 q 308 581 293 595 q 322 546 322 566 m 1240 546 q 1197 430 1240 479 q 1209 371 1209 396 q 1176 265 1211 312 q 1176 174 1189 222 q 1134 102 1164 130 q 1096 -39 1141 15 q 943 -99 1046 -98 l 915 -99 l 856 -99 l 843 -99 q 732 -87 792 -99 q 637 -65 671 -75 q 544 -34 604 -54 q 422 0 449 -1 q 387 15 401 1 q 372 50 372 29 l 372 546 q 386 580 372 566 q 419 596 400 594 q 478 642 438 598 q 556 736 519 686 q 635 829 609 803 q 659 866 649 842 q 672 903 669 889 q 683 950 676 918 q 693 997 688 980 q 708 1038 697 1015 q 734 1077 718 1061 q 769 1091 749 1091 q 833 1083 805 1091 q 879 1063 861 1075 q 910 1032 898 1051 q 929 997 923 1012 q 938 958 935 981 q 942 923 942 935 q 942 893 942 911 q 935 834 942 863 q 920 787 928 805 q 899 744 913 770 q 891 730 897 739 q 883 713 886 721 q 877 694 880 705 l 1091 694 q 1196 650 1152 694 q 1240 546 1240 606 z "},"":{"ha":1290,"x_min":0,"x_max":1240,"o":"m 198 744 q 184 709 198 724 q 149 694 169 694 q 114 709 128 694 q 99 744 99 724 q 114 779 99 765 q 149 794 128 794 q 184 779 169 794 q 198 744 198 765 m 322 347 l 322 843 q 308 878 322 863 q 273 893 293 893 l 50 893 q 15 878 29 893 q 0 843 0 863 l 0 347 q 15 312 0 327 q 50 298 29 298 l 273 298 q 308 312 293 298 q 322 347 322 327 m 1197 463 q 1240 347 1240 415 q 1196 243 1239 287 q 1091 198 1152 198 l 877 198 q 883 180 880 188 q 891 163 886 172 q 899 149 897 153 q 920 105 913 120 q 935 59 927 89 q 942 0 942 29 q 942 -30 942 -19 q 938 -65 942 -42 q 929 -104 935 -88 q 910 -139 923 -119 q 879 -170 898 -158 q 833 -190 861 -182 q 769 -198 805 -198 q 734 -184 749 -198 q 708 -145 718 -168 q 693 -105 697 -122 q 683 -57 688 -88 q 672 -10 676 -25 q 659 27 669 4 q 635 64 649 50 q 556 157 609 90 q 478 251 519 207 q 419 297 438 295 q 386 313 400 298 q 372 346 372 327 l 372 843 q 387 878 372 863 q 422 893 401 892 q 544 927 449 894 q 637 958 604 947 q 732 980 671 968 q 843 992 792 992 l 856 992 l 915 992 l 943 992 q 1096 932 1046 991 q 1134 791 1141 878 q 1176 718 1164 763 q 1176 628 1189 671 q 1209 522 1211 581 q 1197 463 1209 497 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 712 181 l 712 302 q 690 341 712 341 q 664 329 677 341 l 664 155 q 690 143 677 143 q 712 181 712 143 m 855 275 l 906 275 l 906 301 q 880 341 906 341 q 855 301 855 341 l 855 275 m 412 481 l 412 427 l 350 427 l 350 99 l 293 99 l 293 427 l 233 427 l 233 481 l 412 481 m 568 384 l 568 99 l 516 99 l 516 130 q 457 95 486 95 q 425 117 432 95 q 420 159 420 130 l 420 384 l 471 384 l 471 174 q 472 154 471 156 q 484 143 473 143 q 516 167 499 143 l 516 384 l 568 384 m 763 298 l 763 184 q 758 128 763 144 q 717 95 749 95 q 664 127 690 95 l 664 99 l 612 99 l 612 481 l 664 481 l 664 357 q 717 388 689 388 q 758 355 749 388 q 763 298 763 339 m 958 198 l 958 191 q 956 157 958 168 q 945 126 954 140 q 883 95 924 95 q 820 125 842 95 q 804 191 804 146 l 804 291 q 819 358 804 337 q 881 388 842 388 q 942 358 921 388 q 958 291 958 336 l 958 233 l 855 233 l 855 182 q 881 143 855 143 q 904 163 900 143 q 905 168 904 164 q 905 181 905 173 q 905 198 905 189 l 958 198 m 608 836 l 608 715 q 584 676 608 676 q 559 715 559 676 l 559 836 q 584 877 559 877 q 608 836 608 877 m 1022 284 q 1007 485 1022 421 q 973 542 999 519 q 915 569 948 565 q 595 581 809 581 q 277 569 382 581 q 217 542 243 565 q 184 485 192 519 q 169 284 169 418 q 184 82 169 147 q 217 26 192 49 q 276 -2 243 2 q 595 -13 382 -13 q 915 -2 808 -13 q 973 26 948 2 q 1006 82 998 49 q 1022 284 1022 147 m 436 788 l 506 1018 l 448 1018 l 408 867 l 367 1018 l 307 1018 q 325 964 312 1000 q 343 911 337 929 q 379 788 370 831 l 379 632 l 436 632 l 436 788 m 660 725 l 660 826 q 644 894 660 871 q 584 923 622 923 q 523 894 544 923 q 507 826 507 871 l 507 725 q 523 658 507 680 q 584 629 544 629 q 644 658 622 629 q 660 725 660 679 m 801 632 l 853 632 l 853 919 l 801 919 l 801 700 q 768 676 784 676 q 756 688 756 676 q 755 708 755 690 l 755 919 l 703 919 l 703 692 q 708 649 703 663 q 741 629 716 629 q 801 663 769 629 l 801 632 m 1190 868 l 1190 124 q 1125 -34 1190 32 q 967 -99 1059 -99 l 223 -99 q 65 -34 131 -99 q 0 124 0 32 l 0 868 q 65 1026 0 960 q 223 1091 131 1091 l 967 1091 q 1125 1026 1059 1091 q 1190 868 1190 960 z "},"":{"ha":1190,"x_min":21,"x_max":1170,"o":"m 753 226 l 753 63 q 722 11 753 11 q 687 28 705 11 l 687 261 q 722 278 705 278 q 753 226 753 278 m 1015 226 l 1015 190 l 945 190 l 945 226 q 980 278 945 278 q 1015 226 1015 278 m 266 395 l 349 395 l 349 467 l 107 467 l 107 395 l 188 395 l 188 -47 l 266 -47 l 266 395 m 489 -47 l 558 -47 l 558 336 l 489 336 l 489 43 q 445 11 466 11 q 429 27 431 11 q 428 54 428 29 l 428 336 l 359 336 l 359 33 q 365 -23 359 -5 q 410 -52 374 -52 q 489 -5 447 -52 l 489 -47 m 822 68 l 822 221 q 815 298 822 277 q 760 341 801 341 q 687 299 721 341 l 687 467 l 618 467 l 618 -47 l 687 -47 l 687 -9 q 760 -52 722 -52 q 815 -9 801 -52 q 822 68 822 12 m 1084 76 l 1084 86 l 1013 86 q 1011 39 1013 47 q 980 11 1006 11 q 945 64 945 11 l 945 132 l 1084 132 l 1084 212 q 1063 301 1084 273 q 980 341 1032 341 q 898 301 928 341 q 876 212 876 273 l 876 78 q 898 -12 876 16 q 982 -52 929 -52 q 1066 -11 1038 -52 q 1082 31 1080 10 q 1084 76 1084 38 m 612 784 l 612 946 q 579 1000 612 1000 q 546 946 546 1000 l 546 784 q 579 729 546 729 q 612 784 612 729 m 1170 202 q 1149 -70 1170 20 q 1104 -146 1139 -115 q 1025 -182 1070 -177 q 595 -198 883 -198 q 165 -182 308 -198 q 86 -146 120 -177 q 41 -70 51 -115 q 21 202 21 17 q 41 473 21 383 q 86 550 52 519 q 166 586 120 581 q 595 601 308 601 q 1025 586 883 601 q 1105 550 1070 581 q 1149 473 1139 519 q 1170 202 1170 386 m 396 1190 l 475 1190 l 381 881 l 381 671 l 304 671 l 304 881 q 257 1046 293 939 q 206 1190 228 1125 l 288 1190 l 343 987 l 396 1190 m 683 932 l 683 797 q 661 705 683 734 q 579 666 632 666 q 498 705 527 666 q 476 797 476 735 l 476 932 q 498 1023 476 994 q 579 1063 527 1063 q 661 1023 632 1063 q 683 932 683 994 m 942 1058 l 942 671 l 872 671 l 872 714 q 792 666 831 666 q 746 694 756 666 q 740 753 740 713 l 740 1058 l 811 1058 l 811 773 q 811 746 811 748 q 828 729 814 729 q 872 763 849 729 l 872 1058 l 942 1058 z "},"":{"ha":1091,"x_min":4,"x_max":1087,"o":"m 463 674 q 264 320 455 660 q 213 284 243 284 l 28 284 q 4 298 12 284 q 4 326 -4 311 l 200 673 q 200 674 201 673 l 75 890 q 74 918 66 907 q 99 930 81 930 l 284 930 q 336 895 315 930 l 463 674 m 1087 1171 q 1087 1142 1096 1159 l 678 419 l 678 418 l 939 -59 q 939 -88 947 -74 q 915 -99 932 -99 l 729 -99 q 678 -64 697 -99 l 415 418 q 827 1148 429 443 q 877 1183 846 1183 l 1063 1183 q 1087 1171 1080 1183 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 531 598 q 433 770 531 598 q 393 796 417 796 l 250 796 q 230 787 236 796 q 231 765 225 778 l 328 598 l 328 597 l 176 329 q 176 307 169 318 q 195 297 182 297 l 338 297 q 377 325 362 297 l 531 598 m 1015 983 q 996 992 1009 992 l 851 992 q 813 965 828 992 l 494 400 q 698 27 495 398 q 738 0 713 0 l 880 0 q 900 9 894 0 q 899 31 906 19 l 698 400 l 698 401 l 1015 961 q 1015 983 1021 973 m 1190 868 l 1190 124 q 1125 -34 1190 32 q 967 -99 1059 -99 l 223 -99 q 65 -34 131 -99 q 0 124 0 32 l 0 868 q 65 1026 0 960 q 223 1091 131 1091 l 967 1091 q 1125 1026 1059 1091 q 1190 868 1190 960 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 551 316 l 926 510 l 551 706 l 551 316 m 694 984 q 946 981 825 984 q 1124 973 1067 977 l 1180 970 q 1194 969 1181 970 q 1211 967 1206 968 q 1230 963 1217 966 q 1252 957 1242 961 q 1273 947 1261 953 q 1297 932 1286 941 q 1320 911 1309 923 q 1332 897 1325 907 q 1354 852 1339 887 q 1375 773 1370 816 q 1385 668 1381 724 q 1389 580 1388 612 l 1389 549 l 1389 443 q 1375 219 1390 331 q 1356 141 1370 176 q 1331 94 1342 107 l 1320 81 q 1297 60 1309 69 q 1273 45 1286 51 q 1252 36 1261 40 q 1230 29 1242 32 q 1211 26 1217 27 q 1193 24 1205 25 q 1180 22 1181 22 q 694 8 986 8 q 416 13 534 9 q 260 19 298 16 l 222 22 l 195 25 q 152 33 167 29 q 113 49 138 36 q 69 81 88 61 q 57 95 64 85 q 34 140 50 105 q 14 219 19 176 q 4 324 8 268 q 0 412 1 381 l 0 443 l 0 549 q 14 773 -1 661 q 33 851 19 816 q 58 898 47 885 l 69 911 q 91 932 80 923 q 115 947 103 941 q 137 957 128 953 q 159 963 146 961 q 177 967 172 966 q 195 969 183 968 q 208 970 208 970 q 694 984 403 984 z "},"":{"ha":1389,"x_min":50,"x_max":1339,"o":"m 312 643 l 694 406 l 429 185 l 50 432 l 312 643 m 1076 212 l 1076 129 l 696 -98 l 696 -99 l 695 -98 l 694 -99 l 694 -98 l 315 129 l 315 212 l 429 138 l 694 358 l 694 360 l 695 359 l 696 360 l 696 358 l 962 138 l 1076 212 m 429 1099 l 694 878 l 312 643 l 50 852 l 429 1099 m 1077 643 l 1339 432 l 960 185 l 694 406 l 1077 643 m 960 1099 l 1339 852 l 1077 643 l 694 878 l 960 1099 z "},"":{"ha":1190,"x_min":9,"x_max":1182,"o":"m 999 -74 l 133 -74 l 133 298 l 9 298 l 9 -198 l 1123 -198 l 1123 298 l 999 298 l 999 -74 m 269 332 l 295 453 l 901 326 l 876 205 l 269 332 m 349 622 l 401 735 l 963 472 l 911 360 l 349 622 m 505 898 l 584 993 l 1059 595 l 980 500 l 505 898 m 812 1190 l 1182 694 l 1083 619 l 713 1116 l 812 1190 m 256 50 l 256 174 l 876 174 l 876 50 l 256 50 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 736 356 q 765 385 736 356 q 794 496 794 414 q 736 636 794 578 q 595 694 677 694 q 455 636 513 694 q 397 496 397 578 q 455 356 397 414 q 595 298 513 298 q 736 356 677 298 m 811 712 q 856 668 811 712 q 901 496 901 623 q 811 280 901 369 q 595 191 722 191 q 379 280 468 191 q 290 496 290 369 q 379 712 290 623 q 595 801 468 801 q 811 712 722 801 m 963 864 q 974 854 963 864 q 984 814 984 843 q 963 763 984 784 q 913 742 942 742 q 863 763 884 742 q 842 814 842 784 q 863 864 842 843 q 913 885 884 885 q 963 864 942 885 m 655 985 q 628 985 655 985 q 595 984 601 984 q 536 985 590 984 q 454 985 482 985 q 379 982 426 984 q 300 975 332 980 q 244 960 267 969 q 176 915 205 945 q 131 847 146 886 q 117 792 122 825 q 109 712 111 759 q 107 637 107 665 q 107 555 106 609 q 107 496 107 501 q 107 437 107 491 q 107 355 106 383 q 109 280 107 327 q 117 200 111 233 q 131 145 122 167 q 176 77 146 106 q 244 32 205 47 q 300 17 267 23 q 379 10 332 12 q 454 7 426 8 q 536 7 482 7 q 595 8 590 8 q 655 7 601 8 q 736 7 708 7 q 811 10 764 8 q 891 17 858 12 q 946 32 924 23 q 1015 77 985 47 q 1059 145 1044 106 q 1074 200 1068 167 q 1082 280 1080 233 q 1084 355 1084 327 q 1084 437 1084 383 q 1084 496 1084 491 q 1084 555 1084 501 q 1084 637 1084 609 q 1082 712 1084 665 q 1074 792 1080 759 q 1059 847 1068 825 q 1015 915 1044 886 q 946 960 985 945 q 891 975 924 969 q 811 982 858 980 q 736 985 764 984 q 655 985 708 985 m 1187 742 q 1190 496 1190 674 q 1187 250 1190 319 q 1090 1 1179 89 q 841 -95 1002 -88 q 595 -99 773 -99 q 350 -95 418 -99 q 100 1 188 -88 q 4 250 12 89 q 0 496 0 319 q 4 742 0 674 q 100 991 12 903 q 350 1087 188 1080 q 595 1091 418 1091 q 841 1087 773 1091 q 1090 991 1002 1080 q 1187 742 1179 903 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 967 1091 q 1125 1026 1059 1091 q 1190 868 1190 960 l 1190 124 q 1125 -34 1190 32 q 967 -99 1059 -99 l 223 -99 q 65 -34 131 -99 q 0 124 0 32 l 0 868 q 65 1026 0 960 q 223 1091 131 1091 l 967 1091 m 493 380 q 517 404 493 380 q 541 496 541 428 q 493 612 541 564 q 377 660 445 660 q 260 612 308 660 q 212 496 212 564 q 260 380 212 428 q 377 332 308 332 q 493 380 445 332 m 930 380 q 954 404 930 380 q 978 496 978 428 q 930 612 978 564 q 814 660 882 660 q 698 612 746 660 q 649 496 649 564 q 698 380 649 428 q 814 332 746 332 q 930 380 882 332 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 595 708 l 751 471 l 439 471 l 595 708 m 878 298 l 951 298 l 595 833 l 239 298 l 312 298 l 393 422 l 798 422 l 878 298 m 1111 795 q 1151 726 1111 795 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 z "},"":{"ha":1091,"x_min":0,"x_max":1092,"o":"m 632 525 q 593 446 638 476 q 506 442 547 417 q 465 487 476 455 q 464 550 453 519 q 505 595 475 582 q 561 605 532 609 q 610 577 589 600 q 632 525 632 554 m 718 541 q 630 668 707 624 q 477 678 553 712 q 400 610 429 656 q 373 509 370 563 q 433 389 376 439 q 561 346 490 339 q 679 411 632 352 q 718 541 726 470 m 903 961 q 860 996 887 982 q 815 1013 832 1009 q 760 1022 798 1016 q 321 1021 534 1059 q 270 1011 288 1015 q 227 994 252 1008 q 188 961 202 981 q 247 926 212 939 q 304 909 283 912 q 372 900 326 905 q 719 899 549 877 q 789 908 768 905 q 845 925 809 911 q 903 961 880 939 m 947 159 q 935 100 941 139 q 924 34 929 60 q 902 -20 919 9 q 857 -64 885 -48 q 710 -119 791 -101 q 554 -136 630 -137 q 398 -122 477 -135 q 334 -108 362 -115 q 275 -87 307 -100 q 219 -53 243 -74 q 178 -5 194 -33 q 134 221 159 69 l 139 233 l 153 240 q 545 126 326 126 q 939 240 765 126 q 957 222 955 236 q 953 188 960 209 q 947 159 947 166 m 1087 904 q 1001 396 1067 774 q 980 353 997 373 q 947 322 963 332 q 904 298 930 311 q 432 229 709 200 q 126 337 239 250 q 107 358 115 346 q 93 385 98 369 q 86 411 88 401 q 82 442 84 422 q 78 469 79 462 q 57 585 71 508 q 35 710 43 663 q 17 825 27 758 q 0 947 7 891 q 14 985 2 967 q 38 1014 25 1002 q 73 1037 51 1025 q 109 1054 95 1049 q 146 1069 122 1060 q 388 1118 243 1104 q 912 1080 682 1147 q 1079 985 1032 1044 q 1092 946 1091 970 q 1087 904 1092 922 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 657 516 q 625 567 657 550 q 566 568 594 585 q 533 512 532 553 q 567 457 533 471 q 629 460 597 439 q 657 516 662 481 m 719 529 q 691 435 725 477 q 606 388 657 392 q 514 419 555 383 q 470 506 473 454 q 490 578 469 544 q 546 628 512 612 q 656 620 601 652 q 719 529 711 588 m 853 832 q 811 805 837 815 q 770 793 785 795 q 721 787 755 791 q 470 787 601 771 q 421 794 436 791 q 380 806 406 797 q 338 832 354 816 q 366 856 348 846 q 397 868 384 865 q 433 874 410 870 q 749 875 587 901 q 789 868 775 871 q 822 856 803 866 q 853 832 842 846 m 885 253 q 889 274 885 259 q 892 299 894 289 q 878 312 890 308 q 595 229 753 229 q 312 312 437 229 l 302 307 l 298 298 q 330 135 319 178 q 488 51 367 72 q 820 92 681 16 q 858 132 846 107 q 875 198 870 157 q 885 253 881 239 m 986 791 q 980 849 993 832 q 860 917 946 891 q 482 945 692 966 q 307 909 380 935 q 261 890 277 898 q 224 863 244 882 q 202 822 205 845 q 216 715 208 769 q 239 582 225 660 q 257 476 253 504 q 261 452 258 472 q 267 424 264 432 q 276 403 269 416 q 293 381 283 390 q 513 304 374 319 q 854 353 714 282 q 885 370 873 363 q 909 393 897 378 q 924 424 921 408 q 986 791 961 631 m 1190 868 l 1190 124 q 1125 -34 1190 32 q 967 -99 1059 -99 l 223 -99 q 65 -34 131 -99 q 0 124 0 32 l 0 868 q 65 1026 0 960 q 223 1091 131 1091 l 967 1091 q 1125 1026 1059 1091 q 1190 868 1190 960 z "},"":{"ha":794,"x_min":53,"x_max":794,"o":"m 732 160 l 794 -23 q 708 -74 776 -50 q 570 -99 639 -98 q 423 -79 490 -101 q 312 -22 356 -57 q 239 60 269 14 q 196 153 208 107 q 183 245 183 200 l 183 667 l 53 667 l 53 833 q 153 887 109 853 q 223 957 197 921 q 268 1036 250 993 q 295 1113 287 1079 q 306 1181 302 1146 q 310 1188 307 1185 q 315 1190 312 1190 l 505 1190 l 505 862 l 763 862 l 763 667 l 504 667 l 504 265 q 509 222 504 242 q 526 181 514 202 q 565 149 539 160 q 628 138 591 137 q 732 160 688 140 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 880 58 l 832 200 q 753 183 798 183 q 705 191 725 182 q 675 215 684 200 q 661 247 665 231 q 657 281 657 263 l 657 589 l 856 589 l 856 739 l 658 739 l 658 992 l 512 992 q 505 984 506 992 q 492 917 501 950 q 462 843 482 884 q 402 770 441 803 q 310 717 363 736 l 310 589 l 411 589 l 411 265 q 427 176 411 221 q 478 90 444 131 q 572 24 512 49 q 708 0 632 -2 q 814 19 762 1 q 880 58 867 38 m 1190 868 l 1190 124 q 1125 -34 1190 32 q 967 -99 1059 -99 l 223 -99 q 65 -34 131 -99 q 0 124 0 32 l 0 868 q 65 1026 0 960 q 223 1091 131 1091 l 967 1091 q 1125 1026 1059 1091 q 1190 868 1190 960 z "},"":{"ha":595,"x_min":2,"x_max":593,"o":"m 570 198 q 593 184 587 198 q 589 157 599 169 l 318 -141 q 300 -149 310 -149 q 281 -141 289 -149 l 6 157 q 2 184 -4 169 q 25 198 9 198 l 198 198 l 198 1166 q 205 1184 198 1177 q 223 1190 212 1190 l 372 1190 q 390 1184 383 1190 q 397 1166 397 1177 l 397 198 l 570 198 z "},"":{"ha":595,"x_min":2,"x_max":593,"o":"m 593 808 q 570 794 586 794 l 397 794 l 397 -174 q 390 -191 397 -184 q 372 -198 383 -198 l 223 -198 q 205 -191 212 -198 q 198 -174 198 -184 l 198 794 l 25 794 q 2 808 9 794 q 6 836 -4 823 l 277 1133 q 295 1141 285 1141 q 314 1133 306 1141 l 589 836 q 593 808 599 823 z "},"":{"ha":1389,"x_min":50,"x_max":1389,"o":"m 1389 570 l 1389 422 q 1382 404 1389 411 q 1364 397 1375 397 l 397 397 l 397 223 q 382 201 397 207 q 355 205 367 195 l 57 476 q 50 494 50 484 q 57 512 50 505 l 355 787 q 382 791 367 798 q 397 769 397 784 l 397 595 l 1364 595 q 1382 588 1375 595 q 1389 570 1389 581 z "},"":{"ha":1389,"x_min":0,"x_max":1339,"o":"m 1339 498 q 1332 480 1339 488 l 1034 205 q 1007 201 1022 195 q 992 223 992 208 l 992 397 l 25 397 q 7 404 14 397 q 0 422 0 411 l 0 570 q 7 588 0 581 q 25 595 14 595 l 992 595 l 992 769 q 1007 791 992 785 q 1034 787 1022 798 l 1332 516 q 1339 498 1339 508 z "},"":{"ha":1091,"x_min":0,"x_max":1080,"o":"m 1080 249 q 984 55 1049 152 q 785 -97 884 -97 q 677 -72 747 -97 q 560 -47 610 -47 q 450 -73 512 -47 q 347 -99 387 -99 q 114 102 229 -99 q 0 491 0 304 q 88 781 0 668 q 308 893 175 893 q 445 870 363 893 q 552 846 525 846 q 663 873 587 846 q 797 899 742 899 q 962 849 889 899 q 1042 771 1002 821 q 954 680 981 719 q 904 519 904 607 q 957 346 904 423 q 1080 249 1011 270 m 788 1158 q 766 1053 788 1111 q 694 946 742 994 q 610 890 652 904 q 529 877 581 881 q 590 1076 532 992 q 784 1190 647 1159 q 786 1182 784 1188 q 787 1173 787 1176 q 788 1166 787 1170 q 788 1158 788 1161 z "},"":{"ha":1290,"x_min":0,"x_max":1290,"o":"m 529 411 l 529 -94 l 0 -21 l 0 411 l 529 411 m 529 987 l 529 476 l 0 476 l 0 914 l 529 987 m 1290 411 l 1290 -198 l 587 -102 l 587 411 l 1290 411 m 1290 1091 l 1290 476 l 587 476 l 587 994 l 1290 1091 z "},"":{"ha":1091,"x_min":0,"x_max":1091,"o":"m 361 825 q 365 821 361 825 q 382 816 370 816 q 403 825 395 816 q 412 846 412 834 q 403 868 412 859 q 382 877 395 877 q 361 868 370 877 q 353 846 353 859 q 361 825 353 834 m 688 825 q 692 821 688 825 q 709 816 697 816 q 730 825 722 816 q 739 846 739 834 q 730 868 739 859 q 709 877 722 877 q 688 868 697 877 q 679 846 679 859 q 688 825 679 834 m 80 674 q 136 650 112 674 q 159 594 159 627 l 159 261 q 136 205 159 228 q 80 181 113 181 q 23 205 47 181 q 0 261 0 228 l 0 594 q 23 650 0 627 q 80 674 47 674 m 901 659 l 901 143 q 877 82 901 107 q 817 57 852 57 l 759 57 l 759 -119 q 736 -175 759 -152 q 679 -198 712 -198 q 622 -175 646 -198 q 599 -119 599 -152 l 599 57 l 492 57 l 492 -119 q 469 -175 492 -152 q 412 -198 446 -198 q 357 -175 380 -198 q 333 -119 333 -152 l 332 57 l 275 57 q 215 82 239 57 q 190 143 190 107 l 190 659 l 901 659 m 722 973 q 854 854 805 930 q 904 687 904 777 l 187 687 q 236 854 187 777 q 370 973 286 930 l 315 1074 q 319 1090 309 1084 q 334 1085 329 1094 l 390 983 q 546 1015 463 1015 q 701 983 628 1015 l 757 1085 q 773 1090 763 1094 q 777 1074 782 1084 l 722 973 m 1091 594 l 1091 261 q 1068 205 1091 228 q 1011 181 1045 181 q 956 205 979 181 q 932 261 932 228 l 932 594 q 956 651 932 628 q 1011 674 979 674 q 1068 651 1045 674 q 1091 594 1091 628 z "},"":{"ha":1190,"x_min":9,"x_max":1185,"o":"m 514 872 q 502 864 505 871 q 495 856 498 856 q 491 860 491 856 q 506 872 491 870 q 514 872 510 872 m 581 861 q 572 866 578 860 q 559 870 567 872 q 584 868 577 878 q 581 861 586 863 m 309 530 q 305 528 306 531 q 301 518 303 525 q 297 508 299 512 q 289 498 295 504 q 288 488 281 489 q 298 494 291 488 q 308 508 305 500 q 309 513 308 510 q 311 518 310 516 q 312 521 312 519 q 312 524 312 523 q 312 527 312 525 q 312 529 312 528 q 309 530 311 529 m 972 252 q 929 284 972 266 q 935 306 932 296 q 939 326 938 315 q 941 343 940 336 q 942 360 942 349 q 941 375 941 371 q 938 392 941 379 q 935 408 935 405 q 931 427 935 411 q 927 448 928 444 q 891 528 919 485 q 835 586 862 570 q 879 522 853 570 q 921 306 946 396 q 882 274 912 275 q 852 288 858 270 q 846 353 846 305 q 837 436 846 400 q 822 489 830 466 q 807 524 814 512 q 795 543 800 536 q 785 555 790 550 q 779 560 780 560 q 755 640 768 608 q 732 684 742 672 q 714 709 722 695 q 702 740 705 723 q 707 782 699 756 q 710 820 715 807 q 676 839 706 833 q 641 853 664 842 q 614 866 618 865 q 605 886 608 867 q 612 925 603 905 q 639 946 620 946 q 679 923 668 949 q 682 878 690 898 q 680 858 674 863 q 704 857 687 852 q 714 885 714 860 q 714 914 714 910 q 703 953 710 937 q 687 976 697 968 q 669 988 677 984 q 648 994 660 991 q 579 890 565 987 q 578 878 579 878 q 555 886 571 885 q 530 886 539 887 q 518 890 520 884 q 505 960 519 934 q 470 986 492 985 q 438 965 450 987 q 426 918 427 942 q 428 890 425 907 q 438 861 432 873 q 450 850 445 849 q 463 861 458 853 q 457 867 466 868 q 445 879 452 867 q 438 904 439 890 q 445 933 437 922 q 471 944 453 945 q 492 928 484 944 q 500 898 500 911 q 498 880 499 884 q 474 858 481 869 q 453 840 468 849 q 437 830 438 831 q 425 809 427 819 q 431 795 423 799 q 450 780 442 789 q 463 765 459 771 q 477 755 467 760 q 505 750 488 751 q 584 762 541 749 q 601 767 585 763 q 628 775 618 772 q 651 786 639 779 q 667 799 663 792 q 683 805 674 810 q 688 799 687 803 q 686 789 689 794 q 673 782 682 784 q 629 765 657 777 q 594 750 601 753 q 539 732 560 736 q 478 734 520 729 q 471 732 470 736 q 484 718 472 729 q 536 701 504 700 q 564 706 550 701 q 592 717 579 711 q 618 730 605 723 q 641 744 631 738 q 660 753 652 749 q 674 755 669 756 q 680 746 679 753 q 680 743 680 745 q 677 739 679 741 q 672 736 674 737 q 665 732 670 734 q 658 728 661 729 q 651 724 656 727 q 643 721 646 722 q 591 687 622 710 q 539 653 560 663 q 501 653 519 643 q 453 709 485 661 q 433 726 436 733 q 432 718 432 724 q 421 675 432 699 q 398 632 409 650 q 382 587 387 613 q 391 538 377 560 q 342 468 373 533 q 305 359 312 403 q 304 305 304 345 q 300 260 305 266 q 277 257 294 241 q 250 330 253 281 q 253 374 248 352 q 252 388 256 388 q 249 384 250 387 q 257 255 221 333 q 276 233 260 246 q 295 218 291 221 q 375 148 310 200 q 447 88 440 95 q 461 59 460 77 q 450 26 462 41 q 415 8 438 10 q 437 -27 421 -4 q 459 -69 453 -50 q 464 -123 464 -88 q 470 -52 500 -105 q 462 -40 467 -46 q 454 -30 457 -33 q 453 -26 452 -27 q 463 -18 455 -22 q 478 -20 470 -15 q 607 -48 514 -60 q 744 19 710 -36 q 770 43 762 49 q 778 2 780 38 q 760 -69 777 -17 q 756 -98 753 -87 q 774 -110 758 -109 q 786 -50 777 -95 q 796 19 794 -5 q 791 76 798 36 q 785 152 784 117 q 803 206 786 186 q 842 220 815 220 q 869 261 843 249 q 925 269 895 274 q 972 252 956 265 m 485 893 q 483 916 488 906 q 474 928 479 926 q 467 922 467 929 q 471 918 469 918 q 477 906 479 918 q 483 891 474 891 q 485 893 485 891 m 810 740 q 805 749 808 746 q 795 753 801 752 q 784 757 788 754 q 776 763 780 760 q 771 770 773 767 q 767 775 769 772 q 763 778 764 777 q 760 777 763 778 q 766 743 749 764 q 796 718 782 722 q 807 725 803 718 q 810 740 811 732 m 672 905 q 668 920 672 914 q 660 930 664 927 q 653 932 655 933 q 646 931 648 932 q 646 928 645 929 q 650 925 648 926 q 664 901 661 922 q 670 903 664 899 q 672 905 672 904 m 714 1086 q 712 1090 714 1087 q 705 1095 710 1092 q 698 1100 700 1098 q 679 1111 686 1111 q 670 1106 672 1111 q 669 1096 668 1101 q 669 1086 670 1090 q 664 1078 668 1083 q 660 1071 660 1073 q 662 1064 659 1069 q 668 1064 665 1062 q 677 1071 671 1066 q 688 1078 682 1076 q 695 1079 689 1079 q 707 1080 701 1079 q 714 1086 712 1082 m 1152 47 q 1176 28 1167 37 q 1185 9 1184 18 q 1183 -9 1186 0 q 1171 -26 1180 -17 q 1153 -41 1162 -34 q 1130 -55 1144 -47 q 1105 -68 1115 -63 q 1080 -80 1095 -73 q 1059 -90 1066 -87 q 993 -133 1030 -105 q 935 -183 956 -162 q 882 -198 922 -195 q 813 -187 842 -201 q 790 -169 799 -180 q 777 -149 781 -157 q 760 -134 773 -140 q 724 -126 747 -127 q 623 -126 690 -126 q 579 -127 608 -126 q 534 -129 550 -128 q 472 -140 500 -129 q 431 -164 445 -151 q 397 -186 417 -176 q 356 -195 377 -195 q 270 -171 333 -194 q 157 -137 206 -147 q 117 -130 142 -134 q 78 -123 92 -126 q 48 -115 64 -120 q 22 -104 31 -111 q 9 -89 12 -98 q 14 -38 1 -71 q 28 5 27 -4 q 25 36 29 17 q 17 69 21 54 q 14 97 13 83 q 22 118 14 111 q 66 129 33 127 q 112 138 99 130 q 145 165 136 152 q 154 205 154 178 q 129 122 171 148 q 65 111 105 107 q 32 103 39 113 q 36 59 22 91 q 42 45 37 54 q 48 31 47 36 q 52 18 50 26 q 53 1 53 9 q 40 -37 53 -11 q 29 -74 26 -64 q 57 -95 31 -88 q 123 -109 73 -99 q 200 -125 173 -119 q 257 -142 219 -129 q 321 -160 296 -154 q 364 -163 346 -165 q 414 -141 398 -158 q 432 -104 431 -124 q 426 -59 433 -84 q 412 -18 419 -33 q 396 10 404 -3 q 265 198 302 157 q 177 229 212 255 q 166 240 169 222 q 164 270 164 253 q 172 310 165 292 q 191 346 179 328 q 208 379 202 365 q 228 435 214 395 q 251 495 243 474 q 274 543 260 516 q 305 584 289 569 q 401 736 390 695 q 388 976 391 822 q 407 1093 387 1046 q 489 1174 427 1141 q 570 1190 519 1190 q 652 1180 611 1191 q 721 1148 693 1169 q 792 1054 765 1115 q 815 939 818 992 q 838 773 811 866 q 941 605 864 686 q 1018 478 984 559 q 1064 330 1053 398 q 1068 265 1070 292 q 1059 222 1066 237 q 1043 205 1052 206 q 1025 190 1035 203 q 1004 162 1015 177 q 973 136 994 148 q 925 126 952 125 q 901 129 911 126 q 884 140 891 133 q 873 152 877 147 q 864 168 870 157 q 857 183 859 179 q 825 206 840 212 q 804 168 811 201 q 809 93 797 136 q 810 -58 825 39 q 824 -136 802 -109 q 880 -162 846 -164 q 946 -134 915 -160 q 1016 -83 992 -96 q 1096 -50 1039 -69 q 1156 -21 1137 -36 q 1170 5 1174 -7 q 1151 28 1166 18 q 1111 46 1135 37 q 1072 83 1085 54 q 1061 139 1059 112 q 1073 176 1062 167 q 1079 132 1073 152 q 1090 101 1084 112 q 1106 79 1096 89 q 1122 64 1116 68 q 1139 54 1128 60 q 1152 47 1149 48 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 794 28 q 685 414 761 215 l 684 414 l 682 413 q 649 400 670 408 q 570 362 628 392 q 464 299 513 332 q 363 210 415 265 q 283 95 310 155 l 271 104 q 595 -12 414 -12 q 794 28 698 -12 m 650 498 q 609 584 634 536 q 88 512 368 512 q 87 496 87 507 q 121 313 87 400 q 217 157 155 226 q 313 286 256 226 q 423 382 370 346 q 524 445 477 419 q 601 482 572 471 l 630 492 q 640 495 633 493 q 650 498 647 497 m 567 663 q 378 956 474 828 q 197 811 271 905 q 98 601 122 718 q 567 663 332 601 m 1097 415 q 780 438 935 462 q 880 74 848 253 q 1023 221 966 133 q 1097 415 1080 310 m 474 990 q 472 989 473 990 q 474 990 473 990 m 931 877 q 595 1004 787 1004 q 475 990 536 1004 q 666 694 577 858 q 767 741 719 714 q 841 788 814 767 q 892 832 869 809 q 921 864 915 856 q 931 877 927 872 m 1104 501 q 988 819 1101 681 l 987 818 q 973 799 980 809 q 939 765 965 790 q 884 718 913 740 q 806 668 855 696 q 705 618 758 639 q 739 544 724 577 q 744 531 740 540 q 749 518 747 522 q 807 523 777 522 q 864 525 837 525 q 918 524 891 525 q 967 520 944 522 q 1011 516 991 519 q 1048 511 1032 514 q 1077 506 1065 508 q 1096 503 1088 505 l 1104 501 m 1111 795 q 1151 726 1111 795 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 909 367 q 894 438 909 405 q 856 491 879 470 q 800 529 834 512 q 736 555 766 546 q 668 573 706 564 l 587 591 q 553 600 564 597 q 526 608 543 602 q 503 621 510 615 q 490 637 496 627 q 484 660 484 647 q 596 720 484 720 q 656 711 629 720 q 698 689 682 701 q 727 663 713 676 q 758 640 741 649 q 795 631 775 631 q 854 656 832 631 q 876 715 876 680 q 832 792 876 758 q 722 845 789 827 q 581 863 656 863 q 479 851 529 863 q 386 814 429 839 q 317 747 343 790 q 291 647 291 704 q 306 565 291 600 q 350 506 321 529 q 412 469 378 483 q 491 443 445 454 l 605 415 q 691 388 674 398 q 716 341 716 372 q 685 291 716 311 q 604 271 654 271 q 533 284 564 271 q 482 314 501 296 q 447 348 463 331 q 412 378 431 366 q 370 391 392 391 q 311 367 331 391 q 291 309 291 344 q 386 187 291 238 q 612 136 481 136 q 720 151 668 136 q 815 192 772 165 q 884 265 858 219 q 909 367 909 310 m 1190 198 q 1103 -12 1190 75 q 893 -99 1016 -99 q 711 -37 792 -99 q 595 -50 652 -50 q 383 -7 484 -50 q 209 110 282 36 q 93 284 136 183 q 50 496 50 385 q 62 612 50 553 q 0 794 0 693 q 87 1004 0 917 q 298 1091 174 1091 q 479 1029 398 1091 q 595 1042 539 1042 q 807 999 706 1042 q 982 882 908 956 q 1098 708 1055 809 q 1141 496 1141 607 q 1128 380 1141 439 q 1190 198 1190 299 z "},"":{"ha":992,"x_min":34,"x_max":951,"o":"m 775 854 l 804 1004 q 797 1035 808 1022 q 770 1049 786 1049 l 218 1049 q 188 1035 200 1049 q 176 1007 176 1022 l 176 153 q 181 153 176 148 l 406 426 q 436 451 424 446 q 473 457 447 457 l 658 457 q 687 469 675 457 q 701 491 698 480 q 729 639 719 592 q 720 670 732 656 q 692 685 708 685 l 464 685 q 427 700 442 685 q 412 737 412 715 l 412 770 q 427 806 412 792 q 464 821 442 821 l 732 821 q 760 831 746 821 q 775 854 773 842 m 951 1026 q 910 820 939 970 q 856 548 880 670 q 829 414 832 427 q 822 389 824 397 q 811 363 819 381 q 792 338 802 346 q 762 322 781 329 q 717 314 742 314 l 507 314 q 490 306 497 314 q 160 -77 484 299 q 114 -99 143 -96 q 77 -95 86 -102 q 34 -19 34 -78 l 34 1074 q 64 1154 34 1117 q 157 1190 93 1190 l 845 1190 q 943 1149 918 1190 q 951 1026 968 1108 m 951 1026 l 829 414 q 856 548 832 427 q 910 820 880 670 q 951 1026 939 970 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 546 149 l 546 942 q 539 960 546 953 q 521 967 532 967 l 149 967 q 131 960 138 967 q 124 942 124 953 l 124 149 q 131 131 124 138 q 149 124 138 124 l 521 124 q 539 131 532 124 q 546 149 546 138 m 1066 446 l 1066 942 q 1059 960 1066 953 q 1042 967 1053 967 l 670 967 q 652 960 659 967 q 645 942 645 953 l 645 446 q 652 429 645 436 q 670 422 659 422 l 1042 422 q 1059 429 1053 422 q 1066 446 1066 436 m 1190 1042 l 1190 -50 q 1176 -84 1190 -70 q 1141 -99 1161 -99 l 50 -99 q 15 -84 29 -99 q 0 -50 0 -70 l 0 1042 q 15 1077 0 1062 q 50 1091 29 1091 l 1141 1091 q 1176 1077 1161 1091 q 1190 1042 1190 1062 z "},"":{"ha":992,"x_min":0,"x_max":992,"o":"m 992 372 q 970 319 992 341 q 918 298 949 298 q 856 331 878 298 l 680 595 l 645 595 l 645 493 l 836 174 q 843 149 843 163 q 829 114 843 129 q 794 99 814 99 l 645 99 l 645 -112 q 619 -173 645 -147 q 558 -198 594 -198 l 434 -198 q 373 -173 398 -198 q 347 -112 347 -147 l 347 99 l 198 99 q 164 114 178 99 q 149 149 149 129 q 156 174 149 163 l 347 493 l 347 595 l 312 595 l 136 331 q 74 298 114 298 q 22 319 43 298 q 0 372 0 341 q 12 413 0 395 l 211 711 q 347 794 267 794 l 645 794 q 781 711 725 794 l 980 413 q 992 372 992 395 m 619 1115 q 644 1090 619 1115 q 670 992 670 1064 q 619 869 670 920 q 496 818 568 818 q 373 869 424 818 q 322 992 322 920 q 373 1115 322 1064 q 496 1166 424 1166 q 619 1115 568 1166 z "},"":{"ha":794,"x_min":0,"x_max":794,"o":"m 794 645 l 794 322 q 772 270 794 291 q 719 248 750 248 q 667 270 688 248 q 645 322 645 291 l 645 595 l 595 595 l 595 -112 q 570 -173 595 -147 q 508 -198 544 -198 q 447 -173 473 -198 q 422 -112 422 -147 l 422 248 l 372 248 l 372 -112 q 346 -173 372 -147 q 285 -198 321 -198 q 224 -173 250 -198 q 198 -112 198 -147 l 198 595 l 149 595 l 149 322 q 127 270 149 291 q 74 248 105 248 q 22 270 43 248 q 0 322 0 291 l 0 645 q 43 750 0 707 q 149 794 87 794 l 645 794 q 750 750 707 794 q 794 645 794 707 m 520 1115 q 545 1090 520 1115 q 570 992 570 1064 q 520 869 570 920 q 397 818 469 818 q 274 869 325 818 q 223 992 223 920 q 274 1115 223 1064 q 397 1166 325 1166 q 520 1115 469 1166 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 599 181 l 870 548 q 889 594 883 565 q 885 660 896 622 q 837 721 873 697 q 773 741 806 741 q 716 727 739 740 q 674 692 692 714 q 599 661 646 661 q 525 692 553 661 q 483 727 507 714 q 426 741 460 740 q 361 721 393 741 q 314 660 326 697 q 310 594 303 622 q 329 548 316 565 l 599 181 m 1111 795 q 1151 726 1111 795 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 z "},"":{"ha":1389,"x_min":34,"x_max":1355,"o":"m 1106 323 q 1123 364 1106 323 q 1141 496 1141 405 q 1106 669 1141 587 q 1010 812 1070 752 q 868 907 950 872 q 694 942 785 942 q 521 907 604 942 q 379 812 439 872 q 283 669 319 752 q 248 496 248 587 q 283 323 248 405 q 379 180 319 240 q 521 85 439 120 q 694 50 604 50 q 868 85 785 50 q 1010 180 950 120 q 1106 323 1070 240 m 1355 281 q 1339 266 1352 270 l 1113 191 l 1113 -46 q 1103 -66 1113 -58 q 1080 -69 1091 -74 l 854 4 l 715 -188 q 694 -198 707 -198 q 674 -188 682 -198 l 535 4 l 308 -69 q 286 -66 298 -74 q 276 -46 276 -58 l 276 191 l 50 266 q 34 281 37 270 q 37 304 30 295 l 177 496 l 37 688 q 34 711 30 698 q 50 726 37 722 l 276 801 l 276 1038 q 286 1058 276 1050 q 308 1061 298 1066 l 535 988 l 674 1180 q 694 1190 681 1190 q 715 1180 708 1190 l 854 988 l 1080 1061 q 1103 1058 1091 1066 q 1113 1038 1113 1050 l 1113 801 l 1339 726 q 1355 711 1352 722 q 1352 688 1359 698 l 1212 496 l 1352 304 q 1355 281 1359 295 z "},"":{"ha":1190,"x_min":0,"x_max":1139,"o":"m 978 181 q 893 174 936 174 q 632 243 752 174 q 442 433 512 313 q 372 694 372 553 q 453 971 372 843 q 198 794 297 925 q 99 496 99 663 q 139 303 99 395 q 245 145 178 212 q 403 40 311 79 q 595 0 494 0 q 807 48 707 0 q 978 181 908 95 m 1135 246 q 916 -5 1063 89 q 595 -99 769 -99 q 364 -52 474 -99 q 174 75 254 -5 q 47 265 95 155 q 0 496 0 375 q 45 723 0 615 q 165 910 89 831 q 348 1037 242 989 q 573 1090 454 1086 q 620 1060 607 1092 q 608 1004 634 1028 q 506 864 542 944 q 471 694 471 784 q 528 483 471 580 q 681 329 584 386 q 893 273 778 273 q 1070 312 984 273 q 1125 302 1101 326 q 1139 276 1136 291 q 1135 246 1142 260 z "},"":{"ha":1389,"x_min":50,"x_max":1339,"o":"m 829 511 q 836 518 829 511 q 843 546 843 525 q 829 581 843 566 q 794 595 814 595 l 595 595 q 560 581 575 595 q 546 546 546 566 q 560 511 546 525 q 595 496 575 496 l 794 496 q 829 511 814 496 m 1290 694 l 1290 -50 q 1275 -84 1290 -70 q 1240 -99 1260 -99 l 149 -99 q 114 -84 129 -99 q 99 -50 99 -70 l 99 694 q 114 729 99 715 q 149 744 129 744 l 1240 744 q 1275 729 1260 744 q 1290 694 1290 715 m 1339 1042 l 1339 843 q 1325 808 1339 823 q 1290 794 1310 794 l 99 794 q 64 808 79 794 q 50 843 50 823 l 50 1042 q 64 1077 50 1062 q 99 1091 79 1091 l 1290 1091 q 1325 1077 1310 1091 q 1339 1042 1339 1062 z "},"":{"ha":1290,"x_min":25,"x_max":1265,"o":"m 1250 481 q 1258 474 1250 481 q 1265 446 1265 467 q 1250 412 1265 426 q 1215 397 1235 397 l 1042 397 q 990 172 1042 264 l 1151 10 q 1166 -25 1166 -5 q 1151 -60 1166 -45 q 1116 -74 1137 -74 q 1081 -60 1095 -74 l 928 93 q 916 83 924 89 q 884 61 908 77 q 833 33 859 45 q 770 10 808 20 q 694 0 732 0 l 694 694 l 595 694 l 595 0 q 517 10 556 0 q 449 36 477 21 q 398 66 421 51 q 364 91 375 81 l 353 102 l 211 -58 q 174 -74 195 -74 q 140 -62 155 -74 q 124 -28 126 -48 q 136 9 123 -7 l 293 184 q 248 397 248 273 l 74 397 q 40 412 54 397 q 25 446 25 426 q 40 481 25 467 q 74 496 54 496 l 248 496 l 248 724 l 114 858 q 99 893 99 873 q 114 928 99 913 q 149 942 129 942 q 184 928 169 942 l 318 794 l 972 794 l 1106 928 q 1141 942 1121 942 q 1176 928 1161 942 q 1190 893 1190 913 q 1176 858 1190 873 l 1042 724 l 1042 496 l 1215 496 q 1250 481 1235 496 m 893 893 l 397 893 q 469 1068 397 996 q 645 1141 542 1141 q 820 1068 748 1141 q 893 893 893 996 z "},"":{"ha":1488,"x_min":-1,"x_max":1486,"o":"m 1486 787 q 1370 560 1504 738 q 1319 494 1351 535 q 1277 438 1288 454 q 1253 400 1265 422 q 1244 367 1241 377 q 1254 340 1246 357 q 1279 307 1261 324 q 1323 266 1297 290 q 1327 263 1326 264 q 1475 91 1436 161 q 1480 82 1477 88 q 1485 61 1483 76 q 1485 35 1488 47 q 1466 14 1482 23 q 1420 4 1449 4 l 1221 1 q 1178 5 1203 -3 q 1138 22 1153 12 l 1122 31 q 1068 81 1099 47 q 1015 141 1037 114 q 968 186 993 167 q 924 198 942 204 q 918 195 922 197 q 904 184 914 193 q 888 161 895 174 q 875 121 880 147 q 870 60 869 94 q 867 39 870 49 q 861 25 864 29 l 858 21 q 817 4 844 6 l 728 4 q 615 17 673 1 q 513 58 556 33 q 433 109 469 83 q 378 153 397 135 l 359 172 q 338 195 351 180 q 282 266 324 211 q 200 383 240 321 q 105 546 160 445 q 4 757 50 648 q -1 778 -1 770 q 2 791 -1 787 l 5 795 q 49 810 16 810 l 261 811 q 279 806 270 810 q 291 800 288 803 l 295 798 q 314 773 308 789 q 350 693 329 734 q 381 629 370 651 l 394 607 q 437 526 416 560 q 475 473 458 492 q 507 443 491 454 q 533 432 522 432 q 554 436 544 432 q 558 440 556 437 q 567 457 560 443 q 578 494 574 471 q 585 556 581 516 q 585 653 589 597 q 578 710 584 684 q 567 746 573 736 l 563 755 q 497 788 543 781 q 501 807 487 790 q 530 830 513 822 q 715 849 571 850 q 820 839 779 848 q 846 828 836 835 q 862 810 856 822 q 870 785 867 798 q 873 749 873 772 q 872 707 873 727 q 870 652 871 687 q 869 588 869 618 q 868 556 869 580 q 868 519 867 532 q 870 487 868 505 q 879 457 873 469 q 897 438 886 445 q 910 435 903 436 q 930 443 917 433 q 960 470 943 453 q 1000 522 976 487 q 1053 605 1024 557 q 1135 780 1099 686 q 1143 793 1139 787 q 1152 801 1148 799 l 1155 804 q 1159 806 1156 805 q 1169 808 1161 807 q 1184 808 1177 809 l 1407 810 q 1457 808 1438 814 q 1481 795 1476 802 l 1486 787 z "},"":{"ha":1389,"x_min":0,"x_max":1382,"o":"m 523 195 q 532 249 539 222 q 497 288 524 276 q 440 288 470 298 q 394 253 410 278 q 384 200 377 226 q 417 160 391 173 q 475 158 443 148 q 523 195 506 169 m 596 289 q 599 310 602 299 q 585 324 595 320 q 563 324 574 328 q 546 309 552 319 q 556 274 533 285 q 579 275 567 270 q 596 289 591 279 m 731 206 q 608 90 696 127 q 435 81 521 53 q 320 179 352 107 q 326 324 289 250 q 443 432 362 396 q 606 446 524 467 q 729 354 692 424 q 731 206 766 284 m 973 330 q 904 462 966 405 q 742 546 842 519 q 529 563 643 574 q 243 453 357 545 q 140 248 129 361 q 209 116 147 174 q 371 32 271 59 q 584 16 470 5 q 870 125 756 33 q 973 330 984 217 m 1211 327 q 1183 219 1211 274 q 1098 113 1154 164 q 968 22 1042 62 q 792 -43 893 -19 q 583 -67 692 -67 q 370 -41 474 -67 q 183 31 266 -15 q 50 148 101 78 q 0 303 0 219 q 54 493 0 392 q 207 693 108 594 q 472 876 338 824 q 663 870 605 928 q 678 708 713 821 q 677 693 675 698 q 685 687 680 688 q 696 688 691 687 q 707 691 702 689 l 711 692 q 902 738 819 738 q 1021 691 985 738 q 1021 553 1056 642 q 1017 537 1019 543 q 1021 527 1015 532 q 1030 522 1026 523 q 1043 517 1034 520 q 1123 481 1087 503 q 1185 417 1159 458 q 1211 327 1211 377 m 1076 861 q 1099 854 1076 861 q 1154 811 1121 847 q 1196 727 1187 774 q 1191 636 1206 679 q 1168 609 1185 618 q 1134 606 1152 601 q 1108 629 1116 612 q 1104 663 1099 646 q 1086 749 1120 712 q 1003 777 1052 787 q 968 783 984 773 q 949 811 952 793 q 955 846 945 830 q 984 866 965 862 q 1076 861 1030 876 m 1294 937 q 1382 765 1362 863 q 1371 577 1401 667 q 1345 546 1364 556 q 1304 543 1325 536 q 1273 570 1283 550 q 1270 610 1263 589 q 1277 743 1291 674 q 1215 866 1263 813 q 1101 940 1167 919 q 966 946 1034 960 q 926 954 945 942 q 903 987 908 966 q 910 1027 898 1009 q 944 1050 922 1046 q 1133 1041 1039 1070 q 1294 937 1227 1012 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 878 -26 q 593 -99 746 -99 q 308 -26 441 -99 q 491 137 415 41 q 593 345 567 233 q 696 137 620 233 q 878 -26 771 41 m 494 1080 l 494 705 q 396 348 494 509 q 140 111 298 188 q 0 494 0 277 q 65 765 0 639 q 243 974 129 891 q 494 1080 356 1057 m 1190 494 q 1050 111 1190 277 q 794 348 892 188 q 696 705 696 509 l 696 1080 q 948 974 835 1057 q 1126 765 1061 891 q 1190 494 1190 639 z "},"":{"ha":1091,"x_min":0,"x_max":1087,"o":"m 1087 336 q 1028 229 1062 274 q 957 160 994 184 q 880 124 921 136 q 802 113 840 112 q 727 119 763 114 q 660 136 691 125 q 606 158 629 148 q 570 175 583 167 l 557 183 q 333 -96 470 6 q 35 -198 196 -198 q 10 -188 20 -198 q 0 -164 0 -178 q 10 -139 0 -149 q 35 -129 20 -129 q 285 -46 169 -129 q 480 182 401 36 q 424 164 452 171 q 360 154 396 157 q 289 156 323 151 q 217 178 255 161 q 146 224 179 195 q 80 301 112 253 q 22 415 48 350 q 188 459 111 451 q 318 453 266 467 q 415 409 370 439 q 483 350 459 379 q 527 286 508 320 q 588 512 568 388 q 574 510 583 511 q 538 508 566 508 q 484 508 511 507 q 421 516 458 509 q 353 534 384 522 q 288 567 321 545 q 229 617 254 588 q 187 690 205 646 q 165 789 170 735 q 269 817 219 811 q 356 817 318 824 q 427 793 394 809 q 484 755 460 777 q 527 707 508 732 q 560 658 547 683 q 581 615 573 634 q 594 584 590 596 l 597 572 q 606 723 606 667 q 589 736 600 728 q 551 770 579 743 q 502 825 524 797 q 460 898 481 854 q 435 985 440 941 q 444 1083 429 1028 q 498 1190 459 1138 q 597 1143 555 1171 q 663 1084 639 1115 q 700 1018 686 1053 q 716 949 714 983 q 715 882 718 915 q 705 823 713 850 q 691 775 698 796 q 677 742 684 754 l 672 731 q 673 692 673 728 q 672 636 673 656 q 680 651 674 642 q 703 684 685 660 q 742 729 722 708 q 798 772 763 749 q 868 806 832 794 q 955 818 905 818 q 1058 799 1005 817 q 1041 689 1056 739 q 1003 608 1026 640 q 949 553 979 577 q 885 518 918 529 q 820 499 853 506 q 758 492 787 492 q 706 493 729 491 q 670 496 683 494 l 656 498 q 600 279 639 384 q 614 293 605 284 q 652 325 623 302 q 712 366 681 348 q 789 398 743 384 q 880 414 836 413 q 980 396 925 415 q 1087 336 1035 377 z "},"":{"ha":992,"x_min":16,"x_max":976,"o":"m 976 219 l 976 168 q 931 56 976 102 q 824 10 887 10 l 780 10 l 578 -198 l 578 10 l 168 10 q 61 56 105 10 q 16 168 16 102 l 16 219 l 976 219 m 976 472 l 976 274 l 16 274 l 16 472 l 976 472 m 976 726 l 976 529 l 16 529 l 16 726 l 976 726 m 976 835 l 976 783 l 16 783 l 16 835 q 61 946 16 900 q 168 992 105 992 l 824 992 q 931 946 887 992 q 976 835 976 900 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 886 514 q 893 496 893 507 q 886 478 893 485 l 638 230 q 620 223 631 223 q 603 231 610 223 q 595 248 595 238 l 595 397 l 322 397 q 305 404 312 397 q 298 422 298 412 l 298 570 q 305 588 298 581 q 322 595 312 595 l 595 595 l 595 744 q 602 762 595 755 q 620 769 609 769 q 639 761 629 769 l 886 514 m 960 284 q 989 333 960 284 q 1017 496 1017 381 q 960 708 1017 611 q 807 861 904 805 q 595 918 710 918 q 384 861 481 918 q 230 708 287 805 q 174 496 174 611 q 230 284 174 381 q 384 131 287 188 q 595 74 481 74 q 807 131 710 74 q 960 284 904 188 m 1111 795 q 1151 726 1111 795 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 893 570 l 893 422 q 885 404 893 412 q 868 397 878 397 l 595 397 l 595 248 q 588 230 595 237 q 570 223 581 223 q 552 231 561 223 l 305 478 q 298 496 298 485 q 305 514 298 507 l 553 762 q 570 769 560 769 q 588 761 581 769 q 595 744 595 754 l 595 595 l 868 595 q 885 588 878 595 q 893 570 893 581 m 960 284 q 989 333 960 284 q 1017 496 1017 381 q 960 708 1017 611 q 807 861 904 805 q 595 918 710 918 q 384 861 481 918 q 230 708 287 805 q 174 496 174 611 q 230 284 174 381 q 384 131 287 188 q 595 74 481 74 q 807 131 710 74 q 960 284 904 188 m 1111 795 q 1151 726 1111 795 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 794 744 l 794 248 q 779 213 794 228 q 744 198 764 198 q 715 208 729 198 l 368 456 q 347 496 347 470 q 368 536 347 522 l 715 784 q 744 794 729 794 q 779 779 764 794 q 794 744 794 764 m 992 124 l 992 868 q 985 885 992 878 q 967 893 977 893 l 223 893 q 206 885 213 893 q 198 868 198 878 l 198 124 q 206 107 198 114 q 223 99 213 99 l 967 99 q 985 107 977 99 q 992 124 992 114 m 1190 868 l 1190 124 q 1125 -34 1190 32 q 967 -99 1059 -99 l 223 -99 q 65 -34 131 -99 q 0 124 0 32 l 0 868 q 65 1026 0 960 q 223 1091 131 1091 l 967 1091 q 1125 1026 1059 1091 q 1190 868 1190 960 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 736 636 q 765 607 736 636 q 794 496 794 578 q 736 356 794 414 q 595 298 677 298 q 455 356 513 298 q 397 496 397 414 q 455 636 397 578 q 595 694 513 694 q 736 636 677 694 m 807 861 q 758 889 807 861 q 595 918 710 918 q 384 861 481 918 q 230 708 287 805 q 174 496 174 611 q 230 284 174 381 q 384 131 287 188 q 595 74 481 74 q 807 131 710 74 q 960 284 904 188 q 1017 496 1017 381 q 960 708 1017 611 q 807 861 904 805 m 1111 795 q 1151 726 1111 795 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 z "},"":{"ha":1290,"x_min":0,"x_max":1263,"o":"m 793 270 l 872 112 q 709 -112 827 -26 q 446 -198 591 -198 q 223 -138 326 -198 q 60 24 120 -78 q 0 248 0 127 q 81 504 0 388 q 294 667 162 619 l 307 566 q 156 438 212 524 q 99 248 99 351 q 201 3 99 105 q 446 -99 303 -99 q 627 -49 544 -99 q 755 87 709 2 q 793 270 800 173 m 1218 193 l 1263 105 l 1064 5 q 1042 0 1054 0 q 997 27 1011 0 l 812 397 l 446 397 q 413 410 428 397 q 397 441 399 422 l 322 1045 q 327 1077 321 1058 q 371 1141 338 1117 q 446 1166 405 1166 q 534 1129 498 1166 q 570 1042 570 1093 q 530 951 570 988 q 437 918 490 913 l 466 694 l 794 694 l 794 595 l 478 595 l 491 496 l 843 496 q 887 469 874 496 l 1064 116 l 1218 193 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 1001 696 q 877 868 1009 863 q 635 666 698 874 q 698 680 669 680 q 756 606 764 680 q 698 477 753 562 q 617 391 644 391 q 553 522 584 391 q 519 720 543 564 q 395 857 495 867 q 267 780 349 852 q 205 724 246 761 q 142 668 163 687 l 182 616 q 250 656 241 656 q 332 518 294 656 q 367 390 344 475 q 402 263 391 305 q 529 124 455 124 q 826 352 651 124 q 1001 696 997 571 m 1190 868 l 1190 124 q 1125 -34 1190 32 q 967 -99 1059 -99 l 223 -99 q 65 -34 131 -99 q 0 124 0 32 l 0 868 q 65 1026 0 960 q 223 1091 131 1091 l 967 1091 q 1125 1026 1059 1091 q 1190 868 1190 960 z "},"":{"ha":893,"x_min":0,"x_max":893,"o":"m 893 546 q 820 272 893 398 q 621 73 746 146 q 347 0 495 0 l 223 0 q 205 7 212 0 q 198 25 198 14 l 198 498 l 32 447 q 25 446 29 446 q 10 451 17 446 q 0 471 0 459 l 0 570 q 18 594 0 588 l 198 649 l 198 722 l 32 670 q 25 670 29 670 q 10 674 17 670 q 0 694 0 682 l 0 794 q 18 818 0 811 l 198 873 l 198 1066 q 205 1084 198 1077 q 223 1091 212 1091 l 347 1091 q 365 1084 358 1091 q 372 1066 372 1077 l 372 926 l 663 1016 q 684 1012 674 1020 q 694 992 694 1004 l 694 893 q 677 869 694 875 l 372 775 l 372 703 l 663 793 q 684 789 674 797 q 694 769 694 781 l 694 670 q 677 646 694 652 l 372 552 l 372 174 q 618 291 518 184 q 719 546 719 398 q 726 563 719 556 q 744 570 733 570 l 868 570 q 886 563 879 570 q 893 546 893 556 z "},"":{"ha":1091,"x_min":0,"x_max":1091,"o":"m 893 570 l 893 521 q 886 503 893 510 q 868 496 879 496 l 595 496 l 595 223 q 588 205 595 212 q 570 198 581 198 l 521 198 q 503 205 510 198 q 496 223 496 212 l 496 496 l 223 496 q 205 503 212 496 q 198 521 198 510 l 198 570 q 205 588 198 581 q 223 595 212 595 l 496 595 l 496 868 q 503 886 496 879 q 521 893 510 893 l 570 893 q 588 886 581 893 q 595 868 595 879 l 595 595 l 868 595 q 886 588 879 595 q 893 570 893 581 m 992 223 l 992 868 q 956 956 992 919 q 868 992 919 992 l 223 992 q 136 956 172 992 q 99 868 99 919 l 99 223 q 136 136 99 172 q 223 99 172 99 l 868 99 q 956 136 919 99 q 992 223 992 172 m 1091 868 l 1091 223 q 1026 65 1091 131 q 868 0 960 0 l 223 0 q 65 65 131 0 q 0 223 0 131 l 0 868 q 65 1026 0 960 q 223 1091 131 1091 l 868 1091 q 1026 1026 960 1091 q 1091 868 1091 960 z "},"":{"ha":1687,"x_min":0,"x_max":1687,"o":"m 481 322 q 273 273 395 273 l 174 273 l 174 322 l 124 322 q 107 341 114 322 q 99 384 99 359 q 105 422 99 403 q 30 431 60 424 q 0 446 0 437 q 30 462 0 456 q 105 470 60 469 q 99 508 99 490 q 107 552 99 534 q 124 570 114 570 l 174 570 l 174 620 l 273 620 q 481 570 395 620 l 1343 570 q 1426 556 1376 565 q 1488 546 1476 548 q 1604 514 1557 534 q 1669 477 1652 494 q 1687 446 1687 460 q 1669 415 1687 432 q 1604 379 1652 398 q 1488 347 1557 359 q 1426 336 1476 345 q 1343 322 1376 328 l 481 322 m 1348 518 q 1389 446 1389 490 q 1348 375 1389 403 l 1411 352 q 1463 446 1463 389 q 1411 541 1463 504 l 1348 518 m 484 310 l 1271 310 q 918 248 1103 281 q 830 229 873 248 q 766 192 787 211 l 744 174 l 521 -50 q 466 -84 501 -70 q 397 -99 432 -99 l 322 -99 l 250 260 l 273 260 q 484 310 395 260 m 273 632 l 250 632 l 322 992 l 397 992 q 467 977 432 992 q 521 942 501 963 l 744 719 q 753 711 747 716 q 776 693 758 706 q 814 671 794 680 q 861 653 833 661 q 918 645 890 645 l 1271 583 l 484 583 q 273 632 395 632 z "},"":{"ha":1290,"x_min":0,"x_max":1290,"o":"m 1177 589 q 1258 558 1225 589 q 1290 479 1290 526 q 1218 378 1290 404 l 1084 332 l 1128 203 q 1133 167 1133 187 q 1101 88 1133 121 q 1022 54 1068 54 q 956 75 986 54 q 915 131 926 96 l 872 259 l 632 177 l 674 50 q 680 13 680 31 q 648 -66 680 -33 q 569 -99 615 -99 q 503 -78 532 -99 q 462 -22 474 -57 l 419 104 l 301 63 q 262 56 278 56 q 183 87 215 56 q 152 165 152 118 q 173 231 152 202 q 229 272 195 260 l 350 313 l 268 556 l 147 514 q 110 508 127 508 q 32 539 64 508 q 0 617 0 570 q 21 683 0 653 q 77 724 43 712 l 198 765 l 157 888 q 151 925 151 907 q 184 1004 151 971 q 263 1037 216 1037 q 329 1016 299 1037 q 370 960 358 995 l 412 836 l 652 918 l 610 1042 q 604 1078 604 1060 q 637 1157 604 1124 q 715 1190 670 1190 q 782 1169 752 1190 q 823 1114 811 1148 l 864 989 l 990 1032 q 1023 1036 1006 1036 q 1103 1006 1070 1036 q 1135 929 1135 975 q 1112 866 1135 894 q 1055 826 1089 838 l 933 784 l 1015 539 l 1142 583 q 1177 589 1160 589 m 562 386 l 802 467 l 721 711 l 481 629 l 562 386 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 967 1091 q 1125 1026 1059 1091 q 1190 868 1190 960 l 1190 124 q 1125 -34 1190 32 q 967 -99 1059 -99 l 223 -99 q 65 -34 131 -99 q 0 124 0 32 l 0 868 q 65 1026 0 960 q 223 1091 131 1091 l 967 1091 m 992 273 l 992 611 q 942 568 968 584 q 840 502 916 551 q 722 426 763 453 q 595 372 646 372 l 595 372 l 595 372 q 468 426 544 372 q 358 497 432 450 q 248 569 284 544 q 222 590 239 575 q 198 611 206 605 l 198 273 q 220 220 198 242 q 273 198 242 198 l 918 198 q 970 220 949 198 q 992 273 992 242 m 992 717 q 971 771 992 749 q 918 794 949 794 l 273 794 q 220 772 242 794 q 198 719 198 750 q 222 660 198 691 q 274 610 246 629 q 381 541 311 585 q 481 477 451 497 q 494 468 484 475 q 511 457 505 460 q 527 447 516 453 q 545 437 538 440 q 562 429 553 433 q 579 424 571 426 q 595 422 587 422 q 611 424 603 422 q 629 429 619 426 q 645 437 638 433 q 663 447 653 440 q 680 457 674 453 q 696 468 685 460 q 709 477 707 475 l 916 612 q 968 660 943 629 q 992 717 992 691 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 98 496 q 150 739 98 622 l 435 -40 q 191 177 283 33 q 98 496 98 322 m 1097 526 q 1095 496 1097 512 q 1087 458 1093 481 q 1078 424 1081 435 q 1065 378 1075 413 q 1051 333 1054 343 l 992 135 l 777 775 q 845 781 812 777 q 865 796 860 783 q 863 820 870 808 q 841 830 856 831 l 682 822 q 525 830 624 823 q 510 826 516 831 q 501 815 503 822 q 500 800 498 808 q 506 787 501 793 q 522 781 512 782 l 584 775 l 677 521 l 546 130 l 329 775 q 398 781 365 777 q 418 796 412 783 q 416 820 423 808 q 394 830 408 831 l 235 822 q 217 823 229 822 q 197 823 205 823 q 410 1020 278 947 q 694 1092 541 1092 q 912 1051 808 1092 q 1097 935 1015 1010 l 1089 935 q 1018 904 1046 935 q 989 830 989 873 q 991 811 989 821 q 994 795 992 802 q 1000 777 995 787 q 1007 761 1004 767 q 1016 743 1009 755 q 1026 727 1023 732 q 1037 708 1028 722 q 1048 691 1046 694 q 1097 526 1097 608 m 705 444 l 888 -57 q 892 -66 889 -62 q 694 -100 794 -100 q 526 -75 608 -100 l 705 444 m 1217 782 q 1290 496 1290 647 q 1210 197 1290 334 q 994 -19 1129 60 l 1176 507 q 1221 721 1221 638 q 1217 782 1221 753 m 425 1135 q 489 1163 425 1135 q 694 1190 553 1190 q 964 1135 836 1190 q 1186 987 1093 1080 q 1334 766 1279 894 q 1389 496 1389 637 q 1334 226 1389 355 q 1186 5 1279 98 q 964 -143 1093 -88 q 694 -198 836 -198 q 425 -143 553 -198 q 203 5 296 -88 q 55 226 110 98 q 0 496 0 355 q 55 766 0 637 q 203 987 110 894 q 425 1135 296 1080 m 438 -114 q 499 -140 438 -114 q 694 -167 560 -167 q 951 -114 829 -167 q 1163 28 1074 -61 q 1304 239 1252 116 q 1357 496 1357 362 q 1304 753 1357 630 q 1163 965 1252 876 q 951 1106 1074 1053 q 694 1159 829 1159 q 438 1106 560 1159 q 226 965 315 1053 q 84 753 137 876 q 32 496 32 630 q 84 239 32 362 q 226 28 137 116 q 438 -114 315 -61 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 842 1190 l 842 0 l 631 -99 q 310 -20 454 -84 q 83 141 166 43 q 0 353 0 239 q 78 557 0 461 q 291 716 156 653 q 594 800 426 780 l 594 667 q 318 550 426 637 q 210 353 210 463 q 330 146 210 235 q 631 33 450 57 l 631 1087 l 842 1190 m 1360 739 l 1389 437 l 982 525 l 1096 590 q 879 667 1004 644 l 879 800 q 1252 678 1094 774 l 1360 739 z "},"":{"ha":1587,"x_min":0,"x_max":1488,"o":"m 744 1190 l 1488 893 l 1488 794 l 1389 794 q 1373 759 1389 773 q 1335 744 1357 744 l 153 744 q 115 759 131 744 q 99 794 99 773 l 0 794 l 0 893 l 744 1190 m 198 694 l 397 694 l 397 99 l 496 99 l 496 694 l 694 694 l 694 99 l 794 99 l 794 694 l 992 694 l 992 99 l 1091 99 l 1091 694 l 1290 694 l 1290 99 l 1335 99 q 1373 84 1357 99 q 1389 50 1389 70 l 1389 0 l 99 0 l 99 50 q 115 84 99 70 q 153 99 131 99 l 198 99 l 198 694 m 1435 -50 q 1472 -64 1456 -50 q 1488 -99 1488 -79 l 1488 -198 l 0 -198 l 0 -99 q 16 -64 0 -79 q 53 -50 32 -50 l 1435 -50 z "},"":{"ha":1786,"x_min":0,"x_max":1786,"o":"m 1375 543 l 1389 298 q 1325 198 1392 244 q 1143 126 1259 153 q 893 99 1028 99 q 643 126 758 99 q 460 198 527 153 q 397 298 394 244 l 411 543 l 856 402 q 893 397 873 397 q 930 402 913 397 l 1375 543 m 1769 818 q 1786 794 1786 811 q 1769 770 1786 776 l 901 497 q 893 496 898 496 q 885 497 888 496 l 380 656 q 325 570 346 630 q 298 432 303 510 q 347 347 347 404 q 302 264 347 294 l 347 -71 q 341 -91 349 -82 q 322 -99 334 -99 l 174 -99 q 155 -91 162 -99 q 149 -71 147 -82 l 194 264 q 149 347 149 294 q 199 433 149 404 q 275 689 208 594 l 17 770 q 0 794 0 776 q 17 818 0 811 l 885 1090 q 893 1091 888 1091 q 901 1090 898 1091 l 1769 818 z "},"":{"ha":1190,"x_min":84,"x_max":1106,"o":"m 666 449 l 676 -99 q 594 -91 628 -91 q 513 -99 563 -91 l 523 449 q 393 678 492 502 q 225 968 293 853 q 84 1190 157 1083 q 168 1179 129 1179 q 254 1190 202 1179 q 358 1013 303 1104 q 487 798 412 921 q 594 622 562 676 q 679 760 623 670 q 770 907 736 850 q 852 1044 805 964 q 935 1190 898 1123 q 1018 1180 977 1180 q 1106 1190 1061 1180 l 1106 1190 q 1059 1122 1084 1160 q 1021 1061 1035 1084 q 977 987 1008 1039 q 939 922 947 935 q 666 449 826 729 z "},"":{"ha":1190,"x_min":0,"x_max":1166,"o":"m 595 581 l 1157 581 q 1166 482 1166 529 q 1096 182 1166 314 q 895 -25 1025 50 q 595 -99 764 -99 q 363 -52 474 -99 q 174 74 253 -5 q 47 264 94 154 q 0 496 0 374 q 47 728 0 618 q 174 918 94 838 q 363 1044 253 997 q 595 1091 474 1091 q 994 935 828 1091 l 832 780 q 595 872 737 872 q 410 822 495 872 q 276 685 326 771 q 226 496 226 598 q 276 307 226 394 q 410 171 326 221 q 595 120 495 120 q 719 139 663 120 q 812 185 776 157 q 876 249 849 213 q 916 316 903 284 q 933 377 929 348 l 595 377 l 595 581 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 849 286 q 849 262 861 274 q 694 214 801 214 q 540 262 588 214 q 540 286 528 274 q 552 291 545 291 q 563 286 559 291 q 694 248 601 248 q 825 286 787 248 q 837 291 830 291 q 849 286 844 291 m 591 475 q 601 465 591 475 q 611 426 611 455 q 591 377 611 398 q 542 357 570 357 q 493 377 513 357 q 472 426 472 398 q 493 476 472 456 q 542 496 513 496 q 591 475 570 496 m 917 426 q 896 377 917 398 q 847 357 876 357 q 798 377 818 357 q 778 426 778 398 q 798 475 778 455 q 847 496 818 496 q 896 476 876 496 q 917 426 917 456 m 1111 519 q 1084 584 1111 557 q 1018 612 1057 612 q 952 584 980 612 q 711 658 851 653 l 760 877 l 915 842 q 935 794 915 814 q 984 773 955 773 q 1033 794 1012 773 q 1053 843 1053 815 q 1033 892 1053 872 q 984 913 1012 913 q 922 874 942 913 l 750 912 q 731 900 736 916 l 677 658 q 438 583 538 653 q 370 612 411 612 q 305 584 332 612 q 277 519 277 557 q 292 470 277 492 q 330 436 306 447 q 326 392 326 415 q 434 204 326 282 q 695 126 543 126 q 957 204 849 126 q 1066 392 1066 282 q 1060 436 1066 417 q 1097 470 1084 448 q 1111 519 1111 492 m 1334 766 q 1361 701 1334 766 q 1389 496 1389 637 q 1334 226 1389 355 q 1186 5 1279 98 q 964 -143 1093 -88 q 694 -198 836 -198 q 425 -143 553 -198 q 203 5 296 -88 q 55 226 110 98 q 0 496 0 355 q 55 766 0 637 q 203 987 110 894 q 425 1135 296 1080 q 694 1190 553 1190 q 964 1135 836 1190 q 1186 987 1093 1080 q 1334 766 1279 894 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 728 315 q 728 295 738 305 q 595 254 687 254 q 463 295 504 254 q 463 315 453 305 q 473 320 467 320 q 483 315 479 320 q 595 283 515 283 q 708 315 675 283 q 718 320 711 320 q 728 315 724 320 m 524 436 q 506 395 524 412 q 464 377 488 377 q 422 395 440 377 q 405 436 405 412 q 422 479 405 461 q 464 496 439 496 q 506 479 489 496 q 524 436 524 461 m 786 436 q 768 395 786 412 q 726 377 750 377 q 684 395 702 377 q 667 436 667 412 q 684 479 667 461 q 726 496 701 496 q 768 479 751 496 q 786 436 786 461 m 953 516 q 929 572 953 549 q 873 595 906 595 q 816 571 840 595 q 609 635 729 632 l 651 823 l 784 793 q 802 751 784 768 q 843 734 819 734 q 885 751 868 734 q 903 794 903 769 q 885 836 903 818 q 843 853 868 853 q 790 820 806 853 l 643 853 q 627 842 630 856 l 581 635 q 375 570 461 630 q 318 595 352 595 q 261 572 284 595 q 238 516 238 549 q 250 474 238 493 q 283 444 263 454 q 279 407 279 425 q 372 245 279 312 q 596 178 465 178 q 821 245 728 178 q 914 407 914 312 q 909 445 914 426 q 941 474 929 455 q 953 516 953 493 m 1190 868 l 1190 124 q 1125 -34 1190 32 q 967 -99 1059 -99 l 223 -99 q 65 -34 131 -99 q 0 124 0 32 l 0 868 q 65 1026 0 960 q 223 1091 131 1091 l 967 1091 q 1125 1026 1059 1091 q 1190 868 1190 960 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 671 540 l 741 561 l 741 609 q 696 714 741 670 q 589 757 651 757 q 482 714 527 757 q 437 610 437 671 l 437 391 q 426 365 437 375 q 401 354 415 354 q 376 365 386 354 q 365 391 365 375 l 365 484 l 248 484 l 248 389 q 293 281 248 326 q 401 237 337 237 q 508 281 463 237 q 553 387 553 325 l 553 604 q 563 629 553 618 q 589 640 574 640 q 614 629 604 640 q 625 604 625 618 l 625 562 l 671 540 m 929 389 l 929 484 l 813 484 l 813 386 q 803 360 813 370 q 777 350 792 350 q 751 360 762 350 q 741 386 741 371 l 741 481 l 671 461 l 625 483 l 625 388 q 670 281 625 326 q 777 237 715 237 q 885 281 840 237 q 929 389 929 326 m 1111 795 q 1151 726 1111 795 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 z "},"":{"ha":1488,"x_min":0,"x_max":1488,"o":"m 823 639 l 823 730 q 800 786 823 763 q 744 809 777 809 q 688 786 711 809 q 665 730 665 763 l 665 256 q 567 24 665 120 q 332 -72 470 -72 q 97 25 195 -72 q 0 260 0 122 l 0 467 l 254 467 l 254 264 q 277 207 254 230 q 333 184 301 184 q 389 207 366 184 q 412 264 412 230 l 412 744 q 510 970 412 877 q 744 1064 608 1064 q 978 970 880 1064 q 1076 742 1076 875 l 1076 636 l 925 591 l 823 639 m 1234 467 l 1488 467 l 1488 260 q 1391 25 1488 122 q 1156 -72 1294 -72 q 921 24 1018 -72 q 823 257 823 121 l 823 465 l 925 418 l 1076 463 l 1076 253 q 1099 198 1076 221 q 1155 175 1122 175 q 1211 198 1187 175 q 1234 253 1234 221 l 1234 467 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 1141 124 l 1141 496 l 595 496 l 595 1042 l 223 1042 q 100 991 151 1042 q 50 868 50 940 l 50 496 l 595 496 l 595 -50 l 967 -50 q 1090 1 1039 -50 q 1141 124 1141 52 m 1190 868 l 1190 124 q 1125 -34 1190 32 q 967 -99 1059 -99 l 223 -99 q 65 -34 131 -99 q 0 124 0 32 l 0 868 q 65 1026 0 960 q 223 1091 131 1091 l 967 1091 q 1125 1026 1059 1091 q 1190 868 1190 960 z "},"":{"ha":1587,"x_min":0,"x_max":1587,"o":"m 254 972 l 412 972 l 412 210 l 0 210 l 0 750 l 254 750 l 254 972 m 254 337 l 254 623 l 159 623 l 159 337 l 254 337 m 476 750 l 476 210 l 635 210 l 635 750 l 476 750 m 476 972 l 476 814 l 635 814 l 635 972 l 476 972 m 698 750 l 1111 750 l 1111 20 l 698 20 l 698 146 l 953 146 l 953 210 l 698 210 l 698 750 m 953 337 l 953 623 l 857 623 l 857 337 l 953 337 m 1175 750 l 1587 750 l 1587 20 l 1175 20 l 1175 146 l 1428 146 l 1428 210 l 1175 210 l 1175 750 m 1428 337 l 1428 623 l 1333 623 l 1333 337 l 1428 337 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 781 485 q 796 467 781 485 q 811 400 811 450 q 781 315 811 350 q 711 281 752 281 q 656 292 677 281 l 656 507 q 711 520 678 520 q 781 485 752 520 m 515 816 q 530 799 515 816 q 545 732 545 781 q 515 647 545 682 q 445 612 486 612 q 391 623 412 612 l 391 838 q 445 851 412 851 q 515 816 486 851 m 912 220 q 946 257 912 220 q 980 398 980 294 q 912 575 980 501 q 747 649 844 649 q 717 646 732 649 q 656 541 699 586 q 493 463 589 467 l 493 -30 l 656 2 l 656 161 q 747 146 696 146 q 912 220 844 146 m 646 551 q 680 588 646 551 q 715 729 715 625 q 646 906 715 832 q 481 980 577 980 q 371 952 423 980 l 227 952 l 227 301 l 391 332 l 391 492 q 481 477 433 477 q 646 551 577 477 m 1190 868 l 1190 124 q 1125 -34 1190 32 q 967 -99 1059 -99 l 223 -99 q 65 -34 131 -99 q 0 124 0 32 l 0 868 q 65 1026 0 960 q 223 1091 131 1091 l 967 1091 q 1125 1026 1059 1091 q 1190 868 1190 960 z "},"":{"ha":1580,"x_min":32,"x_max":1548,"o":"m 947 470 q 1058 455 1005 473 q 1150 409 1111 436 q 1228 336 1188 382 q 1293 252 1268 290 q 1352 159 1318 215 q 1413 74 1377 115 q 1471 12 1448 33 q 1548 -57 1494 -9 q 1464 -101 1511 -80 q 1356 -147 1417 -122 q 1268 -184 1296 -171 q 1211 -95 1234 -155 q 1177 33 1187 -34 q 1151 173 1166 100 q 1118 303 1136 246 q 1062 399 1101 361 q 967 436 1024 436 l 960 435 l 955 432 q 965 421 958 428 q 987 403 970 417 q 1006 386 1004 388 q 1021 372 1009 383 q 1035 356 1033 360 q 1044 339 1037 351 q 1052 318 1051 328 q 1056 294 1053 308 q 1059 263 1058 280 l 1059 237 q 1058 193 1060 217 q 1052 152 1055 168 q 1042 107 1049 136 q 1033 66 1035 78 q 955 59 1006 67 q 879 50 904 50 q 823 58 849 50 q 822 95 822 71 q 824 169 822 152 q 848 201 825 179 q 892 247 871 223 q 913 287 914 270 q 880 268 894 288 q 793 191 852 227 q 687 155 735 155 q 629 204 668 155 q 546 312 590 253 q 481 387 503 371 q 460 410 477 390 q 63 323 87 323 q 41 332 50 323 q 32 353 32 340 q 38 373 32 364 q 56 384 45 382 l 432 467 q 426 486 426 477 q 431 500 426 494 q 443 508 435 505 q 458 514 451 512 q 476 517 466 515 q 491 521 487 519 q 503 527 494 522 q 516 532 512 532 q 538 519 528 532 q 553 494 548 507 q 687 522 680 522 q 710 514 700 522 q 719 492 719 505 q 713 472 719 481 q 694 461 706 463 l 553 430 l 553 418 q 616 327 552 398 q 697 256 680 256 q 789 318 733 256 q 845 418 845 380 q 827 459 845 446 q 787 473 808 472 q 748 482 766 474 q 729 508 729 490 q 737 535 729 521 l 684 550 q 718 640 718 584 q 714 685 718 660 q 825 698 777 698 q 881 696 860 698 q 918 690 902 695 q 942 679 935 684 q 958 660 950 674 q 970 634 966 646 q 984 598 974 622 q 1002 551 993 573 l 1041 570 q 1023 524 1039 539 q 990 508 1008 508 q 959 503 973 507 q 946 487 946 498 l 947 470 m 994 653 q 983 665 990 656 q 974 676 977 673 q 966 685 971 679 q 958 693 960 691 q 952 699 956 695 q 945 705 948 703 q 939 709 942 707 q 932 712 935 711 q 921 716 927 715 q 905 718 915 718 q 888 718 895 718 q 863 718 881 718 q 834 718 845 718 q 666 685 736 718 q 694 721 678 708 q 736 744 709 734 q 786 772 762 754 q 822 800 811 790 q 861 843 833 811 q 894 882 888 875 q 916 858 904 875 q 941 829 929 840 q 970 819 953 818 l 980 820 l 980 761 l 997 760 q 1284 908 1188 834 q 1323 938 1306 924 q 1356 967 1340 952 q 1382 991 1372 982 q 1404 1017 1391 1000 q 1423 1041 1418 1035 q 1442 1070 1428 1048 q 1460 1099 1456 1092 q 1481 1136 1464 1107 q 1504 1177 1497 1166 l 1509 1184 q 1476 1077 1507 1143 q 1317 872 1414 949 q 1080 762 1219 795 q 1047 756 1069 760 q 1008 749 1025 753 q 978 738 991 745 q 997 702 980 723 q 1014 676 1014 681 q 994 653 1014 667 m 822 -61 q 924 -24 853 -41 q 1038 -8 996 -8 q 1055 -20 1045 -8 q 1077 -53 1066 -32 q 1097 -91 1088 -74 q 1116 -131 1106 -109 q 1127 -157 1125 -153 q 938 -191 1033 -191 q 841 -183 891 -191 l 822 -61 m 637 440 l 674 450 l 759 312 l 702 275 l 637 440 m 1025 40 q 1028 27 1028 28 q 1014 16 1028 22 q 979 6 1001 10 q 937 -2 956 2 q 895 -7 917 -5 q 870 -11 873 -10 l 865 22 q 912 29 881 24 q 968 37 942 34 q 1015 40 993 40 l 1025 40 m 671 526 l 597 511 l 592 524 q 617 529 600 525 q 644 534 635 534 q 671 526 659 534 m 822 35 l 846 35 l 854 -29 l 822 -39 l 822 35 m 1511 1190 l 1511 1190 l 1511 1190 m 1511 1190 l 1511 1186 l 1509 1184 l 1510 1187 l 1511 1190 m 1511 1190 l 1512 1190 l 1511 1190 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 904 -39 q 886 -35 901 -24 q 818 -65 863 -52 q 717 -78 774 -78 q 567 -40 617 -78 q 557 -37 563 -37 q 537 -47 549 -37 q 531 -59 532 -51 q 537 -74 531 -67 q 605 -110 563 -99 q 684 -120 646 -121 q 761 -116 722 -119 q 827 -100 793 -113 q 877 -77 860 -88 q 899 -61 894 -67 q 904 -39 908 -52 m 874 50 q 844 98 860 87 q 785 109 826 109 q 730 102 749 109 q 670 58 708 92 q 660 24 649 40 q 674 21 667 18 q 698 39 680 23 q 706 45 701 40 q 715 52 712 50 q 722 57 717 53 q 731 63 728 61 q 741 67 735 64 q 753 70 747 69 q 765 72 758 71 q 781 73 773 73 q 816 67 802 73 q 834 56 829 61 q 844 39 838 50 q 854 23 852 26 q 863 24 856 21 q 874 50 881 33 m 1149 268 q 1146 303 1149 285 q 1133 338 1142 320 q 1106 366 1124 355 q 1066 377 1089 377 q 991 345 1040 377 q 891 280 941 312 q 812 247 840 247 q 763 262 791 246 q 704 300 735 277 q 639 345 674 322 q 562 383 605 367 q 476 398 519 398 q 323 337 387 397 q 258 198 260 277 q 315 71 257 112 q 364 49 338 56 q 444 43 390 43 q 546 68 488 43 q 650 123 605 93 q 743 177 696 153 q 815 202 791 202 q 866 177 836 201 q 921 125 896 153 q 974 73 946 97 q 1017 48 1001 49 q 1062 59 1044 46 q 1105 108 1080 72 q 1138 186 1127 140 q 1149 268 1149 233 m 1190 392 q 1142 156 1190 265 q 1014 -27 1094 47 q 826 -143 933 -101 q 601 -184 718 -184 q 374 -140 483 -184 q 182 -18 264 -95 q 50 169 99 59 q 0 403 0 279 q 15 537 0 472 q 53 649 30 601 q 108 741 76 698 q 169 814 140 785 q 229 868 198 843 q 279 904 261 893 q 312 923 298 915 q 352 944 323 929 q 394 966 381 958 q 431 989 408 973 q 478 1023 455 1004 q 523 1079 506 1045 q 546 1177 540 1114 q 691 1027 646 1056 q 791 974 725 1004 q 891 923 858 944 q 922 904 908 913 q 968 868 935 894 q 1027 813 1001 841 q 1085 739 1053 785 q 1139 645 1118 694 q 1175 530 1160 596 q 1190 392 1190 463 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 829 359 l 705 235 l 588 117 l 565 94 q 448 26 515 44 q 315 25 381 9 q 259 -64 302 -29 q 159 -99 215 -99 q 47 -52 93 -99 q 0 60 0 -5 q 34 160 0 116 q 122 215 69 203 q 123 350 105 282 q 191 467 141 417 l 201 477 l 318 359 l 309 350 q 281 281 281 322 q 309 212 281 241 q 378 183 338 183 q 447 212 419 183 l 470 235 l 587 353 l 712 477 l 829 359 m 565 887 l 574 878 l 457 760 l 447 770 q 378 798 419 798 q 309 770 338 798 q 281 700 281 741 q 309 631 281 660 l 332 608 l 450 491 l 574 367 l 457 249 l 332 373 l 215 491 l 191 514 q 122 637 139 566 q 126 777 105 709 q 36 832 71 788 q 2 932 2 875 q 48 1044 2 997 q 160 1091 95 1091 q 264 1053 219 1091 q 318 958 308 1015 q 449 955 383 973 q 565 887 515 937 m 1190 60 q 1144 -52 1190 -5 q 1032 -99 1097 -99 q 930 -63 974 -99 q 875 29 886 -26 q 736 24 808 7 q 611 94 663 41 l 602 103 l 719 221 l 729 212 q 798 183 757 183 q 867 212 838 183 q 895 281 895 240 q 867 350 895 321 l 843 373 l 725 491 l 601 615 l 719 732 l 843 608 l 961 491 l 984 467 q 1051 351 1033 418 q 1053 218 1070 284 q 1151 165 1112 209 q 1190 60 1190 120 m 1189 932 q 1149 827 1189 872 q 1051 773 1110 782 q 1053 637 1071 708 q 984 514 1035 566 l 974 505 l 857 622 l 867 632 q 895 701 895 660 q 867 770 895 741 q 798 798 838 798 q 729 770 757 798 l 705 746 l 587 629 l 463 505 l 346 622 l 470 746 l 588 864 l 611 887 q 734 957 663 939 q 872 954 805 974 q 925 1052 880 1012 q 1030 1091 970 1091 q 1142 1044 1096 1091 q 1189 932 1189 997 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 507 355 q 497 355 506 353 q 473 364 488 358 l 457 371 q 390 409 423 387 q 358 434 384 413 q 329 456 332 454 q 225 315 277 376 q 143 230 162 242 q 128 227 140 229 q 114 227 116 226 q 177 298 119 230 q 244 388 194 317 q 305 479 294 458 q 344 555 318 502 q 372 615 370 608 q 287 590 366 616 q 265 584 281 588 q 239 577 250 580 q 226 573 227 574 q 224 565 224 571 q 223 557 224 558 q 199 546 219 550 q 163 546 181 540 q 141 562 149 549 q 137 580 138 567 q 156 584 142 581 q 179 588 171 586 q 260 613 224 601 q 339 640 338 640 q 373 655 347 642 q 407 672 398 669 q 424 678 414 674 q 435 682 433 682 q 439 682 436 683 q 439 656 441 673 q 429 636 439 655 q 408 594 419 616 q 395 568 398 572 q 336 467 376 529 l 385 445 q 443 420 395 440 q 495 398 491 400 q 503 379 498 398 q 507 355 508 360 m 348 732 q 345 710 350 720 q 306 680 336 692 q 260 671 283 671 q 222 691 239 674 q 208 723 211 703 l 208 725 q 224 722 211 723 q 244 722 236 720 q 289 734 252 723 q 332 745 317 743 q 348 732 345 745 m 889 632 l 938 456 l 830 488 l 889 632 m 30 12 l 568 191 l 568 991 l 30 811 l 30 12 m 992 257 l 1071 233 l 931 742 l 853 767 l 686 351 l 765 327 l 800 412 l 963 362 l 992 257 m 602 1003 l 1046 860 l 1046 1155 l 602 1003 m 843 -22 l 966 -33 l 924 -157 l 893 -105 q 679 -189 792 -170 q 608 -198 634 -198 l 543 -198 q 389 -168 482 -198 q 246 -102 295 -138 q 240 -90 240 -97 q 244 -79 240 -84 q 254 -75 248 -75 q 268 -81 257 -75 q 292 -94 279 -87 q 308 -102 305 -101 q 431 -150 364 -131 q 553 -169 498 -169 q 683 -158 627 -169 q 805 -119 739 -146 q 828 -107 816 -113 q 854 -92 840 -100 q 877 -79 869 -84 l 843 -22 m 1190 814 l 1190 -22 l 591 168 q 300 69 580 164 q 15 -25 20 -25 q 1 -15 5 -25 q 0 -12 1 -14 l 0 823 q 3 831 2 830 q 19 839 7 836 q 134 878 102 867 l 134 1176 l 567 1022 q 691 1065 568 1022 q 936 1149 814 1108 q 1061 1190 1058 1190 q 1077 1174 1077 1190 l 1077 850 l 1190 814 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 223 893 q 311 856 274 893 q 347 769 347 820 l 347 -74 q 311 -162 347 -126 q 223 -198 274 -198 l 124 -198 q 36 -162 73 -198 q 0 -74 0 -126 l 0 769 q 36 856 0 820 q 124 893 73 893 l 223 893 m 1290 767 q 1362 694 1335 740 q 1389 595 1389 649 l 1389 0 q 1331 -140 1389 -82 q 1190 -198 1273 -198 l 521 -198 q 433 -162 470 -198 q 397 -74 397 -126 l 397 1116 q 419 1169 397 1147 q 471 1190 440 1190 l 992 1190 q 1060 1175 1023 1190 q 1119 1138 1097 1159 l 1237 1020 q 1274 961 1259 998 q 1290 893 1290 924 l 1290 767 m 719 0 l 719 99 q 712 117 719 110 q 694 124 705 124 l 595 124 q 577 117 584 124 q 570 99 570 110 l 570 0 q 577 -18 570 -11 q 595 -25 584 -25 l 694 -25 q 712 -18 705 -25 q 719 0 719 -11 m 719 198 l 719 298 q 712 315 719 308 q 694 322 705 322 l 595 322 q 577 315 584 322 q 570 298 570 308 l 570 198 q 577 181 570 188 q 595 174 584 174 l 694 174 q 712 181 705 174 q 719 198 719 188 m 719 397 l 719 496 q 712 514 719 507 q 694 521 705 521 l 595 521 q 577 514 584 521 q 570 496 570 507 l 570 397 q 577 379 570 386 q 595 372 584 372 l 694 372 q 712 379 705 372 q 719 397 719 386 m 918 0 l 918 99 q 911 117 918 110 q 893 124 904 124 l 794 124 q 776 117 783 124 q 769 99 769 110 l 769 0 q 776 -18 769 -11 q 794 -25 783 -25 l 893 -25 q 911 -18 904 -25 q 918 0 918 -11 m 918 198 l 918 298 q 911 315 918 308 q 893 322 904 322 l 794 322 q 776 315 783 322 q 769 298 769 308 l 769 198 q 776 181 769 188 q 794 174 783 174 l 893 174 q 911 181 904 174 q 918 198 918 188 m 918 397 l 918 496 q 911 514 918 507 q 893 521 904 521 l 794 521 q 776 514 783 521 q 769 496 769 507 l 769 397 q 776 379 769 386 q 794 372 783 372 l 893 372 q 911 379 904 372 q 918 397 918 386 m 1116 0 l 1116 99 q 1109 117 1116 110 q 1091 124 1102 124 l 992 124 q 974 117 981 124 q 967 99 967 110 l 967 0 q 974 -18 967 -11 q 992 -25 981 -25 l 1091 -25 q 1109 -18 1102 -25 q 1116 0 1116 -11 m 1116 198 l 1116 298 q 1109 315 1116 308 q 1091 322 1102 322 l 992 322 q 974 315 981 322 q 967 298 967 308 l 967 198 q 974 181 967 188 q 992 174 981 174 l 1091 174 q 1109 181 1102 174 q 1116 198 1116 188 m 1116 397 l 1116 496 q 1109 514 1116 507 q 1091 521 1102 521 l 992 521 q 974 514 981 521 q 967 496 967 507 l 967 397 q 974 379 967 386 q 992 372 981 372 l 1091 372 q 1109 379 1102 372 q 1116 397 1116 386 m 1190 694 l 1190 893 l 1066 893 q 1014 915 1035 893 q 992 967 992 936 l 992 1091 l 496 1091 l 496 694 l 1190 694 z "},"":{"ha":1190,"x_min":0,"x_max":1091,"o":"m 1042 1190 q 1077 1176 1062 1190 q 1091 1141 1091 1161 l 1091 -149 q 1077 -184 1091 -169 q 1042 -198 1062 -198 l 50 -198 q 15 -184 29 -198 q 0 -149 0 -169 l 0 1141 q 15 1176 0 1161 q 50 1190 29 1190 l 1042 1190 m 397 967 l 397 918 q 404 900 397 907 q 422 893 411 893 l 471 893 q 489 900 482 893 q 496 918 496 907 l 496 967 q 489 985 496 978 q 471 992 482 992 l 422 992 q 404 985 411 992 q 397 967 397 978 m 397 769 l 397 719 q 404 701 397 708 q 422 694 411 694 l 471 694 q 489 701 482 694 q 496 719 496 708 l 496 769 q 489 787 496 780 q 471 794 482 794 l 422 794 q 404 787 411 794 q 397 769 397 780 m 397 570 l 397 521 q 404 503 397 510 q 422 496 411 496 l 471 496 q 489 503 482 496 q 496 521 496 510 l 496 570 q 489 588 496 581 q 471 595 482 595 l 422 595 q 404 588 411 595 q 397 570 397 581 m 397 372 l 397 322 q 404 305 397 312 q 422 298 411 298 l 471 298 q 489 305 482 298 q 496 322 496 312 l 496 372 q 489 390 496 383 q 471 397 482 397 l 422 397 q 404 390 411 397 q 397 372 397 383 m 298 124 l 298 174 q 291 191 298 184 q 273 198 284 198 l 223 198 q 205 191 212 198 q 198 174 198 184 l 198 124 q 205 106 198 113 q 223 99 212 99 l 273 99 q 291 106 284 99 q 298 124 298 113 m 298 322 l 298 372 q 291 390 298 383 q 273 397 284 397 l 223 397 q 205 390 212 397 q 198 372 198 383 l 198 322 q 205 305 198 312 q 223 298 212 298 l 273 298 q 291 305 284 298 q 298 322 298 312 m 298 521 l 298 570 q 291 588 298 581 q 273 595 284 595 l 223 595 q 205 588 212 595 q 198 570 198 581 l 198 521 q 205 503 198 510 q 223 496 212 496 l 273 496 q 291 503 284 496 q 298 521 298 510 m 298 719 l 298 769 q 291 787 298 780 q 273 794 284 794 l 223 794 q 205 787 212 794 q 198 769 198 780 l 198 719 q 205 701 198 708 q 223 694 212 694 l 273 694 q 291 701 284 694 q 298 719 298 708 m 298 918 l 298 967 q 291 985 298 978 q 273 992 284 992 l 223 992 q 205 985 212 992 q 198 967 198 978 l 198 918 q 205 900 198 907 q 223 893 212 893 l 273 893 q 291 900 284 893 q 298 918 298 907 m 694 -74 l 694 74 q 687 92 694 85 q 670 99 680 99 l 422 99 q 404 92 411 99 q 397 74 397 85 l 397 -74 q 404 -92 397 -85 q 422 -99 411 -99 l 670 -99 q 687 -92 680 -99 q 694 -74 694 -85 m 694 322 l 694 372 q 687 390 694 383 q 670 397 680 397 l 620 397 q 602 390 609 397 q 595 372 595 383 l 595 322 q 602 305 595 312 q 620 298 609 298 l 670 298 q 687 305 680 298 q 694 322 694 312 m 694 521 l 694 570 q 687 588 694 581 q 670 595 680 595 l 620 595 q 602 588 609 595 q 595 570 595 581 l 595 521 q 602 503 595 510 q 620 496 609 496 l 670 496 q 687 503 680 496 q 694 521 694 510 m 694 719 l 694 769 q 687 787 694 780 q 670 794 680 794 l 620 794 q 602 787 609 794 q 595 769 595 780 l 595 719 q 602 701 595 708 q 620 694 609 694 l 670 694 q 687 701 680 694 q 694 719 694 708 m 694 918 l 694 967 q 687 985 694 978 q 670 992 680 992 l 620 992 q 602 985 609 992 q 595 967 595 978 l 595 918 q 602 900 595 907 q 620 893 609 893 l 670 893 q 687 900 680 893 q 694 918 694 907 m 893 124 l 893 174 q 886 191 893 184 q 868 198 879 198 l 818 198 q 801 191 808 198 q 794 174 794 184 l 794 124 q 801 106 794 113 q 818 99 808 99 l 868 99 q 886 106 879 99 q 893 124 893 113 m 893 322 l 893 372 q 886 390 893 383 q 868 397 879 397 l 818 397 q 801 390 808 397 q 794 372 794 383 l 794 322 q 801 305 794 312 q 818 298 808 298 l 868 298 q 886 305 879 298 q 893 322 893 312 m 893 521 l 893 570 q 886 588 893 581 q 868 595 879 595 l 818 595 q 801 588 808 595 q 794 570 794 581 l 794 521 q 801 503 794 510 q 818 496 808 496 l 868 496 q 886 503 879 496 q 893 521 893 510 m 893 719 l 893 769 q 886 787 893 780 q 868 794 879 794 l 818 794 q 801 787 808 794 q 794 769 794 780 l 794 719 q 801 701 794 708 q 818 694 808 694 l 868 694 q 886 701 879 694 q 893 719 893 708 m 893 918 l 893 967 q 886 985 893 978 q 868 992 879 992 l 818 992 q 801 985 808 992 q 794 967 794 978 l 794 918 q 801 900 794 907 q 818 893 808 893 l 868 893 q 886 900 879 893 q 893 918 893 907 z "},"":{"ha":992,"x_min":50,"x_max":942,"o":"m 921 766 l 694 539 l 694 -99 q 669 -160 694 -135 q 608 -186 643 -186 q 546 -160 572 -186 q 521 -99 521 -135 l 521 198 l 471 198 l 471 -99 q 446 -160 471 -135 q 384 -186 420 -186 q 323 -160 349 -186 q 298 -99 298 -135 l 298 539 l 71 766 q 50 818 50 787 q 71 871 50 849 q 124 893 94 893 q 177 871 155 893 l 353 694 l 639 694 l 815 871 q 868 893 837 893 q 921 871 899 893 q 942 818 942 849 q 921 766 942 787 m 619 1016 q 644 990 619 1016 q 670 893 670 965 q 619 770 670 821 q 496 719 568 719 q 373 770 424 719 q 322 893 322 821 q 373 1016 322 965 q 496 1066 424 1066 q 619 1016 568 1066 z "},"":{"ha":1290,"x_min":0,"x_max":1290,"o":"m 605 825 q 590 737 605 778 q 541 665 575 695 q 460 635 507 635 q 353 679 401 635 q 281 784 305 724 q 258 901 258 845 q 273 989 258 948 q 322 1061 288 1031 q 403 1091 356 1091 q 510 1047 463 1091 q 581 942 558 1002 q 605 825 605 882 m 339 450 q 307 343 339 388 q 215 297 274 297 q 105 340 156 297 q 27 443 54 383 q 0 561 0 504 q 33 669 0 623 q 125 715 65 715 q 234 672 184 715 q 312 568 285 629 q 339 450 339 508 m 645 471 q 842 396 736 471 q 1020 212 949 320 q 1091 15 1091 104 q 1078 -45 1091 -21 q 1041 -79 1065 -68 q 991 -95 1016 -91 q 932 -99 965 -99 q 786 -64 879 -99 q 645 -29 694 -29 q 496 -64 594 -29 q 340 -98 398 -98 q 198 15 198 -98 q 242 163 198 81 q 350 312 285 245 q 495 426 415 380 q 645 471 576 471 m 830 635 q 749 665 783 635 q 700 737 715 695 q 685 825 685 778 q 708 942 685 882 q 779 1047 732 1002 q 887 1091 827 1091 q 968 1061 934 1091 q 1017 989 1002 1031 q 1032 901 1032 948 q 1008 784 1032 845 q 937 679 985 724 q 830 635 889 635 m 1165 715 q 1257 669 1225 715 q 1290 561 1290 623 q 1263 443 1290 504 q 1185 340 1235 383 q 1075 297 1134 297 q 983 343 1015 297 q 950 450 950 388 q 977 568 950 508 q 1055 672 1004 629 q 1165 715 1106 715 z "},"":{"ha":595,"x_min":50,"x_max":546,"o":"m 546 781 q 501 593 546 669 q 384 488 457 516 l 419 -149 q 406 -184 420 -169 q 372 -198 392 -198 l 223 -198 q 189 -184 203 -198 q 177 -149 175 -169 l 212 488 q 94 593 138 516 q 50 781 50 669 q 83 975 50 880 q 174 1130 115 1069 q 298 1190 232 1190 q 422 1130 363 1190 q 513 975 480 1069 q 546 781 546 880 z "},"":{"ha":1389,"x_min":0,"x_max":1290,"o":"m 694 -72 l 1190 198 l 1190 691 l 694 511 l 694 -72 m 645 598 l 1186 795 l 645 992 l 104 795 l 645 598 m 1290 794 l 1290 198 q 1276 148 1290 171 q 1238 112 1262 125 l 692 -186 q 645 -198 670 -198 q 598 -186 619 -198 l 52 112 q 14 148 28 125 q 0 198 0 171 l 0 794 q 18 850 0 825 q 65 887 36 876 l 611 1085 q 645 1091 628 1091 q 679 1085 662 1091 l 1225 887 q 1272 850 1254 876 q 1290 794 1290 825 z "},"":{"ha":1786,"x_min":0,"x_max":1687,"o":"m 496 -74 l 794 74 l 794 318 l 496 191 l 496 -74 m 446 277 l 760 412 l 446 546 l 133 412 l 446 277 m 1290 -74 l 1587 74 l 1587 318 l 1290 191 l 1290 -74 m 1240 277 l 1553 412 l 1240 546 l 927 412 l 1240 277 m 893 505 l 1190 632 l 1190 839 l 893 711 l 893 505 m 843 798 l 1185 945 l 843 1091 l 501 945 l 843 798 m 1687 397 l 1687 74 q 1672 22 1687 47 q 1631 -14 1657 -2 l 1284 -188 q 1240 -198 1265 -198 q 1196 -188 1215 -198 l 849 -14 q 843 -11 846 -12 q 838 -14 842 -12 l 491 -188 q 446 -198 471 -198 q 402 -188 422 -198 l 55 -14 q 15 22 29 -2 q 0 74 0 47 l 0 397 q 17 451 0 426 q 60 488 33 476 l 397 632 l 397 942 q 413 997 397 972 q 457 1034 430 1022 l 805 1183 q 843 1190 822 1190 q 882 1183 864 1190 l 1229 1034 q 1273 997 1256 1022 q 1290 942 1290 972 l 1290 632 l 1626 488 q 1670 451 1654 476 q 1687 397 1687 426 z "},"":{"ha":1587,"x_min":0,"x_max":1587,"o":"m 1432 928 l 1036 928 l 1036 832 l 1432 832 l 1432 928 m 1237 598 q 1124 557 1167 598 q 1076 446 1080 516 l 1392 446 q 1237 598 1378 598 m 1249 144 q 1344 169 1298 144 q 1403 236 1390 194 l 1574 236 q 1243 -2 1497 -2 q 979 101 1077 -2 q 881 370 881 203 q 982 637 881 531 q 1243 744 1084 744 q 1430 691 1350 744 q 1548 553 1509 639 q 1587 360 1587 467 q 1586 324 1587 347 l 1076 324 q 1120 191 1076 238 q 1249 144 1165 144 m 215 183 l 444 183 q 603 312 603 183 q 449 452 603 452 l 215 452 l 215 183 m 215 599 l 432 599 q 528 627 493 599 q 563 715 563 656 q 416 827 563 827 l 215 827 l 215 599 m 0 994 l 460 994 q 581 983 528 994 q 679 946 633 972 q 748 871 724 920 q 773 752 773 822 q 639 548 773 612 q 773 459 728 523 q 818 301 818 395 q 799 195 818 243 q 748 115 780 147 q 671 60 715 82 q 577 27 627 37 q 474 17 528 17 l 0 17 l 0 994 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 967 1091 q 1125 1026 1059 1091 q 1190 868 1190 960 l 1190 124 q 1125 -34 1190 32 q 967 -99 1059 -99 l 223 -99 q 65 -34 131 -99 q 0 124 0 32 l 0 868 q 65 1026 0 960 q 223 1091 131 1091 l 967 1091 m 387 807 l 99 807 l 99 197 l 395 197 q 548 241 486 197 q 610 374 610 286 q 499 529 610 496 q 582 656 582 569 q 567 730 582 700 q 523 777 552 761 q 462 800 494 794 q 387 807 429 807 m 370 560 l 233 560 l 233 703 l 360 703 q 452 633 452 703 q 370 560 452 560 m 377 301 l 233 301 l 233 469 l 380 469 q 476 381 476 469 q 377 301 476 301 m 880 276 q 800 305 828 276 q 772 388 772 335 l 1090 388 q 1091 412 1091 396 q 1034 582 1091 514 q 876 651 976 651 q 713 584 777 651 q 649 417 649 518 q 711 249 649 312 q 876 185 772 185 q 1083 333 1035 185 l 976 333 q 939 291 967 307 q 880 276 911 276 m 873 560 q 969 465 960 560 l 772 465 q 802 534 775 508 q 873 560 829 560 m 747 766 l 994 766 l 994 706 l 747 706 l 747 766 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 1171 873 q 1198 845 1171 873 q 1226 739 1226 818 q 1171 606 1226 661 q 1037 550 1115 550 q 903 606 959 550 q 848 739 848 661 q 903 873 848 818 q 1037 929 959 929 q 1171 873 1115 929 m 573 27 q 601 55 573 27 q 629 164 629 84 q 573 301 629 245 q 436 358 516 358 q 394 353 415 358 l 474 321 q 559 238 534 297 q 560 121 584 180 q 477 36 536 61 q 360 36 419 12 q 312 55 343 42 q 264 74 280 67 q 335 -1 289 27 q 436 -29 381 -29 q 573 27 516 -29 m 1273 739 q 1203 906 1273 836 q 1036 975 1134 975 q 868 906 938 975 q 799 739 799 836 q 868 571 799 640 q 1036 502 938 502 q 1203 571 1134 502 q 1273 739 1273 640 m 1389 739 q 1285 489 1389 592 q 1036 386 1182 386 l 698 139 q 613 -30 688 39 q 436 -99 538 -99 q 270 -40 342 -99 q 178 109 198 19 l 0 180 l 0 512 l 301 391 q 436 428 363 428 q 463 426 446 428 l 683 742 q 788 989 684 887 q 1036 1091 891 1091 q 1285 988 1182 1091 q 1389 739 1389 884 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 918 583 q 941 605 918 583 q 963 689 963 627 q 918 795 963 751 q 812 839 874 839 q 706 794 750 839 q 663 689 663 750 q 706 583 663 627 q 812 539 750 539 q 918 583 874 539 m 445 342 q 467 320 445 342 q 490 233 490 298 q 445 124 490 169 q 336 80 400 80 q 257 102 293 80 q 201 162 220 125 q 277 131 241 146 q 370 132 323 112 q 436 199 416 152 q 434 292 454 246 q 367 357 415 339 l 304 383 q 336 387 321 387 q 445 342 400 387 m 1190 868 l 1190 124 q 1125 -34 1190 32 q 967 -99 1059 -99 l 223 -99 q 65 -34 131 -99 q 0 124 0 32 l 0 243 l 133 189 q 206 71 149 118 q 336 25 263 25 q 477 79 417 25 q 544 213 536 133 l 811 408 q 1010 490 928 408 q 1091 687 1091 572 q 1010 885 1091 804 q 811 967 928 967 q 615 886 697 967 q 532 691 534 805 l 358 441 q 336 442 351 442 q 230 413 278 442 l 0 505 l 0 868 q 65 1026 0 960 q 223 1091 131 1091 l 967 1091 q 1125 1026 1059 1091 q 1190 868 1190 960 m 999 687 q 944 555 999 610 q 811 501 889 501 q 679 555 734 501 q 625 687 625 610 q 679 820 625 765 q 811 875 734 875 q 944 820 890 875 q 999 687 999 766 z "},"":{"ha":1389,"x_min":12,"x_max":1376,"o":"m 648 284 l 636 -1 l 635 -18 l 309 5 q 257 29 281 7 q 221 80 233 51 q 210 122 212 101 q 213 173 207 144 q 222 215 219 202 q 239 265 226 229 q 253 306 252 301 q 648 284 314 297 m 348 739 l 488 445 l 374 516 q 287 404 325 460 q 231 307 250 348 q 200 234 212 267 q 186 185 188 202 l 183 169 l 36 446 q 22 489 22 466 q 26 525 21 512 l 33 539 q 121 685 60 588 l 12 752 l 348 739 m 1302 338 l 1156 60 q 1128 24 1147 37 q 1094 8 1109 10 l 1080 5 q 911 -5 1025 -1 l 917 -132 l 739 153 l 902 433 l 908 299 q 1127 295 1039 287 q 1259 321 1215 304 l 1302 338 m 694 1054 q 488 717 657 1005 l 243 862 l 228 871 l 402 1147 q 449 1182 418 1171 q 511 1190 480 1193 q 548 1180 529 1188 q 581 1164 567 1173 q 613 1139 594 1156 q 641 1112 632 1121 q 669 1081 650 1102 q 694 1054 687 1060 m 1201 816 l 1366 535 q 1375 476 1380 506 q 1354 419 1371 446 q 1328 390 1344 403 q 1299 368 1313 377 q 1261 351 1285 360 q 1225 339 1238 343 q 1185 328 1212 335 q 1149 319 1158 321 q 944 656 1123 374 l 1187 808 l 1201 816 m 1090 991 l 1201 1056 l 1030 767 l 705 782 l 822 849 q 764 977 796 918 q 706 1073 732 1037 q 656 1135 679 1109 q 619 1171 632 1161 l 606 1181 l 920 1180 q 965 1172 944 1183 q 995 1150 986 1162 l 1004 1139 q 1090 991 1034 1091 z "},"":{"ha":1587,"x_min":0,"x_max":1587,"o":"m 336 260 q 354 278 336 260 q 372 347 372 296 q 336 435 372 398 q 248 471 299 471 q 160 435 197 471 q 124 347 124 398 q 160 260 124 296 q 248 223 197 223 q 336 260 299 223 m 400 595 l 1187 595 l 1118 872 q 1108 885 1117 878 q 1091 893 1098 893 l 496 893 q 480 885 489 893 q 469 872 470 878 l 400 595 m 1427 260 q 1445 278 1427 260 q 1463 347 1463 296 q 1427 435 1463 398 q 1339 471 1390 471 q 1252 435 1288 471 q 1215 347 1215 398 q 1252 260 1215 296 q 1339 223 1288 223 q 1427 260 1390 223 m 1587 422 l 1587 124 q 1580 106 1587 113 q 1563 99 1573 99 l 1488 99 l 1488 0 q 1445 -105 1488 -62 q 1339 -149 1401 -149 q 1234 -105 1277 -149 q 1190 0 1190 -62 l 1190 99 l 397 99 l 397 0 q 353 -105 397 -62 q 248 -149 310 -149 q 143 -105 186 -149 q 99 0 99 -62 l 99 99 l 25 99 q 7 106 14 99 q 0 124 0 113 l 0 422 q 51 544 0 494 q 174 595 102 595 l 195 595 l 277 920 q 357 1042 295 993 q 496 1091 420 1091 l 1091 1091 q 1230 1042 1167 1091 q 1311 920 1293 993 l 1392 595 l 1414 595 q 1537 544 1486 595 q 1587 422 1587 494 z "},"":{"ha":1587,"x_min":0,"x_max":1587,"o":"m 1414 496 q 1537 445 1486 496 q 1587 322 1587 395 l 1587 25 q 1580 7 1587 14 q 1563 0 1573 0 l 1488 0 l 1488 -50 q 1445 -155 1488 -112 q 1339 -198 1401 -198 q 1234 -155 1277 -198 q 1190 -50 1190 -112 l 1190 0 l 397 0 l 397 -50 q 353 -155 397 -112 q 248 -198 310 -198 q 143 -155 186 -198 q 99 -50 99 -112 l 99 0 l 25 0 q 7 7 14 0 q 0 25 0 14 l 0 322 q 51 445 0 395 q 174 496 102 496 l 195 496 l 277 821 q 357 943 295 894 q 496 992 420 992 l 595 992 l 595 1166 q 602 1184 595 1177 q 620 1190 609 1190 l 967 1190 q 985 1184 978 1190 q 992 1166 992 1177 l 992 992 l 1091 992 q 1230 943 1167 992 q 1311 821 1293 894 l 1392 496 l 1414 496 m 160 160 q 179 142 160 160 q 248 124 197 124 q 336 160 299 124 q 372 248 372 197 q 336 336 372 299 q 248 372 299 372 q 160 336 197 372 q 124 248 124 299 q 160 160 124 197 m 400 496 l 1187 496 l 1118 773 q 1108 786 1117 779 q 1091 794 1098 794 l 496 794 q 480 786 489 794 q 469 773 470 779 l 400 496 m 1252 160 q 1270 142 1252 160 q 1339 124 1288 124 q 1427 160 1390 124 q 1463 248 1463 197 q 1427 336 1463 299 q 1339 372 1390 372 q 1252 336 1288 372 q 1215 248 1215 299 q 1252 160 1215 197 z "},"":{"ha":1190,"x_min":25,"x_max":1166,"o":"m 1151 84 q 1166 50 1166 70 q 1151 15 1166 29 q 1116 0 1136 0 l 758 0 q 763 -68 759 -13 q 767 -152 767 -122 q 753 -185 767 -171 q 719 -198 739 -198 l 471 -198 q 438 -185 452 -198 q 424 -152 424 -171 q 428 -68 424 -122 q 432 0 432 -13 l 74 0 q 40 15 54 0 q 25 50 25 29 q 40 84 25 70 l 351 397 l 174 397 q 139 412 153 397 q 124 446 124 426 q 139 481 124 467 l 450 794 l 298 794 q 263 808 277 794 q 248 843 248 823 q 263 878 248 863 l 560 1176 q 595 1190 575 1190 q 630 1176 615 1190 l 928 878 q 942 843 942 863 q 928 808 942 823 q 893 794 913 794 l 740 794 l 1052 481 q 1066 446 1066 467 q 1052 412 1066 426 q 1017 397 1037 397 l 839 397 l 1151 84 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 873 253 q 850 292 873 277 q 504 381 701 381 q 281 355 401 381 q 249 315 249 348 q 259 288 249 299 q 287 277 270 277 q 315 283 291 277 q 504 304 418 304 q 811 224 679 304 q 837 215 826 215 q 863 226 852 215 q 873 253 873 236 m 948 419 q 921 467 948 450 q 496 576 737 576 q 261 543 377 576 q 224 494 224 533 q 238 461 224 474 q 270 447 251 447 q 299 453 276 447 q 494 479 394 479 q 872 383 710 479 q 901 373 891 373 q 934 386 921 373 q 948 419 948 400 m 1032 612 q 1001 666 1032 648 q 773 751 903 722 q 508 780 644 780 q 226 744 350 780 q 196 724 208 739 q 184 687 184 710 q 200 646 184 663 q 239 630 215 630 q 270 636 248 630 q 508 665 374 665 q 748 639 632 665 q 945 565 865 612 q 976 556 961 556 q 1015 572 998 556 q 1032 612 1032 587 m 1111 795 q 1151 726 1111 795 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 z "},"":{"ha":794,"x_min":0,"x_max":794,"o":"m 794 956 l 559 505 l 577 481 l 794 481 l 794 159 l 401 159 l 367 136 l 257 -76 l 233 -99 l 0 -99 l 0 136 l 235 587 l 216 611 l 0 611 l 0 932 l 393 932 l 427 956 l 537 1167 l 560 1190 l 794 1190 l 794 956 z "},"":{"ha":1786,"x_min":0,"x_max":1786,"o":"m 608 127 l 620 314 l 608 719 q 602 732 607 727 q 589 738 597 738 q 577 732 582 738 q 571 719 571 727 l 560 314 l 571 127 q 577 114 572 119 q 589 109 582 109 q 608 127 606 109 m 837 150 l 846 313 l 836 767 q 826 786 836 780 q 814 790 820 790 q 801 786 808 790 q 791 767 791 780 l 791 763 l 783 314 q 791 131 783 313 l 791 130 q 796 117 791 122 q 814 109 803 109 q 829 115 822 109 q 836 131 836 121 l 837 150 m 27 413 l 43 314 l 27 216 q 20 209 26 209 q 13 216 15 209 l 0 314 l 13 413 q 20 420 15 420 q 27 413 26 420 m 94 474 l 114 314 l 94 157 q 86 150 92 150 q 79 157 79 150 l 61 314 l 79 474 q 86 481 79 481 q 94 474 92 481 m 311 123 m 165 504 l 184 314 l 165 130 q 157 122 165 122 q 147 130 149 122 l 131 314 l 147 504 q 157 513 149 513 q 165 504 165 513 m 238 509 l 256 314 l 238 125 q 227 115 236 115 q 217 125 217 115 l 201 314 l 217 509 q 227 519 217 519 q 238 509 236 519 m 311 495 l 327 314 l 311 123 q 298 111 309 111 q 290 114 294 111 q 287 123 287 118 l 271 314 l 287 495 q 290 503 287 500 q 298 507 294 507 q 311 495 309 507 m 608 127 m 384 608 l 400 314 l 384 123 q 380 114 384 118 q 370 109 376 109 q 357 123 358 109 l 343 314 l 357 608 q 370 622 358 622 q 380 618 376 622 q 384 608 384 614 m 457 675 l 471 312 l 457 123 q 452 113 457 117 q 442 109 448 109 q 426 123 428 109 l 414 312 l 426 675 q 442 690 428 690 q 452 686 448 690 q 457 675 457 681 m 532 706 l 546 314 l 532 126 q 515 110 531 110 q 499 126 501 110 l 487 314 l 499 706 q 504 718 499 713 q 515 723 509 723 q 527 718 522 723 q 532 706 532 713 m 836 131 l 836 131 l 836 131 l 836 131 m 683 709 l 694 314 l 683 129 q 677 115 683 121 q 663 109 671 109 q 650 115 656 109 q 644 129 645 120 l 633 314 l 644 709 q 650 723 644 718 q 663 729 656 729 q 677 723 671 729 q 683 709 683 718 m 760 694 l 770 313 l 760 130 q 753 115 760 122 q 739 109 747 109 q 724 115 730 109 q 717 130 718 122 l 708 313 l 717 694 q 724 710 718 704 q 739 716 730 716 q 753 710 747 716 q 760 694 759 704 m 924 313 l 913 134 l 913 134 q 906 117 913 124 q 889 110 899 110 q 872 117 879 110 q 864 134 865 124 l 860 222 l 855 313 l 864 806 l 864 808 q 873 827 866 820 q 889 832 880 832 q 901 829 895 832 q 913 808 911 822 l 924 313 m 1786 328 q 1721 173 1786 237 q 1566 109 1657 109 l 957 109 q 940 118 947 111 q 933 135 933 125 l 933 832 q 955 857 933 849 q 1095 884 1021 884 q 1357 782 1246 884 q 1481 531 1468 680 q 1566 548 1522 548 q 1721 484 1657 548 q 1786 328 1786 419 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 252 629 q 332 612 252 629 q 595 595 412 595 q 939 629 779 595 q 1190 727 1098 662 l 1190 595 q 1111 496 1190 542 q 894 424 1031 450 q 595 397 756 397 q 297 424 434 397 q 80 496 160 450 q 0 595 0 542 l 0 727 q 252 629 92 662 m 252 33 q 332 17 252 33 q 595 0 412 0 q 939 33 779 0 q 1190 132 1098 67 l 1190 0 q 1111 -99 1190 -53 q 894 -172 1031 -145 q 595 -198 756 -198 q 297 -172 434 -198 q 80 -99 160 -145 q 0 0 0 -53 l 0 132 q 252 33 92 67 m 252 331 q 332 314 252 331 q 595 298 412 298 q 939 331 779 298 q 1190 429 1098 364 l 1190 298 q 1111 198 1190 244 q 894 126 1031 153 q 595 99 756 99 q 297 126 434 99 q 80 198 160 153 q 0 298 0 244 l 0 429 q 252 331 92 364 m 297 1164 q 365 1177 297 1164 q 595 1190 434 1190 q 894 1164 756 1190 q 1111 1091 1031 1137 q 1190 992 1190 1046 l 1190 893 q 1111 794 1190 839 q 894 721 1031 748 q 595 694 756 694 q 297 721 434 694 q 80 794 160 748 q 0 893 0 839 l 0 992 q 80 1091 0 1046 q 297 1164 160 1137 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 1138 896 q 1175 837 1159 874 q 1190 769 1190 800 l 1190 -124 q 1169 -177 1190 -155 q 1116 -198 1147 -198 l 74 -198 q 22 -177 43 -198 q 0 -124 0 -155 l 0 1116 q 22 1169 0 1147 q 74 1190 43 1190 l 769 1190 q 837 1175 800 1190 q 896 1138 874 1159 l 1138 896 m 794 1085 l 794 794 l 1085 794 q 1068 825 1077 816 l 825 1068 q 794 1085 816 1077 m 1091 -99 l 1091 694 l 769 694 q 716 716 738 694 q 694 769 694 738 l 694 1091 l 99 1091 l 99 -99 l 1091 -99 m 693 360 q 758 317 718 340 q 849 322 804 322 q 986 284 963 322 q 987 244 998 267 q 987 243 987 243 q 985 241 986 242 l 985 240 q 930 211 980 211 q 841 226 893 211 q 740 267 789 242 q 436 203 569 249 q 249 0 318 0 q 227 5 237 0 l 208 15 q 204 19 208 16 q 199 47 196 26 q 243 117 206 78 q 345 192 279 157 q 363 188 356 199 q 364 184 364 186 q 447 337 405 250 q 528 540 500 443 q 504 664 509 604 q 509 763 499 724 q 542 794 518 794 l 558 794 l 559 794 q 586 782 577 794 q 593 729 600 766 q 590 723 591 725 q 591 717 591 721 l 591 694 q 580 545 589 598 q 693 360 622 418 m 246 42 q 353 164 287 60 q 285 99 313 133 q 246 42 257 65 m 555 755 q 553 653 543 722 q 559 687 554 658 q 564 720 559 689 q 567 726 565 723 q 567 728 567 727 q 566 730 566 729 q 556 758 565 747 q 555 756 556 757 l 555 755 m 459 243 q 679 305 563 284 q 669 313 677 306 q 656 323 660 319 q 558 460 598 375 q 494 307 537 393 q 459 243 470 264 m 960 255 q 851 274 941 274 q 947 252 910 252 q 961 253 958 252 q 960 255 961 253 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 1138 896 q 1175 837 1159 874 q 1190 769 1190 800 l 1190 -124 q 1169 -177 1190 -155 q 1116 -198 1147 -198 l 74 -198 q 22 -177 43 -198 q 0 -124 0 -155 l 0 1116 q 22 1169 0 1147 q 74 1190 43 1190 l 769 1190 q 837 1175 800 1190 q 896 1138 874 1159 l 1138 896 m 794 1085 l 794 794 l 1085 794 q 1068 825 1077 816 l 825 1068 q 794 1085 816 1077 m 1091 -99 l 1091 694 l 769 694 q 716 716 738 694 q 694 769 694 738 l 694 1091 l 99 1091 l 99 -99 l 1091 -99 m 181 595 l 181 512 l 235 512 l 362 0 l 485 0 l 584 376 q 592 412 590 391 q 594 430 594 424 l 597 430 l 599 412 q 602 396 600 409 q 606 376 604 383 l 705 0 l 829 0 l 956 512 l 1010 512 l 1010 595 l 777 595 l 777 512 l 847 512 l 770 173 q 765 137 767 157 l 763 121 l 760 121 q 760 126 760 123 q 759 132 760 129 q 758 137 758 136 q 755 153 757 141 q 751 173 753 166 l 639 595 l 551 595 l 439 173 q 436 154 438 166 q 433 137 434 142 l 430 121 l 427 121 l 426 137 q 420 173 424 157 l 343 512 l 413 512 l 413 595 l 181 595 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 1138 896 q 1175 837 1159 874 q 1190 769 1190 800 l 1190 -124 q 1169 -177 1190 -155 q 1116 -198 1147 -198 l 74 -198 q 22 -177 43 -198 q 0 -124 0 -155 l 0 1116 q 22 1169 0 1147 q 74 1190 43 1190 l 769 1190 q 837 1175 800 1190 q 896 1138 874 1159 l 1138 896 m 794 1085 l 794 794 l 1085 794 q 1068 825 1077 816 l 825 1068 q 794 1085 816 1077 m 1091 -99 l 1091 694 l 769 694 q 716 716 738 694 q 694 769 694 738 l 694 1091 l 99 1091 l 99 -99 l 1091 -99 m 332 82 l 332 0 l 550 0 l 550 82 l 492 82 l 572 207 q 580 220 576 212 q 586 230 584 227 q 588 233 587 233 l 590 233 q 594 226 591 230 q 597 220 595 222 q 602 214 599 217 q 607 207 605 210 l 690 82 l 631 82 l 631 0 l 856 0 l 856 82 l 804 82 l 655 294 l 806 512 l 858 512 l 858 595 l 642 595 l 642 512 l 699 512 l 619 389 q 612 376 616 384 q 605 366 607 369 l 603 363 l 601 363 q 598 371 601 367 q 584 389 593 380 l 502 512 l 561 512 l 561 595 l 336 595 l 336 512 l 389 512 l 536 301 l 385 82 l 332 82 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 1138 896 q 1175 837 1159 874 q 1190 769 1190 800 l 1190 -124 q 1169 -177 1190 -155 q 1116 -198 1147 -198 l 74 -198 q 22 -177 43 -198 q 0 -124 0 -155 l 0 1116 q 22 1169 0 1147 q 74 1190 43 1190 l 769 1190 q 837 1175 800 1190 q 896 1138 874 1159 l 1138 896 m 794 1085 l 794 794 l 1085 794 q 1068 825 1077 816 l 825 1068 q 794 1085 816 1077 m 1091 -99 l 1091 694 l 769 694 q 716 716 738 694 q 694 769 694 738 l 694 1091 l 99 1091 l 99 -99 l 1091 -99 m 322 82 l 322 0 l 576 0 l 576 82 l 504 82 l 504 212 l 610 212 q 701 223 669 212 q 784 291 753 241 q 815 404 815 340 q 786 513 815 467 q 708 581 757 560 q 608 595 671 595 l 322 595 l 322 512 l 394 512 l 394 82 l 322 82 m 596 299 l 504 299 l 504 507 l 597 507 q 661 493 637 507 q 705 404 705 467 q 656 311 705 335 q 596 299 632 299 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 1138 896 q 1175 837 1159 874 q 1190 769 1190 800 l 1190 -124 q 1169 -177 1190 -155 q 1116 -198 1147 -198 l 74 -198 q 22 -177 43 -198 q 0 -124 0 -155 l 0 1116 q 22 1169 0 1147 q 74 1190 43 1190 l 769 1190 q 837 1175 800 1190 q 896 1138 874 1159 l 1138 896 m 794 1085 l 794 794 l 1085 794 q 1068 825 1077 816 l 825 1068 q 794 1085 816 1077 m 1091 -99 l 1091 694 l 769 694 q 716 716 738 694 q 694 769 694 738 l 694 1091 l 99 1091 l 99 -99 l 1091 -99 m 992 248 l 992 0 l 198 0 l 198 149 l 347 298 l 446 198 l 744 496 l 992 248 m 453 440 q 431 419 453 440 q 347 397 409 397 q 242 440 285 397 q 198 546 198 484 q 242 651 198 608 q 347 694 285 694 q 453 651 409 694 q 496 546 496 608 q 453 440 496 484 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 496 893 l 496 992 l 397 992 l 397 893 l 496 893 m 595 794 l 595 893 l 496 893 l 496 794 l 595 794 m 496 694 l 496 794 l 397 794 l 397 694 l 496 694 m 595 595 l 595 694 l 496 694 l 496 595 l 595 595 m 1138 896 q 1175 837 1159 874 q 1190 769 1190 800 l 1190 -124 q 1169 -177 1190 -155 q 1116 -198 1147 -198 l 74 -198 q 22 -177 43 -198 q 0 -124 0 -155 l 0 1116 q 22 1169 0 1147 q 74 1190 43 1190 l 769 1190 q 837 1175 800 1190 q 896 1138 874 1159 l 1138 896 m 794 1085 l 794 794 l 1085 794 q 1068 825 1077 816 l 825 1068 q 794 1085 816 1077 m 1091 -99 l 1091 694 l 769 694 q 716 716 738 694 q 694 769 694 738 l 694 1091 l 595 1091 l 595 992 l 496 992 l 496 1091 l 99 1091 l 99 -99 l 1091 -99 m 605 460 l 688 189 q 694 149 694 168 q 638 42 694 84 q 496 0 582 0 q 354 42 410 0 q 298 149 298 84 q 304 189 298 168 q 397 496 320 238 l 397 595 l 496 595 l 496 496 l 557 496 q 587 486 574 496 q 605 460 601 476 m 426 114 q 440 107 426 114 q 496 99 455 99 q 566 114 537 99 q 595 149 595 129 q 566 184 595 169 q 496 198 537 198 q 426 184 455 198 q 397 149 397 169 q 426 114 397 129 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 1138 896 q 1175 837 1159 874 q 1190 769 1190 800 l 1190 -124 q 1169 -177 1190 -155 q 1116 -198 1147 -198 l 74 -198 q 22 -177 43 -198 q 0 -124 0 -155 l 0 1116 q 22 1169 0 1147 q 74 1190 43 1190 l 769 1190 q 837 1175 800 1190 q 896 1138 874 1159 l 1138 896 m 794 1085 l 794 794 l 1085 794 q 1068 825 1077 816 l 825 1068 q 794 1085 816 1077 m 1091 -99 l 1091 694 l 769 694 q 716 716 738 694 q 694 769 694 738 l 694 1091 l 99 1091 l 99 -99 l 1091 -99 m 481 532 q 496 508 496 525 l 496 87 q 481 64 496 70 q 471 62 474 62 q 453 69 462 62 l 325 198 l 223 198 q 205 205 212 198 q 198 223 198 212 l 198 372 q 205 390 198 383 q 223 397 212 397 l 325 397 l 453 526 q 481 532 466 538 m 804 -2 q 842 16 828 -2 q 942 298 942 140 q 842 579 942 456 q 809 598 830 595 q 773 587 788 600 q 755 553 756 574 q 766 516 753 532 q 843 298 843 421 q 766 79 843 174 q 755 42 753 63 q 773 9 756 22 q 804 -2 787 -2 m 640 112 q 677 128 661 112 q 744 298 744 200 q 677 467 744 395 q 642 483 663 482 q 606 470 621 484 q 591 435 591 456 q 605 399 590 415 q 645 298 645 355 q 605 196 645 240 q 591 160 590 181 q 606 126 591 140 q 640 112 622 112 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 1138 896 q 1175 837 1159 874 q 1190 769 1190 800 l 1190 -124 q 1169 -177 1190 -155 q 1116 -198 1147 -198 l 74 -198 q 22 -177 43 -198 q 0 -124 0 -155 l 0 1116 q 22 1169 0 1147 q 74 1190 43 1190 l 769 1190 q 837 1175 800 1190 q 896 1138 874 1159 l 1138 896 m 794 1085 l 794 794 l 1085 794 q 1068 825 1077 816 l 825 1068 q 794 1085 816 1077 m 1091 -99 l 1091 694 l 769 694 q 716 716 738 694 q 694 769 694 738 l 694 1091 l 99 1091 l 99 -99 l 1091 -99 m 595 595 q 665 566 636 595 q 694 496 694 536 l 694 198 q 665 129 694 158 q 595 99 636 99 l 298 99 q 228 129 257 99 q 198 198 198 158 l 198 496 q 228 566 198 536 q 298 595 257 595 l 595 595 m 977 594 q 992 570 992 587 l 992 124 q 977 101 992 107 q 967 99 970 99 q 949 106 956 99 l 744 312 l 744 382 l 949 588 q 967 595 956 595 q 977 594 970 595 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 1138 896 q 1175 837 1159 874 q 1190 769 1190 800 l 1190 -124 q 1169 -177 1190 -155 q 1116 -198 1147 -198 l 74 -198 q 22 -177 43 -198 q 0 -124 0 -155 l 0 1116 q 22 1169 0 1147 q 74 1190 43 1190 l 769 1190 q 837 1175 800 1190 q 896 1138 874 1159 l 1138 896 m 794 1085 l 794 794 l 1085 794 q 1068 825 1077 816 l 825 1068 q 794 1085 816 1077 m 1091 -99 l 1091 694 l 769 694 q 716 716 738 694 q 694 769 694 738 l 694 1091 l 99 1091 l 99 -99 l 1091 -99 m 372 595 q 388 605 378 604 q 407 600 398 606 l 446 570 q 456 554 455 564 q 451 536 457 544 l 310 347 l 451 159 q 456 140 457 150 q 446 124 455 130 l 407 95 q 388 90 398 88 q 372 99 378 91 l 197 332 q 197 362 186 347 l 372 595 m 994 362 q 994 332 1004 347 l 818 99 q 802 90 812 91 q 784 95 792 88 l 744 124 q 734 140 736 130 q 739 159 733 150 l 880 347 l 739 536 q 734 554 733 544 q 744 570 736 564 l 784 600 q 802 605 792 606 q 818 595 812 604 l 994 362 m 513 5 q 497 15 503 6 q 493 33 491 23 l 600 677 q 610 693 601 687 q 629 698 618 699 l 677 690 q 693 680 687 688 q 698 661 699 671 l 591 17 q 581 1 589 7 q 562 -3 572 -5 l 513 5 z "},"":{"ha":1190,"x_min":30,"x_max":1160,"o":"m 1160 550 l 1160 396 q 1007 378 1082 378 q 879 168 956 273 q 738 1 801 64 q 639 -81 675 -61 q 513 -79 577 -116 q 466 -45 491 -66 q 400 19 441 -25 q 321 119 360 64 q 238 262 282 174 q 156 451 193 349 q 85 694 119 553 q 30 997 51 836 l 250 997 q 304 688 270 828 q 385 442 338 548 q 479 260 432 336 q 587 109 526 183 q 810 423 718 239 q 637 594 700 479 q 574 852 574 708 q 655 1096 574 1001 q 875 1190 736 1190 q 1087 1109 1013 1190 q 1160 878 1160 1027 q 1115 656 1160 755 q 1100 654 1110 656 q 1065 653 1090 653 q 1016 657 1039 653 q 968 677 993 662 q 929 717 942 692 q 953 860 953 797 q 930 962 953 927 q 869 997 908 997 q 803 958 828 997 q 778 849 778 920 q 860 622 778 705 q 1066 539 941 539 q 1160 550 1115 539 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 167 284 l 635 -27 l 635 251 l 376 424 l 167 284 m 119 396 l 269 496 l 119 596 l 119 396 m 754 -27 l 1221 284 l 1013 424 l 754 251 l 754 -27 m 694 355 l 905 496 l 694 637 l 484 496 l 694 355 m 376 568 l 635 741 l 635 1019 l 167 708 l 376 568 m 1120 496 l 1270 396 l 1270 596 l 1120 496 m 1013 568 l 1221 708 l 754 1019 l 754 741 l 1013 568 m 1389 708 l 1389 284 q 1363 235 1389 253 l 728 -188 q 694 -198 711 -198 q 661 -188 677 -198 l 26 235 q 0 284 0 253 l 0 708 q 26 757 0 739 l 661 1180 q 694 1190 677 1190 q 728 1180 711 1190 l 1363 757 q 1389 708 1389 739 z "},"":{"ha":1587,"x_min":0,"x_max":1587,"o":"m 1395 592 q 1534 479 1481 556 q 1587 308 1587 402 q 1496 90 1587 181 q 1275 0 1404 0 q 1266 0 1272 0 q 1258 1 1260 1 l 321 1 l 320 1 l 319 1 l 315 1 q 91 98 183 9 q 0 315 0 188 q 43 473 0 401 q 157 587 85 545 q 147 650 147 617 q 211 802 147 739 q 365 865 274 865 q 498 820 439 865 q 671 1012 556 939 q 924 1085 785 1085 q 1161 1023 1053 1085 q 1333 853 1270 960 q 1396 620 1396 746 q 1395 606 1396 615 q 1395 592 1395 597 m 363 386 q 428 236 363 291 q 589 181 493 181 q 775 258 695 181 q 738 302 763 274 q 705 341 714 330 q 593 291 653 291 q 520 317 550 291 q 491 384 491 343 q 520 452 491 426 q 591 478 550 478 q 657 462 625 478 q 713 419 688 446 q 764 361 739 393 q 817 298 789 329 q 877 239 846 266 q 952 197 908 213 q 1046 181 996 181 q 1205 236 1140 181 q 1270 384 1270 291 q 1204 532 1270 477 q 1044 587 1139 587 q 857 512 933 587 l 929 429 q 1039 478 980 478 q 1111 453 1080 478 q 1142 388 1142 427 q 1113 317 1142 343 q 1040 290 1084 290 q 976 306 1007 290 q 920 349 946 322 q 870 407 895 375 q 816 470 844 439 q 756 529 787 502 q 681 571 724 555 q 589 587 638 587 q 429 533 494 587 q 363 386 363 478 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 425 1135 q 489 1163 425 1135 q 694 1190 553 1190 q 964 1135 836 1190 q 1186 987 1093 1080 q 1334 766 1279 894 q 1389 496 1389 637 q 1334 226 1389 355 q 1186 5 1279 98 q 964 -143 1093 -88 q 694 -198 836 -198 q 425 -143 553 -198 q 203 5 296 -88 q 55 226 110 98 q 0 496 0 355 q 55 766 0 637 q 203 987 110 894 q 425 1135 296 1080 m 974 1022 q 694 1091 842 1091 q 415 1022 547 1091 l 565 871 q 694 893 629 893 q 824 871 760 893 l 974 1022 m 169 216 l 319 367 q 298 496 298 430 q 319 625 298 562 l 169 776 q 99 496 99 643 q 169 216 99 349 m 415 -29 q 694 -99 547 -99 q 974 -29 842 -99 l 824 121 q 694 99 760 99 q 565 121 629 99 l 415 -29 m 484 286 q 528 242 484 286 q 694 198 571 198 q 905 286 818 198 q 992 496 992 373 q 905 706 992 619 q 694 794 818 794 q 484 706 571 794 q 397 496 397 619 q 484 286 397 373 m 1070 367 l 1220 216 q 1290 496 1290 349 q 1220 776 1290 643 l 1070 625 q 1091 496 1091 562 q 1070 367 1091 430 z "},"":{"ha":1389,"x_min":25,"x_max":1364,"o":"m 1364 496 q 1311 236 1364 360 q 1168 22 1258 112 q 955 -121 1079 -67 q 694 -174 831 -174 q 434 -121 558 -174 q 221 22 310 -67 q 78 236 131 112 q 25 496 25 360 q 100 805 25 661 q 305 1042 175 949 q 595 1159 436 1135 l 595 982 q 311 811 424 947 q 198 496 198 674 q 238 303 198 395 q 344 145 277 212 q 502 40 410 79 q 694 0 594 0 q 887 40 795 0 q 1045 145 979 79 q 1151 303 1111 212 q 1190 496 1190 395 q 1078 811 1190 674 q 794 982 965 947 l 794 1159 q 1084 1042 953 1135 q 1289 805 1214 949 q 1364 496 1364 661 z "},"":{"ha":1389,"x_min":15,"x_max":1375,"o":"m 15 513 q 105 828 21 681 q 341 1074 188 974 q 345 1074 345 1074 q 344 1072 345 1073 q 322 1046 338 1066 q 282 987 307 1026 q 236 901 257 947 q 201 796 214 855 q 190 679 188 737 q 221 557 192 622 q 305 438 249 493 q 384 384 343 399 q 454 375 424 369 q 508 393 484 381 q 544 419 532 405 l 556 431 q 598 521 587 470 q 603 616 608 572 q 586 699 597 660 q 566 761 576 738 l 555 784 q 531 822 547 803 q 498 854 515 841 q 464 877 481 867 q 437 891 448 887 l 427 896 l 508 985 q 568 945 538 972 q 614 898 598 918 l 629 877 q 614 957 629 914 q 583 1025 599 1000 l 567 1049 l 692 1190 l 816 1050 q 775 971 791 1015 q 758 901 760 927 l 755 875 q 803 931 772 904 q 855 972 833 959 l 877 985 l 956 896 q 891 857 922 885 q 844 807 859 829 l 829 784 q 792 681 805 741 q 787 549 779 621 q 831 428 794 477 q 891 381 856 393 q 957 377 925 369 q 1016 397 988 384 q 1060 423 1043 410 l 1077 436 q 1151 525 1123 477 q 1189 619 1180 573 q 1197 713 1198 665 q 1183 805 1195 761 q 1154 888 1170 848 q 1119 960 1138 928 q 1084 1016 1100 992 q 1057 1053 1068 1039 l 1047 1066 q 1042 1076 1036 1076 q 1049 1073 1049 1073 q 1098 1038 1080 1051 q 1146 999 1115 1025 q 1196 954 1177 973 q 1241 904 1215 935 q 1284 844 1267 873 q 1319 776 1301 815 q 1349 696 1338 736 q 1367 605 1359 656 q 1375 500 1374 555 q 1291 140 1377 299 q 1049 -109 1205 -20 q 696 -198 894 -198 q 424 -141 553 -198 q 204 12 295 -84 q 62 239 113 109 q 15 513 10 370 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 677 -79 l 677 -130 q 379 -45 516 -126 q 160 168 242 35 l 205 195 q 261 118 227 157 l 312 162 q 597 -2 426 32 l 584 -69 q 677 -79 634 -78 m 214 332 l 150 310 q 188 223 167 264 l 143 198 q 67 496 67 337 q 143 794 67 655 l 188 769 q 150 682 164 725 l 213 660 q 186 496 186 583 q 214 332 186 412 m 1184 195 l 1229 168 q 1010 -45 1147 35 q 711 -130 873 -126 l 711 -79 q 805 -69 755 -78 l 792 -2 q 1077 162 963 32 l 1128 118 q 1184 195 1162 157 m 1067 624 l 887 562 q 898 496 898 529 q 887 430 898 463 l 1066 368 q 991 237 1042 297 l 847 363 q 733 297 803 311 l 770 110 q 694 102 730 102 q 618 110 659 102 l 656 297 q 542 363 586 311 l 398 237 q 322 368 346 297 l 502 430 q 491 496 491 463 q 502 562 491 529 l 322 624 q 398 755 347 696 l 542 629 q 656 696 587 682 l 618 882 q 694 890 653 890 q 770 882 736 890 l 733 696 q 847 629 801 682 l 991 755 q 1067 624 1042 696 m 677 1122 l 677 1071 q 584 1061 627 1070 l 597 994 q 312 831 426 962 l 261 874 q 205 798 232 842 l 160 824 q 379 1037 243 957 q 677 1122 515 1118 m 1246 794 q 1321 496 1321 655 q 1246 198 1321 337 l 1201 223 q 1239 310 1222 264 l 1175 332 q 1203 496 1203 412 q 1176 660 1203 583 l 1239 682 q 1201 769 1225 725 l 1246 794 m 1228 824 l 1184 798 q 1128 874 1157 842 l 1077 831 q 792 994 963 962 l 805 1061 q 711 1071 762 1070 l 711 1122 q 1010 1037 873 1118 q 1228 824 1146 957 m 1302 239 q 1329 301 1302 239 q 1355 496 1355 362 q 1302 753 1355 630 q 1162 963 1250 875 q 951 1104 1073 1052 q 694 1156 829 1156 q 438 1104 560 1156 q 227 963 315 1052 q 86 753 139 875 q 34 496 34 630 q 86 239 34 362 q 227 29 139 117 q 438 -112 315 -60 q 694 -164 560 -164 q 951 -112 829 -164 q 1162 29 1073 -60 q 1302 239 1250 117 m 1334 766 q 1361 701 1334 766 q 1389 496 1389 637 q 1334 226 1389 355 q 1186 5 1279 98 q 964 -143 1093 -88 q 694 -198 836 -198 q 425 -143 553 -198 q 203 5 296 -88 q 55 226 110 98 q 0 496 0 355 q 55 766 0 637 q 203 987 110 894 q 425 1135 296 1080 q 694 1190 553 1190 q 964 1135 836 1190 q 1186 987 1093 1080 q 1334 766 1279 894 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 451 177 q 379 126 451 126 q 296 174 296 126 q 372 224 296 224 q 451 177 451 224 m 423 538 q 366 472 423 472 q 306 537 306 472 q 366 607 306 607 q 408 587 394 607 q 423 538 423 567 m 552 596 l 552 693 q 447 670 491 670 q 362 693 408 693 q 250 649 295 693 q 204 538 204 605 q 227 459 204 499 q 284 407 250 419 l 284 405 q 254 339 254 391 q 286 279 254 298 l 286 277 q 198 169 198 248 q 214 108 198 134 q 256 69 229 82 q 312 49 282 55 q 374 43 341 43 q 548 188 548 43 q 511 265 548 240 q 413 301 474 290 q 373 317 392 305 q 354 347 354 329 q 392 388 354 381 q 487 442 452 399 q 522 546 522 484 q 514 586 522 564 q 552 596 543 593 m 598 271 l 704 271 q 702 335 702 292 l 702 635 q 704 688 702 670 l 598 688 q 600 633 600 670 l 600 329 q 598 271 600 291 m 992 284 l 992 377 q 939 361 969 361 q 898 425 898 361 l 898 599 l 939 599 q 959 598 946 599 q 980 598 973 598 l 980 688 l 898 688 q 901 767 898 752 l 792 767 q 795 725 795 749 l 795 688 l 749 688 l 749 598 q 777 600 777 600 q 786 600 780 600 q 795 599 792 599 l 795 598 l 794 598 l 794 429 q 796 380 794 401 q 805 336 798 359 q 823 298 811 313 q 857 274 836 284 q 908 265 879 265 q 992 284 958 265 m 716 831 q 698 880 716 859 q 651 901 679 901 q 604 880 623 901 q 585 831 585 860 q 605 782 585 803 q 651 762 624 762 q 697 783 678 762 q 716 831 716 804 m 1190 868 l 1190 124 q 1125 -34 1190 32 q 967 -99 1059 -99 l 223 -99 q 65 -34 131 -99 q 0 124 0 32 l 0 868 q 65 1026 0 960 q 223 1091 131 1091 l 967 1091 q 1125 1026 1059 1091 q 1190 868 1190 960 z "},"":{"ha":1389,"x_min":53,"x_max":1336,"o":"m 461 17 q 333 95 461 95 q 211 14 211 95 q 344 -64 211 -64 q 461 17 461 -64 m 415 602 q 392 681 415 649 q 323 713 369 713 q 227 601 227 713 q 323 496 227 496 q 415 602 415 496 m 624 853 l 624 697 q 563 680 596 687 q 575 615 575 646 q 519 447 575 516 q 366 360 462 377 q 320 339 335 353 q 305 294 305 324 q 322 254 305 270 q 367 229 339 238 q 428 212 395 220 q 494 192 461 204 q 555 163 528 181 q 600 114 583 146 q 618 37 618 81 q 336 -198 618 -198 q 236 -189 283 -198 q 146 -157 188 -179 q 78 -93 103 -135 q 53 5 53 -52 q 194 180 53 133 l 194 183 q 142 281 142 215 q 191 387 142 365 l 191 390 q 98 474 135 408 q 61 602 61 539 q 135 782 61 710 q 317 853 208 853 q 455 817 391 853 q 624 853 531 817 m 870 171 l 698 171 q 701 274 701 205 l 701 746 q 698 846 701 819 l 870 846 q 867 749 867 820 l 867 274 q 870 171 867 205 m 1336 343 l 1336 191 q 1201 160 1281 160 q 1118 176 1153 160 q 1064 215 1084 191 q 1034 275 1045 238 q 1019 346 1022 312 q 1016 426 1016 381 l 1016 698 l 1018 698 l 1018 701 q 1003 702 1012 701 q 989 703 994 703 q 943 698 973 703 l 943 846 l 1018 846 l 1018 904 q 1013 973 1018 946 l 1189 973 q 1184 846 1184 942 l 1317 846 l 1317 698 q 1283 700 1305 698 q 1250 701 1261 701 l 1184 701 l 1184 419 q 1252 317 1184 317 q 1336 343 1299 317 m 860 1156 q 875 1139 860 1156 q 890 1077 890 1121 q 860 998 890 1032 q 785 964 829 964 q 709 998 740 964 q 678 1077 678 1032 q 709 1156 678 1122 q 785 1190 739 1190 q 860 1156 830 1190 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 627 412 l 833 799 l 746 799 l 625 557 q 591 486 606 520 l 558 557 l 438 799 l 345 799 l 549 417 l 549 166 l 627 166 l 627 412 m 1190 868 l 1190 124 q 1125 -34 1190 32 q 967 -99 1059 -99 l 223 -99 q 65 -34 131 -99 q 0 124 0 32 l 0 868 q 65 1026 0 960 q 223 1091 131 1091 l 967 1091 q 1125 1026 1059 1091 q 1190 868 1190 960 z "},"":{"ha":992,"x_min":44,"x_max":948,"o":"m 609 853 q 631 831 609 853 q 653 747 653 809 q 608 641 653 685 q 503 598 564 598 q 417 625 457 598 q 328 512 369 573 q 171 -154 136 224 q 162 -184 172 -171 q 135 -198 151 -197 l 131 -198 q 104 -188 115 -198 q 91 -162 92 -177 q 88 30 80 -64 q 111 198 96 124 q 153 342 126 272 q 206 463 180 412 q 264 560 233 513 q 366 687 311 629 q 353 747 353 715 q 397 853 353 809 q 503 897 441 897 q 609 853 565 897 m 887 965 q 918 913 887 965 q 948 739 948 861 q 887 512 948 616 q 723 348 827 408 q 496 288 618 288 q 395 298 446 288 q 369 317 378 302 q 364 347 360 331 q 382 372 368 363 q 412 377 396 381 q 496 367 452 367 q 640 397 571 367 q 759 476 709 426 q 838 594 808 525 q 867 739 867 663 q 838 883 867 814 q 759 1001 808 952 q 640 1080 709 1051 q 496 1110 571 1110 q 352 1080 421 1110 q 233 1001 283 1051 q 154 883 184 952 q 125 739 125 814 q 165 570 125 650 q 168 539 173 554 q 148 515 163 523 q 117 513 133 508 q 94 533 102 519 q 44 739 44 629 q 80 915 44 831 q 177 1059 116 998 q 321 1155 237 1119 q 496 1190 405 1190 q 723 1130 618 1190 q 887 965 827 1070 z "},"":{"ha":1389,"x_min":14,"x_max":1375,"o":"m 209 566 q 203 606 203 581 q 212 644 203 622 q 230 679 220 667 q 236 720 229 696 q 253 753 243 744 q 325 977 253 861 q 494 1139 397 1093 q 745 1190 601 1190 q 951 1148 848 1190 q 1021 1111 989 1132 q 1076 1067 1053 1090 q 1118 1015 1099 1045 q 1151 957 1138 984 q 1176 892 1164 930 q 1196 822 1188 853 q 1213 746 1204 791 l 1214 742 q 1256 626 1256 678 q 1249 595 1256 615 q 1242 566 1242 575 q 1244 563 1242 565 q 1246 559 1245 561 q 1248 556 1248 557 q 1341 390 1308 468 q 1375 229 1375 312 q 1360 151 1375 195 q 1317 107 1345 107 q 1302 113 1310 107 q 1287 126 1294 119 q 1272 146 1280 134 q 1260 167 1264 159 q 1249 187 1256 175 q 1242 201 1243 199 q 1240 202 1242 202 l 1236 198 q 1134 26 1190 79 q 1182 -4 1149 10 q 1235 -36 1214 -19 q 1263 -87 1256 -54 q 1259 -99 1261 -90 q 1254 -113 1258 -109 q 1020 -188 1204 -188 q 934 -181 979 -188 q 858 -166 890 -174 q 777 -143 827 -157 q 760 -137 766 -139 q 724 -134 749 -134 q 693 -133 699 -133 q 594 -183 661 -167 q 463 -198 527 -198 q 410 -197 436 -198 q 338 -190 384 -196 q 260 -174 292 -184 q 202 -143 227 -164 q 177 -94 177 -122 q 184 -48 177 -63 q 216 -10 192 -33 q 248 0 225 -9 q 286 9 270 9 q 297 11 289 9 q 298 14 298 12 l 297 16 q 213 98 260 25 q 157 219 167 171 l 153 222 q 143 206 150 222 q 101 148 129 174 q 41 119 73 122 l 40 119 q 36 123 37 119 q 32 127 34 126 q 14 205 14 169 q 209 566 14 418 z "},"":{"ha":1587,"x_min":0,"x_max":1587,"o":"m 430 782 q 440 792 430 782 q 450 833 450 801 q 430 884 450 865 q 379 904 411 904 q 320 884 346 904 q 295 833 295 864 q 320 783 295 803 q 379 763 346 763 q 430 782 411 763 m 1025 440 q 1006 479 1025 462 q 955 496 986 496 q 916 479 934 496 q 899 440 899 461 q 916 401 899 419 q 955 384 934 384 q 1006 401 986 384 q 1025 440 1025 418 m 823 782 q 833 792 823 782 q 842 833 842 801 q 823 884 842 865 q 773 904 805 904 q 714 884 739 904 q 688 833 688 864 q 714 783 688 803 q 773 763 739 763 q 823 782 805 763 m 1335 440 q 1314 479 1335 462 q 1264 496 1294 496 q 1226 479 1243 496 q 1208 440 1208 461 q 1226 401 1208 419 q 1264 384 1243 384 q 1314 401 1294 384 q 1335 440 1335 418 m 1128 748 q 1074 751 1104 751 q 833 691 943 751 q 660 530 723 632 q 597 307 597 428 q 615 189 597 246 q 562 187 587 187 q 523 188 542 187 q 481 193 505 189 q 446 198 457 197 q 404 207 436 200 q 365 215 372 213 l 169 116 l 225 285 q 0 665 0 443 q 76 906 0 796 q 280 1079 151 1016 q 562 1142 409 1142 q 820 1091 698 1142 q 1023 950 941 1040 q 1128 748 1104 860 m 1587 313 q 1534 140 1587 222 q 1390 -10 1481 57 l 1433 -150 l 1279 -66 q 1110 -95 1163 -95 q 869 -40 979 -95 q 696 109 759 15 q 632 313 632 202 q 696 518 632 424 q 869 666 759 612 q 1110 721 979 721 q 1345 666 1235 721 q 1521 517 1455 612 q 1587 313 1587 423 z "},"":{"ha":1389,"x_min":0,"x_max":1388,"o":"m 1367 1182 q 1388 1132 1393 1163 l 1190 -58 q 1165 -93 1186 -81 q 1141 -99 1154 -99 q 1122 -95 1132 -99 l 771 48 l 584 -181 q 546 -198 570 -198 q 529 -195 536 -198 q 505 -177 514 -190 q 496 -149 496 -164 l 496 122 l 1166 942 l 337 226 l 31 351 q 0 394 2 362 q 25 439 -2 425 l 1314 1184 q 1339 1190 1326 1190 q 1367 1182 1355 1190 z "},"":{"ha":1389,"x_min":0,"x_max":1388,"o":"m 1367 1182 q 1388 1132 1393 1163 l 1190 -58 q 1165 -93 1186 -81 q 1141 -99 1154 -99 q 1122 -95 1132 -99 l 714 71 l 483 -182 q 446 -198 469 -198 q 429 -195 436 -198 q 405 -177 414 -190 q 397 -149 397 -164 l 397 202 l 31 351 q 0 394 2 362 q 25 439 -2 424 l 1314 1184 q 1367 1182 1342 1200 m 1102 20 l 1273 1046 l 162 405 l 422 298 l 1091 794 l 721 176 l 1102 20 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 1143 727 q 1167 672 1143 727 q 1190 496 1190 617 q 1143 265 1190 375 q 1016 75 1096 155 q 826 -52 936 -5 q 595 -99 716 -99 q 342 -43 462 -99 q 137 115 222 13 q 132 133 132 123 q 139 149 133 143 l 245 256 q 264 263 253 263 q 282 253 277 261 q 421 140 339 180 q 595 99 503 99 q 749 131 676 99 q 876 215 822 162 q 961 342 929 269 q 992 496 992 415 q 961 650 992 577 q 876 777 929 723 q 749 861 822 830 q 595 893 676 893 q 450 865 519 893 q 326 787 380 838 l 432 680 q 443 626 456 656 q 397 595 429 595 l 50 595 q 15 610 29 595 q 0 645 0 625 l 0 992 q 31 1038 0 1025 q 84 1027 61 1051 l 185 927 q 375 1048 268 1005 q 595 1091 481 1091 q 826 1044 716 1091 q 1016 917 936 997 q 1143 727 1096 837 m 694 719 l 694 372 q 687 354 694 361 q 670 347 680 347 l 422 347 q 404 354 411 347 q 397 372 397 361 l 397 422 q 404 439 397 432 q 422 446 411 446 l 595 446 l 595 719 q 602 737 595 730 q 620 744 609 744 l 670 744 q 687 737 680 744 q 694 719 694 730 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 788 953 q 742 972 788 953 q 595 992 696 992 q 403 953 494 992 q 245 847 311 913 q 139 689 178 780 q 99 496 99 597 q 139 303 99 395 q 245 145 178 212 q 403 40 311 79 q 595 0 494 0 q 788 40 696 0 q 946 145 880 79 q 1052 303 1012 212 q 1091 496 1091 395 q 1052 689 1091 597 q 946 847 1012 780 q 788 953 880 913 m 1111 795 q 1151 726 1111 795 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 z "},"":{"ha":1389,"x_min":48,"x_max":1341,"o":"m 1304 -99 q 1201 -96 1270 -99 q 1097 -94 1132 -94 q 995 -96 1063 -94 q 893 -99 927 -99 q 864 -83 874 -99 q 854 -48 854 -67 q 867 -12 854 -24 q 898 1 880 -1 q 937 6 915 2 q 972 18 960 10 q 997 126 997 34 l 997 429 q 996 453 997 446 q 957 457 986 457 l 434 457 q 395 453 405 457 q 394 429 394 446 l 393 142 q 422 15 393 32 q 459 5 434 7 q 503 2 484 2 q 538 -10 522 2 q 553 -45 553 -21 q 544 -82 553 -65 q 515 -99 534 -99 q 407 -96 479 -99 q 300 -94 336 -94 q 201 -96 267 -94 q 102 -99 135 -99 q 75 -83 84 -99 q 65 -48 65 -67 q 77 -13 65 -25 q 105 0 89 -2 q 142 6 121 2 q 174 18 163 10 q 200 129 200 36 l 199 173 l 199 803 q 200 823 199 805 q 200 851 200 841 q 198 881 199 862 q 196 914 198 901 q 191 942 194 927 q 182 966 188 957 q 170 980 177 976 q 135 990 158 988 q 94 991 112 991 q 62 1002 76 991 q 48 1037 48 1013 q 57 1074 48 1057 q 85 1091 67 1091 q 193 1089 121 1091 q 300 1086 264 1086 q 398 1089 332 1086 q 496 1091 463 1091 q 525 1074 515 1091 q 535 1037 535 1057 q 522 1003 535 1014 q 492 992 508 993 q 453 989 475 991 q 420 979 432 987 q 393 855 393 963 l 394 607 q 395 582 394 591 q 425 580 405 580 l 966 580 q 996 582 986 580 q 997 607 997 591 l 997 855 q 970 979 997 963 q 925 989 956 987 q 874 999 894 990 q 854 1037 854 1008 q 864 1074 854 1057 q 893 1091 873 1091 q 995 1089 927 1091 q 1097 1086 1063 1086 q 1197 1089 1131 1086 q 1297 1091 1264 1091 q 1326 1074 1317 1091 q 1336 1037 1336 1057 q 1323 1003 1336 1014 q 1292 992 1309 992 q 1252 989 1274 991 q 1218 980 1229 987 q 1190 855 1190 962 l 1191 124 q 1218 16 1191 32 q 1253 5 1230 8 q 1295 2 1277 2 q 1327 -10 1313 1 q 1341 -45 1341 -22 q 1332 -82 1341 -65 q 1304 -99 1322 -99 z "},"":{"ha":992,"x_min":19,"x_max":991,"o":"m 991 1044 l 991 987 q 976 940 991 965 q 943 915 962 915 q 901 915 904 915 q 877 891 881 910 q 874 841 874 882 l 874 -52 q 860 -85 874 -71 q 827 -99 846 -99 l 743 -99 q 710 -85 724 -99 q 696 -52 696 -71 l 696 892 l 585 892 l 585 -52 q 572 -85 585 -71 q 538 -99 558 -99 l 454 -99 q 420 -85 434 -99 q 407 -52 407 -71 l 407 332 q 217 378 293 342 q 68 517 119 423 q 19 718 19 608 q 87 939 19 846 q 249 1063 155 1031 q 572 1091 335 1091 l 943 1091 q 977 1077 963 1091 q 991 1044 991 1063 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 273 99 l 273 0 l 0 0 l 0 99 l 273 99 m 546 198 q 581 184 566 198 q 595 149 595 169 l 595 -50 q 581 -84 595 -70 q 546 -99 566 -99 l 347 -99 q 312 -84 327 -99 q 298 -50 298 -70 l 298 149 q 312 184 298 169 q 347 198 327 198 l 546 198 m 670 496 l 670 397 l 0 397 l 0 496 l 670 496 m 174 893 l 174 794 l 0 794 l 0 893 l 174 893 m 1190 99 l 1190 0 l 620 0 l 620 99 l 1190 99 m 446 992 q 481 977 467 992 q 496 942 496 963 l 496 744 q 481 709 496 724 q 446 694 467 694 l 248 694 q 213 709 228 694 q 198 744 198 724 l 198 942 q 213 977 198 963 q 248 992 228 992 l 446 992 m 942 595 q 977 581 963 595 q 992 546 992 566 l 992 347 q 977 312 992 327 q 942 298 963 298 l 744 298 q 709 312 724 298 q 694 347 694 327 l 694 546 q 709 581 694 566 q 744 595 724 595 l 942 595 m 1190 496 l 1190 397 l 1017 397 l 1017 496 l 1190 496 m 1190 893 l 1190 794 l 521 794 l 521 893 l 1190 893 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 942 397 q 1118 324 1046 397 q 1190 149 1190 252 q 1118 -27 1190 46 q 942 -99 1046 -99 q 767 -27 839 -99 q 694 149 694 46 q 696 175 694 158 l 417 315 q 248 248 346 248 q 72 320 145 248 q 0 496 0 393 q 72 672 0 599 q 248 744 145 744 q 417 677 346 744 l 696 817 q 694 843 694 834 q 767 1019 694 946 q 942 1091 839 1091 q 1118 1019 1046 1091 q 1190 843 1190 946 q 1118 668 1190 740 q 942 595 1046 595 q 773 662 845 595 l 494 522 q 496 496 496 505 q 494 470 496 487 l 773 330 q 942 397 845 397 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 944 148 q 968 172 944 148 q 992 264 992 196 q 944 381 992 332 q 827 430 895 430 q 715 385 762 430 l 528 478 q 529 496 529 491 q 528 514 529 501 l 715 607 q 827 562 762 562 q 944 611 895 562 q 992 728 992 660 q 944 844 992 796 q 827 893 895 893 q 710 844 759 893 q 661 728 661 796 q 663 710 661 722 l 476 617 q 363 661 428 661 q 247 613 295 661 q 198 496 198 564 q 247 379 198 428 q 363 331 295 331 q 476 375 428 331 l 663 282 q 661 264 661 270 q 710 148 661 196 q 827 99 759 99 q 944 148 895 99 m 1190 868 l 1190 124 q 1125 -34 1190 32 q 967 -99 1059 -99 l 223 -99 q 65 -34 131 -99 q 0 124 0 32 l 0 868 q 65 1026 0 960 q 223 1091 131 1091 l 967 1091 q 1125 1026 1059 1091 q 1190 868 1190 960 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 443 696 q 446 705 443 696 q 443 734 450 715 q 416 761 435 753 q 378 761 398 769 q 230 663 295 727 q 132 515 166 598 q 132 477 124 495 q 159 450 140 458 q 177 446 169 446 q 224 477 210 446 q 300 593 250 543 q 415 669 350 643 q 443 696 435 677 m 1173 1010 l 1208 974 l 1019 786 l 1072 733 q 1087 698 1087 718 q 1072 663 1087 677 l 1022 613 q 1091 347 1091 488 q 1048 135 1091 236 q 932 -39 1005 34 q 758 -155 859 -112 q 546 -198 656 -198 q 334 -155 435 -198 q 159 -39 233 -112 q 43 135 86 34 q 0 347 0 236 q 43 559 0 458 q 159 734 86 660 q 334 850 233 807 q 546 893 435 893 q 811 824 687 893 l 861 873 q 896 888 876 888 q 932 873 917 888 l 984 821 l 1173 1010 m 1179 1053 q 1162 1046 1171 1046 q 1144 1053 1152 1046 l 1073 1123 q 1066 1141 1066 1131 q 1073 1159 1066 1151 q 1091 1166 1081 1166 q 1109 1159 1101 1166 l 1179 1088 q 1187 1071 1187 1081 q 1179 1053 1187 1060 m 1357 875 q 1339 868 1349 868 q 1321 875 1330 868 l 1252 946 q 1244 963 1244 953 q 1252 980 1244 973 q 1269 988 1259 988 q 1287 980 1280 988 l 1357 911 q 1364 893 1364 903 q 1357 875 1364 883 m 1382 1035 q 1385 1031 1382 1035 q 1389 1017 1389 1028 q 1382 999 1389 1006 q 1364 992 1375 992 l 1290 992 q 1272 999 1279 992 q 1265 1017 1265 1006 q 1272 1035 1265 1028 q 1290 1042 1279 1042 l 1364 1042 q 1382 1035 1375 1042 m 1240 1166 l 1240 1091 q 1233 1073 1240 1080 q 1215 1066 1226 1066 q 1197 1073 1204 1066 q 1190 1091 1190 1080 l 1190 1166 q 1197 1184 1190 1177 q 1215 1190 1204 1190 q 1233 1184 1226 1190 q 1240 1166 1240 1177 m 1357 1123 l 1287 1053 q 1270 1046 1279 1046 q 1252 1053 1259 1046 q 1244 1071 1244 1060 q 1252 1088 1244 1081 l 1321 1159 q 1339 1166 1329 1166 q 1357 1159 1349 1166 q 1364 1141 1364 1151 q 1357 1123 1364 1131 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 472 558 l 694 719 l 917 558 l 832 298 l 557 298 l 472 558 m 425 1135 q 489 1163 425 1135 q 694 1190 553 1190 q 964 1135 836 1190 q 1186 987 1093 1080 q 1334 766 1279 894 q 1389 496 1389 637 q 1334 226 1389 355 q 1186 5 1279 98 q 964 -143 1093 -88 q 694 -198 836 -198 q 425 -143 553 -198 q 203 5 296 -88 q 55 226 110 98 q 0 496 0 355 q 55 766 0 637 q 203 987 110 894 q 425 1135 296 1080 m 1174 144 q 1290 496 1290 301 l 1290 498 l 1211 429 l 1025 603 l 1073 853 l 1177 844 q 876 1063 1061 1004 l 917 966 l 694 843 l 472 966 l 513 1063 q 212 844 328 1004 l 316 853 l 364 603 l 178 429 l 99 498 l 99 496 q 215 144 99 301 l 238 246 l 491 215 l 598 -16 l 508 -69 q 694 -99 599 -99 q 880 -69 790 -99 l 791 -16 l 898 215 l 1151 246 l 1174 144 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 347 174 l 347 25 q 340 7 347 14 q 322 0 333 0 l 174 0 q 156 7 163 0 q 149 25 149 14 l 149 174 q 156 191 149 184 q 174 198 163 198 l 322 198 q 340 191 333 198 q 347 174 347 184 m 198 471 l 198 322 q 191 305 198 312 q 174 298 184 298 l 25 298 q 7 305 14 298 q 0 322 0 312 l 0 471 q 7 489 0 482 q 25 496 14 496 l 174 496 q 191 489 184 496 q 198 471 198 482 m 645 174 l 645 25 q 638 7 645 14 q 620 0 631 0 l 471 0 q 453 7 460 0 q 446 25 446 14 l 446 174 q 453 191 446 184 q 471 198 460 198 l 620 198 q 638 191 631 198 q 645 174 645 184 m 496 471 l 496 322 q 489 305 496 312 q 471 298 482 298 l 322 298 q 305 305 312 298 q 298 322 298 312 l 298 471 q 305 489 298 482 q 322 496 312 496 l 471 496 q 489 489 482 496 q 496 471 496 482 m 51 595 q 15 610 29 595 q 0 646 0 625 l 0 746 l 398 746 l 398 646 q 384 610 398 625 q 348 595 369 595 l 51 595 m 942 174 l 942 25 q 935 7 942 14 q 918 0 929 0 l 769 0 q 751 7 758 0 q 744 25 744 14 l 744 174 q 751 191 744 184 q 769 198 758 198 l 918 198 q 935 191 929 198 q 942 174 942 184 m 794 471 l 794 322 q 787 305 794 312 q 769 298 780 298 l 620 298 q 602 305 609 298 q 595 322 595 312 l 595 471 q 602 489 595 482 q 620 496 609 496 l 769 496 q 787 489 780 496 q 794 471 794 482 m 1240 174 l 1240 25 q 1233 7 1240 14 q 1215 0 1226 0 l 1066 0 q 1049 7 1056 0 q 1042 25 1042 14 l 1042 174 q 1049 191 1042 184 q 1066 198 1056 198 l 1215 198 q 1233 191 1226 198 q 1240 174 1240 184 m 1091 471 l 1091 322 q 1084 305 1091 312 q 1066 298 1077 298 l 918 298 q 900 305 907 298 q 893 322 893 312 l 893 471 q 900 489 893 482 q 918 496 907 496 l 1066 496 q 1084 489 1077 496 q 1091 471 1091 482 m 1389 787 l 1389 777 l 991 777 l 991 785 q 694 864 991 866 q 398 785 398 863 l 398 777 l 0 777 l 0 787 q 7 821 0 801 q 33 870 13 841 q 84 929 53 900 q 169 988 115 958 q 293 1040 224 1018 q 467 1077 363 1063 q 694 1091 571 1091 q 922 1077 818 1091 q 1095 1040 1025 1063 q 1220 988 1165 1018 q 1305 929 1274 958 q 1356 870 1336 900 q 1382 821 1376 841 q 1389 787 1389 801 m 1389 471 l 1389 322 q 1382 305 1389 312 q 1364 298 1375 298 l 1215 298 q 1197 305 1204 298 q 1190 322 1190 312 l 1190 471 q 1197 489 1190 482 q 1215 496 1204 496 l 1364 496 q 1382 489 1375 496 q 1389 471 1389 482 m 1389 746 l 1389 646 q 1374 610 1389 625 q 1339 595 1359 595 l 1041 595 q 1005 610 1020 595 q 991 646 991 625 l 991 746 l 1389 746 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 546 942 l 546 347 q 531 312 546 327 q 496 298 516 298 l 496 -149 q 481 -184 496 -169 q 446 -198 467 -198 l 50 -198 q 15 -184 29 -198 q 0 -149 0 -169 l 0 248 l 193 925 q 217 942 198 942 l 546 942 m 794 942 l 794 397 l 595 397 l 595 942 l 794 942 m 1389 248 l 1389 -149 q 1374 -184 1389 -169 q 1339 -198 1359 -198 l 942 -198 q 908 -184 922 -198 q 893 -149 893 -169 l 893 298 q 858 312 873 298 q 843 347 843 327 l 843 942 l 1172 942 q 1196 925 1190 942 l 1389 248 m 570 1166 l 570 992 l 298 992 l 298 1166 q 305 1184 298 1177 q 322 1190 312 1190 l 546 1190 q 563 1184 556 1190 q 570 1166 570 1177 m 1091 1166 l 1091 992 l 818 992 l 818 1166 q 825 1184 818 1177 q 843 1190 832 1190 l 1066 1190 q 1084 1184 1077 1190 q 1091 1166 1091 1177 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 1360 839 q 1389 769 1389 810 q 1360 699 1389 729 l 1049 389 l 1166 273 l 1042 149 q 740 4 915 22 q 421 82 564 -14 l 140 -198 l 0 -198 l 0 -58 l 281 222 q 203 541 184 366 q 347 843 221 717 l 471 967 l 587 851 l 898 1162 q 968 1190 927 1190 q 1038 1162 1009 1190 q 1066 1092 1066 1133 q 1038 1022 1066 1050 l 728 711 l 909 529 l 1220 839 q 1290 868 1249 868 q 1360 839 1332 868 z "},"":{"ha":1389,"x_min":19,"x_max":1370,"o":"m 677 617 q 627 506 677 553 q 509 460 578 460 q 391 506 440 460 q 342 617 342 553 q 391 728 342 682 q 509 773 440 773 q 627 728 578 773 q 677 617 677 682 m 1066 617 q 1017 506 1066 553 q 898 460 968 460 q 780 506 829 460 q 731 617 731 553 q 780 728 731 682 q 898 773 829 773 q 1017 728 968 773 q 1066 617 1066 682 m 1240 477 l 1240 994 q 1215 1090 1240 1062 q 1129 1118 1190 1118 l 267 1118 q 180 1092 203 1118 q 157 994 157 1066 l 157 473 q 226 442 191 455 q 289 420 261 429 q 351 406 316 412 q 407 397 387 400 q 461 394 426 395 q 506 394 495 394 q 550 395 517 394 q 584 397 583 397 q 658 376 637 398 q 666 369 663 371 q 713 329 686 350 q 805 397 718 400 q 833 396 808 397 q 866 394 857 395 q 901 393 875 394 q 942 394 928 393 q 985 398 957 395 q 1032 404 1012 400 q 1080 415 1052 408 q 1132 430 1108 421 q 1184 451 1156 439 q 1240 477 1213 463 m 1366 481 q 1078 286 1273 366 q 1060 -74 1143 65 q 918 -189 1009 -162 q 777 -177 838 -214 q 714 -50 711 -138 l 713 202 l 713 203 q 694 208 707 205 q 676 212 681 211 l 675 -50 q 611 -177 678 -139 q 469 -189 550 -214 q 328 -73 378 -161 q 311 286 246 67 q 22 481 116 366 q 19 530 3 510 q 66 529 36 550 q 75 524 69 528 q 83 518 81 520 l 83 1056 q 119 1151 83 1111 q 208 1190 156 1190 l 1182 1190 q 1270 1151 1234 1190 q 1307 1056 1307 1111 l 1307 518 l 1323 529 q 1370 530 1353 550 q 1366 481 1386 510 z "},"":{"ha":1389,"x_min":78,"x_max":1311,"o":"m 694 854 l 694 518 l 582 518 l 582 854 l 694 854 m 1003 854 l 1003 518 l 891 518 l 891 854 l 1003 854 m 1003 265 l 1199 462 l 1199 1078 l 274 1078 l 274 265 l 526 265 l 526 97 l 694 265 l 1003 265 m 1311 1190 l 1311 405 l 975 69 l 722 69 l 554 -99 l 386 -99 l 386 69 l 78 69 l 78 966 l 162 1190 l 1311 1190 z "},"":{"ha":1190,"x_min":69,"x_max":1124,"o":"m 599 168 l 599 70 q 594 -167 598 -157 q 555 -198 585 -191 q 414 -168 513 -205 q 288 -99 315 -132 q 275 -71 278 -88 q 278 -51 274 -62 q 305 -15 281 -43 q 445 153 328 14 q 491 207 446 153 q 522 226 503 222 q 560 223 541 230 q 589 201 579 215 q 599 168 600 186 m 484 363 q 443 308 481 320 l 350 278 q 124 210 137 210 q 82 238 97 212 q 69 296 73 257 q 70 425 63 355 q 93 522 77 495 q 136 546 109 548 q 293 487 146 546 q 382 450 348 464 l 447 424 q 475 400 465 417 q 484 363 484 384 m 1124 133 q 1053 8 1118 91 q 948 -91 987 -75 q 899 -85 919 -102 q 756 137 888 -78 l 720 197 q 711 233 709 213 q 726 268 713 252 q 791 288 753 301 q 883 257 791 288 q 1070 196 1040 206 q 1107 180 1101 185 q 1124 133 1128 163 m 603 622 q 561 528 607 543 q 473 583 516 515 l 180 1046 q 195 1094 174 1073 q 355 1164 226 1128 q 529 1188 484 1200 q 567 1153 560 1180 q 584 916 570 1139 q 603 622 599 694 m 1116 539 q 1096 493 1118 508 q 841 426 1084 485 q 770 408 789 415 l 771 410 q 736 413 753 405 q 707 438 718 421 q 707 505 684 474 q 765 584 708 506 q 881 742 862 717 q 908 773 901 768 q 958 774 929 787 q 1053 671 995 756 q 1116 541 1111 585 l 1116 539 z "},"":{"ha":1587,"x_min":0,"x_max":1587,"o":"m 794 794 l 496 794 l 496 496 l 794 496 l 794 794 m 893 298 l 893 198 l 397 198 l 397 298 l 893 298 m 893 893 l 893 397 l 397 397 l 397 893 l 893 893 m 1389 298 l 1389 198 l 992 198 l 992 298 l 1389 298 m 1389 496 l 1389 397 l 992 397 l 992 496 l 1389 496 m 1389 694 l 1389 595 l 992 595 l 992 694 l 1389 694 m 1389 893 l 1389 794 l 992 794 l 992 893 l 1389 893 m 198 149 l 198 893 l 99 893 l 99 149 q 114 114 99 129 q 149 99 129 99 q 184 114 169 99 q 198 149 198 129 m 1488 149 l 1488 992 l 298 992 l 298 149 q 289 99 298 123 l 1438 99 q 1473 114 1459 99 q 1488 149 1488 129 m 1587 1091 l 1587 149 q 1544 43 1587 87 q 1438 0 1500 0 l 149 0 q 43 43 87 0 q 0 149 0 87 l 0 992 l 198 992 l 198 1091 l 1587 1091 z "},"":{"ha":1587,"x_min":33,"x_max":1555,"o":"m 866 67 q 837 39 866 67 q 794 10 809 10 q 722 67 778 10 q 665 140 665 124 q 713 181 665 164 q 794 198 762 198 q 874 181 825 198 q 922 140 922 164 q 866 67 922 124 m 1003 220 q 972 239 1001 220 q 893 278 942 259 q 794 298 844 298 q 694 278 743 298 q 616 239 645 259 q 584 220 587 220 q 512 278 570 220 q 453 350 453 336 q 461 368 453 360 q 613 462 522 428 q 794 496 705 496 q 974 462 883 496 q 1126 368 1066 428 q 1134 350 1134 360 q 1075 278 1134 336 q 1003 220 1017 220 m 1215 431 q 1197 437 1206 431 q 1001 557 1091 519 q 794 595 911 595 q 662 578 728 595 q 546 537 595 561 q 458 489 497 513 q 397 448 419 465 q 373 431 374 431 q 301 489 360 431 q 243 561 243 547 q 251 578 243 570 q 499 737 353 680 q 794 794 645 794 q 1088 737 942 794 q 1336 578 1234 680 q 1344 561 1344 570 q 1286 489 1344 547 q 1215 431 1228 431 m 1425 641 q 1407 648 1416 641 q 1120 831 1269 770 q 794 893 970 893 q 468 831 617 893 q 180 648 319 770 q 163 641 171 641 q 91 699 150 641 q 33 771 33 757 q 40 789 33 781 q 385 1012 185 933 q 794 1091 585 1091 q 1202 1012 1002 1091 q 1547 789 1402 933 q 1555 771 1555 781 q 1496 699 1555 757 q 1425 641 1438 641 z "},"":{"ha":1389,"x_min":0,"x_max":1290,"o":"m 269 -70 q 283 -56 269 -70 q 298 0 298 -41 q 269 70 298 41 q 198 99 239 99 q 128 70 157 99 q 99 0 99 41 q 128 -70 99 -41 q 198 -99 157 -99 q 269 -70 239 -99 m 566 -70 q 581 -56 566 -70 q 595 0 595 -41 q 566 70 595 41 q 496 99 537 99 q 426 70 455 99 q 397 0 397 41 q 426 -70 397 -41 q 496 -99 455 -99 q 566 -70 537 -99 m 269 227 q 283 242 269 227 q 298 298 298 257 q 269 368 298 339 q 198 397 239 397 q 128 368 157 397 q 99 298 99 339 q 128 227 99 257 q 198 198 157 198 q 269 227 239 198 m 864 -70 q 878 -56 864 -70 q 893 0 893 -41 q 864 70 893 41 q 794 99 835 99 q 724 70 753 99 q 694 0 694 41 q 724 -70 694 -41 q 794 -99 753 -99 q 864 -70 835 -99 m 566 227 q 581 242 566 227 q 595 298 595 257 q 566 368 595 339 q 496 397 537 397 q 426 368 455 397 q 397 298 397 339 q 426 227 397 257 q 496 198 455 198 q 566 227 537 198 m 269 525 q 283 540 269 525 q 298 595 298 554 q 269 665 298 636 q 198 694 239 694 q 128 665 157 694 q 99 595 99 636 q 128 525 99 554 q 198 496 157 496 q 269 525 239 496 m 864 227 q 878 242 864 227 q 893 298 893 257 q 864 368 893 339 q 794 397 835 397 q 724 368 753 397 q 694 298 694 339 q 724 227 694 257 q 794 198 753 198 q 864 227 835 198 m 566 525 q 581 540 566 525 q 595 595 595 554 q 566 665 595 636 q 496 694 537 694 q 426 665 455 694 q 397 595 397 636 q 426 525 397 554 q 496 496 455 496 q 566 525 537 496 m 1190 0 l 1190 298 q 1161 367 1190 338 q 1091 397 1132 397 q 1022 367 1051 397 q 992 298 992 338 l 992 0 q 1022 -70 992 -40 q 1091 -99 1051 -99 q 1161 -70 1132 -99 q 1190 0 1190 -40 m 864 525 q 878 540 864 525 q 893 595 893 554 q 864 665 893 636 q 794 694 835 694 q 724 665 753 694 q 694 595 694 636 q 724 525 694 554 q 794 496 753 496 q 864 525 835 496 m 1190 843 l 1190 1042 q 1176 1077 1190 1062 q 1141 1091 1161 1091 l 149 1091 q 114 1077 129 1091 q 99 1042 99 1062 l 99 843 q 114 808 99 823 q 149 794 129 794 l 1141 794 q 1176 808 1161 794 q 1190 843 1190 823 m 1161 525 q 1176 540 1161 525 q 1190 595 1190 554 q 1161 665 1190 636 q 1091 694 1132 694 q 1021 665 1050 694 q 992 595 992 636 q 1021 525 992 554 q 1091 496 1050 496 q 1161 525 1132 496 m 1290 1091 l 1290 -99 q 1260 -169 1290 -140 q 1190 -198 1231 -198 l 99 -198 q 29 -169 59 -198 q 0 -99 0 -140 l 0 1091 q 29 1161 0 1132 q 99 1190 59 1190 l 1190 1190 q 1260 1161 1231 1190 q 1290 1091 1290 1132 z "},"":{"ha":1190,"x_min":7,"x_max":1177,"o":"m 1177 690 q 1174 532 1191 625 q 736 188 1107 188 l 702 188 q 668 175 683 188 q 649 142 653 162 l 646 127 l 604 -141 l 602 -153 q 583 -186 598 -173 q 549 -198 568 -198 l 354 -198 q 329 -187 338 -198 q 322 -159 319 -175 q 342 -29 329 -115 q 363 102 356 58 q 384 231 370 145 q 405 361 398 318 q 438 390 408 390 l 539 390 q 722 406 643 388 q 945 518 858 436 q 1065 708 1024 591 q 1092 811 1084 763 q 1094 817 1093 816 q 1097 818 1095 818 q 1101 815 1098 818 q 1177 690 1163 770 m 1044 908 q 1008 725 1044 825 q 774 481 946 545 q 579 449 687 450 q 509 448 579 448 l 439 449 q 348 374 362 449 q 282 -36 346 368 q 273 -44 281 -44 l 44 -44 q 16 -31 27 -44 q 7 -2 5 -19 l 187 1139 q 208 1176 191 1161 q 248 1190 226 1190 l 711 1190 q 787 1180 738 1190 q 873 1156 836 1170 q 1000 1060 956 1124 q 1044 908 1044 997 z "},"":{"ha":1389,"x_min":30,"x_max":1389,"o":"m 342 670 q 382 649 367 670 q 663 50 588 367 l 317 50 q 33 630 219 391 q 30 656 23 643 q 53 670 37 670 l 342 670 m 775 393 q 678 88 737 239 q 480 549 617 329 q 514 897 511 720 q 775 393 677 633 m 852 942 q 1150 401 1034 691 q 1293 -198 1266 111 l 943 -198 q 515 942 911 317 l 852 942 m 1389 496 q 1311 -133 1389 167 q 1032 706 1259 301 q 950 1159 1013 939 q 954 1181 947 1171 q 974 1190 962 1190 l 1252 1190 q 1282 1180 1269 1190 q 1300 1155 1296 1170 q 1389 496 1389 838 z "},"":{"ha":1786,"x_min":0,"x_max":1786,"o":"m 1531 423 l 1424 423 q 1475 562 1435 452 l 1477 569 q 1485 589 1480 577 q 1492 609 1490 601 l 1501 567 l 1531 423 m 412 474 l 367 702 q 308 744 358 744 l 101 744 l 99 734 q 412 474 340 673 m 550 744 l 425 405 l 412 474 q 346 574 391 528 q 244 643 300 620 l 349 247 l 484 247 l 687 744 l 550 744 m 658 246 l 787 246 l 867 744 l 739 744 l 658 246 m 1253 732 q 1138 753 1200 753 q 982 707 1042 753 q 921 588 922 661 q 1033 453 920 509 q 1085 422 1070 436 q 1100 391 1100 408 q 1077 356 1100 368 q 1023 343 1053 343 q 902 369 956 343 l 885 377 l 867 266 q 1011 239 925 239 q 1172 285 1111 239 q 1235 409 1233 332 q 1126 544 1235 491 q 1071 577 1088 563 q 1054 606 1054 590 q 1073 636 1054 623 q 1128 649 1092 649 q 1224 630 1182 649 l 1235 624 l 1253 732 m 1583 744 l 1483 744 q 1416 702 1433 744 l 1225 246 l 1360 246 l 1387 321 l 1552 321 q 1567 246 1556 304 l 1687 246 l 1583 744 m 1786 992 l 1786 0 q 1756 -70 1786 -40 q 1687 -99 1727 -99 l 99 -99 q 29 -70 59 -99 q 0 0 0 -40 l 0 992 q 29 1062 0 1032 q 99 1091 59 1091 l 1687 1091 q 1756 1062 1727 1091 q 1786 992 1786 1032 z "},"":{"ha":1786,"x_min":0,"x_max":1786,"o":"m 867 926 q 649 992 768 992 q 496 961 570 992 q 370 877 423 929 q 286 751 318 824 q 255 598 255 678 q 286 445 255 518 q 370 319 318 372 q 496 235 423 267 q 649 204 569 204 q 867 270 768 204 q 729 475 766 353 q 730 721 693 598 q 867 926 767 843 m 893 908 q 760 714 795 831 q 759 481 724 598 q 893 288 794 365 q 1027 481 991 365 q 1026 714 1062 598 q 893 908 991 831 m 918 926 q 1056 720 1019 843 q 1056 475 1093 598 q 918 270 1020 352 q 1136 204 1018 204 q 1290 235 1217 204 q 1415 319 1363 267 q 1499 445 1468 372 q 1531 598 1531 518 q 1499 751 1531 678 q 1415 877 1468 824 q 1289 961 1363 929 q 1136 992 1216 992 q 918 926 1018 992 m 1493 367 l 1498 367 l 1498 369 l 1485 369 l 1485 367 l 1490 367 l 1490 353 l 1493 353 l 1493 367 m 1515 353 l 1518 353 l 1518 369 l 1514 369 l 1510 359 l 1505 369 l 1501 369 l 1501 353 l 1504 353 l 1504 365 l 1508 355 l 1511 355 l 1515 365 l 1515 353 m 1509 12 l 1509 11 l 1507 11 l 1505 11 l 1505 13 l 1507 13 l 1509 13 l 1509 12 m 1509 5 l 1511 5 l 1508 9 q 1510 9 1509 9 l 1511 10 q 1511 12 1511 11 q 1511 15 1511 14 l 1510 16 q 1507 16 1508 16 l 1503 16 l 1503 5 l 1505 5 l 1505 9 l 1506 9 l 1509 5 m 539 34 q 535 39 539 34 q 531 58 531 43 q 539 82 531 73 q 563 91 548 91 q 585 82 577 91 q 594 58 594 72 q 585 34 594 43 q 563 25 577 25 q 539 34 548 25 m 870 67 q 898 92 874 92 q 925 67 921 92 l 870 67 m 1182 34 q 1178 39 1182 34 q 1173 58 1173 43 q 1182 82 1173 73 q 1204 91 1190 91 q 1227 82 1218 91 q 1236 58 1236 72 q 1228 34 1236 43 q 1204 25 1219 25 q 1182 34 1190 25 m 1393 34 q 1389 39 1393 34 q 1384 58 1384 44 q 1393 82 1384 72 q 1416 91 1402 91 q 1439 82 1430 91 q 1448 58 1448 72 q 1439 34 1448 43 q 1416 25 1430 25 q 1393 34 1402 25 m 1507 2 q 1504 3 1505 2 q 1501 5 1503 3 q 1500 7 1500 6 q 1499 10 1499 9 q 1500 13 1499 12 q 1501 16 1500 15 q 1502 17 1502 17 q 1504 18 1504 17 q 1507 19 1505 19 q 1510 18 1509 19 q 1513 16 1513 16 l 1514 13 l 1514 12 q 1515 10 1515 11 l 1514 9 q 1514 7 1514 8 q 1514 6 1514 6 l 1513 5 q 1510 3 1511 3 q 1507 2 1509 2 m 464 5 l 488 5 l 488 71 q 476 101 488 90 q 446 113 465 112 q 409 95 421 113 q 374 113 398 113 q 344 98 356 113 l 344 110 l 321 110 l 321 5 l 344 5 l 344 64 q 370 91 344 91 q 393 64 393 91 l 393 5 l 415 5 l 415 64 q 441 91 415 91 q 464 64 464 91 l 464 5 m 593 5 l 615 5 l 615 58 l 615 110 l 593 110 l 593 98 q 560 113 580 113 q 522 98 537 113 q 508 58 508 82 q 522 19 508 34 q 560 3 537 3 q 593 19 581 3 l 593 5 m 731 37 q 694 68 731 64 l 684 70 q 666 81 666 73 q 685 92 666 92 q 718 84 703 92 l 728 102 q 685 113 711 113 q 653 104 665 113 q 642 79 642 95 q 678 49 642 53 l 688 47 q 707 36 707 44 q 683 23 707 23 q 648 34 663 23 l 638 16 q 683 3 657 3 q 718 12 705 3 q 731 37 731 22 m 832 11 l 825 30 q 805 25 815 25 q 791 42 791 25 l 791 89 l 828 89 l 828 110 l 791 110 l 791 142 l 767 142 l 767 110 l 746 110 l 746 89 l 767 89 l 767 42 q 804 3 767 3 q 832 11 820 3 m 898 113 q 861 98 876 113 q 846 58 846 82 q 861 18 846 33 q 900 3 877 3 q 942 18 925 3 l 932 35 q 901 23 918 23 q 870 49 875 23 l 948 49 l 948 58 q 934 98 948 83 q 898 113 920 113 m 1022 113 q 994 98 1004 113 l 994 110 l 971 110 l 971 5 l 994 5 l 994 64 q 1017 91 994 91 q 1031 88 1025 91 l 1038 110 q 1022 113 1031 113 m 1060 98 q 1052 90 1060 98 q 1045 58 1045 82 q 1060 19 1045 34 q 1101 3 1075 3 q 1138 16 1123 3 l 1127 34 q 1100 25 1113 24 q 1077 34 1086 25 q 1068 58 1068 43 q 1077 82 1068 73 q 1100 91 1086 91 q 1127 82 1115 91 l 1138 101 q 1101 113 1122 113 q 1060 98 1075 113 m 1235 5 l 1258 5 l 1258 58 l 1258 110 l 1235 110 l 1235 98 q 1202 113 1223 113 q 1165 98 1180 113 q 1149 58 1149 82 q 1165 19 1149 34 q 1202 3 1180 3 q 1235 19 1224 3 l 1235 5 m 1338 113 q 1311 98 1320 113 l 1311 110 l 1288 110 l 1288 5 l 1311 5 l 1311 64 q 1333 91 1311 91 q 1347 88 1341 91 l 1354 110 q 1338 113 1348 113 m 1446 5 l 1469 5 l 1469 58 l 1469 153 l 1446 153 l 1446 98 q 1413 113 1435 113 q 1376 97 1391 113 q 1361 58 1361 81 q 1376 19 1361 35 q 1413 3 1391 3 q 1446 19 1435 3 l 1446 5 m 1507 21 l 1505 20 q 1503 20 1504 20 q 1500 18 1501 19 q 1497 15 1497 17 q 1497 10 1497 13 q 1497 6 1497 8 q 1500 3 1497 5 q 1503 1 1501 2 q 1507 0 1504 0 q 1511 1 1510 0 q 1513 2 1511 2 l 1514 3 q 1517 6 1515 4 q 1518 10 1518 8 q 1517 15 1518 13 q 1514 18 1516 16 q 1513 19 1514 19 l 1511 20 q 1509 21 1511 20 q 1507 21 1507 21 m 1786 992 l 1786 0 q 1756 -70 1786 -40 q 1687 -99 1727 -99 l 99 -99 q 29 -70 59 -99 q 0 0 0 -40 l 0 992 q 29 1062 0 1032 q 99 1091 59 1091 l 1687 1091 q 1756 1062 1727 1091 q 1786 992 1786 1032 z "},"":{"ha":1786,"x_min":0,"x_max":1786,"o":"m 243 588 q 215 523 243 549 q 146 503 192 503 l 133 503 l 133 674 l 146 674 q 215 653 193 674 q 243 588 243 629 m 1619 639 q 1569 598 1619 598 l 1555 598 l 1555 677 l 1570 677 q 1619 639 1619 677 m 295 588 q 256 682 295 646 q 156 718 217 718 l 82 718 l 82 460 l 156 460 q 248 489 213 460 q 295 588 295 529 m 318 460 l 368 460 l 368 718 l 318 718 l 318 460 m 566 538 q 550 586 566 569 q 491 618 534 603 q 461 633 469 626 q 453 651 453 640 q 463 672 453 663 q 490 680 474 680 q 531 659 512 680 l 557 693 q 481 722 525 722 q 424 700 447 722 q 401 648 401 679 q 415 605 401 621 q 464 577 429 589 q 499 562 493 567 q 514 536 514 553 q 503 510 514 520 q 475 499 492 499 q 420 533 438 499 l 388 502 q 477 453 422 453 q 541 476 516 453 q 566 538 566 500 m 781 468 l 781 528 q 721 499 753 499 q 658 524 683 499 q 634 588 634 550 q 658 651 634 625 q 718 677 683 677 q 781 648 752 677 l 781 708 q 719 723 750 723 q 622 684 662 723 q 582 588 582 645 q 622 493 582 532 q 718 453 661 453 q 781 468 751 453 m 1736 0 l 1736 408 q 1624 343 1686 377 q 1440 253 1563 309 q 1185 146 1318 196 q 861 42 1052 96 q 470 -50 670 -12 l 1687 -50 q 1721 -35 1707 -50 q 1736 0 1736 -20 m 1035 488 q 1056 508 1035 488 q 1077 587 1077 529 q 1035 686 1077 645 q 936 727 994 727 q 837 686 878 727 q 796 587 796 645 q 837 488 796 529 q 936 446 878 446 q 1035 488 994 446 m 1194 453 l 1306 718 l 1251 718 l 1181 544 l 1112 718 l 1057 718 l 1167 453 l 1194 453 m 1328 460 l 1471 460 l 1471 503 l 1379 503 l 1379 573 l 1468 573 l 1468 616 l 1379 616 l 1379 674 l 1471 674 l 1471 718 l 1328 718 l 1328 460 m 1631 460 l 1693 460 l 1612 568 q 1671 641 1671 581 q 1647 698 1671 677 q 1580 718 1623 718 l 1504 718 l 1504 460 l 1555 460 l 1555 563 l 1562 563 l 1631 460 m 1786 987 l 1786 5 q 1756 -69 1786 -39 q 1683 -99 1726 -99 l 102 -99 q 30 -69 60 -99 q 0 5 0 -39 l 0 987 q 30 1061 0 1031 q 102 1091 60 1091 l 1683 1091 q 1756 1061 1726 1091 q 1786 987 1786 1031 z "},"":{"ha":1786,"x_min":0,"x_max":1786,"o":"m 92 662 l 161 662 l 126 746 l 92 662 m 574 254 l 631 315 l 577 377 l 450 377 l 450 339 l 560 339 l 560 296 l 450 296 l 450 254 l 574 254 m 696 315 l 773 229 l 773 398 l 696 315 m 919 351 q 888 377 919 377 l 823 377 l 823 323 l 887 323 q 919 351 919 323 m 1143 354 q 1111 377 1143 377 l 1047 377 l 1047 329 l 1110 329 q 1143 354 1143 329 m 928 715 q 895 738 928 738 l 832 738 l 832 691 l 894 691 q 928 715 928 691 m 1283 662 l 1352 662 l 1318 746 l 1283 662 m 542 782 l 542 572 l 491 572 l 491 736 l 418 572 l 374 572 l 301 736 l 301 572 l 198 572 l 179 618 l 74 618 l 55 572 l 1 572 l 91 782 l 165 782 l 250 583 l 250 782 l 332 782 l 398 639 l 458 782 l 542 782 m 973 351 q 968 324 973 336 q 958 305 964 312 q 940 292 951 297 q 920 284 929 287 q 896 281 911 281 q 871 280 880 280 q 846 280 862 280 q 823 281 830 281 l 823 210 l 725 210 l 663 280 l 599 210 l 401 210 l 401 420 l 602 420 l 664 351 l 728 420 l 888 420 q 973 351 973 420 m 747 615 l 747 572 l 579 572 l 579 782 l 747 782 l 747 738 l 629 738 l 629 700 l 744 700 l 744 657 l 629 657 l 629 615 l 747 615 m 1786 182 l 1786 5 q 1756 -69 1786 -38 q 1683 -99 1726 -99 l 102 -99 q 30 -69 60 -99 q 0 5 0 -38 l 0 530 l 86 530 l 105 577 l 148 577 l 167 530 l 336 530 l 336 566 l 351 530 l 439 530 l 454 567 l 454 530 l 873 530 l 873 607 l 881 608 q 889 597 889 608 l 889 530 l 1105 530 l 1105 548 q 1148 534 1123 539 q 1189 529 1173 529 q 1237 529 1204 529 q 1277 530 1270 530 l 1297 577 l 1340 577 l 1359 530 l 1535 530 l 1535 575 l 1562 530 l 1703 530 l 1703 823 l 1563 823 l 1563 789 l 1544 823 l 1401 823 l 1401 789 l 1383 823 l 1190 823 q 1105 806 1136 823 l 1105 823 l 972 823 l 972 806 q 915 823 953 823 l 429 823 l 395 748 l 362 823 l 208 823 l 208 789 l 191 823 l 60 823 l 0 684 l 0 987 q 30 1061 0 1030 q 102 1091 60 1091 l 1683 1091 q 1756 1061 1726 1091 q 1786 987 1786 1030 l 1786 462 l 1693 462 q 1630 445 1653 462 l 1630 462 l 1493 462 q 1432 445 1450 462 l 1432 462 l 1187 462 l 1187 445 q 1120 462 1163 462 l 958 462 l 958 445 q 887 462 940 462 l 706 462 l 664 417 l 625 462 l 355 462 l 355 169 l 621 169 l 663 215 l 704 169 l 867 169 l 867 238 l 884 238 q 953 248 929 238 l 953 169 l 1088 169 l 1088 246 l 1094 246 q 1102 244 1101 246 q 1104 236 1104 243 l 1104 169 l 1514 169 q 1582 188 1558 169 l 1582 169 l 1712 169 q 1786 182 1759 169 m 1198 363 q 1189 330 1198 346 q 1163 308 1180 315 q 1189 288 1182 301 q 1196 252 1196 274 l 1196 210 l 1146 210 l 1146 245 q 1136 279 1146 270 q 1101 287 1127 287 l 1047 287 l 1047 210 l 997 210 l 997 420 l 1116 420 q 1176 408 1153 420 q 1198 363 1198 397 m 984 725 q 974 691 984 707 q 948 669 964 676 q 975 649 968 662 q 981 613 981 636 l 981 572 l 931 572 q 931 593 931 579 q 931 612 932 606 q 929 626 931 618 q 922 639 927 635 q 909 645 918 643 q 886 648 900 648 l 832 648 l 832 572 l 782 572 l 782 782 l 901 781 q 961 770 939 781 q 984 725 984 759 m 1394 253 l 1394 210 l 1226 210 l 1226 420 l 1394 420 l 1394 377 l 1277 377 l 1277 339 l 1391 339 l 1391 296 l 1277 296 l 1277 254 l 1394 253 m 1063 782 l 1063 572 l 1012 572 l 1012 782 l 1063 782 m 1600 277 q 1521 210 1600 210 l 1424 210 l 1424 255 l 1521 255 q 1548 274 1548 255 q 1535 291 1548 287 q 1502 295 1521 295 q 1464 297 1483 295 q 1432 315 1445 300 q 1418 357 1418 329 q 1438 404 1418 388 q 1490 420 1459 420 l 1590 420 l 1590 376 l 1498 376 q 1470 357 1470 376 q 1484 341 1470 344 q 1516 338 1497 337 q 1554 336 1535 338 q 1587 319 1573 333 q 1600 277 1600 305 m 1786 315 l 1786 237 q 1718 210 1767 210 l 1621 210 l 1621 255 l 1718 255 q 1743 274 1743 255 q 1733 289 1743 284 q 1709 293 1724 294 q 1678 295 1695 293 q 1647 301 1662 297 q 1623 320 1633 305 q 1614 357 1614 334 q 1634 404 1614 388 q 1686 420 1655 420 l 1786 420 l 1786 376 l 1694 376 q 1666 357 1666 376 q 1689 339 1666 341 q 1742 336 1711 338 q 1786 315 1773 333 m 1658 781 l 1658 572 l 1587 572 l 1492 729 l 1492 572 l 1390 572 l 1370 618 l 1266 618 l 1246 572 l 1188 572 q 1088 675 1088 572 q 1191 782 1088 782 l 1240 782 l 1240 736 q 1218 737 1235 736 q 1196 737 1202 738 q 1178 736 1190 737 q 1162 731 1166 735 q 1151 720 1157 727 q 1142 703 1144 714 q 1139 677 1139 691 q 1150 632 1139 647 q 1188 616 1160 616 l 1211 616 l 1282 781 l 1357 781 l 1442 583 l 1442 781 l 1518 781 l 1607 636 l 1607 781 l 1658 781 z "},"":{"ha":1786,"x_min":0,"x_max":1786,"o":"m 577 488 q 558 441 577 460 q 509 422 538 422 q 473 434 487 422 q 460 468 460 446 q 479 517 460 497 q 527 536 498 536 q 563 524 549 536 q 577 488 577 511 m 1186 604 q 1169 560 1186 571 q 1118 548 1152 548 l 1093 547 l 1106 630 q 1116 639 1108 639 l 1130 639 q 1157 637 1147 639 q 1177 627 1167 636 q 1186 604 1186 619 m 1458 488 q 1438 441 1458 460 q 1390 422 1418 422 q 1354 434 1368 422 q 1340 468 1340 446 q 1359 517 1340 497 q 1407 536 1379 536 q 1444 524 1429 536 q 1458 488 1458 511 m 398 621 q 368 687 398 667 q 290 708 338 708 l 166 708 q 150 693 151 708 l 99 377 q 102 368 98 372 q 109 364 105 364 l 168 364 q 185 379 184 364 l 199 464 q 205 474 200 470 q 216 479 209 478 q 229 481 223 481 q 244 480 236 481 q 255 479 253 479 q 360 517 322 479 q 398 621 398 554 m 637 379 l 669 581 q 667 590 670 586 q 659 594 663 594 l 600 594 q 587 568 589 594 q 513 599 566 599 q 418 557 457 599 q 379 459 379 515 q 406 386 379 413 q 477 359 432 359 q 522 368 499 359 q 560 393 546 377 q 556 377 556 384 q 567 364 556 364 l 620 364 q 637 379 635 364 m 982 577 q 984 583 984 579 q 980 590 984 587 q 973 594 977 594 l 914 594 q 900 586 905 594 l 818 465 l 784 581 q 767 594 780 594 l 708 594 q 701 590 705 594 q 698 583 698 587 q 713 537 698 581 q 746 442 729 493 q 764 388 763 391 q 701 295 701 301 q 711 284 701 284 l 770 284 q 784 292 779 284 l 982 577 m 1278 621 q 1248 687 1278 667 q 1170 708 1218 708 l 1047 708 q 1030 693 1032 708 l 980 377 q 982 368 979 372 q 990 364 985 364 l 1053 364 q 1066 374 1063 364 l 1080 464 q 1085 474 1080 470 q 1097 479 1090 478 q 1110 481 1104 481 q 1125 480 1116 481 q 1135 479 1133 479 q 1240 517 1202 479 q 1278 621 1278 554 m 1518 379 l 1549 581 q 1547 590 1550 586 q 1539 594 1544 594 l 1480 594 q 1467 568 1469 594 q 1394 599 1447 599 q 1299 557 1338 599 q 1259 459 1259 515 q 1286 386 1259 413 q 1358 359 1313 359 q 1404 368 1380 359 q 1440 393 1427 377 q 1438 386 1440 392 q 1437 377 1437 380 q 1447 364 1437 364 l 1500 364 q 1518 379 1515 364 m 1687 696 l 1687 697 q 1676 708 1687 708 l 1619 708 q 1609 699 1611 708 l 1559 377 l 1558 375 q 1561 368 1558 371 q 1569 364 1564 364 l 1620 364 q 1636 379 1635 364 l 1687 696 m 304 592 q 284 556 300 565 q 237 548 267 548 l 212 547 l 225 630 q 235 639 226 639 l 250 639 q 295 630 281 639 q 304 592 308 621 m 1786 992 l 1786 0 q 1756 -70 1786 -40 q 1687 -99 1727 -99 l 99 -99 q 29 -70 59 -99 q 0 0 0 -40 l 0 992 q 29 1062 0 1032 q 99 1091 59 1091 l 1687 1091 q 1756 1062 1727 1091 q 1786 992 1786 1032 z "},"":{"ha":1786,"x_min":0,"x_max":1786,"o":"m 1238 491 q 1221 408 1238 437 q 1181 381 1207 381 q 1149 388 1163 381 l 1149 562 q 1194 585 1172 585 q 1238 491 1238 585 m 1577 519 l 1492 519 q 1535 594 1497 594 q 1577 519 1575 594 m 369 414 q 343 485 369 460 q 265 529 318 510 q 225 548 237 539 q 212 567 212 556 q 242 587 212 587 q 338 562 287 587 l 352 649 q 236 674 300 674 q 141 644 177 674 q 104 560 104 614 q 129 489 104 515 q 206 446 154 464 q 248 426 236 435 q 260 405 260 417 q 223 381 260 381 q 169 390 201 381 q 113 414 137 400 l 99 326 q 229 295 155 295 q 329 323 292 295 q 369 414 369 355 m 598 581 l 612 667 l 538 667 l 538 771 l 438 755 l 424 667 l 388 660 l 375 581 l 423 581 l 423 411 q 457 318 423 346 q 543 295 487 295 q 605 303 568 295 l 605 395 q 570 389 580 389 q 538 428 538 389 l 538 581 l 598 581 m 842 561 l 842 669 q 821 671 831 671 q 778 659 796 671 q 752 623 760 646 l 744 667 l 643 667 l 643 301 l 759 301 l 759 539 q 822 563 779 563 q 842 561 835 563 m 871 301 l 987 301 l 987 667 l 871 667 l 871 301 m 1353 494 q 1318 633 1353 589 q 1232 674 1287 674 q 1142 630 1183 674 l 1135 667 l 1033 667 l 1033 167 l 1149 186 l 1149 303 q 1202 295 1177 295 q 1306 338 1266 295 q 1353 494 1353 388 m 973 720 q 982 730 973 720 q 991 764 991 739 q 973 808 991 790 q 929 825 955 825 q 886 808 904 825 q 868 764 868 790 q 886 720 868 739 q 929 702 904 702 q 973 720 955 702 m 1687 488 q 1649 624 1687 575 q 1538 674 1611 674 q 1420 622 1463 674 q 1377 483 1377 571 q 1426 337 1377 384 q 1551 295 1469 295 q 1675 326 1629 295 l 1662 405 q 1563 381 1618 381 q 1514 396 1530 381 q 1493 447 1497 411 l 1685 447 q 1687 488 1687 458 m 1786 992 l 1786 0 q 1756 -70 1786 -40 q 1687 -99 1727 -99 l 99 -99 q 29 -70 59 -99 q 0 0 0 -40 l 0 992 q 29 1062 0 1032 q 99 1091 59 1091 l 1687 1091 q 1756 1062 1727 1091 q 1786 992 1786 1032 z "},"":{"ha":1587,"x_min":11,"x_max":1576,"o":"m 1208 530 q 1438 99 1255 254 q 1409 29 1438 59 q 1339 0 1380 0 l 992 0 q 934 -140 992 -82 q 794 -198 876 -198 q 654 -141 711 -198 q 595 -1 596 -83 l 1208 530 m 794 -136 q 806 -124 806 -136 q 794 -112 806 -112 q 715 -79 748 -112 q 682 0 682 -46 q 670 12 682 12 q 657 0 657 12 q 697 -96 657 -57 q 794 -136 737 -136 m 1570 1104 q 1576 1085 1576 1096 q 1568 1068 1576 1075 l 117 -189 q 99 -195 109 -195 q 82 -186 88 -194 l 17 -112 q 11 -93 11 -104 q 19 -77 12 -83 l 164 48 q 149 99 149 73 q 219 167 188 132 q 285 260 251 203 q 343 383 319 317 q 382 543 367 449 q 397 744 397 636 q 488 963 397 862 q 725 1086 578 1064 q 719 1116 719 1101 q 741 1169 719 1147 q 794 1190 763 1190 q 846 1169 825 1190 q 868 1116 868 1147 q 862 1086 868 1101 q 1032 1022 958 1072 q 1146 900 1105 972 l 1470 1181 q 1488 1187 1478 1187 q 1505 1178 1499 1186 l 1570 1104 z "},"":{"ha":1587,"x_min":11,"x_max":1576,"o":"m 794 -136 q 806 -124 806 -136 q 794 -112 806 -112 q 715 -79 748 -112 q 682 0 682 -46 q 670 12 682 12 q 657 0 657 12 q 697 -96 657 -57 q 794 -136 737 -136 m 390 244 l 1070 833 q 967 947 1037 901 q 794 992 897 992 q 662 968 722 992 q 568 905 603 943 q 515 825 533 867 q 496 744 496 784 q 390 244 496 446 m 1438 99 q 1409 29 1438 59 q 1339 0 1380 0 l 992 0 q 934 -140 992 -82 q 794 -198 876 -198 q 654 -141 711 -198 q 595 -1 596 -83 l 711 99 l 1297 99 q 1121 455 1169 244 l 1208 530 q 1438 99 1255 254 m 1505 1178 l 1570 1104 q 1576 1085 1576 1096 q 1568 1068 1576 1075 l 117 -189 q 99 -195 109 -195 q 82 -186 88 -194 l 17 -112 q 11 -93 11 -104 q 19 -77 12 -83 l 164 48 q 149 99 149 73 q 219 167 188 132 q 285 260 251 203 q 343 383 319 317 q 382 543 367 449 q 397 744 397 636 q 488 963 397 862 q 725 1086 578 1064 q 719 1116 719 1101 q 741 1169 719 1147 q 794 1190 763 1190 q 846 1169 825 1190 q 868 1116 868 1147 q 862 1086 868 1101 q 1032 1022 958 1072 q 1146 900 1105 972 l 1470 1181 q 1488 1187 1478 1187 q 1505 1178 1499 1186 z "},"":{"ha":1091,"x_min":0,"x_max":1091,"o":"m 397 124 l 397 670 q 390 687 397 680 q 372 694 383 694 l 322 694 q 305 687 312 694 q 298 670 298 680 l 298 124 q 305 106 298 113 q 322 99 312 99 l 372 99 q 390 106 383 99 q 397 124 397 113 m 595 124 l 595 670 q 588 687 595 680 q 570 694 581 694 l 521 694 q 503 687 510 694 q 496 670 496 680 l 496 124 q 503 106 496 113 q 521 99 510 99 l 570 99 q 588 106 581 99 q 595 124 595 113 m 794 124 l 794 670 q 787 687 794 680 q 769 694 780 694 l 719 694 q 701 687 708 694 q 694 670 694 680 l 694 124 q 701 106 694 113 q 719 99 708 99 l 769 99 q 787 106 780 99 q 794 124 794 113 m 372 893 l 719 893 l 682 984 q 669 992 677 991 l 423 992 q 410 984 415 991 l 372 893 m 1091 868 l 1091 818 q 1084 801 1091 808 q 1066 794 1077 794 l 992 794 l 992 59 q 956 -52 992 -5 q 868 -99 919 -99 l 223 -99 q 136 -54 172 -99 q 99 56 99 -9 l 99 794 l 25 794 q 7 801 14 794 q 0 818 0 808 l 0 868 q 7 886 0 879 q 25 893 14 893 l 264 893 l 319 1022 q 360 1071 330 1051 q 422 1091 391 1091 l 670 1091 q 731 1071 701 1091 q 773 1022 761 1051 l 827 893 l 1066 893 q 1084 886 1077 893 q 1091 868 1091 879 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 891 358 l 891 274 q 863 205 891 235 q 790 158 835 174 q 699 133 746 141 q 608 124 652 124 q 342 232 449 124 q 236 500 236 339 q 341 763 236 657 q 604 868 446 868 q 662 865 630 868 q 734 851 694 861 q 806 824 774 840 q 860 780 838 808 q 881 718 881 753 l 881 633 q 869 621 881 621 l 777 621 q 765 633 765 621 l 765 687 q 714 740 765 721 q 608 759 663 759 q 431 688 499 759 q 362 504 362 617 q 433 310 362 387 q 614 234 504 234 q 721 253 667 234 q 775 304 775 271 l 775 358 q 779 367 775 363 q 787 370 782 370 l 879 370 q 887 367 884 370 q 891 358 891 363 m 788 953 q 742 972 788 953 q 595 992 696 992 q 403 953 494 992 q 245 847 311 913 q 139 689 178 780 q 99 496 99 597 q 139 303 99 395 q 245 145 178 212 q 403 40 311 79 q 595 0 494 0 q 788 40 696 0 q 946 145 880 79 q 1052 303 1012 212 q 1091 496 1091 395 q 1052 689 1091 597 q 946 847 1012 780 q 788 953 880 913 m 1111 795 q 1151 726 1111 795 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 753 590 q 712 721 753 674 q 598 768 670 768 q 501 744 549 768 q 416 679 454 721 q 355 573 378 637 q 331 433 331 508 q 372 299 331 346 q 489 252 414 252 q 625 303 563 252 q 720 432 687 355 q 753 590 753 509 m 1190 496 q 1162 343 1190 410 q 1085 239 1133 277 q 984 181 1038 201 q 871 160 929 161 q 859 159 867 160 q 846 159 852 159 q 736 200 773 159 q 711 264 715 226 q 609 179 670 213 q 474 145 547 145 q 281 219 350 145 q 212 428 212 293 q 264 653 212 550 q 402 816 315 756 q 593 876 490 876 q 713 848 660 876 q 795 771 766 821 l 797 786 l 805 829 q 810 839 806 834 q 817 843 813 843 l 908 843 q 918 835 912 843 q 921 822 922 831 l 828 346 q 824 309 824 328 q 834 269 824 279 q 868 259 843 259 q 912 263 890 260 q 969 282 935 267 q 1028 320 1003 297 q 1073 390 1054 344 q 1091 496 1091 436 q 956 857 1091 722 q 595 992 822 992 q 403 953 494 992 q 245 847 311 913 q 139 689 178 780 q 99 496 99 597 q 139 303 99 395 q 245 145 178 212 q 403 40 311 79 q 595 0 494 0 q 909 112 772 0 q 928 118 918 119 q 944 109 938 117 l 976 71 q 981 52 982 61 q 972 35 980 42 q 796 -64 893 -29 q 595 -99 698 -99 q 364 -52 474 -99 q 174 75 254 -5 q 47 265 95 155 q 0 496 0 375 q 47 727 0 617 q 174 917 95 837 q 364 1044 254 997 q 595 1091 474 1091 q 1026 927 862 1091 q 1190 496 1190 763 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 1140 1190 q 1192 1190 1140 1190 q 1316 1118 1243 1190 q 1389 942 1389 1045 q 1316 767 1389 839 l 1142 594 l 1222 514 q 1230 496 1230 506 q 1222 478 1230 486 l 1059 315 q 1042 308 1052 308 q 1024 315 1032 308 l 942 397 l 475 -71 q 405 -99 446 -99 l 248 -99 l 50 -198 l 0 -149 l 99 50 l 99 207 q 128 277 99 248 l 595 744 l 514 825 q 506 843 506 833 q 514 861 506 853 l 677 1024 q 694 1032 684 1032 q 712 1024 705 1032 l 793 943 l 966 1118 q 1140 1190 1038 1190 m 397 50 l 843 496 l 694 645 l 248 198 l 248 50 l 397 50 z "},"":{"ha":1389,"x_min":0,"x_max":1387,"o":"m 1252 1190 q 1347 1154 1306 1190 q 1387 1064 1387 1118 q 1352 947 1387 1015 q 992 364 1095 460 q 823 294 917 294 q 655 365 725 294 q 585 536 585 437 q 656 700 585 635 l 1151 1149 q 1252 1190 1197 1190 m 547 389 q 630 288 577 330 q 746 229 682 246 l 747 174 q 647 -95 750 9 q 377 -198 543 -198 q 208 -162 281 -198 q 90 -64 134 -126 q 22 78 45 -1 q 0 249 0 157 q 32 226 5 245 q 80 191 58 206 q 126 163 102 176 q 161 150 150 150 q 204 178 193 150 q 248 265 223 229 q 302 324 274 301 q 370 361 331 347 q 450 381 410 375 q 547 389 491 387 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 1389 99 l 1389 -198 l 0 -198 l 0 99 q 66 110 35 99 q 112 131 97 121 q 148 160 126 142 q 188 190 171 181 q 232 198 205 198 q 266 193 250 198 q 290 181 281 188 q 315 160 298 175 q 352 131 338 141 q 397 110 366 121 q 463 99 428 99 q 529 110 498 99 q 574 131 560 122 q 612 160 588 141 q 637 181 628 175 q 661 193 646 188 q 694 198 676 198 q 738 190 722 198 q 778 160 755 181 q 815 131 800 142 q 860 110 829 121 q 926 99 891 99 q 992 110 961 99 q 1038 131 1023 121 q 1074 160 1053 142 q 1114 190 1097 181 q 1158 198 1131 198 q 1201 190 1184 198 q 1241 160 1218 181 q 1277 131 1263 142 q 1323 110 1292 121 q 1389 99 1354 99 m 1389 347 l 1389 198 q 1355 204 1370 198 q 1331 215 1339 209 q 1305 236 1322 222 q 1269 266 1283 256 q 1224 287 1255 276 q 1158 298 1193 298 q 1091 287 1122 298 q 1046 266 1060 276 q 1010 236 1032 256 q 984 215 993 222 q 960 204 976 209 q 926 198 945 198 q 882 207 899 198 q 842 236 866 215 q 806 266 820 256 q 761 287 792 276 q 694 298 730 298 q 629 286 660 298 q 584 265 598 275 q 546 236 570 256 q 521 215 530 222 q 497 204 512 209 q 463 198 482 198 q 420 207 436 198 q 380 236 403 215 q 343 265 358 255 q 298 287 329 276 q 232 298 267 298 q 165 287 196 298 q 120 266 134 276 q 84 236 106 256 q 44 207 60 215 q 0 198 27 198 l 0 347 q 43 453 0 409 q 149 496 87 496 l 198 496 l 198 843 l 397 843 l 397 496 l 595 496 l 595 843 l 794 843 l 794 496 l 992 496 l 992 843 l 1190 843 l 1190 496 l 1240 496 q 1345 453 1302 496 q 1389 347 1389 409 m 397 1017 q 369 925 397 957 q 298 893 341 893 q 227 922 257 893 q 198 992 198 951 q 206 1032 198 1015 q 224 1058 213 1049 q 248 1080 235 1067 q 272 1104 261 1092 q 290 1139 283 1116 q 298 1190 298 1161 q 362 1133 327 1190 q 397 1017 397 1076 m 794 1017 q 766 925 794 957 q 694 893 738 893 q 624 922 653 893 q 595 992 595 951 q 603 1032 595 1015 q 621 1058 610 1049 q 645 1080 632 1067 q 669 1104 658 1092 q 687 1139 680 1116 q 694 1190 694 1161 q 759 1133 724 1190 q 794 1017 794 1076 m 1190 1017 q 1163 925 1190 957 q 1091 893 1135 893 q 1021 922 1050 893 q 992 992 992 951 q 999 1032 992 1015 q 1018 1058 1007 1049 q 1042 1080 1028 1067 q 1066 1104 1055 1092 q 1084 1139 1077 1116 q 1091 1190 1091 1161 q 1156 1133 1121 1190 q 1190 1017 1190 1076 z "},"":{"ha":1587,"x_min":0,"x_max":1587,"o":"m 1587 0 l 1587 -99 l 0 -99 l 0 1091 l 99 1091 l 99 0 l 1587 0 m 1290 794 l 1488 99 l 198 99 l 198 546 l 546 992 l 992 546 l 1290 794 z "},"":{"ha":1389,"x_min":0,"x_max":1339,"o":"m 595 501 l 1018 78 q 827 -53 936 -6 q 595 -99 717 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 q 595 1091 433 1091 l 595 501 m 740 496 l 1339 496 q 1293 265 1339 374 q 1163 73 1246 155 l 740 496 m 1290 595 l 694 595 l 694 1190 q 993 1111 856 1190 q 1210 894 1130 1031 q 1290 595 1290 757 z "},"":{"ha":1587,"x_min":0,"x_max":1587,"o":"m 1587 0 l 1587 -99 l 0 -99 l 0 1091 l 99 1091 l 99 0 l 1587 0 m 1488 967 l 1488 630 q 1473 607 1488 614 q 1445 613 1458 601 l 1352 707 l 861 216 q 843 208 853 208 q 825 216 833 208 l 645 397 l 322 74 l 174 223 l 627 677 q 645 684 635 684 q 663 677 655 684 l 843 496 l 1203 856 l 1109 949 q 1103 977 1097 962 q 1126 992 1110 992 l 1463 992 q 1481 985 1474 992 q 1488 967 1488 978 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 1001 645 q 1009 613 1001 640 q 1028 575 1017 591 q 1060 548 1040 559 q 1094 533 1080 538 q 1137 520 1108 528 q 1389 263 1389 450 q 1307 75 1389 150 q 1110 0 1225 0 q 1023 14 1064 0 q 953 50 983 29 q 893 107 922 71 q 844 175 863 144 q 803 255 825 206 q 769 335 780 305 q 738 418 757 366 q 711 491 719 470 q 663 595 686 554 q 606 670 640 636 q 525 719 572 704 q 415 735 479 735 q 274 692 341 735 q 167 580 206 649 q 127 436 127 511 q 210 220 127 312 q 414 127 292 127 q 614 201 551 127 q 678 291 657 250 l 743 173 q 709 119 732 146 l 710 118 q 409 0 608 0 q 200 61 295 0 q 53 222 105 122 q 0 435 0 322 q 34 594 0 516 q 124 731 67 673 q 257 825 180 790 q 415 861 334 861 q 539 846 483 861 q 634 808 594 832 q 708 746 674 784 q 764 669 742 708 q 810 578 787 630 q 849 482 832 526 q 887 381 865 437 q 930 282 910 324 q 1111 127 1004 127 q 1218 165 1173 127 q 1263 264 1263 202 q 1248 320 1263 297 q 1209 356 1233 343 q 1152 380 1184 368 q 1087 401 1121 392 q 1019 427 1053 410 q 956 468 985 445 q 906 531 928 491 q 876 626 884 572 q 873 652 873 639 q 941 801 873 737 q 1095 861 1009 864 q 1189 850 1156 859 q 1259 808 1221 841 l 1258 808 q 1276 789 1267 800 q 1296 761 1284 779 q 1311 740 1308 744 l 1211 663 q 1169 718 1190 701 l 1169 718 q 1094 735 1151 735 q 1028 709 1056 735 q 1001 645 1001 684 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 1110 375 q 929 560 1110 509 q 887 573 901 568 q 858 593 873 578 q 836 629 842 607 q 834 635 836 630 q 832 644 832 640 q 831 650 831 649 q 850 696 831 678 q 897 715 869 715 q 952 703 939 715 l 951 703 q 981 663 966 691 l 1053 718 q 1015 768 1023 760 q 963 798 990 791 q 897 806 936 806 q 787 761 835 806 q 739 655 739 717 q 740 637 739 649 q 790 529 753 563 q 905 472 828 494 q 943 460 928 466 q 978 443 959 454 q 1008 417 997 432 q 1018 381 1018 401 l 1018 377 q 987 305 1019 332 q 909 277 955 277 q 780 389 834 277 q 740 483 762 426 q 703 581 718 541 q 661 666 687 620 q 603 740 634 712 q 523 787 573 768 q 409 806 474 806 q 260 763 331 806 q 149 648 190 719 q 110 499 108 577 l 110 498 q 149 344 113 415 q 253 230 185 274 q 405 186 320 186 q 621 271 549 186 q 645 311 636 292 l 598 395 q 522 305 566 333 q 408 277 477 277 q 260 345 319 277 q 202 503 202 412 q 265 649 202 584 q 409 715 329 715 q 541 673 496 715 q 622 539 586 632 q 641 486 628 523 q 663 427 655 450 q 688 369 672 405 q 718 312 704 334 q 753 264 732 290 q 796 222 774 237 q 847 196 818 207 q 909 186 877 186 q 1051 240 992 186 q 1110 375 1110 294 m 1190 868 l 1190 124 q 1125 -34 1190 32 q 967 -99 1059 -99 l 223 -99 q 65 -34 131 -99 q 0 124 0 32 l 0 868 q 65 1026 0 960 q 223 1091 131 1091 l 967 1091 q 1125 1026 1059 1091 q 1190 868 1190 960 z "},"":{"ha":1587,"x_min":0,"x_max":1587,"o":"m 861 342 q 877 379 861 342 q 893 496 893 415 q 861 650 893 577 q 777 777 830 723 q 650 861 723 830 q 496 893 577 893 q 342 861 415 893 q 215 777 269 830 q 131 650 162 723 q 99 496 99 577 q 131 342 99 415 q 215 215 162 269 q 342 131 269 162 q 496 99 415 99 q 650 131 577 99 q 777 215 723 162 q 861 342 830 269 m 1457 342 q 1472 379 1457 342 q 1488 496 1488 415 q 1457 650 1488 577 q 1372 777 1425 723 q 1245 861 1318 830 q 1091 893 1172 893 l 792 893 q 938 719 884 823 q 992 496 992 615 q 938 273 992 377 q 792 99 884 169 l 1091 99 q 1245 131 1172 99 q 1372 215 1318 162 q 1457 342 1425 269 m 1548 689 q 1568 643 1548 689 q 1587 496 1587 597 q 1548 303 1587 395 q 1442 145 1508 212 q 1284 40 1376 79 q 1091 0 1192 0 l 496 0 q 303 40 395 0 q 145 145 212 79 q 40 303 79 212 q 0 496 0 395 q 40 689 0 597 q 145 847 79 780 q 303 953 212 913 q 496 992 395 992 l 1091 992 q 1284 953 1192 992 q 1442 847 1376 913 q 1548 689 1508 780 z "},"":{"ha":1587,"x_min":0,"x_max":1587,"o":"m 40 303 q 20 349 40 303 q 0 496 0 395 q 40 689 0 597 q 145 847 79 780 q 303 953 212 913 q 496 992 395 992 l 1091 992 q 1284 953 1192 992 q 1442 847 1376 913 q 1548 689 1508 780 q 1587 496 1587 597 q 1548 303 1587 395 q 1442 145 1508 212 q 1284 40 1376 79 q 1091 0 1192 0 l 496 0 q 303 40 395 0 q 145 145 212 79 q 40 303 79 212 m 937 131 q 974 115 937 131 q 1091 99 1011 99 q 1245 131 1172 99 q 1372 215 1318 162 q 1457 342 1425 269 q 1488 496 1488 415 q 1457 650 1488 577 q 1372 777 1425 723 q 1245 861 1318 830 q 1091 893 1172 893 q 937 861 1011 893 q 811 777 864 830 q 726 650 757 723 q 694 496 694 577 q 726 342 694 415 q 811 215 757 269 q 937 131 864 162 z "},"":{"ha":1786,"x_min":0,"x_max":1786,"o":"m 591 298 l 347 298 q 303 325 316 298 q 308 377 289 352 l 453 571 q 347 595 403 595 q 172 522 245 595 q 99 347 99 450 q 172 172 99 245 q 347 99 245 99 q 505 155 436 99 q 591 298 573 212 m 446 397 l 591 397 q 532 512 577 463 l 446 397 m 818 397 l 1042 694 l 670 694 l 593 592 q 691 397 674 512 l 818 397 m 1614 172 q 1650 208 1614 172 q 1687 347 1687 245 q 1614 522 1687 450 q 1438 595 1541 595 q 1345 577 1392 595 l 1480 375 q 1487 337 1491 357 q 1466 306 1483 317 q 1438 298 1455 298 q 1397 320 1411 298 l 1263 522 q 1190 347 1190 448 q 1263 172 1190 245 q 1438 99 1336 99 q 1614 172 1541 99 m 1684 593 q 1735 542 1684 593 q 1786 347 1786 491 q 1684 102 1786 204 q 1438 0 1582 0 q 1193 102 1295 0 q 1091 347 1091 204 q 1122 489 1091 422 q 1207 605 1152 556 l 1156 681 l 883 318 q 843 298 869 298 l 691 298 q 575 85 673 171 q 347 0 477 0 q 102 102 204 0 q 0 347 0 204 q 102 593 0 491 q 347 694 204 694 q 514 652 436 694 l 620 794 l 446 794 q 412 808 426 794 q 397 843 397 823 q 412 878 397 863 q 446 893 426 893 l 744 893 l 744 794 l 1081 794 l 1015 893 l 843 893 q 808 908 823 893 q 794 942 794 922 q 808 977 794 963 q 843 992 823 992 l 1042 992 q 1083 970 1067 992 l 1290 660 q 1438 694 1360 694 q 1684 593 1582 694 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 269 178 q 283 192 269 178 q 298 248 298 207 q 269 318 298 289 q 198 347 239 347 q 128 318 157 347 q 99 248 99 289 q 128 178 99 207 q 198 149 157 149 q 269 178 239 149 m 1062 178 q 1077 192 1062 178 q 1091 248 1091 207 q 1062 318 1091 289 q 992 347 1033 347 q 922 318 951 347 q 893 248 893 289 q 922 178 893 207 q 992 149 951 149 q 1062 178 1033 149 m 1056 555 l 1000 853 q 982 882 996 870 q 951 893 969 893 l 239 893 q 208 882 222 893 q 191 853 195 870 l 135 555 q 146 514 131 532 q 184 496 160 496 l 1007 496 q 1045 514 1030 496 q 1056 555 1059 532 m 870 1003 q 875 1008 870 1003 q 880 1029 880 1014 q 870 1056 880 1045 q 843 1066 859 1066 l 347 1066 q 321 1056 332 1066 q 310 1029 310 1045 q 321 1003 310 1014 q 347 992 332 992 l 843 992 q 870 1003 859 992 m 1190 467 l 1190 0 l 1091 0 l 1091 -99 q 1062 -169 1091 -140 q 992 -198 1033 -198 q 922 -169 951 -198 q 893 -99 893 -140 l 893 0 l 298 0 l 298 -99 q 269 -169 298 -140 q 198 -198 239 -198 q 128 -169 157 -198 q 99 -99 99 -140 l 99 0 l 0 0 l 0 467 q 19 640 0 554 l 99 992 q 175 1098 106 1053 q 353 1167 243 1144 q 595 1190 463 1190 q 837 1167 728 1190 q 1016 1098 947 1144 q 1091 992 1084 1053 l 1173 640 q 1190 467 1190 561 z "},"":{"ha":1587,"x_min":0,"x_max":1587,"o":"m 1115 593 q 1124 583 1115 593 q 1134 546 1134 573 q 1115 499 1134 519 q 1067 479 1095 479 l 523 479 q 476 499 495 479 q 457 546 457 519 q 476 593 457 573 q 523 612 495 612 l 1067 612 q 1115 593 1095 612 m 1300 546 q 1282 677 1300 612 l 521 677 q 474 697 493 677 q 454 743 454 716 q 474 791 454 771 q 521 810 493 810 l 1225 810 q 1042 986 1156 921 q 794 1051 929 1051 q 541 983 657 1051 q 356 799 424 915 q 288 546 288 683 q 306 414 288 479 l 1067 414 q 1115 395 1095 414 q 1134 348 1134 375 q 1115 301 1134 320 q 1067 281 1095 281 l 363 281 q 546 105 432 171 q 794 40 660 40 q 991 80 897 40 q 1152 188 1084 120 q 1259 349 1219 256 q 1300 546 1300 443 m 1587 743 q 1568 697 1587 716 q 1521 677 1549 677 l 1419 677 q 1432 546 1432 612 q 1382 298 1432 416 q 1246 94 1331 180 q 1042 -42 1160 9 q 794 -93 924 -93 q 447 10 604 -93 q 213 281 290 113 l 67 281 q 19 301 39 281 q 0 348 0 320 q 19 395 0 375 q 67 414 39 414 l 169 414 q 156 546 156 480 q 207 793 156 675 q 343 997 257 911 q 546 1134 428 1083 q 794 1184 664 1184 q 1141 1081 984 1184 q 1375 810 1298 978 l 1521 810 q 1568 791 1549 810 q 1587 743 1587 771 z "},"":{"ha":992,"x_min":9,"x_max":984,"o":"m 739 898 l 650 643 l 741 627 q 869 1028 869 977 q 839 1072 869 1072 q 739 898 795 1072 m 507 365 q 532 297 530 303 q 587 349 561 329 q 562 353 578 350 q 532 358 546 356 q 507 365 519 361 m 281 1059 q 404 656 281 984 q 442 663 417 663 q 500 660 453 663 l 406 932 q 311 1102 348 1102 q 288 1089 296 1102 q 281 1059 281 1075 m 219 471 q 259 379 219 443 q 350 260 299 315 q 428 206 401 206 q 448 216 439 206 q 457 237 457 226 q 432 316 457 256 q 407 372 422 341 q 370 441 392 403 q 322 504 348 479 q 274 529 297 529 q 239 508 259 529 q 219 471 219 487 m 97 212 q 116 131 97 180 q 258 -45 162 19 q 477 -109 355 -109 q 773 23 653 -109 q 891 354 891 154 q 890 406 891 388 q 881 454 889 425 q 857 498 873 484 q 693 556 814 536 q 484 577 573 577 q 446 568 455 577 q 436 541 436 564 q 453 494 436 515 q 496 463 470 474 q 556 445 522 453 q 624 436 590 438 q 690 433 658 435 q 744 433 722 432 q 762 433 756 433 q 793 419 780 433 q 808 376 805 404 q 733 334 786 354 q 661 298 686 317 q 577 210 612 263 q 543 104 543 157 q 557 35 543 80 q 571 -33 571 -9 l 569 -42 q 566 -53 566 -51 q 453 115 460 -45 q 421 113 446 113 q 422 97 422 108 q 391 28 422 56 q 318 -1 360 -1 q 189 60 254 -1 q 123 183 123 120 q 149 235 123 209 q 195 176 189 185 q 298 95 255 95 q 319 102 308 95 q 330 118 330 109 q 262 230 330 144 q 172 316 195 316 q 118 282 139 316 q 97 212 97 247 m 9 205 q 41 331 9 283 q 147 399 74 379 q 126 480 126 457 q 173 575 126 528 q 267 622 220 622 q 322 611 290 622 q 195 1050 195 969 q 227 1151 195 1112 q 319 1190 259 1190 q 571 740 421 1190 q 577 722 576 727 q 600 784 582 735 q 634 876 618 833 q 675 975 649 918 q 725 1070 701 1031 q 780 1137 749 1109 q 839 1165 811 1165 q 926 1127 894 1165 q 958 1032 958 1089 q 835 606 958 949 q 913 570 882 594 q 958 510 943 546 q 978 438 973 474 q 984 352 984 401 q 947 135 984 236 q 845 -40 911 34 q 681 -156 779 -113 q 466 -198 584 -198 q 293 -166 380 -198 q 93 -17 177 -122 q 9 205 9 87 z "},"":{"ha":1587,"x_min":0,"x_max":1587,"o":"m 608 409 l 769 409 q 693 217 758 287 q 526 146 627 146 q 329 236 401 146 q 257 481 257 326 q 329 723 257 632 q 510 814 401 814 q 690 746 625 814 q 765 555 755 679 l 608 555 q 580 632 604 605 q 517 659 556 659 q 448 612 473 659 q 424 474 424 565 q 428 409 424 437 q 442 355 432 381 q 473 315 452 329 q 524 301 494 301 q 608 409 598 301 m 1160 409 l 1320 409 q 1244 217 1309 287 q 1078 146 1179 146 q 881 236 953 146 q 809 481 809 326 q 881 723 809 632 q 1062 814 953 814 q 1242 746 1177 814 q 1317 555 1307 679 l 1159 555 q 1132 632 1156 605 q 1069 659 1108 659 q 1000 612 1025 659 q 976 474 976 565 q 980 409 976 437 q 994 355 984 381 q 1024 315 1004 329 q 1075 301 1045 301 q 1134 331 1113 301 q 1160 409 1156 360 m 1438 501 q 1426 739 1438 662 q 1380 864 1414 817 q 1369 875 1375 870 q 1352 887 1363 880 q 1340 895 1342 894 q 800 944 1273 944 q 250 895 315 944 q 236 886 246 892 q 220 875 226 880 q 208 864 213 870 q 162 741 174 818 q 150 501 150 663 q 162 263 150 340 q 208 139 174 186 q 220 127 213 133 q 236 116 227 122 q 250 107 245 111 q 435 69 284 81 q 800 57 587 57 q 1340 107 1273 57 q 1353 115 1344 110 q 1369 126 1363 121 q 1380 139 1376 132 q 1427 262 1415 185 q 1438 501 1438 339 m 1587 1091 l 1587 -99 l 0 -99 l 0 1091 l 1587 1091 z "},"":{"ha":1190,"x_min":0,"x_max":1066,"o":"m 769 707 l 769 322 q 762 305 769 312 q 744 298 755 298 l 620 298 q 602 305 609 298 q 595 322 595 312 l 595 707 q 533 856 595 794 q 384 918 471 918 l 174 918 l 174 25 q 167 7 174 14 q 149 0 160 0 l 25 0 q 7 7 14 0 q 0 25 0 14 l 0 1066 q 7 1084 0 1077 q 25 1091 14 1091 l 384 1091 q 577 1040 489 1091 q 717 900 666 988 q 769 707 769 811 m 1066 1066 l 1066 384 q 1015 191 1066 280 q 875 52 963 103 q 682 0 787 0 l 322 0 q 305 7 312 0 q 298 25 298 14 l 298 769 q 305 787 298 780 q 322 794 312 794 l 446 794 q 464 787 457 794 q 471 769 471 780 l 471 174 l 682 174 q 831 236 769 174 q 893 384 893 298 l 893 1066 q 900 1084 893 1077 q 918 1091 907 1091 l 1042 1091 q 1059 1084 1053 1091 q 1066 1066 1066 1077 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 1016 538 l 1016 450 q 1006 420 1016 431 q 977 409 995 409 l 820 409 q 791 420 801 409 q 780 450 780 431 l 780 538 q 791 567 780 556 q 820 578 801 578 l 977 578 q 1006 567 995 578 q 1016 538 1016 556 m 636 360 l 636 553 q 611 620 636 594 q 545 645 586 645 l 442 645 q 367 605 389 645 q 293 645 346 645 l 192 645 q 126 620 151 645 q 101 553 101 594 l 101 360 q 117 343 101 343 l 160 343 q 177 360 177 343 l 177 538 q 187 567 177 556 q 217 578 198 578 l 290 578 q 319 567 308 578 q 330 538 330 556 l 330 360 q 346 343 330 343 l 388 343 q 405 360 405 343 l 405 538 q 416 567 405 556 q 446 578 427 578 l 521 578 q 550 567 539 578 q 560 538 560 556 l 560 360 q 577 343 560 343 l 620 343 q 636 360 636 343 m 1093 434 l 1093 553 q 1067 620 1093 594 q 1001 645 1042 645 l 796 645 q 729 620 755 645 q 704 553 704 594 l 704 236 q 721 219 704 219 l 763 219 q 780 236 780 219 l 780 375 q 853 343 804 343 l 1001 343 q 1067 368 1042 343 q 1093 434 1093 393 m 1190 911 l 1190 81 q 1138 -47 1190 6 q 1011 -99 1085 -99 l 180 -99 q 53 -47 105 -99 q 0 81 0 6 l 0 911 q 53 1039 0 986 q 180 1091 105 1091 l 1011 1091 q 1138 1039 1085 1091 q 1190 911 1190 986 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 709 349 l 481 349 l 595 776 l 709 349 m 776 99 l 1017 99 l 766 893 l 425 893 l 174 99 l 415 99 l 711 343 l 776 99 m 1190 868 l 1190 124 q 1125 -33 1190 33 q 967 -99 1059 -99 l 223 -99 q 66 -33 132 -99 q 0 124 0 33 l 0 868 q 66 1025 0 960 q 223 1091 132 1091 l 967 1091 q 1125 1025 1059 1091 q 1190 868 1190 960 z "},"":{"ha":1587,"x_min":0,"x_max":1587,"o":"m 1587 497 q 1577 469 1587 481 q 1552 453 1567 457 l 1393 177 q 1395 164 1395 171 q 1385 136 1395 148 q 1360 121 1376 124 l 1211 -140 q 1213 -153 1213 -146 q 1200 -184 1213 -171 q 1169 -197 1187 -197 q 1137 -183 1149 -197 l 827 -183 q 794 -198 814 -198 q 760 -183 773 -198 l 451 -183 q 418 -198 438 -198 q 387 -186 400 -198 q 374 -154 374 -173 q 377 -139 374 -148 l 227 121 q 202 136 212 124 q 192 164 192 148 q 195 177 192 171 l 35 453 q 10 469 19 457 q 0 497 0 481 q 10 525 0 513 q 36 540 21 537 l 191 807 q 190 809 191 808 q 190 811 190 811 q 216 851 190 839 l 378 1132 q 375 1146 375 1140 q 388 1178 375 1165 q 419 1190 401 1190 q 453 1174 439 1190 l 760 1174 q 794 1190 773 1190 q 827 1174 815 1190 l 1135 1174 q 1170 1190 1149 1190 q 1201 1178 1187 1190 q 1214 1146 1214 1165 q 1211 1132 1214 1142 l 1371 855 q 1401 841 1389 854 q 1414 811 1414 829 q 1408 791 1414 801 l 1553 539 q 1578 524 1568 536 q 1587 497 1587 512 m 824 -122 l 1125 -122 l 860 152 l 749 152 l 484 -122 l 763 -122 q 794 -110 777 -110 q 824 -122 810 -110 m 87 507 q 88 497 88 504 q 86 485 88 489 l 247 206 l 259 202 l 405 356 l 405 625 l 260 775 q 237 767 250 769 l 87 507 m 764 1115 l 463 1115 l 611 960 l 1040 1115 l 823 1115 q 794 1102 811 1102 q 764 1115 777 1102 m 1309 175 q 1313 184 1310 180 l 1263 236 l 1250 175 l 1309 175 m 1227 175 l 1244 257 l 1049 463 l 819 225 l 868 175 l 1227 175 m 1159 -110 l 1171 -88 l 1221 152 l 891 152 l 1149 -114 q 1159 -110 1155 -111 m 448 -122 l 452 -122 l 717 152 l 428 152 l 428 -108 l 431 -112 q 448 -122 442 -116 m 428 175 l 739 175 l 789 226 l 550 475 l 428 346 l 428 175 m 278 175 l 405 175 l 405 322 l 274 184 q 278 175 277 178 m 277 815 q 278 813 277 814 q 278 811 278 812 q 272 789 278 799 l 405 652 l 405 860 l 277 815 m 428 869 l 428 628 l 546 506 l 777 749 l 604 932 l 428 869 m 431 1104 l 428 1098 l 428 894 l 587 951 l 439 1107 q 431 1104 434 1105 m 1121 1115 l 1109 1115 l 628 941 l 793 767 l 1121 1115 m 793 733 l 563 489 l 804 242 l 1033 480 l 793 733 m 533 491 l 428 601 l 428 381 l 533 491 m 805 209 l 772 175 l 838 175 l 805 209 m 1065 479 l 1249 284 l 1352 768 l 1349 772 l 1349 773 l 1065 479 m 1332 789 q 1325 811 1325 799 l 1325 813 l 1158 1104 q 1148 1108 1154 1105 l 809 749 l 1049 496 l 1332 789 m 405 885 l 405 1058 l 278 839 l 405 885 m 405 152 l 278 152 l 405 -67 l 405 152 m 1246 152 l 1208 -24 l 1309 152 l 1246 152 m 1340 206 l 1500 486 q 1499 497 1499 494 q 1501 509 1499 498 l 1369 739 l 1269 264 l 1328 201 q 1340 206 1332 203 z "},"":{"ha":1190,"x_min":0,"x_max":1091,"o":"m 0 663 q 71 839 0 765 q 243 913 142 913 l 818 913 l 1091 1190 l 1091 51 q 1020 -125 1091 -51 q 848 -198 949 -198 l 243 -198 q 71 -125 142 -198 q 0 51 0 -51 l 0 663 m 955 79 l 818 219 l 818 548 q 794 609 818 584 q 733 635 769 635 l 358 635 q 298 609 322 635 q 273 548 273 584 l 273 167 q 298 105 273 131 q 358 79 323 79 l 955 79 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 724 1074 q 293 793 478 980 q 16 359 108 606 q 0 495 0 428 q 79 793 0 656 q 295 1010 159 930 q 593 1089 432 1089 q 724 1074 656 1089 m 932 982 q 1059 862 1004 932 q 537 551 758 774 q 229 27 315 329 q 109 153 157 83 q 415 673 196 452 q 932 982 635 894 m 364 -52 q 658 430 453 224 q 1139 728 863 636 q 1180 577 1170 656 q 780 309 954 484 q 515 -92 607 135 q 364 -52 435 -81 m 1190 -97 q 906 -8 1041 -58 q 681 -91 801 -73 q 894 196 766 68 q 1180 410 1022 325 q 1101 190 1163 292 q 1190 -97 1152 54 z "},"":{"ha":1587,"x_min":0,"x_max":1587,"o":"m 1467 887 l 1587 -99 q 1388 -55 1486 -99 q 1084 16 1233 16 q 794 -99 908 16 q 504 16 679 16 q 199 -55 354 16 q 4 -99 100 -99 l 0 -99 l 120 887 q 494 985 294 985 q 794 903 674 985 q 1094 985 913 985 q 1467 887 1294 985 m 1084 122 q 1263 100 1184 122 q 1465 27 1343 78 l 1369 818 q 1084 879 1236 879 q 794 770 910 879 q 504 879 677 879 q 219 818 351 879 l 122 27 q 251 78 204 60 q 366 108 298 95 q 504 122 434 122 q 794 38 660 122 q 1084 122 927 122 m 1115 148 l 1072 851 q 794 731 908 848 q 504 851 676 851 q 243 800 367 851 l 155 71 q 332 129 251 110 q 504 149 413 149 q 794 70 666 149 q 1084 149 927 153 l 1115 148 z "},"":{"ha":1587,"x_min":0,"x_max":1587,"o":"m 1163 128 l 1163 696 q 1151 724 1163 712 q 1124 736 1139 736 l 1052 736 q 1025 724 1036 736 q 1013 696 1013 712 l 1013 128 q 1025 101 1013 112 q 1052 89 1036 89 l 1124 89 q 1151 101 1139 89 q 1163 128 1163 112 m 942 128 l 942 539 q 931 567 942 555 q 904 578 919 578 l 825 578 q 798 567 810 578 q 787 539 787 555 l 787 128 q 798 101 787 112 q 825 89 810 89 l 904 89 q 931 101 919 89 q 942 128 942 112 m 716 128 l 716 460 q 705 488 716 476 q 677 499 693 499 l 599 499 q 572 488 584 499 q 560 460 560 476 l 560 128 q 572 101 560 112 q 599 89 584 89 l 677 89 q 705 101 693 89 q 716 128 716 112 m 490 128 l 490 408 q 478 436 490 424 q 451 447 467 447 l 373 447 q 346 436 357 447 q 334 408 334 424 l 334 128 q 346 101 334 112 q 373 89 357 89 l 451 89 q 478 101 467 89 q 490 128 490 112 m 1587 241 q 1496 21 1587 112 q 1276 -71 1404 -71 l 312 -71 q 91 21 183 -71 q 0 241 0 112 q 49 407 0 331 q 179 522 98 484 q 171 579 171 549 q 234 729 171 667 q 384 791 296 791 q 523 739 463 791 q 674 972 558 881 q 935 1063 789 1063 q 1149 1006 1051 1063 q 1303 851 1246 949 q 1360 638 1360 753 q 1349 543 1360 587 q 1521 433 1454 518 q 1587 241 1587 348 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 0 1190 l 1190 1190 l 1190 112 l 589 -150 l 0 112 l 0 1190 m 1113 162 l 1113 880 l 78 880 l 78 162 l 590 -66 l 1113 162 m 1113 957 l 1113 1113 l 78 1113 l 78 957 l 1113 957 m 140 726 l 140 637 l 112 637 l 112 726 l 140 726 m 140 612 l 140 522 l 112 522 l 112 612 l 140 612 m 140 497 l 140 408 l 112 408 l 112 497 l 140 497 m 140 382 l 140 293 l 112 293 l 112 382 l 140 382 m 140 267 l 140 178 l 112 178 l 112 267 l 140 267 m 160 157 l 172 183 l 253 146 l 242 121 l 160 157 m 266 110 l 277 136 l 359 101 l 347 74 l 266 110 m 370 64 l 382 90 l 463 54 l 452 28 l 370 64 m 476 18 l 488 43 l 568 8 l 556 -19 l 476 18 m 618 8 l 699 43 l 711 18 l 629 -19 l 618 8 m 722 54 l 804 90 l 815 64 l 734 28 l 722 54 m 828 101 l 909 136 l 921 110 l 839 74 l 828 101 m 932 146 l 1014 183 l 1025 157 l 944 121 l 932 146 m 201 1077 l 201 1049 l 112 1049 l 112 1077 l 201 1077 m 326 1077 l 326 1049 l 237 1049 l 237 1077 l 326 1077 m 452 1077 l 452 1049 l 363 1049 l 363 1077 l 452 1077 m 577 1077 l 577 1049 l 488 1049 l 488 1077 l 577 1077 m 702 1077 l 702 1049 l 614 1049 l 614 1077 l 702 1077 m 828 1077 l 828 1049 l 739 1049 l 739 1077 l 828 1077 m 953 1077 l 953 1049 l 864 1049 l 864 1077 l 953 1077 m 1078 1077 l 1078 1049 l 990 1049 l 990 1077 l 1078 1077 m 140 813 l 140 752 l 112 752 l 112 841 l 201 841 l 201 813 l 140 813 m 326 841 l 326 813 l 237 813 l 237 841 l 326 841 m 452 841 l 452 813 l 363 813 l 363 841 l 452 841 m 577 841 l 577 813 l 488 813 l 488 841 l 577 841 m 702 841 l 702 813 l 614 813 l 614 841 l 702 841 m 828 841 l 828 813 l 739 813 l 739 841 l 828 841 m 953 841 l 953 813 l 864 813 l 864 841 l 953 841 m 1050 752 l 1050 813 l 990 813 l 990 841 l 1079 841 l 1079 752 l 1050 752 m 1050 637 l 1050 726 l 1079 726 l 1079 637 l 1050 637 m 1050 522 l 1050 612 l 1079 612 l 1079 522 l 1050 522 m 1050 408 l 1050 497 l 1079 497 l 1079 408 l 1050 408 m 1050 293 l 1050 382 l 1079 382 l 1079 293 l 1050 293 m 1050 178 l 1050 267 l 1079 267 l 1079 178 l 1050 178 m 589 205 q 418 276 489 205 q 346 448 346 347 q 418 619 346 548 q 589 691 489 691 q 761 619 690 691 q 832 448 832 548 q 761 276 832 347 q 589 205 690 205 m 461 501 q 476 457 461 473 q 515 438 491 441 q 564 432 538 434 q 614 431 591 430 q 652 424 637 431 q 667 400 667 416 q 581 362 667 362 q 485 401 505 362 l 483 401 l 459 353 q 584 320 511 320 q 628 324 607 320 q 671 336 649 328 q 706 362 693 345 q 720 403 720 379 q 699 457 720 439 q 646 478 677 475 q 585 480 615 481 q 533 484 554 480 q 512 504 512 488 q 527 529 512 520 q 559 541 543 539 q 591 543 574 543 q 645 535 617 543 q 685 508 674 526 l 687 508 l 711 553 q 694 560 708 554 q 677 567 680 566 q 662 572 674 568 q 645 578 650 577 q 629 581 639 579 q 611 584 619 584 q 593 585 602 585 q 549 581 570 585 q 507 568 528 577 q 474 542 487 560 q 461 501 461 525 z "},"":{"ha":1587,"x_min":0,"x_max":1587,"o":"m 607 243 q 638 273 607 243 q 669 391 669 304 q 607 539 669 477 q 459 601 546 601 q 311 539 372 601 q 250 391 250 477 q 311 243 250 304 q 459 181 372 181 q 607 243 546 181 m 1277 243 q 1307 274 1277 243 q 1338 391 1338 305 q 1277 539 1338 478 q 1128 601 1215 601 q 980 539 1042 601 q 918 391 918 478 q 980 243 918 304 q 1128 181 1042 181 q 1277 243 1215 181 m 1587 1018 l 1587 -26 q 1563 -85 1587 -60 q 1504 -109 1538 -109 l 84 -109 q 24 -85 49 -109 q 0 -26 0 -60 l 0 1018 q 24 1077 0 1053 q 84 1101 49 1101 l 418 1101 q 477 1077 452 1101 q 501 1018 501 1053 l 501 894 l 1086 894 l 1086 1018 q 1111 1077 1086 1053 q 1170 1101 1135 1101 l 1504 1101 q 1563 1077 1538 1101 q 1587 1018 1587 1053 z "},"":{"ha":1587,"x_min":0,"x_max":1587,"o":"m 1108 739 m 1310 581 q 1506 504 1425 581 q 1587 315 1587 428 q 1503 112 1587 193 q 1296 31 1418 31 q 1170 52 1230 31 q 1063 109 1111 74 q 972 191 1016 145 q 887 289 928 238 q 807 392 847 340 q 723 490 767 443 q 632 572 679 536 q 527 629 586 608 q 404 650 468 650 q 209 579 284 650 q 133 390 133 508 q 214 196 133 268 q 418 124 295 124 q 579 153 495 124 q 729 229 663 182 q 745 244 732 233 q 768 262 757 255 q 785 270 779 270 q 804 262 796 270 q 812 243 812 253 q 766 183 812 224 q 584 73 687 115 q 382 31 481 31 q 192 76 279 31 q 52 204 105 121 q 0 391 0 287 q 110 655 0 550 q 379 760 219 760 q 555 727 472 760 q 698 639 637 693 q 816 520 760 585 q 923 391 872 456 q 1027 272 975 326 q 1143 184 1079 218 q 1277 150 1207 150 q 1407 198 1356 150 q 1459 324 1459 246 q 1409 447 1459 398 q 1285 497 1359 497 q 1222 482 1262 497 q 1169 468 1182 468 q 1141 480 1153 468 q 1129 507 1129 491 q 1136 551 1129 521 q 1142 597 1142 581 q 1059 801 1142 720 q 853 881 976 881 q 766 867 808 881 q 701 836 725 853 q 658 804 677 818 q 632 790 639 790 q 613 798 621 790 q 605 818 605 806 q 624 853 605 832 q 738 934 670 905 q 879 962 806 962 q 1125 865 1027 962 q 1224 620 1224 767 q 1221 569 1224 591 q 1310 581 1265 581 z "},"":{"ha":1290,"x_min":0,"x_max":1290,"o":"m 928 610 q 935 617 928 610 q 942 645 942 625 q 928 680 942 665 q 893 694 913 694 l 794 694 l 794 794 q 779 829 794 814 q 744 843 764 843 q 709 829 724 843 q 694 794 694 814 l 694 694 l 595 694 q 560 680 575 694 q 546 645 546 665 q 560 610 546 625 q 595 595 575 595 l 694 595 l 694 496 q 709 461 694 476 q 744 446 724 446 q 779 461 764 446 q 794 496 794 476 l 794 595 l 893 595 q 928 610 913 595 m 467 70 q 481 56 467 70 q 496 0 496 41 q 467 -70 496 -41 q 397 -99 438 -99 q 327 -70 356 -99 q 298 0 298 -41 q 327 70 298 41 q 397 99 356 99 q 467 70 438 99 m 1161 70 q 1176 56 1161 70 q 1190 0 1190 41 q 1161 -70 1190 -41 q 1091 -99 1132 -99 q 1021 -70 1050 -99 q 992 0 992 -41 q 1021 70 992 41 q 1091 99 1050 99 q 1161 70 1132 99 m 1290 843 l 1290 446 q 1277 413 1290 428 q 1246 397 1265 399 l 436 302 q 440 286 437 297 q 444 265 443 274 q 446 248 446 256 q 428 198 446 236 l 1141 198 q 1176 184 1161 198 q 1190 149 1190 169 q 1176 114 1190 129 q 1141 99 1161 99 l 347 99 q 312 114 327 99 q 298 149 298 129 q 306 179 298 160 q 329 226 315 199 q 345 255 343 252 l 208 893 l 50 893 q 15 908 29 893 q 0 942 0 922 q 15 977 0 963 q 50 992 29 992 l 248 992 q 270 987 260 992 q 286 975 280 982 q 296 956 291 968 q 301 935 300 944 q 306 913 303 927 q 309 893 308 898 l 1240 893 q 1275 878 1260 893 q 1290 843 1290 863 z "},"":{"ha":1290,"x_min":0,"x_max":1290,"o":"m 977 610 q 992 645 992 625 q 977 680 992 665 q 942 694 963 694 q 908 680 922 694 l 794 567 l 794 794 q 779 829 794 814 q 744 843 764 843 q 709 829 724 843 q 694 794 694 814 l 694 567 l 581 680 q 546 694 566 694 q 511 680 525 694 q 496 645 496 665 q 511 610 496 625 l 709 412 q 744 397 724 397 q 779 412 764 397 l 977 610 m 467 70 q 481 56 467 70 q 496 0 496 41 q 467 -70 496 -41 q 397 -99 438 -99 q 327 -70 356 -99 q 298 0 298 -41 q 327 70 298 41 q 397 99 356 99 q 467 70 438 99 m 1161 70 q 1176 56 1161 70 q 1190 0 1190 41 q 1161 -70 1190 -41 q 1091 -99 1132 -99 q 1021 -70 1050 -99 q 992 0 992 -41 q 1021 70 992 41 q 1091 99 1050 99 q 1161 70 1132 99 m 1290 843 l 1290 446 q 1277 413 1290 428 q 1246 397 1265 399 l 436 302 q 440 286 437 297 q 444 265 443 274 q 446 248 446 256 q 428 198 446 236 l 1141 198 q 1176 184 1161 198 q 1190 149 1190 169 q 1176 114 1190 129 q 1141 99 1161 99 l 347 99 q 312 114 327 99 q 298 149 298 129 q 306 179 298 160 q 329 226 315 199 q 345 255 343 252 l 208 893 l 50 893 q 15 908 29 893 q 0 942 0 922 q 15 977 0 963 q 50 992 29 992 l 248 992 q 270 987 260 992 q 286 975 280 982 q 296 956 291 968 q 301 935 300 944 q 306 913 303 927 q 309 893 308 898 l 1240 893 q 1275 878 1260 893 q 1290 843 1290 863 z "},"":{"ha":1587,"x_min":0,"x_max":1587,"o":"m 164 595 l 647 80 l 415 595 l 164 595 m 794 -3 l 1064 595 l 523 595 l 794 -3 m 417 694 l 575 992 l 372 992 l 149 694 l 417 694 m 940 80 l 1423 595 l 1173 595 l 940 80 m 529 694 l 1058 694 l 900 992 l 687 992 l 529 694 m 1170 694 l 1438 694 l 1215 992 l 1012 992 l 1170 694 m 1280 1071 l 1577 674 q 1587 642 1588 660 q 1574 611 1587 624 l 830 -183 q 794 -198 816 -198 q 757 -183 771 -198 l 13 611 q 0 642 1 624 q 10 674 -1 660 l 308 1071 q 347 1091 322 1091 l 1240 1091 q 1280 1071 1266 1091 z "},"":{"ha":1587,"x_min":15,"x_max":1573,"o":"m 1404 -15 q 1438 0 1418 0 q 1473 -15 1459 0 l 1573 -114 l 1503 -184 l 1438 -119 l 1374 -184 q 1339 -198 1360 -198 q 1304 -184 1318 -198 l 1240 -119 l 1176 -184 q 1141 -198 1161 -198 q 1106 -184 1121 -198 l 1042 -119 l 977 -184 q 942 -198 963 -198 q 908 -184 922 -198 l 843 -119 l 779 -184 q 744 -198 764 -198 q 709 -184 724 -198 l 645 -119 l 581 -184 q 546 -198 566 -198 q 511 -184 525 -198 l 446 -119 l 382 -184 q 347 -198 367 -198 q 312 -184 327 -198 l 248 -119 l 184 -184 q 149 -198 169 -198 q 114 -184 129 -198 l 15 -84 l 84 -15 l 149 -79 l 213 -15 q 248 0 228 0 q 283 -15 268 0 l 347 -79 l 412 -15 q 446 0 426 0 q 481 -15 467 0 l 546 -79 l 610 -15 q 645 0 625 0 q 680 -15 665 0 l 744 -79 l 808 -15 q 843 0 823 0 q 878 -15 863 0 l 942 -79 l 1007 -15 q 1042 0 1022 0 q 1077 -15 1062 0 l 1141 -79 l 1205 -15 q 1240 0 1220 0 q 1275 -15 1260 0 l 1339 -79 l 1404 -15 m 184 15 q 149 0 169 0 q 114 15 129 0 l 15 114 l 84 184 l 149 120 l 213 184 q 248 198 228 198 q 283 184 268 198 l 347 120 l 397 170 l 397 397 l 234 640 q 229 684 221 660 q 260 715 236 708 l 397 760 l 397 992 l 496 992 l 496 1091 l 694 1091 l 694 1190 l 893 1190 l 893 1091 l 1091 1091 l 1091 992 l 1190 992 l 1190 760 l 1328 715 q 1359 684 1351 708 q 1353 640 1366 660 l 1190 397 l 1190 170 l 1205 184 q 1240 198 1220 198 q 1275 184 1260 198 l 1339 120 l 1404 184 q 1438 198 1418 198 q 1473 184 1459 198 l 1573 84 l 1503 15 l 1438 79 l 1374 15 q 1339 0 1360 0 q 1304 15 1318 0 l 1240 79 l 1176 15 q 1141 0 1161 0 q 1106 15 1121 0 l 1042 79 l 977 15 q 942 0 963 0 q 908 15 922 0 l 843 79 l 779 15 q 744 0 764 0 q 709 15 724 0 l 645 79 l 581 15 q 546 0 566 0 q 511 15 525 0 l 446 79 l 382 15 q 347 0 367 0 q 312 15 327 0 l 248 79 l 184 15 m 496 893 l 496 794 l 794 893 l 1091 794 l 1091 893 l 992 893 l 992 992 l 595 992 l 595 893 l 496 893 z "},"":{"ha":1190,"x_min":0,"x_max":1091,"o":"m 446 0 l 521 347 l 446 446 l 347 496 l 446 0 m 645 0 l 744 496 l 645 446 l 570 347 l 645 0 m 769 783 q 766 787 767 786 q 691 794 758 794 q 562 779 637 794 q 546 777 556 777 q 529 779 535 777 q 400 794 454 794 q 326 787 333 794 q 322 783 324 786 q 326 762 324 769 q 331 757 327 760 q 337 749 336 754 q 343 733 339 746 q 348 717 347 720 q 354 704 350 714 q 361 691 359 694 q 368 680 363 687 q 377 669 373 672 q 388 662 381 667 q 401 656 395 657 q 417 653 408 654 q 436 651 426 651 q 482 661 464 651 q 507 684 500 670 q 519 711 515 698 q 527 734 522 724 q 541 743 532 743 l 550 743 q 564 734 559 743 q 573 711 569 724 q 584 684 577 698 q 609 661 591 670 q 655 651 627 651 q 674 653 665 651 q 690 656 683 654 q 703 662 697 657 q 714 669 710 667 q 724 680 718 672 q 730 691 729 687 q 737 704 732 694 q 743 717 742 714 q 748 733 744 720 q 754 749 753 746 q 760 757 756 754 q 766 762 764 760 q 769 783 767 769 m 1091 102 q 1035 -46 1091 8 q 884 -99 978 -99 l 207 -99 q 57 -46 113 -99 q 0 102 0 8 q 3 193 0 149 q 18 290 7 237 q 47 386 29 343 q 96 466 65 429 q 169 524 128 504 l 99 694 l 265 694 q 248 794 248 744 q 250 818 248 803 q 99 893 99 849 q 262 970 99 937 q 302 1073 275 1018 q 357 1162 329 1129 q 415 1190 381 1190 q 481 1166 439 1190 q 546 1142 522 1142 q 611 1166 569 1142 q 676 1190 653 1190 q 735 1162 710 1190 q 789 1073 763 1129 q 829 970 816 1018 q 992 893 992 937 q 842 818 992 849 q 826 694 847 756 l 992 694 l 929 520 q 1012 445 977 494 q 1063 334 1046 396 q 1085 217 1079 272 q 1091 102 1091 161 z "},"":{"ha":1786,"x_min":0,"x_max":1783,"o":"m 1783 388 q 1766 234 1793 308 q 1690 107 1740 160 q 1567 25 1639 54 q 1414 1 1494 -5 q 1198 98 1290 9 q 1094 310 1106 186 q 1115 473 1084 396 q 1207 605 1146 550 l 1152 688 q 1035 538 1077 626 q 992 349 992 450 q 978 313 992 328 q 942 298 963 298 l 744 298 l 691 298 q 575 85 673 171 q 347 0 477 0 q 102 102 204 0 q 0 347 0 204 q 102 593 0 491 q 347 694 204 694 q 465 674 406 694 l 484 708 q 248 794 388 794 l 198 794 q 164 808 178 794 q 149 843 149 823 q 164 878 149 863 q 198 893 178 893 l 298 893 q 410 882 358 893 q 500 853 462 872 q 556 822 539 833 q 595 794 573 811 l 992 794 l 1081 794 l 1015 893 l 843 893 q 805 910 820 893 q 794 951 791 928 q 812 980 798 969 q 846 992 827 992 l 1042 992 q 1083 970 1067 992 l 1137 889 l 1225 977 q 1261 992 1240 992 l 1339 992 q 1374 977 1359 992 q 1389 942 1389 963 l 1389 843 q 1374 808 1389 823 q 1339 794 1359 794 l 1201 794 l 1290 660 q 1503 688 1391 709 q 1692 584 1614 668 q 1783 388 1770 500 m 347 99 q 505 155 436 99 q 591 298 573 212 l 347 298 q 305 322 320 298 q 304 370 291 346 l 418 585 q 347 595 381 595 q 172 522 245 595 q 99 347 99 450 q 172 172 99 245 q 347 99 245 99 m 1263 172 q 1300 136 1263 172 q 1438 99 1336 99 q 1614 172 1541 99 q 1687 347 1687 245 q 1614 522 1687 450 q 1438 595 1541 595 q 1345 577 1392 595 l 1480 375 q 1487 337 1491 357 q 1466 306 1483 317 q 1438 298 1455 298 q 1397 320 1411 298 l 1263 522 q 1190 347 1190 448 q 1263 172 1190 245 z "},"":{"ha":1190,"x_min":0,"x_max":1091,"o":"m 1091 0 q 1044 -88 1091 -49 q 916 -151 996 -127 q 742 -186 837 -174 q 546 -198 647 -198 q 349 -186 444 -198 q 175 -151 254 -174 q 48 -88 95 -127 q 0 0 0 -49 q 26 69 0 38 q 96 120 51 99 q 188 155 141 141 q 289 177 234 168 q 326 169 309 181 q 346 137 343 157 q 338 100 350 117 q 306 80 326 83 q 224 62 261 72 q 165 42 187 51 q 127 24 143 33 q 106 9 112 15 q 99 -1 100 2 q 120 -21 102 -9 q 177 -47 139 -33 q 265 -72 215 -60 q 389 -91 315 -84 q 546 -99 463 -99 q 702 -91 628 -99 q 826 -72 776 -84 q 915 -47 877 -60 q 971 -21 953 -33 q 992 1 990 -9 q 985 9 991 4 q 964 24 980 15 q 927 42 949 33 q 867 62 904 51 q 785 80 830 72 q 753 100 765 83 q 745 137 741 117 q 765 169 748 157 q 802 177 782 181 q 904 155 857 168 q 995 120 950 141 q 1066 69 1040 99 q 1091 0 1091 38 m 794 694 l 794 397 q 779 362 794 377 q 744 347 764 347 l 694 347 l 694 50 q 680 15 694 29 q 645 0 665 0 l 446 0 q 412 15 426 0 q 397 50 397 29 l 397 347 l 347 347 q 312 362 327 347 q 298 397 298 377 l 298 694 q 327 765 298 736 q 397 794 356 794 l 694 794 q 765 765 736 794 q 794 694 794 736 m 668 1115 q 694 1090 668 1115 q 719 992 719 1064 q 668 869 719 920 q 546 818 618 818 q 423 869 474 818 q 372 992 372 920 q 423 1115 372 1064 q 546 1166 474 1166 q 668 1115 618 1166 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 992 397 l 1228 397 q 1221 389 1225 392 q 1214 383 1217 385 l 1211 380 l 729 -85 q 694 -99 715 -99 q 660 -85 674 -99 l 177 381 q 160 397 173 383 l 446 397 q 477 407 463 397 q 494 434 491 418 l 549 652 l 696 135 q 714 109 701 119 q 744 99 727 99 q 773 109 760 99 q 791 135 787 119 l 904 511 l 948 424 q 992 397 962 397 m 1389 729 q 1309 496 1389 616 l 1023 496 l 937 667 q 917 688 931 680 q 889 694 904 696 q 846 659 854 691 l 746 326 l 594 857 q 575 883 589 873 q 545 893 562 893 q 515 882 528 893 q 498 856 501 872 l 408 496 l 80 496 q 0 729 0 616 q 98 995 0 899 q 370 1091 197 1091 q 469 1075 419 1091 q 562 1030 519 1058 q 636 977 605 1001 q 694 924 667 952 q 753 977 722 952 q 827 1030 784 1001 q 920 1075 870 1058 q 1018 1091 970 1091 q 1290 995 1192 1091 q 1389 729 1389 899 z "},"":{"ha":992,"x_min":2,"x_max":893,"o":"m 893 744 q 779 446 893 573 q 496 301 664 319 l 496 99 l 670 99 q 687 92 680 99 q 694 74 694 85 l 694 25 q 687 7 694 14 q 670 0 680 0 l 496 0 l 496 -174 q 489 -191 496 -184 q 471 -198 482 -198 l 422 -198 q 404 -191 411 -198 q 397 -174 397 -184 l 397 0 l 223 0 q 205 7 212 0 q 198 25 198 14 l 198 74 q 205 92 198 85 q 223 99 212 99 l 397 99 l 397 301 q 186 381 281 313 q 42 554 92 448 q 2 780 -8 660 q 64 973 10 884 q 205 1119 118 1063 q 395 1187 292 1176 q 643 1146 527 1202 q 825 981 758 1089 q 893 744 893 873 m 201 989 q 150 938 201 989 q 99 744 99 887 q 201 499 99 601 q 446 397 303 397 q 692 499 590 397 q 794 744 794 601 q 692 989 794 887 q 446 1091 590 1091 q 201 989 303 1091 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 1141 1091 q 1176 1077 1161 1091 q 1190 1042 1190 1062 l 1190 719 q 1184 701 1190 708 q 1166 694 1177 694 l 1116 694 q 1098 701 1105 694 q 1091 719 1091 708 l 1091 922 l 795 625 q 893 347 893 505 q 858 174 893 257 q 762 31 822 91 q 620 -64 702 -29 q 446 -99 537 -99 q 273 -64 356 -99 q 131 31 191 -29 q 35 174 71 91 q 0 347 0 257 q 35 520 0 438 q 131 663 71 603 q 273 758 191 723 q 446 794 356 794 q 725 696 604 794 l 1021 992 l 818 992 q 801 999 808 992 q 794 1017 794 1006 l 794 1066 q 801 1084 794 1077 q 818 1091 808 1091 l 1141 1091 m 201 102 q 252 51 201 102 q 446 0 303 0 q 692 102 590 0 q 794 347 794 204 q 692 593 794 491 q 446 694 590 694 q 201 593 303 694 q 99 347 99 491 q 201 102 99 204 z "},"":{"ha":992,"x_min":0,"x_max":893,"o":"m 643 946 q 824 782 756 890 q 893 546 893 675 q 779 248 893 374 q 496 102 664 121 l 496 0 l 570 0 q 588 -7 581 0 q 595 -25 595 -14 l 595 -74 q 588 -92 595 -85 q 570 -99 581 -99 l 496 -99 l 496 -174 q 489 -191 496 -184 q 471 -198 482 -198 l 422 -198 q 404 -191 411 -198 q 397 -174 397 -184 l 397 -99 l 322 -99 q 305 -92 312 -99 q 298 -74 298 -85 l 298 -25 q 305 -7 298 -14 q 322 0 312 0 l 397 0 l 397 102 q 114 248 229 121 q 0 546 0 374 q 69 782 0 675 q 250 946 137 890 q 73 1157 122 1020 q 76 1180 68 1170 q 96 1190 83 1190 l 150 1190 q 172 1175 166 1190 q 281 1042 206 1093 q 446 992 355 992 q 612 1042 538 992 q 721 1175 687 1093 q 749 1190 727 1190 l 797 1190 q 817 1180 810 1190 q 820 1157 825 1170 q 643 946 771 1020 m 201 300 q 252 249 201 300 q 446 198 303 198 q 692 300 590 198 q 794 546 794 402 q 692 791 794 689 q 446 893 590 893 q 201 791 303 893 q 99 546 99 689 q 201 300 99 402 z "},"":{"ha":1190,"x_min":2,"x_max":1091,"o":"m 794 1166 q 801 1184 794 1177 q 818 1190 808 1190 l 1042 1190 q 1077 1176 1062 1190 q 1091 1141 1091 1161 l 1091 918 q 1084 900 1091 907 q 1066 893 1077 893 l 1017 893 q 999 900 1006 893 q 992 918 992 907 l 992 1022 l 795 824 q 893 546 893 701 q 779 248 893 374 q 496 102 664 121 l 496 0 l 570 0 q 588 -7 581 0 q 595 -25 595 -14 l 595 -74 q 588 -92 595 -85 q 570 -99 581 -99 l 496 -99 l 496 -174 q 489 -191 496 -184 q 471 -198 482 -198 l 422 -198 q 404 -191 411 -198 q 397 -174 397 -184 l 397 -99 l 322 -99 q 305 -92 312 -99 q 298 -74 298 -85 l 298 -25 q 305 -7 298 -14 q 322 0 312 0 l 397 0 l 397 102 q 187 182 281 115 q 43 355 93 250 q 2 581 -8 461 q 126 855 14 739 q 395 989 237 971 q 571 974 486 1000 q 725 894 656 949 l 922 1091 l 818 1091 q 801 1098 808 1091 q 794 1116 794 1105 l 794 1166 m 201 300 q 252 249 201 300 q 446 198 303 198 q 692 300 590 198 q 794 546 794 402 q 692 791 794 689 q 446 893 590 893 q 201 791 303 893 q 99 546 99 689 q 201 300 99 402 z "},"":{"ha":1389,"x_min":0,"x_max":1290,"o":"m 992 1166 q 999 1184 992 1177 q 1017 1190 1006 1190 l 1240 1190 q 1275 1176 1260 1190 q 1290 1141 1290 1161 l 1290 918 q 1283 900 1290 907 q 1265 893 1276 893 l 1215 893 q 1197 900 1204 893 q 1190 918 1190 907 l 1190 1022 l 994 824 q 1091 546 1091 701 q 977 248 1091 374 q 694 102 863 121 l 694 0 l 769 0 q 787 -7 780 0 q 794 -25 794 -14 l 794 -74 q 787 -92 794 -85 q 769 -99 780 -99 l 694 -99 l 694 -174 q 687 -191 694 -184 q 670 -198 680 -198 l 620 -198 q 602 -191 609 -198 q 595 -174 595 -184 l 595 -99 l 521 -99 q 503 -92 510 -99 q 496 -74 496 -85 l 496 -25 q 503 -7 496 -14 q 521 0 510 0 l 595 0 l 595 102 q 313 248 427 121 q 198 546 198 374 q 296 824 198 701 l 256 865 l 177 779 q 160 771 171 771 q 143 777 150 770 l 105 811 q 97 827 98 817 q 104 846 97 838 l 185 935 l 99 1022 l 99 918 q 92 900 99 907 q 74 893 85 893 l 25 893 q 7 900 14 893 q 0 918 0 907 l 0 1141 q 15 1176 0 1161 q 50 1190 29 1190 l 273 1190 q 291 1184 284 1190 q 298 1166 298 1177 l 298 1116 q 291 1098 298 1105 q 273 1091 284 1091 l 170 1091 l 252 1008 l 319 1081 q 336 1089 326 1089 q 353 1084 346 1090 l 391 1049 q 399 1033 398 1043 q 392 1015 399 1022 l 322 938 l 367 894 q 645 992 489 992 q 923 894 801 992 l 1121 1091 l 1017 1091 q 999 1098 1006 1091 q 992 1116 992 1105 l 992 1166 m 400 300 q 450 249 400 300 q 645 198 501 198 q 890 300 788 198 q 992 546 992 402 q 890 791 992 689 q 645 893 788 893 q 400 791 501 893 q 298 546 298 689 q 400 300 298 402 z "},"":{"ha":1389,"x_min":2,"x_max":1387,"o":"m 1387 780 q 1347 554 1397 660 q 1202 381 1297 448 q 992 301 1108 313 l 992 99 l 1166 99 q 1184 92 1177 99 q 1190 74 1190 85 l 1190 25 q 1184 7 1190 14 q 1166 0 1177 0 l 992 0 l 992 -174 q 985 -191 992 -184 q 967 -198 978 -198 l 918 -198 q 900 -191 907 -198 q 893 -174 893 -184 l 893 0 l 496 0 l 496 -174 q 489 -191 496 -184 q 471 -198 482 -198 l 422 -198 q 404 -191 411 -198 q 397 -174 397 -184 l 397 0 l 223 0 q 205 7 212 0 q 198 25 198 14 l 198 74 q 205 92 198 85 q 223 99 212 99 l 397 99 l 397 301 q 186 381 281 313 q 42 554 92 448 q 2 780 -8 660 q 129 1057 15 940 q 402 1188 243 1173 q 694 1115 562 1204 q 987 1188 827 1204 q 1260 1057 1146 1173 q 1387 780 1374 940 m 694 501 q 794 744 794 603 q 694 987 794 885 q 595 744 595 885 q 694 501 595 603 m 446 397 q 615 441 536 397 q 496 744 496 569 q 615 1047 496 918 q 446 1091 536 1091 q 201 989 303 1091 q 99 744 99 887 q 201 499 99 601 q 446 397 303 397 m 893 99 l 893 301 q 694 374 787 312 q 496 301 602 312 l 496 99 l 893 99 m 942 397 q 1188 499 1086 397 q 1290 744 1290 601 q 1188 989 1290 887 q 942 1091 1086 1091 q 773 1047 853 1091 q 893 744 893 918 q 773 441 893 569 q 942 397 853 397 z "},"":{"ha":1488,"x_min":1,"x_max":1488,"o":"m 1190 868 q 1197 886 1190 879 q 1215 893 1204 893 l 1438 893 q 1473 878 1459 893 q 1488 843 1488 863 l 1488 620 q 1481 602 1488 609 q 1463 595 1474 595 l 1414 595 q 1396 602 1403 595 q 1389 620 1389 609 l 1389 724 l 1192 526 q 1275 360 1251 453 q 1283 169 1300 268 q 1154 -73 1259 28 q 908 -194 1049 -174 q 610 -132 745 -216 q 422 101 474 -47 q 251 145 332 105 q 114 248 171 185 q 26 398 57 312 q 1 576 -5 484 q 61 771 8 680 q 202 920 115 862 q 395 989 290 977 q 571 974 486 1000 q 725 894 656 949 l 922 1091 l 818 1091 q 801 1098 808 1091 q 794 1116 794 1105 l 794 1166 q 801 1184 794 1177 q 818 1190 808 1190 l 1042 1190 q 1077 1176 1062 1190 q 1091 1141 1091 1161 l 1091 918 q 1084 900 1091 907 q 1066 893 1077 893 l 1017 893 q 999 900 1006 893 q 992 918 992 907 l 992 1022 l 795 824 q 867 693 841 767 q 1121 597 1008 686 l 1319 794 l 1215 794 q 1197 801 1204 794 q 1190 818 1190 808 l 1190 868 m 794 546 q 791 591 794 561 q 581 474 665 571 q 496 248 496 377 q 499 203 496 233 q 709 319 625 222 q 794 546 794 416 m 99 546 q 185 318 99 415 q 399 202 271 220 q 397 248 397 225 q 501 534 397 411 q 763 687 606 658 q 637 836 722 780 q 446 893 551 893 q 201 791 303 893 q 99 546 99 689 m 843 -99 q 1089 3 987 -99 q 1190 248 1190 105 q 1104 476 1190 378 q 891 591 1018 574 q 893 546 893 570 q 788 259 893 383 q 526 107 684 136 q 653 -43 567 14 q 843 -99 739 -99 z "},"":{"ha":1587,"x_min":5,"x_max":1587,"o":"m 1290 1166 q 1297 1184 1290 1177 q 1314 1190 1304 1190 l 1538 1190 q 1573 1176 1558 1190 q 1587 1141 1587 1161 l 1587 918 q 1580 900 1587 907 q 1563 893 1573 893 l 1513 893 q 1495 900 1502 893 q 1488 918 1488 907 l 1488 1022 l 1291 824 q 1375 658 1350 750 q 1382 467 1399 566 q 1254 226 1357 327 q 1011 105 1152 126 q 694 174 839 78 q 496 102 604 114 l 496 0 l 570 0 q 588 -7 581 0 q 595 -25 595 -14 l 595 -74 q 588 -92 595 -85 q 570 -99 581 -99 l 496 -99 l 496 -174 q 489 -191 496 -184 q 471 -198 482 -198 l 422 -198 q 404 -191 411 -198 q 397 -174 397 -184 l 397 -99 l 322 -99 q 305 -92 312 -99 q 298 -74 298 -85 l 298 -25 q 305 -7 298 -14 q 322 0 312 0 l 397 0 l 397 102 q 180 187 277 115 q 35 371 84 259 q 5 609 -13 484 q 128 859 24 754 q 377 987 233 964 q 694 917 550 1013 q 942 992 808 992 q 1221 894 1098 992 l 1418 1091 l 1314 1091 q 1297 1098 1304 1091 q 1290 1116 1290 1105 l 1290 1166 m 694 303 q 794 546 794 405 q 694 788 794 687 q 595 546 595 687 q 694 303 595 405 m 201 791 q 150 740 201 791 q 99 546 99 689 q 201 300 99 402 q 446 198 303 198 q 615 243 537 198 q 496 546 496 372 q 615 849 496 719 q 446 893 537 893 q 201 791 303 893 m 942 198 q 1188 300 1086 198 q 1290 546 1290 402 q 1188 791 1290 689 q 942 893 1086 893 q 773 849 852 893 q 893 546 893 719 q 773 243 893 372 q 942 198 852 198 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 1141 1091 q 1176 1077 1161 1091 q 1190 1042 1190 1062 l 1190 719 q 1184 701 1190 708 q 1166 694 1177 694 l 1116 694 q 1098 701 1105 694 q 1091 719 1091 708 l 1091 922 l 926 756 l 1035 648 q 1042 630 1042 640 q 1035 613 1042 620 l 999 577 q 982 570 992 570 q 964 577 972 570 l 856 687 l 795 625 q 893 347 893 505 q 858 174 893 257 q 762 31 822 91 q 620 -64 702 -29 q 446 -99 537 -99 q 273 -64 356 -99 q 131 31 191 -29 q 35 174 71 91 q 0 347 0 257 q 35 520 0 438 q 131 663 71 603 q 273 758 191 723 q 446 794 356 794 q 725 696 604 794 l 785 756 l 652 890 q 645 908 645 898 q 652 925 645 918 l 687 960 q 705 967 694 967 q 722 960 715 967 l 856 827 l 1021 992 l 818 992 q 801 999 808 992 q 794 1017 794 1006 l 794 1066 q 801 1084 794 1077 q 818 1091 808 1091 l 1141 1091 m 201 102 q 252 51 201 102 q 446 0 303 0 q 692 102 590 0 q 794 347 794 204 q 692 593 794 491 q 446 694 590 694 q 201 593 303 694 q 99 347 99 491 q 201 102 99 204 z "},"":{"ha":992,"x_min":2,"x_max":893,"o":"m 496 691 q 779 546 664 673 q 893 248 893 419 q 825 11 893 119 q 643 -153 758 -97 q 395 -195 527 -210 q 205 -127 292 -184 q 64 19 118 -71 q 2 212 10 108 q 42 438 -8 332 q 186 612 92 544 q 397 691 281 679 l 397 794 l 273 794 q 255 801 262 794 q 248 818 248 808 l 248 868 q 255 886 248 879 q 273 893 262 893 l 397 893 l 397 1021 l 326 949 q 308 942 318 942 q 291 949 298 942 l 255 985 q 248 1002 248 992 q 255 1020 248 1012 l 412 1176 q 446 1190 426 1190 q 481 1176 467 1190 l 638 1020 q 645 1002 645 1012 q 638 985 645 992 l 602 949 q 585 942 595 942 q 567 949 575 942 l 496 1021 l 496 893 l 620 893 q 638 886 631 893 q 645 868 645 879 l 645 818 q 638 801 645 808 q 620 794 631 794 l 496 794 l 496 691 m 201 3 q 252 -48 201 3 q 446 -99 303 -99 q 692 3 590 -99 q 794 248 794 105 q 692 493 794 391 q 446 595 590 595 q 201 493 303 595 q 99 248 99 391 q 201 3 99 105 z "},"":{"ha":1587,"x_min":3,"x_max":1488,"o":"m 1473 481 q 1488 446 1488 467 q 1473 412 1488 426 l 1246 184 q 1228 176 1239 176 q 1211 184 1218 176 l 1176 219 q 1168 236 1168 226 q 1176 253 1168 246 l 1319 397 l 1091 397 l 1091 223 q 1084 205 1091 212 q 1066 198 1077 198 l 1017 198 q 999 205 1006 198 q 992 223 992 212 l 992 397 l 890 397 q 744 114 871 229 q 446 0 618 0 q 209 67 317 0 q 45 250 102 135 q 3 498 -12 366 q 71 688 15 601 q 217 829 128 775 q 410 891 306 883 q 636 851 530 901 q 810 706 742 801 q 890 496 877 612 l 992 496 l 992 670 q 999 687 992 680 q 1017 694 1006 694 l 1066 694 q 1084 687 1077 694 q 1091 670 1091 680 l 1091 496 l 1319 496 l 1176 639 q 1168 657 1168 646 q 1176 674 1168 667 l 1211 709 q 1228 717 1218 717 q 1246 709 1239 717 l 1473 481 m 201 201 q 252 150 201 201 q 446 99 303 99 q 692 201 590 99 q 794 446 794 303 q 692 692 794 590 q 446 794 590 794 q 201 692 303 794 q 99 446 99 590 q 201 201 99 303 z "},"":{"ha":992,"x_min":0,"x_max":893,"o":"m 893 744 q 779 446 893 573 q 496 301 664 319 l 496 -174 q 489 -191 496 -184 q 471 -198 482 -198 l 422 -198 q 404 -191 411 -198 q 397 -174 397 -184 l 397 301 q 114 446 229 319 q 0 744 0 573 q 35 917 0 835 q 131 1060 71 1000 q 273 1155 191 1120 q 446 1190 356 1190 q 620 1155 537 1190 q 762 1060 702 1120 q 858 917 822 1000 q 893 744 893 835 m 201 499 q 252 448 201 499 q 446 397 303 397 q 692 499 590 397 q 794 744 794 601 q 692 989 794 887 q 446 1091 590 1091 q 201 989 303 1091 q 99 744 99 887 q 201 499 99 601 z "},"":{"ha":992,"x_min":0,"x_max":893,"o":"m 692 201 q 743 252 692 201 q 794 446 794 303 q 692 692 794 590 q 446 794 590 794 q 201 692 303 794 q 99 446 99 590 q 201 201 99 303 q 446 99 303 99 q 692 201 590 99 m 858 620 q 875 578 858 620 q 893 446 893 537 q 858 273 893 356 q 762 131 822 191 q 620 35 702 71 q 446 0 537 0 q 273 35 356 0 q 131 131 191 71 q 35 273 71 191 q 0 446 0 356 q 35 620 0 537 q 131 762 71 702 q 273 858 191 822 q 446 893 356 893 q 620 858 537 893 q 762 762 702 822 q 858 620 822 702 z "},"":{"ha":1389,"x_min":0,"x_max":0,"o":""},"":{"ha":1389,"x_min":0,"x_max":0,"o":""},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 1125 1091 q 1171 1072 1152 1091 q 1190 1025 1190 1053 l 1190 -33 q 1171 -80 1190 -60 q 1125 -99 1152 -99 l 822 -99 l 822 362 l 976 362 l 999 542 l 822 542 l 822 656 q 840 722 822 700 q 911 743 858 743 l 1005 744 l 1005 904 q 867 911 956 911 q 699 849 762 911 q 636 674 636 787 l 636 542 l 481 542 l 481 362 l 636 362 l 636 -99 l 66 -99 q 19 -80 39 -99 q 0 -33 0 -60 l 0 1025 q 19 1072 0 1053 q 66 1091 39 1091 l 1125 1091 z "},"":{"ha":992,"x_min":0,"x_max":992,"o":"m 0 728 q 29 885 0 811 q 109 1015 58 960 q 227 1110 160 1070 q 370 1170 294 1150 q 527 1190 447 1190 q 755 1139 649 1190 q 926 989 860 1087 q 992 767 992 891 q 977 621 992 692 q 931 484 963 550 q 853 368 899 418 q 741 288 808 318 q 594 258 674 258 q 490 283 542 258 q 415 351 438 308 q 394 264 408 321 q 376 190 380 207 q 360 135 371 174 q 339 80 348 97 q 315 32 331 64 q 279 -28 298 0 q 231 -95 260 -57 l 220 -99 l 213 -91 q 202 54 202 30 q 218 214 202 126 q 270 437 235 303 q 310 594 305 571 q 285 725 285 645 q 326 846 285 790 q 428 903 366 903 q 501 872 475 903 q 528 792 528 840 q 494 644 528 741 q 460 499 460 547 q 494 418 460 450 q 579 386 529 386 q 658 405 622 386 q 719 458 694 425 q 762 532 743 491 q 792 617 781 572 q 807 703 802 663 q 812 780 812 744 q 727 989 812 915 q 506 1064 643 1064 q 247 964 351 1064 q 143 709 143 863 q 153 643 143 675 q 174 593 163 612 q 195 558 185 574 q 205 534 205 541 q 193 477 205 512 q 164 443 181 443 q 151 445 163 443 q 81 488 112 457 q 34 562 50 520 q 9 645 17 603 q 0 728 0 687 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 723 398 q 738 417 723 398 q 763 436 753 436 q 839 401 773 436 q 908 360 904 367 q 910 349 910 357 q 897 290 910 323 q 842 239 884 260 q 763 219 799 219 q 615 267 718 219 q 484 358 539 301 q 369 501 428 415 q 314 652 313 584 l 314 658 q 371 780 316 729 q 412 798 390 798 q 426 796 416 798 q 440 795 435 795 q 461 790 455 795 q 473 769 467 785 q 498 701 479 753 q 518 643 518 648 q 491 598 518 626 q 464 562 464 570 q 468 550 464 556 q 547 444 494 494 q 664 366 591 403 q 681 360 674 360 q 723 398 693 360 m 606 25 q 795 64 705 25 q 950 167 885 102 q 1054 323 1015 233 q 1093 512 1093 413 q 1054 700 1093 610 q 950 856 1015 791 q 795 960 885 921 q 606 998 705 998 q 417 960 508 998 q 262 856 327 921 q 158 700 197 791 q 119 512 119 610 q 212 226 119 354 l 151 46 l 339 105 q 606 25 461 25 m 379 1049 q 433 1073 379 1049 q 606 1096 488 1096 q 833 1049 725 1096 q 1019 925 941 1003 q 1144 738 1097 846 q 1190 512 1190 630 q 1144 285 1190 393 q 1019 98 1097 177 q 833 -26 941 20 q 606 -73 725 -73 q 323 0 455 -73 l 0 -104 l 105 210 q 22 512 22 348 q 68 738 22 630 q 193 925 115 846 q 379 1049 271 1003 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 99 99 l 893 99 l 893 198 l 99 198 l 99 99 m 99 496 l 893 496 l 893 595 l 99 595 l 99 496 m 1293 96 q 1304 107 1293 96 q 1314 149 1314 118 q 1293 202 1314 180 q 1240 223 1271 223 q 1187 202 1209 223 q 1166 149 1166 180 q 1187 96 1166 118 q 1240 74 1209 74 q 1293 96 1271 74 m 99 893 l 893 893 l 893 992 l 99 992 l 99 893 m 1293 493 q 1304 504 1293 493 q 1314 546 1314 515 q 1293 598 1314 577 q 1240 620 1271 620 q 1187 598 1209 620 q 1166 546 1166 577 q 1187 493 1166 515 q 1240 471 1209 471 q 1293 493 1271 471 m 1293 890 q 1304 901 1293 890 q 1314 942 1314 911 q 1293 995 1314 973 q 1240 1017 1271 1017 q 1187 995 1209 1017 q 1166 942 1166 973 q 1187 890 1166 911 q 1240 868 1209 868 q 1293 890 1271 868 m 1389 298 l 1389 0 l 0 0 l 0 298 l 1389 298 m 1389 694 l 1389 397 l 0 397 l 0 694 l 1389 694 m 1389 1091 l 1389 794 l 0 794 l 0 1091 l 1389 1091 z "},"":{"ha":1587,"x_min":0,"x_max":1587,"o":"m 756 583 q 712 540 756 583 q 546 496 669 496 q 335 583 422 496 q 248 794 248 670 q 335 1004 248 917 q 546 1091 422 1091 q 756 1004 669 1091 q 843 794 843 917 q 756 583 843 670 m 1290 397 l 1563 397 q 1580 389 1573 397 q 1587 372 1587 382 l 1587 223 q 1580 206 1587 213 q 1563 198 1573 198 l 1290 198 l 1290 -74 q 1282 -92 1290 -84 q 1265 -99 1275 -99 l 1116 -99 q 1099 -92 1106 -99 q 1091 -74 1091 -84 l 1091 198 l 818 198 q 801 206 808 198 q 794 223 794 213 l 794 372 q 801 389 794 382 q 818 397 808 397 l 1091 397 l 1091 670 q 1099 687 1091 680 q 1116 694 1106 694 l 1265 694 q 1282 687 1275 694 q 1290 670 1290 680 l 1290 397 m 719 223 q 749 153 719 183 q 818 124 778 124 l 1017 124 l 1017 -60 q 884 -99 964 -99 l 207 -99 q 57 -46 113 -99 q 0 102 0 8 q 3 182 0 143 q 14 266 5 221 q 34 350 22 312 q 67 426 47 389 q 115 489 88 463 q 182 530 143 515 q 268 546 221 546 q 298 532 283 546 q 418 462 360 485 q 546 438 477 438 q 673 462 615 438 q 793 532 732 485 q 823 546 808 546 q 991 471 925 546 l 818 471 q 749 442 778 471 q 719 372 719 412 l 719 223 z "},"":{"ha":1587,"x_min":0,"x_max":1580,"o":"m 756 583 q 712 540 756 583 q 546 496 669 496 q 335 583 422 496 q 248 794 248 670 q 335 1004 248 917 q 546 1091 422 1091 q 756 1004 669 1091 q 843 794 843 917 q 756 583 843 670 m 1380 248 l 1573 55 q 1580 37 1580 48 q 1573 20 1580 27 l 1468 -85 q 1451 -92 1461 -92 q 1433 -85 1440 -92 l 1240 108 l 1047 -85 q 1029 -92 1040 -92 q 1012 -85 1019 -92 l 907 20 q 900 37 900 27 q 907 55 900 48 l 1100 248 l 907 441 q 900 459 900 448 q 907 476 900 469 l 1012 581 q 1029 588 1019 588 q 1047 581 1040 588 l 1240 388 l 1433 581 q 1451 588 1440 588 q 1468 581 1461 588 l 1573 476 q 1580 459 1580 469 q 1573 441 1580 448 l 1380 248 m 994 248 l 854 108 q 825 37 825 79 q 854 -33 825 -4 l 918 -97 q 884 -99 902 -99 l 207 -99 q 57 -46 113 -99 q 0 102 0 8 q 3 182 0 143 q 14 266 5 221 q 34 350 22 312 q 67 426 47 389 q 115 489 88 463 q 182 530 143 515 q 268 546 221 546 q 298 532 283 546 q 546 438 418 438 q 793 532 674 438 q 823 546 808 546 q 867 541 845 546 q 836 502 846 520 q 825 459 825 484 q 854 388 825 417 l 994 248 z "},"":{"ha":1587,"x_min":0,"x_max":1587,"o":"m 198 397 l 1538 397 q 1573 382 1558 397 q 1587 347 1587 367 l 1587 0 l 1389 0 l 1389 198 l 198 198 l 198 0 l 0 0 l 0 942 q 15 977 0 963 q 50 992 29 992 l 149 992 q 184 977 169 992 q 198 942 198 963 l 198 397 m 587 505 q 616 534 587 505 q 645 645 645 563 q 587 785 645 727 q 446 843 529 843 q 306 785 364 843 q 248 645 248 727 q 306 505 248 563 q 446 446 364 446 q 587 505 529 446 m 1587 446 l 1587 496 q 1500 706 1587 619 q 1290 794 1413 794 l 744 794 q 709 779 724 794 q 694 744 694 764 l 694 446 l 1587 446 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 1190 1190 l 1042 843 l 1190 843 l 1190 694 l 978 694 l 935 595 l 1190 595 l 1190 446 l 872 446 l 595 -198 l 319 446 l 0 446 l 0 595 l 255 595 l 212 694 l 0 694 l 0 843 l 149 843 l 0 1190 l 198 1190 l 449 595 l 742 595 l 992 1190 l 1190 1190 m 595 248 l 679 446 l 512 446 l 595 248 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 843 1190 q 1089 1118 987 1190 q 1190 942 1190 1046 l 1190 248 q 1093 76 1190 147 q 856 1 996 5 l 1022 -156 q 1028 -183 1034 -167 q 1004 -198 1022 -198 l 186 -198 q 163 -183 169 -198 q 169 -156 157 -167 l 334 1 q 97 76 195 5 q 0 248 0 147 l 0 942 q 102 1118 0 1046 q 347 1190 204 1190 l 843 1190 m 490 192 q 512 171 490 192 q 595 149 533 149 q 701 192 657 149 q 744 298 744 236 q 701 403 744 360 q 595 446 657 446 q 490 403 533 446 q 446 298 446 360 q 490 192 446 236 m 1042 595 l 1042 992 l 149 992 l 149 595 l 1042 595 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 843 1190 q 1089 1118 987 1190 q 1190 942 1190 1046 l 1190 248 q 1093 76 1190 147 q 856 1 996 5 l 1022 -156 q 1028 -183 1034 -167 q 1004 -198 1022 -198 l 186 -198 q 163 -183 169 -198 q 169 -156 157 -167 l 334 1 q 97 76 195 5 q 0 248 0 147 l 0 942 q 102 1118 0 1046 q 347 1190 204 1190 l 843 1190 m 136 210 q 154 192 136 210 q 223 174 172 174 q 311 210 274 174 q 347 298 347 246 q 311 385 347 349 q 223 422 274 422 q 136 385 172 422 q 99 298 99 349 q 136 210 99 246 m 546 595 l 546 992 l 124 992 l 124 595 l 546 595 m 880 210 q 898 192 880 210 q 967 174 916 174 q 1055 210 1018 174 q 1091 298 1091 246 q 1055 385 1091 349 q 967 422 1018 422 q 880 385 916 422 q 843 298 843 349 q 880 210 843 246 m 1091 595 l 1091 992 l 645 992 l 645 595 l 1091 595 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 463 864 l 463 -45 q 453 -78 463 -64 q 425 -91 443 -91 q 399 -85 412 -91 l 39 95 q 11 121 22 103 q 0 157 0 140 l 0 1041 q 8 1067 0 1056 q 30 1078 16 1078 q 64 1066 41 1078 l 460 868 q 463 864 463 866 m 512 786 l 926 115 l 512 321 l 512 786 m 1389 772 l 1389 -45 q 1378 -76 1389 -64 q 1349 -88 1367 -88 q 1312 -78 1330 -88 l 970 92 l 1389 772 m 1387 865 q 1188 540 1387 863 q 955 162 989 217 l 653 653 l 904 1062 q 944 1084 917 1084 q 964 1079 955 1084 l 1383 870 q 1387 865 1387 868 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 627 412 l 833 799 l 746 799 l 625 557 q 591 486 606 520 l 558 557 l 438 799 l 345 799 l 549 417 l 549 166 l 627 166 l 627 412 m 1190 1091 l 1190 -99 l 0 -99 l 0 1091 l 1190 1091 z "},"":{"ha":1780,"x_min":65,"x_max":1714,"o":"m 370 -108 q 350 -134 364 -120 q 321 -154 335 -149 q 281 -152 301 -161 q 259 -127 260 -142 q 290 -84 258 -110 q 343 -55 322 -59 q 369 -72 360 -52 q 370 -108 377 -91 m 1410 -108 q 1430 -134 1415 -120 q 1459 -154 1445 -149 q 1499 -152 1479 -161 q 1521 -127 1520 -142 q 1490 -84 1522 -110 q 1437 -55 1458 -59 q 1411 -72 1420 -52 q 1410 -108 1403 -91 m 1447 -23 q 1491 -69 1457 -44 q 1551 -102 1525 -95 q 1614 -98 1586 -112 q 1643 -59 1643 -84 q 1591 19 1643 -23 q 1501 65 1538 61 q 1452 36 1470 69 q 1447 -23 1434 3 m 332 -23 q 288 -69 322 -44 q 229 -102 255 -95 q 165 -98 194 -112 q 136 -59 136 -84 q 189 19 136 -23 q 278 65 241 61 q 327 36 309 69 q 332 -23 345 3 m 898 848 l 898 848 q 839 836 867 848 q 873 813 860 830 q 887 774 887 795 q 866 728 887 747 q 815 708 845 708 q 753 742 775 708 q 749 709 749 724 q 793 611 749 652 q 898 570 836 570 q 1003 611 960 570 q 1046 709 1046 652 q 1003 807 1046 767 q 898 848 960 848 m 1133 1017 q 962 1119 1056 1101 q 772 1084 868 1136 q 836 1159 793 1131 q 927 1190 879 1187 q 1022 1177 976 1192 q 1099 1119 1067 1161 q 1133 1017 1130 1077 m 1714 57 q 1706 24 1721 48 q 1711 -7 1711 6 q 1677 -94 1712 -50 q 1592 -165 1642 -138 q 1500 -194 1542 -192 q 1429 -177 1463 -195 q 1378 -126 1395 -159 q 402 -126 846 -146 q 351 -177 384 -158 q 279 -194 317 -195 q 140 -131 212 -191 q 68 -7 67 -71 q 74 24 70 10 q 65 57 59 48 q 89 57 70 64 q 121 97 100 74 q 122 126 115 119 q 153 123 131 134 q 198 150 175 139 q 208 178 198 172 q 248 166 226 188 q 295 164 275 170 q 325 150 309 161 l 325 206 q 311 208 316 206 q 236 242 270 215 q 193 310 202 269 q 193 373 186 339 q 265 446 205 421 q 280 474 267 460 q 308 492 293 488 q 333 486 322 496 q 348 463 344 477 l 358 463 q 405 445 394 459 q 408 439 407 443 q 432 442 416 440 q 456 445 448 444 q 432 458 444 453 q 362 491 415 489 q 363 499 362 496 q 271 513 315 501 q 205 550 227 526 q 172 622 181 578 q 171 708 164 665 q 240 847 183 806 q 281 851 258 860 q 305 819 303 842 q 307 808 305 818 q 308 792 308 798 q 311 777 309 786 q 315 762 312 767 q 322 754 318 756 q 381 745 343 743 q 457 802 418 780 q 331 791 426 805 l 367 827 q 494 913 415 872 q 712 980 606 970 q 680 992 697 986 q 644 1003 664 997 q 611 1011 624 1008 q 574 1019 598 1014 q 541 1027 550 1025 q 1242 919 1002 1125 q 1364 747 1318 854 q 1458 754 1430 739 l 1459 754 q 1465 762 1463 756 q 1469 777 1468 767 q 1472 792 1471 786 q 1474 808 1473 798 l 1475 819 q 1500 850 1477 841 q 1540 846 1522 860 q 1611 708 1597 806 q 1608 621 1616 664 q 1575 550 1600 577 q 1510 513 1553 525 q 1421 498 1467 500 l 1421 491 q 1347 457 1366 489 q 1323 444 1336 453 q 1348 441 1332 443 q 1371 439 1364 439 q 1375 445 1372 443 q 1421 463 1387 459 l 1432 463 q 1446 486 1435 477 q 1472 492 1457 495 q 1500 474 1487 489 q 1514 446 1513 460 q 1587 373 1576 422 q 1587 310 1594 342 q 1544 242 1578 269 q 1469 208 1510 215 q 1456 206 1461 206 q 1455 150 1456 168 q 1484 164 1470 161 q 1531 166 1504 170 q 1571 178 1553 188 q 1582 150 1582 171 q 1628 123 1607 137 q 1657 126 1649 133 q 1659 97 1665 119 q 1690 57 1680 74 q 1714 57 1708 64 m 1501 794 q 1494 753 1501 772 q 1581 650 1558 728 q 1574 727 1584 679 q 1542 797 1563 774 q 1514 810 1526 811 q 1501 794 1501 808 m 1441 717 q 1478 633 1468 684 q 1477 536 1487 581 q 1552 571 1529 546 q 1566 593 1563 582 q 1542 682 1564 643 q 1481 733 1521 721 q 1441 717 1469 722 m 1412 714 q 1378 715 1389 714 q 1419 529 1411 625 q 1452 532 1435 529 q 1453 636 1465 584 q 1412 714 1442 688 m 200 650 q 287 753 223 728 q 280 794 280 772 q 267 810 280 808 q 239 797 254 811 q 207 727 218 774 q 200 650 197 679 m 228 571 q 303 536 250 547 q 303 633 293 581 q 339 717 312 684 l 339 717 q 299 733 311 722 q 238 682 260 721 q 214 593 217 643 q 228 571 221 580 m 365 529 q 422 711 376 625 q 379 698 407 708 l 344 683 l 344 684 q 329 532 308 615 q 365 529 348 529 m 1111 499 q 1124 415 1118 470 q 1133 346 1131 360 q 1140 329 1135 332 q 1159 332 1146 326 q 1207 399 1190 348 q 1225 496 1224 450 q 1111 499 1206 498 m 1047 932 q 1015 964 1047 932 q 893 996 983 996 q 739 932 803 996 q 674 778 674 868 q 739 624 674 687 q 893 560 803 560 q 1047 624 983 560 q 1111 778 1111 687 q 1047 932 1111 868 m 1070 501 q 906 501 988 502 l 906 501 q 908 435 905 481 q 918 384 911 389 q 991 372 941 373 q 1065 381 1041 372 q 1073 411 1072 383 q 1073 465 1075 439 q 1070 501 1071 491 m 862 346 q 869 384 868 350 q 869 452 870 418 q 866 501 867 486 l 866 501 q 700 499 701 499 q 694 451 697 484 q 694 387 692 419 q 705 351 697 355 q 784 339 732 339 q 862 346 836 338 m 556 493 q 560 401 544 447 q 620 336 576 355 q 639 332 632 329 q 648 348 646 334 q 654 418 650 360 q 662 498 658 475 q 556 493 608 496 m 458 395 q 432 367 460 377 q 642 181 534 258 q 879 62 750 105 q 1120 175 1012 100 q 1347 369 1227 250 q 1324 395 1321 379 q 1324 398 1324 397 q 1325 400 1325 399 q 1326 402 1326 401 l 1326 403 l 1326 402 q 1287 407 1313 404 q 1250 410 1262 409 q 1187 308 1230 340 q 1123 308 1147 278 q 1116 319 1119 313 q 1103 367 1111 329 q 1099 360 1101 363 q 1093 355 1097 357 q 1087 351 1090 353 q 1080 348 1084 349 q 1072 346 1075 346 q 1063 344 1069 345 q 1053 343 1056 343 q 1043 342 1050 343 q 1032 342 1035 342 q 906 350 950 335 q 898 330 903 337 q 882 318 894 322 q 864 313 870 314 q 836 310 858 312 q 829 309 832 309 q 672 340 691 296 q 629 298 670 291 q 558 340 592 305 q 543 360 549 350 q 522 411 529 383 q 455 403 477 406 q 458 395 456 401 m 393 -91 q 395 -68 395 -81 q 356 33 382 -13 q 299 87 329 78 q 221 76 267 96 q 140 14 174 55 q 109 -70 105 -28 q 187 -142 136 -111 q 279 -174 237 -173 q 352 -153 319 -176 q 393 -91 385 -129 m 395 41 q 416 -51 413 -8 q 720 84 567 36 q 580 177 644 124 q 441 305 516 229 q 419 295 436 301 q 418 291 419 294 q 417 288 417 289 q 434 259 441 274 q 391 233 425 241 q 368 214 383 222 l 367 214 q 368 98 366 150 q 395 41 383 71 m 449 -88 q 1336 -88 861 -104 q 1004 64 1139 26 q 884 20 946 37 q 871 20 877 18 q 771 58 821 36 q 449 -88 610 12 l 448 -88 l 448 -88 q 449 -88 449 -88 m 1366 -52 q 1388 41 1370 -10 q 1414 96 1399 71 l 1413 95 q 1415 214 1415 155 q 1392 233 1404 220 q 1349 259 1359 240 q 1366 288 1342 274 q 1364 295 1364 291 q 1342 305 1352 298 q 1046 84 1184 157 q 1366 -52 1199 39 m 1670 -70 q 1640 14 1674 -28 q 1559 76 1606 55 q 1480 87 1513 96 q 1424 32 1451 78 q 1384 -68 1397 -14 q 1387 -91 1384 -81 q 1428 -153 1394 -129 q 1500 -174 1461 -176 q 1593 -142 1542 -173 q 1670 -70 1643 -111 z "},"":{"ha":1786,"x_min":0,"x_max":1786,"o":"m 1144 71 q 1163 52 1144 71 q 1181 -19 1181 33 q 1144 -109 1181 -72 q 1054 -146 1107 -146 q 964 -109 1001 -146 q 926 -19 926 -72 q 964 71 926 33 q 1054 109 1001 109 q 1144 71 1107 109 m 563 71 q 582 52 563 71 q 601 -19 601 33 q 563 -109 601 -72 q 473 -146 525 -146 q 383 -109 420 -146 q 346 -19 346 -72 q 383 71 346 33 q 473 109 420 109 q 563 71 525 109 m 0 1139 q 86 1058 44 1092 q 179 994 127 1023 q 285 945 232 965 q 413 910 338 925 q 568 885 489 894 q 762 871 648 877 q 998 864 877 866 q 1287 862 1119 862 q 1476 858 1394 862 q 1616 845 1558 854 q 1712 824 1675 836 q 1768 793 1750 811 q 1786 753 1785 775 q 1771 704 1787 732 q 1727 644 1755 676 q 1658 574 1700 613 q 1568 493 1616 535 q 1460 401 1520 451 q 1239 209 1317 279 q 1298 294 1261 249 q 1371 376 1335 339 q 1444 452 1407 412 q 1508 523 1481 491 q 1550 585 1535 554 q 1560 639 1565 616 q 1525 682 1556 663 q 1435 714 1494 702 q 1277 732 1375 726 q 1041 736 1178 739 q 798 741 911 735 q 599 759 684 747 q 441 791 514 770 q 317 830 367 811 q 222 879 267 850 q 151 930 177 908 q 98 986 125 953 q 59 1040 72 1018 q 28 1092 47 1061 q 0 1139 10 1124 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 945 1090 q 885 1115 945 1090 q 694 1141 825 1141 q 444 1090 563 1141 q 238 952 325 1039 q 101 746 152 866 q 50 496 50 627 q 101 246 50 365 q 238 40 152 126 q 444 -98 325 -47 q 694 -149 563 -149 q 945 -98 825 -149 q 1151 40 1064 -47 q 1288 246 1237 126 q 1339 496 1339 365 q 1288 746 1339 627 q 1151 952 1237 866 q 945 1090 1064 1039 m 425 1135 q 489 1163 425 1135 q 694 1190 553 1190 q 964 1135 836 1190 q 1186 987 1093 1080 q 1334 766 1279 894 q 1389 496 1389 637 q 1334 226 1389 355 q 1186 5 1279 98 q 964 -143 1093 -88 q 694 -198 836 -198 q 425 -143 553 -198 q 203 5 296 -88 q 55 226 110 98 q 0 496 0 355 q 55 766 0 637 q 203 987 110 894 q 425 1135 296 1080 m 384 546 q 397 533 397 546 l 397 161 q 384 149 397 149 l 360 149 q 347 161 347 149 l 347 533 q 360 546 347 546 l 384 546 m 624 467 q 639 481 624 467 q 694 496 653 496 q 765 467 736 496 q 794 397 794 438 q 780 347 794 370 q 744 312 767 325 l 744 223 q 737 205 744 212 q 719 198 730 198 l 670 198 q 652 205 659 198 q 645 223 645 212 l 645 312 q 609 347 622 325 q 595 397 595 370 q 624 467 595 438 m 396 1011 q 464 1051 396 1011 q 694 1091 532 1091 q 993 1011 856 1091 q 1210 795 1130 932 q 1290 496 1290 658 q 1210 197 1290 334 q 993 -19 1130 60 q 694 -99 856 -99 q 396 -19 532 -99 q 179 197 259 60 q 99 496 99 334 q 179 795 99 658 q 396 1011 259 932 m 422 719 l 422 645 q 429 627 422 634 q 446 620 436 620 l 496 620 q 514 627 507 620 q 521 645 521 634 l 521 719 q 572 842 521 791 q 694 893 622 893 q 817 842 767 893 q 868 719 868 791 l 868 645 q 875 627 868 634 q 893 620 882 620 l 942 620 q 960 627 953 620 q 967 645 967 634 l 967 719 q 887 912 967 832 q 694 992 808 992 q 501 912 581 992 q 422 719 422 832 m 1091 149 l 1091 546 q 1077 581 1091 566 q 1042 595 1062 595 l 347 595 q 312 581 327 595 q 298 546 298 566 l 298 149 q 312 114 298 129 q 347 99 327 99 l 1042 99 q 1077 114 1062 99 q 1091 149 1091 129 z "},"":{"ha":1786,"x_min":0,"x_max":1786,"o":"m 1488 794 l 1488 198 l 198 198 l 198 794 l 1488 794 m 1587 347 l 1687 347 l 1687 645 l 1587 645 l 1587 868 q 1580 886 1587 879 q 1563 893 1573 893 l 124 893 q 106 886 113 893 q 99 868 99 879 l 99 124 q 106 106 99 113 q 124 99 113 99 l 1563 99 q 1580 106 1573 99 q 1587 124 1587 113 l 1587 347 m 1786 645 l 1786 347 q 1757 277 1786 306 q 1687 248 1728 248 l 1687 124 q 1650 36 1687 73 q 1563 0 1614 0 l 124 0 q 36 36 73 0 q 0 124 0 73 l 0 868 q 36 956 0 919 q 124 992 73 992 l 1563 992 q 1650 956 1614 992 q 1687 868 1687 919 l 1687 744 q 1757 715 1728 744 q 1786 645 1786 686 z "},"":{"ha":1786,"x_min":0,"x_max":1786,"o":"m 198 198 l 198 794 l 1190 794 l 1190 198 l 198 198 m 1687 744 q 1757 715 1728 744 q 1786 645 1786 686 l 1786 347 q 1757 277 1786 306 q 1687 248 1728 248 l 1687 124 q 1650 36 1687 73 q 1563 0 1614 0 l 124 0 q 36 36 73 0 q 0 124 0 73 l 0 868 q 36 956 0 919 q 124 992 73 992 l 1563 992 q 1650 956 1614 992 q 1687 868 1687 919 l 1687 744 m 1687 347 l 1687 645 l 1587 645 l 1587 868 q 1580 886 1587 879 q 1563 893 1573 893 l 124 893 q 106 886 113 893 q 99 868 99 879 l 99 124 q 106 106 99 113 q 124 99 113 99 l 1563 99 q 1580 106 1573 99 q 1587 124 1587 113 l 1587 347 l 1687 347 z "},"":{"ha":1786,"x_min":0,"x_max":1786,"o":"m 198 198 l 198 794 l 893 794 l 893 198 l 198 198 m 1687 744 q 1757 715 1728 744 q 1786 645 1786 686 l 1786 347 q 1757 277 1786 306 q 1687 248 1728 248 l 1687 124 q 1650 36 1687 73 q 1563 0 1614 0 l 124 0 q 36 36 73 0 q 0 124 0 73 l 0 868 q 36 956 0 919 q 124 992 73 992 l 1563 992 q 1650 956 1614 992 q 1687 868 1687 919 l 1687 744 m 1687 347 l 1687 645 l 1587 645 l 1587 868 q 1580 886 1587 879 q 1563 893 1573 893 l 124 893 q 106 886 113 893 q 99 868 99 879 l 99 124 q 106 106 99 113 q 124 99 113 99 l 1563 99 q 1580 106 1573 99 q 1587 124 1587 113 l 1587 347 l 1687 347 z "},"":{"ha":1786,"x_min":0,"x_max":1786,"o":"m 198 198 l 198 794 l 595 794 l 595 198 l 198 198 m 1687 744 q 1757 715 1728 744 q 1786 645 1786 686 l 1786 347 q 1757 277 1786 306 q 1687 248 1728 248 l 1687 124 q 1650 36 1687 73 q 1563 0 1614 0 l 124 0 q 36 36 73 0 q 0 124 0 73 l 0 868 q 36 956 0 919 q 124 992 73 992 l 1563 992 q 1650 956 1614 992 q 1687 868 1687 919 l 1687 744 m 1687 347 l 1687 645 l 1587 645 l 1587 868 q 1580 886 1587 879 q 1563 893 1573 893 l 124 893 q 106 886 113 893 q 99 868 99 879 l 99 124 q 106 106 99 113 q 124 99 113 99 l 1563 99 q 1580 106 1573 99 q 1587 124 1587 113 l 1587 347 l 1687 347 z "},"":{"ha":1786,"x_min":0,"x_max":1786,"o":"m 1687 744 q 1757 715 1728 744 q 1786 645 1786 686 l 1786 347 q 1757 277 1786 306 q 1687 248 1728 248 l 1687 124 q 1650 36 1687 73 q 1563 0 1614 0 l 124 0 q 36 36 73 0 q 0 124 0 73 l 0 868 q 36 956 0 919 q 124 992 73 992 l 1563 992 q 1650 956 1614 992 q 1687 868 1687 919 l 1687 744 m 1687 347 l 1687 645 l 1587 645 l 1587 868 q 1580 886 1587 879 q 1563 893 1573 893 l 124 893 q 106 886 113 893 q 99 868 99 879 l 99 124 q 106 106 99 113 q 124 99 113 99 l 1563 99 q 1580 106 1573 99 q 1587 124 1587 113 l 1587 347 l 1687 347 z "},"":{"ha":992,"x_min":0,"x_max":889,"o":"m 878 382 q 889 329 902 359 q 843 298 876 298 l 547 298 l 703 -71 q 703 -109 711 -91 q 677 -136 695 -128 l 539 -195 q 501 -195 520 -202 q 474 -168 483 -187 l 326 182 l 84 -60 q 50 -74 70 -74 q 31 -71 40 -74 q 0 -25 0 -57 l 0 1141 q 31 1187 0 1173 q 50 1190 40 1190 q 84 1176 71 1190 l 878 382 z "},"":{"ha":794,"x_min":0,"x_max":694,"o":"m 645 1091 q 397 918 397 1091 l 397 595 l 496 595 l 496 496 l 397 496 l 397 74 q 645 -99 397 -99 l 694 -99 l 694 -198 l 645 -198 q 347 -85 434 -198 q 50 -198 260 -198 l 0 -198 l 0 -99 l 50 -99 q 298 74 298 -99 l 298 496 l 198 496 l 198 595 l 298 595 l 298 918 q 50 1091 298 1091 l 0 1091 l 0 1190 l 50 1190 q 347 1077 260 1190 q 645 1190 434 1190 l 694 1190 l 694 1091 l 645 1091 z "},"":{"ha":1587,"x_min":0,"x_max":1587,"o":"m 1587 893 l 1488 893 l 1488 99 l 1587 99 l 1587 -198 l 1290 -198 l 1290 -99 l 298 -99 l 298 -198 l 0 -198 l 0 99 l 99 99 l 99 893 l 0 893 l 0 1190 l 298 1190 l 298 1091 l 1290 1091 l 1290 1190 l 1587 1190 l 1587 893 m 1389 1091 l 1389 992 l 1488 992 l 1488 1091 l 1389 1091 m 99 1091 l 99 992 l 198 992 l 198 1091 l 99 1091 m 198 -99 l 198 0 l 99 0 l 99 -99 l 198 -99 m 1290 0 l 1290 99 l 1389 99 l 1389 893 l 1290 893 l 1290 992 l 298 992 l 298 893 l 198 893 l 198 99 l 298 99 l 298 0 l 1290 0 m 1488 -99 l 1488 0 l 1389 0 l 1389 -99 l 1488 -99 m 992 694 l 1290 694 l 1290 99 l 595 99 l 595 298 l 298 298 l 298 893 l 992 893 l 992 694 m 397 397 l 893 397 l 893 794 l 397 794 l 397 397 m 1190 198 l 1190 595 l 992 595 l 992 298 l 694 298 l 694 198 l 1190 198 z "},"":{"ha":1786,"x_min":0,"x_max":1786,"o":"m 1786 595 l 1687 595 l 1687 99 l 1786 99 l 1786 -198 l 1488 -198 l 1488 -99 l 794 -99 l 794 -198 l 496 -198 l 496 99 l 595 99 l 595 198 l 298 198 l 298 99 l 0 99 l 0 397 l 99 397 l 99 893 l 0 893 l 0 1190 l 298 1190 l 298 1091 l 992 1091 l 992 1190 l 1290 1190 l 1290 893 l 1190 893 l 1190 794 l 1488 794 l 1488 893 l 1786 893 l 1786 595 m 1587 794 l 1587 694 l 1687 694 l 1687 794 l 1587 794 m 1091 1091 l 1091 992 l 1190 992 l 1190 1091 l 1091 1091 m 99 1091 l 99 992 l 198 992 l 198 1091 l 99 1091 m 198 198 l 198 298 l 99 298 l 99 198 l 198 198 m 1190 298 l 1091 298 l 1091 198 l 1190 198 l 1190 298 m 298 298 l 992 298 l 992 397 l 1091 397 l 1091 893 l 992 893 l 992 992 l 298 992 l 298 893 l 198 893 l 198 397 l 298 397 l 298 298 m 694 -99 l 694 0 l 595 0 l 595 -99 l 694 -99 m 1687 -99 l 1687 0 l 1587 0 l 1587 -99 l 1687 -99 m 1587 99 l 1587 595 l 1488 595 l 1488 694 l 1190 694 l 1190 397 l 1290 397 l 1290 99 l 992 99 l 992 198 l 694 198 l 694 99 l 794 99 l 794 0 l 1488 0 l 1488 99 l 1587 99 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 794 223 l 794 -99 l 74 -99 q 22 -78 43 -99 q 0 -25 0 -56 l 0 1017 q 22 1070 0 1048 q 74 1091 43 1091 l 1116 1091 q 1169 1070 1147 1091 q 1190 1017 1190 1048 l 1190 298 l 868 298 q 815 276 837 298 q 794 223 794 254 m 893 198 l 1188 198 q 1138 96 1177 135 l 995 -47 q 893 -97 956 -85 l 893 198 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 1085 198 l 893 198 l 893 6 q 925 23 915 14 l 1068 167 q 1085 198 1077 176 m 868 298 l 1091 298 l 1091 992 l 99 992 l 99 0 l 794 0 l 794 223 q 815 276 794 254 q 868 298 837 298 m 1190 1017 l 1190 223 q 1175 155 1190 192 q 1138 96 1159 118 l 995 -47 q 936 -84 973 -68 q 868 -99 899 -99 l 74 -99 q 22 -78 43 -99 q 0 -25 0 -56 l 0 1017 q 22 1070 0 1048 q 74 1091 43 1091 l 1116 1091 q 1169 1070 1147 1091 q 1190 1017 1190 1048 z "},"":{"ha":1786,"x_min":0,"x_max":1786,"o":"m 1500 451 q 1506 444 1500 451 q 1512 417 1512 437 q 1500 382 1512 397 q 1470 364 1488 368 q 1456 363 1464 363 l 1338 363 l 1338 471 l 1456 471 q 1470 470 1464 471 q 1500 451 1488 466 m 1487 615 q 1492 608 1487 615 q 1498 582 1498 601 q 1487 550 1498 563 q 1457 533 1475 536 q 1445 532 1455 532 l 1338 532 l 1338 632 l 1445 632 q 1452 632 1448 632 q 1457 632 1456 632 q 1487 615 1475 629 m 564 455 l 564 694 l 388 694 l 388 455 q 358 382 388 410 q 277 353 329 353 q 99 399 193 353 l 99 312 q 193 295 140 301 q 277 288 246 288 l 310 287 q 564 455 564 287 m 1118 312 l 1118 400 q 963 354 1041 360 q 832 386 879 348 q 784 496 784 424 q 832 606 784 568 q 963 638 879 644 q 1118 593 1041 632 l 1118 680 q 1040 695 1080 689 q 978 702 1000 701 l 956 704 q 787 693 858 708 q 678 646 716 677 q 623 578 640 615 q 606 496 606 541 q 623 414 606 451 q 678 346 640 377 q 787 299 716 315 q 956 288 858 284 q 1118 312 1035 291 m 1687 401 q 1653 470 1687 443 q 1569 501 1620 497 l 1569 503 q 1638 535 1613 509 q 1662 597 1662 561 q 1631 665 1662 639 q 1548 693 1599 691 q 1538 693 1545 693 q 1528 694 1531 694 l 1175 694 l 1175 298 l 1556 298 q 1650 327 1613 298 q 1687 401 1687 355 m 1786 992 l 1786 0 q 1756 -70 1786 -40 q 1687 -99 1727 -99 l 99 -99 q 29 -70 59 -99 q 0 0 0 -40 l 0 992 q 29 1062 0 1032 q 99 1091 59 1091 l 1687 1091 q 1756 1062 1727 1091 q 1786 992 1786 1032 z "},"":{"ha":1786,"x_min":0,"x_max":1786,"o":"m 665 229 l 665 766 q 532 661 583 734 q 481 497 481 587 q 532 333 481 406 q 665 229 583 260 m 1004 333 q 1030 370 1004 333 q 1056 497 1056 406 q 1004 661 1056 587 q 871 766 953 734 l 871 228 q 1004 333 953 260 m 1161 725 q 1192 672 1161 725 q 1222 497 1222 620 q 1161 269 1222 374 q 996 103 1101 164 q 768 43 891 43 q 592 79 676 43 q 447 176 508 115 q 350 320 386 236 q 314 497 314 405 q 375 725 314 620 q 540 890 436 829 q 768 951 645 951 q 996 890 891 951 q 1161 725 1101 829 m 1519 491 q 1476 694 1519 599 q 1362 853 1433 789 q 1196 955 1290 918 q 1001 992 1102 992 l 767 992 q 517 929 631 992 q 334 751 402 867 q 267 491 267 636 q 334 245 267 359 q 517 66 401 132 q 767 0 632 0 l 1001 0 q 1196 39 1101 0 q 1362 144 1290 78 q 1476 301 1433 209 q 1519 491 1519 392 m 1786 992 l 1786 0 q 1756 -70 1786 -40 q 1687 -99 1727 -99 l 99 -99 q 29 -70 59 -99 q 0 0 0 -40 l 0 992 q 29 1062 0 1032 q 99 1091 59 1091 l 1687 1091 q 1756 1062 1727 1091 q 1786 992 1786 1032 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 1290 -74 l 1290 769 q 1282 786 1290 779 q 1265 794 1275 794 l 422 794 q 404 786 412 794 q 397 769 397 779 l 397 -74 q 404 -92 397 -84 q 422 -99 412 -99 l 1265 -99 q 1282 -92 1275 -99 q 1290 -74 1290 -84 m 1389 769 l 1389 -74 q 1352 -162 1389 -126 q 1265 -198 1316 -198 l 422 -198 q 334 -162 370 -198 q 298 -74 298 -126 l 298 769 q 334 856 298 820 q 422 893 370 893 l 1265 893 q 1352 856 1316 893 q 1389 769 1389 820 m 1091 1066 l 1091 942 l 992 942 l 992 1066 q 985 1084 992 1077 q 967 1091 977 1091 l 124 1091 q 107 1084 114 1091 q 99 1066 99 1077 l 99 223 q 107 206 99 213 q 124 198 114 198 l 248 198 l 248 99 l 124 99 q 36 136 73 99 q 0 223 0 172 l 0 1066 q 36 1154 0 1118 q 124 1190 73 1190 l 967 1190 q 1055 1154 1018 1190 q 1091 1066 1091 1118 z "},"":{"ha":1786,"x_min":0,"x_max":1687,"o":"m 1339 843 l 1042 298 l 1637 298 l 1339 843 m 347 843 l 50 298 l 645 298 l 347 843 m 984 992 q 948 937 973 961 q 893 901 924 912 l 893 -99 l 1364 -99 q 1382 -106 1375 -99 q 1389 -124 1389 -113 l 1389 -174 q 1382 -191 1389 -184 q 1364 -198 1375 -198 l 322 -198 q 305 -191 312 -198 q 298 -174 298 -184 l 298 -124 q 305 -106 298 -113 q 322 -99 312 -99 l 794 -99 l 794 901 q 738 937 763 912 q 703 992 714 961 l 322 992 q 305 999 312 992 q 298 1017 298 1006 l 298 1066 q 305 1084 298 1077 q 322 1091 312 1091 l 703 1091 q 757 1163 719 1135 q 843 1190 795 1190 q 929 1163 891 1190 q 984 1091 967 1135 l 1364 1091 q 1382 1084 1375 1091 q 1389 1066 1389 1077 l 1389 1017 q 1382 999 1389 1006 q 1364 992 1375 992 l 984 992 m 799 998 q 809 989 799 998 q 843 980 818 980 q 887 998 869 980 q 905 1042 905 1016 q 887 1085 905 1067 q 843 1104 869 1104 q 799 1085 818 1104 q 781 1042 781 1067 q 799 998 781 1016 m 1687 298 q 1650 196 1687 241 q 1559 126 1614 151 q 1447 87 1504 100 q 1339 74 1390 74 q 1231 87 1288 74 q 1119 126 1174 100 q 1028 196 1064 151 q 992 298 992 241 q 1019 360 992 306 q 1090 496 1046 415 q 1173 647 1135 577 q 1252 790 1212 718 q 1296 867 1293 862 q 1339 893 1310 893 q 1383 867 1369 893 q 1426 790 1386 862 q 1505 647 1466 718 q 1588 496 1544 577 q 1659 360 1632 415 q 1687 298 1687 306 m 694 298 q 658 196 694 241 q 567 126 622 151 q 455 87 512 100 q 347 74 398 74 q 239 87 296 74 q 127 126 182 100 q 36 196 72 151 q 0 298 0 241 q 27 360 0 306 q 98 496 54 415 q 181 647 143 577 q 260 790 220 718 q 304 867 301 862 q 347 893 318 893 q 391 867 377 893 q 434 790 394 862 q 513 647 474 718 q 596 496 552 577 q 667 360 640 415 q 694 298 694 306 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 1091 1091 q 1009 734 1091 889 q 802 496 926 578 q 1009 258 926 414 q 1091 -99 1091 103 l 1166 -99 q 1184 -106 1177 -99 q 1190 -124 1190 -113 l 1190 -174 q 1184 -191 1190 -184 q 1166 -198 1177 -198 l 25 -198 q 7 -191 14 -198 q 0 -174 0 -184 l 0 -124 q 7 -106 0 -113 q 25 -99 14 -99 l 99 -99 q 182 258 99 103 q 388 496 264 414 q 182 734 264 578 q 99 1091 99 889 l 25 1091 q 7 1098 14 1091 q 0 1116 0 1105 l 0 1166 q 7 1184 0 1177 q 25 1190 14 1190 l 1166 1190 q 1184 1184 1177 1190 q 1190 1166 1190 1177 l 1190 1116 q 1184 1098 1190 1105 q 1166 1091 1177 1091 l 1091 1091 m 677 543 q 793 614 737 565 q 893 732 849 663 q 965 895 938 801 q 992 1091 992 989 l 198 1091 q 226 895 198 989 q 297 732 253 801 q 398 614 342 663 q 513 543 453 565 q 537 524 528 537 q 546 496 546 512 q 537 468 546 481 q 513 450 528 455 q 398 378 453 427 q 297 260 342 329 q 226 97 253 191 q 198 -99 198 3 l 992 -99 q 965 97 992 3 q 893 260 938 191 q 793 378 849 329 q 677 450 737 427 q 654 468 663 455 q 645 496 645 481 q 654 524 645 512 q 677 543 663 537 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 1091 1091 q 1009 734 1091 889 q 802 496 926 578 q 1009 258 926 414 q 1091 -99 1091 103 l 1166 -99 q 1184 -106 1177 -99 q 1190 -124 1190 -113 l 1190 -174 q 1184 -191 1190 -184 q 1166 -198 1177 -198 l 25 -198 q 7 -191 14 -198 q 0 -174 0 -184 l 0 -124 q 7 -106 0 -113 q 25 -99 14 -99 l 99 -99 q 182 258 99 103 q 388 496 264 414 q 182 734 264 578 q 99 1091 99 889 l 25 1091 q 7 1098 14 1091 q 0 1116 0 1105 l 0 1166 q 7 1184 0 1177 q 25 1190 14 1190 l 1166 1190 q 1184 1184 1177 1190 q 1190 1166 1190 1177 l 1190 1116 q 1184 1098 1190 1105 q 1166 1091 1177 1091 l 1091 1091 m 992 1091 l 198 1091 q 205 992 198 1040 l 985 992 q 992 1091 992 1039 m 992 -99 q 966 94 992 2 q 896 255 939 187 q 798 373 852 324 q 684 446 743 422 l 506 446 q 393 373 447 422 q 295 255 339 324 q 225 94 251 187 q 198 -99 198 2 l 992 -99 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 1091 1091 q 1009 734 1091 889 q 802 496 926 578 q 1009 258 926 414 q 1091 -99 1091 103 l 1166 -99 q 1184 -106 1177 -99 q 1190 -124 1190 -113 l 1190 -174 q 1184 -191 1190 -184 q 1166 -198 1177 -198 l 25 -198 q 7 -191 14 -198 q 0 -174 0 -184 l 0 -124 q 7 -106 0 -113 q 25 -99 14 -99 l 99 -99 q 182 258 99 103 q 388 496 264 414 q 182 734 264 578 q 99 1091 99 889 l 25 1091 q 7 1098 14 1091 q 0 1116 0 1105 l 0 1166 q 7 1184 0 1177 q 25 1190 14 1190 l 1166 1190 q 1184 1184 1177 1190 q 1190 1166 1190 1177 l 1190 1116 q 1184 1098 1190 1105 q 1166 1091 1177 1091 l 1091 1091 m 992 1091 l 198 1091 q 264 794 198 932 l 926 794 q 992 1091 992 932 m 948 149 q 835 336 906 258 q 684 446 764 414 l 506 446 q 355 336 426 414 q 243 149 284 258 l 948 149 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 1091 1091 q 1009 734 1091 889 q 802 496 926 578 q 1009 258 926 414 q 1091 -99 1091 103 l 1166 -99 q 1184 -106 1177 -99 q 1190 -124 1190 -113 l 1190 -174 q 1184 -191 1190 -184 q 1166 -198 1177 -198 l 25 -198 q 7 -191 14 -198 q 0 -174 0 -184 l 0 -124 q 7 -106 0 -113 q 25 -99 14 -99 l 99 -99 q 182 258 99 103 q 388 496 264 414 q 182 734 264 578 q 99 1091 99 889 l 25 1091 q 7 1098 14 1091 q 0 1116 0 1105 l 0 1166 q 7 1184 0 1177 q 25 1190 14 1190 l 1166 1190 q 1184 1184 1177 1190 q 1190 1166 1190 1177 l 1190 1116 q 1184 1098 1190 1105 q 1166 1091 1177 1091 l 1091 1091 m 677 543 q 793 614 737 565 q 893 732 849 663 q 965 895 938 801 q 992 1091 992 989 l 198 1091 q 226 895 198 989 q 297 732 253 801 q 398 614 342 663 q 513 543 453 565 q 537 524 528 537 q 546 496 546 512 q 537 468 546 481 q 513 450 528 455 q 324 298 407 410 l 867 298 q 677 450 784 410 q 654 468 663 455 q 645 496 645 481 q 654 524 645 512 q 677 543 663 537 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 1166 -50 q 1184 -57 1177 -50 q 1190 -74 1190 -64 l 1190 -174 q 1184 -191 1190 -184 q 1166 -198 1177 -198 l 25 -198 q 7 -191 14 -198 q 0 -174 0 -184 l 0 -74 q 7 -57 0 -64 q 25 -50 14 -50 l 1166 -50 m 101 0 q 113 83 103 43 q 136 157 123 123 q 172 224 150 190 q 214 283 195 258 q 264 337 233 308 q 315 383 295 366 q 369 426 335 401 q 421 463 404 451 q 471 496 438 474 q 421 529 438 518 q 369 566 404 541 q 315 609 335 591 q 264 655 295 626 q 214 709 233 684 q 172 768 195 734 q 136 836 150 802 q 113 909 123 869 q 101 992 103 949 l 1090 992 q 1077 909 1087 949 q 1054 836 1067 869 q 1018 768 1041 802 q 977 709 996 734 q 927 655 958 684 q 876 609 896 626 q 821 566 856 591 q 770 529 787 541 q 719 496 753 518 q 770 463 753 474 q 821 426 787 451 q 876 383 856 401 q 927 337 896 366 q 977 283 958 308 q 1018 224 996 258 q 1054 157 1041 190 q 1077 83 1067 123 q 1090 0 1087 43 l 101 0 m 1166 1190 q 1184 1184 1177 1190 q 1190 1166 1190 1177 l 1190 1066 q 1184 1049 1190 1056 q 1166 1042 1177 1042 l 25 1042 q 7 1049 14 1042 q 0 1066 0 1056 l 0 1166 q 7 1184 0 1177 q 25 1190 14 1190 l 1166 1190 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 595 893 q 525 864 554 893 q 496 794 496 835 l 496 694 l 471 694 l 471 767 q 446 830 471 804 q 384 856 422 856 q 323 830 349 856 q 298 769 298 805 l 298 436 l 273 460 l 273 593 q 248 656 273 630 q 186 682 223 682 q 125 656 150 682 q 99 595 99 631 l 99 422 q 126 358 99 385 l 367 129 q 397 50 397 98 q 412 15 397 29 q 446 0 426 0 l 942 0 q 977 15 963 0 q 992 50 992 29 l 992 69 q 1000 129 992 101 l 1084 467 q 1091 526 1091 494 l 1091 717 q 1066 780 1091 754 q 1004 806 1042 806 q 943 780 969 806 q 918 719 918 755 l 918 694 l 893 694 l 893 791 q 873 848 893 822 q 824 879 854 873 q 806 880 813 880 q 745 855 770 880 q 719 794 719 829 l 719 694 l 694 694 l 694 789 q 669 858 694 829 q 605 892 644 888 q 595 893 601 893 m 595 992 q 711 953 660 992 q 806 980 755 980 q 892 959 852 980 q 959 900 932 938 q 1004 905 980 905 q 1136 850 1082 905 q 1190 717 1190 794 l 1190 526 q 1180 443 1190 487 l 1096 105 q 1091 50 1091 86 q 1048 -56 1091 -12 q 942 -99 1004 -99 l 446 -99 q 339 -54 381 -99 q 298 57 298 -9 l 59 286 q 0 422 0 343 l 0 595 q 55 727 0 672 q 186 781 109 781 q 198 780 195 781 q 257 904 203 854 q 384 955 311 955 q 460 939 425 955 q 595 992 516 992 z "},"":{"ha":1389,"x_min":0,"x_max":1265,"o":"m 743 1066 q 730 1078 743 1066 q 682 1091 718 1091 q 621 1066 646 1091 q 595 1004 595 1040 l 595 496 l 570 496 l 570 905 q 545 966 570 941 q 484 992 519 992 q 422 966 448 992 q 397 905 397 941 l 397 496 l 397 298 l 277 457 q 198 496 248 496 q 128 467 157 496 q 99 397 99 438 q 119 337 99 363 l 417 -60 q 496 -99 446 -99 l 1029 -99 q 1077 -82 1056 -99 q 1103 -39 1097 -65 l 1162 275 q 1166 321 1166 300 l 1166 707 q 1140 768 1166 742 q 1079 794 1115 794 q 1018 768 1043 794 q 992 707 992 742 l 992 496 l 967 496 l 967 905 q 942 966 967 941 q 880 992 916 992 q 819 966 845 992 q 794 905 794 941 l 794 496 l 769 496 l 769 1004 q 743 1066 769 1040 m 585 1163 q 607 1177 585 1163 q 682 1190 629 1190 q 779 1163 735 1190 q 848 1088 824 1135 q 880 1091 863 1091 q 1012 1037 957 1091 q 1066 905 1066 982 l 1066 892 q 1206 842 1148 897 q 1265 707 1265 788 l 1265 321 q 1259 257 1265 290 l 1200 -57 q 1140 -158 1189 -118 q 1029 -198 1092 -198 l 496 -198 q 407 -177 450 -198 q 337 -119 365 -156 l 40 277 q 0 397 0 330 q 58 537 0 479 q 198 595 116 595 q 298 569 259 595 l 298 905 q 352 1037 298 982 q 484 1091 407 1091 q 516 1088 501 1091 q 585 1163 540 1135 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 832 -99 l 694 -99 q 519 10 568 -99 q 501 89 501 48 l 501 93 q 425 162 453 116 q 397 260 397 207 q 401 298 397 290 l 198 298 q 58 356 116 298 q 0 496 0 414 q 58 636 0 578 q 198 694 116 694 l 286 694 l 252 708 q 159 780 195 729 q 124 893 124 831 q 182 1033 124 975 q 322 1091 240 1091 q 393 1078 358 1091 l 880 893 l 1190 893 q 1331 835 1273 893 q 1389 694 1389 777 l 1389 177 q 1347 55 1389 109 q 1239 -16 1305 1 l 976 -81 q 832 -99 904 -99 m 794 452 l 674 397 l 547 339 q 510 307 524 329 q 496 260 496 286 q 522 199 496 225 q 583 174 547 174 q 618 181 603 174 l 880 301 q 818 339 842 308 q 794 409 794 370 l 794 452 m 1042 211 q 1016 272 1042 246 q 955 298 991 298 q 919 290 935 298 l 694 188 q 666 174 673 177 q 642 161 659 171 q 619 143 625 151 q 607 121 613 135 q 601 89 601 106 q 625 26 601 50 q 688 1 649 1 q 718 8 704 1 l 991 132 q 1028 164 1014 143 q 1042 211 1042 185 m 862 794 l 358 986 q 322 992 339 992 q 252 963 281 992 q 223 893 223 934 q 241 836 223 862 q 287 800 258 811 l 694 645 l 694 595 l 198 595 q 128 566 157 595 q 99 496 99 537 q 128 426 99 455 q 198 397 157 397 l 613 397 l 794 479 l 794 632 q 829 715 794 681 l 915 794 l 862 794 m 832 0 q 952 15 895 0 l 1215 81 q 1269 116 1248 89 q 1290 177 1290 143 l 1290 694 q 1261 765 1290 736 q 1190 794 1232 794 l 952 794 l 846 696 q 818 632 818 670 l 818 403 q 844 343 818 367 q 905 319 870 319 q 966 346 941 319 q 992 409 992 374 l 992 570 l 1017 570 l 1017 409 q 973 321 1017 355 q 1040 283 1013 315 q 1066 211 1066 252 q 1049 150 1066 178 q 1001 109 1031 122 l 761 0 l 832 0 z "},"":{"ha":1587,"x_min":0,"x_max":1587,"o":"m 892 1190 q 982 1169 939 1190 q 1053 1109 1025 1147 l 1496 504 q 1587 226 1587 381 l 1587 -50 q 1544 -155 1587 -112 q 1438 -198 1500 -198 l 1141 -198 q 1035 -155 1079 -198 q 992 -50 992 -112 l 992 88 l 770 198 l 347 198 q 242 242 285 198 q 198 347 198 285 l 198 372 q 264 530 198 464 q 422 595 329 595 l 747 595 l 780 694 l 248 694 q 114 747 171 694 q 50 876 57 799 q 0 1017 0 937 l 0 1042 q 43 1147 0 1104 q 149 1190 87 1190 l 892 1190 m 1488 -50 l 1488 226 q 1416 446 1488 347 l 972 1051 q 892 1091 942 1091 l 149 1091 q 114 1077 129 1091 q 99 1042 99 1062 q 100 1003 99 1017 q 108 972 102 990 q 127 939 114 954 q 155 977 135 963 q 198 992 174 992 l 843 992 l 843 967 l 198 967 q 164 953 178 967 q 149 918 149 938 q 151 873 149 884 q 185 816 157 839 q 248 794 213 794 l 744 794 l 815 794 q 867 772 846 794 q 889 719 889 750 q 885 696 889 708 l 836 547 q 808 510 828 525 q 765 496 789 496 l 422 496 q 334 460 370 496 q 298 372 298 423 l 298 347 q 312 312 298 327 q 347 298 327 298 l 782 298 q 805 292 794 298 l 1050 170 q 1080 142 1069 160 q 1091 103 1091 124 l 1091 -50 q 1106 -84 1091 -70 q 1141 -99 1121 -99 l 1438 -99 q 1473 -84 1459 -99 q 1488 -50 1488 -70 z "},"":{"ha":1587,"x_min":0,"x_max":1488,"o":"m 356 -198 q 249 -162 296 -198 q 188 -67 202 -125 l 109 244 q 99 328 99 288 q 95 380 99 363 l 5 749 q 0 794 0 770 q 48 918 0 866 q 168 979 96 971 q 232 1087 181 1045 q 350 1128 283 1128 q 465 1089 415 1128 q 531 986 515 1049 l 595 716 l 675 1048 q 741 1151 691 1111 q 856 1190 791 1190 q 976 1146 925 1190 q 1039 1034 1028 1101 q 1156 973 1110 1026 q 1203 847 1203 919 q 1197 801 1203 829 l 1102 405 q 1131 427 1110 410 q 1161 450 1152 443 q 1188 467 1170 456 q 1220 483 1207 479 q 1252 492 1233 488 q 1290 496 1271 496 q 1430 439 1372 496 q 1488 300 1488 381 q 1466 208 1488 252 q 1405 136 1444 165 l 1012 -159 q 894 -198 960 -198 l 356 -198 m 856 1091 q 803 1073 826 1091 q 772 1025 779 1054 l 645 496 l 546 496 l 434 963 q 403 1011 427 992 q 350 1029 380 1029 q 288 1004 313 1029 q 264 942 264 978 q 266 920 264 930 l 368 496 l 348 496 l 271 812 q 240 861 264 841 q 187 880 216 880 q 125 855 150 880 q 99 794 99 829 q 102 773 99 783 l 191 403 q 198 336 197 381 q 206 268 200 291 l 284 -43 q 310 -83 290 -67 q 356 -99 330 -99 l 894 -99 q 953 -79 926 -99 l 1345 215 q 1389 300 1389 248 q 1360 369 1389 340 q 1290 397 1331 397 q 1231 377 1257 397 l 993 198 l 993 374 q 1018 481 993 377 q 1070 700 1042 585 q 1101 825 1098 815 q 1104 847 1104 839 q 1079 910 1104 884 q 1018 936 1054 936 q 964 918 987 936 q 933 870 940 899 l 843 496 l 823 496 l 939 980 q 942 1001 942 991 q 917 1065 942 1039 q 856 1091 893 1091 z "},"":{"ha":1389,"x_min":0,"x_max":1290,"o":"m 496 1091 q 426 1062 455 1091 q 397 992 397 1033 l 397 595 l 397 298 l 280 454 q 197 496 248 496 q 128 467 157 496 q 99 397 99 437 q 119 337 99 363 l 417 -60 q 496 -99 446 -99 l 1053 -99 q 1083 -89 1070 -99 q 1101 -62 1097 -78 l 1172 223 q 1190 374 1190 298 l 1190 542 q 1169 597 1190 574 q 1116 620 1147 620 q 1063 598 1085 620 q 1042 546 1042 577 l 1017 546 l 1017 593 q 992 656 1017 630 q 930 682 967 682 q 869 656 894 682 q 843 595 843 631 l 843 546 l 818 546 l 818 615 q 790 689 818 658 q 719 719 761 719 q 649 690 678 719 q 620 620 620 661 l 620 546 l 595 546 l 595 987 q 567 1061 595 1030 q 496 1091 538 1091 m 496 1190 q 637 1130 579 1190 q 694 987 694 1070 l 694 817 q 719 818 711 818 q 853 765 796 818 q 930 781 890 781 q 1073 714 1018 781 q 1116 719 1094 719 q 1239 667 1189 719 q 1290 542 1290 615 l 1290 374 q 1268 199 1290 284 l 1197 -86 q 1144 -167 1184 -136 q 1053 -198 1104 -198 l 496 -198 q 407 -177 450 -198 q 337 -119 365 -156 l 40 277 q 0 397 0 330 q 58 537 0 478 q 197 595 115 595 q 298 568 252 595 l 298 992 q 356 1132 298 1074 q 496 1190 414 1190 m 595 99 l 595 397 l 570 397 l 570 99 l 595 99 m 794 99 l 794 397 l 769 397 l 769 99 l 794 99 m 992 99 l 992 397 l 967 397 l 967 99 l 992 99 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 998 689 q 1081 671 1045 689 q 1190 496 1190 622 l 1190 359 q 1173 215 1190 286 l 1107 -48 q 1037 -157 1090 -115 q 915 -198 983 -198 l 397 -198 q 257 -140 315 -198 q 198 0 198 -82 l 198 311 l 13 798 q 0 868 0 832 q 58 1008 0 950 q 198 1066 116 1066 q 311 1031 260 1066 q 384 939 362 996 l 397 904 l 397 992 q 455 1132 397 1074 q 595 1190 513 1190 q 736 1132 677 1190 q 794 992 794 1074 l 794 790 q 831 794 815 794 q 930 765 884 794 q 998 689 975 737 m 831 694 q 784 680 805 694 q 752 643 763 667 l 694 517 l 639 397 l 682 397 q 752 372 721 397 q 791 310 783 348 l 910 572 q 918 608 918 587 q 892 669 918 643 q 831 694 867 694 m 1002 590 q 971 584 985 590 q 948 571 956 577 q 930 548 940 565 q 917 525 920 532 q 904 496 914 518 l 801 271 q 794 236 794 256 q 819 174 794 200 q 880 149 845 149 q 927 163 906 149 q 960 200 949 177 l 1084 473 q 1090 502 1090 487 q 1066 565 1090 541 q 1002 590 1041 590 m 99 868 q 105 832 99 851 l 298 329 l 298 275 l 377 361 q 459 397 410 397 l 612 397 l 694 577 l 694 992 q 665 1062 694 1033 q 595 1091 636 1091 q 525 1062 554 1091 q 496 992 496 1033 l 496 496 l 446 496 l 291 904 q 255 950 281 932 q 198 967 229 967 q 128 938 157 967 q 99 868 99 909 m 915 -99 q 975 -78 949 -99 q 1011 -24 1002 -57 l 1077 239 q 1091 359 1091 295 l 1091 429 l 982 189 q 941 142 969 160 q 880 124 913 124 q 808 151 839 124 q 770 218 777 177 q 682 174 736 174 l 521 174 l 521 198 l 682 198 q 745 224 718 198 q 772 285 772 250 q 748 346 772 321 q 688 372 724 372 l 459 372 q 395 344 421 372 l 298 239 l 298 0 q 327 -70 298 -41 q 397 -99 356 -99 l 915 -99 z "},"":{"ha":1529,"x_min":0,"x_max":1528,"o":"m 664 769 l 664 678 q 657 661 664 668 q 639 654 649 654 l 408 654 l 408 25 q 401 7 408 15 q 384 0 395 0 l 280 0 q 262 7 270 0 q 255 25 255 14 l 255 654 l 25 654 q 7 661 15 654 q 0 678 0 668 l 0 769 q 7 787 0 780 q 25 794 14 794 l 639 794 q 657 786 649 794 q 664 769 664 779 m 1469 771 l 1528 26 q 1522 8 1529 16 q 1504 0 1514 0 l 1401 0 q 1384 7 1391 0 q 1376 22 1377 13 l 1341 478 l 1194 149 q 1172 134 1188 134 l 1079 134 q 1056 149 1063 134 l 911 480 l 876 22 q 868 7 875 13 q 852 0 861 0 l 747 0 q 729 8 737 0 q 722 26 722 16 l 783 771 q 791 787 784 780 q 807 794 798 794 l 917 794 q 939 779 932 794 l 1110 376 q 1125 336 1118 357 q 1133 355 1128 342 q 1141 376 1138 369 l 1312 779 q 1335 794 1319 794 l 1444 794 q 1461 787 1454 794 q 1469 771 1468 780 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 808 646 q 761 739 808 714 q 670 753 736 753 l 575 753 l 575 536 l 701 536 q 780 564 752 536 q 808 646 808 593 m 848 425 l 1007 136 q 1006 112 1013 122 q 985 99 1000 99 l 867 99 q 846 112 852 99 l 695 395 l 575 395 l 575 124 q 568 106 575 113 q 550 99 561 99 l 446 99 q 429 106 436 99 q 422 124 422 113 l 422 868 q 429 886 422 879 q 446 893 436 893 l 674 893 q 822 874 773 893 q 925 790 887 850 q 963 650 963 729 q 930 522 963 579 q 841 437 898 465 q 848 425 846 429 m 916 1021 q 863 1044 916 1021 q 694 1066 811 1066 q 473 1021 578 1066 q 291 899 367 976 q 169 718 215 823 q 124 496 124 612 q 169 274 124 380 q 291 93 215 169 q 473 -29 367 16 q 694 -74 578 -74 q 916 -29 811 -74 q 1098 93 1022 16 q 1220 274 1174 169 q 1265 496 1265 380 q 1220 718 1265 612 q 1098 899 1174 823 q 916 1021 1022 976 m 1334 766 q 1361 701 1334 766 q 1389 496 1389 637 q 1334 226 1389 355 q 1186 5 1279 98 q 964 -143 1093 -88 q 694 -198 836 -198 q 425 -143 553 -198 q 203 5 296 -88 q 55 226 110 98 q 0 496 0 355 q 55 766 0 637 q 203 987 110 894 q 425 1135 296 1080 q 694 1190 553 1190 q 964 1135 836 1190 q 1186 987 1093 1080 q 1334 766 1279 894 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 469 235 q 668 315 587 235 q 670 343 679 329 l 636 407 q 617 420 631 417 q 596 412 605 422 l 593 409 q 584 401 590 406 q 570 391 578 397 q 552 380 563 385 q 530 370 542 374 q 504 362 519 365 q 475 360 490 360 q 378 398 416 360 q 340 497 340 437 q 377 594 340 556 q 472 632 415 632 q 527 622 501 632 q 567 600 554 611 l 579 589 q 599 581 587 581 q 618 592 612 583 l 659 653 q 657 683 669 668 q 649 692 655 686 q 625 710 643 698 q 588 732 608 722 q 536 749 567 742 q 469 757 504 757 q 278 682 354 757 q 202 496 202 608 q 277 309 202 383 q 469 235 353 235 m 957 235 q 1156 315 1076 235 q 1159 343 1167 329 l 1125 407 q 1105 420 1118 418 q 1084 412 1093 422 l 1081 409 q 1072 401 1078 406 q 1059 391 1066 397 q 1041 380 1051 385 q 1018 370 1030 374 q 992 362 1007 365 q 963 360 978 360 q 867 398 904 360 q 829 497 829 437 q 866 594 829 556 q 960 632 903 632 q 1016 622 989 632 q 1055 600 1042 611 l 1067 589 q 1087 581 1076 581 q 1106 592 1100 583 l 1147 653 q 1146 683 1157 668 q 1137 692 1143 686 q 1114 710 1131 698 q 1076 732 1097 722 q 1024 749 1056 742 q 957 757 992 757 q 767 682 843 757 q 691 496 691 608 q 766 309 691 383 q 957 235 841 235 m 916 1021 q 863 1044 916 1021 q 694 1066 811 1066 q 473 1021 578 1066 q 291 899 367 976 q 169 718 215 823 q 124 496 124 612 q 169 274 124 380 q 291 93 215 169 q 473 -29 367 16 q 694 -74 578 -74 q 916 -29 811 -74 q 1098 93 1022 16 q 1220 274 1174 169 q 1265 496 1265 380 q 1220 718 1265 612 q 1098 899 1174 823 q 916 1021 1022 976 m 425 1135 q 489 1163 425 1135 q 694 1190 553 1190 q 964 1135 836 1190 q 1186 987 1093 1080 q 1334 766 1279 894 q 1389 496 1389 637 q 1334 226 1389 355 q 1186 5 1279 98 q 964 -143 1093 -88 q 694 -198 836 -198 q 425 -143 553 -198 q 203 5 296 -88 q 55 226 110 98 q 0 496 0 355 q 55 766 0 637 q 203 987 110 894 q 425 1135 296 1080 z "},"":{"ha":1587,"x_min":50,"x_max":1538,"o":"m 570 570 l 868 273 l 570 -25 l 50 496 l 570 1017 l 701 887 l 626 812 l 570 868 l 198 496 l 570 124 l 720 274 l 496 496 l 570 570 m 1017 1017 l 1538 496 l 1017 -25 l 887 105 l 961 180 l 1017 124 l 1389 496 l 1017 868 l 867 718 l 1091 496 l 1017 422 l 719 719 l 1017 1017 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 556 141 l 766 351 l 550 567 l 481 499 l 630 351 l 556 277 l 339 493 l 556 709 l 587 678 l 654 746 l 556 845 l 204 493 l 556 141 m 833 147 l 1185 499 l 833 851 l 623 641 l 839 425 l 908 493 l 759 641 l 833 715 l 1049 499 l 833 283 l 802 314 l 735 246 l 833 147 m 1334 766 q 1361 701 1334 766 q 1389 496 1389 637 q 1334 226 1389 355 q 1186 5 1279 98 q 964 -143 1093 -88 q 694 -198 836 -198 q 425 -143 553 -198 q 203 5 296 -88 q 55 226 110 98 q 0 496 0 355 q 55 766 0 637 q 203 987 110 894 q 425 1135 296 1080 q 694 1190 553 1190 q 964 1135 836 1190 q 1186 987 1093 1080 q 1334 766 1279 894 z "},"":{"ha":1786,"x_min":0,"x_max":1786,"o":"m 505 418 q 483 366 505 388 q 432 345 462 345 q 381 366 402 345 q 360 418 360 388 q 381 469 360 447 q 432 490 402 490 q 483 469 462 490 q 505 418 505 447 m 1378 470 q 1388 459 1378 470 q 1399 419 1399 449 q 1378 367 1399 388 q 1326 346 1356 346 q 1275 367 1296 346 q 1253 419 1253 388 q 1275 470 1253 449 q 1326 491 1296 491 q 1378 470 1356 491 m 593 418 q 549 523 593 479 q 443 567 505 567 q 338 524 381 567 q 294 418 294 480 q 338 312 294 356 q 443 268 381 268 q 549 312 505 268 q 593 418 593 356 m 1443 313 q 1465 335 1443 313 q 1487 419 1487 357 q 1443 524 1487 481 q 1337 568 1399 568 q 1232 524 1276 568 q 1187 419 1187 481 q 1231 313 1187 357 q 1337 269 1275 269 q 1443 313 1399 269 m 659 418 q 596 265 659 328 q 443 202 532 202 q 290 265 353 202 q 227 418 227 329 q 291 570 227 507 q 443 633 354 633 q 596 570 532 633 q 659 418 659 507 m 1490 571 q 1522 539 1490 571 q 1553 419 1553 508 q 1490 266 1553 329 q 1337 203 1427 203 q 1185 266 1248 203 q 1121 419 1121 329 q 1185 571 1121 508 q 1337 634 1248 634 q 1490 571 1427 634 m 701 163 q 754 216 701 163 q 806 416 806 268 q 701 669 806 564 q 448 774 596 774 q 269 726 351 774 q 139 596 187 678 q 91 416 91 513 q 139 237 91 319 q 269 106 187 154 q 448 58 351 58 q 701 163 596 58 m 1324 860 q 893 946 1127 946 q 449 861 646 946 q 622 826 539 861 q 763 731 704 791 q 858 589 822 671 q 893 416 893 507 q 927 586 893 505 q 1018 726 960 667 q 1156 822 1076 785 q 1324 860 1235 858 m 1590 163 q 1643 216 1590 163 q 1695 416 1695 268 q 1590 669 1695 564 q 1338 774 1486 774 q 1085 669 1190 774 q 980 416 980 564 q 1085 163 980 268 q 1338 58 1190 58 q 1590 163 1486 58 m 1489 855 l 1786 855 q 1728 766 1752 815 q 1697 677 1704 717 q 1782 416 1782 560 q 1722 193 1782 295 q 1560 31 1662 91 q 1338 -28 1458 -28 q 1145 16 1235 -28 q 993 136 1055 59 q 893 -3 956 92 q 851 61 884 14 q 794 136 818 108 q 641 16 732 60 q 448 -28 551 -28 q 226 31 328 -28 q 64 193 123 91 q 4 416 4 295 q 89 677 4 560 q 58 766 82 717 q 0 855 34 815 l 283 855 q 558 976 398 932 q 893 1020 718 1020 q 1219 977 1066 1020 q 1489 855 1372 933 z "},"":{"ha":992,"x_min":79,"x_max":913,"o":"m 745 591 q 693 539 745 591 q 496 488 642 488 q 247 591 350 488 q 144 839 144 694 q 247 1087 144 984 q 496 1190 350 1190 q 745 1087 642 1190 q 848 839 848 984 q 745 591 848 694 m 618 961 q 593 987 618 961 q 496 1012 567 1012 q 374 961 425 1012 q 323 839 323 911 q 374 717 323 767 q 496 666 425 666 q 618 717 567 666 q 669 839 669 767 q 618 961 669 911 m 901 445 q 913 407 911 424 q 910 375 915 389 q 889 345 904 361 q 856 317 873 329 q 808 284 839 304 q 564 212 719 228 l 621 156 l 828 -51 q 851 -109 851 -75 q 828 -165 851 -142 l 818 -175 q 761 -198 794 -198 q 704 -175 728 -198 q 497 33 652 -122 l 290 -175 q 233 -198 266 -198 q 176 -175 199 -198 l 167 -165 q 143 -109 143 -142 q 167 -51 143 -75 l 374 156 l 429 212 q 184 284 272 228 q 136 317 153 304 q 103 345 119 329 q 83 375 88 361 q 79 407 78 389 q 91 445 81 424 q 112 472 98 460 q 145 489 126 484 q 188 488 164 494 q 239 460 213 481 q 250 452 243 457 q 284 433 258 446 q 337 409 309 419 q 408 391 365 399 q 496 382 452 382 q 631 402 567 382 q 724 441 695 422 l 753 460 q 804 488 779 481 q 847 489 829 494 q 880 472 866 484 q 901 445 894 460 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 682 828 q 700 810 682 828 q 718 741 718 792 q 682 654 718 690 q 595 618 646 618 q 508 654 544 618 q 472 741 472 690 q 508 828 472 792 q 595 864 544 864 q 682 828 646 864 m 884 460 q 863 484 877 475 q 826 492 849 494 q 779 470 803 490 q 756 455 771 464 q 694 430 742 446 q 595 415 646 415 q 499 429 545 415 q 432 457 453 443 l 412 470 q 365 492 388 490 q 328 484 342 494 q 306 460 314 475 q 305 402 289 425 q 372 345 320 379 q 547 293 436 304 l 508 253 q 360 105 398 143 q 343 65 343 88 q 360 24 343 41 l 367 17 q 407 0 384 0 q 448 17 431 0 l 596 165 q 744 17 684 76 q 785 0 761 0 q 825 17 808 0 l 832 24 q 849 65 849 41 q 832 105 849 88 l 684 253 l 644 293 q 818 345 753 304 q 886 402 870 379 q 884 460 901 425 m 773 563 q 810 600 773 563 q 846 741 846 637 q 773 918 846 845 q 595 992 699 992 q 418 918 491 992 q 344 741 344 845 q 418 563 344 637 q 595 490 491 490 q 773 563 699 490 m 1190 868 l 1190 124 q 1125 -34 1190 32 q 967 -99 1059 -99 l 223 -99 q 65 -34 131 -99 q 0 124 0 32 l 0 868 q 65 1026 0 960 q 223 1091 131 1091 l 967 1091 q 1125 1026 1059 1091 q 1190 868 1190 960 z "},"":{"ha":1333,"x_min":0,"x_max":1333,"o":"m 1213 1091 q 1298 1056 1263 1091 q 1333 970 1333 1021 l 1333 568 q 1280 308 1333 432 q 1139 95 1228 184 q 927 -47 1050 5 q 667 -99 803 -99 q 407 -47 531 -99 q 195 95 284 5 q 53 308 105 184 q 0 568 0 432 l 0 970 q 36 1056 0 1020 q 121 1091 71 1091 l 1213 1091 m 667 267 q 731 292 704 267 l 1044 593 q 1073 659 1073 620 q 1046 724 1073 697 q 981 750 1019 750 q 918 725 945 750 l 667 484 l 417 725 q 354 750 390 750 q 289 724 316 750 q 263 659 263 697 q 291 593 263 619 l 605 292 q 667 267 630 267 z "},"":{"ha":1786,"x_min":0,"x_max":1786,"o":"m 1158 -80 l 929 459 q 806 222 910 421 q 653 -80 703 23 q 631 -80 652 -81 q 611 -79 611 -80 q 413 376 547 71 q 212 838 278 681 q 160 921 195 877 q 80 999 125 966 q 1 1032 35 1032 q 0 1051 1 1036 q 0 1072 0 1066 l 452 1072 l 452 1033 q 390 1021 422 1032 q 339 987 359 1010 q 331 938 319 965 q 499 551 351 892 q 681 133 646 210 q 790 339 705 180 q 891 531 874 498 q 794 749 877 561 q 688 977 711 936 q 532 1032 659 1031 l 532 1071 l 930 1070 l 930 1034 q 858 1015 884 1032 q 848 961 832 997 q 915 814 873 907 q 982 669 957 722 q 1116 950 1067 835 q 1108 1012 1135 993 q 1008 1032 1082 1031 q 1009 1052 1009 1038 q 1009 1070 1009 1066 q 1141 1071 1059 1070 q 1281 1072 1224 1071 q 1352 1072 1338 1072 l 1352 1034 q 1260 1008 1304 1032 q 1190 946 1216 984 l 1025 603 q 1124 378 1035 577 q 1218 166 1213 179 l 1560 954 q 1522 1003 1549 984 q 1471 1027 1494 1022 q 1428 1033 1449 1032 l 1428 1072 l 1785 1069 l 1786 1067 l 1785 1033 q 1629 921 1677 1030 q 1196 -80 1221 -22 l 1158 -80 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 736 498 q 723 463 736 478 q 691 449 710 449 q 656 462 670 449 q 641 494 641 474 q 654 529 641 514 q 687 543 667 543 q 721 531 706 543 q 736 498 736 518 m 747 453 l 1018 904 q 966 855 1011 898 q 869 765 921 813 q 763 667 817 717 q 672 581 709 616 q 633 541 636 546 l 363 91 q 415 140 368 97 q 512 230 461 182 q 618 328 563 277 q 708 414 672 379 q 747 453 745 450 m 1249 496 q 1168 208 1249 340 q 1155 217 1166 210 q 1134 230 1144 224 q 1121 236 1125 236 q 1111 226 1111 236 q 1157 191 1111 218 q 1014 44 1100 105 q 827 -42 929 -17 l 815 10 q 803 18 814 18 q 797 14 799 18 q 795 6 794 9 l 808 -47 q 694 -58 752 -58 q 406 23 540 -58 q 416 39 407 25 q 433 65 426 53 q 440 80 440 77 q 430 90 440 90 q 417 79 426 90 q 400 52 408 67 q 389 34 391 36 q 240 179 301 92 q 155 369 179 267 l 208 381 q 216 392 216 383 q 212 398 216 396 q 204 400 208 401 l 151 388 q 140 496 140 444 q 225 790 140 656 q 239 780 226 789 q 262 766 252 772 q 276 760 273 760 q 286 769 286 760 q 276 781 286 773 q 251 798 267 788 l 236 807 q 382 953 295 894 q 571 1036 469 1013 l 583 984 q 594 977 584 977 q 601 981 598 977 q 602 989 603 985 l 591 1040 q 694 1050 646 1050 q 988 966 853 1050 q 958 915 958 922 q 967 905 958 905 q 1004 955 976 905 q 1150 811 1090 897 q 1233 624 1209 725 l 1190 615 q 1182 602 1182 613 q 1186 596 1182 598 q 1194 594 1190 594 l 1238 605 q 1249 496 1249 549 m 1265 255 q 1290 312 1265 255 q 1314 496 1314 370 q 1265 737 1314 622 q 1133 935 1216 852 q 935 1067 1050 1018 q 694 1116 821 1116 q 453 1067 568 1116 q 256 935 339 1018 q 124 737 173 852 q 74 496 74 622 q 124 255 74 370 q 256 57 173 140 q 453 -75 339 -26 q 694 -124 568 -124 q 935 -75 821 -124 q 1133 57 1050 -26 q 1265 255 1216 140 m 1334 766 q 1361 701 1334 766 q 1389 496 1389 637 q 1334 226 1389 355 q 1186 5 1279 98 q 964 -143 1093 -88 q 694 -198 836 -198 q 425 -143 553 -198 q 203 5 296 -88 q 55 226 110 98 q 0 496 0 355 q 55 766 0 637 q 203 987 110 894 q 425 1135 296 1080 q 694 1190 553 1190 q 964 1135 836 1190 q 1186 987 1093 1080 q 1334 766 1279 894 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 692 1190 q 1042 1097 878 1192 q 1314 809 1221 994 l 739 839 q 512 782 615 846 q 368 604 408 717 l 154 932 q 395 1123 253 1056 q 692 1190 537 1190 m 113 877 l 374 363 q 538 195 430 252 q 765 160 646 137 l 587 -190 q 288 -68 422 -164 q 77 177 154 29 q 0 496 0 326 q 113 877 0 703 m 1342 746 q 1389 505 1387 629 q 1351 268 1390 381 q 1232 57 1312 155 q 1042 -105 1152 -41 q 656 -198 863 -208 l 970 285 q 1034 510 1038 387 q 951 725 1029 634 l 1342 746 m 529 662 q 563 696 529 662 q 694 730 598 730 q 860 662 791 730 q 929 496 929 593 q 860 331 929 399 q 694 262 791 262 q 529 331 598 262 q 460 496 460 399 q 529 662 460 593 z "},"":{"ha":1389,"x_min":2,"x_max":1389,"o":"m 700 -198 q 309 -82 481 -198 q 53 227 137 35 q 2 460 9 329 q 22 718 -5 592 q 108 960 49 844 q 246 1148 167 1076 l 238 930 q 291 942 246 941 q 345 930 335 943 q 469 1037 377 993 q 651 1083 561 1081 q 558 968 609 1048 q 513 841 508 887 q 562 830 532 835 q 610 825 591 826 q 663 822 630 823 q 702 819 696 820 q 710 784 714 815 q 686 725 705 753 q 673 711 682 720 q 629 684 664 702 q 551 657 594 665 l 563 511 l 455 563 q 449 500 441 529 q 477 448 457 470 q 528 416 497 426 q 591 411 559 405 q 667 438 630 418 q 731 472 703 457 q 788 486 760 488 q 858 460 836 483 q 873 410 880 438 q 871 406 872 408 q 864 396 870 403 q 850 384 859 389 q 826 376 842 379 q 790 375 810 373 q 678 270 743 301 q 515 247 612 239 q 641 183 573 200 q 772 179 710 167 q 892 219 834 191 q 991 287 949 247 q 1053 367 1032 326 q 1084 517 1087 438 q 1054 663 1080 595 q 994 760 1028 730 q 1100 698 1061 730 q 1159 611 1139 666 q 1115 877 1171 742 q 953 1097 1059 1011 q 1272 880 1158 1037 q 1389 479 1386 723 q 1357 281 1390 381 q 1262 97 1325 182 q 1115 -55 1199 12 q 923 -160 1032 -122 q 700 -198 815 -198 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 1157 1014 q 879 1099 1029 1099 q 652 1042 759 1099 q 466 887 545 986 q 373 718 408 815 q 336 512 339 622 l 336 480 q 373 274 339 370 q 466 105 408 177 q 652 -50 545 6 q 879 -107 759 -107 q 1157 -22 1029 -107 q 944 -152 1063 -105 q 694 -198 825 -198 q 661 -198 672 -198 q 403 -134 525 -191 q 192 16 281 -77 q 52 233 104 108 q 0 496 0 359 q 55 766 0 637 q 203 987 110 894 q 425 1135 296 1080 q 694 1190 553 1190 l 697 1190 q 945 1144 827 1190 q 1157 1014 1063 1097 m 1389 496 q 1329 215 1389 347 q 1164 -15 1270 83 q 992 -64 1084 -64 q 794 2 886 -64 q 991 182 914 45 q 1068 496 1068 319 q 991 809 1068 672 q 795 991 915 946 q 992 1055 887 1055 q 1167 1004 1084 1055 q 1330 776 1272 908 q 1389 496 1389 644 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 1389 464 q 1383 384 1389 421 l 491 384 q 576 194 491 270 q 776 118 661 118 q 920 154 853 118 q 1025 255 987 190 l 1353 255 q 1221 37 1310 132 q 1014 -109 1132 -57 q 765 -160 895 -160 q 489 -96 620 -160 q 184 -186 312 -186 q 0 18 0 -186 q 35 231 0 107 q 119 408 48 277 q 488 878 274 687 q 157 604 345 817 q 376 952 205 816 q 765 1088 547 1088 q 800 1087 788 1088 q 1135 1178 997 1178 q 1225 1168 1185 1178 q 1299 1137 1266 1158 q 1350 1077 1332 1115 q 1369 988 1369 1039 q 1311 767 1369 898 q 1389 464 1389 625 m 1335 960 q 1294 1063 1335 1025 q 1187 1101 1252 1101 q 991 1046 1104 1101 q 1163 944 1084 1010 q 1295 793 1242 879 q 1335 960 1335 898 m 99 2 q 137 -101 99 -65 q 241 -137 174 -137 q 447 -73 330 -137 q 282 69 353 -17 q 175 259 211 155 q 99 2 99 100 m 490 554 l 1054 554 q 966 738 1050 664 q 772 811 883 811 q 577 738 660 811 q 490 554 494 664 z "},"":{"ha":1587,"x_min":0,"x_max":1488,"o":"m 1389 223 l 1389 967 q 1382 985 1389 977 q 1364 992 1374 992 l 124 992 q 107 985 114 992 q 99 967 99 977 l 99 223 q 107 206 99 213 q 124 198 114 198 l 1364 198 q 1382 206 1374 198 q 1389 223 1389 213 m 1488 967 l 1488 223 q 1452 136 1488 172 q 1364 99 1415 99 l 794 99 l 794 0 l 1066 0 q 1084 -7 1077 0 q 1091 -25 1091 -14 l 1091 -74 q 1084 -92 1091 -85 q 1066 -99 1077 -99 l 422 -99 q 404 -92 411 -99 q 397 -74 397 -85 l 397 -25 q 404 -7 397 -14 q 422 0 411 0 l 694 0 l 694 99 l 124 99 q 36 136 73 99 q 0 223 0 172 l 0 967 q 36 1055 0 1018 q 124 1091 73 1091 l 1364 1091 q 1452 1055 1415 1091 q 1488 967 1488 1018 z "},"":{"ha":1389,"x_min":17,"x_max":1372,"o":"m 107 1091 l 260 1091 q 162 976 205 1042 q 116 887 134 932 q 93 789 98 841 q 86 696 88 738 q 95 594 85 655 q 111 496 104 533 q 133 391 118 460 q 137 369 136 376 q 200 114 177 184 q 318 -99 244 -19 l 107 -99 q 43 -73 70 -99 q 17 -9 17 -47 l 17 1001 q 43 1065 17 1039 q 107 1091 70 1091 m 1043 1091 l 1282 1091 q 1345 1065 1319 1091 q 1372 1001 1372 1039 l 1372 -9 q 1345 -73 1372 -47 q 1282 -99 1319 -99 l 1144 -99 q 1296 339 1308 64 l 932 260 q 923 197 931 226 q 899 141 915 168 q 853 95 883 114 q 780 67 823 76 q 626 98 685 47 q 585 145 601 119 q 545 245 569 171 q 495 445 522 319 q 460 649 468 571 q 456 756 452 726 q 474 816 460 787 q 522 873 489 848 q 601 908 555 898 q 666 913 636 917 q 718 899 696 908 q 760 872 740 891 q 793 835 780 854 q 820 791 807 816 l 1183 869 q 1043 1091 1130 1004 z "},"":{"ha":1190,"x_min":11,"x_max":1086,"o":"m 1086 -9 l 1081 -13 q 880 -149 994 -101 q 635 -198 761 -198 q 389 -149 507 -198 q 188 -13 274 -100 q 53 187 101 74 q 11 333 20 267 q 48 361 8 355 q 91 346 88 367 q 92 343 92 345 q 128 219 106 273 q 246 44 167 123 q 421 -74 322 -32 q 635 -117 523 -117 q 849 -74 746 -117 q 1023 44 948 -31 l 1028 49 q 1047 53 1035 57 q 1073 36 1056 51 q 1086 -9 1101 8 m 720 468 l 669 417 l 718 368 q 712 330 734 352 q 687 317 699 317 q 673 325 680 317 l 625 372 l 574 321 q 562 317 570 317 q 538 329 550 317 l 536 331 q 522 353 522 343 q 529 367 522 359 l 580 417 l 529 468 q 539 503 516 481 q 563 517 553 517 q 574 513 568 517 l 624 462 l 674 512 q 711 502 688 525 q 720 468 732 481 m 1085 424 q 1049 247 1085 332 q 952 103 1015 166 q 807 5 890 41 q 630 -30 724 -30 q 453 5 536 -30 q 308 103 370 41 q 212 247 245 167 q 200 278 200 273 l 199 278 q 233 312 192 299 q 279 303 271 325 q 354 174 308 226 l 355 174 l 355 436 l 355 438 q 434 618 357 543 q 630 698 515 698 q 825 618 744 698 q 905 425 905 538 q 824 230 905 311 q 630 150 743 150 q 543 162 585 150 q 533 209 522 171 q 567 243 546 249 l 578 240 q 604 236 589 238 q 627 233 618 233 q 763 289 708 233 q 819 424 819 344 q 763 556 819 502 q 628 612 708 612 q 490 550 545 612 q 440 426 440 494 l 440 105 q 628 53 525 53 q 771 82 702 53 q 892 162 840 110 q 972 282 944 214 q 1001 424 1001 350 q 891 687 1001 577 q 629 795 783 795 q 365 687 474 795 q 305 619 324 646 l 304 618 q 294 606 298 609 q 277 598 290 602 q 247 601 264 594 q 219 613 231 605 q 207 634 207 622 l 207 1161 q 215 1182 207 1173 q 236 1190 223 1190 l 916 1190 q 939 1148 939 1190 q 916 1105 939 1105 l 288 1105 l 288 731 l 288 731 q 367 796 319 763 q 451 843 415 829 q 630 879 536 879 q 807 843 724 879 q 952 746 890 808 q 1049 601 1015 683 q 1085 424 1085 515 m 1061 874 q 1068 860 1068 868 q 1064 846 1068 853 q 1051 830 1059 840 q 1021 810 1031 810 q 1008 815 1014 810 q 848 918 926 886 q 634 962 749 962 q 431 924 531 962 q 396 953 410 916 q 390 982 389 972 q 402 997 392 994 q 634 1042 503 1042 q 879 992 761 1042 q 1061 874 985 947 z "},"":{"ha":1389,"x_min":22,"x_max":1365,"o":"m 1202 47 q 1222 49 1214 51 q 1231 35 1231 47 q 1219 9 1231 24 q 1185 -24 1209 -3 q 1111 -77 1161 -46 q 1002 -134 1061 -109 q 856 -179 942 -160 q 678 -198 770 -198 q 494 -174 586 -198 q 332 -115 401 -150 q 198 -34 262 -80 q 95 47 134 11 q 30 115 57 83 q 22 127 24 122 q 23 137 21 133 q 29 142 26 140 q 38 144 33 144 q 47 140 43 143 q 280 12 196 50 q 899 -58 581 -125 q 1202 47 1046 -27 m 1363 136 q 1364 82 1371 123 q 1342 2 1358 40 q 1277 -94 1316 -62 q 1256 -101 1263 -105 q 1256 -82 1249 -97 q 1291 12 1273 -47 q 1296 88 1309 71 q 1284 97 1292 94 q 1263 102 1276 101 q 1240 104 1250 103 q 1213 104 1230 105 q 1189 102 1196 103 q 1165 100 1181 102 q 1147 98 1148 98 q 1137 97 1142 98 q 1128 96 1132 97 q 1122 96 1125 96 q 1116 95 1118 95 q 1112 95 1115 95 q 1109 95 1110 95 q 1106 96 1108 95 q 1105 97 1105 96 q 1104 99 1104 98 q 1140 130 1099 112 q 1220 153 1181 149 q 1304 154 1256 159 q 1363 136 1352 150 m 1057 479 q 1068 429 1057 455 q 1092 384 1078 404 q 1121 349 1107 365 q 1147 324 1136 332 l 1157 315 l 981 142 q 920 200 950 171 q 875 246 890 230 l 860 261 q 841 287 852 270 q 765 207 811 241 q 667 158 719 174 q 558 140 614 143 q 451 157 502 138 q 360 207 401 175 q 296 295 320 239 q 272 421 272 350 q 294 540 272 486 q 350 631 315 594 q 432 695 384 667 q 527 739 481 723 q 628 766 574 755 q 720 780 682 777 q 798 785 759 784 l 798 884 q 781 959 798 934 q 687 1000 755 1000 q 675 999 683 1000 q 643 990 667 998 q 600 967 620 981 q 556 921 580 953 q 519 846 533 889 l 291 867 q 308 960 291 914 q 360 1047 326 1005 q 444 1121 395 1089 q 562 1171 493 1152 q 709 1190 630 1190 q 849 1171 787 1190 q 950 1123 912 1152 q 1013 1059 987 1095 q 1047 992 1038 1023 q 1057 935 1057 962 l 1057 479 m 536 463 q 591 360 536 396 q 698 343 642 326 q 787 438 763 362 q 798 516 798 473 l 798 642 q 711 632 752 640 q 629 606 671 625 q 562 551 587 588 q 536 463 536 515 z "},"":{"ha":1389,"x_min":0,"x_max":1290,"o":"m 1190 992 q 1260 963 1231 992 q 1290 893 1290 933 l 1290 -99 q 1260 -169 1290 -140 q 1190 -198 1231 -198 l 99 -198 q 29 -169 59 -198 q 0 -99 0 -140 l 0 893 q 29 963 0 933 q 99 992 59 992 l 198 992 l 198 1066 q 235 1154 198 1118 q 322 1190 271 1190 l 372 1190 q 460 1154 423 1190 q 496 1066 496 1118 l 496 992 l 794 992 l 794 1066 q 830 1154 794 1118 q 918 1190 867 1190 l 967 1190 q 1055 1154 1018 1190 q 1091 1066 1091 1118 l 1091 992 l 1190 992 m 893 1066 l 893 843 q 900 825 893 832 q 918 818 907 818 l 967 818 q 985 825 978 818 q 992 843 992 832 l 992 1066 q 985 1084 992 1077 q 967 1091 978 1091 l 918 1091 q 900 1084 907 1091 q 893 1066 893 1077 m 298 1066 l 298 843 q 305 825 298 832 q 322 818 312 818 l 372 818 q 390 825 383 818 q 397 843 397 832 l 397 1066 q 390 1084 397 1077 q 372 1091 383 1091 l 322 1091 q 305 1084 312 1091 q 298 1066 298 1077 m 1190 -99 l 1190 694 l 99 694 l 99 -99 l 1190 -99 m 694 347 l 868 347 q 886 340 879 347 q 893 322 893 333 l 893 273 q 886 255 893 262 q 868 248 879 248 l 694 248 l 694 74 q 687 57 694 64 q 670 50 680 50 l 620 50 q 602 57 609 50 q 595 74 595 64 l 595 248 l 422 248 q 404 255 411 248 q 397 273 397 262 l 397 322 q 404 340 397 333 q 422 347 411 347 l 595 347 l 595 521 q 602 539 595 532 q 620 546 609 546 l 670 546 q 687 539 680 546 q 694 521 694 532 l 694 347 z "},"":{"ha":1389,"x_min":0,"x_max":1290,"o":"m 893 322 l 893 273 q 886 255 893 262 q 868 248 879 248 l 422 248 q 404 255 411 248 q 397 273 397 262 l 397 322 q 404 340 397 333 q 422 347 411 347 l 868 347 q 886 340 879 347 q 893 322 893 333 m 99 -99 l 1190 -99 l 1190 694 l 99 694 l 99 -99 m 397 843 l 397 1066 q 390 1084 397 1077 q 372 1091 383 1091 l 322 1091 q 305 1084 312 1091 q 298 1066 298 1077 l 298 843 q 305 825 298 832 q 322 818 312 818 l 372 818 q 390 825 383 818 q 397 843 397 832 m 992 843 l 992 1066 q 985 1084 992 1077 q 967 1091 978 1091 l 918 1091 q 900 1084 907 1091 q 893 1066 893 1077 l 893 843 q 900 825 893 832 q 918 818 907 818 l 967 818 q 985 825 978 818 q 992 843 992 832 m 1290 893 l 1290 -99 q 1260 -169 1290 -140 q 1190 -198 1231 -198 l 99 -198 q 29 -169 59 -198 q 0 -99 0 -140 l 0 893 q 29 963 0 933 q 99 992 59 992 l 198 992 l 198 1066 q 235 1154 198 1118 q 322 1190 271 1190 l 372 1190 q 460 1154 423 1190 q 496 1066 496 1118 l 496 992 l 794 992 l 794 1066 q 830 1154 794 1118 q 918 1190 867 1190 l 967 1190 q 1055 1154 1018 1190 q 1091 1066 1091 1118 l 1091 992 l 1190 992 q 1260 963 1231 992 q 1290 893 1290 933 z "},"":{"ha":1389,"x_min":0,"x_max":1290,"o":"m 861 117 l 825 81 q 808 74 818 74 q 791 81 798 74 l 645 228 l 499 81 q 481 74 491 74 q 464 81 471 74 l 429 117 q 422 134 422 124 q 429 152 422 144 l 575 298 l 429 443 q 422 461 422 451 q 429 478 422 471 l 464 514 q 481 521 471 521 q 499 514 491 521 l 645 368 l 791 514 q 808 521 798 521 q 825 514 818 521 l 861 478 q 868 461 868 471 q 861 443 868 451 l 715 298 l 861 152 q 868 134 868 144 q 861 117 868 124 m 99 -99 l 1190 -99 l 1190 694 l 99 694 l 99 -99 m 397 843 l 397 1066 q 390 1084 397 1077 q 372 1091 383 1091 l 322 1091 q 305 1084 312 1091 q 298 1066 298 1077 l 298 843 q 305 825 298 832 q 322 818 312 818 l 372 818 q 390 825 383 818 q 397 843 397 832 m 992 843 l 992 1066 q 985 1084 992 1077 q 967 1091 978 1091 l 918 1091 q 900 1084 907 1091 q 893 1066 893 1077 l 893 843 q 900 825 893 832 q 918 818 907 818 l 967 818 q 985 825 978 818 q 992 843 992 832 m 1290 893 l 1290 -99 q 1260 -169 1290 -140 q 1190 -198 1231 -198 l 99 -198 q 29 -169 59 -198 q 0 -99 0 -140 l 0 893 q 29 963 0 933 q 99 992 59 992 l 198 992 l 198 1066 q 235 1154 198 1118 q 322 1190 271 1190 l 372 1190 q 460 1154 423 1190 q 496 1066 496 1118 l 496 992 l 794 992 l 794 1066 q 830 1154 794 1118 q 918 1190 867 1190 l 967 1190 q 1055 1154 1018 1190 q 1091 1066 1091 1118 l 1091 992 l 1190 992 q 1260 963 1231 992 q 1290 893 1290 933 z "},"":{"ha":1389,"x_min":0,"x_max":1290,"o":"m 1010 443 l 613 47 q 595 40 605 40 q 577 47 585 40 l 354 270 q 347 288 347 277 q 354 305 347 298 l 390 340 q 407 347 397 347 q 425 340 417 347 l 595 170 l 939 514 q 957 521 947 521 q 974 514 967 521 l 1010 478 q 1017 461 1017 471 q 1010 443 1017 451 m 99 -99 l 1190 -99 l 1190 694 l 99 694 l 99 -99 m 397 843 l 397 1066 q 390 1084 397 1077 q 372 1091 383 1091 l 322 1091 q 305 1084 312 1091 q 298 1066 298 1077 l 298 843 q 305 825 298 832 q 322 818 312 818 l 372 818 q 390 825 383 818 q 397 843 397 832 m 992 843 l 992 1066 q 985 1084 992 1077 q 967 1091 978 1091 l 918 1091 q 900 1084 907 1091 q 893 1066 893 1077 l 893 843 q 900 825 893 832 q 918 818 907 818 l 967 818 q 985 825 978 818 q 992 843 992 832 m 1290 893 l 1290 -99 q 1260 -169 1290 -140 q 1190 -198 1231 -198 l 99 -198 q 29 -169 59 -198 q 0 -99 0 -140 l 0 893 q 29 963 0 933 q 99 992 59 992 l 198 992 l 198 1066 q 235 1154 198 1118 q 322 1190 271 1190 l 372 1190 q 460 1154 423 1190 q 496 1066 496 1118 l 496 992 l 794 992 l 794 1066 q 830 1154 794 1118 q 918 1190 867 1190 l 967 1190 q 1055 1154 1018 1190 q 1091 1066 1091 1118 l 1091 992 l 1190 992 q 1260 963 1231 992 q 1290 893 1290 933 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 347 1190 q 382 1176 367 1190 q 397 1141 397 1161 l 397 450 l 812 783 q 843 794 825 794 q 878 779 863 794 q 893 744 893 764 l 893 450 l 1308 783 q 1339 794 1321 794 q 1374 779 1359 794 q 1389 744 1389 764 l 1389 -149 q 1374 -184 1389 -169 q 1339 -198 1359 -198 l 50 -198 q 15 -184 29 -198 q 0 -149 0 -169 l 0 1141 q 15 1176 0 1161 q 50 1190 29 1190 l 347 1190 z "},"":{"ha":794,"x_min":0,"x_max":794,"o":"m 298 359 q 397 347 346 347 q 496 359 448 347 l 496 -149 q 481 -184 496 -169 q 446 -198 467 -198 l 347 -198 q 312 -184 327 -198 q 298 -149 298 -169 l 298 359 m 116 1074 q 174 1132 116 1074 q 397 1190 233 1190 q 677 1074 561 1190 q 794 794 794 958 q 677 513 794 629 q 397 397 561 397 q 116 513 233 397 q 0 794 0 629 q 116 1074 0 958 m 397 1017 q 415 1024 408 1017 q 422 1042 422 1031 q 415 1059 422 1053 q 397 1066 408 1066 q 204 987 284 1066 q 124 794 124 907 q 131 776 124 783 q 149 769 138 769 q 167 776 160 769 q 174 794 174 783 q 239 951 174 886 q 397 1017 305 1017 z "},"":{"ha":1389,"x_min":29,"x_max":1360,"o":"m 1352 960 q 1360 942 1360 953 q 1352 925 1360 932 l 1243 815 q 1190 794 1221 794 l 149 794 q 114 808 129 794 q 99 843 99 823 l 99 1042 q 114 1077 99 1062 q 149 1091 129 1091 l 595 1091 l 595 1141 q 610 1176 595 1161 q 645 1190 625 1190 l 744 1190 q 779 1176 764 1190 q 794 1141 794 1161 l 794 1091 l 1190 1091 q 1243 1070 1221 1091 l 1352 960 m 595 248 l 794 248 l 794 -149 q 779 -184 794 -169 q 744 -198 764 -198 l 645 -198 q 610 -184 625 -198 q 595 -149 595 -169 l 595 248 m 1240 595 q 1275 581 1260 595 q 1290 546 1290 566 l 1290 347 q 1275 312 1290 327 q 1240 298 1260 298 l 198 298 q 146 319 167 298 l 36 429 q 29 446 29 436 q 36 464 29 457 l 146 574 q 198 595 167 595 l 595 595 l 595 744 l 794 744 l 794 595 l 1240 595 z "},"":{"ha":1587,"x_min":0,"x_max":1587,"o":"m 1566 1182 q 1587 1141 1587 1166 l 1587 50 q 1579 22 1587 34 q 1556 4 1570 9 l 1060 -195 q 1023 -195 1042 -203 l 546 -4 l 68 -195 q 50 -198 60 -198 q 22 -190 35 -198 q 0 -149 0 -174 l 0 942 q 9 970 0 958 q 31 988 17 983 l 527 1187 q 564 1187 546 1195 l 1042 996 l 1519 1187 q 1566 1182 1544 1197 m 570 1077 l 570 93 l 1017 -85 l 1017 899 l 570 1077 m 99 909 l 99 -75 l 521 93 l 521 1077 l 99 909 m 1488 83 l 1488 1067 l 1066 899 l 1066 -85 l 1488 83 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 397 1190 q 414 1183 407 1190 q 422 1166 422 1176 l 422 25 q 408 3 422 9 l 36 -195 q 25 -198 31 -198 q 7 -191 15 -198 q 0 -174 0 -184 l 0 967 q 13 989 0 983 l 385 1187 q 397 1190 391 1190 m 1364 1190 q 1382 1183 1374 1190 q 1389 1166 1389 1176 l 1389 25 q 1376 3 1389 9 l 1004 -195 q 992 -198 998 -198 q 975 -191 982 -198 q 967 -174 967 -184 l 967 967 q 980 989 967 983 l 1352 1187 q 1364 1190 1358 1190 m 496 1190 q 507 1188 502 1190 l 904 990 q 918 967 918 982 l 918 -174 q 910 -191 918 -184 q 893 -198 903 -198 q 882 -196 887 -198 l 485 2 q 471 25 471 10 l 471 1166 q 479 1183 471 1176 q 496 1190 486 1190 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 467 426 q 481 440 467 426 q 496 496 496 455 q 467 566 496 537 q 397 595 438 595 q 327 566 356 595 q 298 496 298 537 q 327 426 298 455 q 397 397 356 397 q 467 426 438 397 m 765 426 q 779 440 765 426 q 794 496 794 455 q 765 566 794 537 q 694 595 736 595 q 624 566 653 595 q 595 496 595 537 q 624 426 595 455 q 694 397 653 397 q 765 426 736 397 m 1062 426 q 1077 440 1062 426 q 1091 496 1091 455 q 1062 566 1091 537 q 992 595 1033 595 q 922 566 951 595 q 893 496 893 537 q 922 426 893 455 q 992 397 951 397 q 1062 426 1033 397 m 1296 745 q 1342 688 1296 745 q 1389 496 1389 631 q 1296 247 1389 361 q 1043 66 1203 133 q 694 0 884 0 q 531 14 609 0 q 194 -164 397 -120 q 127 -174 153 -171 q 110 -169 118 -174 q 100 -155 102 -164 q 115 -126 97 -143 q 134 -110 119 -122 q 153 -91 148 -97 q 172 -72 159 -86 q 190 -47 184 -57 q 206 -19 196 -37 q 222 19 216 0 q 233 63 227 37 q 243 119 239 89 q 65 287 129 189 q 0 496 0 385 q 93 745 0 631 q 346 926 186 860 q 694 992 505 992 q 1043 926 884 992 q 1296 745 1203 860 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 467 566 q 481 552 467 566 q 496 496 496 537 q 467 426 496 455 q 397 397 438 397 q 327 426 356 397 q 298 496 298 455 q 327 566 298 537 q 397 595 356 595 q 467 566 438 595 m 765 566 q 779 552 765 566 q 794 496 794 537 q 765 426 794 455 q 694 397 736 397 q 624 426 653 397 q 595 496 595 455 q 624 566 595 537 q 694 595 653 595 q 765 566 736 595 m 1062 566 q 1077 552 1062 566 q 1091 496 1091 537 q 1062 426 1091 455 q 992 397 1033 397 q 922 426 951 397 q 893 496 893 455 q 922 566 893 537 q 992 595 951 595 q 1062 566 1033 595 m 990 839 q 921 866 990 839 q 694 893 853 893 q 399 839 536 893 q 180 694 261 785 q 99 496 99 602 q 155 331 99 409 q 311 195 210 252 l 378 156 l 357 81 q 303 -52 339 11 q 516 81 421 -3 l 550 110 l 594 105 q 694 99 647 99 q 990 153 853 99 q 1209 298 1128 207 q 1290 496 1290 390 q 1209 694 1290 602 q 990 839 1128 785 m 1389 496 q 1296 247 1389 361 q 1043 66 1203 133 q 694 0 884 0 q 582 6 640 0 q 226 -181 429 -129 q 137 -198 188 -192 l 133 -198 q 112 -190 122 -198 q 100 -169 103 -182 l 100 -168 q 100 -159 98 -165 q 101 -151 102 -153 q 105 -144 101 -150 q 109 -137 109 -138 q 115 -130 110 -136 q 121 -123 119 -125 q 145 -96 126 -117 q 172 -67 164 -76 q 196 -36 180 -58 q 221 3 212 -15 q 242 49 230 21 q 262 108 253 77 q 70 278 140 177 q 0 496 0 380 q 55 689 0 597 q 203 847 110 780 q 425 953 296 914 q 694 992 553 992 q 964 953 836 992 q 1186 847 1093 914 q 1334 689 1279 780 q 1389 496 1389 597 z "},"":{"ha":794,"x_min":0,"x_max":794,"o":"m 397 267 l 794 496 l 794 38 l 397 -191 l 397 267 m 0 496 l 0 38 l 397 267 l 0 496 m 397 1184 l 397 725 l 0 496 l 0 954 l 397 1184 m 397 725 l 794 954 l 794 496 l 397 725 z "},"":{"ha":1389,"x_min":64,"x_max":1325,"o":"m 1325 789 q 1067 284 1317 606 q 632 -50 809 -50 q 446 154 522 -50 q 343 528 412 278 q 222 731 288 731 q 123 672 208 731 l 64 748 q 147 823 82 764 q 248 912 212 881 q 435 1025 369 1019 q 553 982 508 1032 q 616 825 598 932 q 667 536 650 602 q 760 343 710 343 q 880 467 800 343 q 964 658 958 592 q 880 766 974 766 q 786 746 836 766 q 1142 1042 879 1050 q 1325 789 1336 1035 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 0 1091 l 1190 1091 l 1190 -99 l 0 -99 l 0 1091 m 841 227 l 670 716 l 841 946 l 350 946 l 521 716 l 350 227 l 595 -9 l 841 227 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 0 1091 l 1190 1091 l 1190 -99 l 0 -99 l 0 1091 m 704 843 l 694 818 l 753 753 l 729 665 l 748 646 l 831 690 l 914 646 l 933 665 l 909 753 l 967 818 l 958 843 l 884 843 l 843 918 l 818 918 l 777 843 l 704 843 m 497 717 q 531 705 522 717 q 540 656 541 692 l 675 672 q 662 744 675 715 q 622 787 648 773 q 569 807 597 801 q 503 812 541 812 q 349 768 400 812 q 298 626 298 723 l 298 570 l 223 570 l 223 471 l 282 471 q 298 465 298 471 l 298 169 q 294 153 298 158 q 280 148 290 149 l 223 143 l 223 74 l 570 74 l 570 141 l 455 152 q 448 153 450 153 q 446 155 446 153 q 445 158 445 157 q 446 164 446 160 q 446 171 446 167 l 446 471 l 594 471 l 624 570 l 445 570 q 443 575 440 570 q 446 582 446 580 l 446 644 q 448 675 446 665 q 453 697 449 686 q 469 713 458 708 q 497 717 479 717 m 967 74 l 967 141 l 925 148 q 918 150 920 149 q 916 152 916 151 q 917 158 916 153 q 918 167 918 163 l 918 570 l 705 570 l 687 492 l 751 475 q 769 454 769 470 l 769 167 q 764 153 769 157 q 749 148 760 150 l 694 141 l 694 74 l 967 74 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 1389 535 q 1366 453 1389 490 q 1304 397 1343 416 q 1314 322 1314 361 q 1231 100 1314 202 q 1006 -62 1149 -2 q 696 -121 863 -121 q 386 -62 529 -121 q 162 100 244 -2 q 79 322 79 202 q 88 395 79 359 q 24 452 48 415 q 0 535 0 490 q 45 644 0 598 q 154 689 90 689 q 267 640 220 689 q 666 766 436 758 l 756 1170 q 767 1186 758 1180 q 787 1190 777 1192 l 1073 1127 q 1115 1173 1087 1156 q 1177 1190 1143 1190 q 1259 1157 1225 1190 q 1293 1075 1293 1123 q 1259 993 1293 1027 q 1177 959 1225 959 q 1095 992 1128 959 q 1061 1074 1061 1026 l 802 1132 l 722 766 q 1124 642 954 759 q 1235 689 1169 689 q 1344 644 1299 689 q 1389 535 1389 598 m 324 381 q 358 298 324 332 q 439 264 391 264 q 522 298 488 264 q 556 381 556 332 q 522 462 556 429 q 439 496 488 496 q 358 462 392 496 q 324 381 324 428 m 952 105 q 960 126 960 114 q 952 146 960 137 q 932 153 944 153 q 912 146 921 153 q 818 98 880 113 q 694 82 756 82 q 570 98 632 82 q 477 146 508 113 q 457 153 468 153 q 437 146 445 153 q 429 126 429 138 q 437 105 429 114 q 529 53 470 72 q 624 30 587 33 q 694 26 660 26 q 765 30 729 26 q 860 53 801 33 q 952 105 918 72 m 867 298 q 884 281 867 298 q 949 264 901 264 q 1031 298 997 264 q 1065 381 1065 332 q 1031 462 1065 428 q 949 496 997 496 q 867 462 901 496 q 833 381 833 429 q 867 298 833 332 z "},"":{"ha":1389,"x_min":53,"x_max":1335,"o":"m 53 574 l 54 574 q 100 761 67 672 q 189 930 133 851 q 319 1066 245 1008 q 492 1157 392 1124 q 706 1190 591 1190 q 1027 1109 885 1190 q 1255 873 1169 1027 q 1335 531 1335 729 l 1335 385 l 463 385 q 505 236 464 299 q 611 141 546 173 q 758 97 676 109 q 923 95 839 84 q 1084 131 1006 105 q 1218 196 1162 157 l 1218 -96 q 1041 -167 1147 -139 q 798 -197 934 -196 q 553 -156 663 -198 q 312 37 407 -99 q 215 326 217 174 q 301 645 213 513 q 553 853 390 777 q 493 755 516 806 q 457 632 470 705 l 949 632 q 943 740 956 691 q 907 819 931 789 q 852 870 883 849 q 790 902 822 892 q 732 918 758 912 q 688 925 705 924 l 671 925 q 470 891 567 922 q 297 810 374 860 q 160 701 220 760 q 53 574 101 643 z "},"":{"ha":1786,"x_min":0,"x_max":1786,"o":"m 0 25 l 0 496 l 1786 496 l 1786 25 q 1749 -63 1786 -26 q 1662 -99 1713 -99 l 124 -99 q 36 -63 73 -99 q 0 25 0 -26 m 496 198 l 496 99 l 794 99 l 794 198 l 496 198 m 198 198 l 198 99 l 397 99 l 397 198 l 198 198 m 1662 1091 q 1749 1055 1713 1091 q 1786 967 1786 1018 l 1786 794 l 0 794 l 0 967 q 36 1055 0 1018 q 124 1091 73 1091 l 1662 1091 z "},"":{"ha":1389,"x_min":0,"x_max":1335,"o":"m 1228 191 l 1059 277 q 906 130 1001 184 q 702 77 811 77 q 492 133 588 77 q 340 284 396 188 q 284 494 284 381 q 317 656 284 579 q 407 789 350 733 q 540 879 463 846 q 702 911 617 911 q 894 865 804 911 q 1043 734 984 818 l 1210 831 q 988 1036 1125 962 q 694 1111 851 1111 q 456 1062 570 1111 q 260 931 342 1013 q 129 735 177 849 q 80 496 80 621 q 129 257 80 371 q 260 61 177 143 q 456 -70 342 -21 q 694 -119 570 -119 q 1003 -36 860 -119 q 1228 191 1146 47 m 798 498 l 1335 226 q 1076 -84 1246 29 q 694 -198 907 -198 q 425 -143 553 -198 q 203 5 296 -88 q 55 226 110 98 q 0 496 0 355 q 55 766 0 637 q 203 987 110 894 q 425 1135 296 1080 q 694 1190 553 1190 q 1059 1087 896 1190 q 1319 803 1222 984 l 798 498 m 1196 496 l 1166 496 l 1166 372 l 1091 372 l 1091 645 l 1197 645 q 1239 629 1221 645 q 1261 592 1256 614 q 1262 549 1266 570 q 1240 512 1258 527 q 1196 496 1223 496 z "},"":{"ha":1389,"x_min":25,"x_max":1364,"o":"m 1106 641 l 630 940 l 701 1057 l 1364 1057 l 1106 641 m 314 436 l 171 525 l 171 1190 l 1088 615 l 314 436 m 1104 540 l 1218 467 l 1218 -198 l 805 61 l 1104 540 m 1075 556 l 687 -65 l 25 -65 l 301 377 l 1075 556 z "},"":{"ha":1389,"x_min":0,"x_max":1290,"o":"m 496 409 l 496 583 q 484 595 496 595 l 409 595 q 397 583 397 595 l 397 409 q 409 397 397 397 l 484 397 q 496 409 496 397 m 893 409 l 893 583 q 880 595 893 595 l 806 595 q 794 583 794 595 l 794 409 q 806 397 794 397 l 880 397 q 893 409 893 397 m 1290 384 l 1290 -198 l 794 -198 l 794 50 q 750 155 794 112 q 645 198 707 198 q 539 155 583 198 q 496 50 496 112 l 496 -198 l 0 -198 l 0 384 q 12 397 0 397 l 87 397 q 99 384 99 397 l 99 298 l 198 298 l 198 781 q 211 794 198 794 l 285 794 q 298 781 298 794 l 298 694 l 397 694 l 397 781 q 409 794 397 794 l 484 794 q 496 781 496 794 l 496 694 l 595 694 l 595 781 q 597 789 595 786 q 604 792 599 791 q 611 794 608 794 q 620 794 614 794 q 627 794 626 794 l 627 1097 q 602 1135 602 1108 q 615 1166 602 1153 q 645 1178 628 1178 q 675 1166 662 1178 q 687 1135 687 1153 q 663 1097 687 1108 l 663 1084 q 727 1091 698 1091 q 773 1085 743 1091 q 815 1080 803 1080 q 852 1085 829 1080 q 880 1091 875 1091 q 893 1079 893 1091 l 893 916 q 866 899 893 904 q 818 894 839 894 q 775 900 804 894 q 732 906 747 906 q 663 897 701 906 l 663 794 q 670 794 663 794 q 679 794 676 794 q 686 792 681 794 q 693 789 691 791 q 694 781 694 786 l 694 694 l 794 694 l 794 781 q 806 794 794 794 l 880 794 q 893 781 893 794 l 893 694 l 992 694 l 992 781 q 1004 794 992 794 l 1079 794 q 1091 781 1091 794 l 1091 298 l 1190 298 l 1190 384 q 1203 397 1190 397 l 1277 397 q 1290 384 1290 397 z "},"":{"ha":1786,"x_min":0,"x_max":1786,"o":"m 1773 567 q 1786 546 1786 560 q 1773 525 1786 531 l 1525 376 q 1513 372 1519 372 q 1500 375 1506 372 q 1488 397 1488 383 l 1488 496 l 823 496 q 887 368 852 451 q 906 326 900 339 q 925 288 913 312 q 946 251 937 264 q 967 225 955 239 q 991 205 979 211 q 1017 198 1004 198 l 1091 198 l 1091 273 q 1098 291 1091 284 q 1116 298 1105 298 l 1364 298 q 1382 291 1375 298 q 1389 273 1389 284 l 1389 25 q 1382 7 1389 14 q 1364 0 1375 0 l 1116 0 q 1098 7 1105 0 q 1091 25 1091 14 l 1091 99 l 1017 99 q 970 107 992 99 q 930 125 947 115 q 895 157 913 136 q 867 192 877 177 q 841 236 856 207 q 818 281 825 266 q 797 328 811 296 q 768 391 779 369 q 740 441 757 413 q 706 483 723 470 q 670 496 688 496 l 391 496 q 320 389 374 431 q 198 347 267 347 q 58 405 116 347 q 0 546 0 463 q 58 686 0 628 q 198 744 116 744 q 320 702 267 744 q 391 595 374 660 l 471 595 q 507 608 490 595 q 542 650 525 622 q 570 700 559 678 q 598 763 581 722 q 620 810 613 795 q 642 855 627 825 q 668 899 657 884 q 697 935 679 914 q 732 966 715 956 q 771 984 749 977 q 818 992 794 992 l 901 992 q 956 1064 918 1036 q 1042 1091 994 1091 q 1147 1048 1104 1091 q 1190 942 1190 1004 q 1147 837 1190 880 q 1042 794 1104 794 q 956 821 994 794 q 901 893 918 849 l 818 893 q 793 887 805 893 q 768 867 780 880 q 748 840 756 853 q 727 804 739 828 q 708 766 715 780 q 689 723 701 752 q 625 595 653 640 l 1488 595 l 1488 694 q 1500 716 1488 708 q 1525 715 1513 724 l 1773 567 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 861 674 q 876 659 861 674 q 891 600 891 643 q 861 526 891 556 q 787 496 830 496 l 591 496 l 591 705 l 787 705 q 861 674 830 705 m 959 428 q 994 464 959 428 q 1030 600 1030 499 q 959 772 1030 701 q 787 843 888 843 l 451 843 l 451 149 l 591 149 l 591 357 l 787 357 q 959 428 887 357 m 1334 766 q 1361 701 1334 766 q 1389 496 1389 637 q 1334 226 1389 355 q 1186 5 1279 98 q 964 -143 1093 -88 q 694 -198 836 -198 q 425 -143 553 -198 q 203 5 296 -88 q 55 226 110 98 q 0 496 0 355 q 55 766 0 637 q 203 987 110 894 q 425 1135 296 1080 q 694 1190 553 1190 q 964 1135 836 1190 q 1186 987 1093 1080 q 1334 766 1279 894 z "},"":{"ha":1786,"x_min":0,"x_max":1786,"o":"m 1275 339 q 1249 422 1275 385 q 1181 475 1222 459 q 1163 404 1176 440 q 1142 374 1158 385 q 1108 363 1126 363 q 1089 366 1098 363 q 1054 396 1065 374 q 1051 441 1043 418 q 1069 552 1069 496 q 1022 728 1069 647 q 893 856 974 809 q 716 904 811 904 q 525 847 612 904 q 395 697 437 791 q 541 615 479 675 q 558 572 558 597 q 541 530 558 547 q 499 513 524 513 q 457 530 474 513 q 317 588 398 588 q 177 531 235 588 q 119 391 119 473 q 177 251 119 308 q 317 193 235 193 l 1128 193 q 1232 236 1189 193 q 1275 339 1275 279 m 1394 339 q 1316 152 1394 229 q 1128 74 1238 74 l 317 74 q 93 167 186 74 q 0 391 0 260 q 78 598 0 509 q 270 703 155 686 q 442 934 319 846 q 716 1022 565 1022 q 1033 899 898 1022 q 1185 598 1167 777 q 1334 506 1275 578 q 1394 339 1394 433 m 1587 339 q 1512 92 1587 204 q 1463 67 1494 67 q 1429 77 1444 67 q 1404 114 1409 90 q 1414 159 1400 139 q 1469 339 1469 239 q 1414 520 1469 439 q 1404 564 1400 540 q 1429 602 1409 588 q 1474 611 1449 616 q 1512 586 1498 606 q 1587 339 1587 476 m 1682 682 q 1786 339 1786 529 q 1682 -4 1786 150 q 1632 -30 1664 -30 q 1600 -20 1614 -30 q 1575 18 1580 -6 q 1583 62 1569 42 q 1667 339 1667 189 q 1583 616 1667 491 q 1575 661 1569 636 q 1600 698 1580 685 q 1644 708 1620 712 q 1682 682 1668 703 z "},"":{"ha":1190,"x_min":28,"x_max":1163,"o":"m 1163 -10 q 1114 -128 1163 -79 q 995 -177 1065 -177 q 876 -128 925 -177 q 827 -10 827 -79 q 876 109 827 60 q 995 158 925 158 q 1114 109 1065 158 q 1163 -10 1163 60 m 982 208 q 833 128 893 196 q 773 -31 773 60 q 798 -138 773 -88 q 505 -198 685 -198 q 349 -182 420 -198 q 230 -140 277 -166 q 144 -81 182 -114 q 85 -15 106 -47 q 51 50 64 18 q 33 101 37 81 q 28 132 28 121 q 31 165 28 146 q 46 208 35 183 q 74 253 57 233 q 124 287 91 273 q 197 301 156 301 q 270 287 238 301 q 319 255 301 274 q 346 214 336 237 q 360 176 357 191 q 363 150 363 161 q 345 88 363 124 q 408 55 367 67 q 481 42 450 43 l 512 41 q 659 81 601 41 q 717 184 717 120 q 710 221 717 204 q 686 256 703 239 q 647 288 668 273 q 590 322 626 302 q 517 358 553 341 q 425 402 481 376 q 391 418 403 412 q 246 495 301 460 q 152 574 191 530 q 96 672 112 618 q 80 798 80 725 q 96 914 80 858 q 147 1020 112 970 q 234 1109 182 1071 q 363 1168 286 1146 q 535 1190 440 1190 q 705 1170 628 1190 q 833 1118 783 1150 q 918 1046 883 1087 q 967 964 953 1004 q 982 884 982 923 q 970 820 982 848 q 942 775 959 791 q 904 747 925 758 q 867 732 884 736 q 836 728 849 728 q 830 728 835 728 q 805 728 815 728 q 775 732 795 728 q 741 742 755 736 q 709 764 727 749 q 680 800 691 779 q 662 854 670 821 q 654 930 654 888 q 608 950 643 942 q 546 958 574 957 l 517 959 q 426 935 464 959 q 371 880 388 911 q 355 822 355 850 q 359 788 355 803 q 377 753 363 773 q 419 713 392 732 q 494 672 445 694 q 610 626 543 649 q 717 585 669 607 q 802 542 766 563 q 866 496 838 521 q 913 450 894 471 q 945 401 932 429 q 965 353 958 374 q 977 304 973 332 q 981 256 980 276 q 982 208 982 236 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 546 273 l 546 719 q 539 737 546 730 q 521 744 532 744 l 322 744 q 305 737 312 744 q 298 719 298 730 l 298 273 q 305 255 298 262 q 322 248 312 248 l 521 248 q 539 255 532 248 q 546 273 546 262 m 893 273 l 893 719 q 886 737 893 730 q 868 744 879 744 l 670 744 q 652 737 659 744 q 645 719 645 730 l 645 273 q 652 255 645 262 q 670 248 659 248 l 868 248 q 886 255 879 248 q 893 273 893 262 m 1111 795 q 1151 726 1111 795 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 296 1011 q 365 1051 296 1011 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 m 384 131 q 432 103 384 131 q 595 74 481 74 q 807 131 710 74 q 960 284 904 188 q 1017 496 1017 381 q 960 708 1017 611 q 807 861 904 805 q 595 918 710 918 q 384 861 481 918 q 230 708 287 805 q 174 496 174 611 q 230 284 174 381 q 384 131 287 188 m 670 248 q 652 255 659 248 q 645 273 645 262 l 645 719 q 652 737 645 730 q 670 744 659 744 l 818 744 q 836 737 829 744 q 843 719 843 730 l 843 273 q 836 255 843 262 q 818 248 829 248 l 670 248 m 372 248 q 354 255 361 248 q 347 273 347 262 l 347 719 q 354 737 347 730 q 372 744 361 744 l 521 744 q 539 737 532 744 q 546 719 546 730 l 546 273 q 539 255 546 262 q 521 248 532 248 l 372 248 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 843 273 l 843 719 q 836 737 843 730 q 818 744 829 744 l 372 744 q 354 737 361 744 q 347 719 347 730 l 347 273 q 354 255 347 262 q 372 248 361 248 l 818 248 q 836 255 829 248 q 843 273 843 262 m 1111 795 q 1151 726 1111 795 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 296 1011 q 365 1051 296 1011 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 m 384 131 q 432 103 384 131 q 595 74 481 74 q 807 131 710 74 q 960 284 904 188 q 1017 496 1017 381 q 960 708 1017 611 q 807 861 904 805 q 595 918 710 918 q 384 861 481 918 q 230 708 287 805 q 174 496 174 611 q 230 284 174 381 q 384 131 287 188 m 372 248 q 354 255 361 248 q 347 273 347 262 l 347 719 q 354 737 347 730 q 372 744 361 744 l 818 744 q 836 737 829 744 q 843 719 843 730 l 843 273 q 836 255 843 262 q 818 248 829 248 l 372 248 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 1362 99 l 1389 -143 q 1376 -182 1391 -165 q 1339 -198 1362 -198 l 50 -198 q 12 -182 27 -198 q 0 -143 -2 -165 l 27 99 l 1362 99 m 1290 749 l 1356 149 l 33 149 l 99 749 q 115 781 102 768 q 149 794 129 794 l 347 794 l 347 694 q 376 624 347 653 q 446 595 405 595 q 517 624 488 595 q 546 694 546 653 l 546 794 l 843 794 l 843 694 q 872 624 843 653 q 942 595 901 595 q 1013 624 984 595 q 1042 694 1042 653 l 1042 794 l 1240 794 q 1273 781 1259 794 q 1290 749 1287 768 m 992 893 l 992 694 q 977 660 992 674 q 942 645 963 645 q 908 660 922 645 q 893 694 893 674 l 893 893 q 835 1033 893 975 q 694 1091 777 1091 q 554 1033 612 1091 q 496 893 496 975 l 496 694 q 481 660 496 674 q 446 645 467 645 q 412 660 426 645 q 397 694 397 674 l 397 893 q 484 1103 397 1016 q 694 1190 571 1190 q 905 1103 818 1190 q 992 893 992 1016 z "},"":{"ha":1587,"x_min":0,"x_max":1587,"o":"m 1488 595 q 1558 566 1529 595 q 1587 496 1587 537 q 1558 426 1587 455 q 1488 397 1529 397 l 1476 397 l 1387 -116 q 1353 -175 1381 -152 q 1290 -198 1325 -198 l 298 -198 q 234 -175 262 -198 q 200 -116 206 -152 l 111 397 l 99 397 q 29 426 58 397 q 0 496 0 455 q 29 566 0 537 q 99 595 58 595 l 1488 595 m 376 -25 q 410 -7 396 -23 q 422 29 423 9 l 397 351 q 379 385 395 371 q 343 397 363 398 q 310 379 323 395 q 298 343 296 363 l 322 21 q 338 -12 324 2 q 372 -25 353 -25 l 376 -25 m 694 25 l 694 347 q 680 382 694 367 q 645 397 665 397 q 610 382 625 397 q 595 347 595 367 l 595 25 q 610 -10 595 5 q 645 -25 625 -25 q 680 -10 665 -25 q 694 25 694 5 m 992 25 l 992 347 q 977 382 992 367 q 942 397 963 397 q 908 382 922 397 q 893 347 893 367 l 893 25 q 908 -10 893 5 q 942 -25 922 -25 q 977 -10 963 -25 q 992 25 992 5 m 1265 21 l 1290 343 q 1278 379 1291 363 q 1244 397 1264 395 q 1208 385 1224 398 q 1190 351 1192 371 l 1166 29 q 1178 -7 1164 9 q 1211 -25 1191 -23 l 1215 -25 q 1249 -12 1235 -25 q 1265 21 1263 2 m 369 964 l 297 645 l 195 645 l 273 987 q 342 1098 288 1055 q 466 1141 396 1141 l 595 1141 q 610 1176 595 1161 q 645 1190 625 1190 l 942 1190 q 977 1176 963 1190 q 992 1141 992 1161 l 1121 1141 q 1246 1098 1191 1141 q 1314 987 1300 1055 l 1393 645 l 1290 645 l 1218 964 q 1183 1020 1210 998 q 1121 1042 1156 1042 l 992 1042 q 977 1007 992 1022 q 942 992 963 992 l 645 992 q 610 1007 625 992 q 595 1042 595 1022 l 466 1042 q 404 1020 431 1042 q 369 964 377 998 z "},"":{"ha":1389,"x_min":26,"x_max":1363,"o":"m 768 397 l 818 595 l 621 595 l 571 397 l 768 397 m 1363 787 l 1320 614 q 1296 595 1314 595 l 1042 595 l 993 397 l 1234 397 q 1253 388 1246 397 q 1258 366 1261 377 l 1215 192 q 1190 174 1211 174 l 937 174 l 874 -81 q 850 -99 869 -99 l 677 -99 q 656 -90 664 -99 q 652 -68 649 -81 l 712 174 l 515 174 l 453 -81 q 429 -99 447 -99 l 254 -99 q 235 -90 243 -99 q 230 -68 228 -81 l 291 174 l 50 174 q 30 183 38 174 q 26 205 23 192 l 69 378 q 93 397 74 397 l 346 397 l 396 595 l 155 595 q 136 605 143 595 q 131 626 128 615 l 174 800 q 198 818 178 818 l 452 818 l 515 1073 q 539 1091 520 1091 l 713 1091 q 732 1082 725 1091 q 737 1060 739 1073 l 677 818 l 873 818 l 936 1073 q 961 1091 942 1091 l 1135 1091 q 1154 1082 1146 1091 q 1159 1060 1161 1073 l 1098 818 l 1339 818 q 1359 809 1351 818 q 1363 787 1366 800 z "},"":{"ha":1190,"x_min":83,"x_max":1108,"o":"m 652 374 l 767 260 l 651 144 l 652 374 m 651 848 l 767 732 l 652 618 l 651 848 m 550 -101 l 910 259 l 673 496 l 910 733 l 550 1093 l 550 619 l 353 817 l 281 745 l 529 496 l 281 247 l 353 175 l 550 373 l 550 -101 m 1083 779 q 1095 719 1083 779 q 1108 496 1108 658 q 1083 213 1108 334 q 1015 14 1058 91 q 906 -112 972 -64 q 765 -179 840 -160 q 595 -198 691 -198 q 425 -179 500 -198 q 284 -112 350 -160 q 176 14 219 -64 q 108 213 133 91 q 83 496 83 334 q 108 779 83 658 q 176 979 133 901 q 284 1104 219 1056 q 425 1171 350 1152 q 595 1190 500 1190 q 765 1171 691 1190 q 906 1104 840 1152 q 1015 979 972 1056 q 1083 779 1058 901 z "},"":{"ha":794,"x_min":31,"x_max":763,"o":"m 462 88 l 596 221 l 462 354 l 462 88 m 462 638 l 596 771 l 462 904 l 462 638 m 487 496 l 763 220 l 345 -198 l 345 353 l 115 123 l 31 207 l 319 496 l 31 785 l 115 869 l 345 639 l 345 1190 l 763 772 l 487 496 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 963 129 q 977 143 963 129 q 992 198 992 158 q 963 268 992 239 q 893 298 933 298 q 823 268 853 298 q 794 198 794 239 q 823 129 794 158 q 893 99 853 99 q 963 129 933 99 m 367 724 q 382 739 367 724 q 397 794 397 753 q 367 863 397 834 q 298 893 338 893 q 228 863 257 893 q 198 794 198 834 q 228 724 198 753 q 298 694 257 694 q 367 724 338 694 m 1103 409 q 1147 365 1103 409 q 1190 198 1190 322 q 1103 -12 1190 75 q 893 -99 1016 -99 q 682 -12 770 -99 q 595 198 595 75 q 682 409 595 322 q 893 496 770 496 q 1103 409 1016 496 m 1116 1042 q 1106 1012 1116 1026 l 288 -79 q 248 -99 273 -99 l 124 -99 q 89 -84 104 -99 q 74 -50 74 -70 q 84 -20 74 -34 l 903 1071 q 942 1091 918 1091 l 1066 1091 q 1101 1077 1087 1091 q 1116 1042 1116 1062 m 508 1004 q 552 960 508 1004 q 595 794 595 917 q 508 583 595 670 q 298 496 421 496 q 87 583 174 496 q 0 794 0 670 q 87 1004 0 917 q 298 1091 174 1091 q 508 1004 421 1091 z "},"":{"ha":1389,"x_min":2,"x_max":1387,"o":"m 81 643 l 694 -143 l 22 345 q 2 372 8 355 q 2 405 -3 388 l 81 643 l 81 643 m 439 643 l 950 643 l 694 -143 l 694 -143 l 439 643 m 285 1118 l 439 643 l 81 643 l 234 1118 q 260 1135 240 1135 q 285 1118 279 1135 m 1308 643 l 1387 405 q 1387 372 1392 388 q 1367 345 1381 355 l 694 -143 l 1308 643 l 1308 643 m 1308 643 l 950 643 l 1104 1118 q 1129 1135 1110 1135 q 1155 1118 1149 1135 l 1308 643 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 298 546 l 422 546 l 422 719 l 298 719 l 298 546 m 946 288 l 946 360 q 758 330 866 332 q 557 366 653 329 q 386 461 460 403 l 387 387 q 551 287 455 325 q 762 250 647 250 q 946 288 862 250 m 496 546 l 992 546 l 992 719 l 496 719 l 496 546 m 1389 570 q 1312 298 1389 426 q 1381 120 1381 219 q 1281 -88 1381 -2 q 1038 -174 1180 -174 q 863 -133 943 -174 q 739 -24 784 -92 q 694 -25 724 -25 q 650 -24 665 -25 q 525 -133 605 -92 q 351 -174 446 -174 q 108 -88 208 -174 q 8 120 8 -2 q 77 298 8 219 q 0 570 0 426 q 93 869 0 732 q 346 1086 186 1006 q 694 1166 506 1166 q 1043 1086 883 1166 q 1296 869 1203 1006 q 1389 570 1389 732 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 399 484 l 399 385 l 204 385 l 204 484 l 399 484 m 399 682 l 399 584 l 204 584 l 204 682 l 399 682 m 987 286 l 987 187 l 722 187 l 722 286 l 987 286 m 987 484 l 987 385 l 466 385 l 466 484 l 987 484 m 987 682 l 987 584 l 466 584 l 466 682 l 987 682 m 1091 16 l 1091 977 q 1087 987 1091 983 q 1076 992 1082 992 l 1051 992 l 758 794 l 595 926 l 432 794 l 140 992 l 115 992 q 104 987 109 992 q 99 977 99 983 l 99 16 q 104 5 99 9 q 115 0 109 0 l 1076 0 q 1087 5 1082 0 q 1091 16 1091 9 m 429 876 l 572 992 l 257 992 l 429 876 m 762 876 l 933 992 l 618 992 l 762 876 m 1190 977 l 1190 16 q 1157 -66 1190 -33 q 1076 -99 1124 -99 l 115 -99 q 33 -66 67 -99 q 0 16 0 -33 l 0 977 q 33 1058 0 1025 q 115 1091 67 1091 l 1076 1091 q 1157 1058 1124 1091 q 1190 977 1190 1025 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 694 558 q 570 773 614 710 q 301 1020 463 930 q 247 1048 275 1035 q 174 1073 178 1079 q 201 1043 171 1066 l 231 1019 q 318 947 279 986 q 391 856 357 908 q 446 769 426 805 q 501 667 467 732 q 511 648 508 654 q 576 529 545 583 q 652 410 607 476 q 741 294 697 344 q 843 198 786 243 q 958 128 900 153 q 1077 81 1077 77 q 1039 110 1078 84 q 977 154 998 138 q 838 318 917 199 q 694 558 759 436 m 426 137 q 323 234 367 184 q 247 345 279 284 q 192 465 215 406 q 146 609 169 524 q 106 771 124 694 q 59 966 88 848 q 0 1190 30 1085 q 386 1163 212 1190 q 679 1091 560 1135 q 889 979 799 1048 q 1033 846 980 911 q 1118 692 1087 780 q 1162 537 1150 603 q 1171 383 1173 471 q 1164 249 1170 295 q 1149 138 1159 203 q 1139 55 1139 73 l 1389 -198 l 1308 -198 l 1090 22 q 1020 12 1073 21 q 925 -3 966 2 q 818 -8 885 -9 q 694 5 752 -7 q 564 51 636 18 q 426 137 492 84 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 1059 644 q 1064 652 1059 644 q 1065 681 1070 661 q 1043 712 1060 701 q 1005 718 1025 722 q 694 670 803 670 q 384 718 586 670 q 346 712 363 722 q 324 681 329 701 q 330 644 319 661 q 360 622 340 626 q 595 577 511 586 q 583 368 594 454 q 563 248 573 282 q 531 158 553 213 l 524 142 q 525 104 516 122 q 553 78 533 85 q 570 74 560 74 q 617 106 605 74 l 623 122 q 678 322 665 229 l 711 322 q 766 122 724 229 l 772 106 q 818 74 784 74 q 836 78 829 74 q 864 104 856 85 q 865 142 873 122 l 858 158 q 826 248 836 213 q 806 368 816 282 q 794 577 795 454 q 1028 622 878 586 q 1059 644 1049 626 m 765 724 q 779 738 765 724 q 794 794 794 753 q 765 864 794 835 q 694 893 736 893 q 624 864 653 893 q 595 794 595 835 q 624 724 595 753 q 694 694 653 694 q 765 724 736 694 m 1197 708 q 1219 657 1197 708 q 1240 496 1240 607 q 1197 284 1240 385 q 1081 110 1154 183 q 906 -7 1008 36 q 694 -50 805 -50 q 482 -7 584 -50 q 308 110 381 36 q 192 284 235 183 q 149 496 149 385 q 192 708 149 607 q 308 882 235 809 q 482 999 381 956 q 694 1042 584 1042 q 906 999 805 1042 q 1081 882 1008 956 q 1197 708 1154 809 m 925 1044 q 870 1068 925 1044 q 694 1091 815 1091 q 463 1044 574 1091 q 274 917 353 997 q 146 727 194 837 q 99 496 99 617 q 146 265 99 375 q 274 75 194 155 q 463 -52 353 -5 q 694 -99 574 -99 q 925 -52 815 -99 q 1115 75 1035 -5 q 1242 265 1195 155 q 1290 496 1290 375 q 1242 727 1290 617 q 1115 917 1195 837 q 925 1044 1035 997 m 1334 766 q 1361 701 1334 766 q 1389 496 1389 637 q 1334 226 1389 355 q 1186 5 1279 98 q 964 -143 1093 -88 q 694 -198 836 -198 q 425 -143 553 -198 q 203 5 296 -88 q 55 226 110 98 q 0 496 0 355 q 55 766 0 637 q 203 987 110 894 q 425 1135 296 1080 q 694 1190 553 1190 q 964 1135 836 1190 q 1186 987 1093 1080 q 1334 766 1279 894 z "},"":{"ha":1190,"x_min":53,"x_max":1137,"o":"m 1050 585 q 1115 560 1088 587 q 1137 497 1141 533 l 1103 70 q 1076 16 1100 37 q 1021 -6 1053 -6 q 1014 -5 1016 -6 q 958 23 980 -3 q 938 83 935 49 l 965 415 l 854 409 q 897 223 897 322 q 782 -65 897 56 l 676 41 q 746 223 746 119 q 667 415 746 336 q 475 495 587 495 q 292 424 371 495 l 186 531 q 406 640 279 619 l 611 873 l 495 940 l 355 815 q 295 794 329 792 q 239 822 261 796 q 218 881 216 847 q 245 938 220 915 l 430 1103 q 477 1123 450 1121 q 526 1112 503 1126 l 904 893 q 942 840 932 877 q 922 749 955 788 l 763 570 l 1050 585 m 1059 955 q 1039 935 1059 955 q 961 915 1018 915 q 863 955 904 915 q 823 1053 823 995 q 863 1150 823 1110 q 961 1190 904 1190 q 1059 1150 1018 1190 q 1100 1053 1100 1110 q 1059 955 1100 995 m 475 -48 q 627 -1 557 -48 l 735 -109 q 475 -198 622 -198 q 263 -142 360 -198 q 109 12 166 -85 q 53 223 53 109 q 143 484 53 369 l 250 376 q 204 223 204 308 q 283 31 204 111 q 475 -48 363 -48 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 682 260 l 682 136 q 675 119 682 126 q 657 112 668 112 l 533 112 q 515 119 522 112 q 508 136 508 126 l 508 260 q 515 278 508 271 q 533 285 522 285 l 657 285 q 675 278 668 285 q 682 260 682 271 m 880 645 q 869 575 880 606 q 834 522 857 544 q 793 488 810 499 q 747 460 777 476 q 711 438 722 446 q 691 419 700 430 q 682 397 682 408 l 682 372 q 675 354 682 361 q 657 347 668 347 l 533 347 q 515 354 522 347 q 508 372 508 361 l 508 425 q 517 475 508 452 q 535 512 525 498 q 565 539 546 525 q 597 559 585 553 q 632 575 609 565 q 690 608 673 594 q 707 646 707 622 q 673 702 707 679 q 599 725 639 725 q 525 704 556 725 q 463 639 503 688 q 444 630 457 630 q 429 635 436 630 l 346 698 q 336 714 338 704 q 340 732 335 724 q 611 880 435 880 q 796 811 711 880 q 880 645 880 742 m 788 953 q 742 972 788 953 q 595 992 696 992 q 403 953 494 992 q 245 847 311 913 q 139 689 178 780 q 99 496 99 597 q 139 303 99 395 q 245 145 178 212 q 403 40 311 79 q 595 0 494 0 q 788 40 696 0 q 946 145 880 79 q 1052 303 1012 212 q 1091 496 1091 395 q 1052 689 1091 597 q 946 847 1012 780 q 788 953 880 913 m 1111 795 q 1151 726 1111 795 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 z "},"":{"ha":1091,"x_min":30,"x_max":1061,"o":"m 369 985 q 351 967 369 985 q 284 949 333 949 q 198 985 234 949 q 163 1070 163 1020 q 198 1155 163 1120 q 284 1190 234 1190 q 369 1155 333 1190 q 404 1070 404 1120 q 369 985 404 1020 m 711 452 q 687 400 711 413 q 638 395 664 386 q 601 421 612 403 l 317 760 q 306 772 312 770 q 298 773 301 775 l 295 771 q 298 755 290 765 l 393 647 l 394 373 l 269 19 q 198 -163 217 -130 q 176 -188 186 -183 q 96 -188 137 -208 q 64 -155 74 -178 q 57 -111 54 -132 q 209 368 58 -98 l 213 691 l 147 563 l 174 391 q 174 359 177 373 q 163 338 170 345 q 148 325 156 330 q 135 319 140 320 l 129 318 q 103 320 115 315 q 84 332 91 325 q 73 350 78 340 q 67 365 69 359 q 66 372 66 370 l 30 604 l 194 899 q 281 925 212 925 q 364 894 339 925 l 693 491 q 704 477 698 487 l 706 475 l 705 474 q 711 452 711 464 m 398 336 q 467 161 432 248 q 521 31 502 74 l 539 -12 q 572 -109 567 -84 q 544 -184 581 -163 q 493 -196 517 -201 q 453 -179 469 -191 q 431 -152 438 -167 l 430 -152 q 424 -133 426 -140 l 328 140 l 398 336 m 1037 -123 q 1061 -167 1061 -161 q 1059 -173 1061 -171 q 1047 -172 1052 -177 q 1035 -152 1043 -168 q 1023 -129 1028 -136 q 695 384 935 5 q 701 384 698 383 q 706 388 704 386 l 708 389 q 717 402 717 396 l 1037 -123 z "},"":{"ha":1786,"x_min":2,"x_max":1786,"o":"m 391 420 l 523 420 l 522 625 l 391 420 m 1186 497 q 1147 605 1186 564 q 1033 646 1108 646 l 991 646 l 991 346 l 1032 346 q 1144 390 1102 346 q 1186 497 1186 434 m 741 789 l 742 203 q 734 184 742 192 q 716 177 727 177 l 549 177 q 531 184 538 177 q 523 203 523 192 l 523 251 l 298 251 l 255 188 q 233 177 247 177 l 26 177 q 3 191 10 177 q 5 218 -5 205 l 436 805 q 457 815 443 815 l 715 815 q 733 808 725 815 q 741 789 741 800 m 1284 731 q 1333 689 1284 731 q 1382 497 1382 646 q 1285 262 1382 347 q 1033 177 1187 177 l 824 177 q 805 184 813 177 q 798 203 798 192 l 798 789 q 805 808 798 800 q 824 815 813 815 l 1032 815 q 1284 731 1187 815 m 1503 496 q 1502 474 1503 488 q 1496 418 1502 460 q 1480 339 1490 377 q 1445 255 1469 301 q 1388 176 1421 209 l 1349 176 q 1400 257 1378 211 q 1432 344 1422 303 q 1449 420 1442 384 q 1456 476 1455 455 l 1456 497 q 1456 514 1456 503 q 1450 561 1456 525 q 1435 632 1445 596 q 1403 718 1425 667 q 1352 815 1381 769 l 1385 815 q 1441 732 1417 778 q 1476 645 1465 685 q 1494 571 1487 605 q 1502 516 1500 536 l 1503 496 m 1645 496 q 1645 474 1645 488 q 1639 418 1645 460 q 1622 339 1633 377 q 1587 255 1611 301 q 1530 176 1563 209 l 1490 176 q 1542 257 1520 211 q 1574 344 1564 303 q 1590 420 1584 384 q 1597 476 1597 455 l 1598 497 q 1598 514 1598 503 q 1592 561 1597 525 q 1577 632 1587 596 q 1545 718 1567 667 q 1494 815 1524 769 l 1528 815 q 1583 732 1559 778 q 1619 645 1607 685 q 1637 571 1630 605 q 1645 516 1643 536 l 1645 496 m 1786 496 q 1785 474 1786 488 q 1779 418 1785 460 q 1762 339 1773 377 q 1728 255 1752 301 q 1671 176 1704 209 l 1631 176 q 1683 257 1661 211 q 1714 344 1704 303 q 1731 420 1724 384 q 1738 476 1737 455 l 1738 497 q 1738 514 1738 503 q 1732 561 1738 525 q 1717 632 1727 596 q 1686 718 1707 667 q 1635 815 1664 769 l 1668 815 q 1724 732 1700 778 q 1759 645 1748 685 q 1777 571 1770 605 q 1784 516 1783 536 l 1786 496 z "},"":{"ha":1091,"x_min":0,"x_max":1091,"o":"m 478 -119 q 468 -74 478 -110 q 444 9 458 -37 q 429 63 430 56 q 425 83 428 66 q 418 111 422 101 q 408 128 415 122 q 368 139 396 139 q 314 134 350 139 q 259 130 277 130 q 222 139 233 130 q 214 151 218 143 q 208 166 210 159 q 203 185 206 174 q 199 199 200 196 q 171 397 171 298 q 199 594 171 495 q 203 609 200 598 q 208 627 206 620 q 214 643 210 635 q 222 655 218 651 q 259 663 233 663 q 314 659 277 663 q 368 655 350 655 q 408 666 396 655 q 418 682 415 672 q 425 710 422 693 q 429 731 428 728 q 444 784 430 738 q 468 867 458 831 q 478 912 478 904 q 444 953 478 929 q 386 986 411 977 q 351 992 370 992 q 275 978 325 992 q 200 947 231 965 q 145 896 170 929 q 110 841 121 863 q 74 768 98 820 q 67 753 70 759 q 15 586 29 670 q 0 397 0 501 q 15 208 0 292 q 67 40 29 123 q 132 -84 111 -54 q 270 -183 181 -155 q 275 -184 273 -184 q 351 -198 325 -198 q 386 -192 370 -198 q 444 -159 411 -183 q 478 -119 478 -136 m 601 589 q 567 604 581 589 q 552 639 552 618 q 567 674 552 660 q 595 744 595 703 q 567 815 595 784 q 552 849 552 829 q 567 884 552 870 q 601 899 581 899 q 636 884 622 899 q 694 744 694 826 q 636 604 694 662 q 601 589 620 589 m 777 463 q 742 449 763 449 q 707 463 721 449 q 692 498 692 478 q 707 533 692 519 q 794 744 794 622 q 707 955 794 867 q 692 990 692 970 q 707 1025 692 1010 q 742 1039 722 1039 q 777 1025 762 1039 q 893 744 893 908 q 777 463 893 580 m 917 323 q 882 308 903 308 q 847 323 861 308 q 832 358 832 338 q 847 393 832 378 q 954 554 917 463 q 992 744 992 645 q 954 934 992 843 q 847 1095 917 1025 q 832 1130 832 1110 q 847 1165 832 1150 q 882 1180 862 1180 q 917 1165 902 1180 q 1046 972 1001 1080 q 1091 744 1091 863 q 1046 516 1091 625 q 917 323 1001 408 z "},"":{"ha":1687,"x_min":0,"x_max":1687,"o":"m 236 236 q 218 255 236 236 q 149 273 200 273 q 61 236 98 273 q 25 149 25 200 q 61 61 25 98 q 149 25 98 25 q 236 61 200 25 q 273 149 273 98 q 236 236 273 200 m 633 236 q 615 255 633 236 q 546 273 597 273 q 458 236 494 273 q 422 149 422 200 q 458 61 422 98 q 546 25 494 25 q 633 61 597 25 q 670 149 670 98 q 633 236 670 200 m 633 633 q 615 651 633 633 q 546 670 597 670 q 458 633 494 670 q 422 546 422 597 q 458 458 422 494 q 546 422 494 422 q 633 458 597 422 q 670 546 670 494 q 633 633 670 597 m 1228 236 q 1210 255 1228 236 q 1141 273 1192 273 q 1053 236 1090 273 q 1017 149 1017 200 q 1053 61 1017 98 q 1141 25 1090 25 q 1228 61 1192 25 q 1265 149 1265 98 q 1228 236 1265 200 m 1625 236 q 1607 255 1625 236 q 1538 273 1589 273 q 1450 236 1487 273 q 1414 149 1414 200 q 1450 61 1414 98 q 1538 25 1487 25 q 1625 61 1589 25 q 1662 149 1662 98 q 1625 236 1662 200 m 1228 633 q 1210 651 1228 633 q 1141 670 1192 670 q 1053 633 1090 670 q 1017 546 1017 597 q 1053 458 1017 494 q 1141 422 1090 422 q 1228 458 1192 422 q 1265 546 1265 494 q 1228 633 1265 597 m 1625 633 q 1607 651 1625 633 q 1538 670 1589 670 q 1450 633 1487 670 q 1414 546 1414 597 q 1450 458 1414 494 q 1538 422 1487 422 q 1625 458 1589 422 q 1662 546 1662 494 q 1625 633 1662 597 m 1625 1030 q 1607 1048 1625 1030 q 1538 1066 1589 1066 q 1450 1030 1487 1066 q 1414 942 1414 994 q 1450 855 1414 891 q 1538 818 1487 818 q 1625 855 1589 818 q 1662 942 1662 891 q 1625 1030 1662 994 m 254 254 q 276 233 254 254 q 298 149 298 211 q 254 43 298 87 q 149 0 211 0 q 43 43 87 0 q 0 149 0 87 q 43 254 0 211 q 149 298 87 298 q 254 254 211 298 m 651 254 q 673 233 651 254 q 694 149 694 211 q 651 43 694 87 q 546 0 608 0 q 440 43 484 0 q 397 149 397 87 q 440 254 397 211 q 546 298 484 298 q 651 254 608 298 m 254 651 q 276 629 254 651 q 298 546 298 608 q 254 440 298 484 q 149 397 211 397 q 43 440 87 397 q 0 546 0 484 q 43 651 0 608 q 149 694 87 694 q 254 651 211 694 m 651 651 q 673 629 651 651 q 694 546 694 608 q 651 440 694 484 q 546 397 608 397 q 440 440 484 397 q 397 546 397 484 q 440 651 397 608 q 546 694 484 694 q 651 651 608 694 m 254 1048 q 276 1026 254 1048 q 298 942 298 1004 q 254 837 298 880 q 149 794 211 794 q 43 837 87 794 q 0 942 0 880 q 43 1048 0 1004 q 149 1091 87 1091 q 254 1048 211 1091 m 1246 254 q 1268 233 1246 254 q 1290 149 1290 211 q 1246 43 1290 87 q 1141 0 1203 0 q 1035 43 1079 0 q 992 149 992 87 q 1035 254 992 211 q 1141 298 1079 298 q 1246 254 1203 298 m 651 1048 q 673 1026 651 1048 q 694 942 694 1004 q 651 837 694 880 q 546 794 608 794 q 440 837 484 794 q 397 942 397 880 q 440 1048 397 1004 q 546 1091 484 1091 q 651 1048 608 1091 m 1643 254 q 1665 233 1643 254 q 1687 149 1687 211 q 1643 43 1687 87 q 1538 0 1600 0 q 1432 43 1476 0 q 1389 149 1389 87 q 1432 254 1389 211 q 1538 298 1476 298 q 1643 254 1600 298 m 1246 651 q 1268 629 1246 651 q 1290 546 1290 608 q 1246 440 1290 484 q 1141 397 1203 397 q 1035 440 1079 397 q 992 546 992 484 q 1035 651 992 608 q 1141 694 1079 694 q 1246 651 1203 694 m 1643 651 q 1665 629 1643 651 q 1687 546 1687 608 q 1643 440 1687 484 q 1538 397 1600 397 q 1432 440 1476 397 q 1389 546 1389 484 q 1432 651 1389 608 q 1538 694 1476 694 q 1643 651 1600 694 m 1246 1048 q 1268 1026 1246 1048 q 1290 942 1290 1004 q 1246 837 1290 880 q 1141 794 1203 794 q 1035 837 1079 794 q 992 942 992 880 q 1035 1048 992 1004 q 1141 1091 1079 1091 q 1246 1048 1203 1091 m 1643 1048 q 1665 1026 1643 1048 q 1687 942 1687 1004 q 1643 837 1687 880 q 1538 794 1600 794 q 1432 837 1476 794 q 1389 942 1389 880 q 1432 1048 1389 1004 q 1538 1091 1476 1091 q 1643 1048 1600 1091 z "},"":{"ha":1389,"x_min":0,"x_max":1386,"o":"m 84 -114 q 92 -121 84 -114 q 99 -149 99 -129 q 84 -184 99 -169 q 50 -198 70 -198 q 15 -184 29 -198 q 0 -149 0 -169 q 15 -114 0 -129 q 50 -99 29 -99 q 84 -114 70 -99 m 233 35 q 241 28 233 35 q 248 0 248 20 q 233 -35 248 -20 q 198 -50 219 -50 q 164 -35 178 -50 q 149 0 149 -20 q 164 35 149 20 q 198 50 178 50 q 233 35 219 50 m 283 283 l 481 84 l 412 15 l 213 213 l 283 283 m 531 332 q 538 325 531 332 q 546 298 546 318 q 531 263 546 277 q 496 248 516 248 q 461 263 476 248 q 446 298 446 277 q 461 332 446 318 q 496 347 476 347 q 531 332 516 347 m 1094 546 q 1085 462 1094 500 q 1056 389 1076 423 q 1022 337 1035 355 q 980 287 1008 319 q 945 245 956 260 q 919 206 934 230 q 899 157 904 182 q 893 99 893 131 q 806 -111 893 -24 q 595 -198 718 -198 q 560 -184 575 -198 q 546 -149 546 -169 q 560 -114 546 -129 q 595 -99 575 -99 q 736 -41 677 -99 q 794 99 794 17 q 803 181 794 143 q 831 252 811 219 q 865 303 851 284 q 905 352 879 322 q 951 408 936 388 q 980 465 966 428 q 994 546 994 503 q 892 791 994 689 q 647 893 791 893 q 402 791 504 893 q 300 546 300 689 q 285 511 300 525 q 250 496 270 496 q 215 511 230 496 q 201 546 201 525 q 236 719 201 636 q 331 861 271 801 q 474 957 391 922 q 647 992 556 992 q 820 957 738 992 q 963 861 903 922 q 1058 719 1023 801 q 1094 546 1094 636 m 680 481 q 687 474 680 481 q 694 446 694 467 q 680 412 694 426 q 645 397 665 397 q 610 412 625 397 q 595 446 595 426 q 610 481 595 467 q 645 496 625 496 q 680 481 665 496 m 918 546 q 903 511 918 525 q 868 496 888 496 q 833 511 848 496 q 818 546 818 525 q 768 668 818 618 q 645 719 717 719 q 522 668 574 719 q 471 546 471 618 q 457 511 471 525 q 422 496 442 496 q 387 511 401 496 q 372 546 372 525 q 452 739 372 659 q 645 818 532 818 q 838 739 758 818 q 918 546 918 659 m 1223 770 q 1222 732 1231 750 q 1194 705 1214 713 q 1177 702 1187 702 q 1149 711 1162 702 q 1131 734 1136 719 q 957 963 1078 872 q 938 995 941 975 q 947 1032 935 1015 q 980 1051 960 1048 q 1017 1042 1001 1054 q 1223 770 1159 935 m 1386 832 q 1385 794 1393 813 q 1357 768 1376 776 q 1339 765 1349 765 q 1293 797 1305 765 q 1063 1101 1221 981 q 1043 1134 1046 1114 q 1053 1170 1040 1154 q 1085 1190 1065 1187 q 1121 1180 1105 1193 q 1386 832 1304 1045 z "},"":{"ha":1786,"x_min":2,"x_max":1783,"o":"m 800 446 q 735 489 754 448 q 698 531 722 515 q 645 546 674 546 q 575 517 604 546 q 546 446 546 488 q 574 377 546 403 l 581 371 q 645 347 608 347 q 698 362 674 347 q 735 404 722 377 q 800 446 754 445 m 1240 546 q 1212 615 1240 589 l 1204 621 q 1141 645 1178 645 q 1088 630 1112 645 q 1051 588 1064 615 q 986 546 1032 547 q 1051 503 1032 544 q 1088 462 1064 477 q 1141 446 1112 446 q 1211 475 1182 446 q 1240 546 1240 505 m 910 717 q 867 680 897 690 q 811 683 838 670 q 707 707 763 707 q 630 694 667 707 q 637 694 632 694 q 645 694 643 694 q 777 656 716 694 q 869 553 838 617 q 872 496 882 525 q 833 453 861 467 q 803 446 819 446 q 833 439 819 446 q 872 397 861 426 q 869 340 882 368 q 777 237 838 276 q 645 198 716 198 l 640 198 q 606 202 628 200 l 381 222 l 196 129 q 174 124 185 124 q 129 151 143 124 l 5 399 q 2 436 -3 417 q 25 465 8 455 l 187 557 l 301 764 q 372 990 315 884 q 524 1173 430 1096 q 579 1190 548 1193 q 629 1163 609 1187 q 645 1109 648 1139 q 618 1059 643 1079 q 528 960 564 1013 q 735 1038 623 1025 q 790 1023 766 1042 q 818 973 815 1004 q 803 918 822 942 q 753 891 784 894 q 630 848 688 883 q 707 856 666 856 q 876 817 796 856 q 914 774 904 803 q 910 717 924 745 m 1656 841 l 1780 593 q 1783 556 1789 575 q 1761 527 1778 537 l 1599 435 l 1484 228 q 1413 2 1471 108 q 1262 -181 1356 -104 q 1215 -198 1242 -198 q 1157 -171 1180 -198 q 1140 -117 1138 -147 q 1167 -67 1143 -87 q 1258 33 1221 -21 q 1051 -46 1163 -33 q 1042 -47 1048 -47 q 992 -28 1014 -47 q 968 19 971 -9 q 983 74 964 50 q 1032 102 1001 98 q 1156 144 1097 109 q 1079 136 1120 136 q 910 175 990 136 q 872 218 882 189 q 876 275 862 247 q 918 312 889 302 q 975 309 948 322 q 1079 285 1023 285 q 1156 298 1118 285 q 1148 298 1153 298 q 1141 298 1143 298 q 1009 336 1070 298 q 917 439 948 375 q 914 496 904 467 q 953 539 925 525 q 983 546 966 546 q 953 553 966 546 q 914 595 925 566 q 917 652 904 624 q 1009 755 948 716 q 1141 794 1070 794 l 1146 794 l 1146 794 q 1179 791 1157 792 l 1404 770 l 1590 863 q 1612 868 1600 868 q 1656 841 1643 868 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 818 546 q 833 511 818 525 q 868 496 848 496 q 903 511 888 496 q 918 546 918 525 q 838 739 918 659 q 645 818 758 818 q 452 739 532 818 q 372 546 372 659 q 387 511 372 525 q 422 496 401 496 q 457 511 442 496 q 471 546 471 525 q 522 668 471 618 q 645 719 574 719 q 767 668 716 719 q 818 546 818 618 m 820 957 q 779 974 820 957 q 647 992 738 992 q 474 957 556 992 q 331 861 391 922 q 236 719 271 801 q 201 546 201 636 q 215 511 201 525 q 250 496 230 496 q 285 511 270 496 q 300 546 300 525 q 402 791 300 689 q 647 893 504 893 q 892 791 791 893 q 994 546 994 689 q 980 465 994 503 q 951 408 966 428 q 905 352 936 388 q 865 303 879 322 q 831 252 851 284 q 803 181 811 219 q 794 99 794 143 q 736 -41 794 17 q 595 -99 677 -99 q 560 -114 575 -99 q 546 -149 546 -129 q 560 -184 546 -169 q 595 -198 575 -198 q 806 -111 718 -198 q 893 99 893 -24 q 899 157 893 131 q 919 206 904 182 q 945 245 934 230 q 980 287 956 260 q 1022 337 1008 319 q 1056 389 1035 355 q 1085 462 1076 423 q 1094 546 1094 500 q 1058 719 1094 636 q 963 861 1023 801 q 820 957 903 922 m 458 435 l 633 260 l 184 -189 q 162 -198 175 -198 q 140 -189 149 -198 l 9 -59 q 0 -36 0 -50 q 9 -14 0 -23 l 458 435 m 1249 1181 l 1380 1051 q 1389 1028 1389 1042 q 1380 1005 1389 1015 l 1199 825 l 1179 805 l 1124 750 q 973 950 1073 869 l 1043 1021 l 1204 1181 q 1227 1190 1214 1190 q 1249 1181 1240 1190 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 671 791 q 661 718 671 770 q 637 602 653 680 q 613 486 621 525 q 610 476 612 477 q 599 474 608 475 q 575 473 584 473 q 510 511 530 473 q 490 599 490 550 q 517 734 490 667 q 597 830 544 801 q 636 841 618 841 q 665 828 658 841 q 671 791 671 815 m 1048 463 q 1018 521 1048 474 q 977 573 987 569 q 951 579 961 579 q 776 519 880 579 l 774 521 q 796 625 777 538 q 815 763 815 713 q 627 944 815 944 q 574 939 608 944 q 444 870 501 926 q 357 741 386 814 q 329 594 329 668 q 391 420 329 481 q 567 359 453 359 q 587 357 587 359 q 586 353 587 354 q 566 262 583 326 q 526 184 555 222 q 462 146 497 146 q 429 182 429 146 q 438 219 429 201 q 457 250 446 237 q 480 272 468 262 q 500 287 491 281 q 508 294 508 293 q 503 301 508 296 q 458 330 484 319 q 407 341 431 341 q 358 315 380 341 q 326 257 336 288 q 316 198 316 225 q 356 88 316 130 q 463 47 396 47 q 584 88 527 47 q 675 185 640 129 q 725 304 709 242 q 737 355 730 321 q 749 407 745 390 q 760 421 751 416 q 935 467 851 467 q 1034 453 973 467 q 1037 453 1035 453 q 1044 456 1041 453 q 1048 463 1048 460 m 1190 868 l 1190 124 q 1125 -34 1190 32 q 967 -99 1059 -99 l 223 -99 q 65 -34 131 -99 q 0 124 0 32 l 0 868 q 65 1026 0 960 q 223 1091 131 1091 l 967 1091 q 1125 1026 1059 1091 q 1190 868 1190 960 z "},"":{"ha":1190,"x_min":29,"x_max":1161,"o":"m 577 954 q 575 984 577 973 q 568 1007 574 995 q 552 1025 563 1019 q 523 1031 541 1031 q 463 1013 493 1031 q 339 865 381 968 q 298 656 298 763 q 304 590 298 622 q 325 528 311 558 q 365 479 339 498 q 429 461 392 461 q 443 461 432 461 q 458 461 453 460 q 470 463 463 461 q 482 470 478 465 q 488 482 486 474 q 525 662 500 542 q 562 841 550 781 q 577 954 577 911 m 1161 446 q 1155 435 1161 440 q 1143 430 1149 430 l 1139 431 q 1090 439 1121 433 q 1035 449 1059 446 q 986 453 1010 453 q 714 381 856 453 q 698 360 702 374 q 679 278 690 332 q 661 200 667 224 q 607 61 643 129 q 520 -67 570 -8 q 400 -162 469 -126 q 257 -198 331 -198 q 90 -134 152 -198 q 29 36 29 -69 q 44 127 29 78 q 93 217 59 177 q 168 258 126 258 q 261 232 198 258 q 326 184 325 206 q 313 175 326 184 q 282 151 300 166 q 246 116 264 136 q 216 69 229 97 q 204 12 204 41 q 217 -29 204 -14 q 254 -45 229 -45 q 320 -21 289 -45 q 372 40 351 4 q 409 122 392 76 q 434 205 426 167 q 446 274 443 242 l 446 281 q 444 284 446 283 q 437 285 441 285 q 429 285 433 285 q 422 285 426 285 q 417 284 418 284 q 144 379 241 284 q 47 649 47 474 q 74 821 47 733 q 148 984 101 908 q 269 1113 196 1059 q 428 1183 343 1168 q 510 1190 468 1190 q 800 911 800 1190 q 770 699 800 835 q 737 536 741 563 l 739 533 q 881 601 818 577 q 1011 625 944 625 q 1052 615 1028 625 q 1114 536 1066 610 q 1161 446 1161 462 z "},"":{"ha":1290,"x_min":1,"x_max":1289,"o":"m 644 669 q 690 655 669 669 l 862 540 q 947 465 909 509 l 1060 333 q 1083 251 1091 298 l 1027 -69 q 1004 -110 1022 -94 q 961 -130 986 -127 l 553 -174 l 280 -198 l 273 -198 q 221 -177 243 -198 q 198 -124 198 -155 q 219 -74 198 -95 q 270 -50 240 -53 l 471 -25 l 124 -25 q 70 -2 92 -25 q 50 53 48 22 q 74 104 51 84 q 128 124 98 124 l 470 125 l 67 174 q 16 203 35 178 q 1 260 -4 228 q 28 304 5 287 q 78 322 50 322 l 86 322 l 459 275 l 187 348 q 139 380 157 356 q 125 433 120 405 q 150 479 129 461 q 198 496 171 496 q 214 494 203 496 l 561 420 l 729 391 q 732 391 730 391 q 734 391 733 391 q 758 408 752 391 q 748 436 763 426 l 604 533 q 571 582 577 551 q 585 639 566 614 q 644 669 606 669 m 590 512 l 734 415 l 565 444 l 561 446 l 533 475 l 349 678 q 347 681 348 679 q 345 684 346 683 q 331 738 326 708 q 360 787 335 768 q 412 801 384 805 q 462 775 441 797 l 572 661 q 568 658 570 660 q 565 655 566 656 q 547 578 540 620 q 590 512 554 536 m 1277 864 l 1289 658 q 1280 544 1292 601 l 1243 374 q 1191 307 1234 329 l 1109 265 q 1079 350 1111 313 l 966 481 q 875 561 925 529 l 703 676 q 644 694 677 694 q 576 665 605 694 l 394 907 q 380 964 374 932 q 412 1013 385 995 q 467 1024 437 1030 q 515 993 497 1018 l 722 720 l 519 1073 q 510 1131 502 1100 q 547 1177 519 1162 q 603 1181 574 1190 q 648 1146 632 1172 l 835 820 l 729 1081 q 726 1139 718 1108 q 760 1182 734 1169 q 819 1187 789 1197 q 863 1147 849 1177 l 1012 825 l 1090 674 q 1108 660 1097 662 q 1129 666 1120 658 q 1138 686 1139 674 l 1128 860 q 1149 915 1127 891 q 1202 939 1170 938 q 1254 916 1232 939 q 1277 864 1276 894 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 260 140 q 255 141 258 140 q 124 253 188 185 q 16 393 60 322 q 0 446 0 416 q 2 461 0 453 q 5 475 3 469 q 10 489 6 481 q 17 501 14 497 q 25 515 19 506 q 33 526 30 523 q 42 538 35 529 q 50 550 49 547 q 401 832 193 744 q 315 996 315 986 q 329 1018 315 1011 q 428 1068 419 1068 q 450 1056 442 1068 l 546 878 q 694 893 617 893 q 1080 786 901 893 q 1373 500 1259 680 q 1389 446 1389 476 q 1373 393 1389 417 q 1204 196 1303 283 q 988 60 1105 110 q 1073 -103 1073 -93 q 1060 -126 1073 -119 q 962 -175 970 -175 q 939 -163 947 -175 l 843 15 l 794 107 l 450 742 l 455 748 q 378 711 410 729 q 477 530 381 708 q 665 182 573 353 q 757 9 757 12 q 750 2 757 4 q 694 0 740 0 q 648 5 650 0 l 295 657 q 231 605 264 636 q 397 300 250 571 q 544 25 544 28 q 536 17 544 17 q 472 34 525 17 q 415 56 419 51 l 333 208 l 160 529 q 99 446 126 488 q 113 427 101 444 q 131 401 126 410 l 267 147 q 260 140 267 140 m 903 219 l 941 148 q 1290 446 1152 234 q 934 748 1150 661 q 1014 633 986 698 q 1042 496 1042 567 q 1005 341 1042 414 q 903 219 969 267 m 668 721 q 663 715 668 721 q 657 694 657 710 q 668 668 657 679 q 694 657 679 657 q 808 610 761 657 q 856 496 856 563 q 867 470 856 481 q 893 459 877 459 q 919 470 908 459 q 930 496 930 481 q 861 663 930 594 q 694 732 792 732 q 668 721 679 732 m 941 745 l 934 748 l 939 742 l 941 745 z "},"":{"ha":992,"x_min":0,"x_max":991,"o":"m 814 333 q 700 43 814 167 q 407 -81 585 -81 q 114 43 227 -81 q 0 333 0 167 q 53 543 0 447 q 199 695 105 639 q 407 752 293 752 q 548 728 481 752 q 518 630 523 680 q 407 652 467 652 q 189 556 277 652 q 102 331 102 461 q 189 107 102 199 q 407 16 276 16 q 625 107 538 16 q 711 331 711 199 q 687 460 711 400 q 782 498 738 470 q 814 333 814 422 m 656 480 q 594 212 656 331 q 409 16 532 94 l 398 16 q 350 19 376 16 q 464 99 415 44 q 541 219 513 153 q 586 365 569 284 q 610 514 604 446 q 615 653 615 582 q 613 732 615 706 q 656 480 656 608 m 613 734 l 613 732 q 453 1073 556 898 q 564 929 522 1028 q 613 734 606 830 m 802 577 q 678 635 738 577 q 903 826 847 728 q 919 870 918 855 q 811 741 887 797 q 653 665 736 684 q 625 753 625 707 q 639 814 625 781 q 672 867 652 846 q 794 924 708 901 q 876 969 839 936 q 933 1047 912 1002 q 991 851 991 966 q 972 719 991 767 q 903 618 947 660 q 802 577 860 577 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 814 384 q 792 498 814 444 q 726 471 760 478 q 743 383 743 432 q 684 229 743 292 q 534 166 624 166 q 384 229 444 166 q 324 383 324 292 q 384 537 324 472 q 534 603 445 603 q 610 588 575 603 q 631 656 613 622 q 534 672 584 672 q 334 588 415 672 q 254 384 254 504 q 334 181 254 264 q 534 99 415 99 q 734 182 653 99 q 814 384 814 264 m 676 659 q 677 604 677 640 q 674 508 677 555 q 658 406 670 462 q 626 305 646 350 q 573 223 607 260 q 495 168 539 185 q 528 166 512 166 l 536 166 q 705 484 705 274 q 676 659 705 574 m 676 659 q 642 792 673 721 q 566 893 611 863 q 676 659 637 772 m 935 740 q 896 875 935 819 q 800 791 864 808 q 715 749 746 776 q 684 672 684 722 q 703 612 684 641 q 812 664 760 625 q 886 753 863 703 q 828 667 883 713 q 721 591 773 621 q 806 551 761 551 q 876 580 846 551 q 922 649 906 608 q 935 740 935 682 m 1190 868 l 1190 124 q 1125 -34 1190 32 q 967 -99 1059 -99 l 223 -99 q 65 -34 131 -99 q 0 124 0 32 l 0 868 q 65 1026 0 960 q 223 1091 131 1091 l 967 1091 q 1125 1026 1059 1091 q 1190 868 1190 960 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 991 301 q 974 322 991 318 q 883 367 922 333 q 821 451 843 401 q 815 470 815 466 q 830 491 815 482 q 864 504 846 499 q 897 520 882 508 q 912 548 912 531 q 898 572 912 563 q 868 582 884 582 q 843 576 859 582 q 819 570 828 570 q 810 571 816 570 q 814 660 814 645 q 801 748 814 721 q 721 842 773 808 q 603 876 669 876 q 390 748 449 876 q 377 660 377 721 q 381 571 377 645 q 370 570 377 570 q 345 575 360 570 q 322 581 329 581 q 292 572 305 581 q 278 547 278 563 q 293 520 278 531 q 327 504 308 508 q 360 491 345 499 q 375 470 375 482 q 370 451 375 466 q 216 322 320 344 q 199 301 199 318 q 305 248 199 265 q 310 228 307 244 q 319 204 313 212 q 337 197 325 197 q 366 200 346 197 q 397 204 386 204 q 449 192 424 204 q 491 167 474 181 q 535 142 508 153 q 594 130 563 130 q 656 142 628 130 q 700 167 684 153 q 742 192 717 181 q 794 204 767 204 q 824 201 805 204 q 854 198 844 198 q 872 205 867 198 q 880 229 877 213 q 885 248 884 244 q 991 301 991 265 m 1111 795 q 1151 726 1111 795 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 z "},"":{"ha":1290,"x_min":12,"x_max":1278,"o":"m 657 1091 q 844 1038 761 1092 q 970 889 926 984 q 991 750 991 844 q 984 602 991 714 q 1006 597 995 597 q 1046 607 1020 597 q 1085 618 1071 618 q 1128 604 1108 618 q 1149 568 1149 590 q 1125 526 1149 543 q 1072 502 1101 509 q 1018 479 1042 494 q 994 443 994 464 q 1003 409 994 431 q 1082 293 1032 346 q 1194 215 1133 240 q 1256 197 1216 205 q 1278 170 1278 192 q 1108 90 1278 115 q 1100 60 1103 81 q 1089 24 1097 38 q 1063 9 1081 9 q 1015 14 1048 9 q 966 19 983 19 q 918 16 937 19 q 869 -2 893 12 q 824 -31 845 -16 q 779 -63 803 -47 q 720 -89 755 -78 q 643 -99 685 -99 q 568 -89 603 -99 q 510 -63 534 -78 q 466 -31 487 -47 q 421 -2 445 -16 q 373 16 397 12 q 324 19 353 19 q 273 14 305 19 q 228 8 241 8 q 201 22 208 8 q 190 59 193 36 q 181 90 187 81 q 12 170 12 115 q 33 197 12 192 q 95 215 74 205 q 207 293 156 239 q 287 409 259 346 q 296 443 296 431 q 272 479 296 464 q 218 502 247 494 q 164 527 188 510 q 140 567 140 543 q 160 603 140 588 q 202 617 180 617 q 239 607 214 617 q 281 597 265 597 q 305 602 295 597 q 298 749 298 712 q 319 889 298 844 q 453 1042 369 995 q 657 1091 536 1090 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 992 301 q 975 322 992 318 q 884 367 923 332 q 822 451 844 401 q 816 470 816 462 q 831 491 816 482 q 864 504 846 499 q 897 520 882 508 q 912 548 912 531 q 898 572 912 563 q 868 582 884 582 q 844 576 860 582 q 819 570 829 570 q 810 571 816 570 q 814 660 814 620 q 801 749 814 721 q 721 843 773 809 q 603 877 670 877 q 390 749 450 877 q 376 660 376 719 q 381 571 376 630 q 369 570 373 570 q 345 576 360 570 q 321 582 329 582 q 292 572 305 582 q 278 547 278 563 q 293 520 278 531 q 326 504 308 508 q 359 491 344 499 q 374 470 374 482 q 369 451 374 462 q 215 322 319 344 q 198 301 198 318 q 305 247 198 264 q 310 227 307 243 q 319 203 313 211 q 336 196 324 196 q 366 200 346 196 q 396 204 386 204 q 448 192 423 204 q 491 167 474 181 q 535 142 508 153 q 594 130 563 130 q 656 142 628 130 q 700 167 684 153 q 742 192 717 181 q 794 204 767 204 q 825 200 805 204 q 855 197 845 197 q 872 204 867 197 q 881 228 878 212 q 885 247 884 245 q 992 301 992 264 m 1190 868 l 1190 124 q 1125 -34 1190 32 q 967 -99 1059 -99 l 223 -99 q 65 -34 131 -99 q 0 124 0 32 l 0 868 q 65 1026 0 960 q 223 1091 131 1091 l 967 1091 q 1125 1026 1059 1091 q 1190 868 1190 960 z "},"":{"ha":1786,"x_min":0,"x_max":1786,"o":"m 1786 1190 q 1689 1119 1732 1155 q 1620 1056 1645 1084 q 1574 1001 1594 1029 q 1545 956 1553 973 q 1528 922 1536 940 q 1517 899 1519 904 q 1489 793 1509 885 q 1452 666 1469 701 q 1413 619 1440 643 q 1361 580 1386 594 q 1304 548 1335 565 q 1267 526 1273 531 q 1150 347 1231 502 q 662 225 886 358 q 427 86 591 184 q 494 110 463 98 q 536 127 524 122 l 548 133 q 674 183 603 153 q 778 224 746 212 q 861 251 810 236 q 972 275 913 265 q 1332 270 1116 299 q 1340 267 1333 270 q 1351 254 1349 263 q 1349 237 1353 246 l 1198 -30 q 1162 -47 1187 -53 q 887 -29 1063 -29 q 576 -63 774 -29 q 272 -99 377 -98 q 157 -89 208 -100 q 74 -60 105 -78 q 26 -29 43 -43 q 1 -3 10 -16 l 0 -2 q 0 -1 0 -2 q 5 4 0 4 q 292 47 112 4 q 582 453 441 330 q 880 575 724 575 q 891 575 884 575 q 920 571 898 574 q 963 562 942 567 q 1011 543 984 556 q 1059 512 1038 529 q 1101 466 1081 494 q 1132 402 1121 438 l 1211 539 q 1228 572 1213 543 q 1262 639 1242 602 q 1309 724 1282 677 q 1375 828 1337 772 q 1452 934 1412 884 q 1552 1044 1504 997 q 1646 1118 1600 1090 q 1718 1160 1692 1147 q 1786 1190 1743 1173 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 1025 496 q 1021 437 1025 461 l 838 448 l 1011 388 q 966 278 997 331 l 801 358 l 938 236 q 855 152 904 188 l 733 290 l 813 123 q 705 78 766 95 l 643 254 l 654 68 q 595 64 625 64 q 536 68 566 64 l 547 253 l 487 78 q 378 123 429 92 l 458 290 l 336 152 q 253 236 291 185 l 391 358 l 225 277 q 180 387 195 331 l 353 448 l 170 437 q 166 496 166 470 q 170 556 166 523 l 354 545 l 180 606 q 225 715 195 663 l 391 634 l 253 757 q 336 841 289 805 l 459 703 l 379 870 q 488 915 431 900 l 547 741 l 537 924 q 595 929 565 929 q 654 924 625 929 l 643 740 l 704 915 q 812 869 761 900 l 732 703 l 855 841 q 938 757 902 805 l 801 634 l 966 715 q 1011 605 994 667 l 837 545 l 1021 556 q 1025 496 1025 532 m 1048 496 q 987 725 1048 620 q 822 891 926 830 q 595 952 718 952 q 419 916 503 952 q 275 819 336 880 q 178 674 214 758 q 143 496 143 589 q 178 319 143 404 q 275 174 214 235 q 419 77 336 113 q 595 41 503 41 q 822 102 718 41 q 987 268 926 163 q 1048 496 1048 373 m 1104 793 l 1104 199 l 595 -98 l 86 199 l 86 793 l 595 1090 l 1104 793 m 595 -142 l 1144 177 l 1144 815 l 595 1134 l 47 815 l 47 177 l 595 -142 m 1190 843 l 1190 149 l 595 -198 l 0 149 l 0 843 l 595 1190 l 1190 843 z "},"":{"ha":1290,"x_min":0,"x_max":1290,"o":"m 263 1022 l 798 1022 l 778 966 l 263 966 q 117 904 177 966 q 56 758 56 843 l 56 160 q 103 29 56 87 q 222 -43 150 -29 q 298 -47 239 -47 l 298 -103 l 263 -103 q 77 -26 154 -103 q 0 160 0 52 l 0 758 q 77 944 0 867 q 263 1022 154 1022 m 922 1190 l 1114 1190 l 740 188 q 709 107 722 140 q 674 31 695 74 q 632 -41 653 -12 q 582 -102 612 -71 q 520 -152 553 -133 q 446 -184 488 -171 q 357 -198 405 -197 l 357 -47 q 527 94 483 -27 q 543 175 543 134 q 527 257 543 217 l 306 825 l 483 825 l 628 372 l 922 1190 m 1290 758 l 1290 -103 l 674 -103 q 708 -47 702 -60 l 1234 -47 l 1234 758 q 1196 878 1234 824 q 1095 955 1157 932 l 1115 1007 q 1241 911 1193 980 q 1290 758 1290 842 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 647 992 q 654 983 647 992 q 660 951 660 973 q 647 910 660 929 q 612 892 634 892 q 577 910 591 892 q 564 951 564 929 q 577 992 564 973 q 612 1010 591 1010 q 647 992 634 1010 m 533 -115 l 533 -27 q 517 13 533 -4 q 478 29 501 29 q 439 13 455 29 q 424 -27 424 -4 l 424 -115 q 440 -156 424 -139 q 478 -173 456 -173 q 517 -156 501 -173 q 533 -115 533 -139 m 667 -115 l 667 -27 q 651 13 667 -4 q 612 29 636 29 q 573 13 589 29 q 557 -27 557 -4 l 557 -115 q 573 -156 557 -139 q 612 -173 589 -173 q 651 -156 635 -173 q 667 -115 667 -139 m 801 -115 l 801 -27 q 786 13 801 -4 q 746 29 770 29 q 707 13 723 29 q 691 -27 691 -4 l 691 -115 q 707 -156 691 -139 q 746 -173 723 -173 q 786 -156 770 -173 q 801 -115 801 -139 m 936 -115 l 936 -27 q 920 13 936 -4 q 881 29 904 29 q 842 13 858 29 q 826 -27 826 -4 l 826 -115 q 842 -156 826 -139 q 881 -173 858 -173 q 920 -156 904 -173 q 936 -115 936 -139 m 1144 415 q 964 214 1079 291 q 714 136 849 136 q 536 176 618 136 q 398 283 453 216 q 310 436 342 349 q 278 615 278 522 q 295 750 278 684 q 214 448 214 615 q 264 206 214 322 q 408 12 315 90 q 478 56 431 56 q 545 17 522 56 q 612 56 570 56 q 679 17 656 56 q 746 56 704 56 q 814 17 789 56 q 880 56 837 56 q 921 44 902 56 q 950 12 940 32 q 1087 192 1037 85 q 1144 415 1138 298 m 1028 437 q 972 495 1028 495 q 935 491 959 495 q 820 476 862 476 q 645 664 645 476 q 668 822 645 731 q 604 609 604 724 q 673 407 604 493 q 855 322 742 322 q 1018 376 941 322 q 1028 437 1028 413 m 685 948 q 660 1017 685 987 q 598 1048 636 1048 q 535 1017 560 1048 q 510 948 510 987 q 534 878 510 908 q 598 847 559 847 q 661 878 636 847 q 685 948 685 908 m 1173 685 q 1144 824 1173 760 q 1056 930 1115 888 q 922 972 997 972 q 806 945 862 972 q 708 872 750 918 q 670 664 670 749 q 706 543 670 584 q 820 501 741 501 q 930 516 861 501 q 971 521 958 521 q 1031 499 1011 521 q 1052 437 1052 477 q 1049 401 1052 417 q 1140 530 1107 454 q 1173 685 1173 605 m 1389 517 q 1363 324 1389 431 q 1290 165 1337 216 q 1139 55 1246 115 q 963 -26 1033 -6 l 960 -27 l 960 -115 q 937 -174 960 -149 q 880 -198 914 -198 q 814 -160 837 -198 q 746 -198 789 -198 q 679 -160 704 -198 q 612 -198 656 -198 q 545 -160 570 -198 q 478 -198 522 -198 q 420 -172 442 -198 q 398 -109 398 -146 q 245 -162 329 -162 q 81 -100 153 -162 q 164 -84 123 -99 q 22 14 76 -60 q 78 9 47 9 q 205 44 146 9 q 19 281 56 193 q 0 405 0 325 q 7 503 0 450 q 31 616 14 556 q 74 725 49 677 q 141 807 99 774 q 234 839 183 839 q 297 799 280 839 q 329 841 312 822 q 339 851 331 843 q 349 863 346 859 q 367 893 357 875 q 386 925 377 911 q 408 956 395 940 q 572 1093 475 1042 q 773 1144 668 1144 q 822 1141 801 1144 q 935 1190 867 1190 q 1043 1146 999 1190 q 1047 1137 1047 1142 q 1042 1127 1047 1133 q 1033 1114 1038 1120 q 1020 1101 1028 1108 q 1012 1093 1013 1094 q 1040 1079 1025 1088 q 1055 1060 1055 1070 q 1042 1041 1055 1056 q 1195 748 1164 934 q 1242 771 1215 771 q 1319 733 1277 771 q 1389 517 1389 671 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 711 489 q 706 539 711 515 l 426 539 l 426 436 l 594 436 q 536 343 584 377 q 426 308 488 308 q 295 364 349 308 q 240 496 240 419 q 295 628 240 573 q 426 684 349 684 q 544 638 498 684 l 625 716 q 426 794 541 794 q 215 706 301 794 q 128 496 128 619 q 215 286 128 373 q 426 198 301 198 q 632 280 553 198 q 711 489 711 361 m 978 453 l 1063 453 l 1063 539 l 978 539 l 978 624 l 893 624 l 893 539 l 808 539 l 808 453 l 893 453 l 893 368 l 978 368 l 978 453 m 1111 795 q 1151 726 1111 795 q 1190 496 1190 658 q 1111 197 1190 334 q 894 -19 1031 60 q 595 -99 757 -99 q 296 -19 433 -99 q 80 197 160 60 q 0 496 0 334 q 80 795 0 658 q 296 1011 160 932 q 595 1091 433 1091 q 894 1011 757 1091 q 1111 795 1031 932 z "},"":{"ha":1190,"x_min":29,"x_max":1190,"o":"m 1190 794 l 1190 143 q 1152 95 1190 106 q 891 55 1018 55 q 724 78 834 55 q 547 101 613 101 q 260 64 420 101 l 260 -198 l 136 -198 l 136 862 q 58 925 88 881 q 29 1021 29 968 q 78 1141 29 1091 q 198 1190 128 1190 q 319 1141 269 1190 q 368 1021 368 1091 q 339 925 368 968 q 260 862 309 881 l 260 809 q 526 843 408 843 q 680 832 603 843 q 766 814 691 830 q 882 798 842 798 q 1010 812 942 798 q 1072 829 1018 814 q 1141 843 1125 843 q 1176 829 1161 843 q 1190 794 1190 814 z "},"":{"ha":1786,"x_min":0,"x_max":1786,"o":"m 105 322 q 112 310 105 322 q 149 298 118 298 q 192 322 180 298 q 192 372 205 347 q 149 397 180 397 q 105 372 118 397 q 105 322 93 347 m 1290 343 q 1261 381 1283 353 q 1228 423 1239 410 q 1199 461 1218 436 q 1166 502 1180 486 q 1135 539 1152 519 q 1100 577 1117 559 l 1003 468 q 841 397 939 395 q 682 473 744 398 q 638 595 638 526 q 684 717 639 664 l 821 877 q 781 889 804 885 q 744 894 759 894 q 701 894 730 894 q 663 893 671 893 q 540 842 591 893 l 418 719 l 298 719 l 298 298 q 314 298 301 298 q 331 298 326 298 q 346 296 336 298 q 362 293 357 295 q 376 286 367 291 q 390 276 384 282 l 620 50 q 796 -36 709 -36 q 893 0 856 -36 q 980 6 937 -16 q 1036 72 1023 28 q 1135 106 1094 67 q 1163 141 1150 120 q 1173 181 1175 163 q 1207 173 1181 173 q 1266 189 1240 173 q 1305 230 1293 205 q 1314 286 1317 255 q 1290 343 1311 316 m 1414 298 l 1488 298 l 1488 694 l 1416 694 l 1294 834 q 1163 893 1243 893 l 1034 893 q 921 841 965 893 l 759 653 q 737 594 737 627 q 758 536 737 562 q 843 496 791 497 q 929 534 895 495 l 1079 703 q 1120 720 1098 721 q 1157 699 1142 718 q 1163 655 1171 679 q 1207 606 1176 640 q 1253 553 1238 572 q 1317 472 1276 525 q 1367 406 1359 418 q 1414 298 1407 355 m 1594 322 q 1600 310 1594 322 q 1637 298 1606 298 q 1680 322 1668 298 q 1680 372 1693 347 q 1637 397 1668 397 q 1594 372 1606 397 q 1594 322 1581 347 m 1786 744 l 1786 248 q 1771 213 1786 228 q 1736 198 1756 198 l 1400 198 q 1336 116 1379 148 q 1239 76 1294 84 q 1177 13 1214 39 q 1097 -22 1140 -13 q 1016 -86 1065 -64 q 917 -105 968 -108 q 819 -135 870 -131 q 720 -124 768 -140 q 630 -83 673 -109 q 550 -20 587 -57 l 327 198 l 50 198 q 15 213 29 198 q 0 248 0 228 l 0 769 q 15 804 0 789 q 50 818 29 818 l 376 818 q 412 856 387 829 q 449 893 438 882 q 483 924 460 904 q 522 953 506 944 q 562 973 539 962 q 610 988 585 984 q 663 992 635 992 l 753 992 q 894 949 830 992 q 1034 992 957 992 l 1163 992 q 1215 987 1190 992 q 1259 976 1240 983 q 1299 956 1278 970 q 1333 932 1320 942 q 1367 901 1347 922 q 1397 868 1387 880 q 1429 831 1407 856 q 1461 794 1450 806 l 1736 794 q 1771 779 1756 794 q 1786 744 1786 764 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 1389 684 l 1389 -74 q 1352 -162 1389 -126 q 1265 -198 1316 -198 l 124 -198 q 36 -162 73 -198 q 0 -74 0 -126 l 0 684 q 9 702 0 695 q 39 729 15 708 q 71 757 63 750 q 106 786 79 763 q 160 829 133 808 q 235 885 188 849 q 346 968 282 922 q 495 1077 410 1015 q 536 1108 499 1080 q 591 1149 573 1136 q 641 1176 610 1162 q 694 1190 672 1190 q 748 1176 717 1190 q 798 1149 779 1162 q 853 1108 818 1135 q 894 1077 889 1081 q 1043 968 979 1015 q 1154 885 1107 922 q 1228 829 1201 849 q 1283 786 1256 808 q 1318 757 1310 763 q 1350 729 1326 750 q 1380 702 1374 708 q 1389 684 1389 695 m 952 230 q 1219 426 1156 378 q 1229 441 1228 432 q 1224 460 1230 451 l 1194 500 q 1178 510 1188 508 q 1159 505 1168 511 q 894 311 980 374 q 853 281 890 308 q 798 240 817 253 q 748 213 779 227 q 694 198 717 198 q 641 213 672 198 q 591 240 610 227 q 536 281 572 253 q 495 311 499 308 q 229 505 351 415 q 211 510 221 511 q 195 500 201 508 l 165 460 q 160 441 159 451 q 170 426 161 432 q 437 230 233 378 q 476 201 445 224 q 526 164 507 177 q 576 134 546 151 q 636 108 606 116 q 694 99 666 99 q 753 108 723 99 q 814 134 783 116 q 864 165 846 153 q 915 202 883 177 q 952 230 946 226 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 1142 483 l 1173 443 q 1178 425 1179 435 q 1169 409 1177 415 q 1071 333 1135 383 q 957 245 1006 283 q 905 205 908 208 q 859 168 875 181 q 812 136 842 156 q 753 108 781 117 q 695 99 724 99 l 694 99 l 694 99 q 636 108 665 99 q 577 136 608 117 q 530 169 547 156 q 484 205 513 181 q 433 245 480 208 q 322 331 387 281 q 227 404 257 381 q 217 420 219 410 q 222 438 216 429 l 251 478 q 268 488 257 487 q 287 483 278 490 q 524 300 360 426 q 558 273 528 297 q 605 237 587 249 q 648 212 622 225 q 694 198 675 198 l 694 198 l 695 198 q 741 212 714 198 q 784 237 767 225 q 831 273 801 249 q 865 300 861 297 q 1108 488 1065 453 q 1126 493 1116 494 q 1142 483 1136 491 m 1290 -74 l 1290 645 q 1166 753 1220 709 q 865 988 1096 810 q 832 1015 863 990 q 784 1053 801 1041 q 741 1078 768 1064 q 695 1091 714 1091 l 694 1091 l 694 1091 q 648 1078 675 1091 q 605 1053 621 1064 q 557 1015 588 1041 q 524 988 526 990 q 279 798 357 860 q 179 717 202 736 q 115 660 157 698 q 99 645 105 650 l 99 -74 q 107 -92 99 -84 q 124 -99 114 -99 l 1265 -99 q 1282 -92 1275 -99 q 1290 -74 1290 -84 m 1389 645 l 1389 -74 q 1352 -162 1389 -126 q 1265 -198 1316 -198 l 124 -198 q 36 -162 73 -198 q 0 -74 0 -126 l 0 645 q 32 718 0 688 q 303 943 127 806 q 484 1084 479 1080 q 529 1120 512 1107 q 577 1153 547 1134 q 636 1181 607 1172 q 694 1190 665 1190 l 694 1190 l 695 1190 q 753 1181 724 1190 q 812 1153 782 1172 q 860 1120 842 1134 q 905 1084 877 1107 q 1026 989 939 1056 q 1201 852 1114 922 q 1357 718 1289 781 q 1389 645 1389 688 z "},"":{"ha":1190,"x_min":16,"x_max":1174,"o":"m 256 1 l 412 -165 l 386 18 l 219 183 l 256 1 m 431 -174 l 643 -5 l 635 184 l 402 18 l 431 -174 m 190 320 l 366 155 l 329 408 l 139 567 l 190 320 m 384 146 l 629 312 l 618 563 l 346 408 l 384 146 m 653 138 l 727 76 l 725 261 l 646 322 q 646 316 646 322 q 646 307 647 310 q 643 301 646 303 l 582 260 l 648 206 q 653 138 653 202 m 107 721 l 305 566 l 253 926 l 36 1060 l 107 721 m 909 207 l 921 388 l 742 261 l 744 75 l 909 207 m 323 560 l 612 710 l 598 1052 l 270 925 l 323 560 m 984 277 l 1000 457 l 825 567 l 823 486 l 935 412 q 938 405 939 409 l 932 313 l 984 277 m 1132 384 l 1156 556 l 1017 457 l 1001 281 l 1132 384 m 987 255 l 932 293 l 925 202 q 922 196 925 198 l 741 51 q 730 51 736 47 l 654 115 l 660 -9 q 656 -16 660 -13 l 429 -197 q 425 -198 426 -198 q 419 -196 419 -197 l 242 -9 q 196 206 239 -5 q 200 215 195 212 l 247 243 q 174 315 174 310 l 118 587 q 122 596 116 592 l 195 631 q 91 715 92 708 l 16 1076 q 22 1086 15 1084 l 357 1190 q 363 1190 361 1190 l 609 1071 q 614 1064 614 1068 l 629 705 q 625 698 629 700 l 533 650 l 631 584 q 635 578 635 583 l 639 483 l 732 540 q 741 540 736 543 l 806 497 l 808 582 q 812 589 808 587 l 972 687 q 980 687 977 689 l 1170 582 q 1174 577 1173 579 q 1169 530 1175 574 q 1156 434 1163 486 q 1148 379 1148 381 q 1145 374 1148 375 l 997 255 q 987 255 992 251 z "},"":{"ha":1290,"x_min":0,"x_max":1290,"o":"m 931 231 q 927 314 931 275 q 910 392 922 353 q 880 458 898 431 q 830 503 861 486 q 760 521 799 521 q 734 505 755 518 q 701 486 712 492 q 669 470 689 480 q 631 457 649 461 q 595 453 613 453 q 559 457 577 453 q 521 470 541 461 q 490 486 501 480 q 457 505 478 492 q 431 521 436 518 q 360 503 391 521 q 311 458 329 486 q 280 392 292 431 q 264 314 268 353 q 260 231 260 275 q 292 137 260 174 q 372 99 325 99 l 818 99 q 898 137 866 99 q 931 231 931 174 m 797 691 q 737 834 797 775 q 595 893 678 893 q 453 834 512 893 q 394 691 394 775 q 453 550 394 608 q 595 491 512 491 q 737 550 678 491 q 797 691 797 608 m 1290 273 l 1290 124 q 1283 106 1290 113 q 1265 99 1276 99 l 1190 99 l 1190 -74 q 1154 -162 1190 -126 q 1066 -198 1118 -198 l 124 -198 q 36 -162 73 -198 q 0 -74 0 -126 l 0 1066 q 36 1154 0 1118 q 124 1190 73 1190 l 1066 1190 q 1154 1154 1118 1190 q 1190 1066 1190 1118 l 1190 893 l 1265 893 q 1283 886 1276 893 q 1290 868 1290 879 l 1290 719 q 1283 701 1290 708 q 1265 694 1276 694 l 1190 694 l 1190 595 l 1265 595 q 1283 588 1276 595 q 1290 570 1290 581 l 1290 422 q 1283 404 1290 411 q 1265 397 1276 397 l 1190 397 l 1190 298 l 1265 298 q 1283 291 1276 298 q 1290 273 1290 284 z "},"":{"ha":1290,"x_min":0,"x_max":1290,"o":"m 797 691 q 737 550 797 608 q 595 491 678 491 q 453 550 512 491 q 394 691 394 608 q 453 834 394 775 q 595 893 512 893 q 737 834 678 893 q 797 691 797 775 m 760 521 q 823 508 795 521 q 870 471 852 494 q 901 419 888 447 q 919 356 913 391 q 928 292 925 322 q 931 231 931 263 q 900 139 931 179 q 818 99 870 99 l 372 99 q 290 139 321 99 q 260 231 260 179 q 263 303 260 268 q 277 380 267 339 q 306 451 288 421 q 355 501 323 481 q 427 521 386 521 l 431 521 q 456 506 436 518 q 483 489 475 494 q 509 476 491 485 q 537 464 526 467 q 565 457 549 460 q 595 453 581 453 q 626 457 610 453 q 653 464 642 460 q 682 476 664 467 q 707 489 699 485 q 735 506 715 494 q 760 521 754 518 m 1290 719 q 1282 702 1290 709 q 1265 694 1275 694 l 1190 694 l 1190 595 l 1265 595 q 1282 588 1275 595 q 1290 570 1290 581 l 1290 422 q 1282 404 1290 412 q 1265 397 1275 397 l 1190 397 l 1190 298 l 1265 298 q 1282 290 1275 298 q 1290 273 1290 283 l 1290 124 q 1282 107 1290 114 q 1265 99 1275 99 l 1190 99 l 1190 -74 q 1154 -162 1190 -126 q 1066 -198 1118 -198 l 124 -198 q 36 -162 73 -198 q 0 -74 0 -126 l 0 1066 q 36 1154 0 1118 q 124 1190 73 1190 l 1066 1190 q 1154 1154 1118 1190 q 1190 1066 1190 1118 l 1190 893 l 1265 893 q 1282 885 1275 893 q 1290 868 1290 878 l 1290 719 m 1091 -74 l 1091 1066 q 1084 1084 1091 1077 q 1066 1091 1077 1091 l 124 1091 q 107 1084 114 1091 q 99 1066 99 1077 l 99 -74 q 107 -92 99 -84 q 124 -99 114 -99 l 1066 -99 q 1084 -92 1077 -99 q 1091 -74 1091 -84 z "},"":{"ha":1587,"x_min":0,"x_max":1587,"o":"m 765 231 q 779 248 765 231 q 794 314 794 264 q 787 405 794 363 q 764 485 780 446 q 717 545 748 523 q 642 567 686 567 q 618 553 637 564 q 589 537 600 543 q 562 523 579 531 q 529 512 545 515 q 496 508 512 508 q 463 512 480 508 q 430 523 447 515 q 403 537 413 531 q 374 553 392 543 q 350 567 355 564 q 275 545 306 567 q 228 485 244 523 q 205 405 212 446 q 198 314 198 363 q 227 231 198 264 q 298 198 256 198 l 694 198 q 765 231 736 198 m 620 593 q 646 618 620 593 q 672 717 672 644 q 620 841 672 790 q 496 893 569 893 q 372 841 423 893 q 320 717 320 790 q 372 593 320 644 q 496 541 423 541 q 620 593 569 541 m 1389 322 l 1389 372 q 1382 390 1389 383 q 1364 397 1375 397 l 918 397 q 900 390 907 397 q 893 372 893 383 l 893 322 q 900 305 893 312 q 918 298 907 298 l 1364 298 q 1382 305 1375 298 q 1389 322 1389 312 m 1389 524 l 1389 567 q 1381 587 1389 579 q 1361 595 1373 595 l 921 595 q 901 587 909 595 q 893 567 893 579 l 893 524 q 901 504 893 512 q 921 496 909 496 l 1361 496 q 1381 504 1373 496 q 1389 524 1389 512 m 1389 719 l 1389 769 q 1382 787 1389 780 q 1364 794 1375 794 l 918 794 q 900 787 907 794 q 893 769 893 780 l 893 719 q 900 701 893 708 q 918 694 907 694 l 1364 694 q 1382 701 1375 694 q 1389 719 1389 708 m 1587 967 l 1587 25 q 1551 -63 1587 -26 q 1463 -99 1514 -99 l 1190 -99 l 1190 -25 q 1184 -7 1190 -14 q 1166 0 1177 0 l 1116 0 q 1098 -7 1105 0 q 1091 -25 1091 -14 l 1091 -99 l 496 -99 l 496 -25 q 489 -7 496 -14 q 471 0 482 0 l 422 0 q 404 -7 411 0 q 397 -25 397 -14 l 397 -99 l 124 -99 q 36 -63 73 -99 q 0 25 0 -26 l 0 967 q 36 1055 0 1018 q 124 1091 73 1091 l 1463 1091 q 1551 1055 1514 1091 q 1587 967 1587 1018 z "},"":{"ha":1587,"x_min":0,"x_max":1587,"o":"m 787 405 q 790 384 787 405 q 794 314 794 363 q 765 231 794 264 q 694 198 736 198 l 298 198 q 227 231 256 198 q 198 314 198 264 q 205 405 198 363 q 228 485 212 446 q 275 545 244 523 q 350 567 306 567 q 374 553 355 564 q 403 537 392 543 q 430 523 413 531 q 463 512 447 515 q 496 508 480 508 q 529 512 512 508 q 562 523 545 515 q 589 537 579 531 q 618 553 600 543 q 642 567 637 564 q 717 545 686 567 q 764 485 748 523 q 787 405 780 446 m 620 841 q 646 816 620 841 q 672 717 672 790 q 620 593 672 644 q 496 541 569 541 q 372 593 423 541 q 320 717 320 644 q 372 841 320 790 q 496 893 423 893 q 620 841 569 893 m 1389 372 l 1389 322 q 1382 305 1389 312 q 1364 298 1375 298 l 918 298 q 900 305 907 298 q 893 322 893 312 l 893 372 q 900 390 893 383 q 918 397 907 397 l 1364 397 q 1382 390 1375 397 q 1389 372 1389 383 m 1389 567 l 1389 524 q 1381 504 1389 512 q 1361 496 1373 496 l 921 496 q 901 504 909 496 q 893 524 893 512 l 893 567 q 901 587 893 579 q 921 595 909 595 l 1361 595 q 1381 587 1373 595 q 1389 567 1389 579 m 1389 769 l 1389 719 q 1382 701 1389 708 q 1364 694 1375 694 l 918 694 q 900 701 907 694 q 893 719 893 708 l 893 769 q 900 787 893 780 q 918 794 907 794 l 1364 794 q 1382 787 1375 794 q 1389 769 1389 780 m 1488 25 l 1488 967 q 1481 985 1488 977 q 1463 992 1473 992 l 124 992 q 107 985 114 992 q 99 967 99 977 l 99 25 q 107 7 99 15 q 124 0 114 0 l 397 0 l 397 74 q 404 92 397 85 q 422 99 411 99 l 471 99 q 489 92 482 99 q 496 74 496 85 l 496 0 l 1091 0 l 1091 74 q 1098 92 1091 85 q 1116 99 1105 99 l 1166 99 q 1184 92 1177 99 q 1190 74 1190 85 l 1190 0 l 1463 0 q 1481 7 1473 0 q 1488 25 1488 15 m 1587 967 l 1587 25 q 1551 -63 1587 -26 q 1463 -99 1514 -99 l 124 -99 q 36 -63 73 -99 q 0 25 0 -26 l 0 967 q 36 1055 0 1018 q 124 1091 73 1091 l 1463 1091 q 1551 1055 1514 1091 q 1587 967 1587 1018 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 1180 153 q 1113 352 1163 273 q 970 444 1062 432 q 846 355 918 387 q 694 322 774 322 q 543 355 615 322 q 419 444 471 387 q 276 352 327 432 q 208 153 226 273 q 419 -31 291 36 q 694 -99 546 -99 q 970 -31 842 -99 q 1180 153 1098 36 m 905 484 q 948 528 905 484 q 992 694 992 571 q 905 905 992 818 q 694 992 818 992 q 484 905 571 992 q 397 694 397 818 q 484 484 397 571 q 694 397 571 397 q 905 484 818 397 m 1334 766 q 1361 701 1334 766 q 1389 496 1389 637 q 1334 227 1389 355 q 1186 5 1279 98 q 965 -143 1094 -88 q 694 -198 836 -198 q 425 -143 553 -198 q 203 5 296 -88 q 55 226 110 98 q 0 496 0 355 q 55 766 0 637 q 203 987 110 894 q 425 1135 296 1080 q 694 1190 553 1190 q 964 1135 836 1190 q 1186 987 1093 1080 q 1334 766 1279 894 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 425 1135 q 489 1163 425 1135 q 694 1190 553 1190 q 964 1135 836 1190 q 1186 987 1093 1080 q 1334 766 1279 894 q 1389 496 1389 637 q 1334 227 1389 356 q 1187 5 1280 98 q 965 -143 1094 -88 q 694 -198 836 -198 q 424 -143 553 -198 q 203 5 295 -88 q 55 227 110 98 q 0 496 0 355 q 55 766 0 637 q 203 987 110 894 q 425 1135 296 1080 m 1174 143 q 1290 496 1290 302 q 1242 727 1290 617 q 1115 917 1195 837 q 925 1044 1035 997 q 694 1091 815 1091 q 463 1044 574 1091 q 274 917 353 997 q 146 727 194 837 q 99 496 99 617 q 215 143 99 302 q 452 397 266 397 q 694 298 553 298 q 937 397 836 298 q 1174 143 1123 397 m 905 434 q 948 478 905 434 q 992 645 992 522 q 905 855 992 768 q 694 942 818 942 q 484 855 571 942 q 397 645 397 768 q 484 434 397 522 q 694 347 571 347 q 905 434 818 347 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 931 583 q 1000 553 967 572 q 1069 497 1033 535 q 1131 407 1105 459 q 1173 274 1156 356 q 1190 91 1190 192 q 1113 -114 1190 -29 q 926 -198 1035 -198 l 264 -198 q 78 -114 155 -198 q 0 91 0 -29 q 17 274 0 192 q 60 407 34 356 q 121 497 85 459 q 190 553 157 535 q 260 583 223 572 q 198 794 198 680 q 230 947 198 874 q 315 1074 261 1021 q 441 1159 368 1128 q 595 1190 515 1190 q 749 1159 676 1190 q 876 1074 822 1128 q 961 947 929 1021 q 992 794 992 874 q 931 583 992 680 m 806 1004 q 762 1048 806 1004 q 595 1091 718 1091 q 385 1004 472 1091 q 298 794 298 917 q 385 583 298 670 q 595 496 472 496 q 806 583 718 496 q 893 794 893 670 q 806 1004 893 917 m 926 -99 q 1043 -44 994 -99 q 1091 91 1091 12 q 1030 383 1091 276 q 856 495 970 490 q 595 397 743 397 q 335 495 447 397 q 160 383 221 490 q 99 91 99 276 q 148 -44 99 12 q 264 -99 196 -99 l 926 -99 z "},"":{"ha":992,"x_min":0,"x_max":992,"o":"m 787 307 q 790 286 787 307 q 794 215 794 265 q 765 133 794 166 q 694 99 736 99 l 298 99 q 227 133 256 99 q 198 215 198 166 q 205 307 198 265 q 228 388 212 349 q 276 448 244 426 q 350 470 307 470 q 496 412 412 412 q 642 470 580 412 q 717 448 685 470 q 764 388 748 426 q 787 307 780 349 m 622 742 q 648 716 622 742 q 674 618 674 691 q 622 493 674 545 q 496 442 570 442 q 370 493 422 442 q 318 618 318 545 q 370 742 318 691 q 496 794 422 794 q 622 742 570 794 m 893 -74 l 893 992 l 99 992 l 99 -74 q 107 -92 99 -84 q 124 -99 114 -99 l 868 -99 q 885 -92 878 -99 q 893 -74 893 -84 m 992 1066 l 992 -74 q 956 -162 992 -126 q 868 -198 919 -198 l 124 -198 q 36 -162 73 -198 q 0 -74 0 -126 l 0 1066 q 36 1154 0 1118 q 124 1190 73 1190 l 397 1190 l 397 1116 q 404 1098 397 1105 q 422 1091 411 1091 l 570 1091 q 588 1098 581 1091 q 595 1116 595 1105 l 595 1190 l 868 1190 q 956 1154 919 1190 q 992 1066 992 1118 z "},"":{"ha":1587,"x_min":0,"x_max":1587,"o":"m 694 251 q 689 329 694 293 q 670 399 683 365 q 630 452 656 432 q 567 471 604 471 q 446 422 518 422 q 326 471 375 422 q 263 452 289 471 q 223 399 236 432 q 204 329 210 365 q 198 251 198 293 q 223 179 198 208 q 281 149 247 149 l 612 149 q 670 179 646 149 q 694 251 694 208 m 552 490 q 574 512 552 490 q 595 595 595 533 q 552 701 595 657 q 446 744 508 744 q 341 701 384 744 q 298 595 298 657 q 341 490 298 533 q 446 446 384 446 q 552 490 508 446 m 1389 223 l 1389 273 q 1382 291 1389 284 q 1364 298 1375 298 l 818 298 q 801 291 808 298 q 794 273 794 284 l 794 223 q 801 205 794 212 q 818 198 808 198 l 1364 198 q 1382 205 1375 198 q 1389 223 1389 212 m 1091 422 l 1091 471 q 1084 489 1091 482 q 1066 496 1077 496 l 818 496 q 801 489 808 496 q 794 471 794 482 l 794 422 q 801 404 794 411 q 818 397 808 397 l 1066 397 q 1084 404 1077 397 q 1091 422 1091 411 m 1389 422 l 1389 471 q 1382 489 1389 482 q 1364 496 1375 496 l 1215 496 q 1197 489 1204 496 q 1190 471 1190 482 l 1190 422 q 1197 404 1190 411 q 1215 397 1204 397 l 1364 397 q 1382 404 1375 397 q 1389 422 1389 411 m 1389 620 l 1389 670 q 1382 687 1389 680 q 1364 694 1375 694 l 818 694 q 801 687 808 694 q 794 670 794 680 l 794 620 q 801 602 794 609 q 818 595 808 595 l 1364 595 q 1382 602 1375 595 q 1389 620 1389 609 m 99 893 l 1488 893 l 1488 967 q 1481 985 1488 978 q 1463 992 1474 992 l 124 992 q 106 985 113 992 q 99 967 99 978 l 99 893 m 1587 967 l 1587 25 q 1551 -63 1587 -26 q 1463 -99 1514 -99 l 124 -99 q 36 -63 73 -99 q 0 25 0 -26 l 0 967 q 36 1055 0 1018 q 124 1091 73 1091 l 1463 1091 q 1551 1055 1514 1091 q 1587 967 1587 1018 z "},"":{"ha":1587,"x_min":0,"x_max":1587,"o":"m 694 251 q 670 179 694 208 q 612 149 646 149 l 281 149 q 223 179 247 149 q 198 251 198 208 q 204 329 198 293 q 223 399 210 365 q 263 452 236 432 q 326 471 289 471 q 446 422 375 422 q 567 471 518 422 q 630 452 604 471 q 670 399 656 432 q 689 329 683 365 q 694 251 694 293 m 552 701 q 574 679 552 701 q 595 595 595 657 q 552 490 595 533 q 446 446 508 446 q 341 490 384 446 q 298 595 298 533 q 341 701 298 657 q 446 744 384 744 q 552 701 508 744 m 1389 273 l 1389 223 q 1382 205 1389 212 q 1364 198 1375 198 l 818 198 q 801 205 808 198 q 794 223 794 212 l 794 273 q 801 291 794 284 q 818 298 808 298 l 1364 298 q 1382 291 1375 298 q 1389 273 1389 284 m 1091 471 l 1091 422 q 1084 404 1091 411 q 1066 397 1077 397 l 818 397 q 801 404 808 397 q 794 422 794 411 l 794 471 q 801 489 794 482 q 818 496 808 496 l 1066 496 q 1084 489 1077 496 q 1091 471 1091 482 m 1389 471 l 1389 422 q 1382 404 1389 411 q 1364 397 1375 397 l 1215 397 q 1197 404 1204 397 q 1190 422 1190 411 l 1190 471 q 1197 489 1190 482 q 1215 496 1204 496 l 1364 496 q 1382 489 1375 496 q 1389 471 1389 482 m 1389 670 l 1389 620 q 1382 602 1389 609 q 1364 595 1375 595 l 818 595 q 801 602 808 595 q 794 620 794 609 l 794 670 q 801 687 794 680 q 818 694 808 694 l 1364 694 q 1382 687 1375 694 q 1389 670 1389 680 m 1488 25 l 1488 893 l 99 893 l 99 25 q 107 7 99 15 q 124 0 114 0 l 1463 0 q 1481 7 1473 0 q 1488 25 1488 15 m 1587 967 l 1587 25 q 1551 -63 1587 -26 q 1463 -99 1514 -99 l 124 -99 q 36 -63 73 -99 q 0 25 0 -26 l 0 967 q 36 1055 0 1018 q 124 1091 73 1091 l 1463 1091 q 1551 1055 1514 1091 q 1587 967 1587 1018 z "},"":{"ha":1389,"x_min":22,"x_max":1366,"o":"m 973 581 q 891 948 973 827 q 636 1070 810 1070 q 383 948 463 1070 q 302 581 302 826 q 383 215 302 336 q 636 95 463 95 q 737 108 693 95 q 707 164 720 141 q 673 215 694 188 q 631 258 652 242 q 582 286 611 275 q 522 298 554 298 q 461 285 487 298 l 423 360 q 637 431 505 431 q 804 389 739 431 q 921 269 869 347 q 973 581 973 384 m 1275 91 l 1366 91 q 1364 39 1368 70 q 1344 -35 1360 8 q 1299 -113 1327 -78 q 1216 -173 1270 -148 q 1090 -198 1161 -198 q 989 -184 1035 -198 q 907 -140 942 -169 q 846 -80 871 -112 q 794 -5 820 -48 q 636 -26 719 -26 q 409 19 519 -26 q 213 141 298 64 q 75 334 127 219 q 22 581 22 450 q 75 828 22 712 q 213 1022 127 944 q 410 1146 299 1101 q 636 1190 520 1190 q 820 1163 729 1190 q 989 1080 911 1135 q 1125 953 1066 1026 q 1218 783 1184 880 q 1251 581 1251 687 q 1189 311 1251 433 q 1019 106 1126 189 q 1092 24 1056 52 q 1173 -5 1128 -5 q 1246 24 1220 -5 q 1275 91 1271 53 z "},"":{"ha":1786,"x_min":0,"x_max":1786,"o":"m 351 -78 q 339 -107 351 -95 q 310 -120 326 -120 q 300 -118 309 -120 q 174 -9 251 -106 q 0 515 0 211 q 165 991 0 779 q 239 1071 195 1030 q 312 1111 282 1111 q 339 1101 326 1111 q 351 1076 351 1090 q 302 1006 351 1055 q 188 863 226 927 q 96 515 96 709 q 191 135 96 298 q 297 1 230 69 q 308 -12 298 -2 q 323 -28 318 -22 q 336 -44 329 -34 q 348 -62 344 -53 q 351 -78 351 -71 m 1392 26 q 1378 -12 1392 3 q 1342 -27 1365 -27 l 505 -27 q 470 -12 484 -27 q 455 22 455 2 q 469 60 455 45 q 505 75 482 75 l 1342 75 q 1377 60 1363 75 q 1392 26 1392 46 m 1225 499 q 1173 319 1225 395 q 1120 258 1154 289 q 1055 211 1085 226 q 1034 203 1042 203 q 1022 208 1028 203 q 1016 217 1016 212 q 1031 240 1016 224 q 1063 276 1046 257 q 1096 328 1081 295 q 1111 397 1111 361 q 1084 498 1111 456 q 1048 530 1061 530 q 1046 526 1046 530 q 1051 499 1046 517 q 1057 470 1057 481 q 1041 443 1057 453 q 1006 433 1024 433 q 955 492 955 433 q 956 526 955 504 q 957 560 957 549 q 949 596 957 580 q 917 637 939 615 q 877 660 894 660 q 872 659 873 660 q 869 657 870 659 q 868 653 868 656 q 880 632 868 651 q 893 591 893 614 q 878 538 893 562 q 842 496 863 514 q 801 460 822 478 q 766 419 780 443 q 751 366 751 395 q 784 242 751 290 q 845 193 806 208 q 858 185 857 189 q 859 181 859 184 q 845 169 859 169 q 819 177 840 169 q 668 286 727 211 q 609 455 609 360 q 628 544 609 498 q 675 634 647 591 q 729 718 702 676 q 775 806 756 760 q 794 892 794 852 q 775 965 794 933 q 732 1015 753 1002 q 717 1031 717 1022 q 749 1046 717 1046 q 834 1024 787 1046 q 889 989 866 1009 q 927 950 912 970 q 953 901 942 930 q 970 848 964 873 q 983 786 977 823 q 985 772 983 785 q 989 753 987 760 q 993 734 990 746 q 1000 713 996 721 q 1008 696 1004 705 q 1020 683 1013 687 q 1034 679 1026 679 q 1063 690 1052 679 q 1073 718 1073 701 q 1058 770 1073 738 q 1042 811 1042 803 q 1050 818 1042 818 q 1122 764 1071 818 q 1202 643 1178 705 q 1225 499 1225 581 m 1786 477 q 1679 87 1786 264 q 1642 31 1664 62 q 1589 -36 1619 0 q 1526 -96 1559 -72 q 1469 -119 1494 -119 q 1445 -107 1456 -119 q 1433 -83 1433 -95 q 1456 -44 1433 -71 q 1509 16 1478 -16 q 1546 57 1539 48 q 1688 468 1688 235 q 1672 650 1688 570 q 1616 814 1656 731 q 1490 991 1571 906 q 1480 1001 1488 993 q 1467 1014 1471 1009 q 1455 1027 1463 1018 q 1444 1043 1448 1036 q 1436 1057 1439 1049 q 1433 1072 1433 1065 q 1445 1099 1433 1087 q 1473 1112 1458 1112 q 1625 981 1527 1112 q 1738 770 1700 880 q 1784 526 1775 660 q 1786 477 1786 494 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 922 177 l 1035 715 q 1027 763 1042 749 q 987 769 1012 778 l 318 511 q 287 491 295 502 q 285 471 279 481 q 310 456 291 461 l 481 402 l 879 653 q 904 657 895 663 q 901 646 909 653 l 579 355 l 579 355 l 579 355 l 567 178 q 601 195 584 178 l 685 276 l 859 148 q 922 177 908 120 m 1334 766 q 1361 701 1334 766 q 1389 496 1389 637 q 1334 226 1389 355 q 1186 5 1279 98 q 964 -143 1093 -88 q 694 -198 836 -198 q 425 -143 553 -198 q 203 5 296 -88 q 55 226 110 98 q 0 496 0 355 q 55 766 0 637 q 203 987 110 894 q 425 1135 296 1080 q 694 1190 553 1190 q 964 1135 836 1190 q 1186 987 1093 1080 q 1334 766 1279 894 z "},"":{"ha":794,"x_min":0,"x_max":794,"o":"m 496 149 q 453 43 496 87 q 347 0 409 0 q 242 43 285 0 q 198 149 198 87 q 226 234 198 195 q 298 289 253 273 l 298 992 l 397 992 l 397 289 q 469 234 442 273 q 496 149 496 195 m 595 149 q 569 260 595 208 q 496 347 543 312 l 496 942 q 453 1048 496 1004 q 347 1091 409 1091 q 242 1048 285 1091 q 198 942 198 1004 l 198 347 q 126 260 152 312 q 99 149 99 208 q 172 -27 99 46 q 347 -99 244 -99 q 523 -27 450 -99 q 595 149 595 46 m 694 149 q 593 -96 694 5 q 347 -198 491 -198 q 102 -96 204 -198 q 0 149 0 5 q 99 391 0 290 l 99 942 q 172 1118 99 1046 q 347 1190 244 1190 q 523 1118 450 1190 q 595 942 595 1046 l 595 391 q 694 149 694 290 m 794 595 l 794 496 l 645 496 l 645 595 l 794 595 m 794 794 l 794 694 l 645 694 l 645 794 l 794 794 m 794 992 l 794 893 l 645 893 l 645 992 l 794 992 z "},"":{"ha":794,"x_min":0,"x_max":794,"o":"m 496 149 q 453 43 496 87 q 347 0 409 0 q 242 43 285 0 q 198 149 198 87 q 226 234 198 195 q 298 289 253 273 l 298 794 l 397 794 l 397 289 q 469 234 442 273 q 496 149 496 195 m 595 149 q 569 260 595 208 q 496 347 543 312 l 496 942 q 453 1048 496 1004 q 347 1091 409 1091 q 242 1048 285 1091 q 198 942 198 1004 l 198 347 q 126 260 152 312 q 99 149 99 208 q 172 -27 99 46 q 347 -99 244 -99 q 523 -27 450 -99 q 595 149 595 46 m 694 149 q 593 -96 694 5 q 347 -198 491 -198 q 102 -96 204 -198 q 0 149 0 5 q 99 391 0 290 l 99 942 q 172 1118 99 1046 q 347 1190 244 1190 q 523 1118 450 1190 q 595 942 595 1046 l 595 391 q 694 149 694 290 m 794 595 l 794 496 l 645 496 l 645 595 l 794 595 m 794 794 l 794 694 l 645 694 l 645 794 l 794 794 m 794 992 l 794 893 l 645 893 l 645 992 l 794 992 z "},"":{"ha":794,"x_min":0,"x_max":794,"o":"m 496 149 q 453 43 496 87 q 347 0 409 0 q 242 43 285 0 q 198 149 198 87 q 226 234 198 195 q 298 289 253 273 l 298 595 l 397 595 l 397 289 q 469 234 442 273 q 496 149 496 195 m 595 149 q 569 260 595 208 q 496 347 543 312 l 496 942 q 453 1048 496 1004 q 347 1091 409 1091 q 242 1048 285 1091 q 198 942 198 1004 l 198 347 q 126 260 152 312 q 99 149 99 208 q 172 -27 99 46 q 347 -99 244 -99 q 523 -27 450 -99 q 595 149 595 46 m 694 149 q 593 -96 694 5 q 347 -198 491 -198 q 102 -96 204 -198 q 0 149 0 5 q 99 391 0 290 l 99 942 q 172 1118 99 1046 q 347 1190 244 1190 q 523 1118 450 1190 q 595 942 595 1046 l 595 391 q 694 149 694 290 m 794 595 l 794 496 l 645 496 l 645 595 l 794 595 m 794 794 l 794 694 l 645 694 l 645 794 l 794 794 m 794 992 l 794 893 l 645 893 l 645 992 l 794 992 z "},"":{"ha":794,"x_min":0,"x_max":794,"o":"m 496 149 q 453 43 496 87 q 347 0 409 0 q 242 43 285 0 q 198 149 198 87 q 226 234 198 195 q 298 289 253 273 l 298 397 l 397 397 l 397 289 q 469 234 442 273 q 496 149 496 195 m 595 149 q 569 260 595 208 q 496 347 543 312 l 496 942 q 453 1048 496 1004 q 347 1091 409 1091 q 242 1048 285 1091 q 198 942 198 1004 l 198 347 q 126 260 152 312 q 99 149 99 208 q 172 -27 99 46 q 347 -99 244 -99 q 523 -27 450 -99 q 595 149 595 46 m 694 149 q 593 -96 694 5 q 347 -198 491 -198 q 102 -96 204 -198 q 0 149 0 5 q 99 391 0 290 l 99 942 q 172 1118 99 1046 q 347 1190 244 1190 q 523 1118 450 1190 q 595 942 595 1046 l 595 391 q 694 149 694 290 m 794 595 l 794 496 l 645 496 l 645 595 l 794 595 m 794 794 l 794 694 l 645 694 l 645 794 l 794 794 m 794 992 l 794 893 l 645 893 l 645 992 l 794 992 z "},"":{"ha":794,"x_min":0,"x_max":794,"o":"m 496 149 q 453 43 496 87 q 347 0 409 0 q 242 43 285 0 q 198 149 198 87 q 242 254 198 210 q 347 298 285 298 q 453 254 409 298 q 496 149 496 210 m 595 149 q 569 260 595 208 q 496 347 543 312 l 496 942 q 453 1048 496 1004 q 347 1091 409 1091 q 242 1048 285 1091 q 198 942 198 1004 l 198 347 q 126 260 152 312 q 99 149 99 208 q 172 -27 99 46 q 347 -99 244 -99 q 523 -27 450 -99 q 595 149 595 46 m 694 149 q 593 -96 694 5 q 347 -198 491 -198 q 102 -96 204 -198 q 0 149 0 5 q 99 391 0 290 l 99 942 q 172 1118 99 1046 q 347 1190 244 1190 q 523 1118 450 1190 q 595 942 595 1046 l 595 391 q 694 149 694 290 m 794 595 l 794 496 l 645 496 l 645 595 l 794 595 m 794 794 l 794 694 l 645 694 l 645 794 l 794 794 m 794 992 l 794 893 l 645 893 l 645 992 l 794 992 z "},"":{"ha":1488,"x_min":0,"x_max":1488,"o":"m 1111 997 q 1118 980 1118 990 q 1111 962 1118 970 l 625 477 q 608 469 618 469 q 590 477 598 469 l 526 540 q 519 558 519 548 q 526 576 519 568 l 560 610 q 497 770 505 680 q 533 937 490 860 q 397 992 476 992 q 257 934 315 992 q 198 794 198 876 l 198 -198 l 0 -198 l 0 794 q 31 947 0 874 q 116 1074 63 1021 q 243 1159 170 1128 q 397 1190 316 1190 q 553 1159 479 1190 q 681 1070 626 1127 q 834 1089 754 1100 q 977 1027 914 1077 l 1011 1061 q 1029 1069 1019 1069 q 1047 1061 1039 1069 l 1111 997 m 1007 779 q 1014 786 1007 779 q 1042 794 1022 794 q 1077 779 1062 794 q 1091 744 1091 764 q 1077 709 1091 724 q 1042 694 1062 694 q 1007 709 1022 694 q 992 744 992 724 q 1007 779 992 764 m 1275 709 q 1268 702 1275 709 q 1240 694 1260 694 q 1205 709 1220 694 q 1190 744 1190 724 q 1205 779 1190 764 q 1240 794 1220 794 q 1275 779 1260 794 q 1290 744 1290 764 q 1275 709 1290 724 m 1404 779 q 1411 786 1404 779 q 1438 794 1418 794 q 1473 779 1459 794 q 1488 744 1488 764 q 1473 709 1488 724 q 1438 694 1459 694 q 1404 709 1418 694 q 1389 744 1389 724 q 1404 779 1389 764 m 908 680 q 915 687 908 680 q 942 694 922 694 q 977 680 963 694 q 992 645 992 665 q 977 610 992 625 q 942 595 963 595 q 908 610 922 595 q 893 645 893 625 q 908 680 893 665 m 1106 610 q 1099 617 1106 610 q 1091 645 1091 625 q 1106 680 1091 665 q 1141 694 1121 694 q 1176 680 1161 694 q 1190 645 1190 665 q 1176 610 1190 625 q 1141 595 1161 595 q 1106 610 1121 595 m 1304 680 q 1312 687 1304 680 q 1339 694 1319 694 q 1374 680 1359 694 q 1389 645 1389 665 q 1374 610 1389 625 q 1339 595 1359 595 q 1304 610 1319 595 q 1290 645 1290 625 q 1304 680 1290 665 m 808 581 q 816 588 808 581 q 843 595 823 595 q 878 581 863 595 q 893 546 893 566 q 878 511 893 525 q 843 496 863 496 q 808 511 823 496 q 794 546 794 525 q 808 581 794 566 m 1077 511 q 1069 503 1077 511 q 1042 496 1062 496 q 1007 511 1022 496 q 992 546 992 525 q 1007 581 992 566 q 1042 595 1022 595 q 1077 581 1062 595 q 1091 546 1091 566 q 1077 511 1091 525 m 1205 581 q 1213 588 1205 581 q 1240 595 1220 595 q 1275 581 1260 595 q 1290 546 1290 566 q 1275 511 1290 525 q 1240 496 1260 496 q 1205 511 1220 496 q 1190 546 1190 525 q 1205 581 1190 566 m 977 412 q 970 404 977 412 q 942 397 963 397 q 908 412 922 397 q 893 446 893 426 q 908 481 893 467 q 942 496 922 496 q 977 481 963 496 q 992 446 992 467 q 977 412 992 426 m 1106 481 q 1113 489 1106 481 q 1141 496 1121 496 q 1176 481 1161 496 q 1190 446 1190 467 q 1176 412 1190 426 q 1141 397 1161 397 q 1106 412 1121 397 q 1091 446 1091 426 q 1106 481 1091 467 m 808 382 q 816 389 808 382 q 843 397 823 397 q 878 382 863 397 q 893 347 893 367 q 878 312 893 327 q 843 298 863 298 q 808 312 823 298 q 794 347 794 327 q 808 382 794 367 m 1007 382 q 1014 389 1007 382 q 1042 397 1022 397 q 1077 382 1062 397 q 1091 347 1091 367 q 1077 312 1091 327 q 1042 298 1062 298 q 1007 312 1022 298 q 992 347 992 327 q 1007 382 992 367 m 908 283 q 915 290 908 283 q 942 298 922 298 q 977 283 963 298 q 992 248 992 268 q 977 213 992 228 q 942 198 963 198 q 908 213 922 198 q 893 248 893 228 q 908 283 893 268 m 808 184 q 816 191 808 184 q 843 198 823 198 q 878 184 863 198 q 893 149 893 169 q 878 114 893 129 q 843 99 863 99 q 808 114 823 99 q 794 149 794 129 q 808 184 794 169 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 1290 347 l 1290 198 q 1190 -23 1290 67 l 1190 -174 q 1184 -191 1190 -184 q 1166 -198 1177 -198 l 1116 -198 q 1098 -191 1105 -198 q 1091 -174 1091 -184 l 1091 -82 q 992 -99 1042 -99 l 397 -99 q 298 -82 346 -99 l 298 -167 q 290 -189 298 -181 q 273 -198 283 -198 l 223 -198 q 206 -189 213 -198 q 198 -167 198 -181 l 198 -23 q 99 198 99 67 l 99 347 l 1290 347 m 539 687 q 542 684 539 687 q 546 670 546 680 q 539 652 546 659 q 521 645 532 645 q 503 652 510 645 q 496 670 496 659 q 503 687 496 680 q 521 694 510 694 q 539 687 532 694 m 588 737 q 592 734 588 737 q 595 719 595 730 q 588 701 595 708 q 570 694 581 694 q 553 701 560 694 q 546 719 546 708 q 553 737 546 730 q 570 744 560 744 q 588 737 581 744 m 539 787 q 542 783 539 787 q 546 769 546 780 q 539 751 546 758 q 521 744 532 744 q 503 751 510 744 q 496 769 496 758 q 503 787 496 780 q 521 794 510 794 q 539 787 532 794 m 638 787 q 641 783 638 787 q 645 769 645 780 q 638 751 645 758 q 620 744 631 744 q 602 751 609 744 q 595 769 595 758 q 602 787 595 780 q 620 794 609 794 q 638 787 631 794 m 588 836 q 592 833 588 836 q 595 818 595 829 q 588 801 595 808 q 570 794 581 794 q 553 801 560 794 q 546 818 546 808 q 553 836 546 829 q 570 843 560 843 q 588 836 581 843 m 539 886 q 542 882 539 886 q 546 868 546 879 q 539 850 546 857 q 521 843 532 843 q 503 850 510 843 q 496 868 496 857 q 503 886 496 879 q 521 893 510 893 q 539 886 532 893 m 1389 471 l 1389 422 q 1382 404 1389 411 q 1364 397 1375 397 l 25 397 q 7 404 14 397 q 0 422 0 411 l 0 471 q 7 489 0 482 q 25 496 14 496 l 99 496 l 99 992 q 157 1132 99 1074 q 298 1190 215 1190 q 440 1130 381 1190 q 516 1139 476 1145 q 588 1109 556 1134 l 605 1126 q 622 1126 614 1135 l 655 1094 q 655 1077 663 1085 l 412 833 q 395 833 403 825 l 362 866 q 362 883 353 874 l 379 900 q 348 980 351 935 q 366 1064 344 1025 q 298 1091 337 1091 q 227 1062 257 1091 q 198 992 198 1033 l 198 496 l 1364 496 q 1382 489 1375 496 q 1389 471 1389 482 m 687 836 q 691 833 687 836 q 694 818 694 829 q 687 801 694 808 q 670 794 680 794 q 652 801 659 794 q 645 818 645 808 q 652 836 645 829 q 670 843 659 843 q 687 836 680 843 m 638 886 q 641 882 638 886 q 645 868 645 879 q 638 850 645 857 q 620 843 631 843 q 602 850 609 843 q 595 868 595 857 q 602 886 595 879 q 620 893 609 893 q 638 886 631 893 m 588 935 q 592 932 588 935 q 595 918 595 929 q 588 900 595 907 q 570 893 581 893 q 553 900 560 893 q 546 918 546 907 q 553 935 546 929 q 570 942 560 942 q 588 935 581 942 m 737 886 q 741 882 737 886 q 744 868 744 879 q 737 850 744 857 q 719 843 730 843 q 701 850 708 843 q 694 868 694 857 q 701 886 694 879 q 719 893 708 893 q 737 886 730 893 m 687 935 q 691 932 687 935 q 694 918 694 929 q 687 900 694 907 q 670 893 680 893 q 652 900 659 893 q 645 918 645 907 q 652 935 645 929 q 670 942 659 942 q 687 935 680 942 m 638 985 q 641 982 638 985 q 645 967 645 978 q 638 949 645 956 q 620 942 631 942 q 602 949 609 942 q 595 967 595 956 q 602 985 595 978 q 620 992 609 992 q 638 985 631 992 m 787 935 q 790 932 787 935 q 794 918 794 929 q 787 900 794 907 q 769 893 780 893 q 751 900 758 893 q 744 918 744 907 q 751 935 744 929 q 769 942 758 942 q 787 935 780 942 m 737 985 q 741 982 737 985 q 744 967 744 978 q 737 949 744 956 q 719 942 730 942 q 701 949 708 942 q 694 967 694 956 q 701 985 694 978 q 719 992 708 992 q 737 985 730 992 m 836 985 q 840 982 836 985 q 843 967 843 978 q 836 949 843 956 q 818 942 829 942 q 801 949 808 942 q 794 967 794 956 q 801 985 794 978 q 818 992 808 992 q 836 985 829 992 z "},"":{"ha":1190,"x_min":1,"x_max":1190,"o":"m 770 267 q 757 114 770 200 q 715 -129 733 -53 q 597 -198 698 -198 q 479 -129 496 -198 q 436 114 460 -53 q 423 267 423 199 q 597 397 423 397 q 770 267 770 397 m 1190 595 q 1087 259 1190 409 q 815 42 983 109 q 804 44 809 40 q 799 56 798 49 q 807 107 805 93 q 811 143 810 132 q 818 153 812 150 q 1016 334 942 215 q 1091 595 1091 453 q 1021 851 1091 735 q 829 1033 950 968 q 568 1090 708 1098 q 384 1043 472 1085 q 234 934 297 1001 q 135 778 172 867 q 99 591 98 688 q 176 331 100 449 q 375 151 252 212 q 382 142 381 149 q 387 107 384 126 q 391 82 388 100 q 395 54 394 64 q 390 43 396 47 q 378 41 384 38 q 176 172 264 86 q 41 377 88 259 q 1 625 -5 495 q 52 837 6 736 q 172 1013 98 938 q 346 1135 246 1087 q 557 1189 446 1182 q 802 1153 684 1197 q 1004 1028 919 1109 q 1140 834 1089 948 q 1190 595 1190 721 m 720 743 q 745 718 720 743 q 770 620 770 692 q 720 497 770 548 q 597 446 669 446 q 474 497 525 446 q 423 620 423 548 q 474 743 423 692 q 597 794 525 794 q 720 743 669 794 m 994 595 q 952 418 994 501 q 839 281 911 336 q 826 279 832 276 q 818 290 820 282 q 796 361 814 330 q 798 377 791 369 q 869 475 843 419 q 894 595 894 532 q 849 753 894 681 q 727 863 804 825 q 563 891 650 901 q 385 804 460 880 q 301 625 311 728 q 319 488 293 553 q 395 377 345 423 q 398 361 403 369 q 375 289 379 329 q 367 279 374 282 q 355 281 361 276 q 240 422 281 338 q 200 604 198 507 q 253 793 202 705 q 391 934 305 880 q 577 991 477 987 q 785 945 689 997 q 937 799 881 893 q 994 595 994 706 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 198 99 l 1190 99 l 1190 694 l 198 694 l 198 99 m 1389 967 l 1389 25 q 1352 -63 1389 -26 q 1265 -99 1316 -99 l 124 -99 q 36 -63 73 -99 q 0 25 0 -26 l 0 967 q 36 1055 0 1018 q 124 1091 73 1091 l 1265 1091 q 1352 1055 1316 1091 q 1389 967 1389 1018 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 1389 174 l 1389 25 q 1352 -63 1389 -26 q 1265 -99 1316 -99 l 124 -99 q 36 -63 73 -99 q 0 25 0 -26 l 0 174 q 36 261 0 225 q 124 298 73 298 l 1265 298 q 1352 261 1316 298 q 1389 174 1389 225 z "},"":{"ha":1587,"x_min":0,"x_max":1587,"o":"m 198 0 l 794 0 l 794 397 l 198 397 l 198 0 m 992 397 l 1389 397 l 1389 992 l 794 992 l 794 794 l 868 794 q 956 757 919 794 q 992 670 992 721 l 992 397 m 1587 1066 l 1587 322 q 1551 235 1587 271 q 1463 198 1514 198 l 992 198 l 992 -74 q 956 -162 992 -126 q 868 -198 919 -198 l 124 -198 q 36 -162 73 -198 q 0 -74 0 -126 l 0 670 q 36 757 0 721 q 124 794 73 794 l 595 794 l 595 1066 q 632 1154 595 1118 q 719 1190 668 1190 l 1463 1190 q 1551 1154 1514 1190 q 1587 1066 1587 1118 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 911 167 l 1024 280 q 1032 298 1032 288 q 1024 315 1032 308 l 843 496 l 1024 677 q 1032 694 1032 684 q 1024 712 1032 705 l 911 825 q 893 833 903 833 q 875 825 883 833 l 694 645 l 514 825 q 496 833 506 833 q 478 825 486 833 l 365 712 q 357 694 357 705 q 365 677 357 684 l 546 496 l 365 315 q 357 298 357 308 q 365 280 357 288 l 478 167 q 496 159 486 159 q 514 167 506 159 l 694 347 l 875 167 q 893 159 883 159 q 911 167 903 159 m 1389 967 l 1389 25 q 1352 -63 1389 -26 q 1265 -99 1316 -99 l 124 -99 q 36 -63 73 -99 q 0 25 0 -26 l 0 967 q 36 1055 0 1018 q 124 1091 73 1091 l 1265 1091 q 1352 1055 1316 1091 q 1389 967 1389 1018 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 974 329 l 861 216 q 843 208 853 208 q 825 216 833 208 l 694 347 l 563 216 q 546 208 556 208 q 528 216 536 208 l 415 329 q 407 347 407 337 q 415 365 407 357 l 546 496 l 415 627 q 407 645 407 635 q 415 663 407 655 l 528 776 q 546 784 536 784 q 563 776 556 784 l 694 645 l 825 776 q 843 784 833 784 q 861 776 853 784 l 974 663 q 982 645 982 655 q 974 627 982 635 l 843 496 l 974 365 q 982 347 982 357 q 974 329 982 337 m 198 99 l 1190 99 l 1190 893 l 198 893 l 198 99 m 1389 967 l 1389 25 q 1352 -63 1389 -26 q 1265 -99 1316 -99 l 124 -99 q 36 -63 73 -99 q 0 25 0 -26 l 0 967 q 36 1055 0 1018 q 124 1091 73 1091 l 1265 1091 q 1352 1055 1316 1091 q 1389 967 1389 1018 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 829 277 l 1066 715 l 560 715 l 322 277 l 829 277 m 1334 766 q 1361 701 1334 766 q 1389 496 1389 637 q 1334 226 1389 355 q 1186 5 1279 98 q 964 -143 1093 -88 q 694 -198 836 -198 q 425 -143 553 -198 q 203 5 296 -88 q 55 226 110 98 q 0 496 0 355 q 55 766 0 637 q 203 987 110 894 q 425 1135 296 1080 q 694 1190 553 1190 q 964 1135 836 1190 q 1186 987 1093 1080 q 1334 766 1279 894 z "},"":{"ha":1390,"x_min":0,"x_max":1390,"o":"m 1001 822 q 973 828 989 835 q 953 806 958 822 q 957 777 949 791 q 988 765 968 763 q 1015 781 1008 767 q 1001 822 1021 795 m 694 631 q 679 625 687 625 q 664 631 670 625 q 658 646 658 637 q 664 660 658 654 q 679 666 670 666 q 694 660 687 666 q 699 646 699 654 q 694 631 699 637 m 822 574 l 794 546 q 772 536 785 536 q 748 546 758 536 l 718 576 q 709 599 709 586 q 718 622 709 612 l 746 649 q 768 659 755 659 q 792 649 782 659 l 822 619 q 831 596 831 610 q 822 574 831 583 m 737 674 q 723 668 732 668 q 708 674 714 668 q 702 689 702 680 q 708 704 702 698 q 722 710 714 710 q 737 704 731 710 q 743 689 743 698 q 737 674 743 680 m 1049 750 q 966 684 1023 701 q 867 697 909 667 q 820 748 838 718 q 804 816 802 778 q 834 887 805 854 q 892 929 863 921 q 947 925 922 936 q 1001 885 972 913 q 1011 875 1003 884 q 1023 865 1020 867 q 1033 854 1025 863 q 1042 842 1040 846 q 1050 830 1045 839 q 1057 817 1056 822 q 1060 802 1058 811 q 1061 786 1062 794 q 1057 769 1059 778 q 1049 750 1054 760 m 1205 377 q 1199 403 1208 392 q 1177 420 1190 415 q 1152 433 1165 426 q 1134 449 1139 441 q 1069 525 1103 504 q 981 534 1035 546 q 1012 548 996 544 q 1038 552 1028 553 l 1047 551 q 1021 621 1049 586 q 1026 652 1025 636 q 1024 676 1026 668 l 1022 684 q 1077 734 1055 702 q 1103 805 1098 766 q 1070 921 1111 870 q 963 980 1028 973 q 875 966 917 986 q 811 908 833 946 q 786 830 788 869 q 797 763 783 791 q 830 713 811 734 q 874 680 850 692 q 806 708 839 684 q 762 777 773 733 q 787 949 740 860 q 764 973 774 965 q 695 959 725 973 q 728 987 710 977 q 756 998 746 997 l 766 999 q 756 1059 766 1038 q 730 1082 748 1076 q 694 1079 713 1087 q 665 1048 675 1070 q 668 1053 667 1051 q 663 995 663 1032 q 678 904 663 958 q 715 809 692 850 q 679 781 696 798 q 613 727 652 769 q 547 648 574 684 l 522 612 q 381 515 452 586 q 323 389 311 444 q 332 368 324 377 q 308 345 320 359 q 292 303 292 326 q 309 272 292 281 q 358 277 326 264 q 418 315 390 291 q 460 362 446 339 q 455 366 459 363 q 439 372 452 368 q 414 374 427 375 q 453 384 432 378 q 484 392 475 390 q 506 396 494 394 q 526 400 518 399 q 544 400 534 400 q 561 426 555 395 q 567 496 567 455 q 536 612 567 575 q 614 443 618 532 q 602 404 613 420 q 581 383 591 388 l 571 378 q 556 353 568 373 q 536 318 545 334 q 516 278 528 302 q 496 231 504 253 q 483 182 489 208 q 478 130 477 156 q 486 81 479 105 q 457 143 459 123 q 431 113 440 125 q 405 81 421 102 q 381 45 388 60 q 368 13 374 30 q 368 -16 363 -4 q 388 -37 373 -29 q 499 12 422 -57 q 647 184 576 81 q 742 361 718 287 q 854 451 808 401 q 921 543 900 500 q 1040 405 957 471 q 1170 343 1121 341 q 1205 377 1200 345 m 1335 766 q 1363 701 1335 766 q 1390 496 1390 637 q 1335 226 1390 355 q 1187 5 1280 98 q 965 -143 1094 -88 q 695 -198 836 -198 q 425 -143 554 -198 q 203 5 296 -88 q 55 226 110 98 q 0 496 0 355 q 55 766 0 637 q 203 987 110 894 q 425 1135 296 1080 q 695 1190 554 1190 q 965 1135 836 1190 q 1187 987 1094 1080 q 1335 766 1280 894 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 401 1049 l 401 541 q 550 542 481 540 q 647 546 618 544 l 676 549 q 746 568 729 550 q 777 641 763 585 l 802 751 l 882 751 l 871 501 l 877 254 l 797 254 l 774 353 q 739 425 763 405 q 674 445 716 444 q 401 451 607 451 l 401 20 q 435 -69 401 -40 q 539 -98 469 -98 l 815 -98 q 861 -97 842 -98 q 904 -91 880 -95 q 946 -77 928 -87 q 984 -52 964 -67 q 1019 -13 1003 -37 q 1049 43 1035 11 l 1121 211 l 1190 211 q 1166 16 1186 182 q 1142 -198 1146 -151 q 938 -192 1029 -195 q 812 -189 847 -190 l 778 -189 l 291 -189 l 0 -198 l 0 -119 l 98 -100 q 169 -71 150 -90 q 189 -10 188 -53 l 195 488 q 189 988 198 800 q 169 1053 188 1035 q 98 1081 151 1071 l 0 1100 l 0 1179 l 291 1170 l 836 1170 q 1125 1190 943 1170 q 1115 1040 1121 1138 q 1105 870 1108 942 l 1101 798 l 1029 798 l 1004 894 q 947 1034 980 988 q 860 1079 914 1079 l 435 1079 q 407 1072 413 1079 q 401 1049 401 1066 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 715 573 l 715 432 q 715 420 715 429 q 715 408 715 412 q 714 399 715 405 q 711 390 713 393 q 706 384 709 388 q 698 380 703 381 q 685 379 692 379 l 685 618 q 698 618 692 618 q 706 614 703 617 q 711 610 709 611 q 714 602 713 608 q 715 594 715 596 q 715 584 715 592 q 715 573 715 575 m 960 498 l 960 405 q 960 395 960 404 q 960 383 960 386 q 958 374 960 380 q 952 366 956 368 q 942 363 948 363 q 931 370 935 363 q 928 498 928 378 q 928 504 928 500 q 928 510 928 508 q 928 517 928 513 q 929 524 928 522 q 932 529 930 526 q 935 534 933 532 q 942 535 938 535 q 949 534 946 535 q 954 530 953 532 q 958 525 956 528 q 959 519 959 523 q 960 513 960 515 q 960 505 960 511 q 960 498 960 500 m 140 315 l 234 315 l 234 681 l 140 681 l 140 315 m 476 315 l 558 315 l 558 681 l 435 681 l 413 510 q 388 681 398 625 l 266 681 l 266 315 l 349 315 l 349 557 l 384 315 l 443 315 l 476 563 l 476 315 m 805 552 q 801 622 805 604 q 793 644 799 634 q 780 660 787 653 q 760 670 773 666 q 740 677 748 675 q 716 680 732 679 q 693 681 700 681 q 670 681 687 681 q 661 681 664 681 l 591 681 l 591 315 q 634 315 606 315 q 787 334 765 315 q 806 474 808 354 q 805 552 805 522 m 1051 399 l 1051 502 q 1049 537 1051 525 q 1042 563 1048 550 q 1023 582 1036 577 q 987 588 1010 588 q 928 562 952 588 l 928 681 l 837 681 l 837 315 l 922 315 l 928 339 q 987 311 951 311 q 1039 334 1026 311 q 1051 399 1051 358 m 1190 967 l 1190 25 q 1154 -63 1190 -26 q 1066 -99 1118 -99 l 124 -99 q 36 -63 73 -99 q 0 25 0 -26 l 0 967 q 36 1055 0 1018 q 124 1091 73 1091 l 1066 1091 q 1154 1055 1118 1091 q 1190 967 1190 1018 z "},"":{"ha":1687,"x_min":37,"x_max":1645,"o":"m 886 -153 q 877 -150 881 -152 q 849 -132 867 -143 q 783 -81 832 -120 q 693 0 734 -43 q 606 108 651 42 q 536 242 560 174 q 401 270 523 244 q 583 -10 452 105 q 886 -153 714 -126 m 389 317 l 519 295 q 488 425 500 354 q 473 538 475 496 l 470 579 q 376 405 405 515 q 389 317 380 355 m 474 789 q 415 674 441 739 q 472 727 449 710 l 474 789 m 1588 453 q 1540 691 1588 577 q 1410 886 1492 804 q 1216 1016 1328 968 q 980 1065 1104 1065 q 763 1024 867 1065 q 577 909 659 984 q 542 785 553 864 q 653 850 588 825 q 775 883 717 875 q 886 894 834 891 q 970 893 939 896 l 1001 891 q 1042 879 1027 890 q 1061 853 1058 867 q 1066 824 1065 839 q 1066 802 1068 810 q 889 803 968 811 q 748 769 811 794 q 637 713 684 743 q 536 637 590 684 q 544 565 539 609 q 572 427 550 522 q 620 288 594 333 q 812 300 715 284 q 978 341 908 315 q 1104 393 1048 367 q 1189 439 1160 419 l 1218 457 q 1248 473 1235 470 q 1272 469 1262 477 q 1285 443 1282 462 q 1255 349 1296 367 q 893 245 1094 274 q 647 233 788 229 q 732 96 679 158 q 839 -3 786 33 q 940 -64 891 -39 q 1018 -98 988 -89 l 1049 -107 q 1252 -95 1159 -125 q 1496 129 1404 -19 q 1588 453 1588 276 m 1645 481 q 1614 317 1635 377 q 1474 48 1560 156 q 1227 -148 1387 -59 q 1163 -182 1190 -174 q 1037 -195 1108 -202 q 980 -197 1009 -197 q 589 -63 761 -197 q 360 280 418 71 q 357 280 360 280 q 353 281 355 281 q 355 193 349 242 q 376 104 362 145 q 403 28 389 64 q 428 -27 418 -7 l 439 -47 q 481 -111 445 -57 q 384 -28 426 -81 q 323 80 343 25 q 293 186 304 136 q 279 270 281 237 l 277 302 q 252 312 274 304 q 214 326 229 320 q 173 342 198 332 q 128 361 147 352 q 90 381 109 370 q 57 402 70 391 q 37 422 43 412 q 76 402 52 414 q 164 367 101 390 q 277 337 227 343 l 278 362 q 351 587 287 477 q 488 870 383 743 q 550 1035 509 959 q 575 1070 562 1057 q 613 1095 588 1084 q 848 1176 736 1152 q 1082 1184 961 1199 q 1320 1109 1204 1170 q 1578 849 1490 1020 q 1645 481 1666 677 z "},"":{"ha":1389,"x_min":29,"x_max":1358,"o":"m 1039 583 q 1034 683 1062 617 q 940 794 1007 749 q 843 835 895 824 q 751 839 791 846 q 698 810 712 831 q 695 788 689 792 q 728 780 701 784 q 758 777 746 778 q 792 769 770 775 q 836 756 815 763 q 888 731 863 746 q 929 703 912 717 q 960 673 946 688 q 984 643 974 657 q 1001 617 993 629 q 1013 594 1008 604 q 1023 580 1018 585 q 1031 575 1027 575 q 1039 583 1035 576 m 1321 138 q 1206 -33 1280 40 q 1039 -142 1131 -105 q 843 -189 948 -180 q 637 -179 739 -198 q 443 -108 536 -159 q 280 17 350 -57 q 170 200 210 91 q 134 435 130 308 q 141 500 135 467 q 150 550 146 534 q 169 612 154 566 q 187 669 184 659 q 188 361 147 508 q 322 115 228 215 q 547 -45 415 15 q 815 -109 679 -105 q 1086 -52 952 -114 q 1310 138 1220 11 q 1324 149 1325 159 q 1321 138 1324 146 m 1104 640 q 1120 603 1104 640 q 1135 486 1135 567 q 1104 332 1135 405 q 1020 205 1073 258 q 894 120 967 151 q 741 88 822 88 q 587 120 660 88 q 462 205 515 151 q 378 332 409 258 q 346 486 346 405 q 378 640 346 567 q 462 767 409 714 q 587 852 515 821 q 741 884 660 884 q 894 852 822 884 q 1020 767 967 821 q 1104 640 1073 714 m 1358 709 q 1218 904 1308 823 q 1022 1023 1128 984 q 796 1064 915 1061 q 562 1036 676 1067 q 349 936 449 1004 q 178 772 249 867 q 77 542 108 677 q 69 253 46 407 q 29 494 31 377 q 57 705 27 611 q 141 881 86 800 q 269 1021 196 963 q 430 1119 343 1080 q 610 1174 517 1158 q 798 1181 702 1190 q 980 1139 893 1172 q 1148 1042 1068 1106 q 1286 890 1228 979 q 1334 796 1311 851 q 1358 709 1356 741 m 1310 444 q 1204 767 1319 633 q 897 953 1089 900 q 889 956 891 953 q 908 963 887 960 q 1086 924 1004 960 q 1220 831 1167 888 q 1310 700 1273 773 q 1355 546 1347 627 q 1354 385 1363 465 q 1307 232 1345 305 q 1212 102 1268 159 q 1068 11 1156 46 q 876 -25 981 -23 q 1032 37 960 -2 q 1167 133 1104 76 q 1267 269 1229 189 q 1310 444 1305 350 z "},"":{"ha":1190,"x_min":0,"x_max":1190,"o":"m 149 198 l 149 99 l 62 99 q 50 112 50 99 l 50 124 l 12 124 q 0 136 0 124 l 0 161 q 12 174 0 174 l 50 174 l 50 186 q 62 198 50 198 l 149 198 m 149 397 l 149 298 l 62 298 q 50 310 50 298 l 50 322 l 12 322 q 0 335 0 322 l 0 360 q 12 372 0 372 l 50 372 l 50 384 q 62 397 50 397 l 149 397 m 149 595 l 149 496 l 62 496 q 50 508 50 496 l 50 521 l 12 521 q 0 533 0 521 l 0 558 q 12 570 0 570 l 50 570 l 50 583 q 62 595 50 595 l 149 595 m 149 794 l 149 694 l 62 694 q 50 707 50 694 l 50 719 l 12 719 q 0 732 0 719 l 0 756 q 12 769 0 769 l 50 769 l 50 781 q 62 794 50 794 l 149 794 m 149 992 l 149 893 l 62 893 q 50 905 50 893 l 50 918 l 12 918 q 0 930 0 918 l 0 955 q 12 967 0 967 l 50 967 l 50 980 q 62 992 50 992 l 149 992 m 992 1116 l 992 -25 q 970 -78 992 -56 q 918 -99 949 -99 l 273 -99 q 220 -78 242 -99 q 198 -25 198 -56 l 198 1116 q 220 1169 198 1147 q 273 1190 242 1190 l 918 1190 q 970 1169 949 1190 q 992 1116 992 1147 m 1190 161 l 1190 136 q 1178 124 1190 124 l 1141 124 l 1141 112 q 1128 99 1141 99 l 1042 99 l 1042 198 l 1128 198 q 1141 186 1141 198 l 1141 174 l 1178 174 q 1190 161 1190 174 m 1190 360 l 1190 335 q 1178 322 1190 322 l 1141 322 l 1141 310 q 1128 298 1141 298 l 1042 298 l 1042 397 l 1128 397 q 1141 384 1141 397 l 1141 372 l 1178 372 q 1190 360 1190 372 m 1190 558 l 1190 533 q 1178 521 1190 521 l 1141 521 l 1141 508 q 1128 496 1141 496 l 1042 496 l 1042 595 l 1128 595 q 1141 583 1141 595 l 1141 570 l 1178 570 q 1190 558 1190 570 m 1190 756 l 1190 732 q 1178 719 1190 719 l 1141 719 l 1141 707 q 1128 694 1141 694 l 1042 694 l 1042 794 l 1128 794 q 1141 781 1141 794 l 1141 769 l 1178 769 q 1190 756 1190 769 m 1190 955 l 1190 930 q 1178 918 1190 918 l 1141 918 l 1141 905 q 1128 893 1141 893 l 1042 893 l 1042 992 l 1128 992 q 1141 980 1141 992 l 1141 967 l 1178 967 q 1190 955 1190 967 z "},"":{"ha":1290,"x_min":36,"x_max":1253,"o":"m 1214 325 l 1084 299 l 1228 216 q 1251 186 1246 206 q 1246 149 1256 167 q 1216 126 1235 131 q 1179 131 1197 121 l 1035 213 l 1077 89 q 1068 40 1087 60 q 1021 24 1049 20 q 984 57 994 28 l 904 289 l 694 410 l 694 167 l 856 -17 q 869 -47 868 -31 q 860 -76 870 -64 q 838 -95 851 -88 q 810 -99 825 -102 q 781 -82 794 -96 l 694 17 l 694 -149 q 680 -184 694 -169 q 645 -198 665 -198 q 610 -184 625 -198 q 595 -149 595 -169 l 595 17 l 508 -82 q 480 -99 496 -96 q 451 -95 464 -102 q 429 -76 439 -88 q 421 -47 420 -64 q 434 -17 422 -31 l 595 167 l 595 410 l 385 289 l 306 57 q 269 24 296 28 q 222 40 241 20 q 212 89 202 60 l 255 213 l 111 131 q 74 126 93 121 q 43 149 54 131 q 38 186 33 167 q 61 216 43 206 l 205 299 l 76 325 q 43 347 53 329 q 37 383 33 365 q 57 414 40 401 q 95 422 73 427 l 336 374 l 546 496 l 336 618 l 95 570 q 85 569 92 569 q 51 583 64 569 q 36 614 38 597 q 45 647 35 631 q 76 667 55 663 l 205 693 l 61 776 q 38 806 43 786 q 43 843 33 825 q 74 867 53 861 q 111 861 94 872 l 255 779 l 212 903 q 222 952 202 932 q 269 968 241 972 q 306 935 296 964 l 385 703 l 595 582 l 595 825 l 434 1009 q 421 1039 422 1023 q 429 1068 420 1056 q 451 1087 439 1080 q 480 1091 464 1094 q 508 1074 496 1088 l 595 975 l 595 1141 q 610 1176 595 1161 q 645 1190 625 1190 q 680 1176 665 1190 q 694 1141 694 1161 l 694 975 l 781 1074 q 810 1091 794 1088 q 838 1087 825 1094 q 860 1068 851 1080 q 869 1039 870 1056 q 856 1009 868 1023 l 694 825 l 694 582 l 904 703 l 984 935 q 1021 968 994 964 q 1068 952 1049 972 q 1077 903 1087 932 l 1035 779 l 1179 861 q 1216 866 1197 871 q 1246 843 1235 861 q 1251 806 1256 825 q 1228 776 1246 786 l 1084 693 l 1214 667 q 1245 647 1235 663 q 1253 614 1255 631 q 1239 583 1252 597 q 1204 569 1225 569 q 1194 570 1197 569 l 954 618 l 744 496 l 954 374 l 1194 422 q 1233 414 1217 427 q 1253 383 1249 401 q 1246 347 1256 365 q 1214 325 1236 329 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 1142 470 q 1116 646 1147 562 q 1028 792 1085 730 q 891 894 972 855 q 720 939 811 933 q 545 914 630 944 q 396 828 460 884 q 292 693 332 773 q 246 522 251 612 q 271 346 240 430 q 359 200 302 262 q 496 98 415 137 q 668 53 577 59 q 895 99 788 47 q 1069 251 1002 152 q 1142 470 1135 350 m 1389 1190 l 1118 921 q 1258 710 1211 830 q 1297 461 1305 590 q 1218 198 1289 319 q 1032 0 1148 78 q 774 -96 915 -77 l 0 -198 l 269 71 q 129 281 176 160 q 90 530 82 401 q 169 794 98 673 q 356 992 239 915 q 614 1088 473 1069 q 1001 1139 743 1105 q 1389 1190 1259 1173 z "},"":{"ha":1389,"x_min":0,"x_max":1389,"o":"m 735 394 l 861 139 l 822 139 l 686 410 l 553 139 l 515 139 l 654 429 l 594 454 l 610 492 l 796 413 l 780 374 l 735 394 m 436 853 l 672 752 l 571 516 l 336 617 l 436 853 m 703 709 l 889 629 l 809 444 l 624 523 l 703 709 m 921 593 l 1069 530 l 1005 383 l 858 446 l 921 593 m 1254 260 q 1278 317 1254 260 q 1302 496 1302 373 q 1254 732 1302 619 q 1124 926 1206 844 q 930 1056 1042 1008 q 694 1104 818 1104 q 459 1056 571 1104 q 265 926 346 1008 q 135 732 183 844 q 87 496 87 619 q 135 260 87 373 q 265 66 183 148 q 459 -64 346 -16 q 694 -112 571 -112 q 930 -64 818 -112 q 1124 66 1042 -16 q 1254 260 1206 148 m 1334 766 q 1361 701 1334 766 q 1389 496 1389 637 q 1334 226 1389 355 q 1186 5 1279 98 q 964 -143 1093 -88 q 694 -198 836 -198 q 425 -143 553 -198 q 203 5 296 -88 q 55 226 110 98 q 0 496 0 355 q 55 766 0 637 q 203 987 110 894 q 425 1135 296 1080 q 694 1190 553 1190 q 964 1135 836 1190 q 1186 987 1093 1080 q 1334 766 1279 894 z "},"":{"ha":1488,"x_min":29,"x_max":1459,"o":"m 1034 234 q 1013 260 1031 253 q 974 269 994 268 q 937 278 954 269 q 917 308 919 288 q 942 416 913 344 q 1001 556 972 488 q 1025 655 1029 625 q 935 735 1015 733 q 877 722 900 736 l 874 721 q 870 719 871 719 q 867 717 870 718 q 863 716 864 716 q 859 715 862 715 q 854 717 856 715 q 850 719 853 718 q 845 723 847 721 q 838 730 842 725 q 831 737 833 735 q 824 742 829 739 q 817 748 820 746 q 810 753 814 750 q 801 756 805 755 q 792 758 797 757 q 755 756 769 762 q 720 732 741 749 q 713 725 719 731 q 703 717 707 719 q 692 709 700 714 q 679 705 684 704 q 666 707 674 705 q 601 738 624 728 q 528 734 569 752 q 469 684 487 716 q 437 607 457 662 q 403 505 418 553 q 372 401 389 457 q 356 344 356 345 q 370 252 339 291 q 456 216 401 213 q 495 228 479 218 q 525 264 511 238 q 586 418 530 274 q 646 569 642 563 q 662 583 650 577 q 685 583 674 588 q 701 542 706 571 q 662 434 700 528 q 623 331 624 339 q 638 287 618 301 q 685 282 658 273 q 728 320 712 291 q 763 391 731 326 q 826 518 795 457 q 862 587 857 580 q 894 608 877 609 q 913 579 916 608 q 862 465 911 567 q 808 341 813 363 q 818 261 798 300 q 875 204 837 222 q 915 192 888 197 q 970 186 941 187 q 1018 196 999 184 q 1034 234 1038 208 m 284 84 q 289 81 284 84 q 297 67 295 78 q 293 45 299 55 q 275 33 287 36 q 255 37 264 31 q 243 55 245 43 q 246 76 240 66 q 264 88 253 86 q 284 84 274 91 m 739 -137 q 745 -166 748 -150 q 729 -191 742 -182 q 700 -198 716 -201 q 675 -181 684 -195 q 669 -152 667 -168 q 685 -127 672 -136 q 714 -121 698 -118 q 739 -137 730 -124 m 146 537 q 149 525 146 537 q 137 492 151 513 q 99 467 123 471 q 54 477 74 462 q 29 515 34 491 q 39 560 25 540 q 77 586 53 581 q 122 577 102 591 q 146 537 142 562 m 1137 -33 q 1147 -80 1152 -54 q 1121 -121 1142 -106 q 1074 -131 1099 -136 q 1034 -105 1049 -126 q 1024 -57 1019 -83 q 1049 -16 1028 -32 q 1096 -6 1071 -2 q 1137 -33 1121 -11 m 1224 436 q 1257 246 1277 348 q 1152 85 1236 144 q 998 39 1083 36 q 933 -60 983 -23 q 822 -94 883 -96 q 713 -50 760 -92 q 703 -57 704 -57 q 529 -95 623 -112 q 379 3 434 -78 q 338 130 340 60 q 227 185 274 141 q 165 284 181 229 q 164 402 149 339 q 226 509 178 464 q 197 608 198 556 q 216 705 195 661 q 277 782 236 749 q 371 821 319 814 q 448 935 396 887 q 562 1006 500 984 q 692 1020 623 1028 q 815 968 760 1011 q 924 982 871 984 q 1023 954 977 979 q 1104 892 1070 929 q 1157 803 1139 855 q 1170 694 1175 750 q 1238 649 1211 681 q 1273 581 1265 618 q 1269 503 1281 543 q 1224 436 1256 463 m 353 947 q 360 913 363 932 q 341 883 357 894 q 307 875 326 872 q 278 894 288 879 q 271 929 267 910 q 290 959 274 948 q 324 966 305 970 q 353 947 343 963 m 476 1165 q 472 1141 479 1152 q 452 1127 465 1130 q 428 1131 439 1124 q 414 1152 417 1139 q 419 1176 412 1165 q 439 1190 426 1187 q 463 1185 452 1193 q 476 1165 474 1178 m 1395 430 q 1390 401 1398 415 q 1366 385 1382 388 q 1339 390 1352 382 q 1322 414 1325 398 q 1327 443 1319 429 q 1351 460 1335 456 q 1379 454 1366 463 q 1395 430 1392 445 m 880 1122 q 887 1077 893 1101 q 860 1040 881 1053 q 815 1034 839 1028 q 779 1060 791 1039 q 772 1106 767 1082 q 799 1143 778 1130 q 844 1150 820 1156 q 880 1122 868 1144 m 1459 614 q 1456 593 1462 602 q 1438 580 1449 583 q 1416 584 1426 577 q 1404 601 1407 591 q 1408 623 1402 613 q 1426 636 1414 633 q 1447 632 1437 638 q 1459 614 1456 625 m 1311 801 q 1319 763 1322 784 q 1298 729 1315 742 q 1260 722 1281 718 q 1228 742 1239 725 q 1220 780 1216 760 q 1241 814 1224 801 q 1278 822 1258 826 q 1311 801 1299 818 z "},"":{"ha":1389,"x_min":0,"x_max":0,"o":""},"":{"ha":1389,"x_min":0,"x_max":0,"o":""},"":{"ha":1389,"x_min":0,"x_max":0,"o":""},"":{"ha":1389,"x_min":0,"x_max":0,"o":""},"":{"ha":1389,"x_min":0,"x_max":0,"o":""},"":{"ha":1389,"x_min":0,"x_max":0,"o":""},"":{"ha":1389,"x_min":0,"x_max":0,"o":""},"":{"ha":1389,"x_min":0,"x_max":0,"o":""},"":{"ha":1389,"x_min":0,"x_max":0,"o":""},"":{"ha":1389,"x_min":0,"x_max":0,"o":""},"":{"ha":1389,"x_min":0,"x_max":0,"o":""},"":{"ha":1389,"x_min":0,"x_max":0,"o":""},"":{"ha":1389,"x_min":0,"x_max":0,"o":""},"":{"ha":1389,"x_min":0,"x_max":0,"o":""},"":{"ha":1389,"x_min":0,"x_max":0,"o":""}},"familyName":"FontAwesome","ascender":1190,"descender":-198,"underlinePosition":0,"underlineThickness":0,"boundingBox":{"yMin":-198,"xMin":-1,"yMax":1190,"xMax":1786},"resolution":1000,"original_font_information":{"format":0,"copyright":"Copyright Dave Gandy 2016. All rights reserved.","fontFamily":"FontAwesome","fontSubfamily":"Regular","uniqueID":"FONTLAB:OTFEXPORT","fullName":"FontAwesome","version":"Version 4.7.0 2016","postScriptName":"FontAwesome","trademark":"Please refer to the Copyright section for the font trademark attribution notices.","manufacturer":"Fort Awesome","designer":"Dave Gandy","manufacturerURL":"http://fontawesome.io","licenceURL":"http://fontawesome.io/license/"},"cssFontWeight":"normal","cssFontStyle":"normal"} |
New file |
| | |
| | | <?xml version="1.0" standalone="no"?> |
| | | <!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd" > |
| | | <svg> |
| | | <metadata> |
| | | Created by FontForge 20120731 at Mon Oct 24 17:37:40 2016 |
| | | By ,,, |
| | | Copyright Dave Gandy 2016. All rights reserved. |
| | | </metadata> |
| | | <defs> |
| | | <font id="FontAwesome" horiz-adv-x="1536" > |
| | | <font-face |
| | | font-family="FontAwesome" |
| | | font-weight="400" |
| | | font-stretch="normal" |
| | | units-per-em="1792" |
| | | panose-1="0 0 0 0 0 0 0 0 0 0" |
| | | ascent="1536" |
| | | descent="-256" |
| | | bbox="-1.02083 -256.962 2304.6 1537.02" |
| | | underline-thickness="0" |
| | | underline-position="0" |
| | | unicode-range="U+0020-F500" |
| | | /> |
| | | <missing-glyph horiz-adv-x="896" |
| | | d="M224 112h448v1312h-448v-1312zM112 0v1536h672v-1536h-672z" /> |
| | | <glyph glyph-name=".notdef" horiz-adv-x="896" |
| | | d="M224 112h448v1312h-448v-1312zM112 0v1536h672v-1536h-672z" /> |
| | | <glyph glyph-name=".null" horiz-adv-x="0" |
| | | /> |
| | | <glyph glyph-name="nonmarkingreturn" horiz-adv-x="597" |
| | | /> |
| | | <glyph glyph-name="space" unicode=" " horiz-adv-x="448" |
| | | /> |
| | | <glyph glyph-name="dieresis" unicode="¨" horiz-adv-x="1792" |
| | | /> |
| | | <glyph glyph-name="copyright" unicode="©" horiz-adv-x="1792" |
| | | /> |
| | | <glyph glyph-name="registered" unicode="®" horiz-adv-x="1792" |
| | | /> |
| | | <glyph glyph-name="acute" unicode="´" horiz-adv-x="1792" |
| | | /> |
| | | <glyph glyph-name="AE" unicode="Æ" horiz-adv-x="1792" |
| | | /> |
| | | <glyph glyph-name="Oslash" unicode="Ø" horiz-adv-x="1792" |
| | | /> |
| | | <glyph glyph-name="trademark" unicode="™" horiz-adv-x="1792" |
| | | /> |
| | | <glyph glyph-name="infinity" unicode="∞" horiz-adv-x="1792" |
| | | /> |
| | | <glyph glyph-name="notequal" unicode="≠" horiz-adv-x="1792" |
| | | /> |
| | | <glyph glyph-name="glass" unicode="" horiz-adv-x="1792" |
| | | d="M1699 1350q0 -35 -43 -78l-632 -632v-768h320q26 0 45 -19t19 -45t-19 -45t-45 -19h-896q-26 0 -45 19t-19 45t19 45t45 19h320v768l-632 632q-43 43 -43 78q0 23 18 36.5t38 17.5t43 4h1408q23 0 43 -4t38 -17.5t18 -36.5z" /> |
| | | <glyph glyph-name="music" unicode="" |
| | | d="M1536 1312v-1120q0 -50 -34 -89t-86 -60.5t-103.5 -32t-96.5 -10.5t-96.5 10.5t-103.5 32t-86 60.5t-34 89t34 89t86 60.5t103.5 32t96.5 10.5q105 0 192 -39v537l-768 -237v-709q0 -50 -34 -89t-86 -60.5t-103.5 -32t-96.5 -10.5t-96.5 10.5t-103.5 32t-86 60.5t-34 89 |
| | | t34 89t86 60.5t103.5 32t96.5 10.5q105 0 192 -39v967q0 31 19 56.5t49 35.5l832 256q12 4 28 4q40 0 68 -28t28 -68z" /> |
| | | <glyph glyph-name="search" unicode="" horiz-adv-x="1664" |
| | | d="M1152 704q0 185 -131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5t316.5 131.5t131.5 316.5zM1664 -128q0 -52 -38 -90t-90 -38q-54 0 -90 38l-343 342q-179 -124 -399 -124q-143 0 -273.5 55.5t-225 150t-150 225t-55.5 273.5 |
| | | t55.5 273.5t150 225t225 150t273.5 55.5t273.5 -55.5t225 -150t150 -225t55.5 -273.5q0 -220 -124 -399l343 -343q37 -37 37 -90z" /> |
| | | <glyph glyph-name="envelope" unicode="" horiz-adv-x="1792" |
| | | d="M1664 32v768q-32 -36 -69 -66q-268 -206 -426 -338q-51 -43 -83 -67t-86.5 -48.5t-102.5 -24.5h-1h-1q-48 0 -102.5 24.5t-86.5 48.5t-83 67q-158 132 -426 338q-37 30 -69 66v-768q0 -13 9.5 -22.5t22.5 -9.5h1472q13 0 22.5 9.5t9.5 22.5zM1664 1083v11v13.5t-0.5 13 |
| | | t-3 12.5t-5.5 9t-9 7.5t-14 2.5h-1472q-13 0 -22.5 -9.5t-9.5 -22.5q0 -168 147 -284q193 -152 401 -317q6 -5 35 -29.5t46 -37.5t44.5 -31.5t50.5 -27.5t43 -9h1h1q20 0 43 9t50.5 27.5t44.5 31.5t46 37.5t35 29.5q208 165 401 317q54 43 100.5 115.5t46.5 131.5z |
| | | M1792 1120v-1088q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h1472q66 0 113 -47t47 -113z" /> |
| | | <glyph glyph-name="heart" unicode="" horiz-adv-x="1792" |
| | | d="M896 -128q-26 0 -44 18l-624 602q-10 8 -27.5 26t-55.5 65.5t-68 97.5t-53.5 121t-23.5 138q0 220 127 344t351 124q62 0 126.5 -21.5t120 -58t95.5 -68.5t76 -68q36 36 76 68t95.5 68.5t120 58t126.5 21.5q224 0 351 -124t127 -344q0 -221 -229 -450l-623 -600 |
| | | q-18 -18 -44 -18z" /> |
| | | <glyph glyph-name="star" unicode="" horiz-adv-x="1664" |
| | | d="M1664 889q0 -22 -26 -48l-363 -354l86 -500q1 -7 1 -20q0 -21 -10.5 -35.5t-30.5 -14.5q-19 0 -40 12l-449 236l-449 -236q-22 -12 -40 -12q-21 0 -31.5 14.5t-10.5 35.5q0 6 2 20l86 500l-364 354q-25 27 -25 48q0 37 56 46l502 73l225 455q19 41 49 41t49 -41l225 -455 |
| | | l502 -73q56 -9 56 -46z" /> |
| | | <glyph glyph-name="star_empty" unicode="" horiz-adv-x="1664" |
| | | d="M1137 532l306 297l-422 62l-189 382l-189 -382l-422 -62l306 -297l-73 -421l378 199l377 -199zM1664 889q0 -22 -26 -48l-363 -354l86 -500q1 -7 1 -20q0 -50 -41 -50q-19 0 -40 12l-449 236l-449 -236q-22 -12 -40 -12q-21 0 -31.5 14.5t-10.5 35.5q0 6 2 20l86 500 |
| | | l-364 354q-25 27 -25 48q0 37 56 46l502 73l225 455q19 41 49 41t49 -41l225 -455l502 -73q56 -9 56 -46z" /> |
| | | <glyph glyph-name="user" unicode="" horiz-adv-x="1280" |
| | | d="M1280 137q0 -109 -62.5 -187t-150.5 -78h-854q-88 0 -150.5 78t-62.5 187q0 85 8.5 160.5t31.5 152t58.5 131t94 89t134.5 34.5q131 -128 313 -128t313 128q76 0 134.5 -34.5t94 -89t58.5 -131t31.5 -152t8.5 -160.5zM1024 1024q0 -159 -112.5 -271.5t-271.5 -112.5 |
| | | t-271.5 112.5t-112.5 271.5t112.5 271.5t271.5 112.5t271.5 -112.5t112.5 -271.5z" /> |
| | | <glyph glyph-name="film" unicode="" horiz-adv-x="1920" |
| | | d="M384 -64v128q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM384 320v128q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM384 704v128q0 26 -19 45t-45 19h-128 |
| | | q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM1408 -64v512q0 26 -19 45t-45 19h-768q-26 0 -45 -19t-19 -45v-512q0 -26 19 -45t45 -19h768q26 0 45 19t19 45zM384 1088v128q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45 |
| | | t45 -19h128q26 0 45 19t19 45zM1792 -64v128q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM1408 704v512q0 26 -19 45t-45 19h-768q-26 0 -45 -19t-19 -45v-512q0 -26 19 -45t45 -19h768q26 0 45 19t19 45zM1792 320v128 |
| | | q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM1792 704v128q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM1792 1088v128q0 26 -19 45t-45 19h-128q-26 0 -45 -19 |
| | | t-19 -45v-128q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM1920 1248v-1344q0 -66 -47 -113t-113 -47h-1600q-66 0 -113 47t-47 113v1344q0 66 47 113t113 47h1600q66 0 113 -47t47 -113z" /> |
| | | <glyph glyph-name="th_large" unicode="" horiz-adv-x="1664" |
| | | d="M768 512v-384q0 -52 -38 -90t-90 -38h-512q-52 0 -90 38t-38 90v384q0 52 38 90t90 38h512q52 0 90 -38t38 -90zM768 1280v-384q0 -52 -38 -90t-90 -38h-512q-52 0 -90 38t-38 90v384q0 52 38 90t90 38h512q52 0 90 -38t38 -90zM1664 512v-384q0 -52 -38 -90t-90 -38 |
| | | h-512q-52 0 -90 38t-38 90v384q0 52 38 90t90 38h512q52 0 90 -38t38 -90zM1664 1280v-384q0 -52 -38 -90t-90 -38h-512q-52 0 -90 38t-38 90v384q0 52 38 90t90 38h512q52 0 90 -38t38 -90z" /> |
| | | <glyph glyph-name="th" unicode="" horiz-adv-x="1792" |
| | | d="M512 288v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM512 800v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1152 288v-192q0 -40 -28 -68t-68 -28h-320 |
| | | q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM512 1312v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1152 800v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28 |
| | | h320q40 0 68 -28t28 -68zM1792 288v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1152 1312v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1792 800v-192 |
| | | q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1792 1312v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68z" /> |
| | | <glyph glyph-name="th_list" unicode="" horiz-adv-x="1792" |
| | | d="M512 288v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM512 800v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1792 288v-192q0 -40 -28 -68t-68 -28h-960 |
| | | q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h960q40 0 68 -28t28 -68zM512 1312v-192q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h320q40 0 68 -28t28 -68zM1792 800v-192q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68v192q0 40 28 68t68 28 |
| | | h960q40 0 68 -28t28 -68zM1792 1312v-192q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h960q40 0 68 -28t28 -68z" /> |
| | | <glyph glyph-name="ok" unicode="" horiz-adv-x="1792" |
| | | d="M1671 970q0 -40 -28 -68l-724 -724l-136 -136q-28 -28 -68 -28t-68 28l-136 136l-362 362q-28 28 -28 68t28 68l136 136q28 28 68 28t68 -28l294 -295l656 657q28 28 68 28t68 -28l136 -136q28 -28 28 -68z" /> |
| | | <glyph glyph-name="remove" unicode="" horiz-adv-x="1408" |
| | | d="M1298 214q0 -40 -28 -68l-136 -136q-28 -28 -68 -28t-68 28l-294 294l-294 -294q-28 -28 -68 -28t-68 28l-136 136q-28 28 -28 68t28 68l294 294l-294 294q-28 28 -28 68t28 68l136 136q28 28 68 28t68 -28l294 -294l294 294q28 28 68 28t68 -28l136 -136q28 -28 28 -68 |
| | | t-28 -68l-294 -294l294 -294q28 -28 28 -68z" /> |
| | | <glyph glyph-name="zoom_in" unicode="" horiz-adv-x="1664" |
| | | d="M1024 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-224v-224q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v224h-224q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h224v224q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5v-224h224 |
| | | q13 0 22.5 -9.5t9.5 -22.5zM1152 704q0 185 -131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5t316.5 131.5t131.5 316.5zM1664 -128q0 -53 -37.5 -90.5t-90.5 -37.5q-54 0 -90 38l-343 342q-179 -124 -399 -124q-143 0 -273.5 55.5 |
| | | t-225 150t-150 225t-55.5 273.5t55.5 273.5t150 225t225 150t273.5 55.5t273.5 -55.5t225 -150t150 -225t55.5 -273.5q0 -220 -124 -399l343 -343q37 -37 37 -90z" /> |
| | | <glyph glyph-name="zoom_out" unicode="" horiz-adv-x="1664" |
| | | d="M1024 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-576q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h576q13 0 22.5 -9.5t9.5 -22.5zM1152 704q0 185 -131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5t316.5 131.5t131.5 316.5z |
| | | M1664 -128q0 -53 -37.5 -90.5t-90.5 -37.5q-54 0 -90 38l-343 342q-179 -124 -399 -124q-143 0 -273.5 55.5t-225 150t-150 225t-55.5 273.5t55.5 273.5t150 225t225 150t273.5 55.5t273.5 -55.5t225 -150t150 -225t55.5 -273.5q0 -220 -124 -399l343 -343q37 -37 37 -90z |
| | | " /> |
| | | <glyph glyph-name="off" unicode="" |
| | | d="M1536 640q0 -156 -61 -298t-164 -245t-245 -164t-298 -61t-298 61t-245 164t-164 245t-61 298q0 182 80.5 343t226.5 270q43 32 95.5 25t83.5 -50q32 -42 24.5 -94.5t-49.5 -84.5q-98 -74 -151.5 -181t-53.5 -228q0 -104 40.5 -198.5t109.5 -163.5t163.5 -109.5 |
| | | t198.5 -40.5t198.5 40.5t163.5 109.5t109.5 163.5t40.5 198.5q0 121 -53.5 228t-151.5 181q-42 32 -49.5 84.5t24.5 94.5q31 43 84 50t95 -25q146 -109 226.5 -270t80.5 -343zM896 1408v-640q0 -52 -38 -90t-90 -38t-90 38t-38 90v640q0 52 38 90t90 38t90 -38t38 -90z" /> |
| | | <glyph glyph-name="signal" unicode="" horiz-adv-x="1792" |
| | | d="M256 96v-192q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM640 224v-320q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v320q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM1024 480v-576q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23 |
| | | v576q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM1408 864v-960q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v960q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM1792 1376v-1472q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v1472q0 14 9 23t23 9h192q14 0 23 -9t9 -23z" /> |
| | | <glyph glyph-name="cog" unicode="" |
| | | d="M1024 640q0 106 -75 181t-181 75t-181 -75t-75 -181t75 -181t181 -75t181 75t75 181zM1536 749v-222q0 -12 -8 -23t-20 -13l-185 -28q-19 -54 -39 -91q35 -50 107 -138q10 -12 10 -25t-9 -23q-27 -37 -99 -108t-94 -71q-12 0 -26 9l-138 108q-44 -23 -91 -38 |
| | | q-16 -136 -29 -186q-7 -28 -36 -28h-222q-14 0 -24.5 8.5t-11.5 21.5l-28 184q-49 16 -90 37l-141 -107q-10 -9 -25 -9q-14 0 -25 11q-126 114 -165 168q-7 10 -7 23q0 12 8 23q15 21 51 66.5t54 70.5q-27 50 -41 99l-183 27q-13 2 -21 12.5t-8 23.5v222q0 12 8 23t19 13 |
| | | l186 28q14 46 39 92q-40 57 -107 138q-10 12 -10 24q0 10 9 23q26 36 98.5 107.5t94.5 71.5q13 0 26 -10l138 -107q44 23 91 38q16 136 29 186q7 28 36 28h222q14 0 24.5 -8.5t11.5 -21.5l28 -184q49 -16 90 -37l142 107q9 9 24 9q13 0 25 -10q129 -119 165 -170q7 -8 7 -22 |
| | | q0 -12 -8 -23q-15 -21 -51 -66.5t-54 -70.5q26 -50 41 -98l183 -28q13 -2 21 -12.5t8 -23.5z" /> |
| | | <glyph glyph-name="trash" unicode="" horiz-adv-x="1408" |
| | | d="M512 800v-576q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v576q0 14 9 23t23 9h64q14 0 23 -9t9 -23zM768 800v-576q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v576q0 14 9 23t23 9h64q14 0 23 -9t9 -23zM1024 800v-576q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v576 |
| | | q0 14 9 23t23 9h64q14 0 23 -9t9 -23zM1152 76v948h-896v-948q0 -22 7 -40.5t14.5 -27t10.5 -8.5h832q3 0 10.5 8.5t14.5 27t7 40.5zM480 1152h448l-48 117q-7 9 -17 11h-317q-10 -2 -17 -11zM1408 1120v-64q0 -14 -9 -23t-23 -9h-96v-948q0 -83 -47 -143.5t-113 -60.5h-832 |
| | | q-66 0 -113 58.5t-47 141.5v952h-96q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h309l70 167q15 37 54 63t79 26h320q40 0 79 -26t54 -63l70 -167h309q14 0 23 -9t9 -23z" /> |
| | | <glyph glyph-name="home" unicode="" horiz-adv-x="1664" |
| | | d="M1408 544v-480q0 -26 -19 -45t-45 -19h-384v384h-256v-384h-384q-26 0 -45 19t-19 45v480q0 1 0.5 3t0.5 3l575 474l575 -474q1 -2 1 -6zM1631 613l-62 -74q-8 -9 -21 -11h-3q-13 0 -21 7l-692 577l-692 -577q-12 -8 -24 -7q-13 2 -21 11l-62 74q-8 10 -7 23.5t11 21.5 |
| | | l719 599q32 26 76 26t76 -26l244 -204v195q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-408l219 -182q10 -8 11 -21.5t-7 -23.5z" /> |
| | | <glyph glyph-name="file_alt" unicode="" |
| | | d="M1468 1156q28 -28 48 -76t20 -88v-1152q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h896q40 0 88 -20t76 -48zM1024 1400v-376h376q-10 29 -22 41l-313 313q-12 12 -41 22zM1408 -128v1024h-416q-40 0 -68 28t-28 68v416h-768v-1536h1280z |
| | | " /> |
| | | <glyph glyph-name="time" unicode="" |
| | | d="M896 992v-448q0 -14 -9 -23t-23 -9h-320q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h224v352q0 14 9 23t23 9h64q14 0 23 -9t9 -23zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273zM1536 640 |
| | | q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> |
| | | <glyph glyph-name="road" unicode="" horiz-adv-x="1920" |
| | | d="M1111 540v4l-24 320q-1 13 -11 22.5t-23 9.5h-186q-13 0 -23 -9.5t-11 -22.5l-24 -320v-4q-1 -12 8 -20t21 -8h244q12 0 21 8t8 20zM1870 73q0 -73 -46 -73h-704q13 0 22 9.5t8 22.5l-20 256q-1 13 -11 22.5t-23 9.5h-272q-13 0 -23 -9.5t-11 -22.5l-20 -256 |
| | | q-1 -13 8 -22.5t22 -9.5h-704q-46 0 -46 73q0 54 26 116l417 1044q8 19 26 33t38 14h339q-13 0 -23 -9.5t-11 -22.5l-15 -192q-1 -14 8 -23t22 -9h166q13 0 22 9t8 23l-15 192q-1 13 -11 22.5t-23 9.5h339q20 0 38 -14t26 -33l417 -1044q26 -62 26 -116z" /> |
| | | <glyph glyph-name="download_alt" unicode="" horiz-adv-x="1664" |
| | | d="M1280 192q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1536 192q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1664 416v-320q0 -40 -28 -68t-68 -28h-1472q-40 0 -68 28t-28 68v320q0 40 28 68t68 28h465l135 -136 |
| | | q58 -56 136 -56t136 56l136 136h464q40 0 68 -28t28 -68zM1339 985q17 -41 -14 -70l-448 -448q-18 -19 -45 -19t-45 19l-448 448q-31 29 -14 70q17 39 59 39h256v448q0 26 19 45t45 19h256q26 0 45 -19t19 -45v-448h256q42 0 59 -39z" /> |
| | | <glyph glyph-name="download" unicode="" |
| | | d="M1120 608q0 -12 -10 -24l-319 -319q-11 -9 -23 -9t-23 9l-320 320q-15 16 -7 35q8 20 30 20h192v352q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-352h192q14 0 23 -9t9 -23zM768 1184q-148 0 -273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273 |
| | | t-73 273t-198 198t-273 73zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> |
| | | <glyph glyph-name="upload" unicode="" |
| | | d="M1118 660q-8 -20 -30 -20h-192v-352q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v352h-192q-14 0 -23 9t-9 23q0 12 10 24l319 319q11 9 23 9t23 -9l320 -320q15 -16 7 -35zM768 1184q-148 0 -273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198 |
| | | t73 273t-73 273t-198 198t-273 73zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> |
| | | <glyph glyph-name="inbox" unicode="" |
| | | d="M1023 576h316q-1 3 -2.5 8.5t-2.5 7.5l-212 496h-708l-212 -496q-1 -3 -2.5 -8.5t-2.5 -7.5h316l95 -192h320zM1536 546v-482q0 -26 -19 -45t-45 -19h-1408q-26 0 -45 19t-19 45v482q0 62 25 123l238 552q10 25 36.5 42t52.5 17h832q26 0 52.5 -17t36.5 -42l238 -552 |
| | | q25 -61 25 -123z" /> |
| | | <glyph glyph-name="play_circle" unicode="" |
| | | d="M1184 640q0 -37 -32 -55l-544 -320q-15 -9 -32 -9q-16 0 -32 8q-32 19 -32 56v640q0 37 32 56q33 18 64 -1l544 -320q32 -18 32 -55zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273zM1536 640 |
| | | q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> |
| | | <glyph glyph-name="repeat" unicode="" |
| | | d="M1536 1280v-448q0 -26 -19 -45t-45 -19h-448q-42 0 -59 40q-17 39 14 69l138 138q-148 137 -349 137q-104 0 -198.5 -40.5t-163.5 -109.5t-109.5 -163.5t-40.5 -198.5t40.5 -198.5t109.5 -163.5t163.5 -109.5t198.5 -40.5q119 0 225 52t179 147q7 10 23 12q15 0 25 -9 |
| | | l137 -138q9 -8 9.5 -20.5t-7.5 -22.5q-109 -132 -264 -204.5t-327 -72.5q-156 0 -298 61t-245 164t-164 245t-61 298t61 298t164 245t245 164t298 61q147 0 284.5 -55.5t244.5 -156.5l130 129q29 31 70 14q39 -17 39 -59z" /> |
| | | <glyph glyph-name="refresh" unicode="" |
| | | d="M1511 480q0 -5 -1 -7q-64 -268 -268 -434.5t-478 -166.5q-146 0 -282.5 55t-243.5 157l-129 -129q-19 -19 -45 -19t-45 19t-19 45v448q0 26 19 45t45 19h448q26 0 45 -19t19 -45t-19 -45l-137 -137q71 -66 161 -102t187 -36q134 0 250 65t186 179q11 17 53 117 |
| | | q8 23 30 23h192q13 0 22.5 -9.5t9.5 -22.5zM1536 1280v-448q0 -26 -19 -45t-45 -19h-448q-26 0 -45 19t-19 45t19 45l138 138q-148 137 -349 137q-134 0 -250 -65t-186 -179q-11 -17 -53 -117q-8 -23 -30 -23h-199q-13 0 -22.5 9.5t-9.5 22.5v7q65 268 270 434.5t480 166.5 |
| | | q146 0 284 -55.5t245 -156.5l130 129q19 19 45 19t45 -19t19 -45z" /> |
| | | <glyph glyph-name="list_alt" unicode="" horiz-adv-x="1792" |
| | | d="M384 352v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 608v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z |
| | | M384 864v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM1536 352v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-960q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h960q13 0 22.5 -9.5t9.5 -22.5z |
| | | M1536 608v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-960q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h960q13 0 22.5 -9.5t9.5 -22.5zM1536 864v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-960q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h960q13 0 22.5 -9.5 |
| | | t9.5 -22.5zM1664 160v832q0 13 -9.5 22.5t-22.5 9.5h-1472q-13 0 -22.5 -9.5t-9.5 -22.5v-832q0 -13 9.5 -22.5t22.5 -9.5h1472q13 0 22.5 9.5t9.5 22.5zM1792 1248v-1088q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h1472q66 0 113 -47 |
| | | t47 -113z" /> |
| | | <glyph glyph-name="lock" unicode="" horiz-adv-x="1152" |
| | | d="M320 768h512v192q0 106 -75 181t-181 75t-181 -75t-75 -181v-192zM1152 672v-576q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68v576q0 40 28 68t68 28h32v192q0 184 132 316t316 132t316 -132t132 -316v-192h32q40 0 68 -28t28 -68z" /> |
| | | <glyph glyph-name="flag" unicode="" horiz-adv-x="1792" |
| | | d="M320 1280q0 -72 -64 -110v-1266q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v1266q-64 38 -64 110q0 53 37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1792 1216v-763q0 -25 -12.5 -38.5t-39.5 -27.5q-215 -116 -369 -116q-61 0 -123.5 22t-108.5 48 |
| | | t-115.5 48t-142.5 22q-192 0 -464 -146q-17 -9 -33 -9q-26 0 -45 19t-19 45v742q0 32 31 55q21 14 79 43q236 120 421 120q107 0 200 -29t219 -88q38 -19 88 -19q54 0 117.5 21t110 47t88 47t54.5 21q26 0 45 -19t19 -45z" /> |
| | | <glyph glyph-name="headphones" unicode="" horiz-adv-x="1664" |
| | | d="M1664 650q0 -166 -60 -314l-20 -49l-185 -33q-22 -83 -90.5 -136.5t-156.5 -53.5v-32q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v576q0 14 9 23t23 9h64q14 0 23 -9t9 -23v-32q71 0 130 -35.5t93 -95.5l68 12q29 95 29 193q0 148 -88 279t-236.5 209t-315.5 78 |
| | | t-315.5 -78t-236.5 -209t-88 -279q0 -98 29 -193l68 -12q34 60 93 95.5t130 35.5v32q0 14 9 23t23 9h64q14 0 23 -9t9 -23v-576q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v32q-88 0 -156.5 53.5t-90.5 136.5l-185 33l-20 49q-60 148 -60 314q0 151 67 291t179 242.5 |
| | | t266 163.5t320 61t320 -61t266 -163.5t179 -242.5t67 -291z" /> |
| | | <glyph glyph-name="volume_off" unicode="" horiz-adv-x="768" |
| | | d="M768 1184v-1088q0 -26 -19 -45t-45 -19t-45 19l-333 333h-262q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h262l333 333q19 19 45 19t45 -19t19 -45z" /> |
| | | <glyph glyph-name="volume_down" unicode="" horiz-adv-x="1152" |
| | | d="M768 1184v-1088q0 -26 -19 -45t-45 -19t-45 19l-333 333h-262q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h262l333 333q19 19 45 19t45 -19t19 -45zM1152 640q0 -76 -42.5 -141.5t-112.5 -93.5q-10 -5 -25 -5q-26 0 -45 18.5t-19 45.5q0 21 12 35.5t29 25t34 23t29 36 |
| | | t12 56.5t-12 56.5t-29 36t-34 23t-29 25t-12 35.5q0 27 19 45.5t45 18.5q15 0 25 -5q70 -27 112.5 -93t42.5 -142z" /> |
| | | <glyph glyph-name="volume_up" unicode="" horiz-adv-x="1664" |
| | | d="M768 1184v-1088q0 -26 -19 -45t-45 -19t-45 19l-333 333h-262q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h262l333 333q19 19 45 19t45 -19t19 -45zM1152 640q0 -76 -42.5 -141.5t-112.5 -93.5q-10 -5 -25 -5q-26 0 -45 18.5t-19 45.5q0 21 12 35.5t29 25t34 23t29 36 |
| | | t12 56.5t-12 56.5t-29 36t-34 23t-29 25t-12 35.5q0 27 19 45.5t45 18.5q15 0 25 -5q70 -27 112.5 -93t42.5 -142zM1408 640q0 -153 -85 -282.5t-225 -188.5q-13 -5 -25 -5q-27 0 -46 19t-19 45q0 39 39 59q56 29 76 44q74 54 115.5 135.5t41.5 173.5t-41.5 173.5 |
| | | t-115.5 135.5q-20 15 -76 44q-39 20 -39 59q0 26 19 45t45 19q13 0 26 -5q140 -59 225 -188.5t85 -282.5zM1664 640q0 -230 -127 -422.5t-338 -283.5q-13 -5 -26 -5q-26 0 -45 19t-19 45q0 36 39 59q7 4 22.5 10.5t22.5 10.5q46 25 82 51q123 91 192 227t69 289t-69 289 |
| | | t-192 227q-36 26 -82 51q-7 4 -22.5 10.5t-22.5 10.5q-39 23 -39 59q0 26 19 45t45 19q13 0 26 -5q211 -91 338 -283.5t127 -422.5z" /> |
| | | <glyph glyph-name="qrcode" unicode="" horiz-adv-x="1408" |
| | | d="M384 384v-128h-128v128h128zM384 1152v-128h-128v128h128zM1152 1152v-128h-128v128h128zM128 129h384v383h-384v-383zM128 896h384v384h-384v-384zM896 896h384v384h-384v-384zM640 640v-640h-640v640h640zM1152 128v-128h-128v128h128zM1408 128v-128h-128v128h128z |
| | | M1408 640v-384h-384v128h-128v-384h-128v640h384v-128h128v128h128zM640 1408v-640h-640v640h640zM1408 1408v-640h-640v640h640z" /> |
| | | <glyph glyph-name="barcode" unicode="" horiz-adv-x="1792" |
| | | d="M63 0h-63v1408h63v-1408zM126 1h-32v1407h32v-1407zM220 1h-31v1407h31v-1407zM377 1h-31v1407h31v-1407zM534 1h-62v1407h62v-1407zM660 1h-31v1407h31v-1407zM723 1h-31v1407h31v-1407zM786 1h-31v1407h31v-1407zM943 1h-63v1407h63v-1407zM1100 1h-63v1407h63v-1407z |
| | | M1226 1h-63v1407h63v-1407zM1352 1h-63v1407h63v-1407zM1446 1h-63v1407h63v-1407zM1635 1h-94v1407h94v-1407zM1698 1h-32v1407h32v-1407zM1792 0h-63v1408h63v-1408z" /> |
| | | <glyph glyph-name="tag" unicode="" |
| | | d="M448 1088q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1515 512q0 -53 -37 -90l-491 -492q-39 -37 -91 -37q-53 0 -90 37l-715 716q-38 37 -64.5 101t-26.5 117v416q0 52 38 90t90 38h416q53 0 117 -26.5t102 -64.5 |
| | | l715 -714q37 -39 37 -91z" /> |
| | | <glyph glyph-name="tags" unicode="" horiz-adv-x="1920" |
| | | d="M448 1088q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1515 512q0 -53 -37 -90l-491 -492q-39 -37 -91 -37q-53 0 -90 37l-715 716q-38 37 -64.5 101t-26.5 117v416q0 52 38 90t90 38h416q53 0 117 -26.5t102 -64.5 |
| | | l715 -714q37 -39 37 -91zM1899 512q0 -53 -37 -90l-491 -492q-39 -37 -91 -37q-36 0 -59 14t-53 45l470 470q37 37 37 90q0 52 -37 91l-715 714q-38 38 -102 64.5t-117 26.5h224q53 0 117 -26.5t102 -64.5l715 -714q37 -39 37 -91z" /> |
| | | <glyph glyph-name="book" unicode="" horiz-adv-x="1664" |
| | | d="M1639 1058q40 -57 18 -129l-275 -906q-19 -64 -76.5 -107.5t-122.5 -43.5h-923q-77 0 -148.5 53.5t-99.5 131.5q-24 67 -2 127q0 4 3 27t4 37q1 8 -3 21.5t-3 19.5q2 11 8 21t16.5 23.5t16.5 23.5q23 38 45 91.5t30 91.5q3 10 0.5 30t-0.5 28q3 11 17 28t17 23 |
| | | q21 36 42 92t25 90q1 9 -2.5 32t0.5 28q4 13 22 30.5t22 22.5q19 26 42.5 84.5t27.5 96.5q1 8 -3 25.5t-2 26.5q2 8 9 18t18 23t17 21q8 12 16.5 30.5t15 35t16 36t19.5 32t26.5 23.5t36 11.5t47.5 -5.5l-1 -3q38 9 51 9h761q74 0 114 -56t18 -130l-274 -906 |
| | | q-36 -119 -71.5 -153.5t-128.5 -34.5h-869q-27 0 -38 -15q-11 -16 -1 -43q24 -70 144 -70h923q29 0 56 15.5t35 41.5l300 987q7 22 5 57q38 -15 59 -43zM575 1056q-4 -13 2 -22.5t20 -9.5h608q13 0 25.5 9.5t16.5 22.5l21 64q4 13 -2 22.5t-20 9.5h-608q-13 0 -25.5 -9.5 |
| | | t-16.5 -22.5zM492 800q-4 -13 2 -22.5t20 -9.5h608q13 0 25.5 9.5t16.5 22.5l21 64q4 13 -2 22.5t-20 9.5h-608q-13 0 -25.5 -9.5t-16.5 -22.5z" /> |
| | | <glyph glyph-name="bookmark" unicode="" horiz-adv-x="1280" |
| | | d="M1164 1408q23 0 44 -9q33 -13 52.5 -41t19.5 -62v-1289q0 -34 -19.5 -62t-52.5 -41q-19 -8 -44 -8q-48 0 -83 32l-441 424l-441 -424q-36 -33 -83 -33q-23 0 -44 9q-33 13 -52.5 41t-19.5 62v1289q0 34 19.5 62t52.5 41q21 9 44 9h1048z" /> |
| | | <glyph glyph-name="print" unicode="" horiz-adv-x="1664" |
| | | d="M384 0h896v256h-896v-256zM384 640h896v384h-160q-40 0 -68 28t-28 68v160h-640v-640zM1536 576q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1664 576v-416q0 -13 -9.5 -22.5t-22.5 -9.5h-224v-160q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68 |
| | | v160h-224q-13 0 -22.5 9.5t-9.5 22.5v416q0 79 56.5 135.5t135.5 56.5h64v544q0 40 28 68t68 28h672q40 0 88 -20t76 -48l152 -152q28 -28 48 -76t20 -88v-256h64q79 0 135.5 -56.5t56.5 -135.5z" /> |
| | | <glyph glyph-name="camera" unicode="" horiz-adv-x="1920" |
| | | d="M960 864q119 0 203.5 -84.5t84.5 -203.5t-84.5 -203.5t-203.5 -84.5t-203.5 84.5t-84.5 203.5t84.5 203.5t203.5 84.5zM1664 1280q106 0 181 -75t75 -181v-896q0 -106 -75 -181t-181 -75h-1408q-106 0 -181 75t-75 181v896q0 106 75 181t181 75h224l51 136 |
| | | q19 49 69.5 84.5t103.5 35.5h512q53 0 103.5 -35.5t69.5 -84.5l51 -136h224zM960 128q185 0 316.5 131.5t131.5 316.5t-131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5z" /> |
| | | <glyph glyph-name="font" unicode="" horiz-adv-x="1664" |
| | | d="M725 977l-170 -450q33 0 136.5 -2t160.5 -2q19 0 57 2q-87 253 -184 452zM0 -128l2 79q23 7 56 12.5t57 10.5t49.5 14.5t44.5 29t31 50.5l237 616l280 724h75h53q8 -14 11 -21l205 -480q33 -78 106 -257.5t114 -274.5q15 -34 58 -144.5t72 -168.5q20 -45 35 -57 |
| | | q19 -15 88 -29.5t84 -20.5q6 -38 6 -57q0 -5 -0.5 -13.5t-0.5 -12.5q-63 0 -190 8t-191 8q-76 0 -215 -7t-178 -8q0 43 4 78l131 28q1 0 12.5 2.5t15.5 3.5t14.5 4.5t15 6.5t11 8t9 11t2.5 14q0 16 -31 96.5t-72 177.5t-42 100l-450 2q-26 -58 -76.5 -195.5t-50.5 -162.5 |
| | | q0 -22 14 -37.5t43.5 -24.5t48.5 -13.5t57 -8.5t41 -4q1 -19 1 -58q0 -9 -2 -27q-58 0 -174.5 10t-174.5 10q-8 0 -26.5 -4t-21.5 -4q-80 -14 -188 -14z" /> |
| | | <glyph glyph-name="bold" unicode="" horiz-adv-x="1408" |
| | | d="M555 15q74 -32 140 -32q376 0 376 335q0 114 -41 180q-27 44 -61.5 74t-67.5 46.5t-80.5 25t-84 10.5t-94.5 2q-73 0 -101 -10q0 -53 -0.5 -159t-0.5 -158q0 -8 -1 -67.5t-0.5 -96.5t4.5 -83.5t12 -66.5zM541 761q42 -7 109 -7q82 0 143 13t110 44.5t74.5 89.5t25.5 142 |
| | | q0 70 -29 122.5t-79 82t-108 43.5t-124 14q-50 0 -130 -13q0 -50 4 -151t4 -152q0 -27 -0.5 -80t-0.5 -79q0 -46 1 -69zM0 -128l2 94q15 4 85 16t106 27q7 12 12.5 27t8.5 33.5t5.5 32.5t3 37.5t0.5 34v35.5v30q0 982 -22 1025q-4 8 -22 14.5t-44.5 11t-49.5 7t-48.5 4.5 |
| | | t-30.5 3l-4 83q98 2 340 11.5t373 9.5q23 0 68 -0.5t68 -0.5q70 0 136.5 -13t128.5 -42t108 -71t74 -104.5t28 -137.5q0 -52 -16.5 -95.5t-39 -72t-64.5 -57.5t-73 -45t-84 -40q154 -35 256.5 -134t102.5 -248q0 -100 -35 -179.5t-93.5 -130.5t-138 -85.5t-163.5 -48.5 |
| | | t-176 -14q-44 0 -132 3t-132 3q-106 0 -307 -11t-231 -12z" /> |
| | | <glyph glyph-name="italic" unicode="" horiz-adv-x="1024" |
| | | d="M0 -126l17 85q22 7 61.5 16.5t72 19t59.5 23.5q28 35 41 101q1 7 62 289t114 543.5t52 296.5v25q-24 13 -54.5 18.5t-69.5 8t-58 5.5l19 103q33 -2 120 -6.5t149.5 -7t120.5 -2.5q48 0 98.5 2.5t121 7t98.5 6.5q-5 -39 -19 -89q-30 -10 -101.5 -28.5t-108.5 -33.5 |
| | | q-8 -19 -14 -42.5t-9 -40t-7.5 -45.5t-6.5 -42q-27 -148 -87.5 -419.5t-77.5 -355.5q-2 -9 -13 -58t-20 -90t-16 -83.5t-6 -57.5l1 -18q17 -4 185 -31q-3 -44 -16 -99q-11 0 -32.5 -1.5t-32.5 -1.5q-29 0 -87 10t-86 10q-138 2 -206 2q-51 0 -143 -9t-121 -11z" /> |
| | | <glyph glyph-name="text_height" unicode="" horiz-adv-x="1792" |
| | | d="M1744 128q33 0 42 -18.5t-11 -44.5l-126 -162q-20 -26 -49 -26t-49 26l-126 162q-20 26 -11 44.5t42 18.5h80v1024h-80q-33 0 -42 18.5t11 44.5l126 162q20 26 49 26t49 -26l126 -162q20 -26 11 -44.5t-42 -18.5h-80v-1024h80zM81 1407l54 -27q12 -5 211 -5q44 0 132 2 |
| | | t132 2q36 0 107.5 -0.5t107.5 -0.5h293q6 0 21 -0.5t20.5 0t16 3t17.5 9t15 17.5l42 1q4 0 14 -0.5t14 -0.5q2 -112 2 -336q0 -80 -5 -109q-39 -14 -68 -18q-25 44 -54 128q-3 9 -11 48t-14.5 73.5t-7.5 35.5q-6 8 -12 12.5t-15.5 6t-13 2.5t-18 0.5t-16.5 -0.5 |
| | | q-17 0 -66.5 0.5t-74.5 0.5t-64 -2t-71 -6q-9 -81 -8 -136q0 -94 2 -388t2 -455q0 -16 -2.5 -71.5t0 -91.5t12.5 -69q40 -21 124 -42.5t120 -37.5q5 -40 5 -50q0 -14 -3 -29l-34 -1q-76 -2 -218 8t-207 10q-50 0 -151 -9t-152 -9q-3 51 -3 52v9q17 27 61.5 43t98.5 29t78 27 |
| | | q19 42 19 383q0 101 -3 303t-3 303v117q0 2 0.5 15.5t0.5 25t-1 25.5t-3 24t-5 14q-11 12 -162 12q-33 0 -93 -12t-80 -26q-19 -13 -34 -72.5t-31.5 -111t-42.5 -53.5q-42 26 -56 44v383z" /> |
| | | <glyph glyph-name="text_width" unicode="" |
| | | d="M81 1407l54 -27q12 -5 211 -5q44 0 132 2t132 2q70 0 246.5 1t304.5 0.5t247 -4.5q33 -1 56 31l42 1q4 0 14 -0.5t14 -0.5q2 -112 2 -336q0 -80 -5 -109q-39 -14 -68 -18q-25 44 -54 128q-3 9 -11 47.5t-15 73.5t-7 36q-10 13 -27 19q-5 2 -66 2q-30 0 -93 1t-103 1 |
| | | t-94 -2t-96 -7q-9 -81 -8 -136l1 -152v52q0 -55 1 -154t1.5 -180t0.5 -153q0 -16 -2.5 -71.5t0 -91.5t12.5 -69q40 -21 124 -42.5t120 -37.5q5 -40 5 -50q0 -14 -3 -29l-34 -1q-76 -2 -218 8t-207 10q-50 0 -151 -9t-152 -9q-3 51 -3 52v9q17 27 61.5 43t98.5 29t78 27 |
| | | q7 16 11.5 74t6 145.5t1.5 155t-0.5 153.5t-0.5 89q0 7 -2.5 21.5t-2.5 22.5q0 7 0.5 44t1 73t0 76.5t-3 67.5t-6.5 32q-11 12 -162 12q-41 0 -163 -13.5t-138 -24.5q-19 -12 -34 -71.5t-31.5 -111.5t-42.5 -54q-42 26 -56 44v383zM1310 125q12 0 42 -19.5t57.5 -41.5 |
| | | t59.5 -49t36 -30q26 -21 26 -49t-26 -49q-4 -3 -36 -30t-59.5 -49t-57.5 -41.5t-42 -19.5q-13 0 -20.5 10.5t-10 28.5t-2.5 33.5t1.5 33t1.5 19.5h-1024q0 -2 1.5 -19.5t1.5 -33t-2.5 -33.5t-10 -28.5t-20.5 -10.5q-12 0 -42 19.5t-57.5 41.5t-59.5 49t-36 30q-26 21 -26 49 |
| | | t26 49q4 3 36 30t59.5 49t57.5 41.5t42 19.5q13 0 20.5 -10.5t10 -28.5t2.5 -33.5t-1.5 -33t-1.5 -19.5h1024q0 2 -1.5 19.5t-1.5 33t2.5 33.5t10 28.5t20.5 10.5z" /> |
| | | <glyph glyph-name="align_left" unicode="" horiz-adv-x="1792" |
| | | d="M1792 192v-128q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1408 576v-128q0 -26 -19 -45t-45 -19h-1280q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1280q26 0 45 -19t19 -45zM1664 960v-128q0 -26 -19 -45 |
| | | t-45 -19h-1536q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1536q26 0 45 -19t19 -45zM1280 1344v-128q0 -26 -19 -45t-45 -19h-1152q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1152q26 0 45 -19t19 -45z" /> |
| | | <glyph glyph-name="align_center" unicode="" horiz-adv-x="1792" |
| | | d="M1792 192v-128q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1408 576v-128q0 -26 -19 -45t-45 -19h-896q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h896q26 0 45 -19t19 -45zM1664 960v-128q0 -26 -19 -45t-45 -19 |
| | | h-1408q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1408q26 0 45 -19t19 -45zM1280 1344v-128q0 -26 -19 -45t-45 -19h-640q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h640q26 0 45 -19t19 -45z" /> |
| | | <glyph glyph-name="align_right" unicode="" horiz-adv-x="1792" |
| | | d="M1792 192v-128q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1792 576v-128q0 -26 -19 -45t-45 -19h-1280q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1280q26 0 45 -19t19 -45zM1792 960v-128q0 -26 -19 -45 |
| | | t-45 -19h-1536q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1536q26 0 45 -19t19 -45zM1792 1344v-128q0 -26 -19 -45t-45 -19h-1152q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1152q26 0 45 -19t19 -45z" /> |
| | | <glyph glyph-name="align_justify" unicode="" horiz-adv-x="1792" |
| | | d="M1792 192v-128q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1792 576v-128q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1792 960v-128q0 -26 -19 -45 |
| | | t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1792 1344v-128q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1664q26 0 45 -19t19 -45z" /> |
| | | <glyph glyph-name="list" unicode="" horiz-adv-x="1792" |
| | | d="M256 224v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-192q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h192q13 0 22.5 -9.5t9.5 -22.5zM256 608v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-192q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h192q13 0 22.5 -9.5 |
| | | t9.5 -22.5zM256 992v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-192q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h192q13 0 22.5 -9.5t9.5 -22.5zM1792 224v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1344q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1344 |
| | | q13 0 22.5 -9.5t9.5 -22.5zM256 1376v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-192q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h192q13 0 22.5 -9.5t9.5 -22.5zM1792 608v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1344q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5 |
| | | t22.5 9.5h1344q13 0 22.5 -9.5t9.5 -22.5zM1792 992v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1344q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1344q13 0 22.5 -9.5t9.5 -22.5zM1792 1376v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1344q-13 0 -22.5 9.5t-9.5 22.5v192 |
| | | q0 13 9.5 22.5t22.5 9.5h1344q13 0 22.5 -9.5t9.5 -22.5z" /> |
| | | <glyph glyph-name="indent_left" unicode="" horiz-adv-x="1792" |
| | | d="M384 992v-576q0 -13 -9.5 -22.5t-22.5 -9.5q-14 0 -23 9l-288 288q-9 9 -9 23t9 23l288 288q9 9 23 9q13 0 22.5 -9.5t9.5 -22.5zM1792 224v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1728q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1728q13 0 22.5 -9.5 |
| | | t9.5 -22.5zM1792 608v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1088q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1088q13 0 22.5 -9.5t9.5 -22.5zM1792 992v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1088q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1088 |
| | | q13 0 22.5 -9.5t9.5 -22.5zM1792 1376v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1728q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1728q13 0 22.5 -9.5t9.5 -22.5z" /> |
| | | <glyph glyph-name="indent_right" unicode="" horiz-adv-x="1792" |
| | | d="M352 704q0 -14 -9 -23l-288 -288q-9 -9 -23 -9q-13 0 -22.5 9.5t-9.5 22.5v576q0 13 9.5 22.5t22.5 9.5q14 0 23 -9l288 -288q9 -9 9 -23zM1792 224v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1728q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1728q13 0 22.5 -9.5 |
| | | t9.5 -22.5zM1792 608v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1088q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1088q13 0 22.5 -9.5t9.5 -22.5zM1792 992v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1088q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1088 |
| | | q13 0 22.5 -9.5t9.5 -22.5zM1792 1376v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1728q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1728q13 0 22.5 -9.5t9.5 -22.5z" /> |
| | | <glyph glyph-name="facetime_video" unicode="" horiz-adv-x="1792" |
| | | d="M1792 1184v-1088q0 -42 -39 -59q-13 -5 -25 -5q-27 0 -45 19l-403 403v-166q0 -119 -84.5 -203.5t-203.5 -84.5h-704q-119 0 -203.5 84.5t-84.5 203.5v704q0 119 84.5 203.5t203.5 84.5h704q119 0 203.5 -84.5t84.5 -203.5v-165l403 402q18 19 45 19q12 0 25 -5 |
| | | q39 -17 39 -59z" /> |
| | | <glyph glyph-name="picture" unicode="" horiz-adv-x="1920" |
| | | d="M640 960q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM1664 576v-448h-1408v192l320 320l160 -160l512 512zM1760 1280h-1600q-13 0 -22.5 -9.5t-9.5 -22.5v-1216q0 -13 9.5 -22.5t22.5 -9.5h1600q13 0 22.5 9.5t9.5 22.5v1216 |
| | | q0 13 -9.5 22.5t-22.5 9.5zM1920 1248v-1216q0 -66 -47 -113t-113 -47h-1600q-66 0 -113 47t-47 113v1216q0 66 47 113t113 47h1600q66 0 113 -47t47 -113z" /> |
| | | <glyph glyph-name="pencil" unicode="" |
| | | d="M363 0l91 91l-235 235l-91 -91v-107h128v-128h107zM886 928q0 22 -22 22q-10 0 -17 -7l-542 -542q-7 -7 -7 -17q0 -22 22 -22q10 0 17 7l542 542q7 7 7 17zM832 1120l416 -416l-832 -832h-416v416zM1515 1024q0 -53 -37 -90l-166 -166l-416 416l166 165q36 38 90 38 |
| | | q53 0 91 -38l235 -234q37 -39 37 -91z" /> |
| | | <glyph glyph-name="map_marker" unicode="" horiz-adv-x="1024" |
| | | d="M768 896q0 106 -75 181t-181 75t-181 -75t-75 -181t75 -181t181 -75t181 75t75 181zM1024 896q0 -109 -33 -179l-364 -774q-16 -33 -47.5 -52t-67.5 -19t-67.5 19t-46.5 52l-365 774q-33 70 -33 179q0 212 150 362t362 150t362 -150t150 -362z" /> |
| | | <glyph glyph-name="adjust" unicode="" |
| | | d="M768 96v1088q-148 0 -273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> |
| | | <glyph glyph-name="tint" unicode="" horiz-adv-x="1024" |
| | | d="M512 384q0 36 -20 69q-1 1 -15.5 22.5t-25.5 38t-25 44t-21 50.5q-4 16 -21 16t-21 -16q-7 -23 -21 -50.5t-25 -44t-25.5 -38t-15.5 -22.5q-20 -33 -20 -69q0 -53 37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1024 512q0 -212 -150 -362t-362 -150t-362 150t-150 362 |
| | | q0 145 81 275q6 9 62.5 90.5t101 151t99.5 178t83 201.5q9 30 34 47t51 17t51.5 -17t33.5 -47q28 -93 83 -201.5t99.5 -178t101 -151t62.5 -90.5q81 -127 81 -275z" /> |
| | | <glyph glyph-name="edit" unicode="" horiz-adv-x="1792" |
| | | d="M888 352l116 116l-152 152l-116 -116v-56h96v-96h56zM1328 1072q-16 16 -33 -1l-350 -350q-17 -17 -1 -33t33 1l350 350q17 17 1 33zM1408 478v-190q0 -119 -84.5 -203.5t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h832 |
| | | q63 0 117 -25q15 -7 18 -23q3 -17 -9 -29l-49 -49q-14 -14 -32 -8q-23 6 -45 6h-832q-66 0 -113 -47t-47 -113v-832q0 -66 47 -113t113 -47h832q66 0 113 47t47 113v126q0 13 9 22l64 64q15 15 35 7t20 -29zM1312 1216l288 -288l-672 -672h-288v288zM1756 1084l-92 -92 |
| | | l-288 288l92 92q28 28 68 28t68 -28l152 -152q28 -28 28 -68t-28 -68z" /> |
| | | <glyph glyph-name="share" unicode="" horiz-adv-x="1664" |
| | | d="M1408 547v-259q0 -119 -84.5 -203.5t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h255v0q13 0 22.5 -9.5t9.5 -22.5q0 -27 -26 -32q-77 -26 -133 -60q-10 -4 -16 -4h-112q-66 0 -113 -47t-47 -113v-832q0 -66 47 -113t113 -47h832 |
| | | q66 0 113 47t47 113v214q0 19 18 29q28 13 54 37q16 16 35 8q21 -9 21 -29zM1645 1043l-384 -384q-18 -19 -45 -19q-12 0 -25 5q-39 17 -39 59v192h-160q-323 0 -438 -131q-119 -137 -74 -473q3 -23 -20 -34q-8 -2 -12 -2q-16 0 -26 13q-10 14 -21 31t-39.5 68.5t-49.5 99.5 |
| | | t-38.5 114t-17.5 122q0 49 3.5 91t14 90t28 88t47 81.5t68.5 74t94.5 61.5t124.5 48.5t159.5 30.5t196.5 11h160v192q0 42 39 59q13 5 25 5q26 0 45 -19l384 -384q19 -19 19 -45t-19 -45z" /> |
| | | <glyph glyph-name="check" unicode="" horiz-adv-x="1664" |
| | | d="M1408 606v-318q0 -119 -84.5 -203.5t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h832q63 0 117 -25q15 -7 18 -23q3 -17 -9 -29l-49 -49q-10 -10 -23 -10q-3 0 -9 2q-23 6 -45 6h-832q-66 0 -113 -47t-47 -113v-832 |
| | | q0 -66 47 -113t113 -47h832q66 0 113 47t47 113v254q0 13 9 22l64 64q10 10 23 10q6 0 12 -3q20 -8 20 -29zM1639 1095l-814 -814q-24 -24 -57 -24t-57 24l-430 430q-24 24 -24 57t24 57l110 110q24 24 57 24t57 -24l263 -263l647 647q24 24 57 24t57 -24l110 -110 |
| | | q24 -24 24 -57t-24 -57z" /> |
| | | <glyph glyph-name="move" unicode="" horiz-adv-x="1792" |
| | | d="M1792 640q0 -26 -19 -45l-256 -256q-19 -19 -45 -19t-45 19t-19 45v128h-384v-384h128q26 0 45 -19t19 -45t-19 -45l-256 -256q-19 -19 -45 -19t-45 19l-256 256q-19 19 -19 45t19 45t45 19h128v384h-384v-128q0 -26 -19 -45t-45 -19t-45 19l-256 256q-19 19 -19 45 |
| | | t19 45l256 256q19 19 45 19t45 -19t19 -45v-128h384v384h-128q-26 0 -45 19t-19 45t19 45l256 256q19 19 45 19t45 -19l256 -256q19 -19 19 -45t-19 -45t-45 -19h-128v-384h384v128q0 26 19 45t45 19t45 -19l256 -256q19 -19 19 -45z" /> |
| | | <glyph glyph-name="step_backward" unicode="" horiz-adv-x="1024" |
| | | d="M979 1395q19 19 32 13t13 -32v-1472q0 -26 -13 -32t-32 13l-710 710q-9 9 -13 19v-678q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v1408q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-678q4 10 13 19z" /> |
| | | <glyph glyph-name="fast_backward" unicode="" horiz-adv-x="1792" |
| | | d="M1747 1395q19 19 32 13t13 -32v-1472q0 -26 -13 -32t-32 13l-710 710q-9 9 -13 19v-710q0 -26 -13 -32t-32 13l-710 710q-9 9 -13 19v-678q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v1408q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-678q4 10 13 19l710 710 |
| | | q19 19 32 13t13 -32v-710q4 10 13 19z" /> |
| | | <glyph glyph-name="backward" unicode="" horiz-adv-x="1664" |
| | | d="M1619 1395q19 19 32 13t13 -32v-1472q0 -26 -13 -32t-32 13l-710 710q-9 9 -13 19v-710q0 -26 -13 -32t-32 13l-710 710q-19 19 -19 45t19 45l710 710q19 19 32 13t13 -32v-710q4 10 13 19z" /> |
| | | <glyph glyph-name="play" unicode="" horiz-adv-x="1408" |
| | | d="M1384 609l-1328 -738q-23 -13 -39.5 -3t-16.5 36v1472q0 26 16.5 36t39.5 -3l1328 -738q23 -13 23 -31t-23 -31z" /> |
| | | <glyph glyph-name="pause" unicode="" |
| | | d="M1536 1344v-1408q0 -26 -19 -45t-45 -19h-512q-26 0 -45 19t-19 45v1408q0 26 19 45t45 19h512q26 0 45 -19t19 -45zM640 1344v-1408q0 -26 -19 -45t-45 -19h-512q-26 0 -45 19t-19 45v1408q0 26 19 45t45 19h512q26 0 45 -19t19 -45z" /> |
| | | <glyph glyph-name="stop" unicode="" |
| | | d="M1536 1344v-1408q0 -26 -19 -45t-45 -19h-1408q-26 0 -45 19t-19 45v1408q0 26 19 45t45 19h1408q26 0 45 -19t19 -45z" /> |
| | | <glyph glyph-name="forward" unicode="" horiz-adv-x="1664" |
| | | d="M45 -115q-19 -19 -32 -13t-13 32v1472q0 26 13 32t32 -13l710 -710q9 -9 13 -19v710q0 26 13 32t32 -13l710 -710q19 -19 19 -45t-19 -45l-710 -710q-19 -19 -32 -13t-13 32v710q-4 -10 -13 -19z" /> |
| | | <glyph glyph-name="fast_forward" unicode="" horiz-adv-x="1792" |
| | | d="M45 -115q-19 -19 -32 -13t-13 32v1472q0 26 13 32t32 -13l710 -710q9 -9 13 -19v710q0 26 13 32t32 -13l710 -710q9 -9 13 -19v678q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-1408q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v678q-4 -10 -13 -19l-710 -710 |
| | | q-19 -19 -32 -13t-13 32v710q-4 -10 -13 -19z" /> |
| | | <glyph glyph-name="step_forward" unicode="" horiz-adv-x="1024" |
| | | d="M45 -115q-19 -19 -32 -13t-13 32v1472q0 26 13 32t32 -13l710 -710q9 -9 13 -19v678q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-1408q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v678q-4 -10 -13 -19z" /> |
| | | <glyph glyph-name="eject" unicode="" horiz-adv-x="1538" |
| | | d="M14 557l710 710q19 19 45 19t45 -19l710 -710q19 -19 13 -32t-32 -13h-1472q-26 0 -32 13t13 32zM1473 0h-1408q-26 0 -45 19t-19 45v256q0 26 19 45t45 19h1408q26 0 45 -19t19 -45v-256q0 -26 -19 -45t-45 -19z" /> |
| | | <glyph glyph-name="chevron_left" unicode="" horiz-adv-x="1280" |
| | | d="M1171 1235l-531 -531l531 -531q19 -19 19 -45t-19 -45l-166 -166q-19 -19 -45 -19t-45 19l-742 742q-19 19 -19 45t19 45l742 742q19 19 45 19t45 -19l166 -166q19 -19 19 -45t-19 -45z" /> |
| | | <glyph glyph-name="chevron_right" unicode="" horiz-adv-x="1280" |
| | | d="M1107 659l-742 -742q-19 -19 -45 -19t-45 19l-166 166q-19 19 -19 45t19 45l531 531l-531 531q-19 19 -19 45t19 45l166 166q19 19 45 19t45 -19l742 -742q19 -19 19 -45t-19 -45z" /> |
| | | <glyph glyph-name="plus_sign" unicode="" |
| | | d="M1216 576v128q0 26 -19 45t-45 19h-256v256q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-256h-256q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h256v-256q0 -26 19 -45t45 -19h128q26 0 45 19t19 45v256h256q26 0 45 19t19 45zM1536 640q0 -209 -103 -385.5 |
| | | t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> |
| | | <glyph glyph-name="minus_sign" unicode="" |
| | | d="M1216 576v128q0 26 -19 45t-45 19h-768q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h768q26 0 45 19t19 45zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5 |
| | | t103 -385.5z" /> |
| | | <glyph glyph-name="remove_sign" unicode="" |
| | | d="M1149 414q0 26 -19 45l-181 181l181 181q19 19 19 45q0 27 -19 46l-90 90q-19 19 -46 19q-26 0 -45 -19l-181 -181l-181 181q-19 19 -45 19q-27 0 -46 -19l-90 -90q-19 -19 -19 -46q0 -26 19 -45l181 -181l-181 -181q-19 -19 -19 -45q0 -27 19 -46l90 -90q19 -19 46 -19 |
| | | q26 0 45 19l181 181l181 -181q19 -19 45 -19q27 0 46 19l90 90q19 19 19 46zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> |
| | | <glyph glyph-name="ok_sign" unicode="" |
| | | d="M1284 802q0 28 -18 46l-91 90q-19 19 -45 19t-45 -19l-408 -407l-226 226q-19 19 -45 19t-45 -19l-91 -90q-18 -18 -18 -46q0 -27 18 -45l362 -362q19 -19 45 -19q27 0 46 19l543 543q18 18 18 45zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103 |
| | | t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> |
| | | <glyph glyph-name="question_sign" unicode="" |
| | | d="M896 160v192q0 14 -9 23t-23 9h-192q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h192q14 0 23 9t9 23zM1152 832q0 88 -55.5 163t-138.5 116t-170 41q-243 0 -371 -213q-15 -24 8 -42l132 -100q7 -6 19 -6q16 0 25 12q53 68 86 92q34 24 86 24q48 0 85.5 -26t37.5 -59 |
| | | q0 -38 -20 -61t-68 -45q-63 -28 -115.5 -86.5t-52.5 -125.5v-36q0 -14 9 -23t23 -9h192q14 0 23 9t9 23q0 19 21.5 49.5t54.5 49.5q32 18 49 28.5t46 35t44.5 48t28 60.5t12.5 81zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5 |
| | | t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> |
| | | <glyph glyph-name="info_sign" unicode="" |
| | | d="M1024 160v160q0 14 -9 23t-23 9h-96v512q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-160q0 -14 9 -23t23 -9h96v-320h-96q-14 0 -23 -9t-9 -23v-160q0 -14 9 -23t23 -9h448q14 0 23 9t9 23zM896 1056v160q0 14 -9 23t-23 9h-192q-14 0 -23 -9t-9 -23v-160q0 -14 9 -23 |
| | | t23 -9h192q14 0 23 9t9 23zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> |
| | | <glyph glyph-name="screenshot" unicode="" |
| | | d="M1197 512h-109q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h109q-32 108 -112.5 188.5t-188.5 112.5v-109q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v109q-108 -32 -188.5 -112.5t-112.5 -188.5h109q26 0 45 -19t19 -45v-128q0 -26 -19 -45t-45 -19h-109 |
| | | q32 -108 112.5 -188.5t188.5 -112.5v109q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-109q108 32 188.5 112.5t112.5 188.5zM1536 704v-128q0 -26 -19 -45t-45 -19h-143q-37 -161 -154.5 -278.5t-278.5 -154.5v-143q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v143 |
| | | q-161 37 -278.5 154.5t-154.5 278.5h-143q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h143q37 161 154.5 278.5t278.5 154.5v143q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-143q161 -37 278.5 -154.5t154.5 -278.5h143q26 0 45 -19t19 -45z" /> |
| | | <glyph glyph-name="remove_circle" unicode="" |
| | | d="M1097 457l-146 -146q-10 -10 -23 -10t-23 10l-137 137l-137 -137q-10 -10 -23 -10t-23 10l-146 146q-10 10 -10 23t10 23l137 137l-137 137q-10 10 -10 23t10 23l146 146q10 10 23 10t23 -10l137 -137l137 137q10 10 23 10t23 -10l146 -146q10 -10 10 -23t-10 -23 |
| | | l-137 -137l137 -137q10 -10 10 -23t-10 -23zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5 |
| | | t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> |
| | | <glyph glyph-name="ok_circle" unicode="" |
| | | d="M1171 723l-422 -422q-19 -19 -45 -19t-45 19l-294 294q-19 19 -19 45t19 45l102 102q19 19 45 19t45 -19l147 -147l275 275q19 19 45 19t45 -19l102 -102q19 -19 19 -45t-19 -45zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198t-73 -273t73 -273t198 -198 |
| | | t273 -73t273 73t198 198t73 273zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> |
| | | <glyph glyph-name="ban_circle" unicode="" |
| | | d="M1312 643q0 161 -87 295l-754 -753q137 -89 297 -89q111 0 211.5 43.5t173.5 116.5t116 174.5t43 212.5zM313 344l755 754q-135 91 -300 91q-148 0 -273 -73t-198 -199t-73 -274q0 -162 89 -299zM1536 643q0 -157 -61 -300t-163.5 -246t-245 -164t-298.5 -61t-298.5 61 |
| | | t-245 164t-163.5 246t-61 300t61 299.5t163.5 245.5t245 164t298.5 61t298.5 -61t245 -164t163.5 -245.5t61 -299.5z" /> |
| | | <glyph glyph-name="arrow_left" unicode="" |
| | | d="M1536 640v-128q0 -53 -32.5 -90.5t-84.5 -37.5h-704l293 -294q38 -36 38 -90t-38 -90l-75 -76q-37 -37 -90 -37q-52 0 -91 37l-651 652q-37 37 -37 90q0 52 37 91l651 650q38 38 91 38q52 0 90 -38l75 -74q38 -38 38 -91t-38 -91l-293 -293h704q52 0 84.5 -37.5 |
| | | t32.5 -90.5z" /> |
| | | <glyph glyph-name="arrow_right" unicode="" |
| | | d="M1472 576q0 -54 -37 -91l-651 -651q-39 -37 -91 -37q-51 0 -90 37l-75 75q-38 38 -38 91t38 91l293 293h-704q-52 0 -84.5 37.5t-32.5 90.5v128q0 53 32.5 90.5t84.5 37.5h704l-293 294q-38 36 -38 90t38 90l75 75q38 38 90 38q53 0 91 -38l651 -651q37 -35 37 -90z" /> |
| | | <glyph glyph-name="arrow_up" unicode="" horiz-adv-x="1664" |
| | | d="M1611 565q0 -51 -37 -90l-75 -75q-38 -38 -91 -38q-54 0 -90 38l-294 293v-704q0 -52 -37.5 -84.5t-90.5 -32.5h-128q-53 0 -90.5 32.5t-37.5 84.5v704l-294 -293q-36 -38 -90 -38t-90 38l-75 75q-38 38 -38 90q0 53 38 91l651 651q35 37 90 37q54 0 91 -37l651 -651 |
| | | q37 -39 37 -91z" /> |
| | | <glyph glyph-name="arrow_down" unicode="" horiz-adv-x="1664" |
| | | d="M1611 704q0 -53 -37 -90l-651 -652q-39 -37 -91 -37q-53 0 -90 37l-651 652q-38 36 -38 90q0 53 38 91l74 75q39 37 91 37q53 0 90 -37l294 -294v704q0 52 38 90t90 38h128q52 0 90 -38t38 -90v-704l294 294q37 37 90 37q52 0 91 -37l75 -75q37 -39 37 -91z" /> |
| | | <glyph glyph-name="share_alt" unicode="" horiz-adv-x="1792" |
| | | d="M1792 896q0 -26 -19 -45l-512 -512q-19 -19 -45 -19t-45 19t-19 45v256h-224q-98 0 -175.5 -6t-154 -21.5t-133 -42.5t-105.5 -69.5t-80 -101t-48.5 -138.5t-17.5 -181q0 -55 5 -123q0 -6 2.5 -23.5t2.5 -26.5q0 -15 -8.5 -25t-23.5 -10q-16 0 -28 17q-7 9 -13 22 |
| | | t-13.5 30t-10.5 24q-127 285 -127 451q0 199 53 333q162 403 875 403h224v256q0 26 19 45t45 19t45 -19l512 -512q19 -19 19 -45z" /> |
| | | <glyph glyph-name="resize_full" unicode="" |
| | | d="M755 480q0 -13 -10 -23l-332 -332l144 -144q19 -19 19 -45t-19 -45t-45 -19h-448q-26 0 -45 19t-19 45v448q0 26 19 45t45 19t45 -19l144 -144l332 332q10 10 23 10t23 -10l114 -114q10 -10 10 -23zM1536 1344v-448q0 -26 -19 -45t-45 -19t-45 19l-144 144l-332 -332 |
| | | q-10 -10 -23 -10t-23 10l-114 114q-10 10 -10 23t10 23l332 332l-144 144q-19 19 -19 45t19 45t45 19h448q26 0 45 -19t19 -45z" /> |
| | | <glyph glyph-name="resize_small" unicode="" |
| | | d="M768 576v-448q0 -26 -19 -45t-45 -19t-45 19l-144 144l-332 -332q-10 -10 -23 -10t-23 10l-114 114q-10 10 -10 23t10 23l332 332l-144 144q-19 19 -19 45t19 45t45 19h448q26 0 45 -19t19 -45zM1523 1248q0 -13 -10 -23l-332 -332l144 -144q19 -19 19 -45t-19 -45 |
| | | t-45 -19h-448q-26 0 -45 19t-19 45v448q0 26 19 45t45 19t45 -19l144 -144l332 332q10 10 23 10t23 -10l114 -114q10 -10 10 -23z" /> |
| | | <glyph glyph-name="plus" unicode="" horiz-adv-x="1408" |
| | | d="M1408 800v-192q0 -40 -28 -68t-68 -28h-416v-416q0 -40 -28 -68t-68 -28h-192q-40 0 -68 28t-28 68v416h-416q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h416v416q0 40 28 68t68 28h192q40 0 68 -28t28 -68v-416h416q40 0 68 -28t28 -68z" /> |
| | | <glyph glyph-name="minus" unicode="" horiz-adv-x="1408" |
| | | d="M1408 800v-192q0 -40 -28 -68t-68 -28h-1216q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h1216q40 0 68 -28t28 -68z" /> |
| | | <glyph glyph-name="asterisk" unicode="" horiz-adv-x="1664" |
| | | d="M1482 486q46 -26 59.5 -77.5t-12.5 -97.5l-64 -110q-26 -46 -77.5 -59.5t-97.5 12.5l-266 153v-307q0 -52 -38 -90t-90 -38h-128q-52 0 -90 38t-38 90v307l-266 -153q-46 -26 -97.5 -12.5t-77.5 59.5l-64 110q-26 46 -12.5 97.5t59.5 77.5l266 154l-266 154 |
| | | q-46 26 -59.5 77.5t12.5 97.5l64 110q26 46 77.5 59.5t97.5 -12.5l266 -153v307q0 52 38 90t90 38h128q52 0 90 -38t38 -90v-307l266 153q46 26 97.5 12.5t77.5 -59.5l64 -110q26 -46 12.5 -97.5t-59.5 -77.5l-266 -154z" /> |
| | | <glyph glyph-name="exclamation_sign" unicode="" |
| | | d="M768 1408q209 0 385.5 -103t279.5 -279.5t103 -385.5t-103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103zM896 161v190q0 14 -9 23.5t-22 9.5h-192q-13 0 -23 -10t-10 -23v-190q0 -13 10 -23t23 -10h192 |
| | | q13 0 22 9.5t9 23.5zM894 505l18 621q0 12 -10 18q-10 8 -24 8h-220q-14 0 -24 -8q-10 -6 -10 -18l17 -621q0 -10 10 -17.5t24 -7.5h185q14 0 23.5 7.5t10.5 17.5z" /> |
| | | <glyph glyph-name="gift" unicode="" |
| | | d="M928 180v56v468v192h-320v-192v-468v-56q0 -25 18 -38.5t46 -13.5h192q28 0 46 13.5t18 38.5zM472 1024h195l-126 161q-26 31 -69 31q-40 0 -68 -28t-28 -68t28 -68t68 -28zM1160 1120q0 40 -28 68t-68 28q-43 0 -69 -31l-125 -161h194q40 0 68 28t28 68zM1536 864v-320 |
| | | q0 -14 -9 -23t-23 -9h-96v-416q0 -40 -28 -68t-68 -28h-1088q-40 0 -68 28t-28 68v416h-96q-14 0 -23 9t-9 23v320q0 14 9 23t23 9h440q-93 0 -158.5 65.5t-65.5 158.5t65.5 158.5t158.5 65.5q107 0 168 -77l128 -165l128 165q61 77 168 77q93 0 158.5 -65.5t65.5 -158.5 |
| | | t-65.5 -158.5t-158.5 -65.5h440q14 0 23 -9t9 -23z" /> |
| | | <glyph glyph-name="leaf" unicode="" horiz-adv-x="1792" |
| | | d="M1280 832q0 26 -19 45t-45 19q-172 0 -318 -49.5t-259.5 -134t-235.5 -219.5q-19 -21 -19 -45q0 -26 19 -45t45 -19q24 0 45 19q27 24 74 71t67 66q137 124 268.5 176t313.5 52q26 0 45 19t19 45zM1792 1030q0 -95 -20 -193q-46 -224 -184.5 -383t-357.5 -268 |
| | | q-214 -108 -438 -108q-148 0 -286 47q-15 5 -88 42t-96 37q-16 0 -39.5 -32t-45 -70t-52.5 -70t-60 -32q-43 0 -63.5 17.5t-45.5 59.5q-2 4 -6 11t-5.5 10t-3 9.5t-1.5 13.5q0 35 31 73.5t68 65.5t68 56t31 48q0 4 -14 38t-16 44q-9 51 -9 104q0 115 43.5 220t119 184.5 |
| | | t170.5 139t204 95.5q55 18 145 25.5t179.5 9t178.5 6t163.5 24t113.5 56.5l29.5 29.5t29.5 28t27 20t36.5 16t43.5 4.5q39 0 70.5 -46t47.5 -112t24 -124t8 -96z" /> |
| | | <glyph glyph-name="fire" unicode="" horiz-adv-x="1408" |
| | | d="M1408 -160v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-1344q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h1344q13 0 22.5 -9.5t9.5 -22.5zM1152 896q0 -78 -24.5 -144t-64 -112.5t-87.5 -88t-96 -77.5t-87.5 -72t-64 -81.5t-24.5 -96.5q0 -96 67 -224l-4 1l1 -1 |
| | | q-90 41 -160 83t-138.5 100t-113.5 122.5t-72.5 150.5t-27.5 184q0 78 24.5 144t64 112.5t87.5 88t96 77.5t87.5 72t64 81.5t24.5 96.5q0 94 -66 224l3 -1l-1 1q90 -41 160 -83t138.5 -100t113.5 -122.5t72.5 -150.5t27.5 -184z" /> |
| | | <glyph glyph-name="eye_open" unicode="" horiz-adv-x="1792" |
| | | d="M1664 576q-152 236 -381 353q61 -104 61 -225q0 -185 -131.5 -316.5t-316.5 -131.5t-316.5 131.5t-131.5 316.5q0 121 61 225q-229 -117 -381 -353q133 -205 333.5 -326.5t434.5 -121.5t434.5 121.5t333.5 326.5zM944 960q0 20 -14 34t-34 14q-125 0 -214.5 -89.5 |
| | | t-89.5 -214.5q0 -20 14 -34t34 -14t34 14t14 34q0 86 61 147t147 61q20 0 34 14t14 34zM1792 576q0 -34 -20 -69q-140 -230 -376.5 -368.5t-499.5 -138.5t-499.5 139t-376.5 368q-20 35 -20 69t20 69q140 229 376.5 368t499.5 139t499.5 -139t376.5 -368q20 -35 20 -69z" /> |
| | | <glyph glyph-name="eye_close" unicode="" horiz-adv-x="1792" |
| | | d="M555 201l78 141q-87 63 -136 159t-49 203q0 121 61 225q-229 -117 -381 -353q167 -258 427 -375zM944 960q0 20 -14 34t-34 14q-125 0 -214.5 -89.5t-89.5 -214.5q0 -20 14 -34t34 -14t34 14t14 34q0 86 61 147t147 61q20 0 34 14t14 34zM1307 1151q0 -7 -1 -9 |
| | | q-106 -189 -316 -567t-315 -566l-49 -89q-10 -16 -28 -16q-12 0 -134 70q-16 10 -16 28q0 12 44 87q-143 65 -263.5 173t-208.5 245q-20 31 -20 69t20 69q153 235 380 371t496 136q89 0 180 -17l54 97q10 16 28 16q5 0 18 -6t31 -15.5t33 -18.5t31.5 -18.5t19.5 -11.5 |
| | | q16 -10 16 -27zM1344 704q0 -139 -79 -253.5t-209 -164.5l280 502q8 -45 8 -84zM1792 576q0 -35 -20 -69q-39 -64 -109 -145q-150 -172 -347.5 -267t-419.5 -95l74 132q212 18 392.5 137t301.5 307q-115 179 -282 294l63 112q95 -64 182.5 -153t144.5 -184q20 -34 20 -69z |
| | | " /> |
| | | <glyph glyph-name="warning_sign" unicode="" horiz-adv-x="1792" |
| | | d="M1024 161v190q0 14 -9.5 23.5t-22.5 9.5h-192q-13 0 -22.5 -9.5t-9.5 -23.5v-190q0 -14 9.5 -23.5t22.5 -9.5h192q13 0 22.5 9.5t9.5 23.5zM1022 535l18 459q0 12 -10 19q-13 11 -24 11h-220q-11 0 -24 -11q-10 -7 -10 -21l17 -457q0 -10 10 -16.5t24 -6.5h185 |
| | | q14 0 23.5 6.5t10.5 16.5zM1008 1469l768 -1408q35 -63 -2 -126q-17 -29 -46.5 -46t-63.5 -17h-1536q-34 0 -63.5 17t-46.5 46q-37 63 -2 126l768 1408q17 31 47 49t65 18t65 -18t47 -49z" /> |
| | | <glyph glyph-name="plane" unicode="" horiz-adv-x="1408" |
| | | d="M1376 1376q44 -52 12 -148t-108 -172l-161 -161l160 -696q5 -19 -12 -33l-128 -96q-7 -6 -19 -6q-4 0 -7 1q-15 3 -21 16l-279 508l-259 -259l53 -194q5 -17 -8 -31l-96 -96q-9 -9 -23 -9h-2q-15 2 -24 13l-189 252l-252 189q-11 7 -13 23q-1 13 9 25l96 97q9 9 23 9 |
| | | q6 0 8 -1l194 -53l259 259l-508 279q-14 8 -17 24q-2 16 9 27l128 128q14 13 30 8l665 -159l160 160q76 76 172 108t148 -12z" /> |
| | | <glyph glyph-name="calendar" unicode="" horiz-adv-x="1664" |
| | | d="M128 -128h288v288h-288v-288zM480 -128h320v288h-320v-288zM128 224h288v320h-288v-320zM480 224h320v320h-320v-320zM128 608h288v288h-288v-288zM864 -128h320v288h-320v-288zM480 608h320v288h-320v-288zM1248 -128h288v288h-288v-288zM864 224h320v320h-320v-320z |
| | | M512 1088v288q0 13 -9.5 22.5t-22.5 9.5h-64q-13 0 -22.5 -9.5t-9.5 -22.5v-288q0 -13 9.5 -22.5t22.5 -9.5h64q13 0 22.5 9.5t9.5 22.5zM1248 224h288v320h-288v-320zM864 608h320v288h-320v-288zM1248 608h288v288h-288v-288zM1280 1088v288q0 13 -9.5 22.5t-22.5 9.5h-64 |
| | | q-13 0 -22.5 -9.5t-9.5 -22.5v-288q0 -13 9.5 -22.5t22.5 -9.5h64q13 0 22.5 9.5t9.5 22.5zM1664 1152v-1280q0 -52 -38 -90t-90 -38h-1408q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h128v96q0 66 47 113t113 47h64q66 0 113 -47t47 -113v-96h384v96q0 66 47 113t113 47 |
| | | h64q66 0 113 -47t47 -113v-96h128q52 0 90 -38t38 -90z" /> |
| | | <glyph glyph-name="random" unicode="" horiz-adv-x="1792" |
| | | d="M666 1055q-60 -92 -137 -273q-22 45 -37 72.5t-40.5 63.5t-51 56.5t-63 35t-81.5 14.5h-224q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h224q250 0 410 -225zM1792 256q0 -14 -9 -23l-320 -320q-9 -9 -23 -9q-13 0 -22.5 9.5t-9.5 22.5v192q-32 0 -85 -0.5t-81 -1t-73 1 |
| | | t-71 5t-64 10.5t-63 18.5t-58 28.5t-59 40t-55 53.5t-56 69.5q59 93 136 273q22 -45 37 -72.5t40.5 -63.5t51 -56.5t63 -35t81.5 -14.5h256v192q0 14 9 23t23 9q12 0 24 -10l319 -319q9 -9 9 -23zM1792 1152q0 -14 -9 -23l-320 -320q-9 -9 -23 -9q-13 0 -22.5 9.5t-9.5 22.5 |
| | | v192h-256q-48 0 -87 -15t-69 -45t-51 -61.5t-45 -77.5q-32 -62 -78 -171q-29 -66 -49.5 -111t-54 -105t-64 -100t-74 -83t-90 -68.5t-106.5 -42t-128 -16.5h-224q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h224q48 0 87 15t69 45t51 61.5t45 77.5q32 62 78 171q29 66 49.5 111 |
| | | t54 105t64 100t74 83t90 68.5t106.5 42t128 16.5h256v192q0 14 9 23t23 9q12 0 24 -10l319 -319q9 -9 9 -23z" /> |
| | | <glyph glyph-name="comment" unicode="" horiz-adv-x="1792" |
| | | d="M1792 640q0 -174 -120 -321.5t-326 -233t-450 -85.5q-70 0 -145 8q-198 -175 -460 -242q-49 -14 -114 -22q-17 -2 -30.5 9t-17.5 29v1q-3 4 -0.5 12t2 10t4.5 9.5l6 9t7 8.5t8 9q7 8 31 34.5t34.5 38t31 39.5t32.5 51t27 59t26 76q-157 89 -247.5 220t-90.5 281 |
| | | q0 130 71 248.5t191 204.5t286 136.5t348 50.5q244 0 450 -85.5t326 -233t120 -321.5z" /> |
| | | <glyph glyph-name="magnet" unicode="" |
| | | d="M1536 704v-128q0 -201 -98.5 -362t-274 -251.5t-395.5 -90.5t-395.5 90.5t-274 251.5t-98.5 362v128q0 26 19 45t45 19h384q26 0 45 -19t19 -45v-128q0 -52 23.5 -90t53.5 -57t71 -30t64 -13t44 -2t44 2t64 13t71 30t53.5 57t23.5 90v128q0 26 19 45t45 19h384 |
| | | q26 0 45 -19t19 -45zM512 1344v-384q0 -26 -19 -45t-45 -19h-384q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h384q26 0 45 -19t19 -45zM1536 1344v-384q0 -26 -19 -45t-45 -19h-384q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h384q26 0 45 -19t19 -45z" /> |
| | | <glyph glyph-name="chevron_up" unicode="" horiz-adv-x="1792" |
| | | d="M1683 205l-166 -165q-19 -19 -45 -19t-45 19l-531 531l-531 -531q-19 -19 -45 -19t-45 19l-166 165q-19 19 -19 45.5t19 45.5l742 741q19 19 45 19t45 -19l742 -741q19 -19 19 -45.5t-19 -45.5z" /> |
| | | <glyph glyph-name="chevron_down" unicode="" horiz-adv-x="1792" |
| | | d="M1683 728l-742 -741q-19 -19 -45 -19t-45 19l-742 741q-19 19 -19 45.5t19 45.5l166 165q19 19 45 19t45 -19l531 -531l531 531q19 19 45 19t45 -19l166 -165q19 -19 19 -45.5t-19 -45.5z" /> |
| | | <glyph glyph-name="retweet" unicode="" horiz-adv-x="1920" |
| | | d="M1280 32q0 -13 -9.5 -22.5t-22.5 -9.5h-960q-8 0 -13.5 2t-9 7t-5.5 8t-3 11.5t-1 11.5v13v11v160v416h-192q-26 0 -45 19t-19 45q0 24 15 41l320 384q19 22 49 22t49 -22l320 -384q15 -17 15 -41q0 -26 -19 -45t-45 -19h-192v-384h576q16 0 25 -11l160 -192q7 -10 7 -21 |
| | | zM1920 448q0 -24 -15 -41l-320 -384q-20 -23 -49 -23t-49 23l-320 384q-15 17 -15 41q0 26 19 45t45 19h192v384h-576q-16 0 -25 12l-160 192q-7 9 -7 20q0 13 9.5 22.5t22.5 9.5h960q8 0 13.5 -2t9 -7t5.5 -8t3 -11.5t1 -11.5v-13v-11v-160v-416h192q26 0 45 -19t19 -45z |
| | | " /> |
| | | <glyph glyph-name="shopping_cart" unicode="" horiz-adv-x="1664" |
| | | d="M640 0q0 -52 -38 -90t-90 -38t-90 38t-38 90t38 90t90 38t90 -38t38 -90zM1536 0q0 -52 -38 -90t-90 -38t-90 38t-38 90t38 90t90 38t90 -38t38 -90zM1664 1088v-512q0 -24 -16.5 -42.5t-40.5 -21.5l-1044 -122q13 -60 13 -70q0 -16 -24 -64h920q26 0 45 -19t19 -45 |
| | | t-19 -45t-45 -19h-1024q-26 0 -45 19t-19 45q0 11 8 31.5t16 36t21.5 40t15.5 29.5l-177 823h-204q-26 0 -45 19t-19 45t19 45t45 19h256q16 0 28.5 -6.5t19.5 -15.5t13 -24.5t8 -26t5.5 -29.5t4.5 -26h1201q26 0 45 -19t19 -45z" /> |
| | | <glyph glyph-name="folder_close" unicode="" horiz-adv-x="1664" |
| | | d="M1664 928v-704q0 -92 -66 -158t-158 -66h-1216q-92 0 -158 66t-66 158v960q0 92 66 158t158 66h320q92 0 158 -66t66 -158v-32h672q92 0 158 -66t66 -158z" /> |
| | | <glyph glyph-name="folder_open" unicode="" horiz-adv-x="1920" |
| | | d="M1879 584q0 -31 -31 -66l-336 -396q-43 -51 -120.5 -86.5t-143.5 -35.5h-1088q-34 0 -60.5 13t-26.5 43q0 31 31 66l336 396q43 51 120.5 86.5t143.5 35.5h1088q34 0 60.5 -13t26.5 -43zM1536 928v-160h-832q-94 0 -197 -47.5t-164 -119.5l-337 -396l-5 -6q0 4 -0.5 12.5 |
| | | t-0.5 12.5v960q0 92 66 158t158 66h320q92 0 158 -66t66 -158v-32h544q92 0 158 -66t66 -158z" /> |
| | | <glyph glyph-name="resize_vertical" unicode="" horiz-adv-x="768" |
| | | d="M704 1216q0 -26 -19 -45t-45 -19h-128v-1024h128q26 0 45 -19t19 -45t-19 -45l-256 -256q-19 -19 -45 -19t-45 19l-256 256q-19 19 -19 45t19 45t45 19h128v1024h-128q-26 0 -45 19t-19 45t19 45l256 256q19 19 45 19t45 -19l256 -256q19 -19 19 -45z" /> |
| | | <glyph glyph-name="resize_horizontal" unicode="" horiz-adv-x="1792" |
| | | d="M1792 640q0 -26 -19 -45l-256 -256q-19 -19 -45 -19t-45 19t-19 45v128h-1024v-128q0 -26 -19 -45t-45 -19t-45 19l-256 256q-19 19 -19 45t19 45l256 256q19 19 45 19t45 -19t19 -45v-128h1024v128q0 26 19 45t45 19t45 -19l256 -256q19 -19 19 -45z" /> |
| | | <glyph glyph-name="bar_chart" unicode="" horiz-adv-x="2048" |
| | | d="M640 640v-512h-256v512h256zM1024 1152v-1024h-256v1024h256zM2048 0v-128h-2048v1536h128v-1408h1920zM1408 896v-768h-256v768h256zM1792 1280v-1152h-256v1152h256z" /> |
| | | <glyph glyph-name="twitter_sign" unicode="" |
| | | d="M1280 926q-56 -25 -121 -34q68 40 93 117q-65 -38 -134 -51q-61 66 -153 66q-87 0 -148.5 -61.5t-61.5 -148.5q0 -29 5 -48q-129 7 -242 65t-192 155q-29 -50 -29 -106q0 -114 91 -175q-47 1 -100 26v-2q0 -75 50 -133.5t123 -72.5q-29 -8 -51 -8q-13 0 -39 4 |
| | | q21 -63 74.5 -104t121.5 -42q-116 -90 -261 -90q-26 0 -50 3q148 -94 322 -94q112 0 210 35.5t168 95t120.5 137t75 162t24.5 168.5q0 18 -1 27q63 45 105 109zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5 |
| | | t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> |
| | | <glyph glyph-name="facebook_sign" unicode="" |
| | | d="M1248 1408q119 0 203.5 -84.5t84.5 -203.5v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-188v595h199l30 232h-229v148q0 56 23.5 84t91.5 28l122 1v207q-63 9 -178 9q-136 0 -217.5 -80t-81.5 -226v-171h-200v-232h200v-595h-532q-119 0 -203.5 84.5t-84.5 203.5v960 |
| | | q0 119 84.5 203.5t203.5 84.5h960z" /> |
| | | <glyph glyph-name="camera_retro" unicode="" horiz-adv-x="1792" |
| | | d="M928 704q0 14 -9 23t-23 9q-66 0 -113 -47t-47 -113q0 -14 9 -23t23 -9t23 9t9 23q0 40 28 68t68 28q14 0 23 9t9 23zM1152 574q0 -106 -75 -181t-181 -75t-181 75t-75 181t75 181t181 75t181 -75t75 -181zM128 0h1536v128h-1536v-128zM1280 574q0 159 -112.5 271.5 |
| | | t-271.5 112.5t-271.5 -112.5t-112.5 -271.5t112.5 -271.5t271.5 -112.5t271.5 112.5t112.5 271.5zM256 1216h384v128h-384v-128zM128 1024h1536v118v138h-828l-64 -128h-644v-128zM1792 1280v-1280q0 -53 -37.5 -90.5t-90.5 -37.5h-1536q-53 0 -90.5 37.5t-37.5 90.5v1280 |
| | | q0 53 37.5 90.5t90.5 37.5h1536q53 0 90.5 -37.5t37.5 -90.5z" /> |
| | | <glyph glyph-name="key" unicode="" horiz-adv-x="1792" |
| | | d="M832 1024q0 80 -56 136t-136 56t-136 -56t-56 -136q0 -42 19 -83q-41 19 -83 19q-80 0 -136 -56t-56 -136t56 -136t136 -56t136 56t56 136q0 42 -19 83q41 -19 83 -19q80 0 136 56t56 136zM1683 320q0 -17 -49 -66t-66 -49q-9 0 -28.5 16t-36.5 33t-38.5 40t-24.5 26 |
| | | l-96 -96l220 -220q28 -28 28 -68q0 -42 -39 -81t-81 -39q-40 0 -68 28l-671 671q-176 -131 -365 -131q-163 0 -265.5 102.5t-102.5 265.5q0 160 95 313t248 248t313 95q163 0 265.5 -102.5t102.5 -265.5q0 -189 -131 -365l355 -355l96 96q-3 3 -26 24.5t-40 38.5t-33 36.5 |
| | | t-16 28.5q0 17 49 66t66 49q13 0 23 -10q6 -6 46 -44.5t82 -79.5t86.5 -86t73 -78t28.5 -41z" /> |
| | | <glyph glyph-name="cogs" unicode="" horiz-adv-x="1920" |
| | | d="M896 640q0 106 -75 181t-181 75t-181 -75t-75 -181t75 -181t181 -75t181 75t75 181zM1664 128q0 52 -38 90t-90 38t-90 -38t-38 -90q0 -53 37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1664 1152q0 52 -38 90t-90 38t-90 -38t-38 -90q0 -53 37.5 -90.5t90.5 -37.5 |
| | | t90.5 37.5t37.5 90.5zM1280 731v-185q0 -10 -7 -19.5t-16 -10.5l-155 -24q-11 -35 -32 -76q34 -48 90 -115q7 -11 7 -20q0 -12 -7 -19q-23 -30 -82.5 -89.5t-78.5 -59.5q-11 0 -21 7l-115 90q-37 -19 -77 -31q-11 -108 -23 -155q-7 -24 -30 -24h-186q-11 0 -20 7.5t-10 17.5 |
| | | l-23 153q-34 10 -75 31l-118 -89q-7 -7 -20 -7q-11 0 -21 8q-144 133 -144 160q0 9 7 19q10 14 41 53t47 61q-23 44 -35 82l-152 24q-10 1 -17 9.5t-7 19.5v185q0 10 7 19.5t16 10.5l155 24q11 35 32 76q-34 48 -90 115q-7 11 -7 20q0 12 7 20q22 30 82 89t79 59q11 0 21 -7 |
| | | l115 -90q34 18 77 32q11 108 23 154q7 24 30 24h186q11 0 20 -7.5t10 -17.5l23 -153q34 -10 75 -31l118 89q8 7 20 7q11 0 21 -8q144 -133 144 -160q0 -8 -7 -19q-12 -16 -42 -54t-45 -60q23 -48 34 -82l152 -23q10 -2 17 -10.5t7 -19.5zM1920 198v-140q0 -16 -149 -31 |
| | | q-12 -27 -30 -52q51 -113 51 -138q0 -4 -4 -7q-122 -71 -124 -71q-8 0 -46 47t-52 68q-20 -2 -30 -2t-30 2q-14 -21 -52 -68t-46 -47q-2 0 -124 71q-4 3 -4 7q0 25 51 138q-18 25 -30 52q-149 15 -149 31v140q0 16 149 31q13 29 30 52q-51 113 -51 138q0 4 4 7q4 2 35 20 |
| | | t59 34t30 16q8 0 46 -46.5t52 -67.5q20 2 30 2t30 -2q51 71 92 112l6 2q4 0 124 -70q4 -3 4 -7q0 -25 -51 -138q17 -23 30 -52q149 -15 149 -31zM1920 1222v-140q0 -16 -149 -31q-12 -27 -30 -52q51 -113 51 -138q0 -4 -4 -7q-122 -71 -124 -71q-8 0 -46 47t-52 68 |
| | | q-20 -2 -30 -2t-30 2q-14 -21 -52 -68t-46 -47q-2 0 -124 71q-4 3 -4 7q0 25 51 138q-18 25 -30 52q-149 15 -149 31v140q0 16 149 31q13 29 30 52q-51 113 -51 138q0 4 4 7q4 2 35 20t59 34t30 16q8 0 46 -46.5t52 -67.5q20 2 30 2t30 -2q51 71 92 112l6 2q4 0 124 -70 |
| | | q4 -3 4 -7q0 -25 -51 -138q17 -23 30 -52q149 -15 149 -31z" /> |
| | | <glyph glyph-name="comments" unicode="" horiz-adv-x="1792" |
| | | d="M1408 768q0 -139 -94 -257t-256.5 -186.5t-353.5 -68.5q-86 0 -176 16q-124 -88 -278 -128q-36 -9 -86 -16h-3q-11 0 -20.5 8t-11.5 21q-1 3 -1 6.5t0.5 6.5t2 6l2.5 5t3.5 5.5t4 5t4.5 5t4 4.5q5 6 23 25t26 29.5t22.5 29t25 38.5t20.5 44q-124 72 -195 177t-71 224 |
| | | q0 139 94 257t256.5 186.5t353.5 68.5t353.5 -68.5t256.5 -186.5t94 -257zM1792 512q0 -120 -71 -224.5t-195 -176.5q10 -24 20.5 -44t25 -38.5t22.5 -29t26 -29.5t23 -25q1 -1 4 -4.5t4.5 -5t4 -5t3.5 -5.5l2.5 -5t2 -6t0.5 -6.5t-1 -6.5q-3 -14 -13 -22t-22 -7 |
| | | q-50 7 -86 16q-154 40 -278 128q-90 -16 -176 -16q-271 0 -472 132q58 -4 88 -4q161 0 309 45t264 129q125 92 192 212t67 254q0 77 -23 152q129 -71 204 -178t75 -230z" /> |
| | | <glyph glyph-name="thumbs_up_alt" unicode="" |
| | | d="M256 192q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1408 768q0 51 -39 89.5t-89 38.5h-352q0 58 48 159.5t48 160.5q0 98 -32 145t-128 47q-26 -26 -38 -85t-30.5 -125.5t-59.5 -109.5q-22 -23 -77 -91q-4 -5 -23 -30t-31.5 -41t-34.5 -42.5 |
| | | t-40 -44t-38.5 -35.5t-40 -27t-35.5 -9h-32v-640h32q13 0 31.5 -3t33 -6.5t38 -11t35 -11.5t35.5 -12.5t29 -10.5q211 -73 342 -73h121q192 0 192 167q0 26 -5 56q30 16 47.5 52.5t17.5 73.5t-18 69q53 50 53 119q0 25 -10 55.5t-25 47.5q32 1 53.5 47t21.5 81zM1536 769 |
| | | q0 -89 -49 -163q9 -33 9 -69q0 -77 -38 -144q3 -21 3 -43q0 -101 -60 -178q1 -139 -85 -219.5t-227 -80.5h-36h-93q-96 0 -189.5 22.5t-216.5 65.5q-116 40 -138 40h-288q-53 0 -90.5 37.5t-37.5 90.5v640q0 53 37.5 90.5t90.5 37.5h274q36 24 137 155q58 75 107 128 |
| | | q24 25 35.5 85.5t30.5 126.5t62 108q39 37 90 37q84 0 151 -32.5t102 -101.5t35 -186q0 -93 -48 -192h176q104 0 180 -76t76 -179z" /> |
| | | <glyph glyph-name="thumbs_down_alt" unicode="" |
| | | d="M256 1088q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1408 512q0 35 -21.5 81t-53.5 47q15 17 25 47.5t10 55.5q0 69 -53 119q18 31 18 69q0 37 -17.5 73.5t-47.5 52.5q5 30 5 56q0 85 -49 126t-136 41h-128q-131 0 -342 -73q-5 -2 -29 -10.5 |
| | | t-35.5 -12.5t-35 -11.5t-38 -11t-33 -6.5t-31.5 -3h-32v-640h32q16 0 35.5 -9t40 -27t38.5 -35.5t40 -44t34.5 -42.5t31.5 -41t23 -30q55 -68 77 -91q41 -43 59.5 -109.5t30.5 -125.5t38 -85q96 0 128 47t32 145q0 59 -48 160.5t-48 159.5h352q50 0 89 38.5t39 89.5z |
| | | M1536 511q0 -103 -76 -179t-180 -76h-176q48 -99 48 -192q0 -118 -35 -186q-35 -69 -102 -101.5t-151 -32.5q-51 0 -90 37q-34 33 -54 82t-25.5 90.5t-17.5 84.5t-31 64q-48 50 -107 127q-101 131 -137 155h-274q-53 0 -90.5 37.5t-37.5 90.5v640q0 53 37.5 90.5t90.5 37.5 |
| | | h288q22 0 138 40q128 44 223 66t200 22h112q140 0 226.5 -79t85.5 -216v-5q60 -77 60 -178q0 -22 -3 -43q38 -67 38 -144q0 -36 -9 -69q49 -73 49 -163z" /> |
| | | <glyph glyph-name="star_half" unicode="" horiz-adv-x="896" |
| | | d="M832 1504v-1339l-449 -236q-22 -12 -40 -12q-21 0 -31.5 14.5t-10.5 35.5q0 6 2 20l86 500l-364 354q-25 27 -25 48q0 37 56 46l502 73l225 455q19 41 49 41z" /> |
| | | <glyph glyph-name="heart_empty" unicode="" horiz-adv-x="1792" |
| | | d="M1664 940q0 81 -21.5 143t-55 98.5t-81.5 59.5t-94 31t-98 8t-112 -25.5t-110.5 -64t-86.5 -72t-60 -61.5q-18 -22 -49 -22t-49 22q-24 28 -60 61.5t-86.5 72t-110.5 64t-112 25.5t-98 -8t-94 -31t-81.5 -59.5t-55 -98.5t-21.5 -143q0 -168 187 -355l581 -560l580 559 |
| | | q188 188 188 356zM1792 940q0 -221 -229 -450l-623 -600q-18 -18 -44 -18t-44 18l-624 602q-10 8 -27.5 26t-55.5 65.5t-68 97.5t-53.5 121t-23.5 138q0 220 127 344t351 124q62 0 126.5 -21.5t120 -58t95.5 -68.5t76 -68q36 36 76 68t95.5 68.5t120 58t126.5 21.5 |
| | | q224 0 351 -124t127 -344z" /> |
| | | <glyph glyph-name="signout" unicode="" horiz-adv-x="1664" |
| | | d="M640 96q0 -4 1 -20t0.5 -26.5t-3 -23.5t-10 -19.5t-20.5 -6.5h-320q-119 0 -203.5 84.5t-84.5 203.5v704q0 119 84.5 203.5t203.5 84.5h320q13 0 22.5 -9.5t9.5 -22.5q0 -4 1 -20t0.5 -26.5t-3 -23.5t-10 -19.5t-20.5 -6.5h-320q-66 0 -113 -47t-47 -113v-704 |
| | | q0 -66 47 -113t113 -47h288h11h13t11.5 -1t11.5 -3t8 -5.5t7 -9t2 -13.5zM1568 640q0 -26 -19 -45l-544 -544q-19 -19 -45 -19t-45 19t-19 45v288h-448q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h448v288q0 26 19 45t45 19t45 -19l544 -544q19 -19 19 -45z" /> |
| | | <glyph glyph-name="linkedin_sign" unicode="" |
| | | d="M237 122h231v694h-231v-694zM483 1030q-1 52 -36 86t-93 34t-94.5 -34t-36.5 -86q0 -51 35.5 -85.5t92.5 -34.5h1q59 0 95 34.5t36 85.5zM1068 122h231v398q0 154 -73 233t-193 79q-136 0 -209 -117h2v101h-231q3 -66 0 -694h231v388q0 38 7 56q15 35 45 59.5t74 24.5 |
| | | q116 0 116 -157v-371zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> |
| | | <glyph glyph-name="pushpin" unicode="" horiz-adv-x="1152" |
| | | d="M480 672v448q0 14 -9 23t-23 9t-23 -9t-9 -23v-448q0 -14 9 -23t23 -9t23 9t9 23zM1152 320q0 -26 -19 -45t-45 -19h-429l-51 -483q-2 -12 -10.5 -20.5t-20.5 -8.5h-1q-27 0 -32 27l-76 485h-404q-26 0 -45 19t-19 45q0 123 78.5 221.5t177.5 98.5v512q-52 0 -90 38 |
| | | t-38 90t38 90t90 38h640q52 0 90 -38t38 -90t-38 -90t-90 -38v-512q99 0 177.5 -98.5t78.5 -221.5z" /> |
| | | <glyph glyph-name="external_link" unicode="" horiz-adv-x="1792" |
| | | d="M1408 608v-320q0 -119 -84.5 -203.5t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h704q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-704q-66 0 -113 -47t-47 -113v-832q0 -66 47 -113t113 -47h832q66 0 113 47t47 113v320 |
| | | q0 14 9 23t23 9h64q14 0 23 -9t9 -23zM1792 1472v-512q0 -26 -19 -45t-45 -19t-45 19l-176 176l-652 -652q-10 -10 -23 -10t-23 10l-114 114q-10 10 -10 23t10 23l652 652l-176 176q-19 19 -19 45t19 45t45 19h512q26 0 45 -19t19 -45z" /> |
| | | <glyph glyph-name="signin" unicode="" |
| | | d="M1184 640q0 -26 -19 -45l-544 -544q-19 -19 -45 -19t-45 19t-19 45v288h-448q-26 0 -45 19t-19 45v384q0 26 19 45t45 19h448v288q0 26 19 45t45 19t45 -19l544 -544q19 -19 19 -45zM1536 992v-704q0 -119 -84.5 -203.5t-203.5 -84.5h-320q-13 0 -22.5 9.5t-9.5 22.5 |
| | | q0 4 -1 20t-0.5 26.5t3 23.5t10 19.5t20.5 6.5h320q66 0 113 47t47 113v704q0 66 -47 113t-113 47h-288h-11h-13t-11.5 1t-11.5 3t-8 5.5t-7 9t-2 13.5q0 4 -1 20t-0.5 26.5t3 23.5t10 19.5t20.5 6.5h320q119 0 203.5 -84.5t84.5 -203.5z" /> |
| | | <glyph glyph-name="trophy" unicode="" horiz-adv-x="1664" |
| | | d="M458 653q-74 162 -74 371h-256v-96q0 -78 94.5 -162t235.5 -113zM1536 928v96h-256q0 -209 -74 -371q141 29 235.5 113t94.5 162zM1664 1056v-128q0 -71 -41.5 -143t-112 -130t-173 -97.5t-215.5 -44.5q-42 -54 -95 -95q-38 -34 -52.5 -72.5t-14.5 -89.5q0 -54 30.5 -91 |
| | | t97.5 -37q75 0 133.5 -45.5t58.5 -114.5v-64q0 -14 -9 -23t-23 -9h-832q-14 0 -23 9t-9 23v64q0 69 58.5 114.5t133.5 45.5q67 0 97.5 37t30.5 91q0 51 -14.5 89.5t-52.5 72.5q-53 41 -95 95q-113 5 -215.5 44.5t-173 97.5t-112 130t-41.5 143v128q0 40 28 68t68 28h288v96 |
| | | q0 66 47 113t113 47h576q66 0 113 -47t47 -113v-96h288q40 0 68 -28t28 -68z" /> |
| | | <glyph glyph-name="github_sign" unicode="" |
| | | d="M519 336q4 6 -3 13q-9 7 -14 2q-4 -6 3 -13q9 -7 14 -2zM491 377q-5 7 -12 4q-6 -4 0 -12q7 -8 12 -5q6 4 0 13zM450 417q2 4 -5 8q-7 2 -8 -2q-3 -5 4 -8q8 -2 9 2zM471 394q2 1 1.5 4.5t-3.5 5.5q-6 7 -10 3t1 -11q6 -6 11 -2zM557 319q2 7 -9 11q-9 3 -13 -4 |
| | | q-2 -7 9 -11q9 -3 13 4zM599 316q0 8 -12 8q-10 0 -10 -8t11 -8t11 8zM638 323q-2 7 -13 5t-9 -9q2 -8 12 -6t10 10zM1280 640q0 212 -150 362t-362 150t-362 -150t-150 -362q0 -167 98 -300.5t252 -185.5q18 -3 26.5 5t8.5 20q0 52 -1 95q-6 -1 -15.5 -2.5t-35.5 -2t-48 4 |
| | | t-43.5 20t-29.5 41.5q-23 59 -57 74q-2 1 -4.5 3.5l-8 8t-7 9.5t4 7.5t19.5 3.5q6 0 15 -2t30 -15.5t33 -35.5q16 -28 37.5 -42t43.5 -14t38 3.5t30 9.5q7 47 33 69q-49 6 -86 18.5t-73 39t-55.5 76t-19.5 119.5q0 79 53 137q-24 62 5 136q19 6 54.5 -7.5t60.5 -29.5l26 -16 |
| | | q58 17 128 17t128 -17q11 7 28.5 18t55.5 26t57 9q29 -74 5 -136q53 -58 53 -137q0 -57 -14 -100.5t-35.5 -70t-53.5 -44.5t-62.5 -26t-68.5 -12q35 -31 35 -95q0 -40 -0.5 -89t-0.5 -51q0 -12 8.5 -20t26.5 -5q154 52 252 185.5t98 300.5zM1536 1120v-960 |
| | | q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> |
| | | <glyph glyph-name="upload_alt" unicode="" horiz-adv-x="1664" |
| | | d="M1280 64q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1536 64q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1664 288v-320q0 -40 -28 -68t-68 -28h-1472q-40 0 -68 28t-28 68v320q0 40 28 68t68 28h427q21 -56 70.5 -92 |
| | | t110.5 -36h256q61 0 110.5 36t70.5 92h427q40 0 68 -28t28 -68zM1339 936q-17 -40 -59 -40h-256v-448q0 -26 -19 -45t-45 -19h-256q-26 0 -45 19t-19 45v448h-256q-42 0 -59 40q-17 39 14 69l448 448q18 19 45 19t45 -19l448 -448q31 -30 14 -69z" /> |
| | | <glyph glyph-name="lemon" unicode="" |
| | | d="M1407 710q0 44 -7 113.5t-18 96.5q-12 30 -17 44t-9 36.5t-4 48.5q0 23 5 68.5t5 67.5q0 37 -10 55q-4 1 -13 1q-19 0 -58 -4.5t-59 -4.5q-60 0 -176 24t-175 24q-43 0 -94.5 -11.5t-85 -23.5t-89.5 -34q-137 -54 -202 -103q-96 -73 -159.5 -189.5t-88 -236t-24.5 -248.5 |
| | | q0 -40 12.5 -120t12.5 -121q0 -23 -11 -66.5t-11 -65.5t12 -36.5t34 -14.5q24 0 72.5 11t73.5 11q57 0 169.5 -15.5t169.5 -15.5q181 0 284 36q129 45 235.5 152.5t166 245.5t59.5 275zM1535 712q0 -165 -70 -327.5t-196 -288t-281 -180.5q-124 -44 -326 -44 |
| | | q-57 0 -170 14.5t-169 14.5q-24 0 -72.5 -14.5t-73.5 -14.5q-73 0 -123.5 55.5t-50.5 128.5q0 24 11 68t11 67q0 40 -12.5 120.5t-12.5 121.5q0 111 18 217.5t54.5 209.5t100.5 194t150 156q78 59 232 120q194 78 316 78q60 0 175.5 -24t173.5 -24q19 0 57 5t58 5 |
| | | q81 0 118 -50.5t37 -134.5q0 -23 -5 -68t-5 -68q0 -13 2 -25t3.5 -16.5t7.5 -20.5t8 -20q16 -40 25 -118.5t9 -136.5z" /> |
| | | <glyph glyph-name="phone" unicode="" horiz-adv-x="1408" |
| | | d="M1408 296q0 -27 -10 -70.5t-21 -68.5q-21 -50 -122 -106q-94 -51 -186 -51q-27 0 -53 3.5t-57.5 12.5t-47 14.5t-55.5 20.5t-49 18q-98 35 -175 83q-127 79 -264 216t-216 264q-48 77 -83 175q-3 9 -18 49t-20.5 55.5t-14.5 47t-12.5 57.5t-3.5 53q0 92 51 186 |
| | | q56 101 106 122q25 11 68.5 21t70.5 10q14 0 21 -3q18 -6 53 -76q11 -19 30 -54t35 -63.5t31 -53.5q3 -4 17.5 -25t21.5 -35.5t7 -28.5q0 -20 -28.5 -50t-62 -55t-62 -53t-28.5 -46q0 -9 5 -22.5t8.5 -20.5t14 -24t11.5 -19q76 -137 174 -235t235 -174q2 -1 19 -11.5t24 -14 |
| | | t20.5 -8.5t22.5 -5q18 0 46 28.5t53 62t55 62t50 28.5q14 0 28.5 -7t35.5 -21.5t25 -17.5q25 -15 53.5 -31t63.5 -35t54 -30q70 -35 76 -53q3 -7 3 -21z" /> |
| | | <glyph glyph-name="check_empty" unicode="" horiz-adv-x="1408" |
| | | d="M1120 1280h-832q-66 0 -113 -47t-47 -113v-832q0 -66 47 -113t113 -47h832q66 0 113 47t47 113v832q0 66 -47 113t-113 47zM1408 1120v-832q0 -119 -84.5 -203.5t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h832 |
| | | q119 0 203.5 -84.5t84.5 -203.5z" /> |
| | | <glyph glyph-name="bookmark_empty" unicode="" horiz-adv-x="1280" |
| | | d="M1152 1280h-1024v-1242l423 406l89 85l89 -85l423 -406v1242zM1164 1408q23 0 44 -9q33 -13 52.5 -41t19.5 -62v-1289q0 -34 -19.5 -62t-52.5 -41q-19 -8 -44 -8q-48 0 -83 32l-441 424l-441 -424q-36 -33 -83 -33q-23 0 -44 9q-33 13 -52.5 41t-19.5 62v1289 |
| | | q0 34 19.5 62t52.5 41q21 9 44 9h1048z" /> |
| | | <glyph glyph-name="phone_sign" unicode="" |
| | | d="M1280 343q0 11 -2 16t-18 16.5t-40.5 25t-47.5 26.5t-45.5 25t-28.5 15q-5 3 -19 13t-25 15t-21 5q-15 0 -36.5 -20.5t-39.5 -45t-38.5 -45t-33.5 -20.5q-7 0 -16.5 3.5t-15.5 6.5t-17 9.5t-14 8.5q-99 55 -170 126.5t-127 170.5q-2 3 -8.5 14t-9.5 17t-6.5 15.5 |
| | | t-3.5 16.5q0 13 20.5 33.5t45 38.5t45 39.5t20.5 36.5q0 10 -5 21t-15 25t-13 19q-3 6 -15 28.5t-25 45.5t-26.5 47.5t-25 40.5t-16.5 18t-16 2q-48 0 -101 -22q-46 -21 -80 -94.5t-34 -130.5q0 -16 2.5 -34t5 -30.5t9 -33t10 -29.5t12.5 -33t11 -30q60 -164 216.5 -320.5 |
| | | t320.5 -216.5q6 -2 30 -11t33 -12.5t29.5 -10t33 -9t30.5 -5t34 -2.5q57 0 130.5 34t94.5 80q22 53 22 101zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z |
| | | " /> |
| | | <glyph glyph-name="twitter" unicode="" horiz-adv-x="1664" |
| | | d="M1620 1128q-67 -98 -162 -167q1 -14 1 -42q0 -130 -38 -259.5t-115.5 -248.5t-184.5 -210.5t-258 -146t-323 -54.5q-271 0 -496 145q35 -4 78 -4q225 0 401 138q-105 2 -188 64.5t-114 159.5q33 -5 61 -5q43 0 85 11q-112 23 -185.5 111.5t-73.5 205.5v4q68 -38 146 -41 |
| | | q-66 44 -105 115t-39 154q0 88 44 163q121 -149 294.5 -238.5t371.5 -99.5q-8 38 -8 74q0 134 94.5 228.5t228.5 94.5q140 0 236 -102q109 21 205 78q-37 -115 -142 -178q93 10 186 50z" /> |
| | | <glyph glyph-name="facebook" unicode="" horiz-adv-x="1024" |
| | | d="M959 1524v-264h-157q-86 0 -116 -36t-30 -108v-189h293l-39 -296h-254v-759h-306v759h-255v296h255v218q0 186 104 288.5t277 102.5q147 0 228 -12z" /> |
| | | <glyph glyph-name="github" unicode="" |
| | | d="M768 1408q209 0 385.5 -103t279.5 -279.5t103 -385.5q0 -251 -146.5 -451.5t-378.5 -277.5q-27 -5 -40 7t-13 30q0 3 0.5 76.5t0.5 134.5q0 97 -52 142q57 6 102.5 18t94 39t81 66.5t53 105t20.5 150.5q0 119 -79 206q37 91 -8 204q-28 9 -81 -11t-92 -44l-38 -24 |
| | | q-93 26 -192 26t-192 -26q-16 11 -42.5 27t-83.5 38.5t-85 13.5q-45 -113 -8 -204q-79 -87 -79 -206q0 -85 20.5 -150t52.5 -105t80.5 -67t94 -39t102.5 -18q-39 -36 -49 -103q-21 -10 -45 -15t-57 -5t-65.5 21.5t-55.5 62.5q-19 32 -48.5 52t-49.5 24l-20 3q-21 0 -29 -4.5 |
| | | t-5 -11.5t9 -14t13 -12l7 -5q22 -10 43.5 -38t31.5 -51l10 -23q13 -38 44 -61.5t67 -30t69.5 -7t55.5 3.5l23 4q0 -38 0.5 -88.5t0.5 -54.5q0 -18 -13 -30t-40 -7q-232 77 -378.5 277.5t-146.5 451.5q0 209 103 385.5t279.5 279.5t385.5 103zM291 305q3 7 -7 12 |
| | | q-10 3 -13 -2q-3 -7 7 -12q9 -6 13 2zM322 271q7 5 -2 16q-10 9 -16 3q-7 -5 2 -16q10 -10 16 -3zM352 226q9 7 0 19q-8 13 -17 6q-9 -5 0 -18t17 -7zM394 184q8 8 -4 19q-12 12 -20 3q-9 -8 4 -19q12 -12 20 -3zM451 159q3 11 -13 16q-15 4 -19 -7t13 -15q15 -6 19 6z |
| | | M514 154q0 13 -17 11q-16 0 -16 -11q0 -13 17 -11q16 0 16 11zM572 164q-2 11 -18 9q-16 -3 -14 -15t18 -8t14 14z" /> |
| | | <glyph glyph-name="unlock" unicode="" horiz-adv-x="1664" |
| | | d="M1664 960v-256q0 -26 -19 -45t-45 -19h-64q-26 0 -45 19t-19 45v256q0 106 -75 181t-181 75t-181 -75t-75 -181v-192h96q40 0 68 -28t28 -68v-576q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68v576q0 40 28 68t68 28h672v192q0 185 131.5 316.5t316.5 131.5 |
| | | t316.5 -131.5t131.5 -316.5z" /> |
| | | <glyph glyph-name="credit_card" unicode="" horiz-adv-x="1920" |
| | | d="M1760 1408q66 0 113 -47t47 -113v-1216q0 -66 -47 -113t-113 -47h-1600q-66 0 -113 47t-47 113v1216q0 66 47 113t113 47h1600zM160 1280q-13 0 -22.5 -9.5t-9.5 -22.5v-224h1664v224q0 13 -9.5 22.5t-22.5 9.5h-1600zM1760 0q13 0 22.5 9.5t9.5 22.5v608h-1664v-608 |
| | | q0 -13 9.5 -22.5t22.5 -9.5h1600zM256 128v128h256v-128h-256zM640 128v128h384v-128h-384z" /> |
| | | <glyph glyph-name="rss" unicode="" horiz-adv-x="1408" |
| | | d="M384 192q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM896 69q2 -28 -17 -48q-18 -21 -47 -21h-135q-25 0 -43 16.5t-20 41.5q-22 229 -184.5 391.5t-391.5 184.5q-25 2 -41.5 20t-16.5 43v135q0 29 21 47q17 17 43 17h5q160 -13 306 -80.5 |
| | | t259 -181.5q114 -113 181.5 -259t80.5 -306zM1408 67q2 -27 -18 -47q-18 -20 -46 -20h-143q-26 0 -44.5 17.5t-19.5 42.5q-12 215 -101 408.5t-231.5 336t-336 231.5t-408.5 102q-25 1 -42.5 19.5t-17.5 43.5v143q0 28 20 46q18 18 44 18h3q262 -13 501.5 -120t425.5 -294 |
| | | q187 -186 294 -425.5t120 -501.5z" /> |
| | | <glyph glyph-name="hdd" unicode="" |
| | | d="M1040 320q0 -33 -23.5 -56.5t-56.5 -23.5t-56.5 23.5t-23.5 56.5t23.5 56.5t56.5 23.5t56.5 -23.5t23.5 -56.5zM1296 320q0 -33 -23.5 -56.5t-56.5 -23.5t-56.5 23.5t-23.5 56.5t23.5 56.5t56.5 23.5t56.5 -23.5t23.5 -56.5zM1408 160v320q0 13 -9.5 22.5t-22.5 9.5 |
| | | h-1216q-13 0 -22.5 -9.5t-9.5 -22.5v-320q0 -13 9.5 -22.5t22.5 -9.5h1216q13 0 22.5 9.5t9.5 22.5zM178 640h1180l-157 482q-4 13 -16 21.5t-26 8.5h-782q-14 0 -26 -8.5t-16 -21.5zM1536 480v-320q0 -66 -47 -113t-113 -47h-1216q-66 0 -113 47t-47 113v320q0 25 16 75 |
| | | l197 606q17 53 63 86t101 33h782q55 0 101 -33t63 -86l197 -606q16 -50 16 -75z" /> |
| | | <glyph glyph-name="bullhorn" unicode="" horiz-adv-x="1792" |
| | | d="M1664 896q53 0 90.5 -37.5t37.5 -90.5t-37.5 -90.5t-90.5 -37.5v-384q0 -52 -38 -90t-90 -38q-417 347 -812 380q-58 -19 -91 -66t-31 -100.5t40 -92.5q-20 -33 -23 -65.5t6 -58t33.5 -55t48 -50t61.5 -50.5q-29 -58 -111.5 -83t-168.5 -11.5t-132 55.5q-7 23 -29.5 87.5 |
| | | t-32 94.5t-23 89t-15 101t3.5 98.5t22 110.5h-122q-66 0 -113 47t-47 113v192q0 66 47 113t113 47h480q435 0 896 384q52 0 90 -38t38 -90v-384zM1536 292v954q-394 -302 -768 -343v-270q377 -42 768 -341z" /> |
| | | <glyph glyph-name="bell" unicode="" horiz-adv-x="1792" |
| | | d="M912 -160q0 16 -16 16q-59 0 -101.5 42.5t-42.5 101.5q0 16 -16 16t-16 -16q0 -73 51.5 -124.5t124.5 -51.5q16 0 16 16zM246 128h1300q-266 300 -266 832q0 51 -24 105t-69 103t-121.5 80.5t-169.5 31.5t-169.5 -31.5t-121.5 -80.5t-69 -103t-24 -105q0 -532 -266 -832z |
| | | M1728 128q0 -52 -38 -90t-90 -38h-448q0 -106 -75 -181t-181 -75t-181 75t-75 181h-448q-52 0 -90 38t-38 90q50 42 91 88t85 119.5t74.5 158.5t50 206t19.5 260q0 152 117 282.5t307 158.5q-8 19 -8 39q0 40 28 68t68 28t68 -28t28 -68q0 -20 -8 -39q190 -28 307 -158.5 |
| | | t117 -282.5q0 -139 19.5 -260t50 -206t74.5 -158.5t85 -119.5t91 -88z" /> |
| | | <glyph glyph-name="certificate" unicode="" |
| | | d="M1376 640l138 -135q30 -28 20 -70q-12 -41 -52 -51l-188 -48l53 -186q12 -41 -19 -70q-29 -31 -70 -19l-186 53l-48 -188q-10 -40 -51 -52q-12 -2 -19 -2q-31 0 -51 22l-135 138l-135 -138q-28 -30 -70 -20q-41 11 -51 52l-48 188l-186 -53q-41 -12 -70 19q-31 29 -19 70 |
| | | l53 186l-188 48q-40 10 -52 51q-10 42 20 70l138 135l-138 135q-30 28 -20 70q12 41 52 51l188 48l-53 186q-12 41 19 70q29 31 70 19l186 -53l48 188q10 41 51 51q41 12 70 -19l135 -139l135 139q29 30 70 19q41 -10 51 -51l48 -188l186 53q41 12 70 -19q31 -29 19 -70 |
| | | l-53 -186l188 -48q40 -10 52 -51q10 -42 -20 -70z" /> |
| | | <glyph glyph-name="hand_right" unicode="" horiz-adv-x="1792" |
| | | d="M256 192q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1664 768q0 51 -39 89.5t-89 38.5h-576q0 20 15 48.5t33 55t33 68t15 84.5q0 67 -44.5 97.5t-115.5 30.5q-24 0 -90 -139q-24 -44 -37 -65q-40 -64 -112 -145q-71 -81 -101 -106 |
| | | q-69 -57 -140 -57h-32v-640h32q72 0 167 -32t193.5 -64t179.5 -32q189 0 189 167q0 26 -5 56q30 16 47.5 52.5t17.5 73.5t-18 69q53 50 53 119q0 25 -10 55.5t-25 47.5h331q52 0 90 38t38 90zM1792 769q0 -105 -75.5 -181t-180.5 -76h-169q-4 -62 -37 -119q3 -21 3 -43 |
| | | q0 -101 -60 -178q1 -139 -85 -219.5t-227 -80.5q-133 0 -322 69q-164 59 -223 59h-288q-53 0 -90.5 37.5t-37.5 90.5v640q0 53 37.5 90.5t90.5 37.5h288q10 0 21.5 4.5t23.5 14t22.5 18t24 22.5t20.5 21.5t19 21.5t14 17q65 74 100 129q13 21 33 62t37 72t40.5 63t55 49.5 |
| | | t69.5 17.5q125 0 206.5 -67t81.5 -189q0 -68 -22 -128h374q104 0 180 -76t76 -179z" /> |
| | | <glyph glyph-name="hand_left" unicode="" horiz-adv-x="1792" |
| | | d="M1376 128h32v640h-32q-35 0 -67.5 12t-62.5 37t-50 46t-49 54q-8 9 -12 14q-72 81 -112 145q-14 22 -38 68q-1 3 -10.5 22.5t-18.5 36t-20 35.5t-21.5 30.5t-18.5 11.5q-71 0 -115.5 -30.5t-44.5 -97.5q0 -43 15 -84.5t33 -68t33 -55t15 -48.5h-576q-50 0 -89 -38.5 |
| | | t-39 -89.5q0 -52 38 -90t90 -38h331q-15 -17 -25 -47.5t-10 -55.5q0 -69 53 -119q-18 -32 -18 -69t17.5 -73.5t47.5 -52.5q-4 -24 -4 -56q0 -85 48.5 -126t135.5 -41q84 0 183 32t194 64t167 32zM1664 192q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45z |
| | | M1792 768v-640q0 -53 -37.5 -90.5t-90.5 -37.5h-288q-59 0 -223 -59q-190 -69 -317 -69q-142 0 -230 77.5t-87 217.5l1 5q-61 76 -61 178q0 22 3 43q-33 57 -37 119h-169q-105 0 -180.5 76t-75.5 181q0 103 76 179t180 76h374q-22 60 -22 128q0 122 81.5 189t206.5 67 |
| | | q38 0 69.5 -17.5t55 -49.5t40.5 -63t37 -72t33 -62q35 -55 100 -129q2 -3 14 -17t19 -21.5t20.5 -21.5t24 -22.5t22.5 -18t23.5 -14t21.5 -4.5h288q53 0 90.5 -37.5t37.5 -90.5z" /> |
| | | <glyph glyph-name="hand_up" unicode="" |
| | | d="M1280 -64q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1408 700q0 189 -167 189q-26 0 -56 -5q-16 30 -52.5 47.5t-73.5 17.5t-69 -18q-50 53 -119 53q-25 0 -55.5 -10t-47.5 -25v331q0 52 -38 90t-90 38q-51 0 -89.5 -39t-38.5 -89v-576 |
| | | q-20 0 -48.5 15t-55 33t-68 33t-84.5 15q-67 0 -97.5 -44.5t-30.5 -115.5q0 -24 139 -90q44 -24 65 -37q64 -40 145 -112q81 -71 106 -101q57 -69 57 -140v-32h640v32q0 72 32 167t64 193.5t32 179.5zM1536 705q0 -133 -69 -322q-59 -164 -59 -223v-288q0 -53 -37.5 -90.5 |
| | | t-90.5 -37.5h-640q-53 0 -90.5 37.5t-37.5 90.5v288q0 10 -4.5 21.5t-14 23.5t-18 22.5t-22.5 24t-21.5 20.5t-21.5 19t-17 14q-74 65 -129 100q-21 13 -62 33t-72 37t-63 40.5t-49.5 55t-17.5 69.5q0 125 67 206.5t189 81.5q68 0 128 -22v374q0 104 76 180t179 76 |
| | | q105 0 181 -75.5t76 -180.5v-169q62 -4 119 -37q21 3 43 3q101 0 178 -60q139 1 219.5 -85t80.5 -227z" /> |
| | | <glyph glyph-name="hand_down" unicode="" |
| | | d="M1408 576q0 84 -32 183t-64 194t-32 167v32h-640v-32q0 -35 -12 -67.5t-37 -62.5t-46 -50t-54 -49q-9 -8 -14 -12q-81 -72 -145 -112q-22 -14 -68 -38q-3 -1 -22.5 -10.5t-36 -18.5t-35.5 -20t-30.5 -21.5t-11.5 -18.5q0 -71 30.5 -115.5t97.5 -44.5q43 0 84.5 15t68 33 |
| | | t55 33t48.5 15v-576q0 -50 38.5 -89t89.5 -39q52 0 90 38t38 90v331q46 -35 103 -35q69 0 119 53q32 -18 69 -18t73.5 17.5t52.5 47.5q24 -4 56 -4q85 0 126 48.5t41 135.5zM1280 1344q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1536 580 |
| | | q0 -142 -77.5 -230t-217.5 -87l-5 1q-76 -61 -178 -61q-22 0 -43 3q-54 -30 -119 -37v-169q0 -105 -76 -180.5t-181 -75.5q-103 0 -179 76t-76 180v374q-54 -22 -128 -22q-121 0 -188.5 81.5t-67.5 206.5q0 38 17.5 69.5t49.5 55t63 40.5t72 37t62 33q55 35 129 100 |
| | | q3 2 17 14t21.5 19t21.5 20.5t22.5 24t18 22.5t14 23.5t4.5 21.5v288q0 53 37.5 90.5t90.5 37.5h640q53 0 90.5 -37.5t37.5 -90.5v-288q0 -59 59 -223q69 -190 69 -317z" /> |
| | | <glyph glyph-name="circle_arrow_left" unicode="" |
| | | d="M1280 576v128q0 26 -19 45t-45 19h-502l189 189q19 19 19 45t-19 45l-91 91q-18 18 -45 18t-45 -18l-362 -362l-91 -91q-18 -18 -18 -45t18 -45l91 -91l362 -362q18 -18 45 -18t45 18l91 91q18 18 18 45t-18 45l-189 189h502q26 0 45 19t19 45zM1536 640 |
| | | q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> |
| | | <glyph glyph-name="circle_arrow_right" unicode="" |
| | | d="M1285 640q0 27 -18 45l-91 91l-362 362q-18 18 -45 18t-45 -18l-91 -91q-18 -18 -18 -45t18 -45l189 -189h-502q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h502l-189 -189q-19 -19 -19 -45t19 -45l91 -91q18 -18 45 -18t45 18l362 362l91 91q18 18 18 45zM1536 640 |
| | | q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> |
| | | <glyph glyph-name="circle_arrow_up" unicode="" |
| | | d="M1284 641q0 27 -18 45l-362 362l-91 91q-18 18 -45 18t-45 -18l-91 -91l-362 -362q-18 -18 -18 -45t18 -45l91 -91q18 -18 45 -18t45 18l189 189v-502q0 -26 19 -45t45 -19h128q26 0 45 19t19 45v502l189 -189q19 -19 45 -19t45 19l91 91q18 18 18 45zM1536 640 |
| | | q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> |
| | | <glyph glyph-name="circle_arrow_down" unicode="" |
| | | d="M1284 639q0 27 -18 45l-91 91q-18 18 -45 18t-45 -18l-189 -189v502q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-502l-189 189q-19 19 -45 19t-45 -19l-91 -91q-18 -18 -18 -45t18 -45l362 -362l91 -91q18 -18 45 -18t45 18l91 91l362 362q18 18 18 45zM1536 640 |
| | | q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> |
| | | <glyph glyph-name="globe" unicode="" |
| | | d="M768 1408q209 0 385.5 -103t279.5 -279.5t103 -385.5t-103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103zM1042 887q-2 -1 -9.5 -9.5t-13.5 -9.5q2 0 4.5 5t5 11t3.5 7q6 7 22 15q14 6 52 12q34 8 51 -11 |
| | | q-2 2 9.5 13t14.5 12q3 2 15 4.5t15 7.5l2 22q-12 -1 -17.5 7t-6.5 21q0 -2 -6 -8q0 7 -4.5 8t-11.5 -1t-9 -1q-10 3 -15 7.5t-8 16.5t-4 15q-2 5 -9.5 11t-9.5 10q-1 2 -2.5 5.5t-3 6.5t-4 5.5t-5.5 2.5t-7 -5t-7.5 -10t-4.5 -5q-3 2 -6 1.5t-4.5 -1t-4.5 -3t-5 -3.5 |
| | | q-3 -2 -8.5 -3t-8.5 -2q15 5 -1 11q-10 4 -16 3q9 4 7.5 12t-8.5 14h5q-1 4 -8.5 8.5t-17.5 8.5t-13 6q-8 5 -34 9.5t-33 0.5q-5 -6 -4.5 -10.5t4 -14t3.5 -12.5q1 -6 -5.5 -13t-6.5 -12q0 -7 14 -15.5t10 -21.5q-3 -8 -16 -16t-16 -12q-5 -8 -1.5 -18.5t10.5 -16.5 |
| | | q2 -2 1.5 -4t-3.5 -4.5t-5.5 -4t-6.5 -3.5l-3 -2q-11 -5 -20.5 6t-13.5 26q-7 25 -16 30q-23 8 -29 -1q-5 13 -41 26q-25 9 -58 4q6 1 0 15q-7 15 -19 12q3 6 4 17.5t1 13.5q3 13 12 23q1 1 7 8.5t9.5 13.5t0.5 6q35 -4 50 11q5 5 11.5 17t10.5 17q9 6 14 5.5t14.5 -5.5 |
| | | t14.5 -5q14 -1 15.5 11t-7.5 20q12 -1 3 17q-4 7 -8 9q-12 4 -27 -5q-8 -4 2 -8q-1 1 -9.5 -10.5t-16.5 -17.5t-16 5q-1 1 -5.5 13.5t-9.5 13.5q-8 0 -16 -15q3 8 -11 15t-24 8q19 12 -8 27q-7 4 -20.5 5t-19.5 -4q-5 -7 -5.5 -11.5t5 -8t10.5 -5.5t11.5 -4t8.5 -3 |
| | | q14 -10 8 -14q-2 -1 -8.5 -3.5t-11.5 -4.5t-6 -4q-3 -4 0 -14t-2 -14q-5 5 -9 17.5t-7 16.5q7 -9 -25 -6l-10 1q-4 0 -16 -2t-20.5 -1t-13.5 8q-4 8 0 20q1 4 4 2q-4 3 -11 9.5t-10 8.5q-46 -15 -94 -41q6 -1 12 1q5 2 13 6.5t10 5.5q34 14 42 7l5 5q14 -16 20 -25 |
| | | q-7 4 -30 1q-20 -6 -22 -12q7 -12 5 -18q-4 3 -11.5 10t-14.5 11t-15 5q-16 0 -22 -1q-146 -80 -235 -222q7 -7 12 -8q4 -1 5 -9t2.5 -11t11.5 3q9 -8 3 -19q1 1 44 -27q19 -17 21 -21q3 -11 -10 -18q-1 2 -9 9t-9 4q-3 -5 0.5 -18.5t10.5 -12.5q-7 0 -9.5 -16t-2.5 -35.5 |
| | | t-1 -23.5l2 -1q-3 -12 5.5 -34.5t21.5 -19.5q-13 -3 20 -43q6 -8 8 -9q3 -2 12 -7.5t15 -10t10 -10.5q4 -5 10 -22.5t14 -23.5q-2 -6 9.5 -20t10.5 -23q-1 0 -2.5 -1t-2.5 -1q3 -7 15.5 -14t15.5 -13q1 -3 2 -10t3 -11t8 -2q2 20 -24 62q-15 25 -17 29q-3 5 -5.5 15.5 |
| | | t-4.5 14.5q2 0 6 -1.5t8.5 -3.5t7.5 -4t2 -3q-3 -7 2 -17.5t12 -18.5t17 -19t12 -13q6 -6 14 -19.5t0 -13.5q9 0 20 -10.5t17 -19.5q5 -8 8 -26t5 -24q2 -7 8.5 -13.5t12.5 -9.5l16 -8t13 -7q5 -2 18.5 -10.5t21.5 -11.5q10 -4 16 -4t14.5 2.5t13.5 3.5q15 2 29 -15t21 -21 |
| | | q36 -19 55 -11q-2 -1 0.5 -7.5t8 -15.5t9 -14.5t5.5 -8.5q5 -6 18 -15t18 -15q6 4 7 9q-3 -8 7 -20t18 -10q14 3 14 32q-31 -15 -49 18q0 1 -2.5 5.5t-4 8.5t-2.5 8.5t0 7.5t5 3q9 0 10 3.5t-2 12.5t-4 13q-1 8 -11 20t-12 15q-5 -9 -16 -8t-16 9q0 -1 -1.5 -5.5t-1.5 -6.5 |
| | | q-13 0 -15 1q1 3 2.5 17.5t3.5 22.5q1 4 5.5 12t7.5 14.5t4 12.5t-4.5 9.5t-17.5 2.5q-19 -1 -26 -20q-1 -3 -3 -10.5t-5 -11.5t-9 -7q-7 -3 -24 -2t-24 5q-13 8 -22.5 29t-9.5 37q0 10 2.5 26.5t3 25t-5.5 24.5q3 2 9 9.5t10 10.5q2 1 4.5 1.5t4.5 0t4 1.5t3 6q-1 1 -4 3 |
| | | q-3 3 -4 3q7 -3 28.5 1.5t27.5 -1.5q15 -11 22 2q0 1 -2.5 9.5t-0.5 13.5q5 -27 29 -9q3 -3 15.5 -5t17.5 -5q3 -2 7 -5.5t5.5 -4.5t5 0.5t8.5 6.5q10 -14 12 -24q11 -40 19 -44q7 -3 11 -2t4.5 9.5t0 14t-1.5 12.5l-1 8v18l-1 8q-15 3 -18.5 12t1.5 18.5t15 18.5q1 1 8 3.5 |
| | | t15.5 6.5t12.5 8q21 19 15 35q7 0 11 9q-1 0 -5 3t-7.5 5t-4.5 2q9 5 2 16q5 3 7.5 11t7.5 10q9 -12 21 -2q8 8 1 16q5 7 20.5 10.5t18.5 9.5q7 -2 8 2t1 12t3 12q4 5 15 9t13 5l17 11q3 4 0 4q18 -2 31 11q10 11 -6 20q3 6 -3 9.5t-15 5.5q3 1 11.5 0.5t10.5 1.5 |
| | | q15 10 -7 16q-17 5 -43 -12zM879 10q206 36 351 189q-3 3 -12.5 4.5t-12.5 3.5q-18 7 -24 8q1 7 -2.5 13t-8 9t-12.5 8t-11 7q-2 2 -7 6t-7 5.5t-7.5 4.5t-8.5 2t-10 -1l-3 -1q-3 -1 -5.5 -2.5t-5.5 -3t-4 -3t0 -2.5q-21 17 -36 22q-5 1 -11 5.5t-10.5 7t-10 1.5t-11.5 -7 |
| | | q-5 -5 -6 -15t-2 -13q-7 5 0 17.5t2 18.5q-3 6 -10.5 4.5t-12 -4.5t-11.5 -8.5t-9 -6.5t-8.5 -5.5t-8.5 -7.5q-3 -4 -6 -12t-5 -11q-2 4 -11.5 6.5t-9.5 5.5q2 -10 4 -35t5 -38q7 -31 -12 -48q-27 -25 -29 -40q-4 -22 12 -26q0 -7 -8 -20.5t-7 -21.5q0 -6 2 -16z" /> |
| | | <glyph glyph-name="wrench" unicode="" horiz-adv-x="1664" |
| | | d="M384 64q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1028 484l-682 -682q-37 -37 -90 -37q-52 0 -91 37l-106 108q-38 36 -38 90q0 53 38 91l681 681q39 -98 114.5 -173.5t173.5 -114.5zM1662 919q0 -39 -23 -106q-47 -134 -164.5 -217.5 |
| | | t-258.5 -83.5q-185 0 -316.5 131.5t-131.5 316.5t131.5 316.5t316.5 131.5q58 0 121.5 -16.5t107.5 -46.5q16 -11 16 -28t-16 -28l-293 -169v-224l193 -107q5 3 79 48.5t135.5 81t70.5 35.5q15 0 23.5 -10t8.5 -25z" /> |
| | | <glyph glyph-name="tasks" unicode="" horiz-adv-x="1792" |
| | | d="M1024 128h640v128h-640v-128zM640 640h1024v128h-1024v-128zM1280 1152h384v128h-384v-128zM1792 320v-256q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v256q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1792 832v-256q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19 |
| | | t-19 45v256q0 26 19 45t45 19h1664q26 0 45 -19t19 -45zM1792 1344v-256q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v256q0 26 19 45t45 19h1664q26 0 45 -19t19 -45z" /> |
| | | <glyph glyph-name="filter" unicode="" horiz-adv-x="1408" |
| | | d="M1403 1241q17 -41 -14 -70l-493 -493v-742q0 -42 -39 -59q-13 -5 -25 -5q-27 0 -45 19l-256 256q-19 19 -19 45v486l-493 493q-31 29 -14 70q17 39 59 39h1280q42 0 59 -39z" /> |
| | | <glyph glyph-name="briefcase" unicode="" horiz-adv-x="1792" |
| | | d="M640 1280h512v128h-512v-128zM1792 640v-480q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v480h672v-160q0 -26 19 -45t45 -19h320q26 0 45 19t19 45v160h672zM1024 640v-128h-256v128h256zM1792 1120v-384h-1792v384q0 66 47 113t113 47h352v160q0 40 28 68 |
| | | t68 28h576q40 0 68 -28t28 -68v-160h352q66 0 113 -47t47 -113z" /> |
| | | <glyph glyph-name="fullscreen" unicode="" |
| | | d="M1283 995l-355 -355l355 -355l144 144q29 31 70 14q39 -17 39 -59v-448q0 -26 -19 -45t-45 -19h-448q-42 0 -59 40q-17 39 14 69l144 144l-355 355l-355 -355l144 -144q31 -30 14 -69q-17 -40 -59 -40h-448q-26 0 -45 19t-19 45v448q0 42 40 59q39 17 69 -14l144 -144 |
| | | l355 355l-355 355l-144 -144q-19 -19 -45 -19q-12 0 -24 5q-40 17 -40 59v448q0 26 19 45t45 19h448q42 0 59 -40q17 -39 -14 -69l-144 -144l355 -355l355 355l-144 144q-31 30 -14 69q17 40 59 40h448q26 0 45 -19t19 -45v-448q0 -42 -39 -59q-13 -5 -25 -5q-26 0 -45 19z |
| | | " /> |
| | | <glyph glyph-name="group" unicode="" horiz-adv-x="1920" |
| | | d="M593 640q-162 -5 -265 -128h-134q-82 0 -138 40.5t-56 118.5q0 353 124 353q6 0 43.5 -21t97.5 -42.5t119 -21.5q67 0 133 23q-5 -37 -5 -66q0 -139 81 -256zM1664 3q0 -120 -73 -189.5t-194 -69.5h-874q-121 0 -194 69.5t-73 189.5q0 53 3.5 103.5t14 109t26.5 108.5 |
| | | t43 97.5t62 81t85.5 53.5t111.5 20q10 0 43 -21.5t73 -48t107 -48t135 -21.5t135 21.5t107 48t73 48t43 21.5q61 0 111.5 -20t85.5 -53.5t62 -81t43 -97.5t26.5 -108.5t14 -109t3.5 -103.5zM640 1280q0 -106 -75 -181t-181 -75t-181 75t-75 181t75 181t181 75t181 -75 |
| | | t75 -181zM1344 896q0 -159 -112.5 -271.5t-271.5 -112.5t-271.5 112.5t-112.5 271.5t112.5 271.5t271.5 112.5t271.5 -112.5t112.5 -271.5zM1920 671q0 -78 -56 -118.5t-138 -40.5h-134q-103 123 -265 128q81 117 81 256q0 29 -5 66q66 -23 133 -23q59 0 119 21.5t97.5 42.5 |
| | | t43.5 21q124 0 124 -353zM1792 1280q0 -106 -75 -181t-181 -75t-181 75t-75 181t75 181t181 75t181 -75t75 -181z" /> |
| | | <glyph glyph-name="link" unicode="" horiz-adv-x="1664" |
| | | d="M1456 320q0 40 -28 68l-208 208q-28 28 -68 28q-42 0 -72 -32q3 -3 19 -18.5t21.5 -21.5t15 -19t13 -25.5t3.5 -27.5q0 -40 -28 -68t-68 -28q-15 0 -27.5 3.5t-25.5 13t-19 15t-21.5 21.5t-18.5 19q-33 -31 -33 -73q0 -40 28 -68l206 -207q27 -27 68 -27q40 0 68 26 |
| | | l147 146q28 28 28 67zM753 1025q0 40 -28 68l-206 207q-28 28 -68 28q-39 0 -68 -27l-147 -146q-28 -28 -28 -67q0 -40 28 -68l208 -208q27 -27 68 -27q42 0 72 31q-3 3 -19 18.5t-21.5 21.5t-15 19t-13 25.5t-3.5 27.5q0 40 28 68t68 28q15 0 27.5 -3.5t25.5 -13t19 -15 |
| | | t21.5 -21.5t18.5 -19q33 31 33 73zM1648 320q0 -120 -85 -203l-147 -146q-83 -83 -203 -83q-121 0 -204 85l-206 207q-83 83 -83 203q0 123 88 209l-88 88q-86 -88 -208 -88q-120 0 -204 84l-208 208q-84 84 -84 204t85 203l147 146q83 83 203 83q121 0 204 -85l206 -207 |
| | | q83 -83 83 -203q0 -123 -88 -209l88 -88q86 88 208 88q120 0 204 -84l208 -208q84 -84 84 -204z" /> |
| | | <glyph glyph-name="cloud" unicode="" horiz-adv-x="1920" |
| | | d="M1920 384q0 -159 -112.5 -271.5t-271.5 -112.5h-1088q-185 0 -316.5 131.5t-131.5 316.5q0 132 71 241.5t187 163.5q-2 28 -2 43q0 212 150 362t362 150q158 0 286.5 -88t187.5 -230q70 62 166 62q106 0 181 -75t75 -181q0 -75 -41 -138q129 -30 213 -134.5t84 -239.5z |
| | | " /> |
| | | <glyph glyph-name="beaker" unicode="" horiz-adv-x="1664" |
| | | d="M1527 88q56 -89 21.5 -152.5t-140.5 -63.5h-1152q-106 0 -140.5 63.5t21.5 152.5l503 793v399h-64q-26 0 -45 19t-19 45t19 45t45 19h512q26 0 45 -19t19 -45t-19 -45t-45 -19h-64v-399zM748 813l-272 -429h712l-272 429l-20 31v37v399h-128v-399v-37z" /> |
| | | <glyph glyph-name="cut" unicode="" horiz-adv-x="1792" |
| | | d="M960 640q26 0 45 -19t19 -45t-19 -45t-45 -19t-45 19t-19 45t19 45t45 19zM1260 576l507 -398q28 -20 25 -56q-5 -35 -35 -51l-128 -64q-13 -7 -29 -7q-17 0 -31 8l-690 387l-110 -66q-8 -4 -12 -5q14 -49 10 -97q-7 -77 -56 -147.5t-132 -123.5q-132 -84 -277 -84 |
| | | q-136 0 -222 78q-90 84 -79 207q7 76 56 147t131 124q132 84 278 84q83 0 151 -31q9 13 22 22l122 73l-122 73q-13 9 -22 22q-68 -31 -151 -31q-146 0 -278 84q-82 53 -131 124t-56 147q-5 59 15.5 113t63.5 93q85 79 222 79q145 0 277 -84q83 -52 132 -123t56 -148 |
| | | q4 -48 -10 -97q4 -1 12 -5l110 -66l690 387q14 8 31 8q16 0 29 -7l128 -64q30 -16 35 -51q3 -36 -25 -56zM579 836q46 42 21 108t-106 117q-92 59 -192 59q-74 0 -113 -36q-46 -42 -21 -108t106 -117q92 -59 192 -59q74 0 113 36zM494 91q81 51 106 117t-21 108 |
| | | q-39 36 -113 36q-100 0 -192 -59q-81 -51 -106 -117t21 -108q39 -36 113 -36q100 0 192 59zM672 704l96 -58v11q0 36 33 56l14 8l-79 47l-26 -26q-3 -3 -10 -11t-12 -12q-2 -2 -4 -3.5t-3 -2.5zM896 480l96 -32l736 576l-128 64l-768 -431v-113l-160 -96l9 -8q2 -2 7 -6 |
| | | q4 -4 11 -12t11 -12l26 -26zM1600 64l128 64l-520 408l-177 -138q-2 -3 -13 -7z" /> |
| | | <glyph glyph-name="copy" unicode="" horiz-adv-x="1792" |
| | | d="M1696 1152q40 0 68 -28t28 -68v-1216q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68v288h-544q-40 0 -68 28t-28 68v672q0 40 20 88t48 76l408 408q28 28 76 48t88 20h416q40 0 68 -28t28 -68v-328q68 40 128 40h416zM1152 939l-299 -299h299v299zM512 1323l-299 -299 |
| | | h299v299zM708 676l316 316v416h-384v-416q0 -40 -28 -68t-68 -28h-416v-640h512v256q0 40 20 88t48 76zM1664 -128v1152h-384v-416q0 -40 -28 -68t-68 -28h-416v-640h896z" /> |
| | | <glyph glyph-name="paper_clip" unicode="" horiz-adv-x="1408" |
| | | d="M1404 151q0 -117 -79 -196t-196 -79q-135 0 -235 100l-777 776q-113 115 -113 271q0 159 110 270t269 111q158 0 273 -113l605 -606q10 -10 10 -22q0 -16 -30.5 -46.5t-46.5 -30.5q-13 0 -23 10l-606 607q-79 77 -181 77q-106 0 -179 -75t-73 -181q0 -105 76 -181 |
| | | l776 -777q63 -63 145 -63q64 0 106 42t42 106q0 82 -63 145l-581 581q-26 24 -60 24q-29 0 -48 -19t-19 -48q0 -32 25 -59l410 -410q10 -10 10 -22q0 -16 -31 -47t-47 -31q-12 0 -22 10l-410 410q-63 61 -63 149q0 82 57 139t139 57q88 0 149 -63l581 -581q100 -98 100 -235 |
| | | z" /> |
| | | <glyph glyph-name="save" unicode="" |
| | | d="M384 0h768v384h-768v-384zM1280 0h128v896q0 14 -10 38.5t-20 34.5l-281 281q-10 10 -34 20t-39 10v-416q0 -40 -28 -68t-68 -28h-576q-40 0 -68 28t-28 68v416h-128v-1280h128v416q0 40 28 68t68 28h832q40 0 68 -28t28 -68v-416zM896 928v320q0 13 -9.5 22.5t-22.5 9.5 |
| | | h-192q-13 0 -22.5 -9.5t-9.5 -22.5v-320q0 -13 9.5 -22.5t22.5 -9.5h192q13 0 22.5 9.5t9.5 22.5zM1536 896v-928q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1344q0 40 28 68t68 28h928q40 0 88 -20t76 -48l280 -280q28 -28 48 -76t20 -88z" /> |
| | | <glyph glyph-name="sign_blank" unicode="" |
| | | d="M1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> |
| | | <glyph glyph-name="reorder" unicode="" |
| | | d="M1536 192v-128q0 -26 -19 -45t-45 -19h-1408q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1408q26 0 45 -19t19 -45zM1536 704v-128q0 -26 -19 -45t-45 -19h-1408q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1408q26 0 45 -19t19 -45zM1536 1216v-128q0 -26 -19 -45 |
| | | t-45 -19h-1408q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h1408q26 0 45 -19t19 -45z" /> |
| | | <glyph glyph-name="ul" unicode="" horiz-adv-x="1792" |
| | | d="M384 128q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM384 640q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM1792 224v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1216q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5 |
| | | t22.5 9.5h1216q13 0 22.5 -9.5t9.5 -22.5zM384 1152q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM1792 736v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1216q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1216q13 0 22.5 -9.5t9.5 -22.5z |
| | | M1792 1248v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1216q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1216q13 0 22.5 -9.5t9.5 -22.5z" /> |
| | | <glyph glyph-name="ol" unicode="" horiz-adv-x="1792" |
| | | d="M381 -84q0 -80 -54.5 -126t-135.5 -46q-106 0 -172 66l57 88q49 -45 106 -45q29 0 50.5 14.5t21.5 42.5q0 64 -105 56l-26 56q8 10 32.5 43.5t42.5 54t37 38.5v1q-16 0 -48.5 -1t-48.5 -1v-53h-106v152h333v-88l-95 -115q51 -12 81 -49t30 -88zM383 543v-159h-362 |
| | | q-6 36 -6 54q0 51 23.5 93t56.5 68t66 47.5t56.5 43.5t23.5 45q0 25 -14.5 38.5t-39.5 13.5q-46 0 -81 -58l-85 59q24 51 71.5 79.5t105.5 28.5q73 0 123 -41.5t50 -112.5q0 -50 -34 -91.5t-75 -64.5t-75.5 -50.5t-35.5 -52.5h127v60h105zM1792 224v-192q0 -13 -9.5 -22.5 |
| | | t-22.5 -9.5h-1216q-13 0 -22.5 9.5t-9.5 22.5v192q0 14 9 23t23 9h1216q13 0 22.5 -9.5t9.5 -22.5zM384 1123v-99h-335v99h107q0 41 0.5 121.5t0.5 121.5v12h-2q-8 -17 -50 -54l-71 76l136 127h106v-404h108zM1792 736v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1216 |
| | | q-13 0 -22.5 9.5t-9.5 22.5v192q0 14 9 23t23 9h1216q13 0 22.5 -9.5t9.5 -22.5zM1792 1248v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1216q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1216q13 0 22.5 -9.5t9.5 -22.5z" /> |
| | | <glyph glyph-name="strikethrough" unicode="" horiz-adv-x="1792" |
| | | d="M1760 640q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-1728q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h1728zM483 704q-28 35 -51 80q-48 98 -48 188q0 181 134 309q133 127 393 127q50 0 167 -19q66 -12 177 -48q10 -38 21 -118q14 -123 14 -183q0 -18 -5 -45l-12 -3l-84 6 |
| | | l-14 2q-50 149 -103 205q-88 91 -210 91q-114 0 -182 -59q-67 -58 -67 -146q0 -73 66 -140t279 -129q69 -20 173 -66q58 -28 95 -52h-743zM990 448h411q7 -39 7 -92q0 -111 -41 -212q-23 -56 -71 -104q-37 -35 -109 -81q-80 -48 -153 -66q-80 -21 -203 -21q-114 0 -195 23 |
| | | l-140 40q-57 16 -72 28q-8 8 -8 22v13q0 108 -2 156q-1 30 0 68l2 37v44l102 2q15 -34 30 -71t22.5 -56t12.5 -27q35 -57 80 -94q43 -36 105 -57q59 -22 132 -22q64 0 139 27q77 26 122 86q47 61 47 129q0 84 -81 157q-34 29 -137 71z" /> |
| | | <glyph glyph-name="underline" unicode="" |
| | | d="M48 1313q-37 2 -45 4l-3 88q13 1 40 1q60 0 112 -4q132 -7 166 -7q86 0 168 3q116 4 146 5q56 0 86 2l-1 -14l2 -64v-9q-60 -9 -124 -9q-60 0 -79 -25q-13 -14 -13 -132q0 -13 0.5 -32.5t0.5 -25.5l1 -229l14 -280q6 -124 51 -202q35 -59 96 -92q88 -47 177 -47 |
| | | q104 0 191 28q56 18 99 51q48 36 65 64q36 56 53 114q21 73 21 229q0 79 -3.5 128t-11 122.5t-13.5 159.5l-4 59q-5 67 -24 88q-34 35 -77 34l-100 -2l-14 3l2 86h84l205 -10q76 -3 196 10l18 -2q6 -38 6 -51q0 -7 -4 -31q-45 -12 -84 -13q-73 -11 -79 -17q-15 -15 -15 -41 |
| | | q0 -7 1.5 -27t1.5 -31q8 -19 22 -396q6 -195 -15 -304q-15 -76 -41 -122q-38 -65 -112 -123q-75 -57 -182 -89q-109 -33 -255 -33q-167 0 -284 46q-119 47 -179 122q-61 76 -83 195q-16 80 -16 237v333q0 188 -17 213q-25 36 -147 39zM1536 -96v64q0 14 -9 23t-23 9h-1472 |
| | | q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h1472q14 0 23 9t9 23z" /> |
| | | <glyph glyph-name="table" unicode="" horiz-adv-x="1664" |
| | | d="M512 160v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM512 544v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1024 160v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23 |
| | | v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM512 928v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1024 544v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1536 160v192 |
| | | q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1024 928v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1536 544v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192 |
| | | q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1536 928v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1664 1248v-1088q0 -66 -47 -113t-113 -47h-1344q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h1344q66 0 113 -47t47 -113 |
| | | z" /> |
| | | <glyph glyph-name="magic" unicode="" horiz-adv-x="1664" |
| | | d="M1190 955l293 293l-107 107l-293 -293zM1637 1248q0 -27 -18 -45l-1286 -1286q-18 -18 -45 -18t-45 18l-198 198q-18 18 -18 45t18 45l1286 1286q18 18 45 18t45 -18l198 -198q18 -18 18 -45zM286 1438l98 -30l-98 -30l-30 -98l-30 98l-98 30l98 30l30 98zM636 1276 |
| | | l196 -60l-196 -60l-60 -196l-60 196l-196 60l196 60l60 196zM1566 798l98 -30l-98 -30l-30 -98l-30 98l-98 30l98 30l30 98zM926 1438l98 -30l-98 -30l-30 -98l-30 98l-98 30l98 30l30 98z" /> |
| | | <glyph glyph-name="truck" unicode="" horiz-adv-x="1792" |
| | | d="M640 128q0 52 -38 90t-90 38t-90 -38t-38 -90t38 -90t90 -38t90 38t38 90zM256 640h384v256h-158q-13 0 -22 -9l-195 -195q-9 -9 -9 -22v-30zM1536 128q0 52 -38 90t-90 38t-90 -38t-38 -90t38 -90t90 -38t90 38t38 90zM1792 1216v-1024q0 -15 -4 -26.5t-13.5 -18.5 |
| | | t-16.5 -11.5t-23.5 -6t-22.5 -2t-25.5 0t-22.5 0.5q0 -106 -75 -181t-181 -75t-181 75t-75 181h-384q0 -106 -75 -181t-181 -75t-181 75t-75 181h-64q-3 0 -22.5 -0.5t-25.5 0t-22.5 2t-23.5 6t-16.5 11.5t-13.5 18.5t-4 26.5q0 26 19 45t45 19v320q0 8 -0.5 35t0 38 |
| | | t2.5 34.5t6.5 37t14 30.5t22.5 30l198 198q19 19 50.5 32t58.5 13h160v192q0 26 19 45t45 19h1024q26 0 45 -19t19 -45z" /> |
| | | <glyph glyph-name="pinterest" unicode="" |
| | | d="M1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103q-111 0 -218 32q59 93 78 164q9 34 54 211q20 -39 73 -67.5t114 -28.5q121 0 216 68.5t147 188.5t52 270q0 114 -59.5 214t-172.5 163t-255 63q-105 0 -196 -29t-154.5 -77t-109 -110.5t-67 -129.5t-21.5 -134 |
| | | q0 -104 40 -183t117 -111q30 -12 38 20q2 7 8 31t8 30q6 23 -11 43q-51 61 -51 151q0 151 104.5 259.5t273.5 108.5q151 0 235.5 -82t84.5 -213q0 -170 -68.5 -289t-175.5 -119q-61 0 -98 43.5t-23 104.5q8 35 26.5 93.5t30 103t11.5 75.5q0 50 -27 83t-77 33 |
| | | q-62 0 -105 -57t-43 -142q0 -73 25 -122l-99 -418q-17 -70 -13 -177q-206 91 -333 281t-127 423q0 209 103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> |
| | | <glyph glyph-name="pinterest_sign" unicode="" |
| | | d="M1248 1408q119 0 203.5 -84.5t84.5 -203.5v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-725q85 122 108 210q9 34 53 209q21 -39 73.5 -67t112.5 -28q181 0 295.5 147.5t114.5 373.5q0 84 -35 162.5t-96.5 139t-152.5 97t-197 36.5q-104 0 -194.5 -28.5t-153 -76.5 |
| | | t-107.5 -109.5t-66.5 -128t-21.5 -132.5q0 -102 39.5 -180t116.5 -110q13 -5 23.5 0t14.5 19q10 44 15 61q6 23 -11 42q-50 62 -50 150q0 150 103.5 256.5t270.5 106.5q149 0 232.5 -81t83.5 -210q0 -168 -67.5 -286t-173.5 -118q-60 0 -97 43.5t-23 103.5q8 34 26.5 92.5 |
| | | t29.5 102t11 74.5q0 49 -26.5 81.5t-75.5 32.5q-61 0 -103.5 -56.5t-42.5 -139.5q0 -72 24 -121l-98 -414q-24 -100 -7 -254h-183q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960z" /> |
| | | <glyph glyph-name="google_plus_sign" unicode="" |
| | | d="M917 631q0 26 -6 64h-362v-132h217q-3 -24 -16.5 -50t-37.5 -53t-66.5 -44.5t-96.5 -17.5q-99 0 -169 71t-70 171t70 171t169 71q92 0 153 -59l104 101q-108 100 -257 100q-160 0 -272 -112.5t-112 -271.5t112 -271.5t272 -112.5q165 0 266.5 105t101.5 270zM1262 585 |
| | | h109v110h-109v110h-110v-110h-110v-110h110v-110h110v110zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> |
| | | <glyph glyph-name="google_plus" unicode="" horiz-adv-x="2304" |
| | | d="M1437 623q0 -208 -87 -370.5t-248 -254t-369 -91.5q-149 0 -285 58t-234 156t-156 234t-58 285t58 285t156 234t234 156t285 58q286 0 491 -192l-199 -191q-117 113 -292 113q-123 0 -227.5 -62t-165.5 -168.5t-61 -232.5t61 -232.5t165.5 -168.5t227.5 -62 |
| | | q83 0 152.5 23t114.5 57.5t78.5 78.5t49 83t21.5 74h-416v252h692q12 -63 12 -122zM2304 745v-210h-209v-209h-210v209h-209v210h209v209h210v-209h209z" /> |
| | | <glyph glyph-name="money" unicode="" horiz-adv-x="1920" |
| | | d="M768 384h384v96h-128v448h-114l-148 -137l77 -80q42 37 55 57h2v-288h-128v-96zM1280 640q0 -70 -21 -142t-59.5 -134t-101.5 -101t-138 -39t-138 39t-101.5 101t-59.5 134t-21 142t21 142t59.5 134t101.5 101t138 39t138 -39t101.5 -101t59.5 -134t21 -142zM1792 384 |
| | | v512q-106 0 -181 75t-75 181h-1152q0 -106 -75 -181t-181 -75v-512q106 0 181 -75t75 -181h1152q0 106 75 181t181 75zM1920 1216v-1152q0 -26 -19 -45t-45 -19h-1792q-26 0 -45 19t-19 45v1152q0 26 19 45t45 19h1792q26 0 45 -19t19 -45z" /> |
| | | <glyph glyph-name="caret_down" unicode="" horiz-adv-x="1024" |
| | | d="M1024 832q0 -26 -19 -45l-448 -448q-19 -19 -45 -19t-45 19l-448 448q-19 19 -19 45t19 45t45 19h896q26 0 45 -19t19 -45z" /> |
| | | <glyph glyph-name="caret_up" unicode="" horiz-adv-x="1024" |
| | | d="M1024 320q0 -26 -19 -45t-45 -19h-896q-26 0 -45 19t-19 45t19 45l448 448q19 19 45 19t45 -19l448 -448q19 -19 19 -45z" /> |
| | | <glyph glyph-name="caret_left" unicode="" horiz-adv-x="640" |
| | | d="M640 1088v-896q0 -26 -19 -45t-45 -19t-45 19l-448 448q-19 19 -19 45t19 45l448 448q19 19 45 19t45 -19t19 -45z" /> |
| | | <glyph glyph-name="caret_right" unicode="" horiz-adv-x="640" |
| | | d="M576 640q0 -26 -19 -45l-448 -448q-19 -19 -45 -19t-45 19t-19 45v896q0 26 19 45t45 19t45 -19l448 -448q19 -19 19 -45z" /> |
| | | <glyph glyph-name="columns" unicode="" horiz-adv-x="1664" |
| | | d="M160 0h608v1152h-640v-1120q0 -13 9.5 -22.5t22.5 -9.5zM1536 32v1120h-640v-1152h608q13 0 22.5 9.5t9.5 22.5zM1664 1248v-1216q0 -66 -47 -113t-113 -47h-1344q-66 0 -113 47t-47 113v1216q0 66 47 113t113 47h1344q66 0 113 -47t47 -113z" /> |
| | | <glyph glyph-name="sort" unicode="" horiz-adv-x="1024" |
| | | d="M1024 448q0 -26 -19 -45l-448 -448q-19 -19 -45 -19t-45 19l-448 448q-19 19 -19 45t19 45t45 19h896q26 0 45 -19t19 -45zM1024 832q0 -26 -19 -45t-45 -19h-896q-26 0 -45 19t-19 45t19 45l448 448q19 19 45 19t45 -19l448 -448q19 -19 19 -45z" /> |
| | | <glyph glyph-name="sort_down" unicode="" horiz-adv-x="1024" |
| | | d="M1024 448q0 -26 -19 -45l-448 -448q-19 -19 -45 -19t-45 19l-448 448q-19 19 -19 45t19 45t45 19h896q26 0 45 -19t19 -45z" /> |
| | | <glyph glyph-name="sort_up" unicode="" horiz-adv-x="1024" |
| | | d="M1024 832q0 -26 -19 -45t-45 -19h-896q-26 0 -45 19t-19 45t19 45l448 448q19 19 45 19t45 -19l448 -448q19 -19 19 -45z" /> |
| | | <glyph glyph-name="envelope_alt" unicode="" horiz-adv-x="1792" |
| | | d="M1792 826v-794q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v794q44 -49 101 -87q362 -246 497 -345q57 -42 92.5 -65.5t94.5 -48t110 -24.5h1h1q51 0 110 24.5t94.5 48t92.5 65.5q170 123 498 345q57 39 100 87zM1792 1120q0 -79 -49 -151t-122 -123 |
| | | q-376 -261 -468 -325q-10 -7 -42.5 -30.5t-54 -38t-52 -32.5t-57.5 -27t-50 -9h-1h-1q-23 0 -50 9t-57.5 27t-52 32.5t-54 38t-42.5 30.5q-91 64 -262 182.5t-205 142.5q-62 42 -117 115.5t-55 136.5q0 78 41.5 130t118.5 52h1472q65 0 112.5 -47t47.5 -113z" /> |
| | | <glyph glyph-name="linkedin" unicode="" |
| | | d="M349 911v-991h-330v991h330zM370 1217q1 -73 -50.5 -122t-135.5 -49h-2q-82 0 -132 49t-50 122q0 74 51.5 122.5t134.5 48.5t133 -48.5t51 -122.5zM1536 488v-568h-329v530q0 105 -40.5 164.5t-126.5 59.5q-63 0 -105.5 -34.5t-63.5 -85.5q-11 -30 -11 -81v-553h-329 |
| | | q2 399 2 647t-1 296l-1 48h329v-144h-2q20 32 41 56t56.5 52t87 43.5t114.5 15.5q171 0 275 -113.5t104 -332.5z" /> |
| | | <glyph glyph-name="undo" unicode="" |
| | | d="M1536 640q0 -156 -61 -298t-164 -245t-245 -164t-298 -61q-172 0 -327 72.5t-264 204.5q-7 10 -6.5 22.5t8.5 20.5l137 138q10 9 25 9q16 -2 23 -12q73 -95 179 -147t225 -52q104 0 198.5 40.5t163.5 109.5t109.5 163.5t40.5 198.5t-40.5 198.5t-109.5 163.5 |
| | | t-163.5 109.5t-198.5 40.5q-98 0 -188 -35.5t-160 -101.5l137 -138q31 -30 14 -69q-17 -40 -59 -40h-448q-26 0 -45 19t-19 45v448q0 42 40 59q39 17 69 -14l130 -129q107 101 244.5 156.5t284.5 55.5q156 0 298 -61t245 -164t164 -245t61 -298z" /> |
| | | <glyph glyph-name="legal" unicode="" horiz-adv-x="1792" |
| | | d="M1771 0q0 -53 -37 -90l-107 -108q-39 -37 -91 -37q-53 0 -90 37l-363 364q-38 36 -38 90q0 53 43 96l-256 256l-126 -126q-14 -14 -34 -14t-34 14q2 -2 12.5 -12t12.5 -13t10 -11.5t10 -13.5t6 -13.5t5.5 -16.5t1.5 -18q0 -38 -28 -68q-3 -3 -16.5 -18t-19 -20.5 |
| | | t-18.5 -16.5t-22 -15.5t-22 -9t-26 -4.5q-40 0 -68 28l-408 408q-28 28 -28 68q0 13 4.5 26t9 22t15.5 22t16.5 18.5t20.5 19t18 16.5q30 28 68 28q10 0 18 -1.5t16.5 -5.5t13.5 -6t13.5 -10t11.5 -10t13 -12.5t12 -12.5q-14 14 -14 34t14 34l348 348q14 14 34 14t34 -14 |
| | | q-2 2 -12.5 12t-12.5 13t-10 11.5t-10 13.5t-6 13.5t-5.5 16.5t-1.5 18q0 38 28 68q3 3 16.5 18t19 20.5t18.5 16.5t22 15.5t22 9t26 4.5q40 0 68 -28l408 -408q28 -28 28 -68q0 -13 -4.5 -26t-9 -22t-15.5 -22t-16.5 -18.5t-20.5 -19t-18 -16.5q-30 -28 -68 -28 |
| | | q-10 0 -18 1.5t-16.5 5.5t-13.5 6t-13.5 10t-11.5 10t-13 12.5t-12 12.5q14 -14 14 -34t-14 -34l-126 -126l256 -256q43 43 96 43q52 0 91 -37l363 -363q37 -39 37 -91z" /> |
| | | <glyph glyph-name="dashboard" unicode="" horiz-adv-x="1792" |
| | | d="M384 384q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM576 832q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1004 351l101 382q6 26 -7.5 48.5t-38.5 29.5 |
| | | t-48 -6.5t-30 -39.5l-101 -382q-60 -5 -107 -43.5t-63 -98.5q-20 -77 20 -146t117 -89t146 20t89 117q16 60 -6 117t-72 91zM1664 384q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1024 1024q0 53 -37.5 90.5 |
| | | t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1472 832q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1792 384q0 -261 -141 -483q-19 -29 -54 -29h-1402q-35 0 -54 29 |
| | | q-141 221 -141 483q0 182 71 348t191 286t286 191t348 71t348 -71t286 -191t191 -286t71 -348z" /> |
| | | <glyph glyph-name="comment_alt" unicode="" horiz-adv-x="1792" |
| | | d="M896 1152q-204 0 -381.5 -69.5t-282 -187.5t-104.5 -255q0 -112 71.5 -213.5t201.5 -175.5l87 -50l-27 -96q-24 -91 -70 -172q152 63 275 171l43 38l57 -6q69 -8 130 -8q204 0 381.5 69.5t282 187.5t104.5 255t-104.5 255t-282 187.5t-381.5 69.5zM1792 640 |
| | | q0 -174 -120 -321.5t-326 -233t-450 -85.5q-70 0 -145 8q-198 -175 -460 -242q-49 -14 -114 -22h-5q-15 0 -27 10.5t-16 27.5v1q-3 4 -0.5 12t2 10t4.5 9.5l6 9t7 8.5t8 9q7 8 31 34.5t34.5 38t31 39.5t32.5 51t27 59t26 76q-157 89 -247.5 220t-90.5 281q0 174 120 321.5 |
| | | t326 233t450 85.5t450 -85.5t326 -233t120 -321.5z" /> |
| | | <glyph glyph-name="comments_alt" unicode="" horiz-adv-x="1792" |
| | | d="M704 1152q-153 0 -286 -52t-211.5 -141t-78.5 -191q0 -82 53 -158t149 -132l97 -56l-35 -84q34 20 62 39l44 31l53 -10q78 -14 153 -14q153 0 286 52t211.5 141t78.5 191t-78.5 191t-211.5 141t-286 52zM704 1280q191 0 353.5 -68.5t256.5 -186.5t94 -257t-94 -257 |
| | | t-256.5 -186.5t-353.5 -68.5q-86 0 -176 16q-124 -88 -278 -128q-36 -9 -86 -16h-3q-11 0 -20.5 8t-11.5 21q-1 3 -1 6.5t0.5 6.5t2 6l2.5 5t3.5 5.5t4 5t4.5 5t4 4.5q5 6 23 25t26 29.5t22.5 29t25 38.5t20.5 44q-124 72 -195 177t-71 224q0 139 94 257t256.5 186.5 |
| | | t353.5 68.5zM1526 111q10 -24 20.5 -44t25 -38.5t22.5 -29t26 -29.5t23 -25q1 -1 4 -4.5t4.5 -5t4 -5t3.5 -5.5l2.5 -5t2 -6t0.5 -6.5t-1 -6.5q-3 -14 -13 -22t-22 -7q-50 7 -86 16q-154 40 -278 128q-90 -16 -176 -16q-271 0 -472 132q58 -4 88 -4q161 0 309 45t264 129 |
| | | q125 92 192 212t67 254q0 77 -23 152q129 -71 204 -178t75 -230q0 -120 -71 -224.5t-195 -176.5z" /> |
| | | <glyph glyph-name="bolt" unicode="" horiz-adv-x="896" |
| | | d="M885 970q18 -20 7 -44l-540 -1157q-13 -25 -42 -25q-4 0 -14 2q-17 5 -25.5 19t-4.5 30l197 808l-406 -101q-4 -1 -12 -1q-18 0 -31 11q-18 15 -13 39l201 825q4 14 16 23t28 9h328q19 0 32 -12.5t13 -29.5q0 -8 -5 -18l-171 -463l396 98q8 2 12 2q19 0 34 -15z" /> |
| | | <glyph glyph-name="sitemap" unicode="" horiz-adv-x="1792" |
| | | d="M1792 288v-320q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v320q0 40 28 68t68 28h96v192h-512v-192h96q40 0 68 -28t28 -68v-320q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v320q0 40 28 68t68 28h96v192h-512v-192h96q40 0 68 -28t28 -68v-320 |
| | | q0 -40 -28 -68t-68 -28h-320q-40 0 -68 28t-28 68v320q0 40 28 68t68 28h96v192q0 52 38 90t90 38h512v192h-96q-40 0 -68 28t-28 68v320q0 40 28 68t68 28h320q40 0 68 -28t28 -68v-320q0 -40 -28 -68t-68 -28h-96v-192h512q52 0 90 -38t38 -90v-192h96q40 0 68 -28t28 -68 |
| | | z" /> |
| | | <glyph glyph-name="umbrella" unicode="" horiz-adv-x="1664" |
| | | d="M896 708v-580q0 -104 -76 -180t-180 -76t-180 76t-76 180q0 26 19 45t45 19t45 -19t19 -45q0 -50 39 -89t89 -39t89 39t39 89v580q33 11 64 11t64 -11zM1664 681q0 -13 -9.5 -22.5t-22.5 -9.5q-11 0 -23 10q-49 46 -93 69t-102 23q-68 0 -128 -37t-103 -97 |
| | | q-7 -10 -17.5 -28t-14.5 -24q-11 -17 -28 -17q-18 0 -29 17q-4 6 -14.5 24t-17.5 28q-43 60 -102.5 97t-127.5 37t-127.5 -37t-102.5 -97q-7 -10 -17.5 -28t-14.5 -24q-11 -17 -29 -17q-17 0 -28 17q-4 6 -14.5 24t-17.5 28q-43 60 -103 97t-128 37q-58 0 -102 -23t-93 -69 |
| | | q-12 -10 -23 -10q-13 0 -22.5 9.5t-9.5 22.5q0 5 1 7q45 183 172.5 319.5t298 204.5t360.5 68q140 0 274.5 -40t246.5 -113.5t194.5 -187t115.5 -251.5q1 -2 1 -7zM896 1408v-98q-42 2 -64 2t-64 -2v98q0 26 19 45t45 19t45 -19t19 -45z" /> |
| | | <glyph glyph-name="paste" unicode="" horiz-adv-x="1792" |
| | | d="M768 -128h896v640h-416q-40 0 -68 28t-28 68v416h-384v-1152zM1024 1312v64q0 13 -9.5 22.5t-22.5 9.5h-704q-13 0 -22.5 -9.5t-9.5 -22.5v-64q0 -13 9.5 -22.5t22.5 -9.5h704q13 0 22.5 9.5t9.5 22.5zM1280 640h299l-299 299v-299zM1792 512v-672q0 -40 -28 -68t-68 -28 |
| | | h-960q-40 0 -68 28t-28 68v160h-544q-40 0 -68 28t-28 68v1344q0 40 28 68t68 28h1088q40 0 68 -28t28 -68v-328q21 -13 36 -28l408 -408q28 -28 48 -76t20 -88z" /> |
| | | <glyph glyph-name="light_bulb" unicode="" horiz-adv-x="1024" |
| | | d="M736 960q0 -13 -9.5 -22.5t-22.5 -9.5t-22.5 9.5t-9.5 22.5q0 46 -54 71t-106 25q-13 0 -22.5 9.5t-9.5 22.5t9.5 22.5t22.5 9.5q50 0 99.5 -16t87 -54t37.5 -90zM896 960q0 72 -34.5 134t-90 101.5t-123 62t-136.5 22.5t-136.5 -22.5t-123 -62t-90 -101.5t-34.5 -134 |
| | | q0 -101 68 -180q10 -11 30.5 -33t30.5 -33q128 -153 141 -298h228q13 145 141 298q10 11 30.5 33t30.5 33q68 79 68 180zM1024 960q0 -155 -103 -268q-45 -49 -74.5 -87t-59.5 -95.5t-34 -107.5q47 -28 47 -82q0 -37 -25 -64q25 -27 25 -64q0 -52 -45 -81q13 -23 13 -47 |
| | | q0 -46 -31.5 -71t-77.5 -25q-20 -44 -60 -70t-87 -26t-87 26t-60 70q-46 0 -77.5 25t-31.5 71q0 24 13 47q-45 29 -45 81q0 37 25 64q-25 27 -25 64q0 54 47 82q-4 50 -34 107.5t-59.5 95.5t-74.5 87q-103 113 -103 268q0 99 44.5 184.5t117 142t164 89t186.5 32.5 |
| | | t186.5 -32.5t164 -89t117 -142t44.5 -184.5z" /> |
| | | <glyph glyph-name="exchange" unicode="" horiz-adv-x="1792" |
| | | d="M1792 352v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-1376v-192q0 -13 -9.5 -22.5t-22.5 -9.5q-12 0 -24 10l-319 320q-9 9 -9 22q0 14 9 23l320 320q9 9 23 9q13 0 22.5 -9.5t9.5 -22.5v-192h1376q13 0 22.5 -9.5t9.5 -22.5zM1792 896q0 -14 -9 -23l-320 -320q-9 -9 -23 -9 |
| | | q-13 0 -22.5 9.5t-9.5 22.5v192h-1376q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h1376v192q0 14 9 23t23 9q12 0 24 -10l319 -319q9 -9 9 -23z" /> |
| | | <glyph glyph-name="cloud_download" unicode="" horiz-adv-x="1920" |
| | | d="M1280 608q0 14 -9 23t-23 9h-224v352q0 13 -9.5 22.5t-22.5 9.5h-192q-13 0 -22.5 -9.5t-9.5 -22.5v-352h-224q-13 0 -22.5 -9.5t-9.5 -22.5q0 -14 9 -23l352 -352q9 -9 23 -9t23 9l351 351q10 12 10 24zM1920 384q0 -159 -112.5 -271.5t-271.5 -112.5h-1088 |
| | | q-185 0 -316.5 131.5t-131.5 316.5q0 130 70 240t188 165q-2 30 -2 43q0 212 150 362t362 150q156 0 285.5 -87t188.5 -231q71 62 166 62q106 0 181 -75t75 -181q0 -76 -41 -138q130 -31 213.5 -135.5t83.5 -238.5z" /> |
| | | <glyph glyph-name="cloud_upload" unicode="" horiz-adv-x="1920" |
| | | d="M1280 672q0 14 -9 23l-352 352q-9 9 -23 9t-23 -9l-351 -351q-10 -12 -10 -24q0 -14 9 -23t23 -9h224v-352q0 -13 9.5 -22.5t22.5 -9.5h192q13 0 22.5 9.5t9.5 22.5v352h224q13 0 22.5 9.5t9.5 22.5zM1920 384q0 -159 -112.5 -271.5t-271.5 -112.5h-1088 |
| | | q-185 0 -316.5 131.5t-131.5 316.5q0 130 70 240t188 165q-2 30 -2 43q0 212 150 362t362 150q156 0 285.5 -87t188.5 -231q71 62 166 62q106 0 181 -75t75 -181q0 -76 -41 -138q130 -31 213.5 -135.5t83.5 -238.5z" /> |
| | | <glyph glyph-name="user_md" unicode="" horiz-adv-x="1408" |
| | | d="M384 192q0 -26 -19 -45t-45 -19t-45 19t-19 45t19 45t45 19t45 -19t19 -45zM1408 131q0 -121 -73 -190t-194 -69h-874q-121 0 -194 69t-73 190q0 68 5.5 131t24 138t47.5 132.5t81 103t120 60.5q-22 -52 -22 -120v-203q-58 -20 -93 -70t-35 -111q0 -80 56 -136t136 -56 |
| | | t136 56t56 136q0 61 -35.5 111t-92.5 70v203q0 62 25 93q132 -104 295 -104t295 104q25 -31 25 -93v-64q-106 0 -181 -75t-75 -181v-89q-32 -29 -32 -71q0 -40 28 -68t68 -28t68 28t28 68q0 42 -32 71v89q0 52 38 90t90 38t90 -38t38 -90v-89q-32 -29 -32 -71q0 -40 28 -68 |
| | | t68 -28t68 28t28 68q0 42 -32 71v89q0 68 -34.5 127.5t-93.5 93.5q0 10 0.5 42.5t0 48t-2.5 41.5t-7 47t-13 40q68 -15 120 -60.5t81 -103t47.5 -132.5t24 -138t5.5 -131zM1088 1024q0 -159 -112.5 -271.5t-271.5 -112.5t-271.5 112.5t-112.5 271.5t112.5 271.5t271.5 112.5 |
| | | t271.5 -112.5t112.5 -271.5z" /> |
| | | <glyph glyph-name="stethoscope" unicode="" horiz-adv-x="1408" |
| | | d="M1280 832q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1408 832q0 -62 -35.5 -111t-92.5 -70v-395q0 -159 -131.5 -271.5t-316.5 -112.5t-316.5 112.5t-131.5 271.5v132q-164 20 -274 128t-110 252v512q0 26 19 45t45 19q6 0 16 -2q17 30 47 48 |
| | | t65 18q53 0 90.5 -37.5t37.5 -90.5t-37.5 -90.5t-90.5 -37.5q-33 0 -64 18v-402q0 -106 94 -181t226 -75t226 75t94 181v402q-31 -18 -64 -18q-53 0 -90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5q35 0 65 -18t47 -48q10 2 16 2q26 0 45 -19t19 -45v-512q0 -144 -110 -252 |
| | | t-274 -128v-132q0 -106 94 -181t226 -75t226 75t94 181v395q-57 21 -92.5 70t-35.5 111q0 80 56 136t136 56t136 -56t56 -136z" /> |
| | | <glyph glyph-name="suitcase" unicode="" horiz-adv-x="1792" |
| | | d="M640 1152h512v128h-512v-128zM288 1152v-1280h-64q-92 0 -158 66t-66 158v832q0 92 66 158t158 66h64zM1408 1152v-1280h-1024v1280h128v160q0 40 28 68t68 28h576q40 0 68 -28t28 -68v-160h128zM1792 928v-832q0 -92 -66 -158t-158 -66h-64v1280h64q92 0 158 -66 |
| | | t66 -158z" /> |
| | | <glyph glyph-name="bell_alt" unicode="" horiz-adv-x="1792" |
| | | d="M912 -160q0 16 -16 16q-59 0 -101.5 42.5t-42.5 101.5q0 16 -16 16t-16 -16q0 -73 51.5 -124.5t124.5 -51.5q16 0 16 16zM1728 128q0 -52 -38 -90t-90 -38h-448q0 -106 -75 -181t-181 -75t-181 75t-75 181h-448q-52 0 -90 38t-38 90q50 42 91 88t85 119.5t74.5 158.5 |
| | | t50 206t19.5 260q0 152 117 282.5t307 158.5q-8 19 -8 39q0 40 28 68t68 28t68 -28t28 -68q0 -20 -8 -39q190 -28 307 -158.5t117 -282.5q0 -139 19.5 -260t50 -206t74.5 -158.5t85 -119.5t91 -88z" /> |
| | | <glyph glyph-name="coffee" unicode="" horiz-adv-x="1920" |
| | | d="M1664 896q0 80 -56 136t-136 56h-64v-384h64q80 0 136 56t56 136zM0 128h1792q0 -106 -75 -181t-181 -75h-1280q-106 0 -181 75t-75 181zM1856 896q0 -159 -112.5 -271.5t-271.5 -112.5h-64v-32q0 -92 -66 -158t-158 -66h-704q-92 0 -158 66t-66 158v736q0 26 19 45 |
| | | t45 19h1152q159 0 271.5 -112.5t112.5 -271.5z" /> |
| | | <glyph glyph-name="food" unicode="" horiz-adv-x="1408" |
| | | d="M640 1472v-640q0 -61 -35.5 -111t-92.5 -70v-779q0 -52 -38 -90t-90 -38h-128q-52 0 -90 38t-38 90v779q-57 20 -92.5 70t-35.5 111v640q0 26 19 45t45 19t45 -19t19 -45v-416q0 -26 19 -45t45 -19t45 19t19 45v416q0 26 19 45t45 19t45 -19t19 -45v-416q0 -26 19 -45 |
| | | t45 -19t45 19t19 45v416q0 26 19 45t45 19t45 -19t19 -45zM1408 1472v-1600q0 -52 -38 -90t-90 -38h-128q-52 0 -90 38t-38 90v512h-224q-13 0 -22.5 9.5t-9.5 22.5v800q0 132 94 226t226 94h256q26 0 45 -19t19 -45z" /> |
| | | <glyph glyph-name="file_text_alt" unicode="" |
| | | d="M1468 1156q28 -28 48 -76t20 -88v-1152q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h896q40 0 88 -20t76 -48zM1024 1400v-376h376q-10 29 -22 41l-313 313q-12 12 -41 22zM1408 -128v1024h-416q-40 0 -68 28t-28 68v416h-768v-1536h1280z |
| | | M384 736q0 14 9 23t23 9h704q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-704q-14 0 -23 9t-9 23v64zM1120 512q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-704q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h704zM1120 256q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-704 |
| | | q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h704z" /> |
| | | <glyph glyph-name="building" unicode="" horiz-adv-x="1408" |
| | | d="M384 224v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z |
| | | M640 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z |
| | | M1152 224v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM896 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z |
| | | M640 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 992v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z |
| | | M1152 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM896 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z |
| | | M640 992v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 1248v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z |
| | | M1152 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM896 992v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z |
| | | M640 1248v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM1152 992v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z |
| | | M896 1248v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM1152 1248v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z |
| | | M896 -128h384v1536h-1152v-1536h384v224q0 13 9.5 22.5t22.5 9.5h320q13 0 22.5 -9.5t9.5 -22.5v-224zM1408 1472v-1664q0 -26 -19 -45t-45 -19h-1280q-26 0 -45 19t-19 45v1664q0 26 19 45t45 19h1280q26 0 45 -19t19 -45z" /> |
| | | <glyph glyph-name="hospital" unicode="" horiz-adv-x="1408" |
| | | d="M384 224v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z |
| | | M640 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM384 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z |
| | | M1152 224v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM896 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z |
| | | M640 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM1152 480v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z |
| | | M896 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5zM1152 736v-64q0 -13 -9.5 -22.5t-22.5 -9.5h-64q-13 0 -22.5 9.5t-9.5 22.5v64q0 13 9.5 22.5t22.5 9.5h64q13 0 22.5 -9.5t9.5 -22.5z |
| | | M896 -128h384v1152h-256v-32q0 -40 -28 -68t-68 -28h-448q-40 0 -68 28t-28 68v32h-256v-1152h384v224q0 13 9.5 22.5t22.5 9.5h320q13 0 22.5 -9.5t9.5 -22.5v-224zM896 1056v320q0 13 -9.5 22.5t-22.5 9.5h-64q-13 0 -22.5 -9.5t-9.5 -22.5v-96h-128v96q0 13 -9.5 22.5 |
| | | t-22.5 9.5h-64q-13 0 -22.5 -9.5t-9.5 -22.5v-320q0 -13 9.5 -22.5t22.5 -9.5h64q13 0 22.5 9.5t9.5 22.5v96h128v-96q0 -13 9.5 -22.5t22.5 -9.5h64q13 0 22.5 9.5t9.5 22.5zM1408 1088v-1280q0 -26 -19 -45t-45 -19h-1280q-26 0 -45 19t-19 45v1280q0 26 19 45t45 19h320 |
| | | v288q0 40 28 68t68 28h448q40 0 68 -28t28 -68v-288h320q26 0 45 -19t19 -45z" /> |
| | | <glyph glyph-name="ambulance" unicode="" horiz-adv-x="1920" |
| | | d="M640 128q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM256 640h384v256h-158q-14 -2 -22 -9l-195 -195q-7 -12 -9 -22v-30zM1536 128q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5 |
| | | t90.5 37.5t37.5 90.5zM1664 800v192q0 14 -9 23t-23 9h-224v224q0 14 -9 23t-23 9h-192q-14 0 -23 -9t-9 -23v-224h-224q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h224v-224q0 -14 9 -23t23 -9h192q14 0 23 9t9 23v224h224q14 0 23 9t9 23zM1920 1344v-1152 |
| | | q0 -26 -19 -45t-45 -19h-192q0 -106 -75 -181t-181 -75t-181 75t-75 181h-384q0 -106 -75 -181t-181 -75t-181 75t-75 181h-128q-26 0 -45 19t-19 45t19 45t45 19v416q0 26 13 58t32 51l198 198q19 19 51 32t58 13h160v320q0 26 19 45t45 19h1152q26 0 45 -19t19 -45z" /> |
| | | <glyph glyph-name="medkit" unicode="" horiz-adv-x="1792" |
| | | d="M1280 416v192q0 14 -9 23t-23 9h-224v224q0 14 -9 23t-23 9h-192q-14 0 -23 -9t-9 -23v-224h-224q-14 0 -23 -9t-9 -23v-192q0 -14 9 -23t23 -9h224v-224q0 -14 9 -23t23 -9h192q14 0 23 9t9 23v224h224q14 0 23 9t9 23zM640 1152h512v128h-512v-128zM256 1152v-1280h-32 |
| | | q-92 0 -158 66t-66 158v832q0 92 66 158t158 66h32zM1440 1152v-1280h-1088v1280h160v160q0 40 28 68t68 28h576q40 0 68 -28t28 -68v-160h160zM1792 928v-832q0 -92 -66 -158t-158 -66h-32v1280h32q92 0 158 -66t66 -158z" /> |
| | | <glyph glyph-name="fighter_jet" unicode="" horiz-adv-x="1920" |
| | | d="M1920 576q-1 -32 -288 -96l-352 -32l-224 -64h-64l-293 -352h69q26 0 45 -4.5t19 -11.5t-19 -11.5t-45 -4.5h-96h-160h-64v32h64v416h-160l-192 -224h-96l-32 32v192h32v32h128v8l-192 24v128l192 24v8h-128v32h-32v192l32 32h96l192 -224h160v416h-64v32h64h160h96 |
| | | q26 0 45 -4.5t19 -11.5t-19 -11.5t-45 -4.5h-69l293 -352h64l224 -64l352 -32q128 -28 200 -52t80 -34z" /> |
| | | <glyph glyph-name="beer" unicode="" horiz-adv-x="1664" |
| | | d="M640 640v384h-256v-256q0 -53 37.5 -90.5t90.5 -37.5h128zM1664 192v-192h-1152v192l128 192h-128q-159 0 -271.5 112.5t-112.5 271.5v320l-64 64l32 128h480l32 128h960l32 -192l-64 -32v-800z" /> |
| | | <glyph glyph-name="h_sign" unicode="" |
| | | d="M1280 192v896q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-320h-512v320q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-896q0 -26 19 -45t45 -19h128q26 0 45 19t19 45v320h512v-320q0 -26 19 -45t45 -19h128q26 0 45 19t19 45zM1536 1120v-960 |
| | | q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> |
| | | <glyph glyph-name="f0fe" unicode="" |
| | | d="M1280 576v128q0 26 -19 45t-45 19h-320v320q0 26 -19 45t-45 19h-128q-26 0 -45 -19t-19 -45v-320h-320q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h320v-320q0 -26 19 -45t45 -19h128q26 0 45 19t19 45v320h320q26 0 45 19t19 45zM1536 1120v-960 |
| | | q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> |
| | | <glyph glyph-name="double_angle_left" unicode="" horiz-adv-x="1024" |
| | | d="M627 160q0 -13 -10 -23l-50 -50q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23t10 23l466 466q10 10 23 10t23 -10l50 -50q10 -10 10 -23t-10 -23l-393 -393l393 -393q10 -10 10 -23zM1011 160q0 -13 -10 -23l-50 -50q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23 |
| | | t10 23l466 466q10 10 23 10t23 -10l50 -50q10 -10 10 -23t-10 -23l-393 -393l393 -393q10 -10 10 -23z" /> |
| | | <glyph glyph-name="double_angle_right" unicode="" horiz-adv-x="1024" |
| | | d="M595 576q0 -13 -10 -23l-466 -466q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l393 393l-393 393q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l466 -466q10 -10 10 -23zM979 576q0 -13 -10 -23l-466 -466q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23 |
| | | l393 393l-393 393q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l466 -466q10 -10 10 -23z" /> |
| | | <glyph glyph-name="double_angle_up" unicode="" horiz-adv-x="1152" |
| | | d="M1075 224q0 -13 -10 -23l-50 -50q-10 -10 -23 -10t-23 10l-393 393l-393 -393q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l466 466q10 10 23 10t23 -10l466 -466q10 -10 10 -23zM1075 608q0 -13 -10 -23l-50 -50q-10 -10 -23 -10t-23 10l-393 393l-393 -393 |
| | | q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l466 466q10 10 23 10t23 -10l466 -466q10 -10 10 -23z" /> |
| | | <glyph glyph-name="double_angle_down" unicode="" horiz-adv-x="1152" |
| | | d="M1075 672q0 -13 -10 -23l-466 -466q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l393 -393l393 393q10 10 23 10t23 -10l50 -50q10 -10 10 -23zM1075 1056q0 -13 -10 -23l-466 -466q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23 |
| | | t10 23l50 50q10 10 23 10t23 -10l393 -393l393 393q10 10 23 10t23 -10l50 -50q10 -10 10 -23z" /> |
| | | <glyph glyph-name="angle_left" unicode="" horiz-adv-x="640" |
| | | d="M627 992q0 -13 -10 -23l-393 -393l393 -393q10 -10 10 -23t-10 -23l-50 -50q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23t10 23l466 466q10 10 23 10t23 -10l50 -50q10 -10 10 -23z" /> |
| | | <glyph glyph-name="angle_right" unicode="" horiz-adv-x="640" |
| | | d="M595 576q0 -13 -10 -23l-466 -466q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l393 393l-393 393q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l466 -466q10 -10 10 -23z" /> |
| | | <glyph glyph-name="angle_up" unicode="" horiz-adv-x="1152" |
| | | d="M1075 352q0 -13 -10 -23l-50 -50q-10 -10 -23 -10t-23 10l-393 393l-393 -393q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l466 466q10 10 23 10t23 -10l466 -466q10 -10 10 -23z" /> |
| | | <glyph glyph-name="angle_down" unicode="" horiz-adv-x="1152" |
| | | d="M1075 800q0 -13 -10 -23l-466 -466q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l393 -393l393 393q10 10 23 10t23 -10l50 -50q10 -10 10 -23z" /> |
| | | <glyph glyph-name="desktop" unicode="" horiz-adv-x="1920" |
| | | d="M1792 544v832q0 13 -9.5 22.5t-22.5 9.5h-1600q-13 0 -22.5 -9.5t-9.5 -22.5v-832q0 -13 9.5 -22.5t22.5 -9.5h1600q13 0 22.5 9.5t9.5 22.5zM1920 1376v-1088q0 -66 -47 -113t-113 -47h-544q0 -37 16 -77.5t32 -71t16 -43.5q0 -26 -19 -45t-45 -19h-512q-26 0 -45 19 |
| | | t-19 45q0 14 16 44t32 70t16 78h-544q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h1600q66 0 113 -47t47 -113z" /> |
| | | <glyph glyph-name="laptop" unicode="" horiz-adv-x="1920" |
| | | d="M416 256q-66 0 -113 47t-47 113v704q0 66 47 113t113 47h1088q66 0 113 -47t47 -113v-704q0 -66 -47 -113t-113 -47h-1088zM384 1120v-704q0 -13 9.5 -22.5t22.5 -9.5h1088q13 0 22.5 9.5t9.5 22.5v704q0 13 -9.5 22.5t-22.5 9.5h-1088q-13 0 -22.5 -9.5t-9.5 -22.5z |
| | | M1760 192h160v-96q0 -40 -47 -68t-113 -28h-1600q-66 0 -113 28t-47 68v96h160h1600zM1040 96q16 0 16 16t-16 16h-160q-16 0 -16 -16t16 -16h160z" /> |
| | | <glyph glyph-name="tablet" unicode="" horiz-adv-x="1152" |
| | | d="M640 128q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1024 288v960q0 13 -9.5 22.5t-22.5 9.5h-832q-13 0 -22.5 -9.5t-9.5 -22.5v-960q0 -13 9.5 -22.5t22.5 -9.5h832q13 0 22.5 9.5t9.5 22.5zM1152 1248v-1088q0 -66 -47 -113t-113 -47h-832 |
| | | q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h832q66 0 113 -47t47 -113z" /> |
| | | <glyph glyph-name="mobile_phone" unicode="" horiz-adv-x="768" |
| | | d="M464 128q0 33 -23.5 56.5t-56.5 23.5t-56.5 -23.5t-23.5 -56.5t23.5 -56.5t56.5 -23.5t56.5 23.5t23.5 56.5zM672 288v704q0 13 -9.5 22.5t-22.5 9.5h-512q-13 0 -22.5 -9.5t-9.5 -22.5v-704q0 -13 9.5 -22.5t22.5 -9.5h512q13 0 22.5 9.5t9.5 22.5zM480 1136 |
| | | q0 16 -16 16h-160q-16 0 -16 -16t16 -16h160q16 0 16 16zM768 1152v-1024q0 -52 -38 -90t-90 -38h-512q-52 0 -90 38t-38 90v1024q0 52 38 90t90 38h512q52 0 90 -38t38 -90z" /> |
| | | <glyph glyph-name="circle_blank" unicode="" |
| | | d="M768 1184q-148 0 -273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273t-73 273t-198 198t-273 73zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103 |
| | | t279.5 -279.5t103 -385.5z" /> |
| | | <glyph glyph-name="quote_left" unicode="" horiz-adv-x="1664" |
| | | d="M768 576v-384q0 -80 -56 -136t-136 -56h-384q-80 0 -136 56t-56 136v704q0 104 40.5 198.5t109.5 163.5t163.5 109.5t198.5 40.5h64q26 0 45 -19t19 -45v-128q0 -26 -19 -45t-45 -19h-64q-106 0 -181 -75t-75 -181v-32q0 -40 28 -68t68 -28h224q80 0 136 -56t56 -136z |
| | | M1664 576v-384q0 -80 -56 -136t-136 -56h-384q-80 0 -136 56t-56 136v704q0 104 40.5 198.5t109.5 163.5t163.5 109.5t198.5 40.5h64q26 0 45 -19t19 -45v-128q0 -26 -19 -45t-45 -19h-64q-106 0 -181 -75t-75 -181v-32q0 -40 28 -68t68 -28h224q80 0 136 -56t56 -136z" /> |
| | | <glyph glyph-name="quote_right" unicode="" horiz-adv-x="1664" |
| | | d="M768 1216v-704q0 -104 -40.5 -198.5t-109.5 -163.5t-163.5 -109.5t-198.5 -40.5h-64q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h64q106 0 181 75t75 181v32q0 40 -28 68t-68 28h-224q-80 0 -136 56t-56 136v384q0 80 56 136t136 56h384q80 0 136 -56t56 -136zM1664 1216 |
| | | v-704q0 -104 -40.5 -198.5t-109.5 -163.5t-163.5 -109.5t-198.5 -40.5h-64q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h64q106 0 181 75t75 181v32q0 40 -28 68t-68 28h-224q-80 0 -136 56t-56 136v384q0 80 56 136t136 56h384q80 0 136 -56t56 -136z" /> |
| | | <glyph glyph-name="spinner" unicode="" horiz-adv-x="1792" |
| | | d="M526 142q0 -53 -37.5 -90.5t-90.5 -37.5q-52 0 -90 38t-38 90q0 53 37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1024 -64q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM320 640q0 -53 -37.5 -90.5t-90.5 -37.5 |
| | | t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1522 142q0 -52 -38 -90t-90 -38q-53 0 -90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM558 1138q0 -66 -47 -113t-113 -47t-113 47t-47 113t47 113t113 47t113 -47t47 -113z |
| | | M1728 640q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1088 1344q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM1618 1138q0 -93 -66 -158.5t-158 -65.5q-93 0 -158.5 65.5t-65.5 158.5 |
| | | q0 92 65.5 158t158.5 66q92 0 158 -66t66 -158z" /> |
| | | <glyph glyph-name="circle" unicode="" |
| | | d="M1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> |
| | | <glyph glyph-name="reply" unicode="" horiz-adv-x="1792" |
| | | d="M1792 416q0 -166 -127 -451q-3 -7 -10.5 -24t-13.5 -30t-13 -22q-12 -17 -28 -17q-15 0 -23.5 10t-8.5 25q0 9 2.5 26.5t2.5 23.5q5 68 5 123q0 101 -17.5 181t-48.5 138.5t-80 101t-105.5 69.5t-133 42.5t-154 21.5t-175.5 6h-224v-256q0 -26 -19 -45t-45 -19t-45 19 |
| | | l-512 512q-19 19 -19 45t19 45l512 512q19 19 45 19t45 -19t19 -45v-256h224q713 0 875 -403q53 -134 53 -333z" /> |
| | | <glyph glyph-name="github_alt" unicode="" horiz-adv-x="1664" |
| | | d="M640 320q0 -40 -12.5 -82t-43 -76t-72.5 -34t-72.5 34t-43 76t-12.5 82t12.5 82t43 76t72.5 34t72.5 -34t43 -76t12.5 -82zM1280 320q0 -40 -12.5 -82t-43 -76t-72.5 -34t-72.5 34t-43 76t-12.5 82t12.5 82t43 76t72.5 34t72.5 -34t43 -76t12.5 -82zM1440 320 |
| | | q0 120 -69 204t-187 84q-41 0 -195 -21q-71 -11 -157 -11t-157 11q-152 21 -195 21q-118 0 -187 -84t-69 -204q0 -88 32 -153.5t81 -103t122 -60t140 -29.5t149 -7h168q82 0 149 7t140 29.5t122 60t81 103t32 153.5zM1664 496q0 -207 -61 -331q-38 -77 -105.5 -133t-141 -86 |
| | | t-170 -47.5t-171.5 -22t-167 -4.5q-78 0 -142 3t-147.5 12.5t-152.5 30t-137 51.5t-121 81t-86 115q-62 123 -62 331q0 237 136 396q-27 82 -27 170q0 116 51 218q108 0 190 -39.5t189 -123.5q147 35 309 35q148 0 280 -32q105 82 187 121t189 39q51 -102 51 -218 |
| | | q0 -87 -27 -168q136 -160 136 -398z" /> |
| | | <glyph glyph-name="folder_close_alt" unicode="" horiz-adv-x="1664" |
| | | d="M1536 224v704q0 40 -28 68t-68 28h-704q-40 0 -68 28t-28 68v64q0 40 -28 68t-68 28h-320q-40 0 -68 -28t-28 -68v-960q0 -40 28 -68t68 -28h1216q40 0 68 28t28 68zM1664 928v-704q0 -92 -66 -158t-158 -66h-1216q-92 0 -158 66t-66 158v960q0 92 66 158t158 66h320 |
| | | q92 0 158 -66t66 -158v-32h672q92 0 158 -66t66 -158z" /> |
| | | <glyph glyph-name="folder_open_alt" unicode="" horiz-adv-x="1920" |
| | | d="M1781 605q0 35 -53 35h-1088q-40 0 -85.5 -21.5t-71.5 -52.5l-294 -363q-18 -24 -18 -40q0 -35 53 -35h1088q40 0 86 22t71 53l294 363q18 22 18 39zM640 768h768v160q0 40 -28 68t-68 28h-576q-40 0 -68 28t-28 68v64q0 40 -28 68t-68 28h-320q-40 0 -68 -28t-28 -68 |
| | | v-853l256 315q44 53 116 87.5t140 34.5zM1909 605q0 -62 -46 -120l-295 -363q-43 -53 -116 -87.5t-140 -34.5h-1088q-92 0 -158 66t-66 158v960q0 92 66 158t158 66h320q92 0 158 -66t66 -158v-32h544q92 0 158 -66t66 -158v-160h192q54 0 99 -24.5t67 -70.5q15 -32 15 -68z |
| | | " /> |
| | | <glyph glyph-name="expand_alt" unicode="" horiz-adv-x="1792" |
| | | /> |
| | | <glyph glyph-name="collapse_alt" unicode="" horiz-adv-x="1792" |
| | | /> |
| | | <glyph glyph-name="smile" unicode="" |
| | | d="M1134 461q-37 -121 -138 -195t-228 -74t-228 74t-138 195q-8 25 4 48.5t38 31.5q25 8 48.5 -4t31.5 -38q25 -80 92.5 -129.5t151.5 -49.5t151.5 49.5t92.5 129.5q8 26 32 38t49 4t37 -31.5t4 -48.5zM640 896q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5 |
| | | t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1152 896q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1408 640q0 130 -51 248.5t-136.5 204t-204 136.5t-248.5 51t-248.5 -51t-204 -136.5t-136.5 -204t-51 -248.5 |
| | | t51 -248.5t136.5 -204t204 -136.5t248.5 -51t248.5 51t204 136.5t136.5 204t51 248.5zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> |
| | | <glyph glyph-name="frown" unicode="" |
| | | d="M1134 307q8 -25 -4 -48.5t-37 -31.5t-49 4t-32 38q-25 80 -92.5 129.5t-151.5 49.5t-151.5 -49.5t-92.5 -129.5q-8 -26 -31.5 -38t-48.5 -4q-26 8 -38 31.5t-4 48.5q37 121 138 195t228 74t228 -74t138 -195zM640 896q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5 |
| | | t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1152 896q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1408 640q0 130 -51 248.5t-136.5 204t-204 136.5t-248.5 51t-248.5 -51t-204 -136.5t-136.5 -204 |
| | | t-51 -248.5t51 -248.5t136.5 -204t204 -136.5t248.5 -51t248.5 51t204 136.5t136.5 204t51 248.5zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> |
| | | <glyph glyph-name="meh" unicode="" |
| | | d="M1152 448q0 -26 -19 -45t-45 -19h-640q-26 0 -45 19t-19 45t19 45t45 19h640q26 0 45 -19t19 -45zM640 896q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1152 896q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5 |
| | | t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1408 640q0 130 -51 248.5t-136.5 204t-204 136.5t-248.5 51t-248.5 -51t-204 -136.5t-136.5 -204t-51 -248.5t51 -248.5t136.5 -204t204 -136.5t248.5 -51t248.5 51t204 136.5t136.5 204t51 248.5zM1536 640 |
| | | q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> |
| | | <glyph glyph-name="gamepad" unicode="" horiz-adv-x="1920" |
| | | d="M832 448v128q0 14 -9 23t-23 9h-192v192q0 14 -9 23t-23 9h-128q-14 0 -23 -9t-9 -23v-192h-192q-14 0 -23 -9t-9 -23v-128q0 -14 9 -23t23 -9h192v-192q0 -14 9 -23t23 -9h128q14 0 23 9t9 23v192h192q14 0 23 9t9 23zM1408 384q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5 |
| | | t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1664 640q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1920 512q0 -212 -150 -362t-362 -150q-192 0 -338 128h-220q-146 -128 -338 -128q-212 0 -362 150 |
| | | t-150 362t150 362t362 150h896q212 0 362 -150t150 -362z" /> |
| | | <glyph glyph-name="keyboard" unicode="" horiz-adv-x="1920" |
| | | d="M384 368v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM512 624v-96q0 -16 -16 -16h-224q-16 0 -16 16v96q0 16 16 16h224q16 0 16 -16zM384 880v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1408 368v-96q0 -16 -16 -16 |
| | | h-864q-16 0 -16 16v96q0 16 16 16h864q16 0 16 -16zM768 624v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM640 880v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1024 624v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16 |
| | | h96q16 0 16 -16zM896 880v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1280 624v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1664 368v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1152 880v-96 |
| | | q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1408 880v-96q0 -16 -16 -16h-96q-16 0 -16 16v96q0 16 16 16h96q16 0 16 -16zM1664 880v-352q0 -16 -16 -16h-224q-16 0 -16 16v96q0 16 16 16h112v240q0 16 16 16h96q16 0 16 -16zM1792 128v896h-1664v-896 |
| | | h1664zM1920 1024v-896q0 -53 -37.5 -90.5t-90.5 -37.5h-1664q-53 0 -90.5 37.5t-37.5 90.5v896q0 53 37.5 90.5t90.5 37.5h1664q53 0 90.5 -37.5t37.5 -90.5z" /> |
| | | <glyph glyph-name="flag_alt" unicode="" horiz-adv-x="1792" |
| | | d="M1664 491v616q-169 -91 -306 -91q-82 0 -145 32q-100 49 -184 76.5t-178 27.5q-173 0 -403 -127v-599q245 113 433 113q55 0 103.5 -7.5t98 -26t77 -31t82.5 -39.5l28 -14q44 -22 101 -22q120 0 293 92zM320 1280q0 -35 -17.5 -64t-46.5 -46v-1266q0 -14 -9 -23t-23 -9 |
| | | h-64q-14 0 -23 9t-9 23v1266q-29 17 -46.5 46t-17.5 64q0 53 37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1792 1216v-763q0 -39 -35 -57q-10 -5 -17 -9q-218 -116 -369 -116q-88 0 -158 35l-28 14q-64 33 -99 48t-91 29t-114 14q-102 0 -235.5 -44t-228.5 -102 |
| | | q-15 -9 -33 -9q-16 0 -32 8q-32 19 -32 56v742q0 35 31 55q35 21 78.5 42.5t114 52t152.5 49.5t155 19q112 0 209 -31t209 -86q38 -19 89 -19q122 0 310 112q22 12 31 17q31 16 62 -2q31 -20 31 -55z" /> |
| | | <glyph glyph-name="flag_checkered" unicode="" horiz-adv-x="1792" |
| | | d="M832 536v192q-181 -16 -384 -117v-185q205 96 384 110zM832 954v197q-172 -8 -384 -126v-189q215 111 384 118zM1664 491v184q-235 -116 -384 -71v224q-20 6 -39 15q-5 3 -33 17t-34.5 17t-31.5 15t-34.5 15.5t-32.5 13t-36 12.5t-35 8.5t-39.5 7.5t-39.5 4t-44 2 |
| | | q-23 0 -49 -3v-222h19q102 0 192.5 -29t197.5 -82q19 -9 39 -15v-188q42 -17 91 -17q120 0 293 92zM1664 918v189q-169 -91 -306 -91q-45 0 -78 8v-196q148 -42 384 90zM320 1280q0 -35 -17.5 -64t-46.5 -46v-1266q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v1266 |
| | | q-29 17 -46.5 46t-17.5 64q0 53 37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1792 1216v-763q0 -39 -35 -57q-10 -5 -17 -9q-218 -116 -369 -116q-88 0 -158 35l-28 14q-64 33 -99 48t-91 29t-114 14q-102 0 -235.5 -44t-228.5 -102q-15 -9 -33 -9q-16 0 -32 8 |
| | | q-32 19 -32 56v742q0 35 31 55q35 21 78.5 42.5t114 52t152.5 49.5t155 19q112 0 209 -31t209 -86q38 -19 89 -19q122 0 310 112q22 12 31 17q31 16 62 -2q31 -20 31 -55z" /> |
| | | <glyph glyph-name="terminal" unicode="" horiz-adv-x="1664" |
| | | d="M585 553l-466 -466q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l393 393l-393 393q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l466 -466q10 -10 10 -23t-10 -23zM1664 96v-64q0 -14 -9 -23t-23 -9h-960q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h960q14 0 23 -9 |
| | | t9 -23z" /> |
| | | <glyph glyph-name="code" unicode="" horiz-adv-x="1920" |
| | | d="M617 137l-50 -50q-10 -10 -23 -10t-23 10l-466 466q-10 10 -10 23t10 23l466 466q10 10 23 10t23 -10l50 -50q10 -10 10 -23t-10 -23l-393 -393l393 -393q10 -10 10 -23t-10 -23zM1208 1204l-373 -1291q-4 -13 -15.5 -19.5t-23.5 -2.5l-62 17q-13 4 -19.5 15.5t-2.5 24.5 |
| | | l373 1291q4 13 15.5 19.5t23.5 2.5l62 -17q13 -4 19.5 -15.5t2.5 -24.5zM1865 553l-466 -466q-10 -10 -23 -10t-23 10l-50 50q-10 10 -10 23t10 23l393 393l-393 393q-10 10 -10 23t10 23l50 50q10 10 23 10t23 -10l466 -466q10 -10 10 -23t-10 -23z" /> |
| | | <glyph glyph-name="reply_all" unicode="" horiz-adv-x="1792" |
| | | d="M640 454v-70q0 -42 -39 -59q-13 -5 -25 -5q-27 0 -45 19l-512 512q-19 19 -19 45t19 45l512 512q29 31 70 14q39 -17 39 -59v-69l-397 -398q-19 -19 -19 -45t19 -45zM1792 416q0 -58 -17 -133.5t-38.5 -138t-48 -125t-40.5 -90.5l-20 -40q-8 -17 -28 -17q-6 0 -9 1 |
| | | q-25 8 -23 34q43 400 -106 565q-64 71 -170.5 110.5t-267.5 52.5v-251q0 -42 -39 -59q-13 -5 -25 -5q-27 0 -45 19l-512 512q-19 19 -19 45t19 45l512 512q29 31 70 14q39 -17 39 -59v-262q411 -28 599 -221q169 -173 169 -509z" /> |
| | | <glyph glyph-name="star_half_empty" unicode="" horiz-adv-x="1664" |
| | | d="M1186 579l257 250l-356 52l-66 10l-30 60l-159 322v-963l59 -31l318 -168l-60 355l-12 66zM1638 841l-363 -354l86 -500q5 -33 -6 -51.5t-34 -18.5q-17 0 -40 12l-449 236l-449 -236q-23 -12 -40 -12q-23 0 -34 18.5t-6 51.5l86 500l-364 354q-32 32 -23 59.5t54 34.5 |
| | | l502 73l225 455q20 41 49 41q28 0 49 -41l225 -455l502 -73q45 -7 54 -34.5t-24 -59.5z" /> |
| | | <glyph glyph-name="location_arrow" unicode="" horiz-adv-x="1408" |
| | | d="M1401 1187l-640 -1280q-17 -35 -57 -35q-5 0 -15 2q-22 5 -35.5 22.5t-13.5 39.5v576h-576q-22 0 -39.5 13.5t-22.5 35.5t4 42t29 30l1280 640q13 7 29 7q27 0 45 -19q15 -14 18.5 -34.5t-6.5 -39.5z" /> |
| | | <glyph glyph-name="crop" unicode="" horiz-adv-x="1664" |
| | | d="M557 256h595v595zM512 301l595 595h-595v-595zM1664 224v-192q0 -14 -9 -23t-23 -9h-224v-224q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v224h-864q-14 0 -23 9t-9 23v864h-224q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h224v224q0 14 9 23t23 9h192q14 0 23 -9t9 -23 |
| | | v-224h851l246 247q10 9 23 9t23 -9q9 -10 9 -23t-9 -23l-247 -246v-851h224q14 0 23 -9t9 -23z" /> |
| | | <glyph glyph-name="code_fork" unicode="" horiz-adv-x="1024" |
| | | d="M288 64q0 40 -28 68t-68 28t-68 -28t-28 -68t28 -68t68 -28t68 28t28 68zM288 1216q0 40 -28 68t-68 28t-68 -28t-28 -68t28 -68t68 -28t68 28t28 68zM928 1088q0 40 -28 68t-68 28t-68 -28t-28 -68t28 -68t68 -28t68 28t28 68zM1024 1088q0 -52 -26 -96.5t-70 -69.5 |
| | | q-2 -287 -226 -414q-67 -38 -203 -81q-128 -40 -169.5 -71t-41.5 -100v-26q44 -25 70 -69.5t26 -96.5q0 -80 -56 -136t-136 -56t-136 56t-56 136q0 52 26 96.5t70 69.5v820q-44 25 -70 69.5t-26 96.5q0 80 56 136t136 56t136 -56t56 -136q0 -52 -26 -96.5t-70 -69.5v-497 |
| | | q54 26 154 57q55 17 87.5 29.5t70.5 31t59 39.5t40.5 51t28 69.5t8.5 91.5q-44 25 -70 69.5t-26 96.5q0 80 56 136t136 56t136 -56t56 -136z" /> |
| | | <glyph glyph-name="unlink" unicode="" horiz-adv-x="1664" |
| | | d="M439 265l-256 -256q-11 -9 -23 -9t-23 9q-9 10 -9 23t9 23l256 256q10 9 23 9t23 -9q9 -10 9 -23t-9 -23zM608 224v-320q0 -14 -9 -23t-23 -9t-23 9t-9 23v320q0 14 9 23t23 9t23 -9t9 -23zM384 448q0 -14 -9 -23t-23 -9h-320q-14 0 -23 9t-9 23t9 23t23 9h320 |
| | | q14 0 23 -9t9 -23zM1648 320q0 -120 -85 -203l-147 -146q-83 -83 -203 -83q-121 0 -204 85l-334 335q-21 21 -42 56l239 18l273 -274q27 -27 68 -27.5t68 26.5l147 146q28 28 28 67q0 40 -28 68l-274 275l18 239q35 -21 56 -42l336 -336q84 -86 84 -204zM1031 1044l-239 -18 |
| | | l-273 274q-28 28 -68 28q-39 0 -68 -27l-147 -146q-28 -28 -28 -67q0 -40 28 -68l274 -274l-18 -240q-35 21 -56 42l-336 336q-84 86 -84 204q0 120 85 203l147 146q83 83 203 83q121 0 204 -85l334 -335q21 -21 42 -56zM1664 960q0 -14 -9 -23t-23 -9h-320q-14 0 -23 9 |
| | | t-9 23t9 23t23 9h320q14 0 23 -9t9 -23zM1120 1504v-320q0 -14 -9 -23t-23 -9t-23 9t-9 23v320q0 14 9 23t23 9t23 -9t9 -23zM1527 1353l-256 -256q-11 -9 -23 -9t-23 9q-9 10 -9 23t9 23l256 256q10 9 23 9t23 -9q9 -10 9 -23t-9 -23z" /> |
| | | <glyph glyph-name="question" unicode="" horiz-adv-x="1024" |
| | | d="M704 280v-240q0 -16 -12 -28t-28 -12h-240q-16 0 -28 12t-12 28v240q0 16 12 28t28 12h240q16 0 28 -12t12 -28zM1020 880q0 -54 -15.5 -101t-35 -76.5t-55 -59.5t-57.5 -43.5t-61 -35.5q-41 -23 -68.5 -65t-27.5 -67q0 -17 -12 -32.5t-28 -15.5h-240q-15 0 -25.5 18.5 |
| | | t-10.5 37.5v45q0 83 65 156.5t143 108.5q59 27 84 56t25 76q0 42 -46.5 74t-107.5 32q-65 0 -108 -29q-35 -25 -107 -115q-13 -16 -31 -16q-12 0 -25 8l-164 125q-13 10 -15.5 25t5.5 28q160 266 464 266q80 0 161 -31t146 -83t106 -127.5t41 -158.5z" /> |
| | | <glyph glyph-name="_279" unicode="" horiz-adv-x="640" |
| | | d="M640 192v-128q0 -26 -19 -45t-45 -19h-512q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h64v384h-64q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h384q26 0 45 -19t19 -45v-576h64q26 0 45 -19t19 -45zM512 1344v-192q0 -26 -19 -45t-45 -19h-256q-26 0 -45 19t-19 45v192 |
| | | q0 26 19 45t45 19h256q26 0 45 -19t19 -45z" /> |
| | | <glyph glyph-name="exclamation" unicode="" horiz-adv-x="640" |
| | | d="M512 288v-224q0 -26 -19 -45t-45 -19h-256q-26 0 -45 19t-19 45v224q0 26 19 45t45 19h256q26 0 45 -19t19 -45zM542 1344l-28 -768q-1 -26 -20.5 -45t-45.5 -19h-256q-26 0 -45.5 19t-20.5 45l-28 768q-1 26 17.5 45t44.5 19h320q26 0 44.5 -19t17.5 -45z" /> |
| | | <glyph glyph-name="superscript" unicode="" |
| | | d="M897 167v-167h-248l-159 252l-24 42q-8 9 -11 21h-3q-1 -3 -2.5 -6.5t-3.5 -8t-3 -6.5q-10 -20 -25 -44l-155 -250h-258v167h128l197 291l-185 272h-137v168h276l139 -228q2 -4 23 -42q8 -9 11 -21h3q3 9 11 21l25 42l140 228h257v-168h-125l-184 -267l204 -296h109z |
| | | M1534 846v-206h-514l-3 27q-4 28 -4 46q0 64 26 117t65 86.5t84 65t84 54.5t65 54t26 64q0 38 -29.5 62.5t-70.5 24.5q-51 0 -97 -39q-14 -11 -36 -38l-105 92q26 37 63 66q83 65 188 65q110 0 178 -59.5t68 -158.5q0 -56 -24.5 -103t-62 -76.5t-81.5 -58.5t-82 -50.5 |
| | | t-65.5 -51.5t-30.5 -63h232v80h126z" /> |
| | | <glyph glyph-name="subscript" unicode="" |
| | | d="M897 167v-167h-248l-159 252l-24 42q-8 9 -11 21h-3q-1 -3 -2.5 -6.5t-3.5 -8t-3 -6.5q-10 -20 -25 -44l-155 -250h-258v167h128l197 291l-185 272h-137v168h276l139 -228q2 -4 23 -42q8 -9 11 -21h3q3 9 11 21l25 42l140 228h257v-168h-125l-184 -267l204 -296h109z |
| | | M1536 -50v-206h-514l-4 27q-3 45 -3 46q0 64 26 117t65 86.5t84 65t84 54.5t65 54t26 64q0 38 -29.5 62.5t-70.5 24.5q-51 0 -97 -39q-14 -11 -36 -38l-105 92q26 37 63 66q80 65 188 65q110 0 178 -59.5t68 -158.5q0 -66 -34.5 -118.5t-84 -86t-99.5 -62.5t-87 -63t-41 -73 |
| | | h232v80h126z" /> |
| | | <glyph glyph-name="_283" unicode="" horiz-adv-x="1920" |
| | | d="M896 128l336 384h-768l-336 -384h768zM1909 1205q15 -34 9.5 -71.5t-30.5 -65.5l-896 -1024q-38 -44 -96 -44h-768q-38 0 -69.5 20.5t-47.5 54.5q-15 34 -9.5 71.5t30.5 65.5l896 1024q38 44 96 44h768q38 0 69.5 -20.5t47.5 -54.5z" /> |
| | | <glyph glyph-name="puzzle_piece" unicode="" horiz-adv-x="1664" |
| | | d="M1664 438q0 -81 -44.5 -135t-123.5 -54q-41 0 -77.5 17.5t-59 38t-56.5 38t-71 17.5q-110 0 -110 -124q0 -39 16 -115t15 -115v-5q-22 0 -33 -1q-34 -3 -97.5 -11.5t-115.5 -13.5t-98 -5q-61 0 -103 26.5t-42 83.5q0 37 17.5 71t38 56.5t38 59t17.5 77.5q0 79 -54 123.5 |
| | | t-135 44.5q-84 0 -143 -45.5t-59 -127.5q0 -43 15 -83t33.5 -64.5t33.5 -53t15 -50.5q0 -45 -46 -89q-37 -35 -117 -35q-95 0 -245 24q-9 2 -27.5 4t-27.5 4l-13 2q-1 0 -3 1q-2 0 -2 1v1024q2 -1 17.5 -3.5t34 -5t21.5 -3.5q150 -24 245 -24q80 0 117 35q46 44 46 89 |
| | | q0 22 -15 50.5t-33.5 53t-33.5 64.5t-15 83q0 82 59 127.5t144 45.5q80 0 134 -44.5t54 -123.5q0 -41 -17.5 -77.5t-38 -59t-38 -56.5t-17.5 -71q0 -57 42 -83.5t103 -26.5q64 0 180 15t163 17v-2q-1 -2 -3.5 -17.5t-5 -34t-3.5 -21.5q-24 -150 -24 -245q0 -80 35 -117 |
| | | q44 -46 89 -46q22 0 50.5 15t53 33.5t64.5 33.5t83 15q82 0 127.5 -59t45.5 -143z" /> |
| | | <glyph glyph-name="microphone" unicode="" horiz-adv-x="1152" |
| | | d="M1152 832v-128q0 -221 -147.5 -384.5t-364.5 -187.5v-132h256q26 0 45 -19t19 -45t-19 -45t-45 -19h-640q-26 0 -45 19t-19 45t19 45t45 19h256v132q-217 24 -364.5 187.5t-147.5 384.5v128q0 26 19 45t45 19t45 -19t19 -45v-128q0 -185 131.5 -316.5t316.5 -131.5 |
| | | t316.5 131.5t131.5 316.5v128q0 26 19 45t45 19t45 -19t19 -45zM896 1216v-512q0 -132 -94 -226t-226 -94t-226 94t-94 226v512q0 132 94 226t226 94t226 -94t94 -226z" /> |
| | | <glyph glyph-name="microphone_off" unicode="" horiz-adv-x="1408" |
| | | d="M271 591l-101 -101q-42 103 -42 214v128q0 26 19 45t45 19t45 -19t19 -45v-128q0 -53 15 -113zM1385 1193l-361 -361v-128q0 -132 -94 -226t-226 -94q-55 0 -109 19l-96 -96q97 -51 205 -51q185 0 316.5 131.5t131.5 316.5v128q0 26 19 45t45 19t45 -19t19 -45v-128 |
| | | q0 -221 -147.5 -384.5t-364.5 -187.5v-132h256q26 0 45 -19t19 -45t-19 -45t-45 -19h-640q-26 0 -45 19t-19 45t19 45t45 19h256v132q-125 13 -235 81l-254 -254q-10 -10 -23 -10t-23 10l-82 82q-10 10 -10 23t10 23l1234 1234q10 10 23 10t23 -10l82 -82q10 -10 10 -23 |
| | | t-10 -23zM1005 1325l-621 -621v512q0 132 94 226t226 94q102 0 184.5 -59t116.5 -152z" /> |
| | | <glyph glyph-name="shield" unicode="" horiz-adv-x="1280" |
| | | d="M1088 576v640h-448v-1137q119 63 213 137q235 184 235 360zM1280 1344v-768q0 -86 -33.5 -170.5t-83 -150t-118 -127.5t-126.5 -103t-121 -77.5t-89.5 -49.5t-42.5 -20q-12 -6 -26 -6t-26 6q-16 7 -42.5 20t-89.5 49.5t-121 77.5t-126.5 103t-118 127.5t-83 150 |
| | | t-33.5 170.5v768q0 26 19 45t45 19h1152q26 0 45 -19t19 -45z" /> |
| | | <glyph glyph-name="calendar_empty" unicode="" horiz-adv-x="1664" |
| | | d="M128 -128h1408v1024h-1408v-1024zM512 1088v288q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-288q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1280 1088v288q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-288q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1664 1152v-1280 |
| | | q0 -52 -38 -90t-90 -38h-1408q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h128v96q0 66 47 113t113 47h64q66 0 113 -47t47 -113v-96h384v96q0 66 47 113t113 47h64q66 0 113 -47t47 -113v-96h128q52 0 90 -38t38 -90z" /> |
| | | <glyph glyph-name="fire_extinguisher" unicode="" horiz-adv-x="1408" |
| | | d="M512 1344q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1408 1376v-320q0 -16 -12 -25q-8 -7 -20 -7q-4 0 -7 1l-448 96q-11 2 -18 11t-7 20h-256v-102q111 -23 183.5 -111t72.5 -203v-800q0 -26 -19 -45t-45 -19h-512q-26 0 -45 19t-19 45v800 |
| | | q0 106 62.5 190.5t161.5 114.5v111h-32q-59 0 -115 -23.5t-91.5 -53t-66 -66.5t-40.5 -53.5t-14 -24.5q-17 -35 -57 -35q-16 0 -29 7q-23 12 -31.5 37t3.5 49q5 10 14.5 26t37.5 53.5t60.5 70t85 67t108.5 52.5q-25 42 -25 86q0 66 47 113t113 47t113 -47t47 -113 |
| | | q0 -33 -14 -64h302q0 11 7 20t18 11l448 96q3 1 7 1q12 0 20 -7q12 -9 12 -25z" /> |
| | | <glyph glyph-name="rocket" unicode="" horiz-adv-x="1664" |
| | | d="M1440 1088q0 40 -28 68t-68 28t-68 -28t-28 -68t28 -68t68 -28t68 28t28 68zM1664 1376q0 -249 -75.5 -430.5t-253.5 -360.5q-81 -80 -195 -176l-20 -379q-2 -16 -16 -26l-384 -224q-7 -4 -16 -4q-12 0 -23 9l-64 64q-13 14 -8 32l85 276l-281 281l-276 -85q-3 -1 -9 -1 |
| | | q-14 0 -23 9l-64 64q-17 19 -5 39l224 384q10 14 26 16l379 20q96 114 176 195q188 187 358 258t431 71q14 0 24 -9.5t10 -22.5z" /> |
| | | <glyph glyph-name="maxcdn" unicode="" horiz-adv-x="1792" |
| | | d="M1745 763l-164 -763h-334l178 832q13 56 -15 88q-27 33 -83 33h-169l-204 -953h-334l204 953h-286l-204 -953h-334l204 953l-153 327h1276q101 0 189.5 -40.5t147.5 -113.5q60 -73 81 -168.5t0 -194.5z" /> |
| | | <glyph glyph-name="chevron_sign_left" unicode="" |
| | | d="M909 141l102 102q19 19 19 45t-19 45l-307 307l307 307q19 19 19 45t-19 45l-102 102q-19 19 -45 19t-45 -19l-454 -454q-19 -19 -19 -45t19 -45l454 -454q19 -19 45 -19t45 19zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5 |
| | | t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> |
| | | <glyph glyph-name="chevron_sign_right" unicode="" |
| | | d="M717 141l454 454q19 19 19 45t-19 45l-454 454q-19 19 -45 19t-45 -19l-102 -102q-19 -19 -19 -45t19 -45l307 -307l-307 -307q-19 -19 -19 -45t19 -45l102 -102q19 -19 45 -19t45 19zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5 |
| | | t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> |
| | | <glyph glyph-name="chevron_sign_up" unicode="" |
| | | d="M1165 397l102 102q19 19 19 45t-19 45l-454 454q-19 19 -45 19t-45 -19l-454 -454q-19 -19 -19 -45t19 -45l102 -102q19 -19 45 -19t45 19l307 307l307 -307q19 -19 45 -19t45 19zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5 |
| | | t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> |
| | | <glyph glyph-name="chevron_sign_down" unicode="" |
| | | d="M813 237l454 454q19 19 19 45t-19 45l-102 102q-19 19 -45 19t-45 -19l-307 -307l-307 307q-19 19 -45 19t-45 -19l-102 -102q-19 -19 -19 -45t19 -45l454 -454q19 -19 45 -19t45 19zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5 |
| | | t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> |
| | | <glyph glyph-name="html5" unicode="" horiz-adv-x="1408" |
| | | d="M1130 939l16 175h-884l47 -534h612l-22 -228l-197 -53l-196 53l-13 140h-175l22 -278l362 -100h4v1l359 99l50 544h-644l-15 181h674zM0 1408h1408l-128 -1438l-578 -162l-574 162z" /> |
| | | <glyph glyph-name="css3" unicode="" horiz-adv-x="1792" |
| | | d="M275 1408h1505l-266 -1333l-804 -267l-698 267l71 356h297l-29 -147l422 -161l486 161l68 339h-1208l58 297h1209l38 191h-1208z" /> |
| | | <glyph glyph-name="anchor" unicode="" horiz-adv-x="1792" |
| | | d="M960 1280q0 26 -19 45t-45 19t-45 -19t-19 -45t19 -45t45 -19t45 19t19 45zM1792 352v-352q0 -22 -20 -30q-8 -2 -12 -2q-12 0 -23 9l-93 93q-119 -143 -318.5 -226.5t-429.5 -83.5t-429.5 83.5t-318.5 226.5l-93 -93q-9 -9 -23 -9q-4 0 -12 2q-20 8 -20 30v352 |
| | | q0 14 9 23t23 9h352q22 0 30 -20q8 -19 -7 -35l-100 -100q67 -91 189.5 -153.5t271.5 -82.5v647h-192q-26 0 -45 19t-19 45v128q0 26 19 45t45 19h192v163q-58 34 -93 92.5t-35 128.5q0 106 75 181t181 75t181 -75t75 -181q0 -70 -35 -128.5t-93 -92.5v-163h192q26 0 45 -19 |
| | | t19 -45v-128q0 -26 -19 -45t-45 -19h-192v-647q149 20 271.5 82.5t189.5 153.5l-100 100q-15 16 -7 35q8 20 30 20h352q14 0 23 -9t9 -23z" /> |
| | | <glyph glyph-name="unlock_alt" unicode="" horiz-adv-x="1152" |
| | | d="M1056 768q40 0 68 -28t28 -68v-576q0 -40 -28 -68t-68 -28h-960q-40 0 -68 28t-28 68v576q0 40 28 68t68 28h32v320q0 185 131.5 316.5t316.5 131.5t316.5 -131.5t131.5 -316.5q0 -26 -19 -45t-45 -19h-64q-26 0 -45 19t-19 45q0 106 -75 181t-181 75t-181 -75t-75 -181 |
| | | v-320h736z" /> |
| | | <glyph glyph-name="bullseye" unicode="" |
| | | d="M1024 640q0 -106 -75 -181t-181 -75t-181 75t-75 181t75 181t181 75t181 -75t75 -181zM1152 640q0 159 -112.5 271.5t-271.5 112.5t-271.5 -112.5t-112.5 -271.5t112.5 -271.5t271.5 -112.5t271.5 112.5t112.5 271.5zM1280 640q0 -212 -150 -362t-362 -150t-362 150 |
| | | t-150 362t150 362t362 150t362 -150t150 -362zM1408 640q0 130 -51 248.5t-136.5 204t-204 136.5t-248.5 51t-248.5 -51t-204 -136.5t-136.5 -204t-51 -248.5t51 -248.5t136.5 -204t204 -136.5t248.5 -51t248.5 51t204 136.5t136.5 204t51 248.5zM1536 640 |
| | | q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> |
| | | <glyph glyph-name="ellipsis_horizontal" unicode="" horiz-adv-x="1408" |
| | | d="M384 800v-192q0 -40 -28 -68t-68 -28h-192q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h192q40 0 68 -28t28 -68zM896 800v-192q0 -40 -28 -68t-68 -28h-192q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h192q40 0 68 -28t28 -68zM1408 800v-192q0 -40 -28 -68t-68 -28h-192 |
| | | q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h192q40 0 68 -28t28 -68z" /> |
| | | <glyph glyph-name="ellipsis_vertical" unicode="" horiz-adv-x="384" |
| | | d="M384 288v-192q0 -40 -28 -68t-68 -28h-192q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h192q40 0 68 -28t28 -68zM384 800v-192q0 -40 -28 -68t-68 -28h-192q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h192q40 0 68 -28t28 -68zM384 1312v-192q0 -40 -28 -68t-68 -28h-192 |
| | | q-40 0 -68 28t-28 68v192q0 40 28 68t68 28h192q40 0 68 -28t28 -68z" /> |
| | | <glyph glyph-name="_303" unicode="" |
| | | d="M512 256q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM863 162q-13 233 -176.5 396.5t-396.5 176.5q-14 1 -24 -9t-10 -23v-128q0 -13 8.5 -22t21.5 -10q154 -11 264 -121t121 -264q1 -13 10 -21.5t22 -8.5h128 |
| | | q13 0 23 10t9 24zM1247 161q-5 154 -56 297.5t-139.5 260t-205 205t-260 139.5t-297.5 56q-14 1 -23 -9q-10 -10 -10 -23v-128q0 -13 9 -22t22 -10q204 -7 378 -111.5t278.5 -278.5t111.5 -378q1 -13 10 -22t22 -9h128q13 0 23 10q11 9 9 23zM1536 1120v-960 |
| | | q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> |
| | | <glyph glyph-name="play_sign" unicode="" |
| | | d="M768 1408q209 0 385.5 -103t279.5 -279.5t103 -385.5t-103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103zM1152 585q32 18 32 55t-32 55l-544 320q-31 19 -64 1q-32 -19 -32 -56v-640q0 -37 32 -56 |
| | | q16 -8 32 -8q17 0 32 9z" /> |
| | | <glyph glyph-name="ticket" unicode="" horiz-adv-x="1792" |
| | | d="M1024 1084l316 -316l-572 -572l-316 316zM813 105l618 618q19 19 19 45t-19 45l-362 362q-18 18 -45 18t-45 -18l-618 -618q-19 -19 -19 -45t19 -45l362 -362q18 -18 45 -18t45 18zM1702 742l-907 -908q-37 -37 -90.5 -37t-90.5 37l-126 126q56 56 56 136t-56 136 |
| | | t-136 56t-136 -56l-125 126q-37 37 -37 90.5t37 90.5l907 906q37 37 90.5 37t90.5 -37l125 -125q-56 -56 -56 -136t56 -136t136 -56t136 56l126 -125q37 -37 37 -90.5t-37 -90.5z" /> |
| | | <glyph glyph-name="minus_sign_alt" unicode="" |
| | | d="M1280 576v128q0 26 -19 45t-45 19h-896q-26 0 -45 -19t-19 -45v-128q0 -26 19 -45t45 -19h896q26 0 45 19t19 45zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5 |
| | | t84.5 -203.5z" /> |
| | | <glyph glyph-name="check_minus" unicode="" horiz-adv-x="1408" |
| | | d="M1152 736v-64q0 -14 -9 -23t-23 -9h-832q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h832q14 0 23 -9t9 -23zM1280 288v832q0 66 -47 113t-113 47h-832q-66 0 -113 -47t-47 -113v-832q0 -66 47 -113t113 -47h832q66 0 113 47t47 113zM1408 1120v-832q0 -119 -84.5 -203.5 |
| | | t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h832q119 0 203.5 -84.5t84.5 -203.5z" /> |
| | | <glyph glyph-name="level_up" unicode="" horiz-adv-x="1024" |
| | | d="M1018 933q-18 -37 -58 -37h-192v-864q0 -14 -9 -23t-23 -9h-704q-21 0 -29 18q-8 20 4 35l160 192q9 11 25 11h320v640h-192q-40 0 -58 37q-17 37 9 68l320 384q18 22 49 22t49 -22l320 -384q27 -32 9 -68z" /> |
| | | <glyph glyph-name="level_down" unicode="" horiz-adv-x="1024" |
| | | d="M32 1280h704q13 0 22.5 -9.5t9.5 -23.5v-863h192q40 0 58 -37t-9 -69l-320 -384q-18 -22 -49 -22t-49 22l-320 384q-26 31 -9 69q18 37 58 37h192v640h-320q-14 0 -25 11l-160 192q-13 14 -4 34q9 19 29 19z" /> |
| | | <glyph glyph-name="check_sign" unicode="" |
| | | d="M685 237l614 614q19 19 19 45t-19 45l-102 102q-19 19 -45 19t-45 -19l-467 -467l-211 211q-19 19 -45 19t-45 -19l-102 -102q-19 -19 -19 -45t19 -45l358 -358q19 -19 45 -19t45 19zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5 |
| | | t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> |
| | | <glyph glyph-name="edit_sign" unicode="" |
| | | d="M404 428l152 -152l-52 -52h-56v96h-96v56zM818 818q14 -13 -3 -30l-291 -291q-17 -17 -30 -3q-14 13 3 30l291 291q17 17 30 3zM544 128l544 544l-288 288l-544 -544v-288h288zM1152 736l92 92q28 28 28 68t-28 68l-152 152q-28 28 -68 28t-68 -28l-92 -92zM1536 1120 |
| | | v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> |
| | | <glyph glyph-name="_312" unicode="" |
| | | d="M1280 608v480q0 26 -19 45t-45 19h-480q-42 0 -59 -39q-17 -41 14 -70l144 -144l-534 -534q-19 -19 -19 -45t19 -45l102 -102q19 -19 45 -19t45 19l534 534l144 -144q18 -19 45 -19q12 0 25 5q39 17 39 59zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960 |
| | | q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> |
| | | <glyph glyph-name="share_sign" unicode="" |
| | | d="M1005 435l352 352q19 19 19 45t-19 45l-352 352q-30 31 -69 14q-40 -17 -40 -59v-160q-119 0 -216 -19.5t-162.5 -51t-114 -79t-76.5 -95.5t-44.5 -109t-21.5 -111.5t-5 -110.5q0 -181 167 -404q11 -12 25 -12q7 0 13 3q22 9 19 33q-44 354 62 473q46 52 130 75.5 |
| | | t224 23.5v-160q0 -42 40 -59q12 -5 24 -5q26 0 45 19zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> |
| | | <glyph glyph-name="compass" unicode="" |
| | | d="M640 448l256 128l-256 128v-256zM1024 1039v-542l-512 -256v542zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103 |
| | | t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> |
| | | <glyph glyph-name="collapse" unicode="" |
| | | d="M1145 861q18 -35 -5 -66l-320 -448q-19 -27 -52 -27t-52 27l-320 448q-23 31 -5 66q17 35 57 35h640q40 0 57 -35zM1280 160v960q0 13 -9.5 22.5t-22.5 9.5h-960q-13 0 -22.5 -9.5t-9.5 -22.5v-960q0 -13 9.5 -22.5t22.5 -9.5h960q13 0 22.5 9.5t9.5 22.5zM1536 1120 |
| | | v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> |
| | | <glyph glyph-name="collapse_top" unicode="" |
| | | d="M1145 419q-17 -35 -57 -35h-640q-40 0 -57 35q-18 35 5 66l320 448q19 27 52 27t52 -27l320 -448q23 -31 5 -66zM1280 160v960q0 13 -9.5 22.5t-22.5 9.5h-960q-13 0 -22.5 -9.5t-9.5 -22.5v-960q0 -13 9.5 -22.5t22.5 -9.5h960q13 0 22.5 9.5t9.5 22.5zM1536 1120v-960 |
| | | q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> |
| | | <glyph glyph-name="_317" unicode="" |
| | | d="M1088 640q0 -33 -27 -52l-448 -320q-31 -23 -66 -5q-35 17 -35 57v640q0 40 35 57q35 18 66 -5l448 -320q27 -19 27 -52zM1280 160v960q0 14 -9 23t-23 9h-960q-14 0 -23 -9t-9 -23v-960q0 -14 9 -23t23 -9h960q14 0 23 9t9 23zM1536 1120v-960q0 -119 -84.5 -203.5 |
| | | t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> |
| | | <glyph glyph-name="eur" unicode="" horiz-adv-x="1024" |
| | | d="M976 229l35 -159q3 -12 -3 -22.5t-17 -14.5l-5 -1q-4 -2 -10.5 -3.5t-16 -4.5t-21.5 -5.5t-25.5 -5t-30 -5t-33.5 -4.5t-36.5 -3t-38.5 -1q-234 0 -409 130.5t-238 351.5h-95q-13 0 -22.5 9.5t-9.5 22.5v113q0 13 9.5 22.5t22.5 9.5h66q-2 57 1 105h-67q-14 0 -23 9 |
| | | t-9 23v114q0 14 9 23t23 9h98q67 210 243.5 338t400.5 128q102 0 194 -23q11 -3 20 -15q6 -11 3 -24l-43 -159q-3 -13 -14 -19.5t-24 -2.5l-4 1q-4 1 -11.5 2.5l-17.5 3.5t-22.5 3.5t-26 3t-29 2.5t-29.5 1q-126 0 -226 -64t-150 -176h468q16 0 25 -12q10 -12 7 -26 |
| | | l-24 -114q-5 -26 -32 -26h-488q-3 -37 0 -105h459q15 0 25 -12q9 -12 6 -27l-24 -112q-2 -11 -11 -18.5t-20 -7.5h-387q48 -117 149.5 -185.5t228.5 -68.5q18 0 36 1.5t33.5 3.5t29.5 4.5t24.5 5t18.5 4.5l12 3l5 2q13 5 26 -2q12 -7 15 -21z" /> |
| | | <glyph glyph-name="gbp" unicode="" horiz-adv-x="1024" |
| | | d="M1020 399v-367q0 -14 -9 -23t-23 -9h-956q-14 0 -23 9t-9 23v150q0 13 9.5 22.5t22.5 9.5h97v383h-95q-14 0 -23 9.5t-9 22.5v131q0 14 9 23t23 9h95v223q0 171 123.5 282t314.5 111q185 0 335 -125q9 -8 10 -20.5t-7 -22.5l-103 -127q-9 -11 -22 -12q-13 -2 -23 7 |
| | | q-5 5 -26 19t-69 32t-93 18q-85 0 -137 -47t-52 -123v-215h305q13 0 22.5 -9t9.5 -23v-131q0 -13 -9.5 -22.5t-22.5 -9.5h-305v-379h414v181q0 13 9 22.5t23 9.5h162q14 0 23 -9.5t9 -22.5z" /> |
| | | <glyph glyph-name="usd" unicode="" horiz-adv-x="1024" |
| | | d="M978 351q0 -153 -99.5 -263.5t-258.5 -136.5v-175q0 -14 -9 -23t-23 -9h-135q-13 0 -22.5 9.5t-9.5 22.5v175q-66 9 -127.5 31t-101.5 44.5t-74 48t-46.5 37.5t-17.5 18q-17 21 -2 41l103 135q7 10 23 12q15 2 24 -9l2 -2q113 -99 243 -125q37 -8 74 -8q81 0 142.5 43 |
| | | t61.5 122q0 28 -15 53t-33.5 42t-58.5 37.5t-66 32t-80 32.5q-39 16 -61.5 25t-61.5 26.5t-62.5 31t-56.5 35.5t-53.5 42.5t-43.5 49t-35.5 58t-21 66.5t-8.5 78q0 138 98 242t255 134v180q0 13 9.5 22.5t22.5 9.5h135q14 0 23 -9t9 -23v-176q57 -6 110.5 -23t87 -33.5 |
| | | t63.5 -37.5t39 -29t15 -14q17 -18 5 -38l-81 -146q-8 -15 -23 -16q-14 -3 -27 7q-3 3 -14.5 12t-39 26.5t-58.5 32t-74.5 26t-85.5 11.5q-95 0 -155 -43t-60 -111q0 -26 8.5 -48t29.5 -41.5t39.5 -33t56 -31t60.5 -27t70 -27.5q53 -20 81 -31.5t76 -35t75.5 -42.5t62 -50 |
| | | t53 -63.5t31.5 -76.5t13 -94z" /> |
| | | <glyph glyph-name="inr" unicode="" horiz-adv-x="898" |
| | | d="M898 1066v-102q0 -14 -9 -23t-23 -9h-168q-23 -144 -129 -234t-276 -110q167 -178 459 -536q14 -16 4 -34q-8 -18 -29 -18h-195q-16 0 -25 12q-306 367 -498 571q-9 9 -9 22v127q0 13 9.5 22.5t22.5 9.5h112q132 0 212.5 43t102.5 125h-427q-14 0 -23 9t-9 23v102 |
| | | q0 14 9 23t23 9h413q-57 113 -268 113h-145q-13 0 -22.5 9.5t-9.5 22.5v133q0 14 9 23t23 9h832q14 0 23 -9t9 -23v-102q0 -14 -9 -23t-23 -9h-233q47 -61 64 -144h171q14 0 23 -9t9 -23z" /> |
| | | <glyph glyph-name="jpy" unicode="" horiz-adv-x="1027" |
| | | d="M603 0h-172q-13 0 -22.5 9t-9.5 23v330h-288q-13 0 -22.5 9t-9.5 23v103q0 13 9.5 22.5t22.5 9.5h288v85h-288q-13 0 -22.5 9t-9.5 23v104q0 13 9.5 22.5t22.5 9.5h214l-321 578q-8 16 0 32q10 16 28 16h194q19 0 29 -18l215 -425q19 -38 56 -125q10 24 30.5 68t27.5 61 |
| | | l191 420q8 19 29 19h191q17 0 27 -16q9 -14 1 -31l-313 -579h215q13 0 22.5 -9.5t9.5 -22.5v-104q0 -14 -9.5 -23t-22.5 -9h-290v-85h290q13 0 22.5 -9.5t9.5 -22.5v-103q0 -14 -9.5 -23t-22.5 -9h-290v-330q0 -13 -9.5 -22.5t-22.5 -9.5z" /> |
| | | <glyph glyph-name="rub" unicode="" horiz-adv-x="1280" |
| | | d="M1043 971q0 100 -65 162t-171 62h-320v-448h320q106 0 171 62t65 162zM1280 971q0 -193 -126.5 -315t-326.5 -122h-340v-118h505q14 0 23 -9t9 -23v-128q0 -14 -9 -23t-23 -9h-505v-192q0 -14 -9.5 -23t-22.5 -9h-167q-14 0 -23 9t-9 23v192h-224q-14 0 -23 9t-9 23v128 |
| | | q0 14 9 23t23 9h224v118h-224q-14 0 -23 9t-9 23v149q0 13 9 22.5t23 9.5h224v629q0 14 9 23t23 9h539q200 0 326.5 -122t126.5 -315z" /> |
| | | <glyph glyph-name="krw" unicode="" horiz-adv-x="1792" |
| | | d="M514 341l81 299h-159l75 -300q1 -1 1 -3t1 -3q0 1 0.5 3.5t0.5 3.5zM630 768l35 128h-292l32 -128h225zM822 768h139l-35 128h-70zM1271 340l78 300h-162l81 -299q0 -1 0.5 -3.5t1.5 -3.5q0 1 0.5 3t0.5 3zM1382 768l33 128h-297l34 -128h230zM1792 736v-64q0 -14 -9 -23 |
| | | t-23 -9h-213l-164 -616q-7 -24 -31 -24h-159q-24 0 -31 24l-166 616h-209l-167 -616q-7 -24 -31 -24h-159q-11 0 -19.5 7t-10.5 17l-160 616h-208q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h175l-33 128h-142q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h109l-89 344q-5 15 5 28 |
| | | q10 12 26 12h137q26 0 31 -24l90 -360h359l97 360q7 24 31 24h126q24 0 31 -24l98 -360h365l93 360q5 24 31 24h137q16 0 26 -12q10 -13 5 -28l-91 -344h111q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-145l-34 -128h179q14 0 23 -9t9 -23z" /> |
| | | <glyph glyph-name="btc" unicode="" horiz-adv-x="1280" |
| | | d="M1167 896q18 -182 -131 -258q117 -28 175 -103t45 -214q-7 -71 -32.5 -125t-64.5 -89t-97 -58.5t-121.5 -34.5t-145.5 -15v-255h-154v251q-80 0 -122 1v-252h-154v255q-18 0 -54 0.5t-55 0.5h-200l31 183h111q50 0 58 51v402h16q-6 1 -16 1v287q-13 68 -89 68h-111v164 |
| | | l212 -1q64 0 97 1v252h154v-247q82 2 122 2v245h154v-252q79 -7 140 -22.5t113 -45t82.5 -78t36.5 -114.5zM952 351q0 36 -15 64t-37 46t-57.5 30.5t-65.5 18.5t-74 9t-69 3t-64.5 -1t-47.5 -1v-338q8 0 37 -0.5t48 -0.5t53 1.5t58.5 4t57 8.5t55.5 14t47.5 21t39.5 30 |
| | | t24.5 40t9.5 51zM881 827q0 33 -12.5 58.5t-30.5 42t-48 28t-55 16.5t-61.5 8t-58 2.5t-54 -1t-39.5 -0.5v-307q5 0 34.5 -0.5t46.5 0t50 2t55 5.5t51.5 11t48.5 18.5t37 27t27 38.5t9 51z" /> |
| | | <glyph glyph-name="file" unicode="" |
| | | d="M1024 1024v472q22 -14 36 -28l408 -408q14 -14 28 -36h-472zM896 992q0 -40 28 -68t68 -28h544v-1056q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h800v-544z" /> |
| | | <glyph glyph-name="file_text" unicode="" |
| | | d="M1468 1060q14 -14 28 -36h-472v472q22 -14 36 -28zM992 896h544v-1056q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h800v-544q0 -40 28 -68t68 -28zM1152 160v64q0 14 -9 23t-23 9h-704q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h704 |
| | | q14 0 23 9t9 23zM1152 416v64q0 14 -9 23t-23 9h-704q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h704q14 0 23 9t9 23zM1152 672v64q0 14 -9 23t-23 9h-704q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h704q14 0 23 9t9 23z" /> |
| | | <glyph glyph-name="sort_by_alphabet" unicode="" horiz-adv-x="1664" |
| | | d="M1191 1128h177l-72 218l-12 47q-2 16 -2 20h-4l-3 -20q0 -1 -3.5 -18t-7.5 -29zM736 96q0 -12 -10 -24l-319 -319q-10 -9 -23 -9q-12 0 -23 9l-320 320q-15 16 -7 35q8 20 30 20h192v1376q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1376h192q14 0 23 -9t9 -23zM1572 -23 |
| | | v-233h-584v90l369 529q12 18 21 27l11 9v3q-2 0 -6.5 -0.5t-7.5 -0.5q-12 -3 -30 -3h-232v-115h-120v229h567v-89l-369 -530q-6 -8 -21 -26l-11 -11v-2l14 2q9 2 30 2h248v119h121zM1661 874v-106h-288v106h75l-47 144h-243l-47 -144h75v-106h-287v106h70l230 662h162 |
| | | l230 -662h70z" /> |
| | | <glyph glyph-name="_329" unicode="" horiz-adv-x="1664" |
| | | d="M1191 104h177l-72 218l-12 47q-2 16 -2 20h-4l-3 -20q0 -1 -3.5 -18t-7.5 -29zM736 96q0 -12 -10 -24l-319 -319q-10 -9 -23 -9q-12 0 -23 9l-320 320q-15 16 -7 35q8 20 30 20h192v1376q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1376h192q14 0 23 -9t9 -23zM1661 -150 |
| | | v-106h-288v106h75l-47 144h-243l-47 -144h75v-106h-287v106h70l230 662h162l230 -662h70zM1572 1001v-233h-584v90l369 529q12 18 21 27l11 9v3q-2 0 -6.5 -0.5t-7.5 -0.5q-12 -3 -30 -3h-232v-115h-120v229h567v-89l-369 -530q-6 -8 -21 -26l-11 -10v-3l14 3q9 1 30 1h248 |
| | | v119h121z" /> |
| | | <glyph glyph-name="sort_by_attributes" unicode="" horiz-adv-x="1792" |
| | | d="M736 96q0 -12 -10 -24l-319 -319q-10 -9 -23 -9q-12 0 -23 9l-320 320q-15 16 -7 35q8 20 30 20h192v1376q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1376h192q14 0 23 -9t9 -23zM1792 -32v-192q0 -14 -9 -23t-23 -9h-832q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h832 |
| | | q14 0 23 -9t9 -23zM1600 480v-192q0 -14 -9 -23t-23 -9h-640q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h640q14 0 23 -9t9 -23zM1408 992v-192q0 -14 -9 -23t-23 -9h-448q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h448q14 0 23 -9t9 -23zM1216 1504v-192q0 -14 -9 -23t-23 -9h-256 |
| | | q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h256q14 0 23 -9t9 -23z" /> |
| | | <glyph glyph-name="sort_by_attributes_alt" unicode="" horiz-adv-x="1792" |
| | | d="M1216 -32v-192q0 -14 -9 -23t-23 -9h-256q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h256q14 0 23 -9t9 -23zM736 96q0 -12 -10 -24l-319 -319q-10 -9 -23 -9q-12 0 -23 9l-320 320q-15 16 -7 35q8 20 30 20h192v1376q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1376h192 |
| | | q14 0 23 -9t9 -23zM1408 480v-192q0 -14 -9 -23t-23 -9h-448q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h448q14 0 23 -9t9 -23zM1600 992v-192q0 -14 -9 -23t-23 -9h-640q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h640q14 0 23 -9t9 -23zM1792 1504v-192q0 -14 -9 -23t-23 -9h-832 |
| | | q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h832q14 0 23 -9t9 -23z" /> |
| | | <glyph glyph-name="sort_by_order" unicode="" |
| | | d="M1346 223q0 63 -44 116t-103 53q-52 0 -83 -37t-31 -94t36.5 -95t104.5 -38q50 0 85 27t35 68zM736 96q0 -12 -10 -24l-319 -319q-10 -9 -23 -9q-12 0 -23 9l-320 320q-15 16 -7 35q8 20 30 20h192v1376q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1376h192q14 0 23 -9t9 -23 |
| | | zM1486 165q0 -62 -13 -121.5t-41 -114t-68 -95.5t-98.5 -65.5t-127.5 -24.5q-62 0 -108 16q-24 8 -42 15l39 113q15 -7 31 -11q37 -13 75 -13q84 0 134.5 58.5t66.5 145.5h-2q-21 -23 -61.5 -37t-84.5 -14q-106 0 -173 71.5t-67 172.5q0 105 72 178t181 73q123 0 205 -94.5 |
| | | t82 -252.5zM1456 882v-114h-469v114h167v432q0 7 0.5 19t0.5 17v16h-2l-7 -12q-8 -13 -26 -31l-62 -58l-82 86l192 185h123v-654h165z" /> |
| | | <glyph glyph-name="sort_by_order_alt" unicode="" |
| | | d="M1346 1247q0 63 -44 116t-103 53q-52 0 -83 -37t-31 -94t36.5 -95t104.5 -38q50 0 85 27t35 68zM736 96q0 -12 -10 -24l-319 -319q-10 -9 -23 -9q-12 0 -23 9l-320 320q-15 16 -7 35q8 20 30 20h192v1376q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1376h192q14 0 23 -9 |
| | | t9 -23zM1456 -142v-114h-469v114h167v432q0 7 0.5 19t0.5 17v16h-2l-7 -12q-8 -13 -26 -31l-62 -58l-82 86l192 185h123v-654h165zM1486 1189q0 -62 -13 -121.5t-41 -114t-68 -95.5t-98.5 -65.5t-127.5 -24.5q-62 0 -108 16q-24 8 -42 15l39 113q15 -7 31 -11q37 -13 75 -13 |
| | | q84 0 134.5 58.5t66.5 145.5h-2q-21 -23 -61.5 -37t-84.5 -14q-106 0 -173 71.5t-67 172.5q0 105 72 178t181 73q123 0 205 -94.5t82 -252.5z" /> |
| | | <glyph glyph-name="_334" unicode="" horiz-adv-x="1664" |
| | | d="M256 192q0 26 -19 45t-45 19q-27 0 -45.5 -19t-18.5 -45q0 -27 18.5 -45.5t45.5 -18.5q26 0 45 18.5t19 45.5zM416 704v-640q0 -26 -19 -45t-45 -19h-288q-26 0 -45 19t-19 45v640q0 26 19 45t45 19h288q26 0 45 -19t19 -45zM1600 704q0 -86 -55 -149q15 -44 15 -76 |
| | | q3 -76 -43 -137q17 -56 0 -117q-15 -57 -54 -94q9 -112 -49 -181q-64 -76 -197 -78h-36h-76h-17q-66 0 -144 15.5t-121.5 29t-120.5 39.5q-123 43 -158 44q-26 1 -45 19.5t-19 44.5v641q0 25 18 43.5t43 20.5q24 2 76 59t101 121q68 87 101 120q18 18 31 48t17.5 48.5 |
| | | t13.5 60.5q7 39 12.5 61t19.5 52t34 50q19 19 45 19q46 0 82.5 -10.5t60 -26t40 -40.5t24 -45t12 -50t5 -45t0.5 -39q0 -38 -9.5 -76t-19 -60t-27.5 -56q-3 -6 -10 -18t-11 -22t-8 -24h277q78 0 135 -57t57 -135z" /> |
| | | <glyph glyph-name="_335" unicode="" horiz-adv-x="1664" |
| | | d="M256 960q0 -26 -19 -45t-45 -19q-27 0 -45.5 19t-18.5 45q0 27 18.5 45.5t45.5 18.5q26 0 45 -18.5t19 -45.5zM416 448v640q0 26 -19 45t-45 19h-288q-26 0 -45 -19t-19 -45v-640q0 -26 19 -45t45 -19h288q26 0 45 19t19 45zM1545 597q55 -61 55 -149q-1 -78 -57.5 -135 |
| | | t-134.5 -57h-277q4 -14 8 -24t11 -22t10 -18q18 -37 27 -57t19 -58.5t10 -76.5q0 -24 -0.5 -39t-5 -45t-12 -50t-24 -45t-40 -40.5t-60 -26t-82.5 -10.5q-26 0 -45 19q-20 20 -34 50t-19.5 52t-12.5 61q-9 42 -13.5 60.5t-17.5 48.5t-31 48q-33 33 -101 120q-49 64 -101 121 |
| | | t-76 59q-25 2 -43 20.5t-18 43.5v641q0 26 19 44.5t45 19.5q35 1 158 44q77 26 120.5 39.5t121.5 29t144 15.5h17h76h36q133 -2 197 -78q58 -69 49 -181q39 -37 54 -94q17 -61 0 -117q46 -61 43 -137q0 -32 -15 -76z" /> |
| | | <glyph glyph-name="youtube_sign" unicode="" |
| | | d="M919 233v157q0 50 -29 50q-17 0 -33 -16v-224q16 -16 33 -16q29 0 29 49zM1103 355h66v34q0 51 -33 51t-33 -51v-34zM532 621v-70h-80v-423h-74v423h-78v70h232zM733 495v-367h-67v40q-39 -45 -76 -45q-33 0 -42 28q-6 17 -6 54v290h66v-270q0 -24 1 -26q1 -15 15 -15 |
| | | q20 0 42 31v280h67zM985 384v-146q0 -52 -7 -73q-12 -42 -53 -42q-35 0 -68 41v-36h-67v493h67v-161q32 40 68 40q41 0 53 -42q7 -21 7 -74zM1236 255v-9q0 -29 -2 -43q-3 -22 -15 -40q-27 -40 -80 -40q-52 0 -81 38q-21 27 -21 86v129q0 59 20 86q29 38 80 38t78 -38 |
| | | q21 -29 21 -86v-76h-133v-65q0 -51 34 -51q24 0 30 26q0 1 0.5 7t0.5 16.5v21.5h68zM785 1079v-156q0 -51 -32 -51t-32 51v156q0 52 32 52t32 -52zM1318 366q0 177 -19 260q-10 44 -43 73.5t-76 34.5q-136 15 -412 15q-275 0 -411 -15q-44 -5 -76.5 -34.5t-42.5 -73.5 |
| | | q-20 -87 -20 -260q0 -176 20 -260q10 -43 42.5 -73t75.5 -35q137 -15 412 -15t412 15q43 5 75.5 35t42.5 73q20 84 20 260zM563 1017l90 296h-75l-51 -195l-53 195h-78q7 -23 23 -69l24 -69q35 -103 46 -158v-201h74v201zM852 936v130q0 58 -21 87q-29 38 -78 38 |
| | | q-51 0 -78 -38q-21 -29 -21 -87v-130q0 -58 21 -87q27 -38 78 -38q49 0 78 38q21 27 21 87zM1033 816h67v370h-67v-283q-22 -31 -42 -31q-15 0 -16 16q-1 2 -1 26v272h-67v-293q0 -37 6 -55q11 -27 43 -27q36 0 77 45v-40zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5 |
| | | h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> |
| | | <glyph glyph-name="youtube" unicode="" |
| | | d="M971 292v-211q0 -67 -39 -67q-23 0 -45 22v301q22 22 45 22q39 0 39 -67zM1309 291v-46h-90v46q0 68 45 68t45 -68zM343 509h107v94h-312v-94h105v-569h100v569zM631 -60h89v494h-89v-378q-30 -42 -57 -42q-18 0 -21 21q-1 3 -1 35v364h-89v-391q0 -49 8 -73 |
| | | q12 -37 58 -37q48 0 102 61v-54zM1060 88v197q0 73 -9 99q-17 56 -71 56q-50 0 -93 -54v217h-89v-663h89v48q45 -55 93 -55q54 0 71 55q9 27 9 100zM1398 98v13h-91q0 -51 -2 -61q-7 -36 -40 -36q-46 0 -46 69v87h179v103q0 79 -27 116q-39 51 -106 51q-68 0 -107 -51 |
| | | q-28 -37 -28 -116v-173q0 -79 29 -116q39 -51 108 -51q72 0 108 53q18 27 21 54q2 9 2 58zM790 1011v210q0 69 -43 69t-43 -69v-210q0 -70 43 -70t43 70zM1509 260q0 -234 -26 -350q-14 -59 -58 -99t-102 -46q-184 -21 -555 -21t-555 21q-58 6 -102.5 46t-57.5 99 |
| | | q-26 112 -26 350q0 234 26 350q14 59 58 99t103 47q183 20 554 20t555 -20q58 -7 102.5 -47t57.5 -99q26 -112 26 -350zM511 1536h102l-121 -399v-271h-100v271q-14 74 -61 212q-37 103 -65 187h106l71 -263zM881 1203v-175q0 -81 -28 -118q-38 -51 -106 -51q-67 0 -105 51 |
| | | q-28 38 -28 118v175q0 80 28 117q38 51 105 51q68 0 106 -51q28 -37 28 -117zM1216 1365v-499h-91v55q-53 -62 -103 -62q-46 0 -59 37q-8 24 -8 75v394h91v-367q0 -33 1 -35q3 -22 21 -22q27 0 57 43v381h91z" /> |
| | | <glyph glyph-name="xing" unicode="" horiz-adv-x="1408" |
| | | d="M597 869q-10 -18 -257 -456q-27 -46 -65 -46h-239q-21 0 -31 17t0 36l253 448q1 0 0 1l-161 279q-12 22 -1 37q9 15 32 15h239q40 0 66 -45zM1403 1511q11 -16 0 -37l-528 -934v-1l336 -615q11 -20 1 -37q-10 -15 -32 -15h-239q-42 0 -66 45l-339 622q18 32 531 942 |
| | | q25 45 64 45h241q22 0 31 -15z" /> |
| | | <glyph glyph-name="xing_sign" unicode="" |
| | | d="M685 771q0 1 -126 222q-21 34 -52 34h-184q-18 0 -26 -11q-7 -12 1 -29l125 -216v-1l-196 -346q-9 -14 0 -28q8 -13 24 -13h185q31 0 50 36zM1309 1268q-7 12 -24 12h-187q-30 0 -49 -35l-411 -729q1 -2 262 -481q20 -35 52 -35h184q18 0 25 12q8 13 -1 28l-260 476v1 |
| | | l409 723q8 16 0 28zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> |
| | | <glyph glyph-name="youtube_play" unicode="" horiz-adv-x="1792" |
| | | d="M711 408l484 250l-484 253v-503zM896 1270q168 0 324.5 -4.5t229.5 -9.5l73 -4q1 0 17 -1.5t23 -3t23.5 -4.5t28.5 -8t28 -13t31 -19.5t29 -26.5q6 -6 15.5 -18.5t29 -58.5t26.5 -101q8 -64 12.5 -136.5t5.5 -113.5v-40v-136q1 -145 -18 -290q-7 -55 -25 -99.5t-32 -61.5 |
| | | l-14 -17q-14 -15 -29 -26.5t-31 -19t-28 -12.5t-28.5 -8t-24 -4.5t-23 -3t-16.5 -1.5q-251 -19 -627 -19q-207 2 -359.5 6.5t-200.5 7.5l-49 4l-36 4q-36 5 -54.5 10t-51 21t-56.5 41q-6 6 -15.5 18.5t-29 58.5t-26.5 101q-8 64 -12.5 136.5t-5.5 113.5v40v136 |
| | | q-1 145 18 290q7 55 25 99.5t32 61.5l14 17q14 15 29 26.5t31 19.5t28 13t28.5 8t23.5 4.5t23 3t17 1.5q251 18 627 18z" /> |
| | | <glyph glyph-name="dropbox" unicode="" horiz-adv-x="1792" |
| | | d="M402 829l494 -305l-342 -285l-490 319zM1388 274v-108l-490 -293v-1l-1 1l-1 -1v1l-489 293v108l147 -96l342 284v2l1 -1l1 1v-2l343 -284zM554 1418l342 -285l-494 -304l-338 270zM1390 829l338 -271l-489 -319l-343 285zM1239 1418l489 -319l-338 -270l-494 304z" /> |
| | | <glyph glyph-name="stackexchange" unicode="" |
| | | d="M1289 -96h-1118v480h-160v-640h1438v640h-160v-480zM347 428l33 157l783 -165l-33 -156zM450 802l67 146l725 -339l-67 -145zM651 1158l102 123l614 -513l-102 -123zM1048 1536l477 -641l-128 -96l-477 641zM330 65v159h800v-159h-800z" /> |
| | | <glyph glyph-name="instagram" unicode="" |
| | | d="M1024 640q0 106 -75 181t-181 75t-181 -75t-75 -181t75 -181t181 -75t181 75t75 181zM1162 640q0 -164 -115 -279t-279 -115t-279 115t-115 279t115 279t279 115t279 -115t115 -279zM1270 1050q0 -38 -27 -65t-65 -27t-65 27t-27 65t27 65t65 27t65 -27t27 -65zM768 1270 |
| | | q-7 0 -76.5 0.5t-105.5 0t-96.5 -3t-103 -10t-71.5 -18.5q-50 -20 -88 -58t-58 -88q-11 -29 -18.5 -71.5t-10 -103t-3 -96.5t0 -105.5t0.5 -76.5t-0.5 -76.5t0 -105.5t3 -96.5t10 -103t18.5 -71.5q20 -50 58 -88t88 -58q29 -11 71.5 -18.5t103 -10t96.5 -3t105.5 0t76.5 0.5 |
| | | t76.5 -0.5t105.5 0t96.5 3t103 10t71.5 18.5q50 20 88 58t58 88q11 29 18.5 71.5t10 103t3 96.5t0 105.5t-0.5 76.5t0.5 76.5t0 105.5t-3 96.5t-10 103t-18.5 71.5q-20 50 -58 88t-88 58q-29 11 -71.5 18.5t-103 10t-96.5 3t-105.5 0t-76.5 -0.5zM1536 640q0 -229 -5 -317 |
| | | q-10 -208 -124 -322t-322 -124q-88 -5 -317 -5t-317 5q-208 10 -322 124t-124 322q-5 88 -5 317t5 317q10 208 124 322t322 124q88 5 317 5t317 -5q208 -10 322 -124t124 -322q5 -88 5 -317z" /> |
| | | <glyph glyph-name="flickr" unicode="" |
| | | d="M1248 1408q119 0 203.5 -84.5t84.5 -203.5v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960zM698 640q0 88 -62 150t-150 62t-150 -62t-62 -150t62 -150t150 -62t150 62t62 150zM1262 640q0 88 -62 150 |
| | | t-150 62t-150 -62t-62 -150t62 -150t150 -62t150 62t62 150z" /> |
| | | <glyph glyph-name="adn" unicode="" |
| | | d="M768 914l201 -306h-402zM1133 384h94l-459 691l-459 -691h94l104 160h522zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> |
| | | <glyph glyph-name="f171" unicode="" horiz-adv-x="1408" |
| | | d="M815 677q8 -63 -50.5 -101t-111.5 -6q-39 17 -53.5 58t-0.5 82t52 58q36 18 72.5 12t64 -35.5t27.5 -67.5zM926 698q-14 107 -113 164t-197 13q-63 -28 -100.5 -88.5t-34.5 -129.5q4 -91 77.5 -155t165.5 -56q91 8 152 84t50 168zM1165 1240q-20 27 -56 44.5t-58 22 |
| | | t-71 12.5q-291 47 -566 -2q-43 -7 -66 -12t-55 -22t-50 -43q30 -28 76 -45.5t73.5 -22t87.5 -11.5q228 -29 448 -1q63 8 89.5 12t72.5 21.5t75 46.5zM1222 205q-8 -26 -15.5 -76.5t-14 -84t-28.5 -70t-58 -56.5q-86 -48 -189.5 -71.5t-202 -22t-201.5 18.5q-46 8 -81.5 18 |
| | | t-76.5 27t-73 43.5t-52 61.5q-25 96 -57 292l6 16l18 9q223 -148 506.5 -148t507.5 148q21 -6 24 -23t-5 -45t-8 -37zM1403 1166q-26 -167 -111 -655q-5 -30 -27 -56t-43.5 -40t-54.5 -31q-252 -126 -610 -88q-248 27 -394 139q-15 12 -25.5 26.5t-17 35t-9 34t-6 39.5 |
| | | t-5.5 35q-9 50 -26.5 150t-28 161.5t-23.5 147.5t-22 158q3 26 17.5 48.5t31.5 37.5t45 30t46 22.5t48 18.5q125 46 313 64q379 37 676 -50q155 -46 215 -122q16 -20 16.5 -51t-5.5 -54z" /> |
| | | <glyph glyph-name="bitbucket_sign" unicode="" |
| | | d="M848 666q0 43 -41 66t-77 1q-43 -20 -42.5 -72.5t43.5 -70.5q39 -23 81 4t36 72zM928 682q8 -66 -36 -121t-110 -61t-119 40t-56 113q-2 49 25.5 93t72.5 64q70 31 141.5 -10t81.5 -118zM1100 1073q-20 -21 -53.5 -34t-53 -16t-63.5 -8q-155 -20 -324 0q-44 6 -63 9.5 |
| | | t-52.5 16t-54.5 32.5q13 19 36 31t40 15.5t47 8.5q198 35 408 1q33 -5 51 -8.5t43 -16t39 -31.5zM1142 327q0 7 5.5 26.5t3 32t-17.5 16.5q-161 -106 -365 -106t-366 106l-12 -6l-5 -12q26 -154 41 -210q47 -81 204 -108q249 -46 428 53q34 19 49 51.5t22.5 85.5t12.5 71z |
| | | M1272 1020q9 53 -8 75q-43 55 -155 88q-216 63 -487 36q-132 -12 -226 -46q-38 -15 -59.5 -25t-47 -34t-29.5 -54q8 -68 19 -138t29 -171t24 -137q1 -5 5 -31t7 -36t12 -27t22 -28q105 -80 284 -100q259 -28 440 63q24 13 39.5 23t31 29t19.5 40q48 267 80 473zM1536 1120 |
| | | v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> |
| | | <glyph glyph-name="tumblr" unicode="" horiz-adv-x="1024" |
| | | d="M944 207l80 -237q-23 -35 -111 -66t-177 -32q-104 -2 -190.5 26t-142.5 74t-95 106t-55.5 120t-16.5 118v544h-168v215q72 26 129 69.5t91 90t58 102t34 99t15 88.5q1 5 4.5 8.5t7.5 3.5h244v-424h333v-252h-334v-518q0 -30 6.5 -56t22.5 -52.5t49.5 -41.5t81.5 -14 |
| | | q78 2 134 29z" /> |
| | | <glyph glyph-name="tumblr_sign" unicode="" |
| | | d="M1136 75l-62 183q-44 -22 -103 -22q-36 -1 -62 10.5t-38.5 31.5t-17.5 40.5t-5 43.5v398h257v194h-256v326h-188q-8 0 -9 -10q-5 -44 -17.5 -87t-39 -95t-77 -95t-118.5 -68v-165h130v-418q0 -57 21.5 -115t65 -111t121 -85.5t176.5 -30.5q69 1 136.5 25t85.5 50z |
| | | M1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> |
| | | <glyph glyph-name="long_arrow_down" unicode="" horiz-adv-x="768" |
| | | d="M765 237q8 -19 -5 -35l-350 -384q-10 -10 -23 -10q-14 0 -24 10l-355 384q-13 16 -5 35q9 19 29 19h224v1248q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-1248h224q21 0 29 -19z" /> |
| | | <glyph glyph-name="long_arrow_up" unicode="" horiz-adv-x="768" |
| | | d="M765 1043q-9 -19 -29 -19h-224v-1248q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v1248h-224q-21 0 -29 19t5 35l350 384q10 10 23 10q14 0 24 -10l355 -384q13 -16 5 -35z" /> |
| | | <glyph glyph-name="long_arrow_left" unicode="" horiz-adv-x="1792" |
| | | d="M1792 736v-192q0 -14 -9 -23t-23 -9h-1248v-224q0 -21 -19 -29t-35 5l-384 350q-10 10 -10 23q0 14 10 24l384 354q16 14 35 6q19 -9 19 -29v-224h1248q14 0 23 -9t9 -23z" /> |
| | | <glyph glyph-name="long_arrow_right" unicode="" horiz-adv-x="1792" |
| | | d="M1728 643q0 -14 -10 -24l-384 -354q-16 -14 -35 -6q-19 9 -19 29v224h-1248q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h1248v224q0 21 19 29t35 -5l384 -350q10 -10 10 -23z" /> |
| | | <glyph glyph-name="apple" unicode="" horiz-adv-x="1408" |
| | | d="M1393 321q-39 -125 -123 -250q-129 -196 -257 -196q-49 0 -140 32q-86 32 -151 32q-61 0 -142 -33q-81 -34 -132 -34q-152 0 -301 259q-147 261 -147 503q0 228 113 374q113 144 284 144q72 0 177 -30q104 -30 138 -30q45 0 143 34q102 34 173 34q119 0 213 -65 |
| | | q52 -36 104 -100q-79 -67 -114 -118q-65 -94 -65 -207q0 -124 69 -223t158 -126zM1017 1494q0 -61 -29 -136q-30 -75 -93 -138q-54 -54 -108 -72q-37 -11 -104 -17q3 149 78 257q74 107 250 148q1 -3 2.5 -11t2.5 -11q0 -4 0.5 -10t0.5 -10z" /> |
| | | <glyph glyph-name="windows" unicode="" horiz-adv-x="1664" |
| | | d="M682 530v-651l-682 94v557h682zM682 1273v-659h-682v565zM1664 530v-786l-907 125v661h907zM1664 1408v-794h-907v669z" /> |
| | | <glyph glyph-name="android" unicode="" horiz-adv-x="1408" |
| | | d="M493 1053q16 0 27.5 11.5t11.5 27.5t-11.5 27.5t-27.5 11.5t-27 -11.5t-11 -27.5t11 -27.5t27 -11.5zM915 1053q16 0 27 11.5t11 27.5t-11 27.5t-27 11.5t-27.5 -11.5t-11.5 -27.5t11.5 -27.5t27.5 -11.5zM103 869q42 0 72 -30t30 -72v-430q0 -43 -29.5 -73t-72.5 -30 |
| | | t-73 30t-30 73v430q0 42 30 72t73 30zM1163 850v-666q0 -46 -32 -78t-77 -32h-75v-227q0 -43 -30 -73t-73 -30t-73 30t-30 73v227h-138v-227q0 -43 -30 -73t-73 -30q-42 0 -72 30t-30 73l-1 227h-74q-46 0 -78 32t-32 78v666h918zM931 1255q107 -55 171 -153.5t64 -215.5 |
| | | h-925q0 117 64 215.5t172 153.5l-71 131q-7 13 5 20q13 6 20 -6l72 -132q95 42 201 42t201 -42l72 132q7 12 20 6q12 -7 5 -20zM1408 767v-430q0 -43 -30 -73t-73 -30q-42 0 -72 30t-30 73v430q0 43 30 72.5t72 29.5q43 0 73 -29.5t30 -72.5z" /> |
| | | <glyph glyph-name="linux" unicode="" |
| | | d="M663 1125q-11 -1 -15.5 -10.5t-8.5 -9.5q-5 -1 -5 5q0 12 19 15h10zM750 1111q-4 -1 -11.5 6.5t-17.5 4.5q24 11 32 -2q3 -6 -3 -9zM399 684q-4 1 -6 -3t-4.5 -12.5t-5.5 -13.5t-10 -13q-10 -11 -1 -12q4 -1 12.5 7t12.5 18q1 3 2 7t2 6t1.5 4.5t0.5 4v3t-1 2.5t-3 2z |
| | | M1254 325q0 18 -55 42q4 15 7.5 27.5t5 26t3 21.5t0.5 22.5t-1 19.5t-3.5 22t-4 20.5t-5 25t-5.5 26.5q-10 48 -47 103t-72 75q24 -20 57 -83q87 -162 54 -278q-11 -40 -50 -42q-31 -4 -38.5 18.5t-8 83.5t-11.5 107q-9 39 -19.5 69t-19.5 45.5t-15.5 24.5t-13 15t-7.5 7 |
| | | q-14 62 -31 103t-29.5 56t-23.5 33t-15 40q-4 21 6 53.5t4.5 49.5t-44.5 25q-15 3 -44.5 18t-35.5 16q-8 1 -11 26t8 51t36 27q37 3 51 -30t4 -58q-11 -19 -2 -26.5t30 -0.5q13 4 13 36v37q-5 30 -13.5 50t-21 30.5t-23.5 15t-27 7.5q-107 -8 -89 -134q0 -15 -1 -15 |
| | | q-9 9 -29.5 10.5t-33 -0.5t-15.5 5q1 57 -16 90t-45 34q-27 1 -41.5 -27.5t-16.5 -59.5q-1 -15 3.5 -37t13 -37.5t15.5 -13.5q10 3 16 14q4 9 -7 8q-7 0 -15.5 14.5t-9.5 33.5q-1 22 9 37t34 14q17 0 27 -21t9.5 -39t-1.5 -22q-22 -15 -31 -29q-8 -12 -27.5 -23.5 |
| | | t-20.5 -12.5q-13 -14 -15.5 -27t7.5 -18q14 -8 25 -19.5t16 -19t18.5 -13t35.5 -6.5q47 -2 102 15q2 1 23 7t34.5 10.5t29.5 13t21 17.5q9 14 20 8q5 -3 6.5 -8.5t-3 -12t-16.5 -9.5q-20 -6 -56.5 -21.5t-45.5 -19.5q-44 -19 -70 -23q-25 -5 -79 2q-10 2 -9 -2t17 -19 |
| | | q25 -23 67 -22q17 1 36 7t36 14t33.5 17.5t30 17t24.5 12t17.5 2.5t8.5 -11q0 -2 -1 -4.5t-4 -5t-6 -4.5t-8.5 -5t-9 -4.5t-10 -5t-9.5 -4.5q-28 -14 -67.5 -44t-66.5 -43t-49 -1q-21 11 -63 73q-22 31 -25 22q-1 -3 -1 -10q0 -25 -15 -56.5t-29.5 -55.5t-21 -58t11.5 -63 |
| | | q-23 -6 -62.5 -90t-47.5 -141q-2 -18 -1.5 -69t-5.5 -59q-8 -24 -29 -3q-32 31 -36 94q-2 28 4 56q4 19 -1 18q-2 -1 -4 -5q-36 -65 10 -166q5 -12 25 -28t24 -20q20 -23 104 -90.5t93 -76.5q16 -15 17.5 -38t-14 -43t-45.5 -23q8 -15 29 -44.5t28 -54t7 -70.5q46 24 7 92 |
| | | q-4 8 -10.5 16t-9.5 12t-2 6q3 5 13 9.5t20 -2.5q46 -52 166 -36q133 15 177 87q23 38 34 30q12 -6 10 -52q-1 -25 -23 -92q-9 -23 -6 -37.5t24 -15.5q3 19 14.5 77t13.5 90q2 21 -6.5 73.5t-7.5 97t23 70.5q15 18 51 18q1 37 34.5 53t72.5 10.5t60 -22.5zM626 1152 |
| | | q3 17 -2.5 30t-11.5 15q-9 2 -9 -7q2 -5 5 -6q10 0 7 -15q-3 -20 8 -20q3 0 3 3zM1045 955q-2 8 -6.5 11.5t-13 5t-14.5 5.5q-5 3 -9.5 8t-7 8t-5.5 6.5t-4 4t-4 -1.5q-14 -16 7 -43.5t39 -31.5q9 -1 14.5 8t3.5 20zM867 1168q0 11 -5 19.5t-11 12.5t-9 3q-6 0 -8 -2t0 -4 |
| | | t5 -3q14 -4 18 -31q0 -3 8 2q2 2 2 3zM921 1401q0 2 -2.5 5t-9 7t-9.5 6q-15 15 -24 15q-9 -1 -11.5 -7.5t-1 -13t-0.5 -12.5q-1 -4 -6 -10.5t-6 -9t3 -8.5q4 -3 8 0t11 9t15 9q1 1 9 1t15 2t9 7zM1486 60q20 -12 31 -24.5t12 -24t-2.5 -22.5t-15.5 -22t-23.5 -19.5 |
| | | t-30 -18.5t-31.5 -16.5t-32 -15.5t-27 -13q-38 -19 -85.5 -56t-75.5 -64q-17 -16 -68 -19.5t-89 14.5q-18 9 -29.5 23.5t-16.5 25.5t-22 19.5t-47 9.5q-44 1 -130 1q-19 0 -57 -1.5t-58 -2.5q-44 -1 -79.5 -15t-53.5 -30t-43.5 -28.5t-53.5 -11.5q-29 1 -111 31t-146 43 |
| | | q-19 4 -51 9.5t-50 9t-39.5 9.5t-33.5 14.5t-17 19.5q-10 23 7 66.5t18 54.5q1 16 -4 40t-10 42.5t-4.5 36.5t10.5 27q14 12 57 14t60 12q30 18 42 35t12 51q21 -73 -32 -106q-32 -20 -83 -15q-34 3 -43 -10q-13 -15 5 -57q2 -6 8 -18t8.5 -18t4.5 -17t1 -22q0 -15 -17 -49 |
| | | t-14 -48q3 -17 37 -26q20 -6 84.5 -18.5t99.5 -20.5q24 -6 74 -22t82.5 -23t55.5 -4q43 6 64.5 28t23 48t-7.5 58.5t-19 52t-20 36.5q-121 190 -169 242q-68 74 -113 40q-11 -9 -15 15q-3 16 -2 38q1 29 10 52t24 47t22 42q8 21 26.5 72t29.5 78t30 61t39 54 |
| | | q110 143 124 195q-12 112 -16 310q-2 90 24 151.5t106 104.5q39 21 104 21q53 1 106 -13.5t89 -41.5q57 -42 91.5 -121.5t29.5 -147.5q-5 -95 30 -214q34 -113 133 -218q55 -59 99.5 -163t59.5 -191q8 -49 5 -84.5t-12 -55.5t-20 -22q-10 -2 -23.5 -19t-27 -35.5 |
| | | t-40.5 -33.5t-61 -14q-18 1 -31.5 5t-22.5 13.5t-13.5 15.5t-11.5 20.5t-9 19.5q-22 37 -41 30t-28 -49t7 -97q20 -70 1 -195q-10 -65 18 -100.5t73 -33t85 35.5q59 49 89.5 66.5t103.5 42.5q53 18 77 36.5t18.5 34.5t-25 28.5t-51.5 23.5q-33 11 -49.5 48t-15 72.5 |
| | | t15.5 47.5q1 -31 8 -56.5t14.5 -40.5t20.5 -28.5t21 -19t21.5 -13t16.5 -9.5z" /> |
| | | <glyph glyph-name="dribble" unicode="" |
| | | d="M1024 36q-42 241 -140 498h-2l-2 -1q-16 -6 -43 -16.5t-101 -49t-137 -82t-131 -114.5t-103 -148l-15 11q184 -150 418 -150q132 0 256 52zM839 643q-21 49 -53 111q-311 -93 -673 -93q-1 -7 -1 -21q0 -124 44 -236.5t124 -201.5q50 89 123.5 166.5t142.5 124.5t130.5 81 |
| | | t99.5 48l37 13q4 1 13 3.5t13 4.5zM732 855q-120 213 -244 378q-138 -65 -234 -186t-128 -272q302 0 606 80zM1416 536q-210 60 -409 29q87 -239 128 -469q111 75 185 189.5t96 250.5zM611 1277q-1 0 -2 -1q1 1 2 1zM1201 1132q-185 164 -433 164q-76 0 -155 -19 |
| | | q131 -170 246 -382q69 26 130 60.5t96.5 61.5t65.5 57t37.5 40.5zM1424 647q-3 232 -149 410l-1 -1q-9 -12 -19 -24.5t-43.5 -44.5t-71 -60.5t-100 -65t-131.5 -64.5q25 -53 44 -95q2 -5 6.5 -17t7.5 -17q36 5 74.5 7t73.5 2t69 -1.5t64 -4t56.5 -5.5t48 -6.5t36.5 -6 |
| | | t25 -4.5zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> |
| | | <glyph glyph-name="skype" unicode="" |
| | | d="M1173 473q0 50 -19.5 91.5t-48.5 68.5t-73 49t-82.5 34t-87.5 23l-104 24q-30 7 -44 10.5t-35 11.5t-30 16t-16.5 21t-7.5 30q0 77 144 77q43 0 77 -12t54 -28.5t38 -33.5t40 -29t48 -12q47 0 75.5 32t28.5 77q0 55 -56 99.5t-142 67.5t-182 23q-68 0 -132 -15.5 |
| | | t-119.5 -47t-89 -87t-33.5 -128.5q0 -61 19 -106.5t56 -75.5t80 -48.5t103 -32.5l146 -36q90 -22 112 -36q32 -20 32 -60q0 -39 -40 -64.5t-105 -25.5q-51 0 -91.5 16t-65 38.5t-45.5 45t-46 38.5t-54 16q-50 0 -75.5 -30t-25.5 -75q0 -92 122 -157.5t291 -65.5 |
| | | q73 0 140 18.5t122.5 53.5t88.5 93.5t33 131.5zM1536 256q0 -159 -112.5 -271.5t-271.5 -112.5q-130 0 -234 80q-77 -16 -150 -16q-143 0 -273.5 55.5t-225 150t-150 225t-55.5 273.5q0 73 16 150q-80 104 -80 234q0 159 112.5 271.5t271.5 112.5q130 0 234 -80 |
| | | q77 16 150 16q143 0 273.5 -55.5t225 -150t150 -225t55.5 -273.5q0 -73 -16 -150q80 -104 80 -234z" /> |
| | | <glyph glyph-name="foursquare" unicode="" horiz-adv-x="1280" |
| | | d="M1000 1102l37 194q5 23 -9 40t-35 17h-712q-23 0 -38.5 -17t-15.5 -37v-1101q0 -7 6 -1l291 352q23 26 38 33.5t48 7.5h239q22 0 37 14.5t18 29.5q24 130 37 191q4 21 -11.5 40t-36.5 19h-294q-29 0 -48 19t-19 48v42q0 29 19 47.5t48 18.5h346q18 0 35 13.5t20 29.5z |
| | | M1227 1324q-15 -73 -53.5 -266.5t-69.5 -350t-35 -173.5q-6 -22 -9 -32.5t-14 -32.5t-24.5 -33t-38.5 -21t-58 -10h-271q-13 0 -22 -10q-8 -9 -426 -494q-22 -25 -58.5 -28.5t-48.5 5.5q-55 22 -55 98v1410q0 55 38 102.5t120 47.5h888q95 0 127 -53t10 -159zM1227 1324 |
| | | l-158 -790q4 17 35 173.5t69.5 350t53.5 266.5z" /> |
| | | <glyph glyph-name="trello" unicode="" |
| | | d="M704 192v1024q0 14 -9 23t-23 9h-480q-14 0 -23 -9t-9 -23v-1024q0 -14 9 -23t23 -9h480q14 0 23 9t9 23zM1376 576v640q0 14 -9 23t-23 9h-480q-14 0 -23 -9t-9 -23v-640q0 -14 9 -23t23 -9h480q14 0 23 9t9 23zM1536 1344v-1408q0 -26 -19 -45t-45 -19h-1408 |
| | | q-26 0 -45 19t-19 45v1408q0 26 19 45t45 19h1408q26 0 45 -19t19 -45z" /> |
| | | <glyph glyph-name="female" unicode="" horiz-adv-x="1280" |
| | | d="M1280 480q0 -40 -28 -68t-68 -28q-51 0 -80 43l-227 341h-45v-132l247 -411q9 -15 9 -33q0 -26 -19 -45t-45 -19h-192v-272q0 -46 -33 -79t-79 -33h-160q-46 0 -79 33t-33 79v272h-192q-26 0 -45 19t-19 45q0 18 9 33l247 411v132h-45l-227 -341q-29 -43 -80 -43 |
| | | q-40 0 -68 28t-28 68q0 29 16 53l256 384q73 107 176 107h384q103 0 176 -107l256 -384q16 -24 16 -53zM864 1280q0 -93 -65.5 -158.5t-158.5 -65.5t-158.5 65.5t-65.5 158.5t65.5 158.5t158.5 65.5t158.5 -65.5t65.5 -158.5z" /> |
| | | <glyph glyph-name="male" unicode="" horiz-adv-x="1024" |
| | | d="M1024 832v-416q0 -40 -28 -68t-68 -28t-68 28t-28 68v352h-64v-912q0 -46 -33 -79t-79 -33t-79 33t-33 79v464h-64v-464q0 -46 -33 -79t-79 -33t-79 33t-33 79v912h-64v-352q0 -40 -28 -68t-68 -28t-68 28t-28 68v416q0 80 56 136t136 56h640q80 0 136 -56t56 -136z |
| | | M736 1280q0 -93 -65.5 -158.5t-158.5 -65.5t-158.5 65.5t-65.5 158.5t65.5 158.5t158.5 65.5t158.5 -65.5t65.5 -158.5z" /> |
| | | <glyph glyph-name="gittip" unicode="" |
| | | d="M773 234l350 473q16 22 24.5 59t-6 85t-61.5 79q-40 26 -83 25.5t-73.5 -17.5t-54.5 -45q-36 -40 -96 -40q-59 0 -95 40q-24 28 -54.5 45t-73.5 17.5t-84 -25.5q-46 -31 -60.5 -79t-6 -85t24.5 -59zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103 |
| | | t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> |
| | | <glyph glyph-name="sun" unicode="" horiz-adv-x="1792" |
| | | d="M1472 640q0 117 -45.5 223.5t-123 184t-184 123t-223.5 45.5t-223.5 -45.5t-184 -123t-123 -184t-45.5 -223.5t45.5 -223.5t123 -184t184 -123t223.5 -45.5t223.5 45.5t184 123t123 184t45.5 223.5zM1748 363q-4 -15 -20 -20l-292 -96v-306q0 -16 -13 -26q-15 -10 -29 -4 |
| | | l-292 94l-180 -248q-10 -13 -26 -13t-26 13l-180 248l-292 -94q-14 -6 -29 4q-13 10 -13 26v306l-292 96q-16 5 -20 20q-5 17 4 29l180 248l-180 248q-9 13 -4 29q4 15 20 20l292 96v306q0 16 13 26q15 10 29 4l292 -94l180 248q9 12 26 12t26 -12l180 -248l292 94 |
| | | q14 6 29 -4q13 -10 13 -26v-306l292 -96q16 -5 20 -20q5 -16 -4 -29l-180 -248l180 -248q9 -12 4 -29z" /> |
| | | <glyph glyph-name="_366" unicode="" |
| | | d="M1262 233q-54 -9 -110 -9q-182 0 -337 90t-245 245t-90 337q0 192 104 357q-201 -60 -328.5 -229t-127.5 -384q0 -130 51 -248.5t136.5 -204t204 -136.5t248.5 -51q144 0 273.5 61.5t220.5 171.5zM1465 318q-94 -203 -283.5 -324.5t-413.5 -121.5q-156 0 -298 61 |
| | | t-245 164t-164 245t-61 298q0 153 57.5 292.5t156 241.5t235.5 164.5t290 68.5q44 2 61 -39q18 -41 -15 -72q-86 -78 -131.5 -181.5t-45.5 -218.5q0 -148 73 -273t198 -198t273 -73q118 0 228 51q41 18 72 -13q14 -14 17.5 -34t-4.5 -38z" /> |
| | | <glyph glyph-name="archive" unicode="" horiz-adv-x="1792" |
| | | d="M1088 704q0 26 -19 45t-45 19h-256q-26 0 -45 -19t-19 -45t19 -45t45 -19h256q26 0 45 19t19 45zM1664 896v-960q0 -26 -19 -45t-45 -19h-1408q-26 0 -45 19t-19 45v960q0 26 19 45t45 19h1408q26 0 45 -19t19 -45zM1728 1344v-256q0 -26 -19 -45t-45 -19h-1536 |
| | | q-26 0 -45 19t-19 45v256q0 26 19 45t45 19h1536q26 0 45 -19t19 -45z" /> |
| | | <glyph glyph-name="bug" unicode="" horiz-adv-x="1664" |
| | | d="M1632 576q0 -26 -19 -45t-45 -19h-224q0 -171 -67 -290l208 -209q19 -19 19 -45t-19 -45q-18 -19 -45 -19t-45 19l-198 197q-5 -5 -15 -13t-42 -28.5t-65 -36.5t-82 -29t-97 -13v896h-128v-896q-51 0 -101.5 13.5t-87 33t-66 39t-43.5 32.5l-15 14l-183 -207 |
| | | q-20 -21 -48 -21q-24 0 -43 16q-19 18 -20.5 44.5t15.5 46.5l202 227q-58 114 -58 274h-224q-26 0 -45 19t-19 45t19 45t45 19h224v294l-173 173q-19 19 -19 45t19 45t45 19t45 -19l173 -173h844l173 173q19 19 45 19t45 -19t19 -45t-19 -45l-173 -173v-294h224q26 0 45 -19 |
| | | t19 -45zM1152 1152h-640q0 133 93.5 226.5t226.5 93.5t226.5 -93.5t93.5 -226.5z" /> |
| | | <glyph glyph-name="vk" unicode="" horiz-adv-x="1920" |
| | | d="M1917 1016q23 -64 -150 -294q-24 -32 -65 -85q-40 -51 -55 -72t-30.5 -49.5t-12 -42t13 -34.5t32.5 -43t57 -53q4 -2 5 -4q141 -131 191 -221q3 -5 6.5 -12.5t7 -26.5t-0.5 -34t-25 -27.5t-59 -12.5l-256 -4q-24 -5 -56 5t-52 22l-20 12q-30 21 -70 64t-68.5 77.5t-61 58 |
| | | t-56.5 15.5q-3 -1 -8 -3.5t-17 -14.5t-21.5 -29.5t-17 -52t-6.5 -77.5q0 -15 -3.5 -27.5t-7.5 -18.5l-4 -5q-18 -19 -53 -22h-115q-71 -4 -146 16.5t-131.5 53t-103 66t-70.5 57.5l-25 24q-10 10 -27.5 30t-71.5 91t-106 151t-122.5 211t-130.5 272q-6 16 -6 27t3 16l4 6 |
| | | q15 19 57 19l274 2q12 -2 23 -6.5t16 -8.5l5 -3q16 -11 24 -32q20 -50 46 -103.5t41 -81.5l16 -29q29 -60 56 -104t48.5 -68.5t41.5 -38.5t34 -14t27 5q2 1 5 5t12 22t13.5 47t9.5 81t0 125q-2 40 -9 73t-14 46l-6 12q-25 34 -85 43q-13 2 5 24q16 19 38 30q53 26 239 24 |
| | | q82 -1 135 -13q20 -5 33.5 -13.5t20.5 -24t10.5 -32t3.5 -45.5t-1 -55t-2.5 -70.5t-1.5 -82.5q0 -11 -1 -42t-0.5 -48t3.5 -40.5t11.5 -39t22.5 -24.5q8 -2 17 -4t26 11t38 34.5t52 67t68 107.5q60 104 107 225q4 10 10 17.5t11 10.5l4 3l5 2.5t13 3t20 0.5l288 2 |
| | | q39 5 64 -2.5t31 -16.5z" /> |
| | | <glyph glyph-name="weibo" unicode="" horiz-adv-x="1792" |
| | | d="M675 252q21 34 11 69t-45 50q-34 14 -73 1t-60 -46q-22 -34 -13 -68.5t43 -50.5t74.5 -2.5t62.5 47.5zM769 373q8 13 3.5 26.5t-17.5 18.5q-14 5 -28.5 -0.5t-21.5 -18.5q-17 -31 13 -45q14 -5 29 0.5t22 18.5zM943 266q-45 -102 -158 -150t-224 -12 |
| | | q-107 34 -147.5 126.5t6.5 187.5q47 93 151.5 139t210.5 19q111 -29 158.5 -119.5t2.5 -190.5zM1255 426q-9 96 -89 170t-208.5 109t-274.5 21q-223 -23 -369.5 -141.5t-132.5 -264.5q9 -96 89 -170t208.5 -109t274.5 -21q223 23 369.5 141.5t132.5 264.5zM1563 422 |
| | | q0 -68 -37 -139.5t-109 -137t-168.5 -117.5t-226 -83t-270.5 -31t-275 33.5t-240.5 93t-171.5 151t-65 199.5q0 115 69.5 245t197.5 258q169 169 341.5 236t246.5 -7q65 -64 20 -209q-4 -14 -1 -20t10 -7t14.5 0.5t13.5 3.5l6 2q139 59 246 59t153 -61q45 -63 0 -178 |
| | | q-2 -13 -4.5 -20t4.5 -12.5t12 -7.5t17 -6q57 -18 103 -47t80 -81.5t34 -116.5zM1489 1046q42 -47 54.5 -108.5t-6.5 -117.5q-8 -23 -29.5 -34t-44.5 -4q-23 8 -34 29.5t-4 44.5q20 63 -24 111t-107 35q-24 -5 -45 8t-25 37q-5 24 8 44.5t37 25.5q60 13 119 -5.5t101 -65.5z |
| | | M1670 1209q87 -96 112.5 -222.5t-13.5 -241.5q-9 -27 -34 -40t-52 -4t-40 34t-5 52q28 82 10 172t-80 158q-62 69 -148 95.5t-173 8.5q-28 -6 -52 9.5t-30 43.5t9.5 51.5t43.5 29.5q123 26 244 -11.5t208 -134.5z" /> |
| | | <glyph glyph-name="renren" unicode="" |
| | | d="M1133 -34q-171 -94 -368 -94q-196 0 -367 94q138 87 235.5 211t131.5 268q35 -144 132.5 -268t235.5 -211zM638 1394v-485q0 -252 -126.5 -459.5t-330.5 -306.5q-181 215 -181 495q0 187 83.5 349.5t229.5 269.5t325 137zM1536 638q0 -280 -181 -495 |
| | | q-204 99 -330.5 306.5t-126.5 459.5v485q179 -30 325 -137t229.5 -269.5t83.5 -349.5z" /> |
| | | <glyph glyph-name="_372" unicode="" horiz-adv-x="1408" |
| | | d="M1402 433q-32 -80 -76 -138t-91 -88.5t-99 -46.5t-101.5 -14.5t-96.5 8.5t-86.5 22t-69.5 27.5t-46 22.5l-17 10q-113 -228 -289.5 -359.5t-384.5 -132.5q-19 0 -32 13t-13 32t13 31.5t32 12.5q173 1 322.5 107.5t251.5 294.5q-36 -14 -72 -23t-83 -13t-91 2.5t-93 28.5 |
| | | t-92 59t-84.5 100t-74.5 146q114 47 214 57t167.5 -7.5t124.5 -56.5t88.5 -77t56.5 -82q53 131 79 291q-7 -1 -18 -2.5t-46.5 -2.5t-69.5 0.5t-81.5 10t-88.5 23t-84 42.5t-75 65t-54.5 94.5t-28.5 127.5q70 28 133.5 36.5t112.5 -1t92 -30t73.5 -50t56 -61t42 -63t27.5 -56 |
| | | t16 -39.5l4 -16q12 122 12 195q-8 6 -21.5 16t-49 44.5t-63.5 71.5t-54 93t-33 112.5t12 127t70 138.5q73 -25 127.5 -61.5t84.5 -76.5t48 -85t20.5 -89t-0.5 -85.5t-13 -76.5t-19 -62t-17 -42l-7 -15q1 -4 1 -50t-1 -72q3 7 10 18.5t30.5 43t50.5 58t71 55.5t91.5 44.5 |
| | | t112 14.5t132.5 -24q-2 -78 -21.5 -141.5t-50 -104.5t-69.5 -71.5t-81.5 -45.5t-84.5 -24t-80 -9.5t-67.5 1t-46.5 4.5l-17 3q-23 -147 -73 -283q6 7 18 18.5t49.5 41t77.5 52.5t99.5 42t117.5 20t129 -23.5t137 -77.5z" /> |
| | | <glyph glyph-name="stack_exchange" unicode="" horiz-adv-x="1280" |
| | | d="M1259 283v-66q0 -85 -57.5 -144.5t-138.5 -59.5h-57l-260 -269v269h-529q-81 0 -138.5 59.5t-57.5 144.5v66h1238zM1259 609v-255h-1238v255h1238zM1259 937v-255h-1238v255h1238zM1259 1077v-67h-1238v67q0 84 57.5 143.5t138.5 59.5h846q81 0 138.5 -59.5t57.5 -143.5z |
| | | " /> |
| | | <glyph glyph-name="_374" unicode="" |
| | | d="M1152 640q0 -14 -9 -23l-320 -320q-9 -9 -23 -9q-13 0 -22.5 9.5t-9.5 22.5v192h-352q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h352v192q0 14 9 23t23 9q12 0 24 -10l319 -319q9 -9 9 -23zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198 |
| | | t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> |
| | | <glyph glyph-name="arrow_circle_alt_left" unicode="" |
| | | d="M1152 736v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-352v-192q0 -14 -9 -23t-23 -9q-12 0 -24 10l-319 319q-9 9 -9 23t9 23l320 320q9 9 23 9q13 0 22.5 -9.5t9.5 -22.5v-192h352q13 0 22.5 -9.5t9.5 -22.5zM1312 640q0 148 -73 273t-198 198t-273 73t-273 -73t-198 -198 |
| | | t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> |
| | | <glyph glyph-name="_376" unicode="" |
| | | d="M1024 960v-640q0 -26 -19 -45t-45 -19q-20 0 -37 12l-448 320q-27 19 -27 52t27 52l448 320q17 12 37 12q26 0 45 -19t19 -45zM1280 160v960q0 13 -9.5 22.5t-22.5 9.5h-960q-13 0 -22.5 -9.5t-9.5 -22.5v-960q0 -13 9.5 -22.5t22.5 -9.5h960q13 0 22.5 9.5t9.5 22.5z |
| | | M1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> |
| | | <glyph glyph-name="dot_circle_alt" unicode="" |
| | | d="M1024 640q0 -106 -75 -181t-181 -75t-181 75t-75 181t75 181t181 75t181 -75t75 -181zM768 1184q-148 0 -273 -73t-198 -198t-73 -273t73 -273t198 -198t273 -73t273 73t198 198t73 273t-73 273t-198 198t-273 73zM1536 640q0 -209 -103 -385.5t-279.5 -279.5 |
| | | t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> |
| | | <glyph glyph-name="_378" unicode="" horiz-adv-x="1664" |
| | | d="M1023 349l102 -204q-58 -179 -210 -290t-339 -111q-156 0 -288.5 77.5t-210 210t-77.5 288.5q0 181 104.5 330t274.5 211l17 -131q-122 -54 -195 -165.5t-73 -244.5q0 -185 131.5 -316.5t316.5 -131.5q126 0 232.5 65t165 175.5t49.5 236.5zM1571 249l58 -114l-256 -128 |
| | | q-13 -7 -29 -7q-40 0 -57 35l-239 477h-472q-24 0 -42.5 16.5t-21.5 40.5l-96 779q-2 17 6 42q14 51 57 82.5t97 31.5q66 0 113 -47t47 -113q0 -69 -52 -117.5t-120 -41.5l37 -289h423v-128h-407l16 -128h455q40 0 57 -35l228 -455z" /> |
| | | <glyph glyph-name="vimeo_square" unicode="" |
| | | d="M1292 898q10 216 -161 222q-231 8 -312 -261q44 19 82 19q85 0 74 -96q-4 -57 -74 -167t-105 -110q-43 0 -82 169q-13 54 -45 255q-30 189 -160 177q-59 -7 -164 -100l-81 -72l-81 -72l52 -67q76 52 87 52q57 0 107 -179q15 -55 45 -164.5t45 -164.5q68 -179 164 -179 |
| | | q157 0 383 294q220 283 226 444zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> |
| | | <glyph glyph-name="_380" unicode="" horiz-adv-x="1152" |
| | | d="M1152 704q0 -191 -94.5 -353t-256.5 -256.5t-353 -94.5h-160q-14 0 -23 9t-9 23v611l-215 -66q-3 -1 -9 -1q-10 0 -19 6q-13 10 -13 26v128q0 23 23 31l233 71v93l-215 -66q-3 -1 -9 -1q-10 0 -19 6q-13 10 -13 26v128q0 23 23 31l233 71v250q0 14 9 23t23 9h160 |
| | | q14 0 23 -9t9 -23v-181l375 116q15 5 28 -5t13 -26v-128q0 -23 -23 -31l-393 -121v-93l375 116q15 5 28 -5t13 -26v-128q0 -23 -23 -31l-393 -121v-487q188 13 318 151t130 328q0 14 9 23t23 9h160q14 0 23 -9t9 -23z" /> |
| | | <glyph glyph-name="plus_square_o" unicode="" horiz-adv-x="1408" |
| | | d="M1152 736v-64q0 -14 -9 -23t-23 -9h-352v-352q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v352h-352q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h352v352q0 14 9 23t23 9h64q14 0 23 -9t9 -23v-352h352q14 0 23 -9t9 -23zM1280 288v832q0 66 -47 113t-113 47h-832 |
| | | q-66 0 -113 -47t-47 -113v-832q0 -66 47 -113t113 -47h832q66 0 113 47t47 113zM1408 1120v-832q0 -119 -84.5 -203.5t-203.5 -84.5h-832q-119 0 -203.5 84.5t-84.5 203.5v832q0 119 84.5 203.5t203.5 84.5h832q119 0 203.5 -84.5t84.5 -203.5z" /> |
| | | <glyph glyph-name="_382" unicode="" horiz-adv-x="2176" |
| | | d="M620 416q-110 -64 -268 -64h-128v64h-64q-13 0 -22.5 23.5t-9.5 56.5q0 24 7 49q-58 2 -96.5 10.5t-38.5 20.5t38.5 20.5t96.5 10.5q-7 25 -7 49q0 33 9.5 56.5t22.5 23.5h64v64h128q158 0 268 -64h1113q42 -7 106.5 -18t80.5 -14q89 -15 150 -40.5t83.5 -47.5t22.5 -40 |
| | | t-22.5 -40t-83.5 -47.5t-150 -40.5q-16 -3 -80.5 -14t-106.5 -18h-1113zM1739 668q53 -36 53 -92t-53 -92l81 -30q68 48 68 122t-68 122zM625 400h1015q-217 -38 -456 -80q-57 0 -113 -24t-83 -48l-28 -24l-288 -288q-26 -26 -70.5 -45t-89.5 -19h-96l-93 464h29 |
| | | q157 0 273 64zM352 816h-29l93 464h96q46 0 90 -19t70 -45l288 -288q4 -4 11 -10.5t30.5 -23t48.5 -29t61.5 -23t72.5 -10.5l456 -80h-1015q-116 64 -273 64z" /> |
| | | <glyph glyph-name="_383" unicode="" horiz-adv-x="1664" |
| | | d="M1519 760q62 0 103.5 -40.5t41.5 -101.5q0 -97 -93 -130l-172 -59l56 -167q7 -21 7 -47q0 -59 -42 -102t-101 -43q-47 0 -85.5 27t-53.5 72l-55 165l-310 -106l55 -164q8 -24 8 -47q0 -59 -42 -102t-102 -43q-47 0 -85 27t-53 72l-55 163l-153 -53q-29 -9 -50 -9 |
| | | q-61 0 -101.5 40t-40.5 101q0 47 27.5 85t71.5 53l156 53l-105 313l-156 -54q-26 -8 -48 -8q-60 0 -101 40.5t-41 100.5q0 47 27.5 85t71.5 53l157 53l-53 159q-8 24 -8 47q0 60 42 102.5t102 42.5q47 0 85 -27t53 -72l54 -160l310 105l-54 160q-8 24 -8 47q0 59 42.5 102 |
| | | t101.5 43q47 0 85.5 -27.5t53.5 -71.5l53 -161l162 55q21 6 43 6q60 0 102.5 -39.5t42.5 -98.5q0 -45 -30 -81.5t-74 -51.5l-157 -54l105 -316l164 56q24 8 46 8zM725 498l310 105l-105 315l-310 -107z" /> |
| | | <glyph glyph-name="_384" unicode="" |
| | | d="M1248 1408q119 0 203.5 -84.5t84.5 -203.5v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960zM1280 352v436q-31 -35 -64 -55q-34 -22 -132.5 -85t-151.5 -99q-98 -69 -164 -69v0v0q-66 0 -164 69 |
| | | q-47 32 -142 92.5t-142 92.5q-12 8 -33 27t-31 27v-436q0 -40 28 -68t68 -28h832q40 0 68 28t28 68zM1280 925q0 41 -27.5 70t-68.5 29h-832q-40 0 -68 -28t-28 -68q0 -37 30.5 -76.5t67.5 -64.5q47 -32 137.5 -89t129.5 -83q3 -2 17 -11.5t21 -14t21 -13t23.5 -13 |
| | | t21.5 -9.5t22.5 -7.5t20.5 -2.5t20.5 2.5t22.5 7.5t21.5 9.5t23.5 13t21 13t21 14t17 11.5l267 174q35 23 66.5 62.5t31.5 73.5z" /> |
| | | <glyph glyph-name="_385" unicode="" horiz-adv-x="1792" |
| | | d="M127 640q0 163 67 313l367 -1005q-196 95 -315 281t-119 411zM1415 679q0 -19 -2.5 -38.5t-10 -49.5t-11.5 -44t-17.5 -59t-17.5 -58l-76 -256l-278 826q46 3 88 8q19 2 26 18.5t-2.5 31t-28.5 13.5l-205 -10q-75 1 -202 10q-12 1 -20.5 -5t-11.5 -15t-1.5 -18.5t9 -16.5 |
| | | t19.5 -8l80 -8l120 -328l-168 -504l-280 832q46 3 88 8q19 2 26 18.5t-2.5 31t-28.5 13.5l-205 -10q-7 0 -23 0.5t-26 0.5q105 160 274.5 253.5t367.5 93.5q147 0 280.5 -53t238.5 -149h-10q-55 0 -92 -40.5t-37 -95.5q0 -12 2 -24t4 -21.5t8 -23t9 -21t12 -22.5t12.5 -21 |
| | | t14.5 -24t14 -23q63 -107 63 -212zM909 573l237 -647q1 -6 5 -11q-126 -44 -255 -44q-112 0 -217 32zM1570 1009q95 -174 95 -369q0 -209 -104 -385.5t-279 -278.5l235 678q59 169 59 276q0 42 -6 79zM896 1536q182 0 348 -71t286 -191t191 -286t71 -348t-71 -348t-191 -286 |
| | | t-286 -191t-348 -71t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71zM896 -215q173 0 331.5 68t273 182.5t182.5 273t68 331.5t-68 331.5t-182.5 273t-273 182.5t-331.5 68t-331.5 -68t-273 -182.5t-182.5 -273t-68 -331.5t68 -331.5t182.5 -273 |
| | | t273 -182.5t331.5 -68z" /> |
| | | <glyph glyph-name="_386" unicode="" horiz-adv-x="1792" |
| | | d="M1086 1536v-1536l-272 -128q-228 20 -414 102t-293 208.5t-107 272.5q0 140 100.5 263.5t275 205.5t391.5 108v-172q-217 -38 -356.5 -150t-139.5 -255q0 -152 154.5 -267t388.5 -145v1360zM1755 954l37 -390l-525 114l147 83q-119 70 -280 99v172q277 -33 481 -157z" /> |
| | | <glyph glyph-name="_387" unicode="" horiz-adv-x="2048" |
| | | d="M960 1536l960 -384v-128h-128q0 -26 -20.5 -45t-48.5 -19h-1526q-28 0 -48.5 19t-20.5 45h-128v128zM256 896h256v-768h128v768h256v-768h128v768h256v-768h128v768h256v-768h59q28 0 48.5 -19t20.5 -45v-64h-1664v64q0 26 20.5 45t48.5 19h59v768zM1851 -64 |
| | | q28 0 48.5 -19t20.5 -45v-128h-1920v128q0 26 20.5 45t48.5 19h1782z" /> |
| | | <glyph glyph-name="_388" unicode="" horiz-adv-x="2304" |
| | | d="M1774 700l18 -316q4 -69 -82 -128t-235 -93.5t-323 -34.5t-323 34.5t-235 93.5t-82 128l18 316l574 -181q22 -7 48 -7t48 7zM2304 1024q0 -23 -22 -31l-1120 -352q-4 -1 -10 -1t-10 1l-652 206q-43 -34 -71 -111.5t-34 -178.5q63 -36 63 -109q0 -69 -58 -107l58 -433 |
| | | q2 -14 -8 -25q-9 -11 -24 -11h-192q-15 0 -24 11q-10 11 -8 25l58 433q-58 38 -58 107q0 73 65 111q11 207 98 330l-333 104q-22 8 -22 31t22 31l1120 352q4 1 10 1t10 -1l1120 -352q22 -8 22 -31z" /> |
| | | <glyph glyph-name="_389" unicode="" |
| | | d="M859 579l13 -707q-62 11 -105 11q-41 0 -105 -11l13 707q-40 69 -168.5 295.5t-216.5 374.5t-181 287q58 -15 108 -15q44 0 111 15q63 -111 133.5 -229.5t167 -276.5t138.5 -227q37 61 109.5 177.5t117.5 190t105 176t107 189.5q54 -14 107 -14q56 0 114 14v0 |
| | | q-28 -39 -60 -88.5t-49.5 -78.5t-56.5 -96t-49 -84q-146 -248 -353 -610z" /> |
| | | <glyph glyph-name="uniF1A0" unicode="" |
| | | d="M768 750h725q12 -67 12 -128q0 -217 -91 -387.5t-259.5 -266.5t-386.5 -96q-157 0 -299 60.5t-245 163.5t-163.5 245t-60.5 299t60.5 299t163.5 245t245 163.5t299 60.5q300 0 515 -201l-209 -201q-123 119 -306 119q-129 0 -238.5 -65t-173.5 -176.5t-64 -243.5 |
| | | t64 -243.5t173.5 -176.5t238.5 -65q87 0 160 24t120 60t82 82t51.5 87t22.5 78h-436v264z" /> |
| | | <glyph glyph-name="f1a1" unicode="" horiz-adv-x="1792" |
| | | d="M1095 369q16 -16 0 -31q-62 -62 -199 -62t-199 62q-16 15 0 31q6 6 15 6t15 -6q48 -49 169 -49q120 0 169 49q6 6 15 6t15 -6zM788 550q0 -37 -26 -63t-63 -26t-63.5 26t-26.5 63q0 38 26.5 64t63.5 26t63 -26.5t26 -63.5zM1183 550q0 -37 -26.5 -63t-63.5 -26t-63 26 |
| | | t-26 63t26 63.5t63 26.5t63.5 -26t26.5 -64zM1434 670q0 49 -35 84t-85 35t-86 -36q-130 90 -311 96l63 283l200 -45q0 -37 26 -63t63 -26t63.5 26.5t26.5 63.5t-26.5 63.5t-63.5 26.5q-54 0 -80 -50l-221 49q-19 5 -25 -16l-69 -312q-180 -7 -309 -97q-35 37 -87 37 |
| | | q-50 0 -85 -35t-35 -84q0 -35 18.5 -64t49.5 -44q-6 -27 -6 -56q0 -142 140 -243t337 -101q198 0 338 101t140 243q0 32 -7 57q30 15 48 43.5t18 63.5zM1792 640q0 -182 -71 -348t-191 -286t-286 -191t-348 -71t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191 |
| | | t348 71t348 -71t286 -191t191 -286t71 -348z" /> |
| | | <glyph glyph-name="_392" unicode="" |
| | | d="M939 407q13 -13 0 -26q-53 -53 -171 -53t-171 53q-13 13 0 26q5 6 13 6t13 -6q42 -42 145 -42t145 42q5 6 13 6t13 -6zM676 563q0 -31 -23 -54t-54 -23t-54 23t-23 54q0 32 22.5 54.5t54.5 22.5t54.5 -22.5t22.5 -54.5zM1014 563q0 -31 -23 -54t-54 -23t-54 23t-23 54 |
| | | q0 32 22.5 54.5t54.5 22.5t54.5 -22.5t22.5 -54.5zM1229 666q0 42 -30 72t-73 30q-42 0 -73 -31q-113 78 -267 82l54 243l171 -39q1 -32 23.5 -54t53.5 -22q32 0 54.5 22.5t22.5 54.5t-22.5 54.5t-54.5 22.5q-48 0 -69 -43l-189 42q-17 5 -21 -13l-60 -268q-154 -6 -265 -83 |
| | | q-30 32 -74 32q-43 0 -73 -30t-30 -72q0 -30 16 -55t42 -38q-5 -25 -5 -48q0 -122 120 -208.5t289 -86.5q170 0 290 86.5t120 208.5q0 25 -6 49q25 13 40.5 37.5t15.5 54.5zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960 |
| | | q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> |
| | | <glyph glyph-name="_393" unicode="" |
| | | d="M866 697l90 27v62q0 79 -58 135t-138 56t-138 -55.5t-58 -134.5v-283q0 -20 -14 -33.5t-33 -13.5t-32.5 13.5t-13.5 33.5v120h-151v-122q0 -82 57.5 -139t139.5 -57q81 0 138.5 56.5t57.5 136.5v280q0 19 13.5 33t33.5 14q19 0 32.5 -14t13.5 -33v-54zM1199 502v122h-150 |
| | | v-126q0 -20 -13.5 -33.5t-33.5 -13.5q-19 0 -32.5 14t-13.5 33v123l-90 -26l-60 28v-123q0 -80 58 -137t139 -57t138.5 57t57.5 139zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103 |
| | | t385.5 -103t279.5 -279.5t103 -385.5z" /> |
| | | <glyph glyph-name="f1a4" unicode="" horiz-adv-x="1920" |
| | | d="M1062 824v118q0 42 -30 72t-72 30t-72 -30t-30 -72v-612q0 -175 -126 -299t-303 -124q-178 0 -303.5 125.5t-125.5 303.5v266h328v-262q0 -43 30 -72.5t72 -29.5t72 29.5t30 72.5v620q0 171 126.5 292t301.5 121q176 0 302 -122t126 -294v-136l-195 -58zM1592 602h328 |
| | | v-266q0 -178 -125.5 -303.5t-303.5 -125.5q-177 0 -303 124.5t-126 300.5v268l131 -61l195 58v-270q0 -42 30 -71.5t72 -29.5t72 29.5t30 71.5v275z" /> |
| | | <glyph glyph-name="_395" unicode="" |
| | | d="M1472 160v480h-704v704h-480q-93 0 -158.5 -65.5t-65.5 -158.5v-480h704v-704h480q93 0 158.5 65.5t65.5 158.5zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5 |
| | | t84.5 -203.5z" /> |
| | | <glyph glyph-name="_396" unicode="" horiz-adv-x="2048" |
| | | d="M328 1254h204v-983h-532v697h328v286zM328 435v369h-123v-369h123zM614 968v-697h205v697h-205zM614 1254v-204h205v204h-205zM901 968h533v-942h-533v163h328v82h-328v697zM1229 435v369h-123v-369h123zM1516 968h532v-942h-532v163h327v82h-327v697zM1843 435v369h-123 |
| | | v-369h123z" /> |
| | | <glyph glyph-name="_397" unicode="" |
| | | d="M1046 516q0 -64 -38 -109t-91 -45q-43 0 -70 15v277q28 17 70 17q53 0 91 -45.5t38 -109.5zM703 944q0 -64 -38 -109.5t-91 -45.5q-43 0 -70 15v277q28 17 70 17q53 0 91 -45t38 -109zM1265 513q0 134 -88 229t-213 95q-20 0 -39 -3q-23 -78 -78 -136q-87 -95 -211 -101 |
| | | v-636l211 41v206q51 -19 117 -19q125 0 213 95t88 229zM922 940q0 134 -88.5 229t-213.5 95q-74 0 -141 -36h-186v-840l211 41v206q55 -19 116 -19q125 0 213.5 95t88.5 229zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960 |
| | | q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> |
| | | <glyph glyph-name="_398" unicode="" horiz-adv-x="2038" |
| | | d="M1222 607q75 3 143.5 -20.5t118 -58.5t101 -94.5t84 -108t75.5 -120.5q33 -56 78.5 -109t75.5 -80.5t99 -88.5q-48 -30 -108.5 -57.5t-138.5 -59t-114 -47.5q-44 37 -74 115t-43.5 164.5t-33 180.5t-42.5 168.5t-72.5 123t-122.5 48.5l-10 -2l-6 -4q4 -5 13 -14 |
| | | q6 -5 28 -23.5t25.5 -22t19 -18t18 -20.5t11.5 -21t10.5 -27.5t4.5 -31t4 -40.5l1 -33q1 -26 -2.5 -57.5t-7.5 -52t-12.5 -58.5t-11.5 -53q-35 1 -101 -9.5t-98 -10.5q-39 0 -72 10q-2 16 -2 47q0 74 3 96q2 13 31.5 41.5t57 59t26.5 51.5q-24 2 -43 -24 |
| | | q-36 -53 -111.5 -99.5t-136.5 -46.5q-25 0 -75.5 63t-106.5 139.5t-84 96.5q-6 4 -27 30q-482 -112 -513 -112q-16 0 -28 11t-12 27q0 15 8.5 26.5t22.5 14.5l486 106q-8 14 -8 25t5.5 17.5t16 11.5t20 7t23 4.5t18.5 4.5q4 1 15.5 7.5t17.5 6.5q15 0 28 -16t20 -33 |
| | | q163 37 172 37q17 0 29.5 -11t12.5 -28q0 -15 -8.5 -26t-23.5 -14l-182 -40l-1 -16q-1 -26 81.5 -117.5t104.5 -91.5q47 0 119 80t72 129q0 36 -23.5 53t-51 18.5t-51 11.5t-23.5 34q0 16 10 34l-68 19q43 44 43 117q0 26 -5 58q82 16 144 16q44 0 71.5 -1.5t48.5 -8.5 |
| | | t31 -13.5t20.5 -24.5t15.5 -33.5t17 -47.5t24 -60l50 25q-3 -40 -23 -60t-42.5 -21t-40 -6.5t-16.5 -20.5zM1282 842q-5 5 -13.5 15.5t-12 14.5t-10.5 11.5t-10 10.5l-8 8t-8.5 7.5t-8 5t-8.5 4.5q-7 3 -14.5 5t-20.5 2.5t-22 0.5h-32.5h-37.5q-126 0 -217 -43 |
| | | q16 30 36 46.5t54 29.5t65.5 36t46 36.5t50 55t43.5 50.5q12 -9 28 -31.5t32 -36.5t38 -13l12 1v-76l22 -1q247 95 371 190q28 21 50 39t42.5 37.5t33 31t29.5 34t24 31t24.5 37t23 38t27 47.5t29.5 53l7 9q-2 -53 -43 -139q-79 -165 -205 -264t-306 -142q-14 -3 -42 -7.5 |
| | | t-50 -9.5t-39 -14q3 -19 24.5 -46t21.5 -34q0 -11 -26 -30zM1061 -79q39 26 131.5 47.5t146.5 21.5q9 0 22.5 -15.5t28 -42.5t26 -50t24 -51t14.5 -33q-121 -45 -244 -45q-61 0 -125 11zM822 568l48 12l109 -177l-73 -48zM1323 51q3 -15 3 -16q0 -7 -17.5 -14.5t-46 -13 |
| | | t-54 -9.5t-53.5 -7.5t-32 -4.5l-7 43q21 2 60.5 8.5t72 10t60.5 3.5h14zM866 679l-96 -20l-6 17q10 1 32.5 7t34.5 6q19 0 35 -10zM1061 45h31l10 -83l-41 -12v95zM1950 1535v1v-1zM1950 1535l-1 -5l-2 -2l1 3zM1950 1535l1 1z" /> |
| | | <glyph glyph-name="_399" unicode="" |
| | | d="M1167 -50q-5 19 -24 5q-30 -22 -87 -39t-131 -17q-129 0 -193 49q-5 4 -13 4q-11 0 -26 -12q-7 -6 -7.5 -16t7.5 -20q34 -32 87.5 -46t102.5 -12.5t99 4.5q41 4 84.5 20.5t65 30t28.5 20.5q12 12 7 29zM1128 65q-19 47 -39 61q-23 15 -76 15q-47 0 -71 -10 |
| | | q-29 -12 -78 -56q-26 -24 -12 -44q9 -8 17.5 -4.5t31.5 23.5q3 2 10.5 8.5t10.5 8.5t10 7t11.5 7t12.5 5t15 4.5t16.5 2.5t20.5 1q27 0 44.5 -7.5t23 -14.5t13.5 -22q10 -17 12.5 -20t12.5 1q23 12 14 34zM1483 346q0 22 -5 44.5t-16.5 45t-34 36.5t-52.5 14 |
| | | q-33 0 -97 -41.5t-129 -83.5t-101 -42q-27 -1 -63.5 19t-76 49t-83.5 58t-100 49t-111 19q-115 -1 -197 -78.5t-84 -178.5q-2 -112 74 -164q29 -20 62.5 -28.5t103.5 -8.5q57 0 132 32.5t134 71t120 70.5t93 31q26 -1 65 -31.5t71.5 -67t68 -67.5t55.5 -32q35 -3 58.5 14 |
| | | t55.5 63q28 41 42.5 101t14.5 106zM1536 506q0 -164 -62 -304.5t-166 -236t-242.5 -149.5t-290.5 -54t-293 57.5t-247.5 157t-170.5 241.5t-64 302q0 89 19.5 172.5t49 145.5t70.5 118.5t78.5 94t78.5 69.5t64.5 46.5t42.5 24.5q14 8 51 26.5t54.5 28.5t48 30t60.5 44 |
| | | q36 28 58 72.5t30 125.5q129 -155 186 -193q44 -29 130 -68t129 -66q21 -13 39 -25t60.5 -46.5t76 -70.5t75 -95t69 -122t47 -148.5t19.5 -177.5z" /> |
| | | <glyph glyph-name="_400" unicode="" |
| | | d="M1070 463l-160 -160l-151 -152l-30 -30q-65 -64 -151.5 -87t-171.5 -2q-16 -70 -72 -115t-129 -45q-85 0 -145 60.5t-60 145.5q0 72 44.5 128t113.5 72q-22 86 1 173t88 152l12 12l151 -152l-11 -11q-37 -37 -37 -89t37 -90q37 -37 89 -37t89 37l30 30l151 152l161 160z |
| | | M729 1145l12 -12l-152 -152l-12 12q-37 37 -89 37t-89 -37t-37 -89.5t37 -89.5l29 -29l152 -152l160 -160l-151 -152l-161 160l-151 152l-30 30q-68 67 -90 159.5t5 179.5q-70 15 -115 71t-45 129q0 85 60 145.5t145 60.5q76 0 133.5 -49t69.5 -123q84 20 169.5 -3.5 |
| | | t149.5 -87.5zM1536 78q0 -85 -60 -145.5t-145 -60.5q-74 0 -131 47t-71 118q-86 -28 -179.5 -6t-161.5 90l-11 12l151 152l12 -12q37 -37 89 -37t89 37t37 89t-37 89l-30 30l-152 152l-160 160l152 152l160 -160l152 -152l29 -30q64 -64 87.5 -150.5t2.5 -171.5 |
| | | q76 -11 126.5 -68.5t50.5 -134.5zM1534 1202q0 -77 -51 -135t-127 -69q26 -85 3 -176.5t-90 -158.5l-12 -12l-151 152l12 12q37 37 37 89t-37 89t-89 37t-89 -37l-30 -30l-152 -152l-160 -160l-152 152l161 160l152 152l29 30q67 67 159 89.5t178 -3.5q11 75 68.5 126 |
| | | t135.5 51q85 0 145 -60.5t60 -145.5z" /> |
| | | <glyph glyph-name="f1ab" unicode="" |
| | | d="M654 458q-1 -3 -12.5 0.5t-31.5 11.5l-20 9q-44 20 -87 49q-7 5 -41 31.5t-38 28.5q-67 -103 -134 -181q-81 -95 -105 -110q-4 -2 -19.5 -4t-18.5 0q6 4 82 92q21 24 85.5 115t78.5 118q17 30 51 98.5t36 77.5q-8 1 -110 -33q-8 -2 -27.5 -7.5t-34.5 -9.5t-17 -5 |
| | | q-2 -2 -2 -10.5t-1 -9.5q-5 -10 -31 -15q-23 -7 -47 0q-18 4 -28 21q-4 6 -5 23q6 2 24.5 5t29.5 6q58 16 105 32q100 35 102 35q10 2 43 19.5t44 21.5q9 3 21.5 8t14.5 5.5t6 -0.5q2 -12 -1 -33q0 -2 -12.5 -27t-26.5 -53.5t-17 -33.5q-25 -50 -77 -131l64 -28 |
| | | q12 -6 74.5 -32t67.5 -28q4 -1 10.5 -25.5t4.5 -30.5zM449 944q3 -15 -4 -28q-12 -23 -50 -38q-30 -12 -60 -12q-26 3 -49 26q-14 15 -18 41l1 3q3 -3 19.5 -5t26.5 0t58 16q36 12 55 14q17 0 21 -17zM1147 815l63 -227l-139 42zM39 15l694 232v1032l-694 -233v-1031z |
| | | M1280 332l102 -31l-181 657l-100 31l-216 -536l102 -31l45 110l211 -65zM777 1294l573 -184v380zM1088 -29l158 -13l-54 -160l-40 66q-130 -83 -276 -108q-58 -12 -91 -12h-84q-79 0 -199.5 39t-183.5 85q-8 7 -8 16q0 8 5 13.5t13 5.5q4 0 18 -7.5t30.5 -16.5t20.5 -11 |
| | | q73 -37 159.5 -61.5t157.5 -24.5q95 0 167 14.5t157 50.5q15 7 30.5 15.5t34 19t28.5 16.5zM1536 1050v-1079l-774 246q-14 -6 -375 -127.5t-368 -121.5q-13 0 -18 13q0 1 -1 3v1078q3 9 4 10q5 6 20 11q107 36 149 50v384l558 -198q2 0 160.5 55t316 108.5t161.5 53.5 |
| | | q20 0 20 -21v-418z" /> |
| | | <glyph glyph-name="_402" unicode="" horiz-adv-x="1792" |
| | | d="M288 1152q66 0 113 -47t47 -113v-1088q0 -66 -47 -113t-113 -47h-128q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h128zM1664 989q58 -34 93 -93t35 -128v-768q0 -106 -75 -181t-181 -75h-864q-66 0 -113 47t-47 113v1536q0 40 28 68t68 28h672q40 0 88 -20t76 -48 |
| | | l152 -152q28 -28 48 -76t20 -88v-163zM928 0v128q0 14 -9 23t-23 9h-128q-14 0 -23 -9t-9 -23v-128q0 -14 9 -23t23 -9h128q14 0 23 9t9 23zM928 256v128q0 14 -9 23t-23 9h-128q-14 0 -23 -9t-9 -23v-128q0 -14 9 -23t23 -9h128q14 0 23 9t9 23zM928 512v128q0 14 -9 23 |
| | | t-23 9h-128q-14 0 -23 -9t-9 -23v-128q0 -14 9 -23t23 -9h128q14 0 23 9t9 23zM1184 0v128q0 14 -9 23t-23 9h-128q-14 0 -23 -9t-9 -23v-128q0 -14 9 -23t23 -9h128q14 0 23 9t9 23zM1184 256v128q0 14 -9 23t-23 9h-128q-14 0 -23 -9t-9 -23v-128q0 -14 9 -23t23 -9h128 |
| | | q14 0 23 9t9 23zM1184 512v128q0 14 -9 23t-23 9h-128q-14 0 -23 -9t-9 -23v-128q0 -14 9 -23t23 -9h128q14 0 23 9t9 23zM1440 0v128q0 14 -9 23t-23 9h-128q-14 0 -23 -9t-9 -23v-128q0 -14 9 -23t23 -9h128q14 0 23 9t9 23zM1440 256v128q0 14 -9 23t-23 9h-128 |
| | | q-14 0 -23 -9t-9 -23v-128q0 -14 9 -23t23 -9h128q14 0 23 9t9 23zM1440 512v128q0 14 -9 23t-23 9h-128q-14 0 -23 -9t-9 -23v-128q0 -14 9 -23t23 -9h128q14 0 23 9t9 23zM1536 896v256h-160q-40 0 -68 28t-28 68v160h-640v-512h896z" /> |
| | | <glyph glyph-name="_403" unicode="" |
| | | d="M1344 1536q26 0 45 -19t19 -45v-1664q0 -26 -19 -45t-45 -19h-1280q-26 0 -45 19t-19 45v1664q0 26 19 45t45 19h1280zM512 1248v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23zM512 992v-64q0 -14 9 -23t23 -9h64q14 0 23 9 |
| | | t9 23v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23zM512 736v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23zM512 480v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23zM384 160v64 |
| | | q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM384 416v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM384 672v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64 |
| | | q14 0 23 9t9 23zM384 928v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM384 1184v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM896 -96v192q0 14 -9 23t-23 9h-320q-14 0 -23 -9 |
| | | t-9 -23v-192q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM896 416v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM896 672v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM896 928v64 |
| | | q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM896 1184v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1152 160v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64 |
| | | q14 0 23 9t9 23zM1152 416v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1152 672v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1152 928v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9 |
| | | t-9 -23v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1152 1184v64q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h64q14 0 23 9t9 23z" /> |
| | | <glyph glyph-name="_404" unicode="" horiz-adv-x="1280" |
| | | d="M1188 988l-292 -292v-824q0 -46 -33 -79t-79 -33t-79 33t-33 79v384h-64v-384q0 -46 -33 -79t-79 -33t-79 33t-33 79v824l-292 292q-28 28 -28 68t28 68q29 28 68.5 28t67.5 -28l228 -228h368l228 228q28 28 68 28t68 -28q28 -29 28 -68.5t-28 -67.5zM864 1152 |
| | | q0 -93 -65.5 -158.5t-158.5 -65.5t-158.5 65.5t-65.5 158.5t65.5 158.5t158.5 65.5t158.5 -65.5t65.5 -158.5z" /> |
| | | <glyph glyph-name="uniF1B1" unicode="" horiz-adv-x="1664" |
| | | d="M780 1064q0 -60 -19 -113.5t-63 -92.5t-105 -39q-76 0 -138 57.5t-92 135.5t-30 151q0 60 19 113.5t63 92.5t105 39q77 0 138.5 -57.5t91.5 -135t30 -151.5zM438 581q0 -80 -42 -139t-119 -59q-76 0 -141.5 55.5t-100.5 133.5t-35 152q0 80 42 139.5t119 59.5 |
| | | q76 0 141.5 -55.5t100.5 -134t35 -152.5zM832 608q118 0 255 -97.5t229 -237t92 -254.5q0 -46 -17 -76.5t-48.5 -45t-64.5 -20t-76 -5.5q-68 0 -187.5 45t-182.5 45q-66 0 -192.5 -44.5t-200.5 -44.5q-183 0 -183 146q0 86 56 191.5t139.5 192.5t187.5 146t193 59zM1071 819 |
| | | q-61 0 -105 39t-63 92.5t-19 113.5q0 74 30 151.5t91.5 135t138.5 57.5q61 0 105 -39t63 -92.5t19 -113.5q0 -73 -30 -151t-92 -135.5t-138 -57.5zM1503 923q77 0 119 -59.5t42 -139.5q0 -74 -35 -152t-100.5 -133.5t-141.5 -55.5q-77 0 -119 59t-42 139q0 74 35 152.5 |
| | | t100.5 134t141.5 55.5z" /> |
| | | <glyph glyph-name="_406" unicode="" horiz-adv-x="768" |
| | | d="M704 1008q0 -145 -57 -243.5t-152 -135.5l45 -821q2 -26 -16 -45t-44 -19h-192q-26 0 -44 19t-16 45l45 821q-95 37 -152 135.5t-57 243.5q0 128 42.5 249.5t117.5 200t160 78.5t160 -78.5t117.5 -200t42.5 -249.5z" /> |
| | | <glyph glyph-name="_407" unicode="" horiz-adv-x="1792" |
| | | d="M896 -93l640 349v636l-640 -233v-752zM832 772l698 254l-698 254l-698 -254zM1664 1024v-768q0 -35 -18 -65t-49 -47l-704 -384q-28 -16 -61 -16t-61 16l-704 384q-31 17 -49 47t-18 65v768q0 40 23 73t61 47l704 256q22 8 44 8t44 -8l704 -256q38 -14 61 -47t23 -73z |
| | | " /> |
| | | <glyph glyph-name="_408" unicode="" horiz-adv-x="2304" |
| | | d="M640 -96l384 192v314l-384 -164v-342zM576 358l404 173l-404 173l-404 -173zM1664 -96l384 192v314l-384 -164v-342zM1600 358l404 173l-404 173l-404 -173zM1152 651l384 165v266l-384 -164v-267zM1088 1030l441 189l-441 189l-441 -189zM2176 512v-416q0 -36 -19 -67 |
| | | t-52 -47l-448 -224q-25 -14 -57 -14t-57 14l-448 224q-4 2 -7 4q-2 -2 -7 -4l-448 -224q-25 -14 -57 -14t-57 14l-448 224q-33 16 -52 47t-19 67v416q0 38 21.5 70t56.5 48l434 186v400q0 38 21.5 70t56.5 48l448 192q23 10 50 10t50 -10l448 -192q35 -16 56.5 -48t21.5 -70 |
| | | v-400l434 -186q36 -16 57 -48t21 -70z" /> |
| | | <glyph glyph-name="_409" unicode="" horiz-adv-x="2048" |
| | | d="M1848 1197h-511v-124h511v124zM1596 771q-90 0 -146 -52.5t-62 -142.5h408q-18 195 -200 195zM1612 186q63 0 122 32t76 87h221q-100 -307 -427 -307q-214 0 -340.5 132t-126.5 347q0 208 130.5 345.5t336.5 137.5q138 0 240.5 -68t153 -179t50.5 -248q0 -17 -2 -47h-658 |
| | | q0 -111 57.5 -171.5t166.5 -60.5zM277 236h296q205 0 205 167q0 180 -199 180h-302v-347zM277 773h281q78 0 123.5 36.5t45.5 113.5q0 144 -190 144h-260v-294zM0 1282h594q87 0 155 -14t126.5 -47.5t90 -96.5t31.5 -154q0 -181 -172 -263q114 -32 172 -115t58 -204 |
| | | q0 -75 -24.5 -136.5t-66 -103.5t-98.5 -71t-121 -42t-134 -13h-611v1260z" /> |
| | | <glyph glyph-name="_410" unicode="" |
| | | d="M1248 1408q119 0 203.5 -84.5t84.5 -203.5v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960zM499 1041h-371v-787h382q117 0 197 57.5t80 170.5q0 158 -143 200q107 52 107 164q0 57 -19.5 96.5 |
| | | t-56.5 60.5t-79 29.5t-97 8.5zM477 723h-176v184h163q119 0 119 -90q0 -94 -106 -94zM486 388h-185v217h189q124 0 124 -113q0 -104 -128 -104zM1136 356q-68 0 -104 38t-36 107h411q1 10 1 30q0 132 -74.5 220.5t-203.5 88.5q-128 0 -210 -86t-82 -216q0 -135 79 -217 |
| | | t213 -82q205 0 267 191h-138q-11 -34 -47.5 -54t-75.5 -20zM1126 722q113 0 124 -122h-254q4 56 39 89t91 33zM964 988h319v-77h-319v77z" /> |
| | | <glyph glyph-name="_411" unicode="" horiz-adv-x="1792" |
| | | d="M1582 954q0 -101 -71.5 -172.5t-172.5 -71.5t-172.5 71.5t-71.5 172.5t71.5 172.5t172.5 71.5t172.5 -71.5t71.5 -172.5zM812 212q0 104 -73 177t-177 73q-27 0 -54 -6l104 -42q77 -31 109.5 -106.5t1.5 -151.5q-31 -77 -107 -109t-152 -1q-21 8 -62 24.5t-61 24.5 |
| | | q32 -60 91 -96.5t130 -36.5q104 0 177 73t73 177zM1642 953q0 126 -89.5 215.5t-215.5 89.5q-127 0 -216.5 -89.5t-89.5 -215.5q0 -127 89.5 -216t216.5 -89q126 0 215.5 89t89.5 216zM1792 953q0 -189 -133.5 -322t-321.5 -133l-437 -319q-12 -129 -109 -218t-229 -89 |
| | | q-121 0 -214 76t-118 192l-230 92v429l389 -157q79 48 173 48q13 0 35 -2l284 407q2 187 135.5 319t320.5 132q188 0 321.5 -133.5t133.5 -321.5z" /> |
| | | <glyph glyph-name="_412" unicode="" |
| | | d="M1242 889q0 80 -57 136.5t-137 56.5t-136.5 -57t-56.5 -136q0 -80 56.5 -136.5t136.5 -56.5t137 56.5t57 136.5zM632 301q0 -83 -58 -140.5t-140 -57.5q-56 0 -103 29t-72 77q52 -20 98 -40q60 -24 120 1.5t85 86.5q24 60 -1.5 120t-86.5 84l-82 33q22 5 42 5 |
| | | q82 0 140 -57.5t58 -140.5zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v153l172 -69q20 -92 93.5 -152t168.5 -60q104 0 181 70t87 173l345 252q150 0 255.5 105.5t105.5 254.5q0 150 -105.5 255.5t-255.5 105.5 |
| | | q-148 0 -253 -104.5t-107 -252.5l-225 -322q-9 1 -28 1q-75 0 -137 -37l-297 119v468q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5zM1289 887q0 -100 -71 -170.5t-171 -70.5t-170.5 70.5t-70.5 170.5t70.5 171t170.5 71q101 0 171.5 -70.5t70.5 -171.5z |
| | | " /> |
| | | <glyph glyph-name="_413" unicode="" horiz-adv-x="1792" |
| | | d="M836 367l-15 -368l-2 -22l-420 29q-36 3 -67 31.5t-47 65.5q-11 27 -14.5 55t4 65t12 55t21.5 64t19 53q78 -12 509 -28zM449 953l180 -379l-147 92q-63 -72 -111.5 -144.5t-72.5 -125t-39.5 -94.5t-18.5 -63l-4 -21l-190 357q-17 26 -18 56t6 47l8 18q35 63 114 188 |
| | | l-140 86zM1680 436l-188 -359q-12 -29 -36.5 -46.5t-43.5 -20.5l-18 -4q-71 -7 -219 -12l8 -164l-230 367l211 362l7 -173q170 -16 283 -5t170 33zM895 1360q-47 -63 -265 -435l-317 187l-19 12l225 356q20 31 60 45t80 10q24 -2 48.5 -12t42 -21t41.5 -33t36 -34.5 |
| | | t36 -39.5t32 -35zM1550 1053l212 -363q18 -37 12.5 -76t-27.5 -74q-13 -20 -33 -37t-38 -28t-48.5 -22t-47 -16t-51.5 -14t-46 -12q-34 72 -265 436l313 195zM1407 1279l142 83l-220 -373l-419 20l151 86q-34 89 -75 166t-75.5 123.5t-64.5 80t-47 46.5l-17 13l405 -1 |
| | | q31 3 58 -10.5t39 -28.5l11 -15q39 -61 112 -190z" /> |
| | | <glyph glyph-name="_414" unicode="" horiz-adv-x="2048" |
| | | d="M480 448q0 66 -47 113t-113 47t-113 -47t-47 -113t47 -113t113 -47t113 47t47 113zM516 768h1016l-89 357q-2 8 -14 17.5t-21 9.5h-768q-9 0 -21 -9.5t-14 -17.5zM1888 448q0 66 -47 113t-113 47t-113 -47t-47 -113t47 -113t113 -47t113 47t47 113zM2048 544v-384 |
| | | q0 -14 -9 -23t-23 -9h-96v-128q0 -80 -56 -136t-136 -56t-136 56t-56 136v128h-1024v-128q0 -80 -56 -136t-136 -56t-136 56t-56 136v128h-96q-14 0 -23 9t-9 23v384q0 93 65.5 158.5t158.5 65.5h28l105 419q23 94 104 157.5t179 63.5h768q98 0 179 -63.5t104 -157.5 |
| | | l105 -419h28q93 0 158.5 -65.5t65.5 -158.5z" /> |
| | | <glyph glyph-name="_415" unicode="" horiz-adv-x="2048" |
| | | d="M1824 640q93 0 158.5 -65.5t65.5 -158.5v-384q0 -14 -9 -23t-23 -9h-96v-64q0 -80 -56 -136t-136 -56t-136 56t-56 136v64h-1024v-64q0 -80 -56 -136t-136 -56t-136 56t-56 136v64h-96q-14 0 -23 9t-9 23v384q0 93 65.5 158.5t158.5 65.5h28l105 419q23 94 104 157.5 |
| | | t179 63.5h128v224q0 14 9 23t23 9h448q14 0 23 -9t9 -23v-224h128q98 0 179 -63.5t104 -157.5l105 -419h28zM320 160q66 0 113 47t47 113t-47 113t-113 47t-113 -47t-47 -113t47 -113t113 -47zM516 640h1016l-89 357q-2 8 -14 17.5t-21 9.5h-768q-9 0 -21 -9.5t-14 -17.5z |
| | | M1728 160q66 0 113 47t47 113t-47 113t-113 47t-113 -47t-47 -113t47 -113t113 -47z" /> |
| | | <glyph glyph-name="_416" unicode="" |
| | | d="M1504 64q0 -26 -19 -45t-45 -19h-462q1 -17 6 -87.5t5 -108.5q0 -25 -18 -42.5t-43 -17.5h-320q-25 0 -43 17.5t-18 42.5q0 38 5 108.5t6 87.5h-462q-26 0 -45 19t-19 45t19 45l402 403h-229q-26 0 -45 19t-19 45t19 45l402 403h-197q-26 0 -45 19t-19 45t19 45l384 384 |
| | | q19 19 45 19t45 -19l384 -384q19 -19 19 -45t-19 -45t-45 -19h-197l402 -403q19 -19 19 -45t-19 -45t-45 -19h-229l402 -403q19 -19 19 -45z" /> |
| | | <glyph glyph-name="_417" unicode="" |
| | | d="M1127 326q0 32 -30 51q-193 115 -447 115q-133 0 -287 -34q-42 -9 -42 -52q0 -20 13.5 -34.5t35.5 -14.5q5 0 37 8q132 27 243 27q226 0 397 -103q19 -11 33 -11q19 0 33 13.5t14 34.5zM1223 541q0 40 -35 61q-237 141 -548 141q-153 0 -303 -42q-48 -13 -48 -64 |
| | | q0 -25 17.5 -42.5t42.5 -17.5q7 0 37 8q122 33 251 33q279 0 488 -124q24 -13 38 -13q25 0 42.5 17.5t17.5 42.5zM1331 789q0 47 -40 70q-126 73 -293 110.5t-343 37.5q-204 0 -364 -47q-23 -7 -38.5 -25.5t-15.5 -48.5q0 -31 20.5 -52t51.5 -21q11 0 40 8q133 37 307 37 |
| | | q159 0 309.5 -34t253.5 -95q21 -12 40 -12q29 0 50.5 20.5t21.5 51.5zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> |
| | | <glyph glyph-name="_418" unicode="" horiz-adv-x="1024" |
| | | d="M1024 1233l-303 -582l24 -31h279v-415h-507l-44 -30l-142 -273l-30 -30h-301v303l303 583l-24 30h-279v415h507l44 30l142 273l30 30h301v-303z" /> |
| | | <glyph glyph-name="_419" unicode="" horiz-adv-x="2304" |
| | | d="M784 164l16 241l-16 523q-1 10 -7.5 17t-16.5 7q-9 0 -16 -7t-7 -17l-14 -523l14 -241q1 -10 7.5 -16.5t15.5 -6.5q22 0 24 23zM1080 193l11 211l-12 586q0 16 -13 24q-8 5 -16 5t-16 -5q-13 -8 -13 -24l-1 -6l-10 -579q0 -1 11 -236v-1q0 -10 6 -17q9 -11 23 -11 |
| | | q11 0 20 9q9 7 9 20zM35 533l20 -128l-20 -126q-2 -9 -9 -9t-9 9l-17 126l17 128q2 9 9 9t9 -9zM121 612l26 -207l-26 -203q-2 -9 -10 -9q-9 0 -9 10l-23 202l23 207q0 9 9 9q8 0 10 -9zM401 159zM213 650l25 -245l-25 -237q0 -11 -11 -11q-10 0 -12 11l-21 237l21 245 |
| | | q2 12 12 12q11 0 11 -12zM307 657l23 -252l-23 -244q-2 -13 -14 -13q-13 0 -13 13l-21 244l21 252q0 13 13 13q12 0 14 -13zM401 639l21 -234l-21 -246q-2 -16 -16 -16q-6 0 -10.5 4.5t-4.5 11.5l-20 246l20 234q0 6 4.5 10.5t10.5 4.5q14 0 16 -15zM784 164zM495 785 |
| | | l21 -380l-21 -246q0 -7 -5 -12.5t-12 -5.5q-16 0 -18 18l-18 246l18 380q2 18 18 18q7 0 12 -5.5t5 -12.5zM589 871l19 -468l-19 -244q0 -8 -5.5 -13.5t-13.5 -5.5q-18 0 -20 19l-16 244l16 468q2 19 20 19q8 0 13.5 -5.5t5.5 -13.5zM687 911l18 -506l-18 -242 |
| | | q-2 -21 -22 -21q-19 0 -21 21l-16 242l16 506q0 9 6.5 15.5t14.5 6.5q9 0 15 -6.5t7 -15.5zM1079 169v0v0v0zM881 915l15 -510l-15 -239q0 -10 -7.5 -17.5t-17.5 -7.5t-17 7t-8 18l-14 239l14 510q0 11 7.5 18t17.5 7t17.5 -7t7.5 -18zM980 896l14 -492l-14 -236 |
| | | q0 -11 -8 -19t-19 -8t-19 8t-9 19l-12 236l12 492q1 12 9 20t19 8t18.5 -8t8.5 -20zM1192 404l-14 -231v0q0 -13 -9 -22t-22 -9t-22 9t-10 22l-6 114l-6 117l12 636v3q2 15 12 24q9 7 20 7q8 0 15 -5q14 -8 16 -26zM2304 423q0 -117 -83 -199.5t-200 -82.5h-786 |
| | | q-13 2 -22 11t-9 22v899q0 23 28 33q85 34 181 34q195 0 338 -131.5t160 -323.5q53 22 110 22q117 0 200 -83t83 -201z" /> |
| | | <glyph glyph-name="uniF1C0" unicode="" |
| | | d="M768 768q237 0 443 43t325 127v-170q0 -69 -103 -128t-280 -93.5t-385 -34.5t-385 34.5t-280 93.5t-103 128v170q119 -84 325 -127t443 -43zM768 0q237 0 443 43t325 127v-170q0 -69 -103 -128t-280 -93.5t-385 -34.5t-385 34.5t-280 93.5t-103 128v170q119 -84 325 -127 |
| | | t443 -43zM768 384q237 0 443 43t325 127v-170q0 -69 -103 -128t-280 -93.5t-385 -34.5t-385 34.5t-280 93.5t-103 128v170q119 -84 325 -127t443 -43zM768 1536q208 0 385 -34.5t280 -93.5t103 -128v-128q0 -69 -103 -128t-280 -93.5t-385 -34.5t-385 34.5t-280 93.5 |
| | | t-103 128v128q0 69 103 128t280 93.5t385 34.5z" /> |
| | | <glyph glyph-name="uniF1C1" unicode="" |
| | | d="M1468 1156q28 -28 48 -76t20 -88v-1152q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h896q40 0 88 -20t76 -48zM1024 1400v-376h376q-10 29 -22 41l-313 313q-12 12 -41 22zM1408 -128v1024h-416q-40 0 -68 28t-28 68v416h-768v-1536h1280z |
| | | M894 465q33 -26 84 -56q59 7 117 7q147 0 177 -49q16 -22 2 -52q0 -1 -1 -2l-2 -2v-1q-6 -38 -71 -38q-48 0 -115 20t-130 53q-221 -24 -392 -83q-153 -262 -242 -262q-15 0 -28 7l-24 12q-1 1 -6 5q-10 10 -6 36q9 40 56 91.5t132 96.5q14 9 23 -6q2 -2 2 -4q52 85 107 197 |
| | | q68 136 104 262q-24 82 -30.5 159.5t6.5 127.5q11 40 42 40h21h1q23 0 35 -15q18 -21 9 -68q-2 -6 -4 -8q1 -3 1 -8v-30q-2 -123 -14 -192q55 -164 146 -238zM318 54q52 24 137 158q-51 -40 -87.5 -84t-49.5 -74zM716 974q-15 -42 -2 -132q1 7 7 44q0 3 7 43q1 4 4 8 |
| | | q-1 1 -1 2q-1 2 -1 3q-1 22 -13 36q0 -1 -1 -2v-2zM592 313q135 54 284 81q-2 1 -13 9.5t-16 13.5q-76 67 -127 176q-27 -86 -83 -197q-30 -56 -45 -83zM1238 329q-24 24 -140 24q76 -28 124 -28q14 0 18 1q0 1 -2 3z" /> |
| | | <glyph glyph-name="_422" unicode="" |
| | | d="M1468 1156q28 -28 48 -76t20 -88v-1152q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h896q40 0 88 -20t76 -48zM1024 1400v-376h376q-10 29 -22 41l-313 313q-12 12 -41 22zM1408 -128v1024h-416q-40 0 -68 28t-28 68v416h-768v-1536h1280z |
| | | M233 768v-107h70l164 -661h159l128 485q7 20 10 46q2 16 2 24h4l3 -24q1 -3 3.5 -20t5.5 -26l128 -485h159l164 661h70v107h-300v-107h90l-99 -438q-5 -20 -7 -46l-2 -21h-4q0 3 -0.5 6.5t-1.5 8t-1 6.5q-1 5 -4 21t-5 25l-144 545h-114l-144 -545q-2 -9 -4.5 -24.5 |
| | | t-3.5 -21.5l-4 -21h-4l-2 21q-2 26 -7 46l-99 438h90v107h-300z" /> |
| | | <glyph glyph-name="_423" unicode="" |
| | | d="M1468 1156q28 -28 48 -76t20 -88v-1152q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h896q40 0 88 -20t76 -48zM1024 1400v-376h376q-10 29 -22 41l-313 313q-12 12 -41 22zM1408 -128v1024h-416q-40 0 -68 28t-28 68v416h-768v-1536h1280z |
| | | M429 106v-106h281v106h-75l103 161q5 7 10 16.5t7.5 13.5t3.5 4h2q1 -4 5 -10q2 -4 4.5 -7.5t6 -8t6.5 -8.5l107 -161h-76v-106h291v106h-68l-192 273l195 282h67v107h-279v-107h74l-103 -159q-4 -7 -10 -16.5t-9 -13.5l-2 -3h-2q-1 4 -5 10q-6 11 -17 23l-106 159h76v107 |
| | | h-290v-107h68l189 -272l-194 -283h-68z" /> |
| | | <glyph glyph-name="_424" unicode="" |
| | | d="M1468 1156q28 -28 48 -76t20 -88v-1152q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h896q40 0 88 -20t76 -48zM1024 1400v-376h376q-10 29 -22 41l-313 313q-12 12 -41 22zM1408 -128v1024h-416q-40 0 -68 28t-28 68v416h-768v-1536h1280z |
| | | M416 106v-106h327v106h-93v167h137q76 0 118 15q67 23 106.5 87t39.5 146q0 81 -37 141t-100 87q-48 19 -130 19h-368v-107h92v-555h-92zM769 386h-119v268h120q52 0 83 -18q56 -33 56 -115q0 -89 -62 -120q-31 -15 -78 -15z" /> |
| | | <glyph glyph-name="_425" unicode="" |
| | | d="M1468 1156q28 -28 48 -76t20 -88v-1152q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h896q40 0 88 -20t76 -48zM1024 1400v-376h376q-10 29 -22 41l-313 313q-12 12 -41 22zM1408 -128v1024h-416q-40 0 -68 28t-28 68v416h-768v-1536h1280z |
| | | M1280 320v-320h-1024v192l192 192l128 -128l384 384zM448 512q-80 0 -136 56t-56 136t56 136t136 56t136 -56t56 -136t-56 -136t-136 -56z" /> |
| | | <glyph glyph-name="_426" unicode="" |
| | | d="M640 1152v128h-128v-128h128zM768 1024v128h-128v-128h128zM640 896v128h-128v-128h128zM768 768v128h-128v-128h128zM1468 1156q28 -28 48 -76t20 -88v-1152q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h896q40 0 88 -20t76 -48zM1024 1400 |
| | | v-376h376q-10 29 -22 41l-313 313q-12 12 -41 22zM1408 -128v1024h-416q-40 0 -68 28t-28 68v416h-128v-128h-128v128h-512v-1536h1280zM781 593l107 -349q8 -27 8 -52q0 -83 -72.5 -137.5t-183.5 -54.5t-183.5 54.5t-72.5 137.5q0 25 8 52q21 63 120 396v128h128v-128h79 |
| | | q22 0 39 -13t23 -34zM640 128q53 0 90.5 19t37.5 45t-37.5 45t-90.5 19t-90.5 -19t-37.5 -45t37.5 -45t90.5 -19z" /> |
| | | <glyph glyph-name="_427" unicode="" |
| | | d="M1468 1156q28 -28 48 -76t20 -88v-1152q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h896q40 0 88 -20t76 -48zM1024 1400v-376h376q-10 29 -22 41l-313 313q-12 12 -41 22zM1408 -128v1024h-416q-40 0 -68 28t-28 68v416h-768v-1536h1280z |
| | | M620 686q20 -8 20 -30v-544q0 -22 -20 -30q-8 -2 -12 -2q-12 0 -23 9l-166 167h-131q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h131l166 167q16 15 35 7zM1037 -3q31 0 50 24q129 159 129 363t-129 363q-16 21 -43 24t-47 -14q-21 -17 -23.5 -43.5t14.5 -47.5 |
| | | q100 -123 100 -282t-100 -282q-17 -21 -14.5 -47.5t23.5 -42.5q18 -15 40 -15zM826 145q27 0 47 20q87 93 87 219t-87 219q-18 19 -45 20t-46 -17t-20 -44.5t18 -46.5q52 -57 52 -131t-52 -131q-19 -20 -18 -46.5t20 -44.5q20 -17 44 -17z" /> |
| | | <glyph glyph-name="_428" unicode="" |
| | | d="M1468 1156q28 -28 48 -76t20 -88v-1152q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h896q40 0 88 -20t76 -48zM1024 1400v-376h376q-10 29 -22 41l-313 313q-12 12 -41 22zM1408 -128v1024h-416q-40 0 -68 28t-28 68v416h-768v-1536h1280z |
| | | M768 768q52 0 90 -38t38 -90v-384q0 -52 -38 -90t-90 -38h-384q-52 0 -90 38t-38 90v384q0 52 38 90t90 38h384zM1260 766q20 -8 20 -30v-576q0 -22 -20 -30q-8 -2 -12 -2q-14 0 -23 9l-265 266v90l265 266q9 9 23 9q4 0 12 -2z" /> |
| | | <glyph glyph-name="_429" unicode="" |
| | | d="M1468 1156q28 -28 48 -76t20 -88v-1152q0 -40 -28 -68t-68 -28h-1344q-40 0 -68 28t-28 68v1600q0 40 28 68t68 28h896q40 0 88 -20t76 -48zM1024 1400v-376h376q-10 29 -22 41l-313 313q-12 12 -41 22zM1408 -128v1024h-416q-40 0 -68 28t-28 68v416h-768v-1536h1280z |
| | | M480 768q8 11 21 12.5t24 -6.5l51 -38q11 -8 12.5 -21t-6.5 -24l-182 -243l182 -243q8 -11 6.5 -24t-12.5 -21l-51 -38q-11 -8 -24 -6.5t-21 12.5l-226 301q-14 19 0 38zM1282 467q14 -19 0 -38l-226 -301q-8 -11 -21 -12.5t-24 6.5l-51 38q-11 8 -12.5 21t6.5 24l182 243 |
| | | l-182 243q-8 11 -6.5 24t12.5 21l51 38q11 8 24 6.5t21 -12.5zM662 6q-13 2 -20.5 13t-5.5 24l138 831q2 13 13 20.5t24 5.5l63 -10q13 -2 20.5 -13t5.5 -24l-138 -831q-2 -13 -13 -20.5t-24 -5.5z" /> |
| | | <glyph glyph-name="_430" unicode="" |
| | | d="M1497 709v-198q-101 -23 -198 -23q-65 -136 -165.5 -271t-181.5 -215.5t-128 -106.5q-80 -45 -162 3q-28 17 -60.5 43.5t-85 83.5t-102.5 128.5t-107.5 184t-105.5 244t-91.5 314.5t-70.5 390h283q26 -218 70 -398.5t104.5 -317t121.5 -235.5t140 -195q169 169 287 406 |
| | | q-142 72 -223 220t-81 333q0 192 104 314.5t284 122.5q178 0 273 -105.5t95 -297.5q0 -159 -58 -286q-7 -1 -19.5 -3t-46 -2t-63 6t-62 25.5t-50.5 51.5q31 103 31 184q0 87 -29 132t-79 45q-53 0 -85 -49.5t-32 -140.5q0 -186 105 -293.5t267 -107.5q62 0 121 14z" /> |
| | | <glyph glyph-name="_431" unicode="" horiz-adv-x="1792" |
| | | d="M216 367l603 -402v359l-334 223zM154 511l193 129l-193 129v-258zM973 -35l603 402l-269 180l-334 -223v-359zM896 458l272 182l-272 182l-272 -182zM485 733l334 223v359l-603 -402zM1445 640l193 -129v258zM1307 733l269 180l-603 402v-359zM1792 913v-546 |
| | | q0 -41 -34 -64l-819 -546q-21 -13 -43 -13t-43 13l-819 546q-34 23 -34 64v546q0 41 34 64l819 546q21 13 43 13t43 -13l819 -546q34 -23 34 -64z" /> |
| | | <glyph glyph-name="_432" unicode="" horiz-adv-x="2048" |
| | | d="M1800 764q111 -46 179.5 -145.5t68.5 -221.5q0 -164 -118 -280.5t-285 -116.5q-4 0 -11.5 0.5t-10.5 0.5h-1209h-1h-2h-5q-170 10 -288 125.5t-118 280.5q0 110 55 203t147 147q-12 39 -12 82q0 115 82 196t199 81q95 0 172 -58q75 154 222.5 248t326.5 94 |
| | | q166 0 306 -80.5t221.5 -218.5t81.5 -301q0 -6 -0.5 -18t-0.5 -18zM468 498q0 -122 84 -193t208 -71q137 0 240 99q-16 20 -47.5 56.5t-43.5 50.5q-67 -65 -144 -65q-55 0 -93.5 33.5t-38.5 87.5q0 53 38.5 87t91.5 34q44 0 84.5 -21t73 -55t65 -75t69 -82t77 -75t97 -55 |
| | | t121.5 -21q121 0 204.5 71.5t83.5 190.5q0 121 -84 192t-207 71q-143 0 -241 -97l93 -108q66 64 142 64q52 0 92 -33t40 -84q0 -57 -37 -91.5t-94 -34.5q-43 0 -82.5 21t-72 55t-65.5 75t-69.5 82t-77.5 75t-96.5 55t-118.5 21q-122 0 -207 -70.5t-85 -189.5z" /> |
| | | <glyph glyph-name="_433" unicode="" horiz-adv-x="1792" |
| | | d="M896 1536q182 0 348 -71t286 -191t191 -286t71 -348t-71 -348t-191 -286t-286 -191t-348 -71t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71zM896 1408q-190 0 -361 -90l194 -194q82 28 167 28t167 -28l194 194q-171 90 -361 90zM218 279l194 194 |
| | | q-28 82 -28 167t28 167l-194 194q-90 -171 -90 -361t90 -361zM896 -128q190 0 361 90l-194 194q-82 -28 -167 -28t-167 28l-194 -194q171 -90 361 -90zM896 256q159 0 271.5 112.5t112.5 271.5t-112.5 271.5t-271.5 112.5t-271.5 -112.5t-112.5 -271.5t112.5 -271.5 |
| | | t271.5 -112.5zM1380 473l194 -194q90 171 90 361t-90 361l-194 -194q28 -82 28 -167t-28 -167z" /> |
| | | <glyph glyph-name="_434" unicode="" horiz-adv-x="1792" |
| | | d="M1760 640q0 -176 -68.5 -336t-184 -275.5t-275.5 -184t-336 -68.5t-336 68.5t-275.5 184t-184 275.5t-68.5 336q0 213 97 398.5t265 305.5t374 151v-228q-221 -45 -366.5 -221t-145.5 -406q0 -130 51 -248.5t136.5 -204t204 -136.5t248.5 -51t248.5 51t204 136.5 |
| | | t136.5 204t51 248.5q0 230 -145.5 406t-366.5 221v228q206 -31 374 -151t265 -305.5t97 -398.5z" /> |
| | | <glyph glyph-name="uniF1D0" unicode="" horiz-adv-x="1792" |
| | | d="M19 662q8 217 116 406t305 318h5q0 -1 -1 -3q-8 -8 -28 -33.5t-52 -76.5t-60 -110.5t-44.5 -135.5t-14 -150.5t39 -157.5t108.5 -154q50 -50 102 -69.5t90.5 -11.5t69.5 23.5t47 32.5l16 16q39 51 53 116.5t6.5 122.5t-21 107t-26.5 80l-14 29q-10 25 -30.5 49.5t-43 41 |
| | | t-43.5 29.5t-35 19l-13 6l104 115q39 -17 78 -52t59 -61l19 -27q1 48 -18.5 103.5t-40.5 87.5l-20 31l161 183l160 -181q-33 -46 -52.5 -102.5t-22.5 -90.5l-4 -33q22 37 61.5 72.5t67.5 52.5l28 17l103 -115q-44 -14 -85 -50t-60 -65l-19 -29q-31 -56 -48 -133.5t-7 -170 |
| | | t57 -156.5q33 -45 77.5 -60.5t85 -5.5t76 26.5t57.5 33.5l21 16q60 53 96.5 115t48.5 121.5t10 121.5t-18 118t-37 107.5t-45.5 93t-45 72t-34.5 47.5l-13 17q-14 13 -7 13l10 -3q40 -29 62.5 -46t62 -50t64 -58t58.5 -65t55.5 -77t45.5 -88t38 -103t23.5 -117t10.5 -136 |
| | | q3 -259 -108 -465t-312 -321t-456 -115q-185 0 -351 74t-283.5 198t-184 293t-60.5 353z" /> |
| | | <glyph glyph-name="uniF1D1" unicode="" horiz-adv-x="1792" |
| | | d="M874 -102v-66q-208 6 -385 109.5t-283 275.5l58 34q29 -49 73 -99l65 57q148 -168 368 -212l-17 -86q65 -12 121 -13zM276 428l-83 -28q22 -60 49 -112l-57 -33q-98 180 -98 385t98 385l57 -33q-30 -56 -49 -112l82 -28q-35 -100 -35 -212q0 -109 36 -212zM1528 251 |
| | | l58 -34q-106 -172 -283 -275.5t-385 -109.5v66q56 1 121 13l-17 86q220 44 368 212l65 -57q44 50 73 99zM1377 805l-233 -80q14 -42 14 -85t-14 -85l232 -80q-31 -92 -98 -169l-185 162q-57 -67 -147 -85l48 -241q-52 -10 -98 -10t-98 10l48 241q-90 18 -147 85l-185 -162 |
| | | q-67 77 -98 169l232 80q-14 42 -14 85t14 85l-233 80q33 93 99 169l185 -162q59 68 147 86l-48 240q44 10 98 10t98 -10l-48 -240q88 -18 147 -86l185 162q66 -76 99 -169zM874 1448v-66q-65 -2 -121 -13l17 -86q-220 -42 -368 -211l-65 56q-38 -42 -73 -98l-57 33 |
| | | q106 172 282 275.5t385 109.5zM1705 640q0 -205 -98 -385l-57 33q27 52 49 112l-83 28q36 103 36 212q0 112 -35 212l82 28q-19 56 -49 112l57 33q98 -180 98 -385zM1585 1063l-57 -33q-35 56 -73 98l-65 -56q-148 169 -368 211l17 86q-56 11 -121 13v66q209 -6 385 -109.5 |
| | | t282 -275.5zM1748 640q0 173 -67.5 331t-181.5 272t-272 181.5t-331 67.5t-331 -67.5t-272 -181.5t-181.5 -272t-67.5 -331t67.5 -331t181.5 -272t272 -181.5t331 -67.5t331 67.5t272 181.5t181.5 272t67.5 331zM1792 640q0 -182 -71 -348t-191 -286t-286 -191t-348 -71 |
| | | t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71t348 -71t286 -191t191 -286t71 -348z" /> |
| | | <glyph glyph-name="uniF1D2" unicode="" |
| | | d="M582 228q0 -66 -93 -66q-107 0 -107 63q0 64 98 64q102 0 102 -61zM546 694q0 -85 -74 -85q-77 0 -77 84q0 90 77 90q36 0 55 -25.5t19 -63.5zM712 769v125q-78 -29 -135 -29q-50 29 -110 29q-86 0 -145 -57t-59 -143q0 -50 29.5 -102t73.5 -67v-3q-38 -17 -38 -85 |
| | | q0 -53 41 -77v-3q-113 -37 -113 -139q0 -45 20 -78.5t54 -51t72 -25.5t81 -8q224 0 224 188q0 67 -48 99t-126 46q-27 5 -51.5 20.5t-24.5 39.5q0 44 49 52q77 15 122 70t45 134q0 24 -10 52q37 9 49 13zM771 350h137q-2 27 -2 82v387q0 46 2 69h-137q3 -23 3 -71v-392 |
| | | q0 -50 -3 -75zM1280 366v121q-30 -21 -68 -21q-53 0 -53 82v225h52q9 0 26.5 -1t26.5 -1v117h-105q0 82 3 102h-140q4 -24 4 -55v-47h-60v-117q36 3 37 3q3 0 11 -0.5t12 -0.5v-2h-2v-217q0 -37 2.5 -64t11.5 -56.5t24.5 -48.5t43.5 -31t66 -12q64 0 108 24zM924 1072 |
| | | q0 36 -24 63.5t-60 27.5t-60.5 -27t-24.5 -64q0 -36 25 -62.5t60 -26.5t59.5 27t24.5 62zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> |
| | | <glyph glyph-name="_438" unicode="" horiz-adv-x="1792" |
| | | d="M595 22q0 100 -165 100q-158 0 -158 -104q0 -101 172 -101q151 0 151 105zM536 777q0 61 -30 102t-89 41q-124 0 -124 -145q0 -135 124 -135q119 0 119 137zM805 1101v-202q-36 -12 -79 -22q16 -43 16 -84q0 -127 -73 -216.5t-197 -112.5q-40 -8 -59.5 -27t-19.5 -58 |
| | | q0 -31 22.5 -51.5t58 -32t78.5 -22t86 -25.5t78.5 -37.5t58 -64t22.5 -98.5q0 -304 -363 -304q-69 0 -130 12.5t-116 41t-87.5 82t-32.5 127.5q0 165 182 225v4q-67 41 -67 126q0 109 63 137v4q-72 24 -119.5 108.5t-47.5 165.5q0 139 95 231.5t235 92.5q96 0 178 -47 |
| | | q98 0 218 47zM1123 220h-222q4 45 4 134v609q0 94 -4 128h222q-4 -33 -4 -124v-613q0 -89 4 -134zM1724 442v-196q-71 -39 -174 -39q-62 0 -107 20t-70 50t-39.5 78t-18.5 92t-4 103v351h2v4q-7 0 -19 1t-18 1q-21 0 -59 -6v190h96v76q0 54 -6 89h227q-6 -41 -6 -165h171 |
| | | v-190q-15 0 -43.5 2t-42.5 2h-85v-365q0 -131 87 -131q61 0 109 33zM1148 1389q0 -58 -39 -101.5t-96 -43.5q-58 0 -98 43.5t-40 101.5q0 59 39.5 103t98.5 44q58 0 96.5 -44.5t38.5 -102.5z" /> |
| | | <glyph glyph-name="_439" unicode="" |
| | | d="M809 532l266 499h-112l-157 -312q-24 -48 -44 -92l-42 92l-155 312h-120l263 -493v-324h101v318zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> |
| | | <glyph glyph-name="uniF1D5" unicode="" horiz-adv-x="1280" |
| | | d="M842 964q0 -80 -57 -136.5t-136 -56.5q-60 0 -111 35q-62 -67 -115 -146q-247 -371 -202 -859q1 -22 -12.5 -38.5t-34.5 -18.5h-5q-20 0 -35 13.5t-17 33.5q-14 126 -3.5 247.5t29.5 217t54 186t69 155.5t74 125q61 90 132 165q-16 35 -16 77q0 80 56.5 136.5t136.5 56.5 |
| | | t136.5 -56.5t56.5 -136.5zM1223 953q0 -158 -78 -292t-212.5 -212t-292.5 -78q-64 0 -131 14q-21 5 -32.5 23.5t-6.5 39.5q5 20 23 31.5t39 7.5q51 -13 108 -13q97 0 186 38t153 102t102 153t38 186t-38 186t-102 153t-153 102t-186 38t-186 -38t-153 -102t-102 -153 |
| | | t-38 -186q0 -114 52 -218q10 -20 3.5 -40t-25.5 -30t-39.5 -3t-30.5 26q-64 123 -64 265q0 119 46.5 227t124.5 186t186 124t226 46q158 0 292.5 -78t212.5 -212.5t78 -292.5z" /> |
| | | <glyph glyph-name="uniF1D6" unicode="" horiz-adv-x="1792" |
| | | d="M270 730q-8 19 -8 52q0 20 11 49t24 45q-1 22 7.5 53t22.5 43q0 139 92.5 288.5t217.5 209.5q139 66 324 66q133 0 266 -55q49 -21 90 -48t71 -56t55 -68t42 -74t32.5 -84.5t25.5 -89.5t22 -98l1 -5q55 -83 55 -150q0 -14 -9 -40t-9 -38q0 -1 1.5 -3.5t3.5 -5t2 -3.5 |
| | | q77 -114 120.5 -214.5t43.5 -208.5q0 -43 -19.5 -100t-55.5 -57q-9 0 -19.5 7.5t-19 17.5t-19 26t-16 26.5t-13.5 26t-9 17.5q-1 1 -3 1l-5 -4q-59 -154 -132 -223q20 -20 61.5 -38.5t69 -41.5t35.5 -65q-2 -4 -4 -16t-7 -18q-64 -97 -302 -97q-53 0 -110.5 9t-98 20 |
| | | t-104.5 30q-15 5 -23 7q-14 4 -46 4.5t-40 1.5q-41 -45 -127.5 -65t-168.5 -20q-35 0 -69 1.5t-93 9t-101 20.5t-74.5 40t-32.5 64q0 40 10 59.5t41 48.5q11 2 40.5 13t49.5 12q4 0 14 2q2 2 2 4l-2 3q-48 11 -108 105.5t-73 156.5l-5 3q-4 0 -12 -20q-18 -41 -54.5 -74.5 |
| | | t-77.5 -37.5h-1q-4 0 -6 4.5t-5 5.5q-23 54 -23 100q0 275 252 466z" /> |
| | | <glyph glyph-name="uniF1D7" unicode="" horiz-adv-x="2048" |
| | | d="M580 1075q0 41 -25 66t-66 25q-43 0 -76 -25.5t-33 -65.5q0 -39 33 -64.5t76 -25.5q41 0 66 24.5t25 65.5zM1323 568q0 28 -25.5 50t-65.5 22q-27 0 -49.5 -22.5t-22.5 -49.5q0 -28 22.5 -50.5t49.5 -22.5q40 0 65.5 22t25.5 51zM1087 1075q0 41 -24.5 66t-65.5 25 |
| | | q-43 0 -76 -25.5t-33 -65.5q0 -39 33 -64.5t76 -25.5q41 0 65.5 24.5t24.5 65.5zM1722 568q0 28 -26 50t-65 22q-27 0 -49.5 -22.5t-22.5 -49.5q0 -28 22.5 -50.5t49.5 -22.5q39 0 65 22t26 51zM1456 965q-31 4 -70 4q-169 0 -311 -77t-223.5 -208.5t-81.5 -287.5 |
| | | q0 -78 23 -152q-35 -3 -68 -3q-26 0 -50 1.5t-55 6.5t-44.5 7t-54.5 10.5t-50 10.5l-253 -127l72 218q-290 203 -290 490q0 169 97.5 311t264 223.5t363.5 81.5q176 0 332.5 -66t262 -182.5t136.5 -260.5zM2048 404q0 -117 -68.5 -223.5t-185.5 -193.5l55 -181l-199 109 |
| | | q-150 -37 -218 -37q-169 0 -311 70.5t-223.5 191.5t-81.5 264t81.5 264t223.5 191.5t311 70.5q161 0 303 -70.5t227.5 -192t85.5 -263.5z" /> |
| | | <glyph glyph-name="_443" unicode="" horiz-adv-x="1792" |
| | | d="M1764 1525q33 -24 27 -64l-256 -1536q-5 -29 -32 -45q-14 -8 -31 -8q-11 0 -24 5l-453 185l-242 -295q-18 -23 -49 -23q-13 0 -22 4q-19 7 -30.5 23.5t-11.5 36.5v349l864 1059l-1069 -925l-395 162q-37 14 -40 55q-2 40 32 59l1664 960q15 9 32 9q20 0 36 -11z" /> |
| | | <glyph glyph-name="_444" unicode="" horiz-adv-x="1792" |
| | | d="M1764 1525q33 -24 27 -64l-256 -1536q-5 -29 -32 -45q-14 -8 -31 -8q-11 0 -24 5l-527 215l-298 -327q-18 -21 -47 -21q-14 0 -23 4q-19 7 -30 23.5t-11 36.5v452l-472 193q-37 14 -40 55q-3 39 32 59l1664 960q35 21 68 -2zM1422 26l221 1323l-1434 -827l336 -137 |
| | | l863 639l-478 -797z" /> |
| | | <glyph glyph-name="_445" unicode="" |
| | | d="M1536 640q0 -156 -61 -298t-164 -245t-245 -164t-298 -61q-172 0 -327 72.5t-264 204.5q-7 10 -6.5 22.5t8.5 20.5l137 138q10 9 25 9q16 -2 23 -12q73 -95 179 -147t225 -52q104 0 198.5 40.5t163.5 109.5t109.5 163.5t40.5 198.5t-40.5 198.5t-109.5 163.5 |
| | | t-163.5 109.5t-198.5 40.5q-98 0 -188 -35.5t-160 -101.5l137 -138q31 -30 14 -69q-17 -40 -59 -40h-448q-26 0 -45 19t-19 45v448q0 42 40 59q39 17 69 -14l130 -129q107 101 244.5 156.5t284.5 55.5q156 0 298 -61t245 -164t164 -245t61 -298zM896 928v-448q0 -14 -9 -23 |
| | | t-23 -9h-320q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h224v352q0 14 9 23t23 9h64q14 0 23 -9t9 -23z" /> |
| | | <glyph glyph-name="_446" unicode="" |
| | | d="M768 1280q-130 0 -248.5 -51t-204 -136.5t-136.5 -204t-51 -248.5t51 -248.5t136.5 -204t204 -136.5t248.5 -51t248.5 51t204 136.5t136.5 204t51 248.5t-51 248.5t-136.5 204t-204 136.5t-248.5 51zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103 |
| | | t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> |
| | | <glyph glyph-name="_447" unicode="" horiz-adv-x="1792" |
| | | d="M1682 -128q-44 0 -132.5 3.5t-133.5 3.5q-44 0 -132 -3.5t-132 -3.5q-24 0 -37 20.5t-13 45.5q0 31 17 46t39 17t51 7t45 15q33 21 33 140l-1 391q0 21 -1 31q-13 4 -50 4h-675q-38 0 -51 -4q-1 -10 -1 -31l-1 -371q0 -142 37 -164q16 -10 48 -13t57 -3.5t45 -15 |
| | | t20 -45.5q0 -26 -12.5 -48t-36.5 -22q-47 0 -139.5 3.5t-138.5 3.5q-43 0 -128 -3.5t-127 -3.5q-23 0 -35.5 21t-12.5 45q0 30 15.5 45t36 17.5t47.5 7.5t42 15q33 23 33 143l-1 57v813q0 3 0.5 26t0 36.5t-1.5 38.5t-3.5 42t-6.5 36.5t-11 31.5t-16 18q-15 10 -45 12t-53 2 |
| | | t-41 14t-18 45q0 26 12 48t36 22q46 0 138.5 -3.5t138.5 -3.5q42 0 126.5 3.5t126.5 3.5q25 0 37.5 -22t12.5 -48q0 -30 -17 -43.5t-38.5 -14.5t-49.5 -4t-43 -13q-35 -21 -35 -160l1 -320q0 -21 1 -32q13 -3 39 -3h699q25 0 38 3q1 11 1 32l1 320q0 139 -35 160 |
| | | q-18 11 -58.5 12.5t-66 13t-25.5 49.5q0 26 12.5 48t37.5 22q44 0 132 -3.5t132 -3.5q43 0 129 3.5t129 3.5q25 0 37.5 -22t12.5 -48q0 -30 -17.5 -44t-40 -14.5t-51.5 -3t-44 -12.5q-35 -23 -35 -161l1 -943q0 -119 34 -140q16 -10 46 -13.5t53.5 -4.5t41.5 -15.5t18 -44.5 |
| | | q0 -26 -12 -48t-36 -22z" /> |
| | | <glyph glyph-name="_448" unicode="" horiz-adv-x="1280" |
| | | d="M1278 1347v-73q0 -29 -18.5 -61t-42.5 -32q-50 0 -54 -1q-26 -6 -32 -31q-3 -11 -3 -64v-1152q0 -25 -18 -43t-43 -18h-108q-25 0 -43 18t-18 43v1218h-143v-1218q0 -25 -17.5 -43t-43.5 -18h-108q-26 0 -43.5 18t-17.5 43v496q-147 12 -245 59q-126 58 -192 179 |
| | | q-64 117 -64 259q0 166 88 286q88 118 209 159q111 37 417 37h479q25 0 43 -18t18 -43z" /> |
| | | <glyph glyph-name="_449" unicode="" |
| | | d="M352 128v-128h-352v128h352zM704 256q26 0 45 -19t19 -45v-256q0 -26 -19 -45t-45 -19h-256q-26 0 -45 19t-19 45v256q0 26 19 45t45 19h256zM864 640v-128h-864v128h864zM224 1152v-128h-224v128h224zM1536 128v-128h-736v128h736zM576 1280q26 0 45 -19t19 -45v-256 |
| | | q0 -26 -19 -45t-45 -19h-256q-26 0 -45 19t-19 45v256q0 26 19 45t45 19h256zM1216 768q26 0 45 -19t19 -45v-256q0 -26 -19 -45t-45 -19h-256q-26 0 -45 19t-19 45v256q0 26 19 45t45 19h256zM1536 640v-128h-224v128h224zM1536 1152v-128h-864v128h864z" /> |
| | | <glyph glyph-name="uniF1E0" unicode="" |
| | | d="M1216 512q133 0 226.5 -93.5t93.5 -226.5t-93.5 -226.5t-226.5 -93.5t-226.5 93.5t-93.5 226.5q0 12 2 34l-360 180q-92 -86 -218 -86q-133 0 -226.5 93.5t-93.5 226.5t93.5 226.5t226.5 93.5q126 0 218 -86l360 180q-2 22 -2 34q0 133 93.5 226.5t226.5 93.5 |
| | | t226.5 -93.5t93.5 -226.5t-93.5 -226.5t-226.5 -93.5q-126 0 -218 86l-360 -180q2 -22 2 -34t-2 -34l360 -180q92 86 218 86z" /> |
| | | <glyph glyph-name="_451" unicode="" |
| | | d="M1280 341q0 88 -62.5 151t-150.5 63q-84 0 -145 -58l-241 120q2 16 2 23t-2 23l241 120q61 -58 145 -58q88 0 150.5 63t62.5 151t-62.5 150.5t-150.5 62.5t-151 -62.5t-63 -150.5q0 -7 2 -23l-241 -120q-62 57 -145 57q-88 0 -150.5 -62.5t-62.5 -150.5t62.5 -150.5 |
| | | t150.5 -62.5q83 0 145 57l241 -120q-2 -16 -2 -23q0 -88 63 -150.5t151 -62.5t150.5 62.5t62.5 150.5zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> |
| | | <glyph glyph-name="_452" unicode="" horiz-adv-x="1792" |
| | | d="M571 947q-10 25 -34 35t-49 0q-108 -44 -191 -127t-127 -191q-10 -25 0 -49t35 -34q13 -5 24 -5q42 0 60 40q34 84 98.5 148.5t148.5 98.5q25 11 35 35t0 49zM1513 1303l46 -46l-244 -243l68 -68q19 -19 19 -45.5t-19 -45.5l-64 -64q89 -161 89 -343q0 -143 -55.5 -273.5 |
| | | t-150 -225t-225 -150t-273.5 -55.5t-273.5 55.5t-225 150t-150 225t-55.5 273.5t55.5 273.5t150 225t225 150t273.5 55.5q182 0 343 -89l64 64q19 19 45.5 19t45.5 -19l68 -68zM1521 1359q-10 -10 -22 -10q-13 0 -23 10l-91 90q-9 10 -9 23t9 23q10 9 23 9t23 -9l90 -91 |
| | | q10 -9 10 -22.5t-10 -22.5zM1751 1129q-11 -9 -23 -9t-23 9l-90 91q-10 9 -10 22.5t10 22.5q9 10 22.5 10t22.5 -10l91 -90q9 -10 9 -23t-9 -23zM1792 1312q0 -14 -9 -23t-23 -9h-96q-14 0 -23 9t-9 23t9 23t23 9h96q14 0 23 -9t9 -23zM1600 1504v-96q0 -14 -9 -23t-23 -9 |
| | | t-23 9t-9 23v96q0 14 9 23t23 9t23 -9t9 -23zM1751 1449l-91 -90q-10 -10 -22 -10q-13 0 -23 10q-10 9 -10 22.5t10 22.5l90 91q10 9 23 9t23 -9q9 -10 9 -23t-9 -23z" /> |
| | | <glyph glyph-name="_453" unicode="" horiz-adv-x="1792" |
| | | d="M609 720l287 208l287 -208l-109 -336h-355zM896 1536q182 0 348 -71t286 -191t191 -286t71 -348t-71 -348t-191 -286t-286 -191t-348 -71t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71zM1515 186q149 203 149 454v3l-102 -89l-240 224l63 323 |
| | | l134 -12q-150 206 -389 282l53 -124l-287 -159l-287 159l53 124q-239 -76 -389 -282l135 12l62 -323l-240 -224l-102 89v-3q0 -251 149 -454l30 132l326 -40l139 -298l-116 -69q117 -39 240 -39t240 39l-116 69l139 298l326 40z" /> |
| | | <glyph glyph-name="_454" unicode="" horiz-adv-x="1792" |
| | | d="M448 224v-192q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM256 608v-192q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM832 224v-192q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23 |
| | | v192q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM640 608v-192q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM66 768q-28 0 -47 19t-19 46v129h514v-129q0 -27 -19 -46t-46 -19h-383zM1216 224v-192q0 -14 -9 -23t-23 -9h-192 |
| | | q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM1024 608v-192q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM1600 224v-192q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h192q14 0 23 -9t9 -23 |
| | | zM1408 608v-192q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM1792 1016v-13h-514v10q0 104 -382 102q-382 -1 -382 -102v-10h-514v13q0 17 8.5 43t34 64t65.5 75.5t110.5 76t160 67.5t224 47.5t293.5 18.5t293 -18.5t224 -47.5 |
| | | t160.5 -67.5t110.5 -76t65.5 -75.5t34 -64t8.5 -43zM1792 608v-192q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v192q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM1792 962v-129q0 -27 -19 -46t-46 -19h-384q-27 0 -46 19t-19 46v129h514z" /> |
| | | <glyph glyph-name="_455" unicode="" horiz-adv-x="1792" |
| | | d="M704 1216v-768q0 -26 -19 -45t-45 -19v-576q0 -26 -19 -45t-45 -19h-512q-26 0 -45 19t-19 45v512l249 873q7 23 31 23h424zM1024 1216v-704h-256v704h256zM1792 320v-512q0 -26 -19 -45t-45 -19h-512q-26 0 -45 19t-19 45v576q-26 0 -45 19t-19 45v768h424q24 0 31 -23z |
| | | M736 1504v-224h-352v224q0 14 9 23t23 9h288q14 0 23 -9t9 -23zM1408 1504v-224h-352v224q0 14 9 23t23 9h288q14 0 23 -9t9 -23z" /> |
| | | <glyph glyph-name="_456" unicode="" horiz-adv-x="1792" |
| | | d="M1755 1083q37 -38 37 -90.5t-37 -90.5l-401 -400l150 -150l-160 -160q-163 -163 -389.5 -186.5t-411.5 100.5l-362 -362h-181v181l362 362q-124 185 -100.5 411.5t186.5 389.5l160 160l150 -150l400 401q38 37 91 37t90 -37t37 -90.5t-37 -90.5l-400 -401l234 -234 |
| | | l401 400q38 37 91 37t90 -37z" /> |
| | | <glyph glyph-name="_457" unicode="" horiz-adv-x="1792" |
| | | d="M873 796q0 -83 -63.5 -142.5t-152.5 -59.5t-152.5 59.5t-63.5 142.5q0 84 63.5 143t152.5 59t152.5 -59t63.5 -143zM1375 796q0 -83 -63 -142.5t-153 -59.5q-89 0 -152.5 59.5t-63.5 142.5q0 84 63.5 143t152.5 59q90 0 153 -59t63 -143zM1600 616v667q0 87 -32 123.5 |
| | | t-111 36.5h-1112q-83 0 -112.5 -34t-29.5 -126v-673q43 -23 88.5 -40t81 -28t81 -18.5t71 -11t70 -4t58.5 -0.5t56.5 2t44.5 2q68 1 95 -27q6 -6 10 -9q26 -25 61 -51q7 91 118 87q5 0 36.5 -1.5t43 -2t45.5 -1t53 1t54.5 4.5t61 8.5t62 13.5t67 19.5t67.5 27t72 34.5z |
| | | M1763 621q-121 -149 -372 -252q84 -285 -23 -465q-66 -113 -183 -148q-104 -32 -182 15q-86 51 -82 164l-1 326v1q-8 2 -24.5 6t-23.5 5l-1 -338q4 -114 -83 -164q-79 -47 -183 -15q-117 36 -182 150q-105 180 -22 463q-251 103 -372 252q-25 37 -4 63t60 -1q4 -2 11.5 -7 |
| | | t10.5 -8v694q0 72 47 123t114 51h1257q67 0 114 -51t47 -123v-694l21 15q39 27 60 1t-4 -63z" /> |
| | | <glyph glyph-name="_458" unicode="" horiz-adv-x="1792" |
| | | d="M896 1102v-434h-145v434h145zM1294 1102v-434h-145v434h145zM1294 342l253 254v795h-1194v-1049h326v-217l217 217h398zM1692 1536v-1013l-434 -434h-326l-217 -217h-217v217h-398v1158l109 289h1483z" /> |
| | | <glyph glyph-name="_459" unicode="" |
| | | d="M773 217v-127q-1 -292 -6 -305q-12 -32 -51 -40q-54 -9 -181.5 38t-162.5 89q-13 15 -17 36q-1 12 4 26q4 10 34 47t181 216q1 0 60 70q15 19 39.5 24.5t49.5 -3.5q24 -10 37.5 -29t12.5 -42zM624 468q-3 -55 -52 -70l-120 -39q-275 -88 -292 -88q-35 2 -54 36 |
| | | q-12 25 -17 75q-8 76 1 166.5t30 124.5t56 32q13 0 202 -77q71 -29 115 -47l84 -34q23 -9 35.5 -30.5t11.5 -48.5zM1450 171q-7 -54 -91.5 -161t-135.5 -127q-37 -14 -63 7q-14 10 -184 287l-47 77q-14 21 -11.5 46t19.5 46q35 43 83 26q1 -1 119 -40q203 -66 242 -79.5 |
| | | t47 -20.5q28 -22 22 -61zM778 803q5 -102 -54 -122q-58 -17 -114 71l-378 598q-8 35 19 62q41 43 207.5 89.5t224.5 31.5q40 -10 49 -45q3 -18 22 -305.5t24 -379.5zM1440 695q3 -39 -26 -59q-15 -10 -329 -86q-67 -15 -91 -23l1 2q-23 -6 -46 4t-37 32q-30 47 0 87 |
| | | q1 1 75 102q125 171 150 204t34 39q28 19 65 2q48 -23 123 -133.5t81 -167.5v-3z" /> |
| | | <glyph glyph-name="_460" unicode="" horiz-adv-x="2048" |
| | | d="M1024 1024h-384v-384h384v384zM1152 384v-128h-640v128h640zM1152 1152v-640h-640v640h640zM1792 384v-128h-512v128h512zM1792 640v-128h-512v128h512zM1792 896v-128h-512v128h512zM1792 1152v-128h-512v128h512zM256 192v960h-128v-960q0 -26 19 -45t45 -19t45 19 |
| | | t19 45zM1920 192v1088h-1536v-1088q0 -33 -11 -64h1483q26 0 45 19t19 45zM2048 1408v-1216q0 -80 -56 -136t-136 -56h-1664q-80 0 -136 56t-56 136v1088h256v128h1792z" /> |
| | | <glyph glyph-name="_461" unicode="" horiz-adv-x="2048" |
| | | d="M1024 13q-20 0 -93 73.5t-73 93.5q0 32 62.5 54t103.5 22t103.5 -22t62.5 -54q0 -20 -73 -93.5t-93 -73.5zM1294 284q-2 0 -40 25t-101.5 50t-128.5 25t-128.5 -25t-101 -50t-40.5 -25q-18 0 -93.5 75t-75.5 93q0 13 10 23q78 77 196 121t233 44t233 -44t196 -121 |
| | | q10 -10 10 -23q0 -18 -75.5 -93t-93.5 -75zM1567 556q-11 0 -23 8q-136 105 -252 154.5t-268 49.5q-85 0 -170.5 -22t-149 -53t-113.5 -62t-79 -53t-31 -22q-17 0 -92 75t-75 93q0 12 10 22q132 132 320 205t380 73t380 -73t320 -205q10 -10 10 -22q0 -18 -75 -93t-92 -75z |
| | | M1838 827q-11 0 -22 9q-179 157 -371.5 236.5t-420.5 79.5t-420.5 -79.5t-371.5 -236.5q-11 -9 -22 -9q-17 0 -92.5 75t-75.5 93q0 13 10 23q187 186 445 288t527 102t527 -102t445 -288q10 -10 10 -23q0 -18 -75.5 -93t-92.5 -75z" /> |
| | | <glyph glyph-name="_462" unicode="" horiz-adv-x="1792" |
| | | d="M384 0q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM768 0q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM384 384q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5 |
| | | t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1152 0q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM768 384q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5 |
| | | t37.5 90.5zM384 768q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1152 384q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM768 768q0 53 -37.5 90.5t-90.5 37.5 |
| | | t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1536 0v384q0 52 -38 90t-90 38t-90 -38t-38 -90v-384q0 -52 38 -90t90 -38t90 38t38 90zM1152 768q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5z |
| | | M1536 1088v256q0 26 -19 45t-45 19h-1280q-26 0 -45 -19t-19 -45v-256q0 -26 19 -45t45 -19h1280q26 0 45 19t19 45zM1536 768q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1664 1408v-1536q0 -52 -38 -90t-90 -38 |
| | | h-1408q-52 0 -90 38t-38 90v1536q0 52 38 90t90 38h1408q52 0 90 -38t38 -90z" /> |
| | | <glyph glyph-name="_463" unicode="" |
| | | d="M1519 890q18 -84 -4 -204q-87 -444 -565 -444h-44q-25 0 -44 -16.5t-24 -42.5l-4 -19l-55 -346l-2 -15q-5 -26 -24.5 -42.5t-44.5 -16.5h-251q-21 0 -33 15t-9 36q9 56 26.5 168t26.5 168t27 167.5t27 167.5q5 37 43 37h131q133 -2 236 21q175 39 287 144q102 95 155 246 |
| | | q24 70 35 133q1 6 2.5 7.5t3.5 1t6 -3.5q79 -59 98 -162zM1347 1172q0 -107 -46 -236q-80 -233 -302 -315q-113 -40 -252 -42q0 -1 -90 -1l-90 1q-100 0 -118 -96q-2 -8 -85 -530q-1 -10 -12 -10h-295q-22 0 -36.5 16.5t-11.5 38.5l232 1471q5 29 27.5 48t51.5 19h598 |
| | | q34 0 97.5 -13t111.5 -32q107 -41 163.5 -123t56.5 -196z" /> |
| | | <glyph glyph-name="_464" unicode="" horiz-adv-x="1792" |
| | | d="M441 864q33 0 52 -26q266 -364 362 -774h-446q-127 441 -367 749q-12 16 -3 33.5t29 17.5h373zM1000 507q-49 -199 -125 -393q-79 310 -256 594q40 221 44 449q211 -340 337 -650zM1099 1216q235 -324 384.5 -698.5t184.5 -773.5h-451q-41 665 -553 1472h435zM1792 640 |
| | | q0 -424 -101 -812q-67 560 -359 1083q-25 301 -106 584q-4 16 5.5 28.5t25.5 12.5h359q21 0 38.5 -13t22.5 -33q115 -409 115 -850z" /> |
| | | <glyph glyph-name="uniF1F0" unicode="" horiz-adv-x="2304" |
| | | d="M1975 546h-138q14 37 66 179l3 9q4 10 10 26t9 26l12 -55zM531 611l-58 295q-11 54 -75 54h-268l-2 -13q311 -79 403 -336zM710 960l-162 -438l-17 89q-26 70 -85 129.5t-131 88.5l135 -510h175l261 641h-176zM849 318h166l104 642h-166zM1617 944q-69 27 -149 27 |
| | | q-123 0 -201 -59t-79 -153q-1 -102 145 -174q48 -23 67 -41t19 -39q0 -30 -30 -46t-69 -16q-86 0 -156 33l-22 11l-23 -144q74 -34 185 -34q130 -1 208.5 59t80.5 160q0 106 -140 174q-49 25 -71 42t-22 38q0 22 24.5 38.5t70.5 16.5q70 1 124 -24l15 -8zM2042 960h-128 |
| | | q-65 0 -87 -54l-246 -588h174l35 96h212q5 -22 20 -96h154zM2304 1280v-1280q0 -52 -38 -90t-90 -38h-2048q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h2048q52 0 90 -38t38 -90z" /> |
| | | <glyph glyph-name="_466" unicode="" horiz-adv-x="2304" |
| | | d="M1119 1195q-128 85 -281 85q-103 0 -197.5 -40.5t-162.5 -108.5t-108.5 -162t-40.5 -197q0 -104 40.5 -198t108.5 -162t162 -108.5t198 -40.5q153 0 281 85q-131 107 -178 265.5t0.5 316.5t177.5 265zM1152 1171q-126 -99 -172 -249.5t-0.5 -300.5t172.5 -249 |
| | | q127 99 172.5 249t-0.5 300.5t-172 249.5zM1185 1195q130 -107 177.5 -265.5t0.5 -317t-178 -264.5q128 -85 281 -85q104 0 198 40.5t162 108.5t108.5 162t40.5 198q0 103 -40.5 197t-108.5 162t-162.5 108.5t-197.5 40.5q-153 0 -281 -85zM1926 473h7v3h-17v-3h7v-17h3v17z |
| | | M1955 456h4v20h-5l-6 -13l-6 13h-5v-20h3v15l6 -13h4l5 13v-15zM1947 16v-2h-2h-3v3h3h2v-1zM1947 7h3l-4 5h2l1 1q1 1 1 3t-1 3l-1 1h-3h-6v-13h3v5h1zM685 75q0 19 11 31t30 12q18 0 29 -12.5t11 -30.5q0 -19 -11 -31t-29 -12q-19 0 -30 12t-11 31zM1158 119q30 0 35 -32 |
| | | h-70q5 32 35 32zM1514 75q0 19 11 31t29 12t29.5 -12.5t11.5 -30.5q0 -19 -11 -31t-30 -12q-18 0 -29 12t-11 31zM1786 75q0 18 11.5 30.5t29.5 12.5t29.5 -12.5t11.5 -30.5q0 -19 -11.5 -31t-29.5 -12t-29.5 12.5t-11.5 30.5zM1944 3q-2 0 -4 1q-1 0 -3 2t-2 3q-1 2 -1 4 |
| | | q0 3 1 4q0 2 2 4l1 1q2 0 2 1q2 1 4 1q3 0 4 -1l4 -2l2 -4v-1q1 -2 1 -3l-1 -1v-3t-1 -1l-1 -2q-2 -2 -4 -2q-1 -1 -4 -1zM599 7h30v85q0 24 -14.5 38.5t-39.5 15.5q-32 0 -47 -24q-14 24 -45 24q-24 0 -39 -20v16h-30v-135h30v75q0 36 33 36q30 0 30 -36v-75h29v75 |
| | | q0 36 33 36q30 0 30 -36v-75zM765 7h29v68v67h-29v-16q-17 20 -43 20q-29 0 -48 -20t-19 -51t19 -51t48 -20q28 0 43 20v-17zM943 48q0 34 -47 40l-14 2q-23 4 -23 14q0 15 25 15q23 0 43 -11l12 24q-22 14 -55 14q-26 0 -41 -12t-15 -32q0 -33 47 -39l13 -2q24 -4 24 -14 |
| | | q0 -17 -31 -17q-25 0 -45 14l-13 -23q25 -17 58 -17q29 0 45.5 12t16.5 32zM1073 14l-8 25q-13 -7 -26 -7q-19 0 -19 22v61h48v27h-48v41h-30v-41h-28v-27h28v-61q0 -50 47 -50q21 0 36 10zM1159 146q-29 0 -48 -20t-19 -51q0 -32 19.5 -51.5t49.5 -19.5q33 0 55 19l-14 22 |
| | | q-18 -15 -39 -15q-34 0 -41 33h101v12q0 32 -18 51.5t-46 19.5zM1318 146q-23 0 -35 -20v16h-30v-135h30v76q0 35 29 35q10 0 18 -4l9 28q-9 4 -21 4zM1348 75q0 -31 19.5 -51t52.5 -20q29 0 48 16l-14 24q-18 -13 -35 -12q-18 0 -29.5 12t-11.5 31t11.5 31t29.5 12 |
| | | q19 0 35 -12l14 24q-20 16 -48 16q-33 0 -52.5 -20t-19.5 -51zM1593 7h30v68v67h-30v-16q-15 20 -42 20q-29 0 -48.5 -20t-19.5 -51t19.5 -51t48.5 -20q28 0 42 20v-17zM1726 146q-23 0 -35 -20v16h-29v-135h29v76q0 35 29 35q10 0 18 -4l9 28q-8 4 -21 4zM1866 7h29v68v122 |
| | | h-29v-71q-15 20 -43 20t-47.5 -20.5t-19.5 -50.5t19.5 -50.5t47.5 -20.5q29 0 43 20v-17zM1944 27l-2 -1h-3q-2 -1 -4 -3q-3 -1 -3 -4q-1 -2 -1 -6q0 -3 1 -5q0 -2 3 -4q2 -2 4 -3t5 -1q4 0 6 1q0 1 2 2l2 1q1 1 3 4q1 2 1 5q0 4 -1 6q-1 1 -3 4q0 1 -2 2l-2 1q-1 0 -3 0.5 |
| | | t-3 0.5zM2304 1280v-1280q0 -52 -38 -90t-90 -38h-2048q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h2048q52 0 90 -38t38 -90z" /> |
| | | <glyph glyph-name="_467" unicode="" horiz-adv-x="2304" |
| | | d="M313 759q0 -51 -36 -84q-29 -26 -89 -26h-17v220h17q61 0 89 -27q36 -31 36 -83zM2089 824q0 -52 -64 -52h-19v101h20q63 0 63 -49zM380 759q0 74 -50 120.5t-129 46.5h-95v-333h95q74 0 119 38q60 51 60 128zM410 593h65v333h-65v-333zM730 694q0 40 -20.5 62t-75.5 42 |
| | | q-29 10 -39.5 19t-10.5 23q0 16 13.5 26.5t34.5 10.5q29 0 53 -27l34 44q-41 37 -98 37q-44 0 -74 -27.5t-30 -67.5q0 -35 18 -55.5t64 -36.5q37 -13 45 -19q19 -12 19 -34q0 -20 -14 -33.5t-36 -13.5q-48 0 -71 44l-42 -40q44 -64 115 -64q51 0 83 30.5t32 79.5zM1008 604 |
| | | v77q-37 -37 -78 -37q-49 0 -80.5 32.5t-31.5 82.5q0 48 31.5 81.5t77.5 33.5q43 0 81 -38v77q-40 20 -80 20q-74 0 -125.5 -50.5t-51.5 -123.5t51 -123.5t125 -50.5q42 0 81 19zM2240 0v527q-65 -40 -144.5 -84t-237.5 -117t-329.5 -137.5t-417.5 -134.5t-504 -118h1569 |
| | | q26 0 45 19t19 45zM1389 757q0 75 -53 128t-128 53t-128 -53t-53 -128t53 -128t128 -53t128 53t53 128zM1541 584l144 342h-71l-90 -224l-89 224h-71l142 -342h35zM1714 593h184v56h-119v90h115v56h-115v74h119v57h-184v-333zM2105 593h80l-105 140q76 16 76 94q0 47 -31 73 |
| | | t-87 26h-97v-333h65v133h9zM2304 1274v-1268q0 -56 -38.5 -95t-93.5 -39h-2040q-55 0 -93.5 39t-38.5 95v1268q0 56 38.5 95t93.5 39h2040q55 0 93.5 -39t38.5 -95z" /> |
| | | <glyph glyph-name="f1f3" unicode="" horiz-adv-x="2304" |
| | | d="M119 854h89l-45 108zM740 328l74 79l-70 79h-163v-49h142v-55h-142v-54h159zM898 406l99 -110v217zM1186 453q0 33 -40 33h-84v-69h83q41 0 41 36zM1475 457q0 29 -42 29h-82v-61h81q43 0 43 32zM1197 923q0 29 -42 29h-82v-60h81q43 0 43 31zM1656 854h89l-44 108z |
| | | M699 1009v-271h-66v212l-94 -212h-57l-94 212v-212h-132l-25 60h-135l-25 -60h-70l116 271h96l110 -257v257h106l85 -184l77 184h108zM1255 453q0 -20 -5.5 -35t-14 -25t-22.5 -16.5t-26 -10t-31.5 -4.5t-31.5 -1t-32.5 0.5t-29.5 0.5v-91h-126l-80 90l-83 -90h-256v271h260 |
| | | l80 -89l82 89h207q109 0 109 -89zM964 794v-56h-217v271h217v-57h-152v-49h148v-55h-148v-54h152zM2304 235v-229q0 -55 -38.5 -94.5t-93.5 -39.5h-2040q-55 0 -93.5 39.5t-38.5 94.5v678h111l25 61h55l25 -61h218v46l19 -46h113l20 47v-47h541v99l10 1q10 0 10 -14v-86h279 |
| | | v23q23 -12 55 -18t52.5 -6.5t63 0.5t51.5 1l25 61h56l25 -61h227v58l34 -58h182v378h-180v-44l-25 44h-185v-44l-23 44h-249q-69 0 -109 -22v22h-172v-22q-24 22 -73 22h-628l-43 -97l-43 97h-198v-44l-22 44h-169l-78 -179v391q0 55 38.5 94.5t93.5 39.5h2040 |
| | | q55 0 93.5 -39.5t38.5 -94.5v-678h-120q-51 0 -81 -22v22h-177q-55 0 -78 -22v22h-316v-22q-31 22 -87 22h-209v-22q-23 22 -91 22h-234l-54 -58l-50 58h-349v-378h343l55 59l52 -59h211v89h21q59 0 90 13v-102h174v99h8q8 0 10 -2t2 -10v-87h529q57 0 88 24v-24h168 |
| | | q60 0 95 17zM1546 469q0 -23 -12 -43t-34 -29q25 -9 34 -26t9 -46v-54h-65v45q0 33 -12 43.5t-46 10.5h-69v-99h-65v271h154q48 0 77 -15t29 -58zM1269 936q0 -24 -12.5 -44t-33.5 -29q26 -9 34.5 -25.5t8.5 -46.5v-53h-65q0 9 0.5 26.5t0 25t-3 18.5t-8.5 16t-17.5 8.5 |
| | | t-29.5 3.5h-70v-98h-64v271l153 -1q49 0 78 -14.5t29 -57.5zM1798 327v-56h-216v271h216v-56h-151v-49h148v-55h-148v-54zM1372 1009v-271h-66v271h66zM2065 357q0 -86 -102 -86h-126v58h126q34 0 34 25q0 16 -17 21t-41.5 5t-49.5 3.5t-42 22.5t-17 55q0 39 26 60t66 21 |
| | | h130v-57h-119q-36 0 -36 -25q0 -16 17.5 -20.5t42 -4t49 -2.5t42 -21.5t17.5 -54.5zM2304 407v-101q-24 -35 -88 -35h-125v58h125q33 0 33 25q0 13 -12.5 19t-31 5.5t-40 2t-40 8t-31 24t-12.5 48.5q0 39 26.5 60t66.5 21h129v-57h-118q-36 0 -36 -25q0 -20 29 -22t68.5 -5 |
| | | t56.5 -26zM2139 1008v-270h-92l-122 203v-203h-132l-26 60h-134l-25 -60h-75q-129 0 -129 133q0 138 133 138h63v-59q-7 0 -28 1t-28.5 0.5t-23 -2t-21.5 -6.5t-14.5 -13.5t-11.5 -23t-3 -33.5q0 -38 13.5 -58t49.5 -20h29l92 213h97l109 -256v256h99l114 -188v188h66z" /> |
| | | <glyph glyph-name="_469" unicode="" horiz-adv-x="2304" |
| | | d="M745 630q0 -37 -25.5 -61.5t-62.5 -24.5q-29 0 -46.5 16t-17.5 44q0 37 25 62.5t62 25.5q28 0 46.5 -16.5t18.5 -45.5zM1530 779q0 -42 -22 -57t-66 -15l-32 -1l17 107q2 11 13 11h18q22 0 35 -2t25 -12.5t12 -30.5zM1881 630q0 -36 -25.5 -61t-61.5 -25q-29 0 -47 16 |
| | | t-18 44q0 37 25 62.5t62 25.5q28 0 46.5 -16.5t18.5 -45.5zM513 801q0 59 -38.5 85.5t-100.5 26.5h-160q-19 0 -21 -19l-65 -408q-1 -6 3 -11t10 -5h76q20 0 22 19l18 110q1 8 7 13t15 6.5t17 1.5t19 -1t14 -1q86 0 135 48.5t49 134.5zM822 489l41 261q1 6 -3 11t-10 5h-76 |
| | | q-14 0 -17 -33q-27 40 -95 40q-72 0 -122.5 -54t-50.5 -127q0 -59 34.5 -94t92.5 -35q28 0 58 12t48 32q-4 -12 -4 -21q0 -16 13 -16h69q19 0 22 19zM1269 752q0 5 -4 9.5t-9 4.5h-77q-11 0 -18 -10l-106 -156l-44 150q-5 16 -22 16h-75q-5 0 -9 -4.5t-4 -9.5q0 -2 19.5 -59 |
| | | t42 -123t23.5 -70q-82 -112 -82 -120q0 -13 13 -13h77q11 0 18 10l255 368q2 2 2 7zM1649 801q0 59 -38.5 85.5t-100.5 26.5h-159q-20 0 -22 -19l-65 -408q-1 -6 3 -11t10 -5h82q12 0 16 13l18 116q1 8 7 13t15 6.5t17 1.5t19 -1t14 -1q86 0 135 48.5t49 134.5zM1958 489 |
| | | l41 261q1 6 -3 11t-10 5h-76q-14 0 -17 -33q-26 40 -95 40q-72 0 -122.5 -54t-50.5 -127q0 -59 34.5 -94t92.5 -35q29 0 59 12t47 32q0 -1 -2 -9t-2 -12q0 -16 13 -16h69q19 0 22 19zM2176 898v1q0 14 -13 14h-74q-11 0 -13 -11l-65 -416l-1 -2q0 -5 4 -9.5t10 -4.5h66 |
| | | q19 0 21 19zM392 764q-5 -35 -26 -46t-60 -11l-33 -1l17 107q2 11 13 11h19q40 0 58 -11.5t12 -48.5zM2304 1280v-1280q0 -52 -38 -90t-90 -38h-2048q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h2048q52 0 90 -38t38 -90z" /> |
| | | <glyph glyph-name="_470" unicode="" horiz-adv-x="2304" |
| | | d="M1597 633q0 -69 -21 -106q-19 -35 -52 -35q-23 0 -41 9v224q29 30 57 30q57 0 57 -122zM2035 669h-110q6 98 56 98q51 0 54 -98zM476 534q0 59 -33 91.5t-101 57.5q-36 13 -52 24t-16 25q0 26 38 26q58 0 124 -33l18 112q-67 32 -149 32q-77 0 -123 -38q-48 -39 -48 -109 |
| | | q0 -58 32.5 -90.5t99.5 -56.5q39 -14 54.5 -25.5t15.5 -27.5q0 -31 -48 -31q-29 0 -70 12.5t-72 30.5l-18 -113q72 -41 168 -41q81 0 129 37q51 41 51 117zM771 749l19 111h-96v135l-129 -21l-18 -114l-46 -8l-17 -103h62v-219q0 -84 44 -120q38 -30 111 -30q32 0 79 11v118 |
| | | q-32 -7 -44 -7q-42 0 -42 50v197h77zM1087 724v139q-15 3 -28 3q-32 0 -55.5 -16t-33.5 -46l-10 56h-131v-471h150v306q26 31 82 31q16 0 26 -2zM1124 389h150v471h-150v-471zM1746 638q0 122 -45 179q-40 52 -111 52q-64 0 -117 -56l-8 47h-132v-645l150 25v151 |
| | | q36 -11 68 -11q83 0 134 56q61 65 61 202zM1278 986q0 33 -23 56t-56 23t-56 -23t-23 -56t23 -56.5t56 -23.5t56 23.5t23 56.5zM2176 629q0 113 -48 176q-50 64 -144 64q-96 0 -151.5 -66t-55.5 -180q0 -128 63 -188q55 -55 161 -55q101 0 160 40l-16 103q-57 -31 -128 -31 |
| | | q-43 0 -63 19q-23 19 -28 66h248q2 14 2 52zM2304 1280v-1280q0 -52 -38 -90t-90 -38h-2048q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h2048q52 0 90 -38t38 -90z" /> |
| | | <glyph glyph-name="_471" unicode="" horiz-adv-x="2048" |
| | | d="M1558 684q61 -356 298 -556q0 -52 -38 -90t-90 -38h-448q0 -106 -75 -181t-181 -75t-180.5 74.5t-75.5 180.5zM1024 -176q16 0 16 16t-16 16q-59 0 -101.5 42.5t-42.5 101.5q0 16 -16 16t-16 -16q0 -73 51.5 -124.5t124.5 -51.5zM2026 1424q8 -10 7.5 -23.5t-10.5 -22.5 |
| | | l-1872 -1622q-10 -8 -23.5 -7t-21.5 11l-84 96q-8 10 -7.5 23.5t10.5 21.5l186 161q-19 32 -19 66q50 42 91 88t85 119.5t74.5 158.5t50 206t19.5 260q0 152 117 282.5t307 158.5q-8 19 -8 39q0 40 28 68t68 28t68 -28t28 -68q0 -20 -8 -39q124 -18 219 -82.5t148 -157.5 |
| | | l418 363q10 8 23.5 7t21.5 -11z" /> |
| | | <glyph glyph-name="_472" unicode="" horiz-adv-x="2048" |
| | | d="M1040 -160q0 16 -16 16q-59 0 -101.5 42.5t-42.5 101.5q0 16 -16 16t-16 -16q0 -73 51.5 -124.5t124.5 -51.5q16 0 16 16zM503 315l877 760q-42 88 -132.5 146.5t-223.5 58.5q-93 0 -169.5 -31.5t-121.5 -80.5t-69 -103t-24 -105q0 -384 -137 -645zM1856 128 |
| | | q0 -52 -38 -90t-90 -38h-448q0 -106 -75 -181t-181 -75t-180.5 74.5t-75.5 180.5l149 129h757q-166 187 -227 459l111 97q61 -356 298 -556zM1942 1520l84 -96q8 -10 7.5 -23.5t-10.5 -22.5l-1872 -1622q-10 -8 -23.5 -7t-21.5 11l-84 96q-8 10 -7.5 23.5t10.5 21.5l186 161 |
| | | q-19 32 -19 66q50 42 91 88t85 119.5t74.5 158.5t50 206t19.5 260q0 152 117 282.5t307 158.5q-8 19 -8 39q0 40 28 68t68 28t68 -28t28 -68q0 -20 -8 -39q124 -18 219 -82.5t148 -157.5l418 363q10 8 23.5 7t21.5 -11z" /> |
| | | <glyph glyph-name="_473" unicode="" horiz-adv-x="1408" |
| | | d="M512 160v704q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-704q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM768 160v704q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-704q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1024 160v704q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-704 |
| | | q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM480 1152h448l-48 117q-7 9 -17 11h-317q-10 -2 -17 -11zM1408 1120v-64q0 -14 -9 -23t-23 -9h-96v-948q0 -83 -47 -143.5t-113 -60.5h-832q-66 0 -113 58.5t-47 141.5v952h-96q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h309l70 167 |
| | | q15 37 54 63t79 26h320q40 0 79 -26t54 -63l70 -167h309q14 0 23 -9t9 -23z" /> |
| | | <glyph glyph-name="_474" unicode="" |
| | | d="M1150 462v-109q0 -50 -36.5 -89t-94 -60.5t-118 -32.5t-117.5 -11q-205 0 -342.5 139t-137.5 346q0 203 136 339t339 136q34 0 75.5 -4.5t93 -18t92.5 -34t69 -56.5t28 -81v-109q0 -16 -16 -16h-118q-16 0 -16 16v70q0 43 -65.5 67.5t-137.5 24.5q-140 0 -228.5 -91.5 |
| | | t-88.5 -237.5q0 -151 91.5 -249.5t233.5 -98.5q68 0 138 24t70 66v70q0 7 4.5 11.5t10.5 4.5h119q6 0 11 -4.5t5 -11.5zM768 1280q-130 0 -248.5 -51t-204 -136.5t-136.5 -204t-51 -248.5t51 -248.5t136.5 -204t204 -136.5t248.5 -51t248.5 51t204 136.5t136.5 204t51 248.5 |
| | | t-51 248.5t-136.5 204t-204 136.5t-248.5 51zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> |
| | | <glyph glyph-name="_475" unicode="" |
| | | d="M972 761q0 108 -53.5 169t-147.5 61q-63 0 -124 -30.5t-110 -84.5t-79.5 -137t-30.5 -180q0 -112 53.5 -173t150.5 -61q96 0 176 66.5t122.5 166t42.5 203.5zM1536 640q0 -111 -37 -197t-98.5 -135t-131.5 -74.5t-145 -27.5q-6 0 -15.5 -0.5t-16.5 -0.5q-95 0 -142 53 |
| | | q-28 33 -33 83q-52 -66 -131.5 -110t-173.5 -44q-161 0 -249.5 95.5t-88.5 269.5q0 157 66 290t179 210.5t246 77.5q87 0 155 -35.5t106 -99.5l2 19l11 56q1 6 5.5 12t9.5 6h118q5 0 13 -11q5 -5 3 -16l-120 -614q-5 -24 -5 -48q0 -39 12.5 -52t44.5 -13q28 1 57 5.5t73 24 |
| | | t77 50t57 89.5t24 137q0 292 -174 466t-466 174q-130 0 -248.5 -51t-204 -136.5t-136.5 -204t-51 -248.5t51 -248.5t136.5 -204t204 -136.5t248.5 -51q228 0 405 144q11 9 24 8t21 -12l41 -49q8 -12 7 -24q-2 -13 -12 -22q-102 -83 -227.5 -128t-258.5 -45q-156 0 -298 61 |
| | | t-245 164t-164 245t-61 298t61 298t164 245t245 164t298 61q344 0 556 -212t212 -556z" /> |
| | | <glyph glyph-name="_476" unicode="" horiz-adv-x="1792" |
| | | d="M1698 1442q94 -94 94 -226.5t-94 -225.5l-225 -223l104 -104q10 -10 10 -23t-10 -23l-210 -210q-10 -10 -23 -10t-23 10l-105 105l-603 -603q-37 -37 -90 -37h-203l-256 -128l-64 64l128 256v203q0 53 37 90l603 603l-105 105q-10 10 -10 23t10 23l210 210q10 10 23 10 |
| | | t23 -10l104 -104l223 225q93 94 225.5 94t226.5 -94zM512 64l576 576l-192 192l-576 -576v-192h192z" /> |
| | | <glyph glyph-name="f1fc" unicode="" horiz-adv-x="1792" |
| | | d="M1615 1536q70 0 122.5 -46.5t52.5 -116.5q0 -63 -45 -151q-332 -629 -465 -752q-97 -91 -218 -91q-126 0 -216.5 92.5t-90.5 219.5q0 128 92 212l638 579q59 54 130 54zM706 502q39 -76 106.5 -130t150.5 -76l1 -71q4 -213 -129.5 -347t-348.5 -134q-123 0 -218 46.5 |
| | | t-152.5 127.5t-86.5 183t-29 220q7 -5 41 -30t62 -44.5t59 -36.5t46 -17q41 0 55 37q25 66 57.5 112.5t69.5 76t88 47.5t103 25.5t125 10.5z" /> |
| | | <glyph glyph-name="_478" unicode="" horiz-adv-x="1792" |
| | | d="M1792 128v-384h-1792v384q45 0 85 14t59 27.5t47 37.5q30 27 51.5 38t56.5 11q24 0 44 -7t31 -15t33 -27q29 -25 47 -38t58 -27t86 -14q45 0 85 14.5t58 27t48 37.5q21 19 32.5 27t31 15t43.5 7q35 0 56.5 -11t51.5 -38q28 -24 47 -37.5t59 -27.5t85 -14t85 14t59 27.5 |
| | | t47 37.5q30 27 51.5 38t56.5 11q34 0 55.5 -11t51.5 -38q28 -24 47 -37.5t59 -27.5t85 -14zM1792 448v-192q-24 0 -44 7t-31 15t-33 27q-29 25 -47 38t-58 27t-85 14q-46 0 -86 -14t-58 -27t-47 -38q-22 -19 -33 -27t-31 -15t-44 -7q-35 0 -56.5 11t-51.5 38q-29 25 -47 38 |
| | | t-58 27t-86 14q-45 0 -85 -14.5t-58 -27t-48 -37.5q-21 -19 -32.5 -27t-31 -15t-43.5 -7q-35 0 -56.5 11t-51.5 38q-28 24 -47 37.5t-59 27.5t-85 14q-46 0 -86 -14t-58 -27t-47 -38q-30 -27 -51.5 -38t-56.5 -11v192q0 80 56 136t136 56h64v448h256v-448h256v448h256v-448 |
| | | h256v448h256v-448h64q80 0 136 -56t56 -136zM512 1312q0 -77 -36 -118.5t-92 -41.5q-53 0 -90.5 37.5t-37.5 90.5q0 29 9.5 51t23.5 34t31 28t31 31.5t23.5 44.5t9.5 67q38 0 83 -74t45 -150zM1024 1312q0 -77 -36 -118.5t-92 -41.5q-53 0 -90.5 37.5t-37.5 90.5 |
| | | q0 29 9.5 51t23.5 34t31 28t31 31.5t23.5 44.5t9.5 67q38 0 83 -74t45 -150zM1536 1312q0 -77 -36 -118.5t-92 -41.5q-53 0 -90.5 37.5t-37.5 90.5q0 29 9.5 51t23.5 34t31 28t31 31.5t23.5 44.5t9.5 67q38 0 83 -74t45 -150z" /> |
| | | <glyph glyph-name="_479" unicode="" horiz-adv-x="2048" |
| | | d="M2048 0v-128h-2048v1536h128v-1408h1920zM1664 1024l256 -896h-1664v576l448 576l576 -576z" /> |
| | | <glyph glyph-name="_480" unicode="" horiz-adv-x="1792" |
| | | d="M768 646l546 -546q-106 -108 -247.5 -168t-298.5 -60q-209 0 -385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103v-762zM955 640h773q0 -157 -60 -298.5t-168 -247.5zM1664 768h-768v768q209 0 385.5 -103t279.5 -279.5t103 -385.5z" /> |
| | | <glyph glyph-name="_481" unicode="" horiz-adv-x="2048" |
| | | d="M2048 0v-128h-2048v1536h128v-1408h1920zM1920 1248v-435q0 -21 -19.5 -29.5t-35.5 7.5l-121 121l-633 -633q-10 -10 -23 -10t-23 10l-233 233l-416 -416l-192 192l585 585q10 10 23 10t23 -10l233 -233l464 464l-121 121q-16 16 -7.5 35.5t29.5 19.5h435q14 0 23 -9 |
| | | t9 -23z" /> |
| | | <glyph glyph-name="_482" unicode="" horiz-adv-x="1792" |
| | | d="M1292 832q0 -6 10 -41q10 -29 25 -49.5t41 -34t44 -20t55 -16.5q325 -91 325 -332q0 -146 -105.5 -242.5t-254.5 -96.5q-59 0 -111.5 18.5t-91.5 45.5t-77 74.5t-63 87.5t-53.5 103.5t-43.5 103t-39.5 106.5t-35.5 95q-32 81 -61.5 133.5t-73.5 96.5t-104 64t-142 20 |
| | | q-96 0 -183 -55.5t-138 -144.5t-51 -185q0 -160 106.5 -279.5t263.5 -119.5q177 0 258 95q56 63 83 116l84 -152q-15 -34 -44 -70l1 -1q-131 -152 -388 -152q-147 0 -269.5 79t-190.5 207.5t-68 274.5q0 105 43.5 206t116 176.5t172 121.5t204.5 46q87 0 159 -19t123.5 -50 |
| | | t95 -80t72.5 -99t58.5 -117t50.5 -124.5t50 -130.5t55 -127q96 -200 233 -200q81 0 138.5 48.5t57.5 128.5q0 42 -19 72t-50.5 46t-72.5 31.5t-84.5 27t-87.5 34t-81 52t-65 82t-39 122.5q-3 16 -3 33q0 110 87.5 192t198.5 78q78 -3 120.5 -14.5t90.5 -53.5h-1 |
| | | q12 -11 23 -24.5t26 -36t19 -27.5l-129 -99q-26 49 -54 70v1q-23 21 -97 21q-49 0 -84 -33t-35 -83z" /> |
| | | <glyph glyph-name="_483" unicode="" |
| | | d="M1432 484q0 173 -234 239q-35 10 -53 16.5t-38 25t-29 46.5q0 2 -2 8.5t-3 12t-1 7.5q0 36 24.5 59.5t60.5 23.5q54 0 71 -15h-1q20 -15 39 -51l93 71q-39 54 -49 64q-33 29 -67.5 39t-85.5 10q-80 0 -142 -57.5t-62 -137.5q0 -7 2 -23q16 -96 64.5 -140t148.5 -73 |
| | | q29 -8 49 -15.5t45 -21.5t38.5 -34.5t13.5 -46.5v-5q1 -58 -40.5 -93t-100.5 -35q-97 0 -167 144q-23 47 -51.5 121.5t-48 125.5t-54 110.5t-74 95.5t-103.5 60.5t-147 24.5q-101 0 -192 -56t-144 -148t-50 -192v-1q4 -108 50.5 -199t133.5 -147.5t196 -56.5q186 0 279 110 |
| | | q20 27 31 51l-60 109q-42 -80 -99 -116t-146 -36q-115 0 -191 87t-76 204q0 105 82 189t186 84q112 0 170 -53.5t104 -172.5q8 -21 25.5 -68.5t28.5 -76.5t31.5 -74.5t38.5 -74t45.5 -62.5t55.5 -53.5t66 -33t80 -13.5q107 0 183 69.5t76 174.5zM1536 1120v-960 |
| | | q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> |
| | | <glyph glyph-name="_484" unicode="" horiz-adv-x="2048" |
| | | d="M1152 640q0 104 -40.5 198.5t-109.5 163.5t-163.5 109.5t-198.5 40.5t-198.5 -40.5t-163.5 -109.5t-109.5 -163.5t-40.5 -198.5t40.5 -198.5t109.5 -163.5t163.5 -109.5t198.5 -40.5t198.5 40.5t163.5 109.5t109.5 163.5t40.5 198.5zM1920 640q0 104 -40.5 198.5 |
| | | t-109.5 163.5t-163.5 109.5t-198.5 40.5h-386q119 -90 188.5 -224t69.5 -288t-69.5 -288t-188.5 -224h386q104 0 198.5 40.5t163.5 109.5t109.5 163.5t40.5 198.5zM2048 640q0 -130 -51 -248.5t-136.5 -204t-204 -136.5t-248.5 -51h-768q-130 0 -248.5 51t-204 136.5 |
| | | t-136.5 204t-51 248.5t51 248.5t136.5 204t204 136.5t248.5 51h768q130 0 248.5 -51t204 -136.5t136.5 -204t51 -248.5z" /> |
| | | <glyph glyph-name="_485" unicode="" horiz-adv-x="2048" |
| | | d="M0 640q0 130 51 248.5t136.5 204t204 136.5t248.5 51h768q130 0 248.5 -51t204 -136.5t136.5 -204t51 -248.5t-51 -248.5t-136.5 -204t-204 -136.5t-248.5 -51h-768q-130 0 -248.5 51t-204 136.5t-136.5 204t-51 248.5zM1408 128q104 0 198.5 40.5t163.5 109.5 |
| | | t109.5 163.5t40.5 198.5t-40.5 198.5t-109.5 163.5t-163.5 109.5t-198.5 40.5t-198.5 -40.5t-163.5 -109.5t-109.5 -163.5t-40.5 -198.5t40.5 -198.5t109.5 -163.5t163.5 -109.5t198.5 -40.5z" /> |
| | | <glyph glyph-name="_486" unicode="" horiz-adv-x="2304" |
| | | d="M762 384h-314q-40 0 -57.5 35t6.5 67l188 251q-65 31 -137 31q-132 0 -226 -94t-94 -226t94 -226t226 -94q115 0 203 72.5t111 183.5zM576 512h186q-18 85 -75 148zM1056 512l288 384h-480l-99 -132q105 -103 126 -252h165zM2176 448q0 132 -94 226t-226 94 |
| | | q-60 0 -121 -24l174 -260q15 -23 10 -49t-27 -40q-15 -11 -36 -11q-35 0 -53 29l-174 260q-93 -95 -93 -225q0 -132 94 -226t226 -94t226 94t94 226zM2304 448q0 -185 -131.5 -316.5t-316.5 -131.5t-316.5 131.5t-131.5 316.5q0 97 39.5 183.5t109.5 149.5l-65 98l-353 -469 |
| | | q-18 -26 -51 -26h-197q-23 -164 -149 -274t-294 -110q-185 0 -316.5 131.5t-131.5 316.5t131.5 316.5t316.5 131.5q114 0 215 -55l137 183h-224q-26 0 -45 19t-19 45t19 45t45 19h384v-128h435l-85 128h-222q-26 0 -45 19t-19 45t19 45t45 19h256q33 0 53 -28l267 -400 |
| | | q91 44 192 44q185 0 316.5 -131.5t131.5 -316.5z" /> |
| | | <glyph glyph-name="_487" unicode="" |
| | | d="M384 320q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1408 320q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1362 716l-72 384q-5 23 -22.5 37.5t-40.5 14.5 |
| | | h-918q-23 0 -40.5 -14.5t-22.5 -37.5l-72 -384q-5 -30 14 -53t49 -23h1062q30 0 49 23t14 53zM1136 1328q0 20 -14 34t-34 14h-640q-20 0 -34 -14t-14 -34t14 -34t34 -14h640q20 0 34 14t14 34zM1536 603v-603h-128v-128q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5 |
| | | t-37.5 90.5v128h-768v-128q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5v128h-128v603q0 112 25 223l103 454q9 78 97.5 137t230 89t312.5 30t312.5 -30t230 -89t97.5 -137l105 -454q23 -102 23 -223z" /> |
| | | <glyph glyph-name="_488" unicode="" horiz-adv-x="2048" |
| | | d="M1463 704q0 -35 -25 -60.5t-61 -25.5h-702q-36 0 -61 25.5t-25 60.5t25 60.5t61 25.5h702q36 0 61 -25.5t25 -60.5zM1677 704q0 86 -23 170h-982q-36 0 -61 25t-25 60q0 36 25 61t61 25h908q-88 143 -235 227t-320 84q-177 0 -327.5 -87.5t-238 -237.5t-87.5 -327 |
| | | q0 -86 23 -170h982q36 0 61 -25t25 -60q0 -36 -25 -61t-61 -25h-908q88 -143 235.5 -227t320.5 -84q132 0 253 51.5t208 139t139 208t52 253.5zM2048 959q0 -35 -25 -60t-61 -25h-131q17 -85 17 -170q0 -167 -65.5 -319.5t-175.5 -263t-262.5 -176t-319.5 -65.5 |
| | | q-246 0 -448.5 133t-301.5 350h-189q-36 0 -61 25t-25 61q0 35 25 60t61 25h132q-17 85 -17 170q0 167 65.5 319.5t175.5 263t262.5 176t320.5 65.5q245 0 447.5 -133t301.5 -350h188q36 0 61 -25t25 -61z" /> |
| | | <glyph glyph-name="_489" unicode="" horiz-adv-x="1280" |
| | | d="M953 1158l-114 -328l117 -21q165 451 165 518q0 56 -38 56q-57 0 -130 -225zM654 471l33 -88q37 42 71 67l-33 5.5t-38.5 7t-32.5 8.5zM362 1367q0 -98 159 -521q17 10 49 10q15 0 75 -5l-121 351q-75 220 -123 220q-19 0 -29 -17.5t-10 -37.5zM283 608q0 -36 51.5 -119 |
| | | t117.5 -153t100 -70q14 0 25.5 13t11.5 27q0 24 -32 102q-13 32 -32 72t-47.5 89t-61.5 81t-62 32q-20 0 -45.5 -27t-25.5 -47zM125 273q0 -41 25 -104q59 -145 183.5 -227t281.5 -82q227 0 382 170q152 169 152 427q0 43 -1 67t-11.5 62t-30.5 56q-56 49 -211.5 75.5 |
| | | t-270.5 26.5q-37 0 -49 -11q-12 -5 -12 -35q0 -34 21.5 -60t55.5 -40t77.5 -23.5t87.5 -11.5t85 -4t70 0h23q24 0 40 -19q15 -19 19 -55q-28 -28 -96 -54q-61 -22 -93 -46q-64 -46 -108.5 -114t-44.5 -137q0 -31 18.5 -88.5t18.5 -87.5l-3 -12q-4 -12 -4 -14 |
| | | q-137 10 -146 216q-8 -2 -41 -2q2 -7 2 -21q0 -53 -40.5 -89.5t-94.5 -36.5q-82 0 -166.5 78t-84.5 159q0 34 33 67q52 -64 60 -76q77 -104 133 -104q12 0 26.5 8.5t14.5 20.5q0 34 -87.5 145t-116.5 111q-43 0 -70 -44.5t-27 -90.5zM11 264q0 101 42.5 163t136.5 88 |
| | | q-28 74 -28 104q0 62 61 123t122 61q29 0 70 -15q-163 462 -163 567q0 80 41 130.5t119 50.5q131 0 325 -581q6 -17 8 -23q6 16 29 79.5t43.5 118.5t54 127.5t64.5 123t70.5 86.5t76.5 36q71 0 112 -49t41 -122q0 -108 -159 -550q61 -15 100.5 -46t58.5 -78t26 -93.5 |
| | | t7 -110.5q0 -150 -47 -280t-132 -225t-211 -150t-278 -55q-111 0 -223 42q-149 57 -258 191.5t-109 286.5z" /> |
| | | <glyph glyph-name="_490" unicode="" horiz-adv-x="2048" |
| | | d="M785 528h207q-14 -158 -98.5 -248.5t-214.5 -90.5q-162 0 -254.5 116t-92.5 316q0 194 93 311.5t233 117.5q148 0 232 -87t97 -247h-203q-5 64 -35.5 99t-81.5 35q-57 0 -88.5 -60.5t-31.5 -177.5q0 -48 5 -84t18 -69.5t40 -51.5t66 -18q95 0 109 139zM1497 528h206 |
| | | q-14 -158 -98 -248.5t-214 -90.5q-162 0 -254.5 116t-92.5 316q0 194 93 311.5t233 117.5q148 0 232 -87t97 -247h-204q-4 64 -35 99t-81 35q-57 0 -88.5 -60.5t-31.5 -177.5q0 -48 5 -84t18 -69.5t39.5 -51.5t65.5 -18q49 0 76.5 38t33.5 101zM1856 647q0 207 -15.5 307 |
| | | t-60.5 161q-6 8 -13.5 14t-21.5 15t-16 11q-86 63 -697 63q-625 0 -710 -63q-5 -4 -17.5 -11.5t-21 -14t-14.5 -14.5q-45 -60 -60 -159.5t-15 -308.5q0 -208 15 -307.5t60 -160.5q6 -8 15 -15t20.5 -14t17.5 -12q44 -33 239.5 -49t470.5 -16q610 0 697 65q5 4 17 11t20.5 14 |
| | | t13.5 16q46 60 61 159t15 309zM2048 1408v-1536h-2048v1536h2048z" /> |
| | | <glyph glyph-name="_491" unicode="" |
| | | d="M992 912v-496q0 -14 -9 -23t-23 -9h-160q-14 0 -23 9t-9 23v496q0 112 -80 192t-192 80h-272v-1152q0 -14 -9 -23t-23 -9h-160q-14 0 -23 9t-9 23v1344q0 14 9 23t23 9h464q135 0 249 -66.5t180.5 -180.5t66.5 -249zM1376 1376v-880q0 -135 -66.5 -249t-180.5 -180.5 |
| | | t-249 -66.5h-464q-14 0 -23 9t-9 23v960q0 14 9 23t23 9h160q14 0 23 -9t9 -23v-768h272q112 0 192 80t80 192v880q0 14 9 23t23 9h160q14 0 23 -9t9 -23z" /> |
| | | <glyph glyph-name="_492" unicode="" |
| | | d="M1311 694v-114q0 -24 -13.5 -38t-37.5 -14h-202q-24 0 -38 14t-14 38v114q0 24 14 38t38 14h202q24 0 37.5 -14t13.5 -38zM821 464v250q0 53 -32.5 85.5t-85.5 32.5h-133q-68 0 -96 -52q-28 52 -96 52h-130q-53 0 -85.5 -32.5t-32.5 -85.5v-250q0 -22 21 -22h55 |
| | | q22 0 22 22v230q0 24 13.5 38t38.5 14h94q24 0 38 -14t14 -38v-230q0 -22 21 -22h54q22 0 22 22v230q0 24 14 38t38 14h97q24 0 37.5 -14t13.5 -38v-230q0 -22 22 -22h55q21 0 21 22zM1410 560v154q0 53 -33 85.5t-86 32.5h-264q-53 0 -86 -32.5t-33 -85.5v-410 |
| | | q0 -21 22 -21h55q21 0 21 21v180q31 -42 94 -42h191q53 0 86 32.5t33 85.5zM1536 1176v-1072q0 -96 -68 -164t-164 -68h-1072q-96 0 -164 68t-68 164v1072q0 96 68 164t164 68h1072q96 0 164 -68t68 -164z" /> |
| | | <glyph glyph-name="_493" unicode="" |
| | | d="M915 450h-294l147 551zM1001 128h311l-324 1024h-440l-324 -1024h311l383 314zM1536 1120v-960q0 -118 -85 -203t-203 -85h-960q-118 0 -203 85t-85 203v960q0 118 85 203t203 85h960q118 0 203 -85t85 -203z" /> |
| | | <glyph glyph-name="_494" unicode="" horiz-adv-x="2048" |
| | | d="M2048 641q0 -21 -13 -36.5t-33 -19.5l-205 -356q3 -9 3 -18q0 -20 -12.5 -35.5t-32.5 -19.5l-193 -337q3 -8 3 -16q0 -23 -16.5 -40t-40.5 -17q-25 0 -41 18h-400q-17 -20 -43 -20t-43 20h-399q-17 -20 -43 -20q-23 0 -40 16.5t-17 40.5q0 8 4 20l-193 335 |
| | | q-20 4 -32.5 19.5t-12.5 35.5q0 9 3 18l-206 356q-20 5 -32.5 20.5t-12.5 35.5q0 21 13.5 36.5t33.5 19.5l199 344q0 1 -0.5 3t-0.5 3q0 36 34 51l209 363q-4 10 -4 18q0 24 17 40.5t40 16.5q26 0 44 -21h396q16 21 43 21t43 -21h398q18 21 44 21q23 0 40 -16.5t17 -40.5 |
| | | q0 -6 -4 -18l207 -358q23 -1 39 -17.5t16 -38.5q0 -13 -7 -27l187 -324q19 -4 31.5 -19.5t12.5 -35.5zM1063 -158h389l-342 354h-143l-342 -354h360q18 16 39 16t39 -16zM112 654q1 -4 1 -13q0 -10 -2 -15l208 -360l15 -6l188 199v347l-187 194q-13 -8 -29 -10zM986 1438 |
| | | h-388l190 -200l554 200h-280q-16 -16 -38 -16t-38 16zM1689 226q1 6 5 11l-64 68l-17 -79h76zM1583 226l22 105l-252 266l-296 -307l63 -64h463zM1495 -142l16 28l65 310h-427l333 -343q8 4 13 5zM578 -158h5l342 354h-373v-335l4 -6q14 -5 22 -13zM552 226h402l64 66 |
| | | l-309 321l-157 -166v-221zM359 226h163v189l-168 -177q4 -8 5 -12zM358 1051q0 -1 0.5 -2t0.5 -2q0 -16 -8 -29l171 -177v269zM552 1121v-311l153 -157l297 314l-223 236zM556 1425l-4 -8v-264l205 74l-191 201q-6 -2 -10 -3zM1447 1438h-16l-621 -224l213 -225zM1023 946 |
| | | l-297 -315l311 -319l296 307zM688 634l-136 141v-284zM1038 270l-42 -44h85zM1374 618l238 -251l132 624l-3 5l-1 1zM1718 1018q-8 13 -8 29v2l-216 376q-5 1 -13 5l-437 -463l310 -327zM522 1142v223l-163 -282zM522 196h-163l163 -283v283zM1607 196l-48 -227l130 227h-82 |
| | | zM1729 266l207 361q-2 10 -2 14q0 1 3 16l-171 296l-129 -612l77 -82q5 3 15 7z" /> |
| | | <glyph glyph-name="f210" unicode="" |
| | | d="M0 856q0 131 91.5 226.5t222.5 95.5h742l352 358v-1470q0 -132 -91.5 -227t-222.5 -95h-780q-131 0 -222.5 95t-91.5 227v790zM1232 102l-176 180v425q0 46 -32 79t-78 33h-484q-46 0 -78 -33t-32 -79v-492q0 -46 32.5 -79.5t77.5 -33.5h770z" /> |
| | | <glyph glyph-name="_496" unicode="" |
| | | d="M934 1386q-317 -121 -556 -362.5t-358 -560.5q-20 89 -20 176q0 208 102.5 384.5t278.5 279t384 102.5q82 0 169 -19zM1203 1267q93 -65 164 -155q-389 -113 -674.5 -400.5t-396.5 -676.5q-93 72 -155 162q112 386 395 671t667 399zM470 -67q115 356 379.5 622t619.5 384 |
| | | q40 -92 54 -195q-292 -120 -516 -345t-343 -518q-103 14 -194 52zM1536 -125q-193 50 -367 115q-135 -84 -290 -107q109 205 274 370.5t369 275.5q-21 -152 -101 -284q65 -175 115 -370z" /> |
| | | <glyph glyph-name="f212" unicode="" horiz-adv-x="2048" |
| | | d="M1893 1144l155 -1272q-131 0 -257 57q-200 91 -393 91q-226 0 -374 -148q-148 148 -374 148q-193 0 -393 -91q-128 -57 -252 -57h-5l155 1272q224 127 482 127q233 0 387 -106q154 106 387 106q258 0 482 -127zM1398 157q129 0 232 -28.5t260 -93.5l-124 1021 |
| | | q-171 78 -368 78q-224 0 -374 -141q-150 141 -374 141q-197 0 -368 -78l-124 -1021q105 43 165.5 65t148.5 39.5t178 17.5q202 0 374 -108q172 108 374 108zM1438 191l-55 907q-211 -4 -359 -155q-152 155 -374 155q-176 0 -336 -66l-114 -941q124 51 228.5 76t221.5 25 |
| | | q209 0 374 -102q172 107 374 102z" /> |
| | | <glyph glyph-name="_498" unicode="" horiz-adv-x="2048" |
| | | d="M1500 165v733q0 21 -15 36t-35 15h-93q-20 0 -35 -15t-15 -36v-733q0 -20 15 -35t35 -15h93q20 0 35 15t15 35zM1216 165v531q0 20 -15 35t-35 15h-101q-20 0 -35 -15t-15 -35v-531q0 -20 15 -35t35 -15h101q20 0 35 15t15 35zM924 165v429q0 20 -15 35t-35 15h-101 |
| | | q-20 0 -35 -15t-15 -35v-429q0 -20 15 -35t35 -15h101q20 0 35 15t15 35zM632 165v362q0 20 -15 35t-35 15h-101q-20 0 -35 -15t-15 -35v-362q0 -20 15 -35t35 -15h101q20 0 35 15t15 35zM2048 311q0 -166 -118 -284t-284 -118h-1244q-166 0 -284 118t-118 284 |
| | | q0 116 63 214.5t168 148.5q-10 34 -10 73q0 113 80.5 193.5t193.5 80.5q102 0 180 -67q45 183 194 300t338 117q149 0 275 -73.5t199.5 -199.5t73.5 -275q0 -66 -14 -122q135 -33 221 -142.5t86 -247.5z" /> |
| | | <glyph glyph-name="_499" unicode="" |
| | | d="M0 1536h1536v-1392l-776 -338l-760 338v1392zM1436 209v926h-1336v-926l661 -294zM1436 1235v201h-1336v-201h1336zM181 937v-115h-37v115h37zM181 789v-115h-37v115h37zM181 641v-115h-37v115h37zM181 493v-115h-37v115h37zM181 345v-115h-37v115h37zM207 202l15 34 |
| | | l105 -47l-15 -33zM343 142l15 34l105 -46l-15 -34zM478 82l15 34l105 -46l-15 -34zM614 23l15 33l104 -46l-15 -34zM797 10l105 46l15 -33l-105 -47zM932 70l105 46l15 -34l-105 -46zM1068 130l105 46l15 -34l-105 -46zM1203 189l105 47l15 -34l-105 -46zM259 1389v-36h-114 |
| | | v36h114zM421 1389v-36h-115v36h115zM583 1389v-36h-115v36h115zM744 1389v-36h-114v36h114zM906 1389v-36h-114v36h114zM1068 1389v-36h-115v36h115zM1230 1389v-36h-115v36h115zM1391 1389v-36h-114v36h114zM181 1049v-79h-37v115h115v-36h-78zM421 1085v-36h-115v36h115z |
| | | M583 1085v-36h-115v36h115zM744 1085v-36h-114v36h114zM906 1085v-36h-114v36h114zM1068 1085v-36h-115v36h115zM1230 1085v-36h-115v36h115zM1355 970v79h-78v36h115v-115h-37zM1355 822v115h37v-115h-37zM1355 674v115h37v-115h-37zM1355 526v115h37v-115h-37zM1355 378 |
| | | v115h37v-115h-37zM1355 230v115h37v-115h-37zM760 265q-129 0 -221 91.5t-92 221.5q0 129 92 221t221 92q130 0 221.5 -92t91.5 -221q0 -130 -91.5 -221.5t-221.5 -91.5zM595 646q0 -36 19.5 -56.5t49.5 -25t64 -7t64 -2t49.5 -9t19.5 -30.5q0 -49 -112 -49q-97 0 -123 51 |
| | | h-3l-31 -63q67 -42 162 -42q29 0 56.5 5t55.5 16t45.5 33t17.5 53q0 46 -27.5 69.5t-67.5 27t-79.5 3t-67 5t-27.5 25.5q0 21 20.5 33t40.5 15t41 3q34 0 70.5 -11t51.5 -34h3l30 58q-3 1 -21 8.5t-22.5 9t-19.5 7t-22 7t-20 4.5t-24 4t-23 1q-29 0 -56.5 -5t-54 -16.5 |
| | | t-43 -34t-16.5 -53.5z" /> |
| | | <glyph glyph-name="_500" unicode="" horiz-adv-x="2048" |
| | | d="M863 504q0 112 -79.5 191.5t-191.5 79.5t-191 -79.5t-79 -191.5t79 -191t191 -79t191.5 79t79.5 191zM1726 505q0 112 -79 191t-191 79t-191.5 -79t-79.5 -191q0 -113 79.5 -192t191.5 -79t191 79.5t79 191.5zM2048 1314v-1348q0 -44 -31.5 -75.5t-76.5 -31.5h-1832 |
| | | q-45 0 -76.5 31.5t-31.5 75.5v1348q0 44 31.5 75.5t76.5 31.5h431q44 0 76 -31.5t32 -75.5v-161h754v161q0 44 32 75.5t76 31.5h431q45 0 76.5 -31.5t31.5 -75.5z" /> |
| | | <glyph glyph-name="_501" unicode="" horiz-adv-x="2048" |
| | | d="M1430 953zM1690 749q148 0 253 -98.5t105 -244.5q0 -157 -109 -261.5t-267 -104.5q-85 0 -162 27.5t-138 73.5t-118 106t-109 126t-103.5 132.5t-108.5 126.5t-117 106t-136 73.5t-159 27.5q-154 0 -251.5 -91.5t-97.5 -244.5q0 -157 104 -250t263 -93q100 0 208 37.5 |
| | | t193 98.5q5 4 21 18.5t30 24t22 9.5q14 0 24.5 -10.5t10.5 -24.5q0 -24 -60 -77q-101 -88 -234.5 -142t-260.5 -54q-133 0 -245.5 58t-180 165t-67.5 241q0 205 141.5 341t347.5 136q120 0 226.5 -43.5t185.5 -113t151.5 -153t139 -167.5t133.5 -153.5t149.5 -113 |
| | | t172.5 -43.5q102 0 168.5 61.5t66.5 162.5q0 95 -64.5 159t-159.5 64q-30 0 -81.5 -18.5t-68.5 -18.5q-20 0 -35.5 15t-15.5 35q0 18 8.5 57t8.5 59q0 159 -107.5 263t-266.5 104q-58 0 -111.5 -18.5t-84 -40.5t-55.5 -40.5t-33 -18.5q-15 0 -25.5 10.5t-10.5 25.5 |
| | | q0 19 25 46q59 67 147 103.5t182 36.5q191 0 318 -125.5t127 -315.5q0 -37 -4 -66q57 15 115 15z" /> |
| | | <glyph glyph-name="_502" unicode="" horiz-adv-x="1664" |
| | | d="M1216 832q0 26 -19 45t-45 19h-128v128q0 26 -19 45t-45 19t-45 -19t-19 -45v-128h-128q-26 0 -45 -19t-19 -45t19 -45t45 -19h128v-128q0 -26 19 -45t45 -19t45 19t19 45v128h128q26 0 45 19t19 45zM640 0q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5 |
| | | t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1536 0q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1664 1088v-512q0 -24 -16 -42.5t-41 -21.5l-1044 -122q1 -7 4.5 -21.5t6 -26.5t2.5 -22q0 -16 -24 -64h920 |
| | | q26 0 45 -19t19 -45t-19 -45t-45 -19h-1024q-26 0 -45 19t-19 45q0 14 11 39.5t29.5 59.5t20.5 38l-177 823h-204q-26 0 -45 19t-19 45t19 45t45 19h256q16 0 28.5 -6.5t20 -15.5t13 -24.5t7.5 -26.5t5.5 -29.5t4.5 -25.5h1201q26 0 45 -19t19 -45z" /> |
| | | <glyph glyph-name="_503" unicode="" horiz-adv-x="1664" |
| | | d="M1280 832q0 26 -19 45t-45 19t-45 -19l-147 -146v293q0 26 -19 45t-45 19t-45 -19t-19 -45v-293l-147 146q-19 19 -45 19t-45 -19t-19 -45t19 -45l256 -256q19 -19 45 -19t45 19l256 256q19 19 19 45zM640 0q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5 |
| | | t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1536 0q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1664 1088v-512q0 -24 -16 -42.5t-41 -21.5l-1044 -122q1 -7 4.5 -21.5t6 -26.5t2.5 -22q0 -16 -24 -64h920 |
| | | q26 0 45 -19t19 -45t-19 -45t-45 -19h-1024q-26 0 -45 19t-19 45q0 14 11 39.5t29.5 59.5t20.5 38l-177 823h-204q-26 0 -45 19t-19 45t19 45t45 19h256q16 0 28.5 -6.5t20 -15.5t13 -24.5t7.5 -26.5t5.5 -29.5t4.5 -25.5h1201q26 0 45 -19t19 -45z" /> |
| | | <glyph glyph-name="_504" unicode="" horiz-adv-x="2048" |
| | | d="M212 768l623 -665l-300 665h-323zM1024 -4l349 772h-698zM538 896l204 384h-262l-288 -384h346zM1213 103l623 665h-323zM683 896h682l-204 384h-274zM1510 896h346l-288 384h-262zM1651 1382l384 -512q14 -18 13 -41.5t-17 -40.5l-960 -1024q-18 -20 -47 -20t-47 20 |
| | | l-960 1024q-16 17 -17 40.5t13 41.5l384 512q18 26 51 26h1152q33 0 51 -26z" /> |
| | | <glyph glyph-name="_505" unicode="" horiz-adv-x="2048" |
| | | d="M1811 -19q19 19 45 19t45 -19l128 -128l-90 -90l-83 83l-83 -83q-18 -19 -45 -19t-45 19l-83 83l-83 -83q-19 -19 -45 -19t-45 19l-83 83l-83 -83q-19 -19 -45 -19t-45 19l-83 83l-83 -83q-19 -19 -45 -19t-45 19l-83 83l-83 -83q-19 -19 -45 -19t-45 19l-83 83l-83 -83 |
| | | q-19 -19 -45 -19t-45 19l-83 83l-83 -83q-19 -19 -45 -19t-45 19l-128 128l90 90l83 -83l83 83q19 19 45 19t45 -19l83 -83l83 83q19 19 45 19t45 -19l83 -83l83 83q19 19 45 19t45 -19l83 -83l83 83q19 19 45 19t45 -19l83 -83l83 83q19 19 45 19t45 -19l83 -83l83 83 |
| | | q19 19 45 19t45 -19l83 -83zM237 19q-19 -19 -45 -19t-45 19l-128 128l90 90l83 -82l83 82q19 19 45 19t45 -19l83 -82l64 64v293l-210 314q-17 26 -7 56.5t40 40.5l177 58v299h128v128h256v128h256v-128h256v-128h128v-299l177 -58q30 -10 40 -40.5t-7 -56.5l-210 -314 |
| | | v-293l19 18q19 19 45 19t45 -19l83 -82l83 82q19 19 45 19t45 -19l128 -128l-90 -90l-83 83l-83 -83q-18 -19 -45 -19t-45 19l-83 83l-83 -83q-19 -19 -45 -19t-45 19l-83 83l-83 -83q-19 -19 -45 -19t-45 19l-83 83l-83 -83q-19 -19 -45 -19t-45 19l-83 83l-83 -83 |
| | | q-19 -19 -45 -19t-45 19l-83 83l-83 -83q-19 -19 -45 -19t-45 19l-83 83zM640 1152v-128l384 128l384 -128v128h-128v128h-512v-128h-128z" /> |
| | | <glyph glyph-name="_506" unicode="" |
| | | d="M576 0l96 448l-96 128l-128 64zM832 0l128 640l-128 -64l-96 -128zM992 1010q-2 4 -4 6q-10 8 -96 8q-70 0 -167 -19q-7 -2 -21 -2t-21 2q-97 19 -167 19q-86 0 -96 -8q-2 -2 -4 -6q2 -18 4 -27q2 -3 7.5 -6.5t7.5 -10.5q2 -4 7.5 -20.5t7 -20.5t7.5 -17t8.5 -17t9 -14 |
| | | t12 -13.5t14 -9.5t17.5 -8t20.5 -4t24.5 -2q36 0 59 12.5t32.5 30t14.5 34.5t11.5 29.5t17.5 12.5h12q11 0 17.5 -12.5t11.5 -29.5t14.5 -34.5t32.5 -30t59 -12.5q13 0 24.5 2t20.5 4t17.5 8t14 9.5t12 13.5t9 14t8.5 17t7.5 17t7 20.5t7.5 20.5q2 7 7.5 10.5t7.5 6.5 |
| | | q2 9 4 27zM1408 131q0 -121 -73 -190t-194 -69h-874q-121 0 -194 69t-73 190q0 61 4.5 118t19 125.5t37.5 123.5t63.5 103.5t93.5 74.5l-90 220h214q-22 64 -22 128q0 12 2 32q-194 40 -194 96q0 57 210 99q17 62 51.5 134t70.5 114q32 37 76 37q30 0 84 -31t84 -31t84 31 |
| | | t84 31q44 0 76 -37q36 -42 70.5 -114t51.5 -134q210 -42 210 -99q0 -56 -194 -96q7 -81 -20 -160h214l-82 -225q63 -33 107.5 -96.5t65.5 -143.5t29 -151.5t8 -148.5z" /> |
| | | <glyph glyph-name="_507" unicode="" horiz-adv-x="2304" |
| | | d="M2301 500q12 -103 -22 -198.5t-99 -163.5t-158.5 -106t-196.5 -31q-161 11 -279.5 125t-134.5 274q-12 111 27.5 210.5t118.5 170.5l-71 107q-96 -80 -151 -194t-55 -244q0 -27 -18.5 -46.5t-45.5 -19.5h-256h-69q-23 -164 -149 -274t-294 -110q-185 0 -316.5 131.5 |
| | | t-131.5 316.5t131.5 316.5t316.5 131.5q76 0 152 -27l24 45q-123 110 -304 110h-64q-26 0 -45 19t-19 45t19 45t45 19h128q78 0 145 -13.5t116.5 -38.5t71.5 -39.5t51 -36.5h512h115l-85 128h-222q-30 0 -49 22.5t-14 52.5q4 23 23 38t43 15h253q33 0 53 -28l70 -105 |
| | | l114 114q19 19 46 19h101q26 0 45 -19t19 -45v-128q0 -26 -19 -45t-45 -19h-179l115 -172q131 63 275 36q143 -26 244 -134.5t118 -253.5zM448 128q115 0 203 72.5t111 183.5h-314q-35 0 -55 31q-18 32 -1 63l147 277q-47 13 -91 13q-132 0 -226 -94t-94 -226t94 -226 |
| | | t226 -94zM1856 128q132 0 226 94t94 226t-94 226t-226 94q-60 0 -121 -24l174 -260q15 -23 10 -49t-27 -40q-15 -11 -36 -11q-35 0 -53 29l-174 260q-93 -95 -93 -225q0 -132 94 -226t226 -94z" /> |
| | | <glyph glyph-name="_508" unicode="" |
| | | d="M1408 0q0 -63 -61.5 -113.5t-164 -81t-225 -46t-253.5 -15.5t-253.5 15.5t-225 46t-164 81t-61.5 113.5q0 49 33 88.5t91 66.5t118 44.5t131 29.5q26 5 48 -10.5t26 -41.5q5 -26 -10.5 -48t-41.5 -26q-58 -10 -106 -23.5t-76.5 -25.5t-48.5 -23.5t-27.5 -19.5t-8.5 -12 |
| | | q3 -11 27 -26.5t73 -33t114 -32.5t160.5 -25t201.5 -10t201.5 10t160.5 25t114 33t73 33.5t27 27.5q-1 4 -8.5 11t-27.5 19t-48.5 23.5t-76.5 25t-106 23.5q-26 4 -41.5 26t-10.5 48q4 26 26 41.5t48 10.5q71 -12 131 -29.5t118 -44.5t91 -66.5t33 -88.5zM1024 896v-384 |
| | | q0 -26 -19 -45t-45 -19h-64v-384q0 -26 -19 -45t-45 -19h-256q-26 0 -45 19t-19 45v384h-64q-26 0 -45 19t-19 45v384q0 53 37.5 90.5t90.5 37.5h384q53 0 90.5 -37.5t37.5 -90.5zM928 1280q0 -93 -65.5 -158.5t-158.5 -65.5t-158.5 65.5t-65.5 158.5t65.5 158.5t158.5 65.5 |
| | | t158.5 -65.5t65.5 -158.5z" /> |
| | | <glyph glyph-name="_509" unicode="" horiz-adv-x="1792" |
| | | d="M1280 512h305q-5 -6 -10 -10.5t-9 -7.5l-3 -4l-623 -600q-18 -18 -44 -18t-44 18l-624 602q-5 2 -21 20h369q22 0 39.5 13.5t22.5 34.5l70 281l190 -667q6 -20 23 -33t39 -13q21 0 38 13t23 33l146 485l56 -112q18 -35 57 -35zM1792 940q0 -145 -103 -300h-369l-111 221 |
| | | q-8 17 -25.5 27t-36.5 8q-45 -5 -56 -46l-129 -430l-196 686q-6 20 -23.5 33t-39.5 13t-39 -13.5t-22 -34.5l-116 -464h-423q-103 155 -103 300q0 220 127 344t351 124q62 0 126.5 -21.5t120 -58t95.5 -68.5t76 -68q36 36 76 68t95.5 68.5t120 58t126.5 21.5q224 0 351 -124 |
| | | t127 -344z" /> |
| | | <glyph glyph-name="venus" unicode="" horiz-adv-x="1280" |
| | | d="M1152 960q0 -221 -147.5 -384.5t-364.5 -187.5v-260h224q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-224v-224q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v224h-224q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h224v260q-150 16 -271.5 103t-186 224t-52.5 292 |
| | | q11 134 80.5 249t182 188t245.5 88q170 19 319 -54t236 -212t87 -306zM128 960q0 -185 131.5 -316.5t316.5 -131.5t316.5 131.5t131.5 316.5t-131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5z" /> |
| | | <glyph glyph-name="_511" unicode="" |
| | | d="M1472 1408q26 0 45 -19t19 -45v-416q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v262l-382 -383q126 -156 126 -359q0 -117 -45.5 -223.5t-123 -184t-184 -123t-223.5 -45.5t-223.5 45.5t-184 123t-123 184t-45.5 223.5t45.5 223.5t123 184t184 123t223.5 45.5 |
| | | q203 0 359 -126l382 382h-261q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h416zM576 0q185 0 316.5 131.5t131.5 316.5t-131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5z" /> |
| | | <glyph glyph-name="_512" unicode="" horiz-adv-x="1280" |
| | | d="M830 1220q145 -72 233.5 -210.5t88.5 -305.5q0 -221 -147.5 -384.5t-364.5 -187.5v-132h96q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-96v-96q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v96h-96q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h96v132q-217 24 -364.5 187.5 |
| | | t-147.5 384.5q0 167 88.5 305.5t233.5 210.5q-165 96 -228 273q-6 16 3.5 29.5t26.5 13.5h69q21 0 29 -20q44 -106 140 -171t214 -65t214 65t140 171q8 20 37 20h61q17 0 26.5 -13.5t3.5 -29.5q-63 -177 -228 -273zM576 256q185 0 316.5 131.5t131.5 316.5t-131.5 316.5 |
| | | t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5z" /> |
| | | <glyph glyph-name="_513" unicode="" |
| | | d="M1024 1504q0 14 9 23t23 9h288q26 0 45 -19t19 -45v-288q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v134l-254 -255q126 -158 126 -359q0 -221 -147.5 -384.5t-364.5 -187.5v-132h96q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-96v-96q0 -14 -9 -23t-23 -9h-64 |
| | | q-14 0 -23 9t-9 23v96h-96q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h96v132q-149 16 -270.5 103t-186.5 223.5t-53 291.5q16 204 160 353.5t347 172.5q118 14 228 -19t198 -103l255 254h-134q-14 0 -23 9t-9 23v64zM576 256q185 0 316.5 131.5t131.5 316.5t-131.5 316.5 |
| | | t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5z" /> |
| | | <glyph glyph-name="_514" unicode="" horiz-adv-x="1792" |
| | | d="M1280 1504q0 14 9 23t23 9h288q26 0 45 -19t19 -45v-288q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v134l-254 -255q126 -158 126 -359q0 -221 -147.5 -384.5t-364.5 -187.5v-132h96q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-96v-96q0 -14 -9 -23t-23 -9h-64 |
| | | q-14 0 -23 9t-9 23v96h-96q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h96v132q-217 24 -364.5 187.5t-147.5 384.5q0 201 126 359l-52 53l-101 -111q-9 -10 -22 -10.5t-23 7.5l-48 44q-10 8 -10.5 21.5t8.5 23.5l105 115l-111 112v-134q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9 |
| | | t-9 23v288q0 26 19 45t45 19h288q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-133l106 -107l86 94q9 10 22 10.5t23 -7.5l48 -44q10 -8 10.5 -21.5t-8.5 -23.5l-90 -99l57 -56q158 126 359 126t359 -126l255 254h-134q-14 0 -23 9t-9 23v64zM832 256q185 0 316.5 131.5 |
| | | t131.5 316.5t-131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5z" /> |
| | | <glyph glyph-name="_515" unicode="" horiz-adv-x="1792" |
| | | d="M1790 1007q12 -155 -52.5 -292t-186 -224t-271.5 -103v-260h224q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-224v-224q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v224h-512v-224q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v224h-224q-14 0 -23 9t-9 23v64q0 14 9 23 |
| | | t23 9h224v260q-150 16 -271.5 103t-186 224t-52.5 292q17 206 164.5 356.5t352.5 169.5q206 21 377 -94q171 115 377 94q205 -19 352.5 -169.5t164.5 -356.5zM896 647q128 131 128 313t-128 313q-128 -131 -128 -313t128 -313zM576 512q115 0 218 57q-154 165 -154 391 |
| | | q0 224 154 391q-103 57 -218 57q-185 0 -316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5zM1152 128v260q-137 15 -256 94q-119 -79 -256 -94v-260h512zM1216 512q185 0 316.5 131.5t131.5 316.5t-131.5 316.5t-316.5 131.5q-115 0 -218 -57q154 -167 154 -391 |
| | | q0 -226 -154 -391q103 -57 218 -57z" /> |
| | | <glyph glyph-name="_516" unicode="" horiz-adv-x="1920" |
| | | d="M1536 1120q0 14 9 23t23 9h288q26 0 45 -19t19 -45v-288q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v134l-254 -255q76 -95 107.5 -214t9.5 -247q-31 -182 -166 -312t-318 -156q-210 -29 -384.5 80t-241.5 300q-117 6 -221 57.5t-177.5 133t-113.5 192.5t-32 230 |
| | | q9 135 78 252t182 191.5t248 89.5q118 14 227.5 -19t198.5 -103l255 254h-134q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h288q26 0 45 -19t19 -45v-288q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v134l-254 -255q59 -74 93 -169q182 -9 328 -124l255 254h-134q-14 0 -23 9 |
| | | t-9 23v64zM1024 704q0 20 -4 58q-162 -25 -271 -150t-109 -292q0 -20 4 -58q162 25 271 150t109 292zM128 704q0 -168 111 -294t276 -149q-3 29 -3 59q0 210 135 369.5t338 196.5q-53 120 -163.5 193t-245.5 73q-185 0 -316.5 -131.5t-131.5 -316.5zM1088 -128 |
| | | q185 0 316.5 131.5t131.5 316.5q0 168 -111 294t-276 149q3 -28 3 -59q0 -210 -135 -369.5t-338 -196.5q53 -120 163.5 -193t245.5 -73z" /> |
| | | <glyph glyph-name="_517" unicode="" horiz-adv-x="2048" |
| | | d="M1664 1504q0 14 9 23t23 9h288q26 0 45 -19t19 -45v-288q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v134l-254 -255q76 -95 107.5 -214t9.5 -247q-32 -180 -164.5 -310t-313.5 -157q-223 -34 -409 90q-117 -78 -256 -93v-132h96q14 0 23 -9t9 -23v-64q0 -14 -9 -23 |
| | | t-23 -9h-96v-96q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v96h-96q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h96v132q-155 17 -279.5 109.5t-187 237.5t-39.5 307q25 187 159.5 322.5t320.5 164.5q224 34 410 -90q146 97 320 97q201 0 359 -126l255 254h-134q-14 0 -23 9 |
| | | t-9 23v64zM896 391q128 131 128 313t-128 313q-128 -131 -128 -313t128 -313zM128 704q0 -185 131.5 -316.5t316.5 -131.5q117 0 218 57q-154 167 -154 391t154 391q-101 57 -218 57q-185 0 -316.5 -131.5t-131.5 -316.5zM1216 256q185 0 316.5 131.5t131.5 316.5 |
| | | t-131.5 316.5t-316.5 131.5q-117 0 -218 -57q154 -167 154 -391t-154 -391q101 -57 218 -57z" /> |
| | | <glyph glyph-name="_518" unicode="" |
| | | d="M1472 1408q26 0 45 -19t19 -45v-416q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v262l-213 -214l140 -140q9 -10 9 -23t-9 -22l-46 -46q-9 -9 -22 -9t-23 9l-140 141l-78 -79q126 -156 126 -359q0 -117 -45.5 -223.5t-123 -184t-184 -123t-223.5 -45.5t-223.5 45.5 |
| | | t-184 123t-123 184t-45.5 223.5t45.5 223.5t123 184t184 123t223.5 45.5q203 0 359 -126l78 78l-172 172q-9 10 -9 23t9 22l46 46q9 9 22 9t23 -9l172 -172l213 213h-261q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h416zM576 0q185 0 316.5 131.5t131.5 316.5t-131.5 316.5 |
| | | t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5z" /> |
| | | <glyph glyph-name="_519" unicode="" horiz-adv-x="1280" |
| | | d="M640 892q217 -24 364.5 -187.5t147.5 -384.5q0 -167 -87 -306t-236 -212t-319 -54q-133 15 -245.5 88t-182 188t-80.5 249q-12 155 52.5 292t186 224t271.5 103v132h-160q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h160v165l-92 -92q-10 -9 -23 -9t-22 9l-46 46q-9 9 -9 22 |
| | | t9 23l202 201q19 19 45 19t45 -19l202 -201q9 -10 9 -23t-9 -22l-46 -46q-9 -9 -22 -9t-23 9l-92 92v-165h160q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-160v-132zM576 -128q185 0 316.5 131.5t131.5 316.5t-131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5 |
| | | t131.5 -316.5t316.5 -131.5z" /> |
| | | <glyph glyph-name="_520" unicode="" horiz-adv-x="2048" |
| | | d="M1901 621q19 -19 19 -45t-19 -45l-294 -294q-9 -10 -22.5 -10t-22.5 10l-45 45q-10 9 -10 22.5t10 22.5l185 185h-294v-224q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v224h-132q-24 -217 -187.5 -364.5t-384.5 -147.5q-167 0 -306 87t-212 236t-54 319q15 133 88 245.5 |
| | | t188 182t249 80.5q155 12 292 -52.5t224 -186t103 -271.5h132v224q0 14 9 23t23 9h64q14 0 23 -9t9 -23v-224h294l-185 185q-10 9 -10 22.5t10 22.5l45 45q9 10 22.5 10t22.5 -10zM576 128q185 0 316.5 131.5t131.5 316.5t-131.5 316.5t-316.5 131.5t-316.5 -131.5 |
| | | t-131.5 -316.5t131.5 -316.5t316.5 -131.5z" /> |
| | | <glyph glyph-name="_521" unicode="" horiz-adv-x="1280" |
| | | d="M1152 960q0 -221 -147.5 -384.5t-364.5 -187.5v-612q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v612q-217 24 -364.5 187.5t-147.5 384.5q0 117 45.5 223.5t123 184t184 123t223.5 45.5t223.5 -45.5t184 -123t123 -184t45.5 -223.5zM576 512q185 0 316.5 131.5 |
| | | t131.5 316.5t-131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5z" /> |
| | | <glyph glyph-name="_522" unicode="" horiz-adv-x="1280" |
| | | d="M1024 576q0 185 -131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5t131.5 -316.5t316.5 -131.5t316.5 131.5t131.5 316.5zM1152 576q0 -117 -45.5 -223.5t-123 -184t-184 -123t-223.5 -45.5t-223.5 45.5t-184 123t-123 184t-45.5 223.5t45.5 223.5t123 184t184 123 |
| | | t223.5 45.5t223.5 -45.5t184 -123t123 -184t45.5 -223.5z" /> |
| | | <glyph glyph-name="_523" unicode="" horiz-adv-x="1792" |
| | | /> |
| | | <glyph glyph-name="_524" unicode="" horiz-adv-x="1792" |
| | | /> |
| | | <glyph glyph-name="_525" unicode="" |
| | | d="M1451 1408q35 0 60 -25t25 -60v-1366q0 -35 -25 -60t-60 -25h-391v595h199l30 232h-229v148q0 56 23.5 84t91.5 28l122 1v207q-63 9 -178 9q-136 0 -217.5 -80t-81.5 -226v-171h-200v-232h200v-595h-735q-35 0 -60 25t-25 60v1366q0 35 25 60t60 25h1366z" /> |
| | | <glyph glyph-name="_526" unicode="" horiz-adv-x="1280" |
| | | d="M0 939q0 108 37.5 203.5t103.5 166.5t152 123t185 78t202 26q158 0 294 -66.5t221 -193.5t85 -287q0 -96 -19 -188t-60 -177t-100 -149.5t-145 -103t-189 -38.5q-68 0 -135 32t-96 88q-10 -39 -28 -112.5t-23.5 -95t-20.5 -71t-26 -71t-32 -62.5t-46 -77.5t-62 -86.5 |
| | | l-14 -5l-9 10q-15 157 -15 188q0 92 21.5 206.5t66.5 287.5t52 203q-32 65 -32 169q0 83 52 156t132 73q61 0 95 -40.5t34 -102.5q0 -66 -44 -191t-44 -187q0 -63 45 -104.5t109 -41.5q55 0 102 25t78.5 68t56 95t38 110.5t20 111t6.5 99.5q0 173 -109.5 269.5t-285.5 96.5 |
| | | q-200 0 -334 -129.5t-134 -328.5q0 -44 12.5 -85t27 -65t27 -45.5t12.5 -30.5q0 -28 -15 -73t-37 -45q-2 0 -17 3q-51 15 -90.5 56t-61 94.5t-32.5 108t-11 106.5z" /> |
| | | <glyph glyph-name="_527" unicode="" |
| | | d="M985 562q13 0 97.5 -44t89.5 -53q2 -5 2 -15q0 -33 -17 -76q-16 -39 -71 -65.5t-102 -26.5q-57 0 -190 62q-98 45 -170 118t-148 185q-72 107 -71 194v8q3 91 74 158q24 22 52 22q6 0 18 -1.5t19 -1.5q19 0 26.5 -6.5t15.5 -27.5q8 -20 33 -88t25 -75q0 -21 -34.5 -57.5 |
| | | t-34.5 -46.5q0 -7 5 -15q34 -73 102 -137q56 -53 151 -101q12 -7 22 -7q15 0 54 48.5t52 48.5zM782 32q127 0 243.5 50t200.5 134t134 200.5t50 243.5t-50 243.5t-134 200.5t-200.5 134t-243.5 50t-243.5 -50t-200.5 -134t-134 -200.5t-50 -243.5q0 -203 120 -368l-79 -233 |
| | | l242 77q158 -104 345 -104zM782 1414q153 0 292.5 -60t240.5 -161t161 -240.5t60 -292.5t-60 -292.5t-161 -240.5t-240.5 -161t-292.5 -60q-195 0 -365 94l-417 -134l136 405q-108 178 -108 389q0 153 60 292.5t161 240.5t240.5 161t292.5 60z" /> |
| | | <glyph glyph-name="_528" unicode="" horiz-adv-x="1792" |
| | | d="M128 128h1024v128h-1024v-128zM128 640h1024v128h-1024v-128zM1696 192q0 40 -28 68t-68 28t-68 -28t-28 -68t28 -68t68 -28t68 28t28 68zM128 1152h1024v128h-1024v-128zM1696 704q0 40 -28 68t-68 28t-68 -28t-28 -68t28 -68t68 -28t68 28t28 68zM1696 1216 |
| | | q0 40 -28 68t-68 28t-68 -28t-28 -68t28 -68t68 -28t68 28t28 68zM1792 384v-384h-1792v384h1792zM1792 896v-384h-1792v384h1792zM1792 1408v-384h-1792v384h1792z" /> |
| | | <glyph glyph-name="_529" unicode="" horiz-adv-x="2048" |
| | | d="M704 640q-159 0 -271.5 112.5t-112.5 271.5t112.5 271.5t271.5 112.5t271.5 -112.5t112.5 -271.5t-112.5 -271.5t-271.5 -112.5zM1664 512h352q13 0 22.5 -9.5t9.5 -22.5v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-352v-352q0 -13 -9.5 -22.5t-22.5 -9.5h-192q-13 0 -22.5 9.5 |
| | | t-9.5 22.5v352h-352q-13 0 -22.5 9.5t-9.5 22.5v192q0 13 9.5 22.5t22.5 9.5h352v352q0 13 9.5 22.5t22.5 9.5h192q13 0 22.5 -9.5t9.5 -22.5v-352zM928 288q0 -52 38 -90t90 -38h256v-238q-68 -50 -171 -50h-874q-121 0 -194 69t-73 190q0 53 3.5 103.5t14 109t26.5 108.5 |
| | | t43 97.5t62 81t85.5 53.5t111.5 20q19 0 39 -17q79 -61 154.5 -91.5t164.5 -30.5t164.5 30.5t154.5 91.5q20 17 39 17q132 0 217 -96h-223q-52 0 -90 -38t-38 -90v-192z" /> |
| | | <glyph glyph-name="_530" unicode="" horiz-adv-x="2048" |
| | | d="M704 640q-159 0 -271.5 112.5t-112.5 271.5t112.5 271.5t271.5 112.5t271.5 -112.5t112.5 -271.5t-112.5 -271.5t-271.5 -112.5zM1781 320l249 -249q9 -9 9 -23q0 -13 -9 -22l-136 -136q-9 -9 -22 -9q-14 0 -23 9l-249 249l-249 -249q-9 -9 -23 -9q-13 0 -22 9l-136 136 |
| | | q-9 9 -9 22q0 14 9 23l249 249l-249 249q-9 9 -9 23q0 13 9 22l136 136q9 9 22 9q14 0 23 -9l249 -249l249 249q9 9 23 9q13 0 22 -9l136 -136q9 -9 9 -22q0 -14 -9 -23zM1283 320l-181 -181q-37 -37 -37 -91q0 -53 37 -90l83 -83q-21 -3 -44 -3h-874q-121 0 -194 69 |
| | | t-73 190q0 53 3.5 103.5t14 109t26.5 108.5t43 97.5t62 81t85.5 53.5t111.5 20q19 0 39 -17q154 -122 319 -122t319 122q20 17 39 17q28 0 57 -6q-28 -27 -41 -50t-13 -56q0 -54 37 -91z" /> |
| | | <glyph glyph-name="_531" unicode="" horiz-adv-x="2048" |
| | | d="M256 512h1728q26 0 45 -19t19 -45v-448h-256v256h-1536v-256h-256v1216q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-704zM832 832q0 106 -75 181t-181 75t-181 -75t-75 -181t75 -181t181 -75t181 75t75 181zM2048 576v64q0 159 -112.5 271.5t-271.5 112.5h-704 |
| | | q-26 0 -45 -19t-19 -45v-384h1152z" /> |
| | | <glyph glyph-name="_532" unicode="" |
| | | d="M1536 1536l-192 -448h192v-192h-274l-55 -128h329v-192h-411l-357 -832l-357 832h-411v192h329l-55 128h-274v192h192l-192 448h256l323 -768h378l323 768h256zM768 320l108 256h-216z" /> |
| | | <glyph glyph-name="_533" unicode="" |
| | | d="M1088 1536q185 0 316.5 -93.5t131.5 -226.5v-896q0 -130 -125.5 -222t-305.5 -97l213 -202q16 -15 8 -35t-30 -20h-1056q-22 0 -30 20t8 35l213 202q-180 5 -305.5 97t-125.5 222v896q0 133 131.5 226.5t316.5 93.5h640zM768 192q80 0 136 56t56 136t-56 136t-136 56 |
| | | t-136 -56t-56 -136t56 -136t136 -56zM1344 768v512h-1152v-512h1152z" /> |
| | | <glyph glyph-name="_534" unicode="" |
| | | d="M1088 1536q185 0 316.5 -93.5t131.5 -226.5v-896q0 -130 -125.5 -222t-305.5 -97l213 -202q16 -15 8 -35t-30 -20h-1056q-22 0 -30 20t8 35l213 202q-180 5 -305.5 97t-125.5 222v896q0 133 131.5 226.5t316.5 93.5h640zM288 224q66 0 113 47t47 113t-47 113t-113 47 |
| | | t-113 -47t-47 -113t47 -113t113 -47zM704 768v512h-544v-512h544zM1248 224q66 0 113 47t47 113t-47 113t-113 47t-113 -47t-47 -113t47 -113t113 -47zM1408 768v512h-576v-512h576z" /> |
| | | <glyph glyph-name="_535" unicode="" horiz-adv-x="1792" |
| | | d="M597 1115v-1173q0 -25 -12.5 -42.5t-36.5 -17.5q-17 0 -33 8l-465 233q-21 10 -35.5 33.5t-14.5 46.5v1140q0 20 10 34t29 14q14 0 44 -15l511 -256q3 -3 3 -5zM661 1014l534 -866l-534 266v600zM1792 996v-1054q0 -25 -14 -40.5t-38 -15.5t-47 13l-441 220zM1789 1116 |
| | | q0 -3 -256.5 -419.5t-300.5 -487.5l-390 634l324 527q17 28 52 28q14 0 26 -6l541 -270q4 -2 4 -6z" /> |
| | | <glyph glyph-name="_536" unicode="" |
| | | d="M809 532l266 499h-112l-157 -312q-24 -48 -44 -92l-42 92l-155 312h-120l263 -493v-324h101v318zM1536 1408v-1536h-1536v1536h1536z" /> |
| | | <glyph glyph-name="_537" unicode="" horiz-adv-x="2296" |
| | | d="M478 -139q-8 -16 -27 -34.5t-37 -25.5q-25 -9 -51.5 3.5t-28.5 31.5q-1 22 40 55t68 38q23 4 34 -21.5t2 -46.5zM1819 -139q7 -16 26 -34.5t38 -25.5q25 -9 51.5 3.5t27.5 31.5q2 22 -39.5 55t-68.5 38q-22 4 -33 -21.5t-2 -46.5zM1867 -30q13 -27 56.5 -59.5t77.5 -41.5 |
| | | q45 -13 82 4.5t37 50.5q0 46 -67.5 100.5t-115.5 59.5q-40 5 -63.5 -37.5t-6.5 -76.5zM428 -30q-13 -27 -56 -59.5t-77 -41.5q-45 -13 -82 4.5t-37 50.5q0 46 67.5 100.5t115.5 59.5q40 5 63 -37.5t6 -76.5zM1158 1094h1q-41 0 -76 -15q27 -8 44 -30.5t17 -49.5 |
| | | q0 -35 -27 -60t-65 -25q-52 0 -80 43q-5 -23 -5 -42q0 -74 56 -126.5t135 -52.5q80 0 136 52.5t56 126.5t-56 126.5t-136 52.5zM1462 1312q-99 109 -220.5 131.5t-245.5 -44.5q27 60 82.5 96.5t118 39.5t121.5 -17t99.5 -74.5t44.5 -131.5zM2212 73q8 -11 -11 -42 |
| | | q7 -23 7 -40q1 -56 -44.5 -112.5t-109.5 -91.5t-118 -37q-48 -2 -92 21.5t-66 65.5q-687 -25 -1259 0q-23 -41 -66.5 -65t-92.5 -22q-86 3 -179.5 80.5t-92.5 160.5q2 22 7 40q-19 31 -11 42q6 10 31 1q14 22 41 51q-7 29 2 38q11 10 39 -4q29 20 59 34q0 29 13 37 |
| | | q23 12 51 -16q35 5 61 -2q18 -4 38 -19v73q-11 0 -18 2q-53 10 -97 44.5t-55 87.5q-9 38 0 81q15 62 93 95q2 17 19 35.5t36 23.5t33 -7.5t19 -30.5h13q46 -5 60 -23q3 -3 5 -7q10 1 30.5 3.5t30.5 3.5q-15 11 -30 17q-23 40 -91 43q0 6 1 10q-62 2 -118.5 18.5t-84.5 47.5 |
| | | q-32 36 -42.5 92t-2.5 112q16 126 90 179q23 16 52 4.5t32 -40.5q0 -1 1.5 -14t2.5 -21t3 -20t5.5 -19t8.5 -10q27 -14 76 -12q48 46 98 74q-40 4 -162 -14l47 46q61 58 163 111q145 73 282 86q-20 8 -41 15.5t-47 14t-42.5 10.5t-47.5 11t-43 10q595 126 904 -139 |
| | | q98 -84 158 -222q85 -10 121 9h1q5 3 8.5 10t5.5 19t3 19.5t3 21.5l1 14q3 28 32 40t52 -5q73 -52 91 -178q7 -57 -3.5 -113t-42.5 -91q-28 -32 -83.5 -48.5t-115.5 -18.5v-10q-71 -2 -95 -43q-14 -5 -31 -17q11 -1 32 -3.5t30 -3.5q1 5 5 8q16 18 60 23h13q5 18 19 30t33 8 |
| | | t36 -23t19 -36q79 -32 93 -95q9 -40 1 -81q-12 -53 -56 -88t-97 -44q-10 -2 -17 -2q0 -49 -1 -73q20 15 38 19q26 7 61 2q28 28 51 16q14 -9 14 -37q33 -16 59 -34q27 13 38 4q10 -10 2 -38q28 -30 41 -51q23 8 31 -1zM1937 1025q0 -29 -9 -54q82 -32 112 -132 |
| | | q4 37 -9.5 98.5t-41.5 90.5q-20 19 -36 17t-16 -20zM1859 925q35 -42 47.5 -108.5t-0.5 -124.5q67 13 97 45q13 14 18 28q-3 64 -31 114.5t-79 66.5q-15 -15 -52 -21zM1822 921q-30 0 -44 1q42 -115 53 -239q21 0 43 3q16 68 1 135t-53 100zM258 839q30 100 112 132 |
| | | q-9 25 -9 54q0 18 -16.5 20t-35.5 -17q-28 -29 -41.5 -90.5t-9.5 -98.5zM294 737q29 -31 97 -45q-13 58 -0.5 124.5t47.5 108.5v0q-37 6 -52 21q-51 -16 -78.5 -66t-31.5 -115q9 -17 18 -28zM471 683q14 124 73 235q-19 -4 -55 -18l-45 -19v1q-46 -89 -20 -196q25 -3 47 -3z |
| | | M1434 644q8 -38 16.5 -108.5t11.5 -89.5q3 -18 9.5 -21.5t23.5 4.5q40 20 62 85.5t23 125.5q-24 2 -146 4zM1152 1285q-116 0 -199 -82.5t-83 -198.5q0 -117 83 -199.5t199 -82.5t199 82.5t83 199.5q0 116 -83 198.5t-199 82.5zM1380 646q-105 2 -211 0v1q-1 -27 2.5 -86 |
| | | t13.5 -66q29 -14 93.5 -14.5t95.5 10.5q9 3 11 39t-0.5 69.5t-4.5 46.5zM1112 447q8 4 9.5 48t-0.5 88t-4 63v1q-212 -3 -214 -3q-4 -20 -7 -62t0 -83t14 -46q34 -15 101 -16t101 10zM718 636q-16 -59 4.5 -118.5t77.5 -84.5q15 -8 24 -5t12 21q3 16 8 90t10 103 |
| | | q-69 -2 -136 -6zM591 510q3 -23 -34 -36q132 -141 271.5 -240t305.5 -154q172 49 310.5 146t293.5 250q-33 13 -30 34q0 2 0.5 3.5t1.5 3t1 2.5v1v-1q-17 2 -50 5.5t-48 4.5q-26 -90 -82 -132q-51 -38 -82 1q-5 6 -9 14q-7 13 -17 62q-2 -5 -5 -9t-7.5 -7t-8 -5.5t-9.5 -4 |
| | | l-10 -2.5t-12 -2l-12 -1.5t-13.5 -1t-13.5 -0.5q-106 -9 -163 11q-4 -17 -10 -26.5t-21 -15t-23 -7t-36 -3.5q-6 -1 -9 -1q-179 -17 -203 40q-2 -63 -56 -54q-47 8 -91 54q-12 13 -20 26q-17 29 -26 65q-58 -6 -87 -10q1 -2 4 -10zM507 -118q3 14 3 30q-17 71 -51 130 |
| | | t-73 70q-41 12 -101.5 -14.5t-104.5 -80t-39 -107.5q35 -53 100 -93t119 -42q51 -2 94 28t53 79zM510 53q23 -63 27 -119q195 113 392 174q-98 52 -180.5 120t-179.5 165q-6 -4 -29 -13q0 -1 -1 -4t-1 -5q31 -18 22 -37q-12 -23 -56 -34q-10 -13 -29 -24h-1q-2 -83 1 -150 |
| | | q19 -34 35 -73zM579 -113q532 -21 1145 0q-254 147 -428 196q-76 -35 -156 -57q-8 -3 -16 0q-65 21 -129 49q-208 -60 -416 -188h-1v-1q1 0 1 1zM1763 -67q4 54 28 120q14 38 33 71l-1 -1q3 77 3 153q-15 8 -30 25q-42 9 -56 33q-9 20 22 38q-2 4 -2 9q-16 4 -28 12 |
| | | q-204 -190 -383 -284q198 -59 414 -176zM2155 -90q5 54 -39 107.5t-104 80t-102 14.5q-38 -11 -72.5 -70.5t-51.5 -129.5q0 -16 3 -30q10 -49 53 -79t94 -28q54 2 119 42t100 93z" /> |
| | | <glyph glyph-name="_538" unicode="" horiz-adv-x="2304" |
| | | d="M1524 -25q0 -68 -48 -116t-116 -48t-116.5 48t-48.5 116t48.5 116.5t116.5 48.5t116 -48.5t48 -116.5zM775 -25q0 -68 -48.5 -116t-116.5 -48t-116 48t-48 116t48 116.5t116 48.5t116.5 -48.5t48.5 -116.5zM0 1469q57 -60 110.5 -104.5t121 -82t136 -63t166 -45.5 |
| | | t200 -31.5t250 -18.5t304 -9.5t372.5 -2.5q139 0 244.5 -5t181 -16.5t124 -27.5t71 -39.5t24 -51.5t-19.5 -64t-56.5 -76.5t-89.5 -91t-116 -104.5t-139 -119q-185 -157 -286 -247q29 51 76.5 109t94 105.5t94.5 98.5t83 91.5t54 80.5t13 70t-45.5 55.5t-116.5 41t-204 23.5 |
| | | t-304 5q-168 -2 -314 6t-256 23t-204.5 41t-159.5 51.5t-122.5 62.5t-91.5 66.5t-68 71.5t-50.5 69.5t-40 68t-36.5 59.5z" /> |
| | | <glyph glyph-name="_539" unicode="" horiz-adv-x="1792" |
| | | d="M896 1472q-169 0 -323 -66t-265.5 -177.5t-177.5 -265.5t-66 -323t66 -323t177.5 -265.5t265.5 -177.5t323 -66t323 66t265.5 177.5t177.5 265.5t66 323t-66 323t-177.5 265.5t-265.5 177.5t-323 66zM896 1536q182 0 348 -71t286 -191t191 -286t71 -348t-71 -348 |
| | | t-191 -286t-286 -191t-348 -71t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71zM496 704q16 0 16 -16v-480q0 -16 -16 -16h-32q-16 0 -16 16v480q0 16 16 16h32zM896 640q53 0 90.5 -37.5t37.5 -90.5q0 -35 -17.5 -64t-46.5 -46v-114q0 -14 -9 -23 |
| | | t-23 -9h-64q-14 0 -23 9t-9 23v114q-29 17 -46.5 46t-17.5 64q0 53 37.5 90.5t90.5 37.5zM896 1408q209 0 385.5 -103t279.5 -279.5t103 -385.5t-103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103zM544 928v-96 |
| | | q0 -14 9 -23t23 -9h64q14 0 23 9t9 23v96q0 93 65.5 158.5t158.5 65.5t158.5 -65.5t65.5 -158.5v-96q0 -14 9 -23t23 -9h64q14 0 23 9t9 23v96q0 146 -103 249t-249 103t-249 -103t-103 -249zM1408 192v512q0 26 -19 45t-45 19h-896q-26 0 -45 -19t-19 -45v-512 |
| | | q0 -26 19 -45t45 -19h896q26 0 45 19t19 45z" /> |
| | | <glyph glyph-name="_540" unicode="" horiz-adv-x="2304" |
| | | d="M1920 1024v-768h-1664v768h1664zM2048 448h128v384h-128v288q0 14 -9 23t-23 9h-1856q-14 0 -23 -9t-9 -23v-960q0 -14 9 -23t23 -9h1856q14 0 23 9t9 23v288zM2304 832v-384q0 -53 -37.5 -90.5t-90.5 -37.5v-160q0 -66 -47 -113t-113 -47h-1856q-66 0 -113 47t-47 113 |
| | | v960q0 66 47 113t113 47h1856q66 0 113 -47t47 -113v-160q53 0 90.5 -37.5t37.5 -90.5z" /> |
| | | <glyph glyph-name="_541" unicode="" horiz-adv-x="2304" |
| | | d="M256 256v768h1280v-768h-1280zM2176 960q53 0 90.5 -37.5t37.5 -90.5v-384q0 -53 -37.5 -90.5t-90.5 -37.5v-160q0 -66 -47 -113t-113 -47h-1856q-66 0 -113 47t-47 113v960q0 66 47 113t113 47h1856q66 0 113 -47t47 -113v-160zM2176 448v384h-128v288q0 14 -9 23t-23 9 |
| | | h-1856q-14 0 -23 -9t-9 -23v-960q0 -14 9 -23t23 -9h1856q14 0 23 9t9 23v288h128z" /> |
| | | <glyph glyph-name="_542" unicode="" horiz-adv-x="2304" |
| | | d="M256 256v768h896v-768h-896zM2176 960q53 0 90.5 -37.5t37.5 -90.5v-384q0 -53 -37.5 -90.5t-90.5 -37.5v-160q0 -66 -47 -113t-113 -47h-1856q-66 0 -113 47t-47 113v960q0 66 47 113t113 47h1856q66 0 113 -47t47 -113v-160zM2176 448v384h-128v288q0 14 -9 23t-23 9 |
| | | h-1856q-14 0 -23 -9t-9 -23v-960q0 -14 9 -23t23 -9h1856q14 0 23 9t9 23v288h128z" /> |
| | | <glyph glyph-name="_543" unicode="" horiz-adv-x="2304" |
| | | d="M256 256v768h512v-768h-512zM2176 960q53 0 90.5 -37.5t37.5 -90.5v-384q0 -53 -37.5 -90.5t-90.5 -37.5v-160q0 -66 -47 -113t-113 -47h-1856q-66 0 -113 47t-47 113v960q0 66 47 113t113 47h1856q66 0 113 -47t47 -113v-160zM2176 448v384h-128v288q0 14 -9 23t-23 9 |
| | | h-1856q-14 0 -23 -9t-9 -23v-960q0 -14 9 -23t23 -9h1856q14 0 23 9t9 23v288h128z" /> |
| | | <glyph glyph-name="_544" unicode="" horiz-adv-x="2304" |
| | | d="M2176 960q53 0 90.5 -37.5t37.5 -90.5v-384q0 -53 -37.5 -90.5t-90.5 -37.5v-160q0 -66 -47 -113t-113 -47h-1856q-66 0 -113 47t-47 113v960q0 66 47 113t113 47h1856q66 0 113 -47t47 -113v-160zM2176 448v384h-128v288q0 14 -9 23t-23 9h-1856q-14 0 -23 -9t-9 -23 |
| | | v-960q0 -14 9 -23t23 -9h1856q14 0 23 9t9 23v288h128z" /> |
| | | <glyph glyph-name="_545" unicode="" horiz-adv-x="1280" |
| | | d="M1133 493q31 -30 14 -69q-17 -40 -59 -40h-382l201 -476q10 -25 0 -49t-34 -35l-177 -75q-25 -10 -49 0t-35 34l-191 452l-312 -312q-19 -19 -45 -19q-12 0 -24 5q-40 17 -40 59v1504q0 42 40 59q12 5 24 5q27 0 45 -19z" /> |
| | | <glyph glyph-name="_546" unicode="" horiz-adv-x="1024" |
| | | d="M832 1408q-320 0 -320 -224v-416h128v-128h-128v-544q0 -224 320 -224h64v-128h-64q-272 0 -384 146q-112 -146 -384 -146h-64v128h64q320 0 320 224v544h-128v128h128v416q0 224 -320 224h-64v128h64q272 0 384 -146q112 146 384 146h64v-128h-64z" /> |
| | | <glyph glyph-name="_547" unicode="" horiz-adv-x="2048" |
| | | d="M2048 1152h-128v-1024h128v-384h-384v128h-1280v-128h-384v384h128v1024h-128v384h384v-128h1280v128h384v-384zM1792 1408v-128h128v128h-128zM128 1408v-128h128v128h-128zM256 -128v128h-128v-128h128zM1664 0v128h128v1024h-128v128h-1280v-128h-128v-1024h128v-128 |
| | | h1280zM1920 -128v128h-128v-128h128zM1280 896h384v-768h-896v256h-384v768h896v-256zM512 512h640v512h-640v-512zM1536 256v512h-256v-384h-384v-128h640z" /> |
| | | <glyph glyph-name="_548" unicode="" horiz-adv-x="2304" |
| | | d="M2304 768h-128v-640h128v-384h-384v128h-896v-128h-384v384h128v128h-384v-128h-384v384h128v640h-128v384h384v-128h896v128h384v-384h-128v-128h384v128h384v-384zM2048 1024v-128h128v128h-128zM1408 1408v-128h128v128h-128zM128 1408v-128h128v128h-128zM256 256 |
| | | v128h-128v-128h128zM1536 384h-128v-128h128v128zM384 384h896v128h128v640h-128v128h-896v-128h-128v-640h128v-128zM896 -128v128h-128v-128h128zM2176 -128v128h-128v-128h128zM2048 128v640h-128v128h-384v-384h128v-384h-384v128h-384v-128h128v-128h896v128h128z" /> |
| | | <glyph glyph-name="_549" unicode="" |
| | | d="M1024 288v-416h-928q-40 0 -68 28t-28 68v1344q0 40 28 68t68 28h1344q40 0 68 -28t28 -68v-928h-416q-40 0 -68 -28t-28 -68zM1152 256h381q-15 -82 -65 -132l-184 -184q-50 -50 -132 -65v381z" /> |
| | | <glyph glyph-name="_550" unicode="" |
| | | d="M1400 256h-248v-248q29 10 41 22l185 185q12 12 22 41zM1120 384h288v896h-1280v-1280h896v288q0 40 28 68t68 28zM1536 1312v-1024q0 -40 -20 -88t-48 -76l-184 -184q-28 -28 -76 -48t-88 -20h-1024q-40 0 -68 28t-28 68v1344q0 40 28 68t68 28h1344q40 0 68 -28t28 -68 |
| | | z" /> |
| | | <glyph glyph-name="_551" unicode="" horiz-adv-x="2304" |
| | | d="M1951 538q0 -26 -15.5 -44.5t-38.5 -23.5q-8 -2 -18 -2h-153v140h153q10 0 18 -2q23 -5 38.5 -23.5t15.5 -44.5zM1933 751q0 -25 -15 -42t-38 -21q-3 -1 -15 -1h-139v129h139q3 0 8.5 -0.5t6.5 -0.5q23 -4 38 -21.5t15 -42.5zM728 587v308h-228v-308q0 -58 -38 -94.5 |
| | | t-105 -36.5q-108 0 -229 59v-112q53 -15 121 -23t109 -9l42 -1q328 0 328 217zM1442 403v113q-99 -52 -200 -59q-108 -8 -169 41t-61 142t61 142t169 41q101 -7 200 -58v112q-48 12 -100 19.5t-80 9.5l-28 2q-127 6 -218.5 -14t-140.5 -60t-71 -88t-22 -106t22 -106t71 -88 |
| | | t140.5 -60t218.5 -14q101 4 208 31zM2176 518q0 54 -43 88.5t-109 39.5v3q57 8 89 41.5t32 79.5q0 55 -41 88t-107 36q-3 0 -12 0.5t-14 0.5h-455v-510h491q74 0 121.5 36.5t47.5 96.5zM2304 1280v-1280q0 -52 -38 -90t-90 -38h-2048q-52 0 -90 38t-38 90v1280q0 52 38 90 |
| | | t90 38h2048q52 0 90 -38t38 -90z" /> |
| | | <glyph glyph-name="_552" unicode="" horiz-adv-x="2304" |
| | | d="M858 295v693q-106 -41 -172 -135.5t-66 -211.5t66 -211.5t172 -134.5zM1362 641q0 117 -66 211.5t-172 135.5v-694q106 41 172 135.5t66 211.5zM1577 641q0 -159 -78.5 -294t-213.5 -213.5t-294 -78.5q-119 0 -227.5 46.5t-187 125t-125 187t-46.5 227.5q0 159 78.5 294 |
| | | t213.5 213.5t294 78.5t294 -78.5t213.5 -213.5t78.5 -294zM1960 634q0 139 -55.5 261.5t-147.5 205.5t-213.5 131t-252.5 48h-301q-176 0 -323.5 -81t-235 -230t-87.5 -335q0 -171 87 -317.5t236 -231.5t323 -85h301q129 0 251.5 50.5t214.5 135t147.5 202.5t55.5 246z |
| | | M2304 1280v-1280q0 -52 -38 -90t-90 -38h-2048q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h2048q52 0 90 -38t38 -90z" /> |
| | | <glyph glyph-name="_553" unicode="" horiz-adv-x="1792" |
| | | d="M1664 -96v1088q0 13 -9.5 22.5t-22.5 9.5h-1088q-13 0 -22.5 -9.5t-9.5 -22.5v-1088q0 -13 9.5 -22.5t22.5 -9.5h1088q13 0 22.5 9.5t9.5 22.5zM1792 992v-1088q0 -66 -47 -113t-113 -47h-1088q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h1088q66 0 113 -47t47 -113 |
| | | zM1408 1376v-160h-128v160q0 13 -9.5 22.5t-22.5 9.5h-1088q-13 0 -22.5 -9.5t-9.5 -22.5v-1088q0 -13 9.5 -22.5t22.5 -9.5h160v-128h-160q-66 0 -113 47t-47 113v1088q0 66 47 113t113 47h1088q66 0 113 -47t47 -113z" /> |
| | | <glyph glyph-name="_554" unicode="" horiz-adv-x="2304" |
| | | d="M1728 1088l-384 -704h768zM448 1088l-384 -704h768zM1269 1280q-14 -40 -45.5 -71.5t-71.5 -45.5v-1291h608q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-1344q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h608v1291q-40 14 -71.5 45.5t-45.5 71.5h-491q-14 0 -23 9t-9 23v64 |
| | | q0 14 9 23t23 9h491q21 57 70 92.5t111 35.5t111 -35.5t70 -92.5h491q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-491zM1088 1264q33 0 56.5 23.5t23.5 56.5t-23.5 56.5t-56.5 23.5t-56.5 -23.5t-23.5 -56.5t23.5 -56.5t56.5 -23.5zM2176 384q0 -73 -46.5 -131t-117.5 -91 |
| | | t-144.5 -49.5t-139.5 -16.5t-139.5 16.5t-144.5 49.5t-117.5 91t-46.5 131q0 11 35 81t92 174.5t107 195.5t102 184t56 100q18 33 56 33t56 -33q4 -7 56 -100t102 -184t107 -195.5t92 -174.5t35 -81zM896 384q0 -73 -46.5 -131t-117.5 -91t-144.5 -49.5t-139.5 -16.5 |
| | | t-139.5 16.5t-144.5 49.5t-117.5 91t-46.5 131q0 11 35 81t92 174.5t107 195.5t102 184t56 100q18 33 56 33t56 -33q4 -7 56 -100t102 -184t107 -195.5t92 -174.5t35 -81z" /> |
| | | <glyph glyph-name="_555" unicode="" |
| | | d="M1408 1408q0 -261 -106.5 -461.5t-266.5 -306.5q160 -106 266.5 -306.5t106.5 -461.5h96q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-1472q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h96q0 261 106.5 461.5t266.5 306.5q-160 106 -266.5 306.5t-106.5 461.5h-96q-14 0 -23 9 |
| | | t-9 23v64q0 14 9 23t23 9h1472q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-96zM874 700q77 29 149 92.5t129.5 152.5t92.5 210t35 253h-1024q0 -132 35 -253t92.5 -210t129.5 -152.5t149 -92.5q19 -7 30.5 -23.5t11.5 -36.5t-11.5 -36.5t-30.5 -23.5q-77 -29 -149 -92.5 |
| | | t-129.5 -152.5t-92.5 -210t-35 -253h1024q0 132 -35 253t-92.5 210t-129.5 152.5t-149 92.5q-19 7 -30.5 23.5t-11.5 36.5t11.5 36.5t30.5 23.5z" /> |
| | | <glyph glyph-name="_556" unicode="" |
| | | d="M1408 1408q0 -261 -106.5 -461.5t-266.5 -306.5q160 -106 266.5 -306.5t106.5 -461.5h96q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-1472q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h96q0 261 106.5 461.5t266.5 306.5q-160 106 -266.5 306.5t-106.5 461.5h-96q-14 0 -23 9 |
| | | t-9 23v64q0 14 9 23t23 9h1472q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-96zM1280 1408h-1024q0 -66 9 -128h1006q9 61 9 128zM1280 -128q0 130 -34 249.5t-90.5 208t-126.5 152t-146 94.5h-230q-76 -31 -146 -94.5t-126.5 -152t-90.5 -208t-34 -249.5h1024z" /> |
| | | <glyph glyph-name="_557" unicode="" |
| | | d="M1408 1408q0 -261 -106.5 -461.5t-266.5 -306.5q160 -106 266.5 -306.5t106.5 -461.5h96q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-1472q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h96q0 261 106.5 461.5t266.5 306.5q-160 106 -266.5 306.5t-106.5 461.5h-96q-14 0 -23 9 |
| | | t-9 23v64q0 14 9 23t23 9h1472q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-96zM1280 1408h-1024q0 -206 85 -384h854q85 178 85 384zM1223 192q-54 141 -145.5 241.5t-194.5 142.5h-230q-103 -42 -194.5 -142.5t-145.5 -241.5h910z" /> |
| | | <glyph glyph-name="_558" unicode="" |
| | | d="M1408 1408q0 -261 -106.5 -461.5t-266.5 -306.5q160 -106 266.5 -306.5t106.5 -461.5h96q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-1472q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h96q0 261 106.5 461.5t266.5 306.5q-160 106 -266.5 306.5t-106.5 461.5h-96q-14 0 -23 9 |
| | | t-9 23v64q0 14 9 23t23 9h1472q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-96zM874 700q77 29 149 92.5t129.5 152.5t92.5 210t35 253h-1024q0 -132 35 -253t92.5 -210t129.5 -152.5t149 -92.5q19 -7 30.5 -23.5t11.5 -36.5t-11.5 -36.5t-30.5 -23.5q-137 -51 -244 -196 |
| | | h700q-107 145 -244 196q-19 7 -30.5 23.5t-11.5 36.5t11.5 36.5t30.5 23.5z" /> |
| | | <glyph glyph-name="_559" unicode="" |
| | | d="M1504 -64q14 0 23 -9t9 -23v-128q0 -14 -9 -23t-23 -9h-1472q-14 0 -23 9t-9 23v128q0 14 9 23t23 9h1472zM130 0q3 55 16 107t30 95t46 87t53.5 76t64.5 69.5t66 60t70.5 55t66.5 47.5t65 43q-43 28 -65 43t-66.5 47.5t-70.5 55t-66 60t-64.5 69.5t-53.5 76t-46 87 |
| | | t-30 95t-16 107h1276q-3 -55 -16 -107t-30 -95t-46 -87t-53.5 -76t-64.5 -69.5t-66 -60t-70.5 -55t-66.5 -47.5t-65 -43q43 -28 65 -43t66.5 -47.5t70.5 -55t66 -60t64.5 -69.5t53.5 -76t46 -87t30 -95t16 -107h-1276zM1504 1536q14 0 23 -9t9 -23v-128q0 -14 -9 -23t-23 -9 |
| | | h-1472q-14 0 -23 9t-9 23v128q0 14 9 23t23 9h1472z" /> |
| | | <glyph glyph-name="_560" unicode="" |
| | | d="M768 1152q-53 0 -90.5 -37.5t-37.5 -90.5v-128h-32v93q0 48 -32 81.5t-80 33.5q-46 0 -79 -33t-33 -79v-429l-32 30v172q0 48 -32 81.5t-80 33.5q-46 0 -79 -33t-33 -79v-224q0 -47 35 -82l310 -296q39 -39 39 -102q0 -26 19 -45t45 -19h640q26 0 45 19t19 45v25 |
| | | q0 41 10 77l108 436q10 36 10 77v246q0 48 -32 81.5t-80 33.5q-46 0 -79 -33t-33 -79v-32h-32v125q0 40 -25 72.5t-64 40.5q-14 2 -23 2q-46 0 -79 -33t-33 -79v-128h-32v122q0 51 -32.5 89.5t-82.5 43.5q-5 1 -13 1zM768 1280q84 0 149 -50q57 34 123 34q59 0 111 -27 |
| | | t86 -76q27 7 59 7q100 0 170 -71.5t70 -171.5v-246q0 -51 -13 -108l-109 -436q-6 -24 -6 -71q0 -80 -56 -136t-136 -56h-640q-84 0 -138 58.5t-54 142.5l-308 296q-76 73 -76 175v224q0 99 70.5 169.5t169.5 70.5q11 0 16 -1q6 95 75.5 160t164.5 65q52 0 98 -21 |
| | | q72 69 174 69z" /> |
| | | <glyph glyph-name="_561" unicode="" horiz-adv-x="1792" |
| | | d="M880 1408q-46 0 -79 -33t-33 -79v-656h-32v528q0 46 -33 79t-79 33t-79 -33t-33 -79v-528v-256l-154 205q-38 51 -102 51q-53 0 -90.5 -37.5t-37.5 -90.5q0 -43 26 -77l384 -512q38 -51 102 -51h688q34 0 61 22t34 56l76 405q5 32 5 59v498q0 46 -33 79t-79 33t-79 -33 |
| | | t-33 -79v-272h-32v528q0 46 -33 79t-79 33t-79 -33t-33 -79v-528h-32v656q0 46 -33 79t-79 33zM880 1536q68 0 125.5 -35.5t88.5 -96.5q19 4 42 4q99 0 169.5 -70.5t70.5 -169.5v-17q105 6 180.5 -64t75.5 -175v-498q0 -40 -8 -83l-76 -404q-14 -79 -76.5 -131t-143.5 -52 |
| | | h-688q-60 0 -114.5 27.5t-90.5 74.5l-384 512q-51 68 -51 154q0 106 75 181t181 75q78 0 128 -34v434q0 99 70.5 169.5t169.5 70.5q23 0 42 -4q31 61 88.5 96.5t125.5 35.5z" /> |
| | | <glyph glyph-name="_562" unicode="" horiz-adv-x="1792" |
| | | d="M1073 -128h-177q-163 0 -226 141q-23 49 -23 102v5q-62 30 -98.5 88.5t-36.5 127.5q0 38 5 48h-261q-106 0 -181 75t-75 181t75 181t181 75h113l-44 17q-74 28 -119.5 93.5t-45.5 145.5q0 106 75 181t181 75q46 0 91 -17l628 -239h401q106 0 181 -75t75 -181v-668 |
| | | q0 -88 -54 -157.5t-140 -90.5l-339 -85q-92 -23 -186 -23zM1024 583l-155 -71l-163 -74q-30 -14 -48 -41.5t-18 -60.5q0 -46 33 -79t79 -33q26 0 46 10l338 154q-49 10 -80.5 50t-31.5 90v55zM1344 272q0 46 -33 79t-79 33q-26 0 -46 -10l-290 -132q-28 -13 -37 -17 |
| | | t-30.5 -17t-29.5 -23.5t-16 -29t-8 -40.5q0 -50 31.5 -82t81.5 -32q20 0 38 9l352 160q30 14 48 41.5t18 60.5zM1112 1024l-650 248q-24 8 -46 8q-53 0 -90.5 -37.5t-37.5 -90.5q0 -40 22.5 -73t59.5 -47l526 -200v-64h-640q-53 0 -90.5 -37.5t-37.5 -90.5t37.5 -90.5 |
| | | t90.5 -37.5h535l233 106v198q0 63 46 106l111 102h-69zM1073 0q82 0 155 19l339 85q43 11 70 45.5t27 78.5v668q0 53 -37.5 90.5t-90.5 37.5h-308l-136 -126q-36 -33 -36 -82v-296q0 -46 33 -77t79 -31t79 35t33 81v208h32v-208q0 -70 -57 -114q52 -8 86.5 -48.5t34.5 -93.5 |
| | | q0 -42 -23 -78t-61 -53l-310 -141h91z" /> |
| | | <glyph glyph-name="_563" unicode="" horiz-adv-x="2048" |
| | | d="M1151 1536q61 0 116 -28t91 -77l572 -781q118 -159 118 -359v-355q0 -80 -56 -136t-136 -56h-384q-80 0 -136 56t-56 136v177l-286 143h-546q-80 0 -136 56t-56 136v32q0 119 84.5 203.5t203.5 84.5h420l42 128h-686q-100 0 -173.5 67.5t-81.5 166.5q-65 79 -65 182v32 |
| | | q0 80 56 136t136 56h959zM1920 -64v355q0 157 -93 284l-573 781q-39 52 -103 52h-959q-26 0 -45 -19t-19 -45q0 -32 1.5 -49.5t9.5 -40.5t25 -43q10 31 35.5 50t56.5 19h832v-32h-832q-26 0 -45 -19t-19 -45q0 -44 3 -58q8 -44 44 -73t81 -29h640h91q40 0 68 -28t28 -68 |
| | | q0 -15 -5 -30l-64 -192q-10 -29 -35 -47.5t-56 -18.5h-443q-66 0 -113 -47t-47 -113v-32q0 -26 19 -45t45 -19h561q16 0 29 -7l317 -158q24 -13 38.5 -36t14.5 -50v-197q0 -26 19 -45t45 -19h384q26 0 45 19t19 45z" /> |
| | | <glyph glyph-name="_564" unicode="" horiz-adv-x="2048" |
| | | d="M459 -256q-77 0 -137.5 47.5t-79.5 122.5l-101 401q-13 57 -13 108q0 45 -5 67l-116 477q-7 27 -7 57q0 93 62 161t155 78q17 85 82.5 139t152.5 54q83 0 148 -51.5t85 -132.5l83 -348l103 428q20 81 85 132.5t148 51.5q89 0 155.5 -57.5t80.5 -144.5q92 -10 152 -79 |
| | | t60 -162q0 -24 -7 -59l-123 -512q10 7 37.5 28.5t38.5 29.5t35 23t41 20.5t41.5 11t49.5 5.5q105 0 180 -74t75 -179q0 -62 -28.5 -118t-78.5 -94l-507 -380q-68 -51 -153 -51h-694zM1104 1408q-38 0 -68.5 -24t-39.5 -62l-164 -682h-127l-145 602q-9 38 -39.5 62t-68.5 24 |
| | | q-48 0 -80 -33t-32 -80q0 -15 3 -28l132 -547h-26l-99 408q-9 37 -40 62.5t-69 25.5q-47 0 -80 -33t-33 -79q0 -14 3 -26l116 -478q7 -28 9 -86t10 -88l100 -401q8 -32 34 -52.5t59 -20.5h694q42 0 76 26l507 379q56 43 56 110q0 52 -37.5 88.5t-89.5 36.5q-43 0 -77 -26 |
| | | l-307 -230v227q0 4 32 138t68 282t39 161q4 18 4 29q0 47 -32 81t-79 34q-39 0 -69.5 -24t-39.5 -62l-116 -482h-26l150 624q3 14 3 28q0 48 -31.5 82t-79.5 34z" /> |
| | | <glyph glyph-name="_565" unicode="" horiz-adv-x="1792" |
| | | d="M640 1408q-53 0 -90.5 -37.5t-37.5 -90.5v-512v-384l-151 202q-41 54 -107 54q-52 0 -89 -38t-37 -90q0 -43 26 -77l384 -512q38 -51 102 -51h718q22 0 39.5 13.5t22.5 34.5l92 368q24 96 24 194v217q0 41 -28 71t-68 30t-68 -28t-28 -68h-32v61q0 48 -32 81.5t-80 33.5 |
| | | q-46 0 -79 -33t-33 -79v-64h-32v90q0 55 -37 94.5t-91 39.5q-53 0 -90.5 -37.5t-37.5 -90.5v-96h-32v570q0 55 -37 94.5t-91 39.5zM640 1536q107 0 181.5 -77.5t74.5 -184.5v-220q22 2 32 2q99 0 173 -69q47 21 99 21q113 0 184 -87q27 7 56 7q94 0 159 -67.5t65 -161.5 |
| | | v-217q0 -116 -28 -225l-92 -368q-16 -64 -68 -104.5t-118 -40.5h-718q-60 0 -114.5 27.5t-90.5 74.5l-384 512q-51 68 -51 154q0 105 74.5 180.5t179.5 75.5q71 0 130 -35v547q0 106 75 181t181 75zM768 128v384h-32v-384h32zM1024 128v384h-32v-384h32zM1280 128v384h-32 |
| | | v-384h32z" /> |
| | | <glyph glyph-name="_566" unicode="" |
| | | d="M1288 889q60 0 107 -23q141 -63 141 -226v-177q0 -94 -23 -186l-85 -339q-21 -86 -90.5 -140t-157.5 -54h-668q-106 0 -181 75t-75 181v401l-239 628q-17 45 -17 91q0 106 75 181t181 75q80 0 145.5 -45.5t93.5 -119.5l17 -44v113q0 106 75 181t181 75t181 -75t75 -181 |
| | | v-261q27 5 48 5q69 0 127.5 -36.5t88.5 -98.5zM1072 896q-33 0 -60.5 -18t-41.5 -48l-74 -163l-71 -155h55q50 0 90 -31.5t50 -80.5l154 338q10 20 10 46q0 46 -33 79t-79 33zM1293 761q-22 0 -40.5 -8t-29 -16t-23.5 -29.5t-17 -30.5t-17 -37l-132 -290q-10 -20 -10 -46 |
| | | q0 -46 33 -79t79 -33q33 0 60.5 18t41.5 48l160 352q9 18 9 38q0 50 -32 81.5t-82 31.5zM128 1120q0 -22 8 -46l248 -650v-69l102 111q43 46 106 46h198l106 233v535q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5v-640h-64l-200 526q-14 37 -47 59.5t-73 22.5 |
| | | q-53 0 -90.5 -37.5t-37.5 -90.5zM1180 -128q44 0 78.5 27t45.5 70l85 339q19 73 19 155v91l-141 -310q-17 -38 -53 -61t-78 -23q-53 0 -93.5 34.5t-48.5 86.5q-44 -57 -114 -57h-208v32h208q46 0 81 33t35 79t-31 79t-77 33h-296q-49 0 -82 -36l-126 -136v-308 |
| | | q0 -53 37.5 -90.5t90.5 -37.5h668z" /> |
| | | <glyph glyph-name="_567" unicode="" horiz-adv-x="1973" |
| | | d="M857 992v-117q0 -13 -9.5 -22t-22.5 -9h-298v-812q0 -13 -9 -22.5t-22 -9.5h-135q-13 0 -22.5 9t-9.5 23v812h-297q-13 0 -22.5 9t-9.5 22v117q0 14 9 23t23 9h793q13 0 22.5 -9.5t9.5 -22.5zM1895 995l77 -961q1 -13 -8 -24q-10 -10 -23 -10h-134q-12 0 -21 8.5 |
| | | t-10 20.5l-46 588l-189 -425q-8 -19 -29 -19h-120q-20 0 -29 19l-188 427l-45 -590q-1 -12 -10 -20.5t-21 -8.5h-135q-13 0 -23 10q-9 10 -9 24l78 961q1 12 10 20.5t21 8.5h142q20 0 29 -19l220 -520q10 -24 20 -51q3 7 9.5 24.5t10.5 26.5l221 520q9 19 29 19h141 |
| | | q13 0 22 -8.5t10 -20.5z" /> |
| | | <glyph glyph-name="_568" unicode="" horiz-adv-x="1792" |
| | | d="M1042 833q0 88 -60 121q-33 18 -117 18h-123v-281h162q66 0 102 37t36 105zM1094 548l205 -373q8 -17 -1 -31q-8 -16 -27 -16h-152q-20 0 -28 17l-194 365h-155v-350q0 -14 -9 -23t-23 -9h-134q-14 0 -23 9t-9 23v960q0 14 9 23t23 9h294q128 0 190 -24q85 -31 134 -109 |
| | | t49 -180q0 -92 -42.5 -165.5t-115.5 -109.5q6 -10 9 -16zM896 1376q-150 0 -286 -58.5t-234.5 -157t-157 -234.5t-58.5 -286t58.5 -286t157 -234.5t234.5 -157t286 -58.5t286 58.5t234.5 157t157 234.5t58.5 286t-58.5 286t-157 234.5t-234.5 157t-286 58.5zM1792 640 |
| | | q0 -182 -71 -348t-191 -286t-286 -191t-348 -71t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71t348 -71t286 -191t191 -286t71 -348z" /> |
| | | <glyph glyph-name="_569" unicode="" horiz-adv-x="1792" |
| | | d="M605 303q153 0 257 104q14 18 3 36l-45 82q-6 13 -24 17q-16 2 -27 -11l-4 -3q-4 -4 -11.5 -10t-17.5 -13.5t-23.5 -14.5t-28.5 -13t-33.5 -9.5t-37.5 -3.5q-76 0 -125 50t-49 127q0 76 48 125.5t122 49.5q37 0 71.5 -14t50.5 -28l16 -14q11 -11 26 -10q16 2 24 14l53 78 |
| | | q13 20 -2 39q-3 4 -11 12t-30 23.5t-48.5 28t-67.5 22.5t-86 10q-148 0 -246 -96.5t-98 -240.5q0 -146 97 -241.5t247 -95.5zM1235 303q153 0 257 104q14 18 4 36l-45 82q-8 14 -25 17q-16 2 -27 -11l-4 -3q-4 -4 -11.5 -10t-17.5 -13.5t-23.5 -14.5t-28.5 -13t-33.5 -9.5 |
| | | t-37.5 -3.5q-76 0 -125 50t-49 127q0 76 48 125.5t122 49.5q37 0 71.5 -14t50.5 -28l16 -14q11 -11 26 -10q16 2 24 14l53 78q13 20 -2 39q-3 4 -11 12t-30 23.5t-48.5 28t-67.5 22.5t-86 10q-147 0 -245.5 -96.5t-98.5 -240.5q0 -146 97 -241.5t247 -95.5zM896 1376 |
| | | q-150 0 -286 -58.5t-234.5 -157t-157 -234.5t-58.5 -286t58.5 -286t157 -234.5t234.5 -157t286 -58.5t286 58.5t234.5 157t157 234.5t58.5 286t-58.5 286t-157 234.5t-234.5 157t-286 58.5zM896 1536q182 0 348 -71t286 -191t191 -286t71 -348t-71 -348t-191 -286t-286 -191 |
| | | t-348 -71t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71z" /> |
| | | <glyph glyph-name="f260" unicode="" horiz-adv-x="2048" |
| | | d="M736 736l384 -384l-384 -384l-672 672l672 672l168 -168l-96 -96l-72 72l-480 -480l480 -480l193 193l-289 287zM1312 1312l672 -672l-672 -672l-168 168l96 96l72 -72l480 480l-480 480l-193 -193l289 -287l-96 -96l-384 384z" /> |
| | | <glyph glyph-name="f261" unicode="" horiz-adv-x="1792" |
| | | d="M717 182l271 271l-279 279l-88 -88l192 -191l-96 -96l-279 279l279 279l40 -40l87 87l-127 128l-454 -454zM1075 190l454 454l-454 454l-271 -271l279 -279l88 88l-192 191l96 96l279 -279l-279 -279l-40 40l-87 -88zM1792 640q0 -182 -71 -348t-191 -286t-286 -191 |
| | | t-348 -71t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71t348 -71t286 -191t191 -286t71 -348z" /> |
| | | <glyph glyph-name="_572" unicode="" horiz-adv-x="2304" |
| | | d="M651 539q0 -39 -27.5 -66.5t-65.5 -27.5q-39 0 -66.5 27.5t-27.5 66.5q0 38 27.5 65.5t66.5 27.5q38 0 65.5 -27.5t27.5 -65.5zM1805 540q0 -39 -27.5 -66.5t-66.5 -27.5t-66.5 27.5t-27.5 66.5t27.5 66t66.5 27t66.5 -27t27.5 -66zM765 539q0 79 -56.5 136t-136.5 57 |
| | | t-136.5 -56.5t-56.5 -136.5t56.5 -136.5t136.5 -56.5t136.5 56.5t56.5 136.5zM1918 540q0 80 -56.5 136.5t-136.5 56.5q-79 0 -136 -56.5t-57 -136.5t56.5 -136.5t136.5 -56.5t136.5 56.5t56.5 136.5zM850 539q0 -116 -81.5 -197.5t-196.5 -81.5q-116 0 -197.5 82t-81.5 197 |
| | | t82 196.5t197 81.5t196.5 -81.5t81.5 -196.5zM2004 540q0 -115 -81.5 -196.5t-197.5 -81.5q-115 0 -196.5 81.5t-81.5 196.5t81.5 196.5t196.5 81.5q116 0 197.5 -81.5t81.5 -196.5zM1040 537q0 191 -135.5 326.5t-326.5 135.5q-125 0 -231 -62t-168 -168.5t-62 -231.5 |
| | | t62 -231.5t168 -168.5t231 -62q191 0 326.5 135.5t135.5 326.5zM1708 1110q-254 111 -556 111q-319 0 -573 -110q117 0 223 -45.5t182.5 -122.5t122 -183t45.5 -223q0 115 43.5 219.5t118 180.5t177.5 123t217 50zM2187 537q0 191 -135 326.5t-326 135.5t-326.5 -135.5 |
| | | t-135.5 -326.5t135.5 -326.5t326.5 -135.5t326 135.5t135 326.5zM1921 1103h383q-44 -51 -75 -114.5t-40 -114.5q110 -151 110 -337q0 -156 -77 -288t-209 -208.5t-287 -76.5q-133 0 -249 56t-196 155q-47 -56 -129 -179q-11 22 -53.5 82.5t-74.5 97.5 |
| | | q-80 -99 -196.5 -155.5t-249.5 -56.5q-155 0 -287 76.5t-209 208.5t-77 288q0 186 110 337q-9 51 -40 114.5t-75 114.5h365q149 100 355 156.5t432 56.5q224 0 421 -56t348 -157z" /> |
| | | <glyph glyph-name="f263" unicode="" horiz-adv-x="1280" |
| | | d="M640 629q-188 0 -321 133t-133 320q0 188 133 321t321 133t321 -133t133 -321q0 -187 -133 -320t-321 -133zM640 1306q-92 0 -157.5 -65.5t-65.5 -158.5q0 -92 65.5 -157.5t157.5 -65.5t157.5 65.5t65.5 157.5q0 93 -65.5 158.5t-157.5 65.5zM1163 574q13 -27 15 -49.5 |
| | | t-4.5 -40.5t-26.5 -38.5t-42.5 -37t-61.5 -41.5q-115 -73 -315 -94l73 -72l267 -267q30 -31 30 -74t-30 -73l-12 -13q-31 -30 -74 -30t-74 30q-67 68 -267 268l-267 -268q-31 -30 -74 -30t-73 30l-12 13q-31 30 -31 73t31 74l267 267l72 72q-203 21 -317 94 |
| | | q-39 25 -61.5 41.5t-42.5 37t-26.5 38.5t-4.5 40.5t15 49.5q10 20 28 35t42 22t56 -2t65 -35q5 -4 15 -11t43 -24.5t69 -30.5t92 -24t113 -11q91 0 174 25.5t120 50.5l38 25q33 26 65 35t56 2t42 -22t28 -35z" /> |
| | | <glyph glyph-name="_574" unicode="" |
| | | d="M927 956q0 -66 -46.5 -112.5t-112.5 -46.5t-112.5 46.5t-46.5 112.5t46.5 112.5t112.5 46.5t112.5 -46.5t46.5 -112.5zM1141 593q-10 20 -28 32t-47.5 9.5t-60.5 -27.5q-10 -8 -29 -20t-81 -32t-127 -20t-124 18t-86 36l-27 18q-31 25 -60.5 27.5t-47.5 -9.5t-28 -32 |
| | | q-22 -45 -2 -74.5t87 -73.5q83 -53 226 -67l-51 -52q-142 -142 -191 -190q-22 -22 -22 -52.5t22 -52.5l9 -9q22 -22 52.5 -22t52.5 22l191 191q114 -115 191 -191q22 -22 52.5 -22t52.5 22l9 9q22 22 22 52.5t-22 52.5l-191 190l-52 52q141 14 225 67q67 44 87 73.5t-2 74.5 |
| | | zM1092 956q0 134 -95 229t-229 95t-229 -95t-95 -229t95 -229t229 -95t229 95t95 229zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> |
| | | <glyph glyph-name="_575" unicode="" horiz-adv-x="1720" |
| | | d="M1565 1408q65 0 110 -45.5t45 -110.5v-519q0 -176 -68 -336t-182.5 -275t-274 -182.5t-334.5 -67.5q-176 0 -335.5 67.5t-274.5 182.5t-183 275t-68 336v519q0 64 46 110t110 46h1409zM861 344q47 0 82 33l404 388q37 35 37 85q0 49 -34.5 83.5t-83.5 34.5q-47 0 -82 -33 |
| | | l-323 -310l-323 310q-35 33 -81 33q-49 0 -83.5 -34.5t-34.5 -83.5q0 -51 36 -85l405 -388q33 -33 81 -33z" /> |
| | | <glyph glyph-name="_576" unicode="" horiz-adv-x="2304" |
| | | d="M1494 -103l-295 695q-25 -49 -158.5 -305.5t-198.5 -389.5q-1 -1 -27.5 -0.5t-26.5 1.5q-82 193 -255.5 587t-259.5 596q-21 50 -66.5 107.5t-103.5 100.5t-102 43q0 5 -0.5 24t-0.5 27h583v-50q-39 -2 -79.5 -16t-66.5 -43t-10 -64q26 -59 216.5 -499t235.5 -540 |
| | | q31 61 140 266.5t131 247.5q-19 39 -126 281t-136 295q-38 69 -201 71v50l513 -1v-47q-60 -2 -93.5 -25t-12.5 -69q33 -70 87 -189.5t86 -187.5q110 214 173 363q24 55 -10 79.5t-129 26.5q1 7 1 25v24q64 0 170.5 0.5t180 1t92.5 0.5v-49q-62 -2 -119 -33t-90 -81 |
| | | l-213 -442q13 -33 127.5 -290t121.5 -274l441 1017q-14 38 -49.5 62.5t-65 31.5t-55.5 8v50l460 -4l1 -2l-1 -44q-139 -4 -201 -145q-526 -1216 -559 -1291h-49z" /> |
| | | <glyph glyph-name="_577" unicode="" horiz-adv-x="1792" |
| | | d="M949 643q0 -26 -16.5 -45t-41.5 -19q-26 0 -45 16.5t-19 41.5q0 26 17 45t42 19t44 -16.5t19 -41.5zM964 585l350 581q-9 -8 -67.5 -62.5t-125.5 -116.5t-136.5 -127t-117 -110.5t-50.5 -51.5l-349 -580q7 7 67 62t126 116.5t136 127t117 111t50 50.5zM1611 640 |
| | | q0 -201 -104 -371q-3 2 -17 11t-26.5 16.5t-16.5 7.5q-13 0 -13 -13q0 -10 59 -44q-74 -112 -184.5 -190.5t-241.5 -110.5l-16 67q-1 10 -15 10q-5 0 -8 -5.5t-2 -9.5l16 -68q-72 -15 -146 -15q-199 0 -372 105q1 2 13 20.5t21.5 33.5t9.5 19q0 13 -13 13q-6 0 -17 -14.5 |
| | | t-22.5 -34.5t-13.5 -23q-113 75 -192 187.5t-110 244.5l69 15q10 3 10 15q0 5 -5.5 8t-10.5 2l-68 -15q-14 72 -14 139q0 206 109 379q2 -1 18.5 -12t30 -19t17.5 -8q13 0 13 12q0 6 -12.5 15.5t-32.5 21.5l-20 12q77 112 189 189t244 107l15 -67q2 -10 15 -10q5 0 8 5.5 |
| | | t2 10.5l-15 66q71 13 134 13q204 0 379 -109q-39 -56 -39 -65q0 -13 12 -13q11 0 48 64q111 -75 187.5 -186t107.5 -241l-56 -12q-10 -2 -10 -16q0 -5 5.5 -8t9.5 -2l57 13q14 -72 14 -140zM1696 640q0 163 -63.5 311t-170.5 255t-255 170.5t-311 63.5t-311 -63.5 |
| | | t-255 -170.5t-170.5 -255t-63.5 -311t63.5 -311t170.5 -255t255 -170.5t311 -63.5t311 63.5t255 170.5t170.5 255t63.5 311zM1792 640q0 -182 -71 -348t-191 -286t-286 -191t-348 -71t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71t348 -71t286 -191 |
| | | t191 -286t71 -348z" /> |
| | | <glyph glyph-name="_578" unicode="" horiz-adv-x="1792" |
| | | d="M893 1536q240 2 451 -120q232 -134 352 -372l-742 39q-160 9 -294 -74.5t-185 -229.5l-276 424q128 159 311 245.5t383 87.5zM146 1131l337 -663q72 -143 211 -217t293 -45l-230 -451q-212 33 -385 157.5t-272.5 316t-99.5 411.5q0 267 146 491zM1732 962 |
| | | q58 -150 59.5 -310.5t-48.5 -306t-153 -272t-246 -209.5q-230 -133 -498 -119l405 623q88 131 82.5 290.5t-106.5 277.5zM896 942q125 0 213.5 -88.5t88.5 -213.5t-88.5 -213.5t-213.5 -88.5t-213.5 88.5t-88.5 213.5t88.5 213.5t213.5 88.5z" /> |
| | | <glyph glyph-name="_579" unicode="" horiz-adv-x="1792" |
| | | d="M903 -256q-283 0 -504.5 150.5t-329.5 398.5q-58 131 -67 301t26 332.5t111 312t179 242.5l-11 -281q11 14 68 15.5t70 -15.5q42 81 160.5 138t234.5 59q-54 -45 -119.5 -148.5t-58.5 -163.5q25 -8 62.5 -13.5t63 -7.5t68 -4t50.5 -3q15 -5 9.5 -45.5t-30.5 -75.5 |
| | | q-5 -7 -16.5 -18.5t-56.5 -35.5t-101 -34l15 -189l-139 67q-18 -43 -7.5 -81.5t36 -66.5t65.5 -41.5t81 -6.5q51 9 98 34.5t83.5 45t73.5 17.5q61 -4 89.5 -33t19.5 -65q-1 -2 -2.5 -5.5t-8.5 -12.5t-18 -15.5t-31.5 -10.5t-46.5 -1q-60 -95 -144.5 -135.5t-209.5 -29.5 |
| | | q74 -61 162.5 -82.5t168.5 -6t154.5 52t128 87.5t80.5 104q43 91 39 192.5t-37.5 188.5t-78.5 125q87 -38 137 -79.5t77 -112.5q15 170 -57.5 343t-209.5 284q265 -77 412 -279.5t151 -517.5q2 -127 -40.5 -255t-123.5 -238t-189 -196t-247.5 -135.5t-288.5 -49.5z" /> |
| | | <glyph glyph-name="_580" unicode="" horiz-adv-x="1792" |
| | | d="M1493 1308q-165 110 -359 110q-155 0 -293 -73t-240 -200q-75 -93 -119.5 -218t-48.5 -266v-42q4 -141 48.5 -266t119.5 -218q102 -127 240 -200t293 -73q194 0 359 110q-121 -108 -274.5 -168t-322.5 -60q-29 0 -43 1q-175 8 -333 82t-272 193t-181 281t-67 339 |
| | | q0 182 71 348t191 286t286 191t348 71h3q168 -1 320.5 -60.5t273.5 -167.5zM1792 640q0 -192 -77 -362.5t-213 -296.5q-104 -63 -222 -63q-137 0 -255 84q154 56 253.5 233t99.5 405q0 227 -99 404t-253 234q119 83 254 83q119 0 226 -65q135 -125 210.5 -295t75.5 -361z |
| | | " /> |
| | | <glyph glyph-name="_581" unicode="" horiz-adv-x="1792" |
| | | d="M1792 599q0 -56 -7 -104h-1151q0 -146 109.5 -244.5t257.5 -98.5q99 0 185.5 46.5t136.5 130.5h423q-56 -159 -170.5 -281t-267.5 -188.5t-321 -66.5q-187 0 -356 83q-228 -116 -394 -116q-237 0 -237 263q0 115 45 275q17 60 109 229q199 360 475 606 |
| | | q-184 -79 -427 -354q63 274 283.5 449.5t501.5 175.5q30 0 45 -1q255 117 433 117q64 0 116 -13t94.5 -40.5t66.5 -76.5t24 -115q0 -116 -75 -286q101 -182 101 -390zM1722 1239q0 83 -53 132t-137 49q-108 0 -254 -70q121 -47 222.5 -131.5t170.5 -195.5q51 135 51 216z |
| | | M128 2q0 -86 48.5 -132.5t134.5 -46.5q115 0 266 83q-122 72 -213.5 183t-137.5 245q-98 -205 -98 -332zM632 715h728q-5 142 -113 237t-251 95q-144 0 -251.5 -95t-112.5 -237z" /> |
| | | <glyph glyph-name="_582" unicode="" horiz-adv-x="2048" |
| | | d="M1792 288v960q0 13 -9.5 22.5t-22.5 9.5h-1600q-13 0 -22.5 -9.5t-9.5 -22.5v-960q0 -13 9.5 -22.5t22.5 -9.5h1600q13 0 22.5 9.5t9.5 22.5zM1920 1248v-960q0 -66 -47 -113t-113 -47h-736v-128h352q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-832q-14 0 -23 9t-9 23 |
| | | v64q0 14 9 23t23 9h352v128h-736q-66 0 -113 47t-47 113v960q0 66 47 113t113 47h1600q66 0 113 -47t47 -113z" /> |
| | | <glyph glyph-name="_583" unicode="" horiz-adv-x="1792" |
| | | d="M138 1408h197q-70 -64 -126 -149q-36 -56 -59 -115t-30 -125.5t-8.5 -120t10.5 -132t21 -126t28 -136.5q4 -19 6 -28q51 -238 81 -329q57 -171 152 -275h-272q-48 0 -82 34t-34 82v1304q0 48 34 82t82 34zM1346 1408h308q48 0 82 -34t34 -82v-1304q0 -48 -34 -82t-82 -34 |
| | | h-178q212 210 196 565l-469 -101q-2 -45 -12 -82t-31 -72t-59.5 -59.5t-93.5 -36.5q-123 -26 -199 40q-32 27 -53 61t-51.5 129t-64.5 258q-35 163 -45.5 263t-5.5 139t23 77q20 41 62.5 73t102.5 45q45 12 83.5 6.5t67 -17t54 -35t43 -48t34.5 -56.5l468 100 |
| | | q-68 175 -180 287z" /> |
| | | <glyph glyph-name="_584" unicode="" |
| | | d="M1401 -11l-6 -6q-113 -113 -259 -175q-154 -64 -317 -64q-165 0 -317 64q-148 63 -259 175q-113 112 -175 258q-42 103 -54 189q-4 28 48 36q51 8 56 -20q1 -1 1 -4q18 -90 46 -159q50 -124 152 -226q98 -98 226 -152q132 -56 276 -56q143 0 276 56q128 55 225 152l6 6 |
| | | q10 10 25 6q12 -3 33 -22q36 -37 17 -58zM929 604l-66 -66l63 -63q21 -21 -7 -49q-17 -17 -32 -17q-10 0 -19 10l-62 61l-66 -66q-5 -5 -15 -5q-15 0 -31 16l-2 2q-18 15 -18 29q0 7 8 17l66 65l-66 66q-16 16 14 45q18 18 31 18q6 0 13 -5l65 -66l65 65q18 17 48 -13 |
| | | q27 -27 11 -44zM1400 547q0 -118 -46 -228q-45 -105 -126 -186q-80 -80 -187 -126t-228 -46t-228 46t-187 126q-82 82 -125 186q-15 33 -15 40h-1q-9 27 43 44q50 16 60 -12q37 -99 97 -167h1v339v2q3 136 102 232q105 103 253 103q147 0 251 -103t104 -249 |
| | | q0 -147 -104.5 -251t-250.5 -104q-58 0 -112 16q-28 11 -13 61q16 51 44 43l14 -3q14 -3 33 -6t30 -3q104 0 176 71.5t72 174.5q0 101 -72 171q-71 71 -175 71q-107 0 -178 -80q-64 -72 -64 -160v-413q110 -67 242 -67q96 0 185 36.5t156 103.5t103.5 155t36.5 183 |
| | | q0 198 -141 339q-140 140 -339 140q-200 0 -340 -140q-53 -53 -77 -87l-2 -2q-8 -11 -13 -15.5t-21.5 -9.5t-38.5 3q-21 5 -36.5 16.5t-15.5 26.5v680q0 15 10.5 26.5t27.5 11.5h877q30 0 30 -55t-30 -55h-811v-483h1q40 42 102 84t108 61q109 46 231 46q121 0 228 -46 |
| | | t187 -126q81 -81 126 -186q46 -112 46 -229zM1369 1128q9 -8 9 -18t-5.5 -18t-16.5 -21q-26 -26 -39 -26q-9 0 -16 7q-106 91 -207 133q-128 56 -276 56q-133 0 -262 -49q-27 -10 -45 37q-9 25 -8 38q3 16 16 20q130 57 299 57q164 0 316 -64q137 -58 235 -152z" /> |
| | | <glyph glyph-name="_585" unicode="" horiz-adv-x="1792" |
| | | d="M1551 60q15 6 26 3t11 -17.5t-15 -33.5q-13 -16 -44 -43.5t-95.5 -68t-141 -74t-188 -58t-229.5 -24.5q-119 0 -238 31t-209 76.5t-172.5 104t-132.5 105t-84 87.5q-8 9 -10 16.5t1 12t8 7t11.5 2t11.5 -4.5q192 -117 300 -166q389 -176 799 -90q190 40 391 135z |
| | | M1758 175q11 -16 2.5 -69.5t-28.5 -102.5q-34 -83 -85 -124q-17 -14 -26 -9t0 24q21 45 44.5 121.5t6.5 98.5q-5 7 -15.5 11.5t-27 6t-29.5 2.5t-35 0t-31.5 -2t-31 -3t-22.5 -2q-6 -1 -13 -1.5t-11 -1t-8.5 -1t-7 -0.5h-5.5h-4.5t-3 0.5t-2 1.5l-1.5 3q-6 16 47 40t103 30 |
| | | q46 7 108 1t76 -24zM1364 618q0 -31 13.5 -64t32 -58t37.5 -46t33 -32l13 -11l-227 -224q-40 37 -79 75.5t-58 58.5l-19 20q-11 11 -25 33q-38 -59 -97.5 -102.5t-127.5 -63.5t-140 -23t-137.5 21t-117.5 65.5t-83 113t-31 162.5q0 84 28 154t72 116.5t106.5 83t122.5 57 |
| | | t130 34.5t119.5 18.5t99.5 6.5v127q0 65 -21 97q-34 53 -121 53q-6 0 -16.5 -1t-40.5 -12t-56 -29.5t-56 -59.5t-48 -96l-294 27q0 60 22 119t67 113t108 95t151.5 65.5t190.5 24.5q100 0 181 -25t129.5 -61.5t81 -83t45 -86t12.5 -73.5v-589zM692 597q0 -86 70 -133 |
| | | q66 -44 139 -22q84 25 114 123q14 45 14 101v162q-59 -2 -111 -12t-106.5 -33.5t-87 -71t-32.5 -114.5z" /> |
| | | <glyph glyph-name="_586" unicode="" horiz-adv-x="1792" |
| | | d="M1536 1280q52 0 90 -38t38 -90v-1280q0 -52 -38 -90t-90 -38h-1408q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h128v96q0 66 47 113t113 47h64q66 0 113 -47t47 -113v-96h384v96q0 66 47 113t113 47h64q66 0 113 -47t47 -113v-96h128zM1152 1376v-288q0 -14 9 -23t23 -9 |
| | | h64q14 0 23 9t9 23v288q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23zM384 1376v-288q0 -14 9 -23t23 -9h64q14 0 23 9t9 23v288q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23zM1536 -128v1024h-1408v-1024h1408zM896 448h224q14 0 23 -9t9 -23v-64q0 -14 -9 -23t-23 -9h-224 |
| | | v-224q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v224h-224q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h224v224q0 14 9 23t23 9h64q14 0 23 -9t9 -23v-224z" /> |
| | | <glyph glyph-name="_587" unicode="" horiz-adv-x="1792" |
| | | d="M1152 416v-64q0 -14 -9 -23t-23 -9h-576q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h576q14 0 23 -9t9 -23zM128 -128h1408v1024h-1408v-1024zM512 1088v288q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-288q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1280 1088v288q0 14 -9 23 |
| | | t-23 9h-64q-14 0 -23 -9t-9 -23v-288q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1664 1152v-1280q0 -52 -38 -90t-90 -38h-1408q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h128v96q0 66 47 113t113 47h64q66 0 113 -47t47 -113v-96h384v96q0 66 47 113t113 47h64q66 0 113 -47 |
| | | t47 -113v-96h128q52 0 90 -38t38 -90z" /> |
| | | <glyph glyph-name="_588" unicode="" horiz-adv-x="1792" |
| | | d="M1111 151l-46 -46q-9 -9 -22 -9t-23 9l-188 189l-188 -189q-10 -9 -23 -9t-22 9l-46 46q-9 9 -9 22t9 23l189 188l-189 188q-9 10 -9 23t9 22l46 46q9 9 22 9t23 -9l188 -188l188 188q10 9 23 9t22 -9l46 -46q9 -9 9 -22t-9 -23l-188 -188l188 -188q9 -10 9 -23t-9 -22z |
| | | M128 -128h1408v1024h-1408v-1024zM512 1088v288q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-288q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1280 1088v288q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-288q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1664 1152v-1280 |
| | | q0 -52 -38 -90t-90 -38h-1408q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h128v96q0 66 47 113t113 47h64q66 0 113 -47t47 -113v-96h384v96q0 66 47 113t113 47h64q66 0 113 -47t47 -113v-96h128q52 0 90 -38t38 -90z" /> |
| | | <glyph glyph-name="_589" unicode="" horiz-adv-x="1792" |
| | | d="M1303 572l-512 -512q-10 -9 -23 -9t-23 9l-288 288q-9 10 -9 23t9 22l46 46q9 9 22 9t23 -9l220 -220l444 444q10 9 23 9t22 -9l46 -46q9 -9 9 -22t-9 -23zM128 -128h1408v1024h-1408v-1024zM512 1088v288q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-288q0 -14 9 -23 |
| | | t23 -9h64q14 0 23 9t9 23zM1280 1088v288q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-288q0 -14 9 -23t23 -9h64q14 0 23 9t9 23zM1664 1152v-1280q0 -52 -38 -90t-90 -38h-1408q-52 0 -90 38t-38 90v1280q0 52 38 90t90 38h128v96q0 66 47 113t113 47h64q66 0 113 -47 |
| | | t47 -113v-96h384v96q0 66 47 113t113 47h64q66 0 113 -47t47 -113v-96h128q52 0 90 -38t38 -90z" /> |
| | | <glyph glyph-name="_590" unicode="" horiz-adv-x="1792" |
| | | d="M448 1536q26 0 45 -19t19 -45v-891l536 429q17 14 40 14q26 0 45 -19t19 -45v-379l536 429q17 14 40 14q26 0 45 -19t19 -45v-1152q0 -26 -19 -45t-45 -19h-1664q-26 0 -45 19t-19 45v1664q0 26 19 45t45 19h384z" /> |
| | | <glyph glyph-name="_591" unicode="" horiz-adv-x="1024" |
| | | d="M512 448q66 0 128 15v-655q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v655q62 -15 128 -15zM512 1536q212 0 362 -150t150 -362t-150 -362t-362 -150t-362 150t-150 362t150 362t362 150zM512 1312q14 0 23 9t9 23t-9 23t-23 9q-146 0 -249 -103t-103 -249 |
| | | q0 -14 9 -23t23 -9t23 9t9 23q0 119 84.5 203.5t203.5 84.5z" /> |
| | | <glyph glyph-name="_592" unicode="" horiz-adv-x="1792" |
| | | d="M1745 1239q10 -10 10 -23t-10 -23l-141 -141q-28 -28 -68 -28h-1344q-26 0 -45 19t-19 45v256q0 26 19 45t45 19h576v64q0 26 19 45t45 19h128q26 0 45 -19t19 -45v-64h512q40 0 68 -28zM768 320h256v-512q0 -26 -19 -45t-45 -19h-128q-26 0 -45 19t-19 45v512zM1600 768 |
| | | q26 0 45 -19t19 -45v-256q0 -26 -19 -45t-45 -19h-1344q-40 0 -68 28l-141 141q-10 10 -10 23t10 23l141 141q28 28 68 28h512v192h256v-192h576z" /> |
| | | <glyph glyph-name="_593" unicode="" horiz-adv-x="2048" |
| | | d="M2020 1525q28 -20 28 -53v-1408q0 -20 -11 -36t-29 -23l-640 -256q-24 -11 -48 0l-616 246l-616 -246q-10 -5 -24 -5q-19 0 -36 11q-28 20 -28 53v1408q0 20 11 36t29 23l640 256q24 11 48 0l616 -246l616 246q32 13 60 -6zM736 1390v-1270l576 -230v1270zM128 1173 |
| | | v-1270l544 217v1270zM1920 107v1270l-544 -217v-1270z" /> |
| | | <glyph glyph-name="_594" unicode="" horiz-adv-x="1792" |
| | | d="M512 1536q13 0 22.5 -9.5t9.5 -22.5v-1472q0 -20 -17 -28l-480 -256q-7 -4 -15 -4q-13 0 -22.5 9.5t-9.5 22.5v1472q0 20 17 28l480 256q7 4 15 4zM1760 1536q13 0 22.5 -9.5t9.5 -22.5v-1472q0 -20 -17 -28l-480 -256q-7 -4 -15 -4q-13 0 -22.5 9.5t-9.5 22.5v1472 |
| | | q0 20 17 28l480 256q7 4 15 4zM640 1536q8 0 14 -3l512 -256q18 -10 18 -29v-1472q0 -13 -9.5 -22.5t-22.5 -9.5q-8 0 -14 3l-512 256q-18 10 -18 29v1472q0 13 9.5 22.5t22.5 9.5z" /> |
| | | <glyph glyph-name="_595" unicode="" horiz-adv-x="1792" |
| | | d="M640 640q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1024 640q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1408 640q0 53 -37.5 90.5t-90.5 37.5 |
| | | t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5zM1792 640q0 -174 -120 -321.5t-326 -233t-450 -85.5q-110 0 -211 18q-173 -173 -435 -229q-52 -10 -86 -13q-12 -1 -22 6t-13 18q-4 15 20 37q5 5 23.5 21.5t25.5 23.5t23.5 25.5t24 31.5t20.5 37 |
| | | t20 48t14.5 57.5t12.5 72.5q-146 90 -229.5 216.5t-83.5 269.5q0 174 120 321.5t326 233t450 85.5t450 -85.5t326 -233t120 -321.5z" /> |
| | | <glyph glyph-name="_596" unicode="" horiz-adv-x="1792" |
| | | d="M640 640q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1024 640q0 -53 -37.5 -90.5t-90.5 -37.5t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM1408 640q0 -53 -37.5 -90.5t-90.5 -37.5 |
| | | t-90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5t90.5 -37.5t37.5 -90.5zM896 1152q-204 0 -381.5 -69.5t-282 -187.5t-104.5 -255q0 -112 71.5 -213.5t201.5 -175.5l87 -50l-27 -96q-24 -91 -70 -172q152 63 275 171l43 38l57 -6q69 -8 130 -8q204 0 381.5 69.5t282 187.5 |
| | | t104.5 255t-104.5 255t-282 187.5t-381.5 69.5zM1792 640q0 -174 -120 -321.5t-326 -233t-450 -85.5q-70 0 -145 8q-198 -175 -460 -242q-49 -14 -114 -22h-5q-15 0 -27 10.5t-16 27.5v1q-3 4 -0.5 12t2 10t4.5 9.5l6 9t7 8.5t8 9q7 8 31 34.5t34.5 38t31 39.5t32.5 51 |
| | | t27 59t26 76q-157 89 -247.5 220t-90.5 281q0 130 71 248.5t191 204.5t286 136.5t348 50.5t348 -50.5t286 -136.5t191 -204.5t71 -248.5z" /> |
| | | <glyph glyph-name="_597" unicode="" horiz-adv-x="1024" |
| | | d="M512 345l512 295v-591l-512 -296v592zM0 640v-591l512 296zM512 1527v-591l-512 -296v591zM512 936l512 295v-591z" /> |
| | | <glyph glyph-name="_598" unicode="" horiz-adv-x="1792" |
| | | d="M1709 1018q-10 -236 -332 -651q-333 -431 -562 -431q-142 0 -240 263q-44 160 -132 482q-72 262 -157 262q-18 0 -127 -76l-77 98q24 21 108 96.5t130 115.5q156 138 241 146q95 9 153 -55.5t81 -203.5q44 -287 66 -373q55 -249 120 -249q51 0 154 161q101 161 109 246 |
| | | q13 139 -109 139q-57 0 -121 -26q120 393 459 382q251 -8 236 -326z" /> |
| | | <glyph glyph-name="f27e" unicode="" |
| | | d="M0 1408h1536v-1536h-1536v1536zM1085 293l-221 631l221 297h-634l221 -297l-221 -631l317 -304z" /> |
| | | <glyph glyph-name="uniF280" unicode="" |
| | | d="M0 1408h1536v-1536h-1536v1536zM908 1088l-12 -33l75 -83l-31 -114l25 -25l107 57l107 -57l25 25l-31 114l75 83l-12 33h-95l-53 96h-32l-53 -96h-95zM641 925q32 0 44.5 -16t11.5 -63l174 21q0 55 -17.5 92.5t-50.5 56t-69 25.5t-85 7q-133 0 -199 -57.5t-66 -182.5v-72 |
| | | h-96v-128h76q20 0 20 -8v-382q0 -14 -5 -20t-18 -7l-73 -7v-88h448v86l-149 14q-6 1 -8.5 1.5t-3.5 2.5t-0.5 4t1 7t0.5 10v387h191l38 128h-231q-6 0 -2 6t4 9v80q0 27 1.5 40.5t7.5 28t19.5 20t36.5 5.5zM1248 96v86l-54 9q-7 1 -9.5 2.5t-2.5 3t1 7.5t1 12v520h-275 |
| | | l-23 -101l83 -22q23 -7 23 -27v-370q0 -14 -6 -18.5t-20 -6.5l-70 -9v-86h352z" /> |
| | | <glyph glyph-name="uniF281" unicode="" horiz-adv-x="1792" |
| | | d="M1792 690q0 -58 -29.5 -105.5t-79.5 -72.5q12 -46 12 -96q0 -155 -106.5 -287t-290.5 -208.5t-400 -76.5t-399.5 76.5t-290 208.5t-106.5 287q0 47 11 94q-51 25 -82 73.5t-31 106.5q0 82 58 140.5t141 58.5q85 0 145 -63q218 152 515 162l116 521q3 13 15 21t26 5 |
| | | l369 -81q18 37 54 59.5t79 22.5q62 0 106 -43.5t44 -105.5t-44 -106t-106 -44t-105.5 43.5t-43.5 105.5l-334 74l-104 -472q300 -9 519 -160q58 61 143 61q83 0 141 -58.5t58 -140.5zM418 491q0 -62 43.5 -106t105.5 -44t106 44t44 106t-44 105.5t-106 43.5q-61 0 -105 -44 |
| | | t-44 -105zM1228 136q11 11 11 26t-11 26q-10 10 -25 10t-26 -10q-41 -42 -121 -62t-160 -20t-160 20t-121 62q-11 10 -26 10t-25 -10q-11 -10 -11 -25.5t11 -26.5q43 -43 118.5 -68t122.5 -29.5t91 -4.5t91 4.5t122.5 29.5t118.5 68zM1225 341q62 0 105.5 44t43.5 106 |
| | | q0 61 -44 105t-105 44q-62 0 -106 -43.5t-44 -105.5t44 -106t106 -44z" /> |
| | | <glyph glyph-name="_602" unicode="" horiz-adv-x="1792" |
| | | d="M69 741h1q16 126 58.5 241.5t115 217t167.5 176t223.5 117.5t276.5 43q231 0 414 -105.5t294 -303.5q104 -187 104 -442v-188h-1125q1 -111 53.5 -192.5t136.5 -122.5t189.5 -57t213 -3t208 46.5t173.5 84.5v-377q-92 -55 -229.5 -92t-312.5 -38t-316 53 |
| | | q-189 73 -311.5 249t-124.5 372q-3 242 111 412t325 268q-48 -60 -78 -125.5t-46 -159.5h635q8 77 -8 140t-47 101.5t-70.5 66.5t-80.5 41t-75 20.5t-56 8.5l-22 1q-135 -5 -259.5 -44.5t-223.5 -104.5t-176 -140.5t-138 -163.5z" /> |
| | | <glyph glyph-name="_603" unicode="" horiz-adv-x="2304" |
| | | d="M0 32v608h2304v-608q0 -66 -47 -113t-113 -47h-1984q-66 0 -113 47t-47 113zM640 256v-128h384v128h-384zM256 256v-128h256v128h-256zM2144 1408q66 0 113 -47t47 -113v-224h-2304v224q0 66 47 113t113 47h1984z" /> |
| | | <glyph glyph-name="_604" unicode="" horiz-adv-x="1792" |
| | | d="M1584 246l-218 111q-74 -120 -196.5 -189t-263.5 -69q-147 0 -271 72t-196 196t-72 270q0 110 42.5 209.5t115 172t172 115t209.5 42.5q131 0 247.5 -60.5t192.5 -168.5l215 125q-110 169 -286.5 265t-378.5 96q-161 0 -308 -63t-253 -169t-169 -253t-63 -308t63 -308 |
| | | t169 -253t253 -169t308 -63q213 0 397.5 107t290.5 292zM1030 643l693 -352q-116 -253 -334.5 -400t-492.5 -147q-182 0 -348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71q260 0 470.5 -133.5t335.5 -366.5zM1543 640h-39v-160h-96v352h136q32 0 54.5 -20 |
| | | t28.5 -48t1 -56t-27.5 -48t-57.5 -20z" /> |
| | | <glyph glyph-name="uniF285" unicode="" horiz-adv-x="1792" |
| | | d="M1427 827l-614 386l92 151h855zM405 562l-184 116v858l1183 -743zM1424 697l147 -95v-858l-532 335zM1387 718l-500 -802h-855l356 571z" /> |
| | | <glyph glyph-name="uniF286" unicode="" horiz-adv-x="1792" |
| | | d="M640 528v224q0 16 -16 16h-96q-16 0 -16 -16v-224q0 -16 16 -16h96q16 0 16 16zM1152 528v224q0 16 -16 16h-96q-16 0 -16 -16v-224q0 -16 16 -16h96q16 0 16 16zM1664 496v-752h-640v320q0 80 -56 136t-136 56t-136 -56t-56 -136v-320h-640v752q0 16 16 16h96 |
| | | q16 0 16 -16v-112h128v624q0 16 16 16h96q16 0 16 -16v-112h128v112q0 16 16 16h96q16 0 16 -16v-112h128v112q0 6 2.5 9.5t8.5 5t9.5 2t11.5 0t9 -0.5v391q-32 15 -32 50q0 23 16.5 39t38.5 16t38.5 -16t16.5 -39q0 -35 -32 -50v-17q45 10 83 10q21 0 59.5 -7.5t54.5 -7.5 |
| | | q17 0 47 7.5t37 7.5q16 0 16 -16v-210q0 -15 -35 -21.5t-62 -6.5q-18 0 -54.5 7.5t-55.5 7.5q-40 0 -90 -12v-133q1 0 9 0.5t11.5 0t9.5 -2t8.5 -5t2.5 -9.5v-112h128v112q0 16 16 16h96q16 0 16 -16v-112h128v112q0 16 16 16h96q16 0 16 -16v-624h128v112q0 16 16 16h96 |
| | | q16 0 16 -16z" /> |
| | | <glyph glyph-name="_607" unicode="" horiz-adv-x="2304" |
| | | d="M2288 731q16 -8 16 -27t-16 -27l-320 -192q-8 -5 -16 -5q-9 0 -16 4q-16 10 -16 28v128h-858q37 -58 83 -165q16 -37 24.5 -55t24 -49t27 -47t27 -34t31.5 -26t33 -8h96v96q0 14 9 23t23 9h320q14 0 23 -9t9 -23v-320q0 -14 -9 -23t-23 -9h-320q-14 0 -23 9t-9 23v96h-96 |
| | | q-32 0 -61 10t-51 23.5t-45 40.5t-37 46t-33.5 57t-28.5 57.5t-28 60.5q-23 53 -37 81.5t-36 65t-44.5 53.5t-46.5 17h-360q-22 -84 -91 -138t-157 -54q-106 0 -181 75t-75 181t75 181t181 75q88 0 157 -54t91 -138h104q24 0 46.5 17t44.5 53.5t36 65t37 81.5q19 41 28 60.5 |
| | | t28.5 57.5t33.5 57t37 46t45 40.5t51 23.5t61 10h107q21 57 70 92.5t111 35.5q80 0 136 -56t56 -136t-56 -136t-136 -56q-62 0 -111 35.5t-70 92.5h-107q-17 0 -33 -8t-31.5 -26t-27 -34t-27 -47t-24 -49t-24.5 -55q-46 -107 -83 -165h1114v128q0 18 16 28t32 -1z" /> |
| | | <glyph glyph-name="_608" unicode="" horiz-adv-x="1792" |
| | | d="M1150 774q0 -56 -39.5 -95t-95.5 -39h-253v269h253q56 0 95.5 -39.5t39.5 -95.5zM1329 774q0 130 -91.5 222t-222.5 92h-433v-896h180v269h253q130 0 222 91.5t92 221.5zM1792 640q0 -182 -71 -348t-191 -286t-286 -191t-348 -71t-348 71t-286 191t-191 286t-71 348 |
| | | t71 348t191 286t286 191t348 71t348 -71t286 -191t191 -286t71 -348z" /> |
| | | <glyph glyph-name="_609" unicode="" horiz-adv-x="2304" |
| | | d="M1645 438q0 59 -34 106.5t-87 68.5q-7 -45 -23 -92q-7 -24 -27.5 -38t-44.5 -14q-12 0 -24 3q-31 10 -45 38.5t-4 58.5q23 71 23 143q0 123 -61 227.5t-166 165.5t-228 61q-134 0 -247 -73t-167 -194q108 -28 188 -106q22 -23 22 -55t-22 -54t-54 -22t-55 22 |
| | | q-75 75 -180 75q-106 0 -181 -74.5t-75 -180.5t75 -180.5t181 -74.5h1046q79 0 134.5 55.5t55.5 133.5zM1798 438q0 -142 -100.5 -242t-242.5 -100h-1046q-169 0 -289 119.5t-120 288.5q0 153 100 267t249 136q62 184 221 298t354 114q235 0 408.5 -158.5t196.5 -389.5 |
| | | q116 -25 192.5 -118.5t76.5 -214.5zM2048 438q0 -175 -97 -319q-23 -33 -64 -33q-24 0 -43 13q-26 17 -32 48.5t12 57.5q71 104 71 233t-71 233q-18 26 -12 57t32 49t57.5 11.5t49.5 -32.5q97 -142 97 -318zM2304 438q0 -244 -134 -443q-23 -34 -64 -34q-23 0 -42 13 |
| | | q-26 18 -32.5 49t11.5 57q108 164 108 358q0 195 -108 357q-18 26 -11.5 57.5t32.5 48.5q26 18 57 12t49 -33q134 -198 134 -442z" /> |
| | | <glyph glyph-name="_610" unicode="" |
| | | d="M1500 -13q0 -89 -63 -152.5t-153 -63.5t-153.5 63.5t-63.5 152.5q0 90 63.5 153.5t153.5 63.5t153 -63.5t63 -153.5zM1267 268q-115 -15 -192.5 -102.5t-77.5 -205.5q0 -74 33 -138q-146 -78 -379 -78q-109 0 -201 21t-153.5 54.5t-110.5 76.5t-76 85t-44.5 83 |
| | | t-23.5 66.5t-6 39.5q0 19 4.5 42.5t18.5 56t36.5 58t64 43.5t94.5 18t94 -17.5t63 -41t35.5 -53t17.5 -49t4 -33.5q0 -34 -23 -81q28 -27 82 -42t93 -17l40 -1q115 0 190 51t75 133q0 26 -9 48.5t-31.5 44.5t-49.5 41t-74 44t-93.5 47.5t-119.5 56.5q-28 13 -43 20 |
| | | q-116 55 -187 100t-122.5 102t-72 125.5t-20.5 162.5q0 78 20.5 150t66 137.5t112.5 114t166.5 77t221.5 28.5q120 0 220 -26t164.5 -67t109.5 -94t64 -105.5t19 -103.5q0 -46 -15 -82.5t-36.5 -58t-48.5 -36t-49 -19.5t-39 -5h-8h-32t-39 5t-44 14t-41 28t-37 46t-24 70.5 |
| | | t-10 97.5q-15 16 -59 25.5t-81 10.5l-37 1q-68 0 -117.5 -31t-70.5 -70t-21 -76q0 -24 5 -43t24 -46t53 -51t97 -53.5t150 -58.5q76 -25 138.5 -53.5t109 -55.5t83 -59t60.5 -59.5t41 -62.5t26.5 -62t14.5 -63.5t6 -62t1 -62.5z" /> |
| | | <glyph glyph-name="_611" unicode="" |
| | | d="M704 352v576q0 14 -9 23t-23 9h-256q-14 0 -23 -9t-9 -23v-576q0 -14 9 -23t23 -9h256q14 0 23 9t9 23zM1152 352v576q0 14 -9 23t-23 9h-256q-14 0 -23 -9t-9 -23v-576q0 -14 9 -23t23 -9h256q14 0 23 9t9 23zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103 |
| | | t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> |
| | | <glyph glyph-name="_612" unicode="" |
| | | d="M768 1408q209 0 385.5 -103t279.5 -279.5t103 -385.5t-103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103zM768 96q148 0 273 73t198 198t73 273t-73 273t-198 198t-273 73t-273 -73t-198 -198t-73 -273 |
| | | t73 -273t198 -198t273 -73zM864 320q-14 0 -23 9t-9 23v576q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-576q0 -14 -9 -23t-23 -9h-192zM480 320q-14 0 -23 9t-9 23v576q0 14 9 23t23 9h192q14 0 23 -9t9 -23v-576q0 -14 -9 -23t-23 -9h-192z" /> |
| | | <glyph glyph-name="_613" unicode="" |
| | | d="M1088 352v576q0 14 -9 23t-23 9h-576q-14 0 -23 -9t-9 -23v-576q0 -14 9 -23t23 -9h576q14 0 23 9t9 23zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5 |
| | | t103 -385.5z" /> |
| | | <glyph glyph-name="_614" unicode="" |
| | | d="M768 1408q209 0 385.5 -103t279.5 -279.5t103 -385.5t-103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103zM768 96q148 0 273 73t198 198t73 273t-73 273t-198 198t-273 73t-273 -73t-198 -198t-73 -273 |
| | | t73 -273t198 -198t273 -73zM480 320q-14 0 -23 9t-9 23v576q0 14 9 23t23 9h576q14 0 23 -9t9 -23v-576q0 -14 -9 -23t-23 -9h-576z" /> |
| | | <glyph glyph-name="_615" unicode="" horiz-adv-x="1792" |
| | | d="M1757 128l35 -313q3 -28 -16 -50q-19 -21 -48 -21h-1664q-29 0 -48 21q-19 22 -16 50l35 313h1722zM1664 967l86 -775h-1708l86 775q3 24 21 40.5t43 16.5h256v-128q0 -53 37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5v128h384v-128q0 -53 37.5 -90.5t90.5 -37.5 |
| | | t90.5 37.5t37.5 90.5v128h256q25 0 43 -16.5t21 -40.5zM1280 1152v-256q0 -26 -19 -45t-45 -19t-45 19t-19 45v256q0 106 -75 181t-181 75t-181 -75t-75 -181v-256q0 -26 -19 -45t-45 -19t-45 19t-19 45v256q0 159 112.5 271.5t271.5 112.5t271.5 -112.5t112.5 -271.5z" /> |
| | | <glyph glyph-name="_616" unicode="" horiz-adv-x="2048" |
| | | d="M1920 768q53 0 90.5 -37.5t37.5 -90.5t-37.5 -90.5t-90.5 -37.5h-15l-115 -662q-8 -46 -44 -76t-82 -30h-1280q-46 0 -82 30t-44 76l-115 662h-15q-53 0 -90.5 37.5t-37.5 90.5t37.5 90.5t90.5 37.5h1792zM485 -32q26 2 43.5 22.5t15.5 46.5l-32 416q-2 26 -22.5 43.5 |
| | | t-46.5 15.5t-43.5 -22.5t-15.5 -46.5l32 -416q2 -25 20.5 -42t43.5 -17h5zM896 32v416q0 26 -19 45t-45 19t-45 -19t-19 -45v-416q0 -26 19 -45t45 -19t45 19t19 45zM1280 32v416q0 26 -19 45t-45 19t-45 -19t-19 -45v-416q0 -26 19 -45t45 -19t45 19t19 45zM1632 27l32 416 |
| | | q2 26 -15.5 46.5t-43.5 22.5t-46.5 -15.5t-22.5 -43.5l-32 -416q-2 -26 15.5 -46.5t43.5 -22.5h5q25 0 43.5 17t20.5 42zM476 1244l-93 -412h-132l101 441q19 88 89 143.5t160 55.5h167q0 26 19 45t45 19h384q26 0 45 -19t19 -45h167q90 0 160 -55.5t89 -143.5l101 -441 |
| | | h-132l-93 412q-11 44 -45.5 72t-79.5 28h-167q0 -26 -19 -45t-45 -19h-384q-26 0 -45 19t-19 45h-167q-45 0 -79.5 -28t-45.5 -72z" /> |
| | | <glyph glyph-name="_617" unicode="" horiz-adv-x="1792" |
| | | d="M991 512l64 256h-254l-64 -256h254zM1759 1016l-56 -224q-7 -24 -31 -24h-327l-64 -256h311q15 0 25 -12q10 -14 6 -28l-56 -224q-5 -24 -31 -24h-327l-81 -328q-7 -24 -31 -24h-224q-16 0 -26 12q-9 12 -6 28l78 312h-254l-81 -328q-7 -24 -31 -24h-225q-15 0 -25 12 |
| | | q-9 12 -6 28l78 312h-311q-15 0 -25 12q-9 12 -6 28l56 224q7 24 31 24h327l64 256h-311q-15 0 -25 12q-10 14 -6 28l56 224q5 24 31 24h327l81 328q7 24 32 24h224q15 0 25 -12q9 -12 6 -28l-78 -312h254l81 328q7 24 32 24h224q15 0 25 -12q9 -12 6 -28l-78 -312h311 |
| | | q15 0 25 -12q9 -12 6 -28z" /> |
| | | <glyph glyph-name="_618" unicode="" |
| | | d="M841 483l148 -148l-149 -149zM840 1094l149 -149l-148 -148zM710 -130l464 464l-306 306l306 306l-464 464v-611l-255 255l-93 -93l320 -321l-320 -321l93 -93l255 255v-611zM1429 640q0 -209 -32 -365.5t-87.5 -257t-140.5 -162.5t-181.5 -86.5t-219.5 -24.5 |
| | | t-219.5 24.5t-181.5 86.5t-140.5 162.5t-87.5 257t-32 365.5t32 365.5t87.5 257t140.5 162.5t181.5 86.5t219.5 24.5t219.5 -24.5t181.5 -86.5t140.5 -162.5t87.5 -257t32 -365.5z" /> |
| | | <glyph glyph-name="_619" unicode="" horiz-adv-x="1024" |
| | | d="M596 113l173 172l-173 172v-344zM596 823l173 172l-173 172v-344zM628 640l356 -356l-539 -540v711l-297 -296l-108 108l372 373l-372 373l108 108l297 -296v711l539 -540z" /> |
| | | <glyph glyph-name="_620" unicode="" |
| | | d="M1280 256q0 52 -38 90t-90 38t-90 -38t-38 -90t38 -90t90 -38t90 38t38 90zM512 1024q0 52 -38 90t-90 38t-90 -38t-38 -90t38 -90t90 -38t90 38t38 90zM1536 256q0 -159 -112.5 -271.5t-271.5 -112.5t-271.5 112.5t-112.5 271.5t112.5 271.5t271.5 112.5t271.5 -112.5 |
| | | t112.5 -271.5zM1440 1344q0 -20 -13 -38l-1056 -1408q-19 -26 -51 -26h-160q-26 0 -45 19t-19 45q0 20 13 38l1056 1408q19 26 51 26h160q26 0 45 -19t19 -45zM768 1024q0 -159 -112.5 -271.5t-271.5 -112.5t-271.5 112.5t-112.5 271.5t112.5 271.5t271.5 112.5 |
| | | t271.5 -112.5t112.5 -271.5z" /> |
| | | <glyph glyph-name="_621" unicode="" horiz-adv-x="1792" |
| | | d="M104 830l792 -1015l-868 630q-18 13 -25 34.5t0 42.5l101 308v0zM566 830h660l-330 -1015v0zM368 1442l198 -612h-462l198 612q8 23 33 23t33 -23zM1688 830l101 -308q7 -21 0 -42.5t-25 -34.5l-868 -630l792 1015v0zM1688 830h-462l198 612q8 23 33 23t33 -23z" /> |
| | | <glyph glyph-name="_622" unicode="" horiz-adv-x="1792" |
| | | d="M384 704h160v224h-160v-224zM1221 372v92q-104 -36 -243 -38q-135 -1 -259.5 46.5t-220.5 122.5l1 -96q88 -80 212 -128.5t272 -47.5q129 0 238 49zM640 704h640v224h-640v-224zM1792 736q0 -187 -99 -352q89 -102 89 -229q0 -157 -129.5 -268t-313.5 -111 |
| | | q-122 0 -225 52.5t-161 140.5q-19 -1 -57 -1t-57 1q-58 -88 -161 -140.5t-225 -52.5q-184 0 -313.5 111t-129.5 268q0 127 89 229q-99 165 -99 352q0 209 120 385.5t326.5 279.5t449.5 103t449.5 -103t326.5 -279.5t120 -385.5z" /> |
| | | <glyph glyph-name="_623" unicode="" |
| | | d="M515 625v-128h-252v128h252zM515 880v-127h-252v127h252zM1273 369v-128h-341v128h341zM1273 625v-128h-672v128h672zM1273 880v-127h-672v127h672zM1408 20v1240q0 8 -6 14t-14 6h-32l-378 -256l-210 171l-210 -171l-378 256h-32q-8 0 -14 -6t-6 -14v-1240q0 -8 6 -14 |
| | | t14 -6h1240q8 0 14 6t6 14zM553 1130l185 150h-406zM983 1130l221 150h-406zM1536 1260v-1240q0 -62 -43 -105t-105 -43h-1240q-62 0 -105 43t-43 105v1240q0 62 43 105t105 43h1240q62 0 105 -43t43 -105z" /> |
| | | <glyph glyph-name="_624" unicode="" horiz-adv-x="1792" |
| | | d="M896 720q-104 196 -160 278q-139 202 -347 318q-34 19 -70 36q-89 40 -94 32t34 -38l39 -31q62 -43 112.5 -93.5t94.5 -116.5t70.5 -113t70.5 -131q9 -17 13 -25q44 -84 84 -153t98 -154t115.5 -150t131 -123.5t148.5 -90.5q153 -66 154 -60q1 3 -49 37q-53 36 -81 57 |
| | | q-77 58 -179 211t-185 310zM549 177q-76 60 -132.5 125t-98 143.5t-71 154.5t-58.5 186t-52 209t-60.5 252t-76.5 289q273 0 497.5 -36t379 -92t271 -144.5t185.5 -172.5t110 -198.5t56 -199.5t12.5 -198.5t-9.5 -173t-20 -143.5t-13 -107l323 -327h-104l-281 285 |
| | | q-22 -2 -91.5 -14t-121.5 -19t-138 -6t-160.5 17t-167.5 59t-179 111z" /> |
| | | <glyph glyph-name="_625" unicode="" horiz-adv-x="1792" |
| | | d="M1374 879q-6 26 -28.5 39.5t-48.5 7.5q-261 -62 -401 -62t-401 62q-26 6 -48.5 -7.5t-28.5 -39.5t7.5 -48.5t39.5 -28.5q194 -46 303 -58q-2 -158 -15.5 -269t-26.5 -155.5t-41 -115.5l-9 -21q-10 -25 1 -49t36 -34q9 -4 23 -4q44 0 60 41l8 20q54 139 71 259h42 |
| | | q17 -120 71 -259l8 -20q16 -41 60 -41q14 0 23 4q25 10 36 34t1 49l-9 21q-28 71 -41 115.5t-26.5 155.5t-15.5 269q109 12 303 58q26 6 39.5 28.5t7.5 48.5zM1024 1024q0 53 -37.5 90.5t-90.5 37.5t-90.5 -37.5t-37.5 -90.5t37.5 -90.5t90.5 -37.5t90.5 37.5t37.5 90.5z |
| | | M1600 640q0 -143 -55.5 -273.5t-150 -225t-225 -150t-273.5 -55.5t-273.5 55.5t-225 150t-150 225t-55.5 273.5t55.5 273.5t150 225t225 150t273.5 55.5t273.5 -55.5t225 -150t150 -225t55.5 -273.5zM896 1408q-156 0 -298 -61t-245 -164t-164 -245t-61 -298t61 -298 |
| | | t164 -245t245 -164t298 -61t298 61t245 164t164 245t61 298t-61 298t-164 245t-245 164t-298 61zM1792 640q0 -182 -71 -348t-191 -286t-286 -191t-348 -71t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71t348 -71t286 -191t191 -286t71 -348z" /> |
| | | <glyph glyph-name="_626" unicode="" |
| | | d="M1438 723q34 -35 29 -82l-44 -551q-4 -42 -34.5 -70t-71.5 -28q-6 0 -9 1q-44 3 -72.5 36.5t-25.5 77.5l35 429l-143 -8q55 -113 55 -240q0 -216 -148 -372l-137 137q91 101 91 235q0 145 -102.5 248t-247.5 103q-134 0 -236 -92l-137 138q120 114 284 141l264 300 |
| | | l-149 87l-181 -161q-33 -30 -77 -27.5t-73 35.5t-26.5 77t34.5 73l239 213q26 23 60 26.5t64 -14.5l488 -283q36 -21 48 -68q17 -67 -26 -117l-205 -232l371 20q49 3 83 -32zM1240 1180q-74 0 -126 52t-52 126t52 126t126 52t126.5 -52t52.5 -126t-52.5 -126t-126.5 -52z |
| | | M613 -62q106 0 196 61l139 -139q-146 -116 -335 -116q-148 0 -273.5 73t-198.5 198t-73 273q0 188 116 336l139 -139q-60 -88 -60 -197q0 -145 102.5 -247.5t247.5 -102.5z" /> |
| | | <glyph glyph-name="_627" unicode="" |
| | | d="M880 336v-160q0 -14 -9 -23t-23 -9h-160q-14 0 -23 9t-9 23v160q0 14 9 23t23 9h160q14 0 23 -9t9 -23zM1136 832q0 -50 -15 -90t-45.5 -69t-52 -44t-59.5 -36q-32 -18 -46.5 -28t-26 -24t-11.5 -29v-32q0 -14 -9 -23t-23 -9h-160q-14 0 -23 9t-9 23v68q0 35 10.5 64.5 |
| | | t24 47.5t39 35.5t41 25.5t44.5 21q53 25 75 43t22 49q0 42 -43.5 71.5t-95.5 29.5q-56 0 -95 -27q-29 -20 -80 -83q-9 -12 -25 -12q-11 0 -19 6l-108 82q-10 7 -12 20t5 23q122 192 349 192q129 0 238.5 -89.5t109.5 -214.5zM768 1280q-130 0 -248.5 -51t-204 -136.5 |
| | | t-136.5 -204t-51 -248.5t51 -248.5t136.5 -204t204 -136.5t248.5 -51t248.5 51t204 136.5t136.5 204t51 248.5t-51 248.5t-136.5 204t-204 136.5t-248.5 51zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5 |
| | | t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> |
| | | <glyph glyph-name="_628" unicode="" horiz-adv-x="1408" |
| | | d="M366 1225q-64 0 -110 45.5t-46 110.5q0 64 46 109.5t110 45.5t109.5 -45.5t45.5 -109.5q0 -65 -45.5 -110.5t-109.5 -45.5zM917 583q0 -50 -30 -67.5t-63.5 -6.5t-47.5 34l-367 438q-7 12 -14 15.5t-11 1.5l-3 -3q-7 -8 4 -21l122 -139l1 -354l-161 -457 |
| | | q-67 -192 -92 -234q-15 -26 -28 -32q-50 -26 -103 -1q-29 13 -41.5 43t-9.5 57q2 17 197 618l5 416l-85 -164l35 -222q4 -24 -1 -42t-14 -27.5t-19 -16t-17 -7.5l-7 -2q-19 -3 -34.5 3t-24 16t-14 22t-7.5 19.5t-2 9.5l-46 299l211 381q23 34 113 34q75 0 107 -40l424 -521 |
| | | q7 -5 14 -17l3 -3l-1 -1q7 -13 7 -29zM514 433q43 -113 88.5 -225t69.5 -168l24 -55q36 -93 42 -125q11 -70 -36 -97q-35 -22 -66 -16t-51 22t-29 35h-1q-6 16 -8 25l-124 351zM1338 -159q31 -49 31 -57q0 -5 -3 -7q-9 -5 -14.5 0.5t-15.5 26t-16 30.5q-114 172 -423 661 |
| | | q3 -1 7 1t7 4l3 2q11 9 11 17z" /> |
| | | <glyph glyph-name="_629" unicode="" horiz-adv-x="2304" |
| | | d="M504 542h171l-1 265zM1530 641q0 87 -50.5 140t-146.5 53h-54v-388h52q91 0 145 57t54 138zM956 1018l1 -756q0 -14 -9.5 -24t-23.5 -10h-216q-14 0 -23.5 10t-9.5 24v62h-291l-55 -81q-10 -15 -28 -15h-267q-21 0 -30.5 18t3.5 35l556 757q9 14 27 14h332q14 0 24 -10 |
| | | t10 -24zM1783 641q0 -193 -125.5 -303t-324.5 -110h-270q-14 0 -24 10t-10 24v756q0 14 10 24t24 10h268q200 0 326 -109t126 -302zM1939 640q0 -11 -0.5 -29t-8 -71.5t-21.5 -102t-44.5 -108t-73.5 -102.5h-51q38 45 66.5 104.5t41.5 112t21 98t9 72.5l1 27q0 8 -0.5 22.5 |
| | | t-7.5 60t-20 91.5t-41 111.5t-66 124.5h43q41 -47 72 -107t45.5 -111.5t23 -96t10.5 -70.5zM2123 640q0 -11 -0.5 -29t-8 -71.5t-21.5 -102t-45 -108t-74 -102.5h-51q38 45 66.5 104.5t41.5 112t21 98t9 72.5l1 27q0 8 -0.5 22.5t-7.5 60t-19.5 91.5t-40.5 111.5t-66 124.5 |
| | | h43q41 -47 72 -107t45.5 -111.5t23 -96t10.5 -70.5zM2304 640q0 -11 -0.5 -29t-8 -71.5t-21.5 -102t-44.5 -108t-73.5 -102.5h-51q38 45 66 104.5t41 112t21 98t9 72.5l1 27q0 8 -0.5 22.5t-7.5 60t-19.5 91.5t-40.5 111.5t-66 124.5h43q41 -47 72 -107t45.5 -111.5t23 -96 |
| | | t9.5 -70.5z" /> |
| | | <glyph glyph-name="uniF2A0" unicode="" horiz-adv-x="1408" |
| | | d="M617 -153q0 11 -13 58t-31 107t-20 69q-1 4 -5 26.5t-8.5 36t-13.5 21.5q-15 14 -51 14q-23 0 -70 -5.5t-71 -5.5q-34 0 -47 11q-6 5 -11 15.5t-7.5 20t-6.5 24t-5 18.5q-37 128 -37 255t37 255q1 4 5 18.5t6.5 24t7.5 20t11 15.5q13 11 47 11q24 0 71 -5.5t70 -5.5 |
| | | q36 0 51 14q9 8 13.5 21.5t8.5 36t5 26.5q2 9 20 69t31 107t13 58q0 22 -43.5 52.5t-75.5 42.5q-20 8 -45 8q-34 0 -98 -18q-57 -17 -96.5 -40.5t-71 -66t-46 -70t-45.5 -94.5q-6 -12 -9 -19q-49 -107 -68 -216t-19 -244t19 -244t68 -216q56 -122 83 -161q63 -91 179 -127 |
| | | l6 -2q64 -18 98 -18q25 0 45 8q32 12 75.5 42.5t43.5 52.5zM776 760q-26 0 -45 19t-19 45.5t19 45.5q37 37 37 90q0 52 -37 91q-19 19 -19 45t19 45t45 19t45 -19q75 -75 75 -181t-75 -181q-21 -19 -45 -19zM957 579q-27 0 -45 19q-19 19 -19 45t19 45q112 114 112 272 |
| | | t-112 272q-19 19 -19 45t19 45t45 19t45 -19q150 -150 150 -362t-150 -362q-18 -19 -45 -19zM1138 398q-27 0 -45 19q-19 19 -19 45t19 45q90 91 138.5 208t48.5 245t-48.5 245t-138.5 208q-19 19 -19 45t19 45t45 19t45 -19q109 -109 167 -249t58 -294t-58 -294t-167 -249 |
| | | q-18 -19 -45 -19z" /> |
| | | <glyph glyph-name="uniF2A1" unicode="" horiz-adv-x="2176" |
| | | d="M192 352q-66 0 -113 -47t-47 -113t47 -113t113 -47t113 47t47 113t-47 113t-113 47zM704 352q-66 0 -113 -47t-47 -113t47 -113t113 -47t113 47t47 113t-47 113t-113 47zM704 864q-66 0 -113 -47t-47 -113t47 -113t113 -47t113 47t47 113t-47 113t-113 47zM1472 352 |
| | | q-66 0 -113 -47t-47 -113t47 -113t113 -47t113 47t47 113t-47 113t-113 47zM1984 352q-66 0 -113 -47t-47 -113t47 -113t113 -47t113 47t47 113t-47 113t-113 47zM1472 864q-66 0 -113 -47t-47 -113t47 -113t113 -47t113 47t47 113t-47 113t-113 47zM1984 864 |
| | | q-66 0 -113 -47t-47 -113t47 -113t113 -47t113 47t47 113t-47 113t-113 47zM1984 1376q-66 0 -113 -47t-47 -113t47 -113t113 -47t113 47t47 113t-47 113t-113 47zM384 192q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM896 192q0 -80 -56 -136 |
| | | t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM384 704q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM896 704q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM384 1216q0 -80 -56 -136t-136 -56 |
| | | t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM1664 192q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM896 1216q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM2176 192q0 -80 -56 -136t-136 -56t-136 56 |
| | | t-56 136t56 136t136 56t136 -56t56 -136zM1664 704q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM2176 704q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136zM1664 1216q0 -80 -56 -136t-136 -56t-136 56t-56 136 |
| | | t56 136t136 56t136 -56t56 -136zM2176 1216q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136z" /> |
| | | <glyph glyph-name="uniF2A2" unicode="" horiz-adv-x="1792" |
| | | d="M128 -192q0 -26 -19 -45t-45 -19t-45 19t-19 45t19 45t45 19t45 -19t19 -45zM320 0q0 -26 -19 -45t-45 -19t-45 19t-19 45t19 45t45 19t45 -19t19 -45zM365 365l256 -256l-90 -90l-256 256zM704 384q0 -26 -19 -45t-45 -19t-45 19t-19 45t19 45t45 19t45 -19t19 -45z |
| | | M1411 704q0 -59 -11.5 -108.5t-37.5 -93.5t-44 -67.5t-53 -64.5q-31 -35 -45.5 -54t-33.5 -50t-26.5 -64t-7.5 -74q0 -159 -112.5 -271.5t-271.5 -112.5q-26 0 -45 19t-19 45t19 45t45 19q106 0 181 75t75 181q0 57 11.5 105.5t37 91t43.5 66.5t52 63q40 46 59.5 72 |
| | | t37.5 74.5t18 103.5q0 185 -131.5 316.5t-316.5 131.5t-316.5 -131.5t-131.5 -316.5q0 -26 -19 -45t-45 -19t-45 19t-19 45q0 117 45.5 223.5t123 184t184 123t223.5 45.5t223.5 -45.5t184 -123t123 -184t45.5 -223.5zM896 576q0 -26 -19 -45t-45 -19t-45 19t-19 45t19 45 |
| | | t45 19t45 -19t19 -45zM1184 704q0 -26 -19 -45t-45 -19t-45 19t-19 45q0 93 -65.5 158.5t-158.5 65.5q-92 0 -158 -65.5t-66 -158.5q0 -26 -19 -45t-45 -19t-45 19t-19 45q0 146 103 249t249 103t249 -103t103 -249zM1578 993q10 -25 -1 -49t-36 -34q-9 -4 -23 -4 |
| | | q-19 0 -35.5 11t-23.5 30q-68 178 -224 295q-21 16 -25 42t12 47q17 21 43 25t47 -12q183 -137 266 -351zM1788 1074q9 -25 -1.5 -49t-35.5 -34q-11 -4 -23 -4q-44 0 -60 41q-92 238 -297 393q-22 16 -25.5 42t12.5 47q16 22 42 25.5t47 -12.5q235 -175 341 -449z" /> |
| | | <glyph glyph-name="uniF2A3" unicode="" horiz-adv-x="2304" |
| | | d="M1032 576q-59 2 -84 55q-17 34 -48 53.5t-68 19.5q-53 0 -90.5 -37.5t-37.5 -90.5q0 -56 36 -89l10 -8q34 -31 82 -31q37 0 68 19.5t48 53.5q25 53 84 55zM1600 704q0 56 -36 89l-10 8q-34 31 -82 31q-37 0 -68 -19.5t-48 -53.5q-25 -53 -84 -55q59 -2 84 -55 |
| | | q17 -34 48 -53.5t68 -19.5q53 0 90.5 37.5t37.5 90.5zM1174 925q-17 -35 -55 -48t-73 4q-62 31 -134 31q-51 0 -99 -17q3 0 9.5 0.5t9.5 0.5q92 0 170.5 -50t118.5 -133q17 -36 3.5 -73.5t-49.5 -54.5q-18 -9 -39 -9q21 0 39 -9q36 -17 49.5 -54.5t-3.5 -73.5 |
| | | q-40 -83 -118.5 -133t-170.5 -50h-6q-16 2 -44 4l-290 27l-239 -120q-14 -7 -29 -7q-40 0 -57 35l-160 320q-11 23 -4 47.5t29 37.5l209 119l148 267q17 155 91.5 291.5t195.5 236.5q31 25 70.5 21.5t64.5 -34.5t21.5 -70t-34.5 -65q-70 -59 -117 -128q123 84 267 101 |
| | | q40 5 71.5 -19t35.5 -64q5 -40 -19 -71.5t-64 -35.5q-84 -10 -159 -55q46 10 99 10q115 0 218 -50q36 -18 49 -55.5t-5 -73.5zM2137 1085l160 -320q11 -23 4 -47.5t-29 -37.5l-209 -119l-148 -267q-17 -155 -91.5 -291.5t-195.5 -236.5q-26 -22 -61 -22q-45 0 -74 35 |
| | | q-25 31 -21.5 70t34.5 65q70 59 117 128q-123 -84 -267 -101q-4 -1 -12 -1q-36 0 -63.5 24t-31.5 60q-5 40 19 71.5t64 35.5q84 10 159 55q-46 -10 -99 -10q-115 0 -218 50q-36 18 -49 55.5t5 73.5q17 35 55 48t73 -4q62 -31 134 -31q51 0 99 17q-3 0 -9.5 -0.5t-9.5 -0.5 |
| | | q-92 0 -170.5 50t-118.5 133q-17 36 -3.5 73.5t49.5 54.5q18 9 39 9q-21 0 -39 9q-36 17 -49.5 54.5t3.5 73.5q40 83 118.5 133t170.5 50h6h1q14 -2 42 -4l291 -27l239 120q14 7 29 7q40 0 57 -35z" /> |
| | | <glyph glyph-name="uniF2A4" unicode="" horiz-adv-x="1792" |
| | | d="M1056 704q0 -26 19 -45t45 -19t45 19t19 45q0 146 -103 249t-249 103t-249 -103t-103 -249q0 -26 19 -45t45 -19t45 19t19 45q0 93 66 158.5t158 65.5t158 -65.5t66 -158.5zM835 1280q-117 0 -223.5 -45.5t-184 -123t-123 -184t-45.5 -223.5q0 -26 19 -45t45 -19t45 19 |
| | | t19 45q0 185 131.5 316.5t316.5 131.5t316.5 -131.5t131.5 -316.5q0 -55 -18 -103.5t-37.5 -74.5t-59.5 -72q-34 -39 -52 -63t-43.5 -66.5t-37 -91t-11.5 -105.5q0 -106 -75 -181t-181 -75q-26 0 -45 -19t-19 -45t19 -45t45 -19q159 0 271.5 112.5t112.5 271.5q0 41 7.5 74 |
| | | t26.5 64t33.5 50t45.5 54q35 41 53 64.5t44 67.5t37.5 93.5t11.5 108.5q0 117 -45.5 223.5t-123 184t-184 123t-223.5 45.5zM591 561l226 -226l-579 -579q-12 -12 -29 -12t-29 12l-168 168q-12 12 -12 29t12 29zM1612 1524l168 -168q12 -12 12 -29t-12 -30l-233 -233 |
| | | l-26 -25l-71 -71q-66 153 -195 258l91 91l207 207q13 12 30 12t29 -12z" /> |
| | | <glyph glyph-name="uniF2A5" unicode="" |
| | | d="M866 1021q0 -27 -13 -94q-11 -50 -31.5 -150t-30.5 -150q-2 -11 -4.5 -12.5t-13.5 -2.5q-20 -2 -31 -2q-58 0 -84 49.5t-26 113.5q0 88 35 174t103 124q28 14 51 14q28 0 36.5 -16.5t8.5 -47.5zM1352 597q0 14 -39 75.5t-52 66.5q-21 8 -34 8q-91 0 -226 -77l-2 2 |
| | | q3 22 27.5 135t24.5 178q0 233 -242 233q-24 0 -68 -6q-94 -17 -168.5 -89.5t-111.5 -166.5t-37 -189q0 -146 80.5 -225t227.5 -79q25 0 25 -3t-1 -5q-4 -34 -26 -117q-14 -52 -51.5 -101t-82.5 -49q-42 0 -42 47q0 24 10.5 47.5t25 39.5t29.5 28.5t26 20t11 8.5q0 3 -7 10 |
| | | q-24 22 -58.5 36.5t-65.5 14.5q-35 0 -63.5 -34t-41 -75t-12.5 -75q0 -88 51.5 -142t138.5 -54q82 0 155 53t117.5 126t65.5 153q6 22 15.5 66.5t14.5 66.5q3 12 14 18q118 60 227 60q48 0 127 -18q1 -1 4 -1q5 0 9.5 4.5t4.5 8.5zM1536 1120v-960q0 -119 -84.5 -203.5 |
| | | t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5t84.5 -203.5z" /> |
| | | <glyph glyph-name="uniF2A6" unicode="" horiz-adv-x="1535" |
| | | d="M744 1231q0 24 -2 38.5t-8.5 30t-21 23t-37.5 7.5q-39 0 -78 -23q-105 -58 -159 -190.5t-54 -269.5q0 -44 8.5 -85.5t26.5 -80.5t52.5 -62.5t81.5 -23.5q4 0 18 -0.5t20 0t16 3t15 8.5t7 16q16 77 48 231.5t48 231.5q19 91 19 146zM1498 575q0 -7 -7.5 -13.5t-15.5 -6.5 |
| | | l-6 1q-22 3 -62 11t-72 12.5t-63 4.5q-167 0 -351 -93q-15 -8 -21 -27q-10 -36 -24.5 -105.5t-22.5 -100.5q-23 -91 -70 -179.5t-112.5 -164.5t-154.5 -123t-185 -47q-135 0 -214.5 83.5t-79.5 219.5q0 53 19.5 117t63 116.5t97.5 52.5q38 0 120 -33.5t83 -61.5 |
| | | q0 -1 -16.5 -12.5t-39.5 -31t-46 -44.5t-39 -61t-16 -74q0 -33 16.5 -53t48.5 -20q45 0 85 31.5t66.5 78t48 105.5t32.5 107t16 90v9q0 2 -3.5 3.5t-8.5 1.5h-10t-10 -0.5t-6 -0.5q-227 0 -352 122.5t-125 348.5q0 108 34.5 221t96 210t156 167.5t204.5 89.5q52 9 106 9 |
| | | q374 0 374 -360q0 -98 -38 -273t-43 -211l3 -3q101 57 182.5 88t167.5 31q22 0 53 -13q19 -7 80 -102.5t61 -116.5z" /> |
| | | <glyph glyph-name="uniF2A7" unicode="" horiz-adv-x="1664" |
| | | d="M831 863q32 0 59 -18l222 -148q61 -40 110 -97l146 -170q40 -46 29 -106l-72 -413q-6 -32 -29.5 -53.5t-55.5 -25.5l-527 -56l-352 -32h-9q-39 0 -67.5 28t-28.5 68q0 37 27 64t65 32l260 32h-448q-41 0 -69.5 30t-26.5 71q2 39 32 65t69 26l442 1l-521 64q-41 5 -66 37 |
| | | t-19 73q6 35 34.5 57.5t65.5 22.5h10l481 -60l-351 94q-38 10 -62 41.5t-18 68.5q6 36 33 58.5t62 22.5q6 0 20 -2l448 -96l217 -37q1 0 3 -0.5t3 -0.5q23 0 30.5 23t-12.5 36l-186 125q-35 23 -42 63.5t18 73.5q27 38 76 38zM761 661l186 -125l-218 37l-5 2l-36 38 |
| | | l-238 262q-1 1 -2.5 3.5t-2.5 3.5q-24 31 -18.5 70t37.5 64q31 23 68 17.5t64 -33.5l142 -147q-2 -1 -5 -3.5t-4 -4.5q-32 -45 -23 -99t55 -85zM1648 1115l15 -266q4 -73 -11 -147l-48 -219q-12 -59 -67 -87l-106 -54q2 62 -39 109l-146 170q-53 61 -117 103l-222 148 |
| | | q-34 23 -76 23q-51 0 -88 -37l-235 312q-25 33 -18 73.5t41 63.5q33 22 71.5 14t62.5 -40l266 -352l-262 455q-21 35 -10.5 75t47.5 59q35 18 72.5 6t57.5 -46l241 -420l-136 337q-15 35 -4.5 74t44.5 56q37 19 76 6t56 -51l193 -415l101 -196q8 -15 23 -17.5t27 7.5t11 26 |
| | | l-12 224q-2 41 26 71t69 31q39 0 67 -28.5t30 -67.5z" /> |
| | | <glyph glyph-name="uniF2A8" unicode="" horiz-adv-x="1792" |
| | | d="M335 180q-2 0 -6 2q-86 57 -168.5 145t-139.5 180q-21 30 -21 69q0 9 2 19t4 18t7 18t8.5 16t10.5 17t10 15t12 15.5t11 14.5q184 251 452 365q-110 198 -110 211q0 19 17 29q116 64 128 64q18 0 28 -16l124 -229q92 19 192 19q266 0 497.5 -137.5t378.5 -369.5 |
| | | q20 -31 20 -69t-20 -69q-91 -142 -218.5 -253.5t-278.5 -175.5q110 -198 110 -211q0 -20 -17 -29q-116 -64 -127 -64q-19 0 -29 16l-124 229l-64 119l-444 820l7 7q-58 -24 -99 -47q3 -5 127 -234t243 -449t119 -223q0 -7 -9 -9q-13 -3 -72 -3q-57 0 -60 7l-456 841 |
| | | q-39 -28 -82 -68q24 -43 214 -393.5t190 -354.5q0 -10 -11 -10q-14 0 -82.5 22t-72.5 28l-106 197l-224 413q-44 -53 -78 -106q2 -3 18 -25t23 -34l176 -327q0 -10 -10 -10zM1165 282l49 -91q273 111 450 385q-180 277 -459 389q67 -64 103 -148.5t36 -176.5 |
| | | q0 -106 -47 -200.5t-132 -157.5zM848 896q0 -20 14 -34t34 -14q86 0 147 -61t61 -147q0 -20 14 -34t34 -14t34 14t14 34q0 126 -89 215t-215 89q-20 0 -34 -14t-14 -34zM1214 961l-9 4l7 -7z" /> |
| | | <glyph glyph-name="uniF2A9" unicode="" horiz-adv-x="1280" |
| | | d="M1050 430q0 -215 -147 -374q-148 -161 -378 -161q-232 0 -378 161q-147 159 -147 374q0 147 68 270.5t189 196.5t268 73q96 0 182 -31q-32 -62 -39 -126q-66 28 -143 28q-167 0 -280.5 -123t-113.5 -291q0 -170 112.5 -288.5t281.5 -118.5t281 118.5t112 288.5 |
| | | q0 89 -32 166q66 13 123 49q41 -98 41 -212zM846 619q0 -192 -79.5 -345t-238.5 -253l-14 -1q-29 0 -62 5q83 32 146.5 102.5t99.5 154.5t58.5 189t30 192.5t7.5 178.5q0 69 -3 103q55 -160 55 -326zM791 947v-2q-73 214 -206 440q88 -59 142.5 -186.5t63.5 -251.5z |
| | | M1035 744q-83 0 -160 75q218 120 290 247q19 37 21 56q-42 -94 -139.5 -166.5t-204.5 -97.5q-35 54 -35 113q0 37 17 79t43 68q46 44 157 74q59 16 106 58.5t74 100.5q74 -105 74 -253q0 -109 -24 -170q-32 -77 -88.5 -130.5t-130.5 -53.5z" /> |
| | | <glyph glyph-name="uniF2AA" unicode="" |
| | | d="M1050 495q0 78 -28 147q-41 -25 -85 -34q22 -50 22 -114q0 -117 -77 -198.5t-193 -81.5t-193.5 81.5t-77.5 198.5q0 115 78 199.5t193 84.5q53 0 98 -19q4 43 27 87q-60 21 -125 21q-154 0 -257.5 -108.5t-103.5 -263.5t103.5 -261t257.5 -106t257.5 106.5t103.5 260.5z |
| | | M872 850q2 -24 2 -71q0 -63 -5 -123t-20.5 -132.5t-40.5 -130t-68.5 -106t-100.5 -70.5q21 -3 42 -3h10q219 139 219 411q0 116 -38 225zM872 850q-4 80 -44 171.5t-98 130.5q92 -156 142 -302zM1207 955q0 102 -51 174q-41 -86 -124 -109q-69 -19 -109 -53.5t-40 -99.5 |
| | | q0 -40 24 -77q74 17 140.5 67t95.5 115q-4 -52 -74.5 -111.5t-138.5 -97.5q52 -52 110 -52q51 0 90 37t60 90q17 42 17 117zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960q119 0 203.5 -84.5 |
| | | t84.5 -203.5z" /> |
| | | <glyph glyph-name="uniF2AB" unicode="" |
| | | d="M1279 388q0 22 -22 27q-67 15 -118 59t-80 108q-7 19 -7 25q0 15 19.5 26t43 17t43 20.5t19.5 36.5q0 19 -18.5 31.5t-38.5 12.5q-12 0 -32 -8t-31 -8q-4 0 -12 2q5 95 5 114q0 79 -17 114q-36 78 -103 121.5t-152 43.5q-199 0 -275 -165q-17 -35 -17 -114q0 -19 5 -114 |
| | | q-4 -2 -14 -2q-12 0 -32 7.5t-30 7.5q-21 0 -38.5 -12t-17.5 -32q0 -21 19.5 -35.5t43 -20.5t43 -17t19.5 -26q0 -6 -7 -25q-64 -138 -198 -167q-22 -5 -22 -27q0 -46 137 -68q2 -5 6 -26t11.5 -30.5t23.5 -9.5q12 0 37.5 4.5t39.5 4.5q35 0 67 -15t54 -32.5t57.5 -32.5 |
| | | t76.5 -15q43 0 79 15t57.5 32.5t53.5 32.5t67 15q14 0 39.5 -4t38.5 -4q16 0 23 10t11 30t6 25q137 22 137 68zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5 |
| | | t103 -385.5z" /> |
| | | <glyph glyph-name="uniF2AC" unicode="" horiz-adv-x="1664" |
| | | d="M848 1408q134 1 240.5 -68.5t163.5 -192.5q27 -58 27 -179q0 -47 -9 -191q14 -7 28 -7q18 0 51 13.5t51 13.5q29 0 56 -18t27 -46q0 -32 -31.5 -54t-69 -31.5t-69 -29t-31.5 -47.5q0 -15 12 -43q37 -82 102.5 -150t144.5 -101q28 -12 80 -23q28 -6 28 -35 |
| | | q0 -70 -219 -103q-7 -11 -11 -39t-14 -46.5t-33 -18.5q-20 0 -62 6.5t-64 6.5q-37 0 -62 -5q-32 -5 -63 -22.5t-58 -38t-58 -40.5t-76 -33.5t-99 -13.5q-52 0 -96.5 13.5t-75 33.5t-57.5 40.5t-58 38t-62 22.5q-26 5 -63 5q-24 0 -65.5 -7.5t-58.5 -7.5q-25 0 -35 18.5 |
| | | t-14 47.5t-11 40q-219 33 -219 103q0 29 28 35q52 11 80 23q78 32 144.5 101t102.5 150q12 28 12 43q0 28 -31.5 47.5t-69.5 29.5t-69.5 31.5t-31.5 52.5q0 27 26 45.5t55 18.5q15 0 48 -13t53 -13q18 0 32 7q-9 142 -9 190q0 122 27 180q64 137 172 198t264 63z" /> |
| | | <glyph glyph-name="uniF2AD" unicode="" |
| | | d="M1280 388q0 22 -22 27q-67 14 -118 58t-80 109q-7 14 -7 25q0 15 19.5 26t42.5 17t42.5 20.5t19.5 36.5q0 19 -18.5 31.5t-38.5 12.5q-11 0 -31 -8t-32 -8q-4 0 -12 2q5 63 5 115q0 78 -17 114q-36 78 -102.5 121.5t-152.5 43.5q-198 0 -275 -165q-18 -38 -18 -115 |
| | | q0 -38 6 -114q-10 -2 -15 -2q-11 0 -31.5 8t-30.5 8q-20 0 -37.5 -12.5t-17.5 -32.5q0 -21 19.5 -35.5t42.5 -20.5t42.5 -17t19.5 -26q0 -11 -7 -25q-64 -138 -198 -167q-22 -5 -22 -27q0 -47 138 -69q2 -5 6 -26t11 -30.5t23 -9.5q13 0 38.5 5t38.5 5q35 0 67.5 -15 |
| | | t54.5 -32.5t57.5 -32.5t76.5 -15q43 0 79 15t57.5 32.5t54 32.5t67.5 15q13 0 39 -4.5t39 -4.5q15 0 22.5 9.5t11.5 31t5 24.5q138 22 138 69zM1536 1120v-960q0 -119 -84.5 -203.5t-203.5 -84.5h-960q-119 0 -203.5 84.5t-84.5 203.5v960q0 119 84.5 203.5t203.5 84.5h960 |
| | | q119 0 203.5 -84.5t84.5 -203.5z" /> |
| | | <glyph glyph-name="uniF2AE" unicode="" horiz-adv-x="2304" |
| | | d="M2304 1536q-69 -46 -125 -92t-89 -81t-59.5 -71.5t-37.5 -57.5t-22 -44.5t-14 -29.5q-10 -18 -35.5 -136.5t-48.5 -164.5q-15 -29 -50 -60.5t-67.5 -50.5t-72.5 -41t-48 -28q-47 -31 -151 -231q-341 14 -630 -158q-92 -53 -303 -179q47 16 86 31t55 22l15 7 |
| | | q71 27 163 64.5t133.5 53.5t108 34.5t142.5 31.5q186 31 465 -7q1 0 10 -3q11 -6 14 -17t-3 -22l-194 -345q-15 -29 -47 -22q-128 24 -354 24q-146 0 -402 -44.5t-392 -46.5q-82 -1 -149 13t-107 37t-61 40t-33 34l-1 1v2q0 6 6 6q138 0 371 55q192 366 374.5 524t383.5 158 |
| | | q5 0 14.5 -0.5t38 -5t55 -12t61.5 -24.5t63 -39.5t54 -59t40 -82.5l102 177q2 4 21 42.5t44.5 86.5t61 109.5t84 133.5t100.5 137q66 82 128 141.5t121.5 96.5t92.5 53.5t88 39.5z" /> |
| | | <glyph glyph-name="uniF2B0" unicode="" |
| | | d="M1322 640q0 -45 -5 -76l-236 14l224 -78q-19 -73 -58 -141l-214 103l177 -158q-44 -61 -107 -108l-157 178l103 -215q-61 -37 -140 -59l-79 228l14 -240q-38 -6 -76 -6t-76 6l14 238l-78 -226q-74 19 -140 59l103 215l-157 -178q-59 43 -108 108l178 158l-214 -104 |
| | | q-39 69 -58 141l224 79l-237 -14q-5 42 -5 76q0 35 5 77l238 -14l-225 79q19 73 58 140l214 -104l-177 159q46 61 107 108l158 -178l-103 215q67 39 140 58l77 -224l-13 236q36 6 75 6q38 0 76 -6l-14 -237l78 225q74 -19 140 -59l-103 -214l158 178q61 -47 107 -108 |
| | | l-177 -159l213 104q37 -62 58 -141l-224 -78l237 14q5 -31 5 -77zM1352 640q0 160 -78.5 295.5t-213 214t-292.5 78.5q-119 0 -227 -46.5t-186.5 -125t-124.5 -187.5t-46 -229q0 -119 46 -228t124.5 -187.5t186.5 -125t227 -46.5q158 0 292.5 78.5t213 214t78.5 294.5z |
| | | M1425 1023v-766l-657 -383l-657 383v766l657 383zM768 -183l708 412v823l-708 411l-708 -411v-823zM1536 1088v-896l-768 -448l-768 448v896l768 448z" /> |
| | | <glyph glyph-name="uniF2B1" unicode="" horiz-adv-x="1664" |
| | | d="M339 1318h691l-26 -72h-665q-110 0 -188.5 -79t-78.5 -189v-771q0 -95 60.5 -169.5t153.5 -93.5q23 -5 98 -5v-72h-45q-140 0 -239.5 100t-99.5 240v771q0 140 99.5 240t239.5 100zM1190 1536h247l-482 -1294q-23 -61 -40.5 -103.5t-45 -98t-54 -93.5t-64.5 -78.5 |
| | | t-79.5 -65t-95.5 -41t-116 -18.5v195q163 26 220 182q20 52 20 105q0 54 -20 106l-285 733h228l187 -585zM1664 978v-1111h-795q37 55 45 73h678v1038q0 85 -49.5 155t-129.5 99l25 67q101 -34 163.5 -123.5t62.5 -197.5z" /> |
| | | <glyph glyph-name="uniF2B2" unicode="" horiz-adv-x="1792" |
| | | d="M852 1227q0 -29 -17 -52.5t-45 -23.5t-45 23.5t-17 52.5t17 52.5t45 23.5t45 -23.5t17 -52.5zM688 -149v114q0 30 -20.5 51.5t-50.5 21.5t-50 -21.5t-20 -51.5v-114q0 -30 20.5 -52t49.5 -22q30 0 50.5 22t20.5 52zM860 -149v114q0 30 -20 51.5t-50 21.5t-50.5 -21.5 |
| | | t-20.5 -51.5v-114q0 -30 20.5 -52t50.5 -22q29 0 49.5 22t20.5 52zM1034 -149v114q0 30 -20.5 51.5t-50.5 21.5t-50.5 -21.5t-20.5 -51.5v-114q0 -30 20.5 -52t50.5 -22t50.5 22t20.5 52zM1208 -149v114q0 30 -20.5 51.5t-50.5 21.5t-50.5 -21.5t-20.5 -51.5v-114 |
| | | q0 -30 20.5 -52t50.5 -22t50.5 22t20.5 52zM1476 535q-84 -160 -232 -259.5t-323 -99.5q-123 0 -229.5 51.5t-178.5 137t-113 197.5t-41 232q0 88 21 174q-104 -175 -104 -390q0 -162 65 -312t185 -251q30 57 91 57q56 0 86 -50q32 50 87 50q56 0 86 -50q32 50 87 50t87 -50 |
| | | q30 50 86 50q28 0 52.5 -15.5t37.5 -40.5q112 94 177 231.5t73 287.5zM1326 564q0 75 -72 75q-17 0 -47 -6q-95 -19 -149 -19q-226 0 -226 243q0 86 30 204q-83 -127 -83 -275q0 -150 89 -260.5t235 -110.5q111 0 210 70q13 48 13 79zM884 1223q0 50 -32 89.5t-81 39.5 |
| | | t-81 -39.5t-32 -89.5q0 -51 31.5 -90.5t81.5 -39.5t81.5 39.5t31.5 90.5zM1513 884q0 96 -37.5 179t-113 137t-173.5 54q-77 0 -149 -35t-127 -94q-48 -159 -48 -268q0 -104 45.5 -157t147.5 -53q53 0 142 19q36 6 53 6q51 0 77.5 -28t26.5 -80q0 -26 -4 -46 |
| | | q75 68 117.5 165.5t42.5 200.5zM1792 667q0 -111 -33.5 -249.5t-93.5 -204.5q-58 -64 -195 -142.5t-228 -104.5l-4 -1v-114q0 -43 -29.5 -75t-72.5 -32q-56 0 -86 50q-32 -50 -87 -50t-87 50q-30 -50 -86 -50q-55 0 -87 50q-30 -50 -86 -50q-47 0 -75 33.5t-28 81.5 |
| | | q-90 -68 -198 -68q-118 0 -211 80q54 1 106 20q-113 31 -182 127q32 -7 71 -7q89 0 164 46q-192 192 -240 306q-24 56 -24 160q0 57 9 125.5t31.5 146.5t55 141t86.5 105t120 42q59 0 81 -52q19 29 42 54q2 3 12 13t13 16q10 15 23 38t25 42t28 39q87 111 211.5 177 |
| | | t260.5 66q35 0 62 -4q59 64 146 64q83 0 140 -57q5 -5 5 -12q0 -5 -6 -13.5t-12.5 -16t-16 -17l-10.5 -10.5q17 -6 36 -18t19 -24q0 -6 -16 -25q157 -138 197 -378q25 30 60 30q45 0 100 -49q90 -80 90 -279z" /> |
| | | <glyph glyph-name="uniF2B3" unicode="" |
| | | d="M917 631q0 33 -6 64h-362v-132h217q-12 -76 -74.5 -120.5t-142.5 -44.5q-99 0 -169 71.5t-70 170.5t70 170.5t169 71.5q93 0 153 -59l104 101q-108 100 -257 100q-160 0 -272 -112.5t-112 -271.5t112 -271.5t272 -112.5q165 0 266.5 105t101.5 270zM1262 585h109v110 |
| | | h-109v110h-110v-110h-110v-110h110v-110h110v110zM1536 640q0 -209 -103 -385.5t-279.5 -279.5t-385.5 -103t-385.5 103t-279.5 279.5t-103 385.5t103 385.5t279.5 279.5t385.5 103t385.5 -103t279.5 -279.5t103 -385.5z" /> |
| | | <glyph glyph-name="uniF2B4" unicode="" |
| | | d="M1536 1024v-839q0 -48 -49 -62q-174 -52 -338 -52q-73 0 -215.5 29.5t-227.5 29.5q-164 0 -370 -48v-338h-160v1368q-63 25 -101 81t-38 124q0 91 64 155t155 64t155 -64t64 -155q0 -68 -38 -124t-101 -81v-68q190 44 343 44q99 0 198 -15q14 -2 111.5 -22.5t149.5 -20.5 |
| | | q77 0 165 18q11 2 80 21t89 19q26 0 45 -19t19 -45z" /> |
| | | <glyph glyph-name="uniF2B5" unicode="" horiz-adv-x="2304" |
| | | d="M192 384q40 0 56 32t0 64t-56 32t-56 -32t0 -64t56 -32zM1665 442q-10 13 -38.5 50t-41.5 54t-38 49t-42.5 53t-40.5 47t-45 49l-125 -140q-83 -94 -208.5 -92t-205.5 98q-57 69 -56.5 158t58.5 157l177 206q-22 11 -51 16.5t-47.5 6t-56.5 -0.5t-49 -1q-92 0 -158 -66 |
| | | l-158 -158h-155v-544q5 0 21 0.5t22 0t19.5 -2t20.5 -4.5t17.5 -8.5t18.5 -13.5l297 -292q115 -111 227 -111q78 0 125 47q57 -20 112.5 8t72.5 85q74 -6 127 44q20 18 36 45.5t14 50.5q10 -10 43 -10q43 0 77 21t49.5 53t12 71.5t-30.5 73.5zM1824 384h96v512h-93l-157 180 |
| | | q-66 76 -169 76h-167q-89 0 -146 -67l-209 -243q-28 -33 -28 -75t27 -75q43 -51 110 -52t111 49l193 218q25 23 53.5 21.5t47 -27t8.5 -56.5q16 -19 56 -63t60 -68q29 -36 82.5 -105.5t64.5 -84.5q52 -66 60 -140zM2112 384q40 0 56 32t0 64t-56 32t-56 -32t0 -64t56 -32z |
| | | M2304 960v-640q0 -26 -19 -45t-45 -19h-434q-27 -65 -82 -106.5t-125 -51.5q-33 -48 -80.5 -81.5t-102.5 -45.5q-42 -53 -104.5 -81.5t-128.5 -24.5q-60 -34 -126 -39.5t-127.5 14t-117 53.5t-103.5 81l-287 282h-358q-26 0 -45 19t-19 45v672q0 26 19 45t45 19h421 |
| | | q14 14 47 48t47.5 48t44 40t50.5 37.5t51 25.5t62 19.5t68 5.5h117q99 0 181 -56q82 56 181 56h167q35 0 67 -6t56.5 -14.5t51.5 -26.5t44.5 -31t43 -39.5t39 -42t41 -48t41.5 -48.5h355q26 0 45 -19t19 -45z" /> |
| | | <glyph glyph-name="uniF2B6" unicode="" horiz-adv-x="1792" |
| | | d="M1792 882v-978q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v978q0 15 11 24q8 7 39 34.5t41.5 36t45.5 37.5t70 55.5t96 73t143.5 107t192.5 140.5q5 4 52.5 40t71.5 52.5t64 35t69 18.5t69 -18.5t65 -35.5t71 -52t52 -40q110 -80 192.5 -140.5t143.5 -107 |
| | | t96 -73t70 -55.5t45.5 -37.5t41.5 -36t39 -34.5q11 -9 11 -24zM1228 297q263 191 345 252q11 8 12.5 20.5t-6.5 23.5l-38 52q-8 11 -21 12.5t-24 -6.5q-231 -169 -343 -250q-5 -3 -52 -39t-71.5 -52.5t-64.5 -35t-69 -18.5t-69 18.5t-64.5 35t-71.5 52.5t-52 39 |
| | | q-186 134 -343 250q-11 8 -24 6.5t-21 -12.5l-38 -52q-8 -11 -6.5 -23.5t12.5 -20.5q82 -61 345 -252q10 -8 50 -38t65 -47t64 -39.5t77.5 -33.5t75.5 -11t75.5 11t79 34.5t64.5 39.5t65 47.5t48 36.5z" /> |
| | | <glyph glyph-name="uniF2B7" unicode="" horiz-adv-x="1792" |
| | | d="M1474 623l39 -51q8 -11 6.5 -23.5t-11.5 -20.5q-43 -34 -126.5 -98.5t-146.5 -113t-67 -51.5q-39 -32 -60 -48t-60.5 -41t-76.5 -36.5t-74 -11.5h-1h-1q-37 0 -74 11.5t-76 36.5t-61 41.5t-60 47.5q-5 4 -65 50.5t-143.5 111t-122.5 94.5q-11 8 -12.5 20.5t6.5 23.5 |
| | | l37 52q8 11 21.5 13t24.5 -7q94 -73 306 -236q5 -4 43.5 -35t60.5 -46.5t56.5 -32.5t58.5 -17h1h1q24 0 58.5 17t56.5 32.5t60.5 46.5t43.5 35q258 198 313 242q11 8 24 6.5t21 -12.5zM1664 -96v928q-90 83 -159 139q-91 74 -389 304q-3 2 -43 35t-61 48t-56 32.5t-59 17.5 |
| | | h-1h-1q-24 0 -59 -17.5t-56 -32.5t-61 -48t-43 -35q-215 -166 -315.5 -245.5t-129.5 -104t-82 -74.5q-14 -12 -21 -19v-928q0 -13 9.5 -22.5t22.5 -9.5h1472q13 0 22.5 9.5t9.5 22.5zM1792 832v-928q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v928q0 56 41 94 |
| | | q123 114 350 290.5t233 181.5q36 30 59 47.5t61.5 42t76 36.5t74.5 12h1h1q37 0 74.5 -12t76 -36.5t61.5 -42t59 -47.5q43 -36 156 -122t226 -177t201 -173q41 -38 41 -94z" /> |
| | | <glyph glyph-name="uniF2B8" unicode="" |
| | | d="M330 1l202 -214l-34 236l-216 213zM556 -225l274 218l-11 245l-300 -215zM245 413l227 -213l-48 327l-245 204zM495 189l317 214l-14 324l-352 -200zM843 178l95 -80l-2 239l-103 79q0 -1 1 -8.5t0 -12t-5 -7.5l-78 -52l85 -70q7 -6 7 -88zM138 930l256 -200l-68 465 |
| | | l-279 173zM1173 267l15 234l-230 -164l2 -240zM417 722l373 194l-19 441l-423 -163zM1270 357l20 233l-226 142l-2 -105l144 -95q6 -4 4 -9l-7 -119zM1461 496l30 222l-179 -128l-20 -228zM1273 329l-71 49l-8 -117q0 -5 -4 -8l-234 -187q-7 -5 -14 0l-98 83l7 -161 |
| | | q0 -5 -4 -8l-293 -234q-4 -2 -6 -2q-8 2 -8 3l-228 242q-4 4 -59 277q-2 7 5 11l61 37q-94 86 -95 92l-72 351q-2 7 6 12l94 45q-133 100 -135 108l-96 466q-2 10 7 13l433 135q5 0 8 -1l317 -153q6 -4 6 -9l20 -463q0 -7 -6 -10l-118 -61l126 -85q5 -2 5 -8l5 -123l121 74 |
| | | q5 4 11 0l84 -56l3 110q0 6 5 9l206 126q6 3 11 0l245 -135q4 -4 5 -7t-6.5 -60t-17.5 -124.5t-10 -70.5q0 -5 -4 -7l-191 -153q-6 -5 -13 0z" /> |
| | | <glyph glyph-name="uniF2B9" unicode="" horiz-adv-x="1664" |
| | | d="M1201 298q0 57 -5.5 107t-21 100.5t-39.5 86t-64 58t-91 22.5q-6 -4 -33.5 -20.5t-42.5 -24.5t-40.5 -20t-49 -17t-46.5 -5t-46.5 5t-49 17t-40.5 20t-42.5 24.5t-33.5 20.5q-51 0 -91 -22.5t-64 -58t-39.5 -86t-21 -100.5t-5.5 -107q0 -73 42 -121.5t103 -48.5h576 |
| | | q61 0 103 48.5t42 121.5zM1028 892q0 108 -76.5 184t-183.5 76t-183.5 -76t-76.5 -184q0 -107 76.5 -183t183.5 -76t183.5 76t76.5 183zM1664 352v-192q0 -14 -9 -23t-23 -9h-96v-224q0 -66 -47 -113t-113 -47h-1216q-66 0 -113 47t-47 113v1472q0 66 47 113t113 47h1216 |
| | | q66 0 113 -47t47 -113v-224h96q14 0 23 -9t9 -23v-192q0 -14 -9 -23t-23 -9h-96v-128h96q14 0 23 -9t9 -23v-192q0 -14 -9 -23t-23 -9h-96v-128h96q14 0 23 -9t9 -23z" /> |
| | | <glyph glyph-name="uniF2BA" unicode="" horiz-adv-x="1664" |
| | | d="M1028 892q0 -107 -76.5 -183t-183.5 -76t-183.5 76t-76.5 183q0 108 76.5 184t183.5 76t183.5 -76t76.5 -184zM980 672q46 0 82.5 -17t60 -47.5t39.5 -67t24 -81t11.5 -82.5t3.5 -79q0 -67 -39.5 -118.5t-105.5 -51.5h-576q-66 0 -105.5 51.5t-39.5 118.5q0 48 4.5 93.5 |
| | | t18.5 98.5t36.5 91.5t63 64.5t93.5 26h5q7 -4 32 -19.5t35.5 -21t33 -17t37 -16t35 -9t39.5 -4.5t39.5 4.5t35 9t37 16t33 17t35.5 21t32 19.5zM1664 928q0 -13 -9.5 -22.5t-22.5 -9.5h-96v-128h96q13 0 22.5 -9.5t9.5 -22.5v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-96v-128h96 |
| | | q13 0 22.5 -9.5t9.5 -22.5v-192q0 -13 -9.5 -22.5t-22.5 -9.5h-96v-224q0 -66 -47 -113t-113 -47h-1216q-66 0 -113 47t-47 113v1472q0 66 47 113t113 47h1216q66 0 113 -47t47 -113v-224h96q13 0 22.5 -9.5t9.5 -22.5v-192zM1408 -96v1472q0 13 -9.5 22.5t-22.5 9.5h-1216 |
| | | q-13 0 -22.5 -9.5t-9.5 -22.5v-1472q0 -13 9.5 -22.5t22.5 -9.5h1216q13 0 22.5 9.5t9.5 22.5z" /> |
| | | <glyph glyph-name="uniF2BB" unicode="" horiz-adv-x="2048" |
| | | d="M1024 405q0 64 -9 117.5t-29.5 103t-60.5 78t-97 28.5q-6 -4 -30 -18t-37.5 -21.5t-35.5 -17.5t-43 -14.5t-42 -4.5t-42 4.5t-43 14.5t-35.5 17.5t-37.5 21.5t-30 18q-57 0 -97 -28.5t-60.5 -78t-29.5 -103t-9 -117.5t37 -106.5t91 -42.5h512q54 0 91 42.5t37 106.5z |
| | | M867 925q0 94 -66.5 160.5t-160.5 66.5t-160.5 -66.5t-66.5 -160.5t66.5 -160.5t160.5 -66.5t160.5 66.5t66.5 160.5zM1792 416v64q0 14 -9 23t-23 9h-576q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h576q14 0 23 9t9 23zM1792 676v56q0 15 -10.5 25.5t-25.5 10.5h-568 |
| | | q-15 0 -25.5 -10.5t-10.5 -25.5v-56q0 -15 10.5 -25.5t25.5 -10.5h568q15 0 25.5 10.5t10.5 25.5zM1792 928v64q0 14 -9 23t-23 9h-576q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h576q14 0 23 9t9 23zM2048 1248v-1216q0 -66 -47 -113t-113 -47h-352v96q0 14 -9 23t-23 9 |
| | | h-64q-14 0 -23 -9t-9 -23v-96h-768v96q0 14 -9 23t-23 9h-64q-14 0 -23 -9t-9 -23v-96h-352q-66 0 -113 47t-47 113v1216q0 66 47 113t113 47h1728q66 0 113 -47t47 -113z" /> |
| | | <glyph glyph-name="uniF2BC" unicode="" horiz-adv-x="2048" |
| | | d="M1024 405q0 -64 -37 -106.5t-91 -42.5h-512q-54 0 -91 42.5t-37 106.5t9 117.5t29.5 103t60.5 78t97 28.5q6 -4 30 -18t37.5 -21.5t35.5 -17.5t43 -14.5t42 -4.5t42 4.5t43 14.5t35.5 17.5t37.5 21.5t30 18q57 0 97 -28.5t60.5 -78t29.5 -103t9 -117.5zM867 925 |
| | | q0 -94 -66.5 -160.5t-160.5 -66.5t-160.5 66.5t-66.5 160.5t66.5 160.5t160.5 66.5t160.5 -66.5t66.5 -160.5zM1792 480v-64q0 -14 -9 -23t-23 -9h-576q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h576q14 0 23 -9t9 -23zM1792 732v-56q0 -15 -10.5 -25.5t-25.5 -10.5h-568 |
| | | q-15 0 -25.5 10.5t-10.5 25.5v56q0 15 10.5 25.5t25.5 10.5h568q15 0 25.5 -10.5t10.5 -25.5zM1792 992v-64q0 -14 -9 -23t-23 -9h-576q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h576q14 0 23 -9t9 -23zM1920 32v1216q0 13 -9.5 22.5t-22.5 9.5h-1728q-13 0 -22.5 -9.5 |
| | | t-9.5 -22.5v-1216q0 -13 9.5 -22.5t22.5 -9.5h352v96q0 14 9 23t23 9h64q14 0 23 -9t9 -23v-96h768v96q0 14 9 23t23 9h64q14 0 23 -9t9 -23v-96h352q13 0 22.5 9.5t9.5 22.5zM2048 1248v-1216q0 -66 -47 -113t-113 -47h-1728q-66 0 -113 47t-47 113v1216q0 66 47 113 |
| | | t113 47h1728q66 0 113 -47t47 -113z" /> |
| | | <glyph glyph-name="uniF2BD" unicode="" horiz-adv-x="1792" |
| | | d="M1523 197q-22 155 -87.5 257.5t-184.5 118.5q-67 -74 -159.5 -115.5t-195.5 -41.5t-195.5 41.5t-159.5 115.5q-119 -16 -184.5 -118.5t-87.5 -257.5q106 -150 271 -237.5t356 -87.5t356 87.5t271 237.5zM1280 896q0 159 -112.5 271.5t-271.5 112.5t-271.5 -112.5 |
| | | t-112.5 -271.5t112.5 -271.5t271.5 -112.5t271.5 112.5t112.5 271.5zM1792 640q0 -182 -71 -347.5t-190.5 -286t-285.5 -191.5t-349 -71q-182 0 -348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71t348 -71t286 -191t191 -286t71 -348z" /> |
| | | <glyph glyph-name="uniF2BE" unicode="" horiz-adv-x="1792" |
| | | d="M896 1536q182 0 348 -71t286 -191t191 -286t71 -348q0 -181 -70.5 -347t-190.5 -286t-286 -191.5t-349 -71.5t-349 71t-285.5 191.5t-190.5 286t-71 347.5t71 348t191 286t286 191t348 71zM1515 185q149 205 149 455q0 156 -61 298t-164 245t-245 164t-298 61t-298 -61 |
| | | t-245 -164t-164 -245t-61 -298q0 -250 149 -455q66 327 306 327q131 -128 313 -128t313 128q240 0 306 -327zM1280 832q0 159 -112.5 271.5t-271.5 112.5t-271.5 -112.5t-112.5 -271.5t112.5 -271.5t271.5 -112.5t271.5 112.5t112.5 271.5z" /> |
| | | <glyph glyph-name="uniF2C0" unicode="" |
| | | d="M1201 752q47 -14 89.5 -38t89 -73t79.5 -115.5t55 -172t22 -236.5q0 -154 -100 -263.5t-241 -109.5h-854q-141 0 -241 109.5t-100 263.5q0 131 22 236.5t55 172t79.5 115.5t89 73t89.5 38q-79 125 -79 272q0 104 40.5 198.5t109.5 163.5t163.5 109.5t198.5 40.5 |
| | | t198.5 -40.5t163.5 -109.5t109.5 -163.5t40.5 -198.5q0 -147 -79 -272zM768 1408q-159 0 -271.5 -112.5t-112.5 -271.5t112.5 -271.5t271.5 -112.5t271.5 112.5t112.5 271.5t-112.5 271.5t-271.5 112.5zM1195 -128q88 0 150.5 71.5t62.5 173.5q0 239 -78.5 377t-225.5 145 |
| | | q-145 -127 -336 -127t-336 127q-147 -7 -225.5 -145t-78.5 -377q0 -102 62.5 -173.5t150.5 -71.5h854z" /> |
| | | <glyph glyph-name="uniF2C1" unicode="" horiz-adv-x="1280" |
| | | d="M1024 278q0 -64 -37 -107t-91 -43h-512q-54 0 -91 43t-37 107t9 118t29.5 104t61 78.5t96.5 28.5q80 -75 188 -75t188 75q56 0 96.5 -28.5t61 -78.5t29.5 -104t9 -118zM870 797q0 -94 -67.5 -160.5t-162.5 -66.5t-162.5 66.5t-67.5 160.5t67.5 160.5t162.5 66.5 |
| | | t162.5 -66.5t67.5 -160.5zM1152 -96v1376h-1024v-1376q0 -13 9.5 -22.5t22.5 -9.5h960q13 0 22.5 9.5t9.5 22.5zM1280 1376v-1472q0 -66 -47 -113t-113 -47h-960q-66 0 -113 47t-47 113v1472q0 66 47 113t113 47h352v-96q0 -14 9 -23t23 -9h192q14 0 23 9t9 23v96h352 |
| | | q66 0 113 -47t47 -113z" /> |
| | | <glyph glyph-name="uniF2C2" unicode="" horiz-adv-x="2048" |
| | | d="M896 324q0 54 -7.5 100.5t-24.5 90t-51 68.5t-81 25q-64 -64 -156 -64t-156 64q-47 0 -81 -25t-51 -68.5t-24.5 -90t-7.5 -100.5q0 -55 31.5 -93.5t75.5 -38.5h426q44 0 75.5 38.5t31.5 93.5zM768 768q0 80 -56 136t-136 56t-136 -56t-56 -136t56 -136t136 -56t136 56 |
| | | t56 136zM1792 288v64q0 14 -9 23t-23 9h-704q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h704q14 0 23 9t9 23zM1408 544v64q0 14 -9 23t-23 9h-320q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h320q14 0 23 9t9 23zM1792 544v64q0 14 -9 23t-23 9h-192q-14 0 -23 -9t-9 -23 |
| | | v-64q0 -14 9 -23t23 -9h192q14 0 23 9t9 23zM1792 800v64q0 14 -9 23t-23 9h-704q-14 0 -23 -9t-9 -23v-64q0 -14 9 -23t23 -9h704q14 0 23 9t9 23zM128 1152h1792v96q0 14 -9 23t-23 9h-1728q-14 0 -23 -9t-9 -23v-96zM2048 1248v-1216q0 -66 -47 -113t-113 -47h-1728 |
| | | q-66 0 -113 47t-47 113v1216q0 66 47 113t113 47h1728q66 0 113 -47t47 -113z" /> |
| | | <glyph glyph-name="uniF2C3" unicode="" horiz-adv-x="2048" |
| | | d="M896 324q0 -55 -31.5 -93.5t-75.5 -38.5h-426q-44 0 -75.5 38.5t-31.5 93.5q0 54 7.5 100.5t24.5 90t51 68.5t81 25q64 -64 156 -64t156 64q47 0 81 -25t51 -68.5t24.5 -90t7.5 -100.5zM768 768q0 -80 -56 -136t-136 -56t-136 56t-56 136t56 136t136 56t136 -56t56 -136z |
| | | M1792 352v-64q0 -14 -9 -23t-23 -9h-704q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h704q14 0 23 -9t9 -23zM1408 608v-64q0 -14 -9 -23t-23 -9h-320q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h320q14 0 23 -9t9 -23zM1792 608v-64q0 -14 -9 -23t-23 -9h-192q-14 0 -23 9t-9 23v64 |
| | | q0 14 9 23t23 9h192q14 0 23 -9t9 -23zM1792 864v-64q0 -14 -9 -23t-23 -9h-704q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h704q14 0 23 -9t9 -23zM1920 32v1120h-1792v-1120q0 -13 9.5 -22.5t22.5 -9.5h1728q13 0 22.5 9.5t9.5 22.5zM2048 1248v-1216q0 -66 -47 -113t-113 -47 |
| | | h-1728q-66 0 -113 47t-47 113v1216q0 66 47 113t113 47h1728q66 0 113 -47t47 -113z" /> |
| | | <glyph glyph-name="uniF2C4" unicode="" horiz-adv-x="1792" |
| | | d="M1255 749q0 318 -105 474.5t-330 156.5q-222 0 -326 -157t-104 -474q0 -316 104 -471.5t326 -155.5q74 0 131 17q-22 43 -39 73t-44 65t-53.5 56.5t-63 36t-77.5 14.5q-46 0 -79 -16l-49 97q105 91 276 91q132 0 215.5 -54t150.5 -155q67 149 67 402zM1645 117h117 |
| | | q3 -27 -2 -67t-26.5 -95t-58 -100.5t-107 -78t-162.5 -32.5q-71 0 -130.5 19t-105.5 56t-79 78t-66 96q-97 -27 -205 -27q-150 0 -292.5 58t-253 158.5t-178 249t-67.5 317.5q0 170 67.5 319.5t178.5 250.5t253.5 159t291.5 58q121 0 238.5 -36t217 -106t176 -164.5 |
| | | t119.5 -219t43 -261.5q0 -190 -80.5 -347.5t-218.5 -264.5q47 -70 93.5 -106.5t104.5 -36.5q61 0 94 37.5t38 85.5z" /> |
| | | <glyph glyph-name="uniF2C5" unicode="" horiz-adv-x="2304" |
| | | d="M453 -101q0 -21 -16 -37.5t-37 -16.5q-1 0 -13 3q-63 15 -162 140q-225 284 -225 676q0 341 213 614q39 51 95 103.5t94 52.5q19 0 35 -13.5t16 -32.5q0 -27 -63 -90q-98 -102 -147 -184q-119 -199 -119 -449q0 -281 123 -491q50 -85 136 -173q2 -3 14.5 -16t19.5 -21 |
| | | t17 -20.5t14.5 -23.5t4.5 -21zM1796 33q0 -29 -17.5 -48.5t-46.5 -19.5h-1081q-26 0 -45 19t-19 45q0 29 17.5 48.5t46.5 19.5h1081q26 0 45 -19t19 -45zM1581 644q0 -134 -67 -233q-25 -38 -69.5 -78.5t-83.5 -60.5q-16 -10 -27 -10q-7 0 -15 6t-8 12q0 9 19 30t42 46 |
| | | t42 67.5t19 88.5q0 76 -35 130q-29 42 -46 42q-3 0 -3 -5q0 -12 7.5 -35.5t7.5 -36.5q0 -22 -21.5 -35t-44.5 -13q-66 0 -66 76q0 15 1.5 44t1.5 44q0 25 -10 46q-13 25 -42 53.5t-51 28.5q-5 0 -7 -0.5t-3.5 -2.5t-1.5 -6q0 -2 16 -26t16 -54q0 -37 -19 -68t-46 -54 |
| | | t-53.5 -46t-45.5 -54t-19 -68q0 -98 42 -160q29 -43 79 -63q16 -5 17 -10q1 -2 1 -5q0 -16 -18 -16q-6 0 -33 11q-119 43 -195 139.5t-76 218.5q0 55 24.5 115.5t60 115t70.5 108.5t59.5 113.5t24.5 111.5q0 53 -25 94q-29 48 -56 64q-19 9 -19 21q0 20 41 20q50 0 110 -29 |
| | | q41 -19 71 -44.5t49.5 -51t33.5 -62.5t22 -69t16 -80q0 -1 3 -17.5t4.5 -25t5.5 -25t9 -27t11 -21.5t14.5 -16.5t18.5 -5.5q23 0 37 14t14 37q0 25 -20 67t-20 52t10 10q27 0 93 -70q72 -76 102.5 -156t30.5 -186zM2304 615q0 -274 -138 -503q-19 -32 -48 -72t-68 -86.5 |
| | | t-81 -77t-74 -30.5q-16 0 -31 15.5t-15 31.5q0 15 29 50.5t68.5 77t48.5 52.5q183 230 183 531q0 131 -20.5 235t-72.5 211q-58 119 -163 228q-2 3 -13 13.5t-16.5 16.5t-15 17.5t-15 20t-9.5 18.5t-4 19q0 19 16 35.5t35 16.5q70 0 196 -169q98 -131 146 -273t60 -314 |
| | | q2 -42 2 -64z" /> |
| | | <glyph glyph-name="uniF2C6" unicode="" horiz-adv-x="1792" |
| | | d="M1189 229l147 693q9 44 -10.5 63t-51.5 7l-864 -333q-29 -11 -39.5 -25t-2.5 -26.5t32 -19.5l221 -69l513 323q21 14 32 6q7 -5 -4 -15l-415 -375v0v0l-16 -228q23 0 45 22l108 104l224 -165q64 -36 81 38zM1792 640q0 -182 -71 -348t-191 -286t-286 -191t-348 -71 |
| | | t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71t348 -71t286 -191t191 -286t71 -348z" /> |
| | | <glyph glyph-name="uniF2C7" unicode="" horiz-adv-x="1024" |
| | | d="M640 192q0 -80 -56 -136t-136 -56t-136 56t-56 136q0 60 35 110t93 71v907h128v-907q58 -21 93 -71t35 -110zM768 192q0 77 -34 144t-94 112v768q0 80 -56 136t-136 56t-136 -56t-56 -136v-768q-60 -45 -94 -112t-34 -144q0 -133 93.5 -226.5t226.5 -93.5t226.5 93.5 |
| | | t93.5 226.5zM896 192q0 -185 -131.5 -316.5t-316.5 -131.5t-316.5 131.5t-131.5 316.5q0 182 128 313v711q0 133 93.5 226.5t226.5 93.5t226.5 -93.5t93.5 -226.5v-711q128 -131 128 -313zM1024 768v-128h-192v128h192zM1024 1024v-128h-192v128h192zM1024 1280v-128h-192 |
| | | v128h192z" /> |
| | | <glyph glyph-name="uniF2C8" unicode="" horiz-adv-x="1024" |
| | | d="M640 192q0 -80 -56 -136t-136 -56t-136 56t-56 136q0 60 35 110t93 71v651h128v-651q58 -21 93 -71t35 -110zM768 192q0 77 -34 144t-94 112v768q0 80 -56 136t-136 56t-136 -56t-56 -136v-768q-60 -45 -94 -112t-34 -144q0 -133 93.5 -226.5t226.5 -93.5t226.5 93.5 |
| | | t93.5 226.5zM896 192q0 -185 -131.5 -316.5t-316.5 -131.5t-316.5 131.5t-131.5 316.5q0 182 128 313v711q0 133 93.5 226.5t226.5 93.5t226.5 -93.5t93.5 -226.5v-711q128 -131 128 -313zM1024 768v-128h-192v128h192zM1024 1024v-128h-192v128h192zM1024 1280v-128h-192 |
| | | v128h192z" /> |
| | | <glyph glyph-name="uniF2C9" unicode="" horiz-adv-x="1024" |
| | | d="M640 192q0 -80 -56 -136t-136 -56t-136 56t-56 136q0 60 35 110t93 71v395h128v-395q58 -21 93 -71t35 -110zM768 192q0 77 -34 144t-94 112v768q0 80 -56 136t-136 56t-136 -56t-56 -136v-768q-60 -45 -94 -112t-34 -144q0 -133 93.5 -226.5t226.5 -93.5t226.5 93.5 |
| | | t93.5 226.5zM896 192q0 -185 -131.5 -316.5t-316.5 -131.5t-316.5 131.5t-131.5 316.5q0 182 128 313v711q0 133 93.5 226.5t226.5 93.5t226.5 -93.5t93.5 -226.5v-711q128 -131 128 -313zM1024 768v-128h-192v128h192zM1024 1024v-128h-192v128h192zM1024 1280v-128h-192 |
| | | v128h192z" /> |
| | | <glyph glyph-name="uniF2CA" unicode="" horiz-adv-x="1024" |
| | | d="M640 192q0 -80 -56 -136t-136 -56t-136 56t-56 136q0 60 35 110t93 71v139h128v-139q58 -21 93 -71t35 -110zM768 192q0 77 -34 144t-94 112v768q0 80 -56 136t-136 56t-136 -56t-56 -136v-768q-60 -45 -94 -112t-34 -144q0 -133 93.5 -226.5t226.5 -93.5t226.5 93.5 |
| | | t93.5 226.5zM896 192q0 -185 -131.5 -316.5t-316.5 -131.5t-316.5 131.5t-131.5 316.5q0 182 128 313v711q0 133 93.5 226.5t226.5 93.5t226.5 -93.5t93.5 -226.5v-711q128 -131 128 -313zM1024 768v-128h-192v128h192zM1024 1024v-128h-192v128h192zM1024 1280v-128h-192 |
| | | v128h192z" /> |
| | | <glyph glyph-name="uniF2CB" unicode="" horiz-adv-x="1024" |
| | | d="M640 192q0 -80 -56 -136t-136 -56t-136 56t-56 136q0 79 56 135.5t136 56.5t136 -56.5t56 -135.5zM768 192q0 77 -34 144t-94 112v768q0 80 -56 136t-136 56t-136 -56t-56 -136v-768q-60 -45 -94 -112t-34 -144q0 -133 93.5 -226.5t226.5 -93.5t226.5 93.5t93.5 226.5z |
| | | M896 192q0 -185 -131.5 -316.5t-316.5 -131.5t-316.5 131.5t-131.5 316.5q0 182 128 313v711q0 133 93.5 226.5t226.5 93.5t226.5 -93.5t93.5 -226.5v-711q128 -131 128 -313zM1024 768v-128h-192v128h192zM1024 1024v-128h-192v128h192zM1024 1280v-128h-192v128h192z" /> |
| | | <glyph glyph-name="uniF2CC" unicode="" horiz-adv-x="1920" |
| | | d="M1433 1287q10 -10 10 -23t-10 -23l-626 -626q-10 -10 -23 -10t-23 10l-82 82q-10 10 -10 23t10 23l44 44q-72 91 -81.5 207t46.5 215q-74 71 -176 71q-106 0 -181 -75t-75 -181v-1280h-256v1280q0 104 40.5 198.5t109.5 163.5t163.5 109.5t198.5 40.5q106 0 201 -41 |
| | | t166 -115q94 39 197 24.5t185 -79.5l44 44q10 10 23 10t23 -10zM1344 1024q26 0 45 -19t19 -45t-19 -45t-45 -19t-45 19t-19 45t19 45t45 19zM1600 896q-26 0 -45 19t-19 45t19 45t45 19t45 -19t19 -45t-19 -45t-45 -19zM1856 1024q26 0 45 -19t19 -45t-19 -45t-45 -19 |
| | | t-45 19t-19 45t19 45t45 19zM1216 896q26 0 45 -19t19 -45t-19 -45t-45 -19t-45 19t-19 45t19 45t45 19zM1408 832q0 26 19 45t45 19t45 -19t19 -45t-19 -45t-45 -19t-45 19t-19 45zM1728 896q26 0 45 -19t19 -45t-19 -45t-45 -19t-45 19t-19 45t19 45t45 19zM1088 768 |
| | | q26 0 45 -19t19 -45t-19 -45t-45 -19t-45 19t-19 45t19 45t45 19zM1344 640q-26 0 -45 19t-19 45t19 45t45 19t45 -19t19 -45t-19 -45t-45 -19zM1600 768q26 0 45 -19t19 -45t-19 -45t-45 -19t-45 19t-19 45t19 45t45 19zM1216 512q-26 0 -45 19t-19 45t19 45t45 19t45 -19 |
| | | t19 -45t-19 -45t-45 -19zM1472 640q26 0 45 -19t19 -45t-19 -45t-45 -19t-45 19t-19 45t19 45t45 19zM1088 512q26 0 45 -19t19 -45t-19 -45t-45 -19t-45 19t-19 45t19 45t45 19zM1344 512q26 0 45 -19t19 -45t-19 -45t-45 -19t-45 19t-19 45t19 45t45 19zM1216 384 |
| | | q26 0 45 -19t19 -45t-19 -45t-45 -19t-45 19t-19 45t19 45t45 19zM1088 256q26 0 45 -19t19 -45t-19 -45t-45 -19t-45 19t-19 45t19 45t45 19z" /> |
| | | <glyph glyph-name="uniF2CD" unicode="" horiz-adv-x="1792" |
| | | d="M1664 448v-192q0 -169 -128 -286v-194q0 -14 -9 -23t-23 -9h-64q-14 0 -23 9t-9 23v118q-63 -22 -128 -22h-768q-65 0 -128 22v-110q0 -17 -9.5 -28.5t-22.5 -11.5h-64q-13 0 -22.5 11.5t-9.5 28.5v186q-128 117 -128 286v192h1536zM704 864q0 -14 -9 -23t-23 -9t-23 9 |
| | | t-9 23t9 23t23 9t23 -9t9 -23zM768 928q0 -14 -9 -23t-23 -9t-23 9t-9 23t9 23t23 9t23 -9t9 -23zM704 992q0 -14 -9 -23t-23 -9t-23 9t-9 23t9 23t23 9t23 -9t9 -23zM832 992q0 -14 -9 -23t-23 -9t-23 9t-9 23t9 23t23 9t23 -9t9 -23zM768 1056q0 -14 -9 -23t-23 -9t-23 9 |
| | | t-9 23t9 23t23 9t23 -9t9 -23zM704 1120q0 -14 -9 -23t-23 -9t-23 9t-9 23t9 23t23 9t23 -9t9 -23zM1792 608v-64q0 -14 -9 -23t-23 -9h-1728q-14 0 -23 9t-9 23v64q0 14 9 23t23 9h96v640q0 106 75 181t181 75q108 0 184 -78q46 19 98 12t93 -39l22 22q11 11 22 0l42 -42 |
| | | q11 -11 0 -22l-314 -314q-11 -11 -22 0l-42 42q-11 11 0 22l22 22q-36 46 -40.5 104t23.5 108q-37 35 -88 35q-53 0 -90.5 -37.5t-37.5 -90.5v-640h1504q14 0 23 -9t9 -23zM896 1056q0 -14 -9 -23t-23 -9t-23 9t-9 23t9 23t23 9t23 -9t9 -23zM832 1120q0 -14 -9 -23t-23 -9 |
| | | t-23 9t-9 23t9 23t23 9t23 -9t9 -23zM768 1184q0 -14 -9 -23t-23 -9t-23 9t-9 23t9 23t23 9t23 -9t9 -23zM960 1120q0 -14 -9 -23t-23 -9t-23 9t-9 23t9 23t23 9t23 -9t9 -23zM896 1184q0 -14 -9 -23t-23 -9t-23 9t-9 23t9 23t23 9t23 -9t9 -23zM832 1248q0 -14 -9 -23 |
| | | t-23 -9t-23 9t-9 23t9 23t23 9t23 -9t9 -23zM1024 1184q0 -14 -9 -23t-23 -9t-23 9t-9 23t9 23t23 9t23 -9t9 -23zM960 1248q0 -14 -9 -23t-23 -9t-23 9t-9 23t9 23t23 9t23 -9t9 -23zM1088 1248q0 -14 -9 -23t-23 -9t-23 9t-9 23t9 23t23 9t23 -9t9 -23z" /> |
| | | <glyph glyph-name="uniF2CE" unicode="" |
| | | d="M994 344q0 -86 -17 -197q-31 -215 -55 -313q-22 -90 -152 -90t-152 90q-24 98 -55 313q-17 110 -17 197q0 168 224 168t224 -168zM1536 768q0 -240 -134 -434t-350 -280q-8 -3 -15 3t-6 15q7 48 10 66q4 32 6 47q1 9 9 12q159 81 255.5 234t96.5 337q0 180 -91 330.5 |
| | | t-247 234.5t-337 74q-124 -7 -237 -61t-193.5 -140.5t-128 -202t-46.5 -240.5q1 -184 99 -336.5t257 -231.5q7 -3 9 -12q3 -21 6 -45q1 -9 5 -32.5t6 -35.5q1 -9 -6.5 -15t-15.5 -2q-148 58 -261 169.5t-173.5 264t-52.5 319.5q7 143 66 273.5t154.5 227t225 157.5t272.5 70 |
| | | q164 10 315.5 -46.5t261 -160.5t175 -250.5t65.5 -308.5zM994 800q0 -93 -65.5 -158.5t-158.5 -65.5t-158.5 65.5t-65.5 158.5t65.5 158.5t158.5 65.5t158.5 -65.5t65.5 -158.5zM1282 768q0 -122 -53.5 -228.5t-146.5 -177.5q-8 -6 -16 -2t-10 14q-6 52 -29 92q-7 10 3 20 |
| | | q58 54 91 127t33 155q0 111 -58.5 204t-157.5 141.5t-212 36.5q-133 -15 -229 -113t-109 -231q-10 -92 23.5 -176t98.5 -144q10 -10 3 -20q-24 -41 -29 -93q-2 -9 -10 -13t-16 2q-95 74 -148.5 183t-51.5 234q3 131 69 244t177 181.5t241 74.5q144 7 268 -60t196.5 -187.5 |
| | | t72.5 -263.5z" /> |
| | | <glyph glyph-name="uniF2D0" unicode="" horiz-adv-x="1792" |
| | | d="M256 128h1280v768h-1280v-768zM1792 1248v-1216q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v1216q0 66 47 113t113 47h1472q66 0 113 -47t47 -113z" /> |
| | | <glyph glyph-name="uniF2D1" unicode="" horiz-adv-x="1792" |
| | | d="M1792 224v-192q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v192q0 66 47 113t113 47h1472q66 0 113 -47t47 -113z" /> |
| | | <glyph glyph-name="uniF2D2" unicode="" horiz-adv-x="2048" |
| | | d="M256 0h768v512h-768v-512zM1280 512h512v768h-768v-256h96q66 0 113 -47t47 -113v-352zM2048 1376v-960q0 -66 -47 -113t-113 -47h-608v-352q0 -66 -47 -113t-113 -47h-960q-66 0 -113 47t-47 113v960q0 66 47 113t113 47h608v352q0 66 47 113t113 47h960q66 0 113 -47 |
| | | t47 -113z" /> |
| | | <glyph glyph-name="uniF2D3" unicode="" horiz-adv-x="1792" |
| | | d="M1175 215l146 146q10 10 10 23t-10 23l-233 233l233 233q10 10 10 23t-10 23l-146 146q-10 10 -23 10t-23 -10l-233 -233l-233 233q-10 10 -23 10t-23 -10l-146 -146q-10 -10 -10 -23t10 -23l233 -233l-233 -233q-10 -10 -10 -23t10 -23l146 -146q10 -10 23 -10t23 10 |
| | | l233 233l233 -233q10 -10 23 -10t23 10zM1792 1248v-1216q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v1216q0 66 47 113t113 47h1472q66 0 113 -47t47 -113z" /> |
| | | <glyph glyph-name="uniF2D4" unicode="" horiz-adv-x="1792" |
| | | d="M1257 425l-146 -146q-10 -10 -23 -10t-23 10l-169 169l-169 -169q-10 -10 -23 -10t-23 10l-146 146q-10 10 -10 23t10 23l169 169l-169 169q-10 10 -10 23t10 23l146 146q10 10 23 10t23 -10l169 -169l169 169q10 10 23 10t23 -10l146 -146q10 -10 10 -23t-10 -23 |
| | | l-169 -169l169 -169q10 -10 10 -23t-10 -23zM256 128h1280v1024h-1280v-1024zM1792 1248v-1216q0 -66 -47 -113t-113 -47h-1472q-66 0 -113 47t-47 113v1216q0 66 47 113t113 47h1472q66 0 113 -47t47 -113z" /> |
| | | <glyph glyph-name="uniF2D5" unicode="" horiz-adv-x="1792" |
| | | d="M1070 358l306 564h-654l-306 -564h654zM1792 640q0 -182 -71 -348t-191 -286t-286 -191t-348 -71t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71t348 -71t286 -191t191 -286t71 -348z" /> |
| | | <glyph glyph-name="uniF2D6" unicode="" horiz-adv-x="1794" |
| | | d="M1291 1060q-15 17 -35 8.5t-26 -28.5t5 -38q14 -17 40 -14.5t34 20.5t-18 52zM895 814q-8 -8 -19.5 -8t-18.5 8q-8 8 -8 19t8 18q7 8 18.5 8t19.5 -8q7 -7 7 -18t-7 -19zM1060 740l-35 -35q-12 -13 -29.5 -13t-30.5 13l-38 38q-12 13 -12 30t12 30l35 35q12 12 29.5 12 |
| | | t30.5 -12l38 -39q12 -12 12 -29.5t-12 -29.5zM951 870q-7 -8 -18.5 -8t-19.5 8q-7 8 -7 19t7 19q8 8 19 8t19 -8t8 -19t-8 -19zM1354 968q-34 -64 -107.5 -85.5t-127.5 16.5q-38 28 -61 66.5t-21 87.5t39 92t75.5 53t70.5 -5t70 -51q2 -2 13 -12.5t14.5 -13.5t13 -13.5 |
| | | t12.5 -15.5t10 -15.5t8.5 -18t4 -18.5t1 -21t-5 -22t-9.5 -24zM1555 486q3 20 -8.5 34.5t-27.5 21.5t-33 17t-23 20q-40 71 -84 98.5t-113 11.5q19 13 40 18.5t33 4.5l12 -1q2 45 -34 90q6 20 6.5 40.5t-2.5 30.5l-3 10q43 24 71 65t34 91q10 84 -43 150.5t-137 76.5 |
| | | q-60 7 -114 -18.5t-82 -74.5q-30 -51 -33.5 -101t14.5 -87t43.5 -64t56.5 -42q-45 4 -88 36t-57 88q-28 108 32 222q-16 21 -29 32q-50 0 -89 -19q19 24 42 37t36 14l13 1q0 50 -13 78q-10 21 -32.5 28.5t-47 -3.5t-37.5 -40q2 4 4 7q-7 -28 -6.5 -75.5t19 -117t48.5 -122.5 |
| | | q-25 -14 -47 -36q-35 -16 -85.5 -70.5t-84.5 -101.5l-33 -46q-90 -34 -181 -125.5t-75 -162.5q1 -16 11 -27q-15 -12 -30 -30q-21 -25 -21 -54t21.5 -40t63.5 6q41 19 77 49.5t55 60.5q-2 2 -6.5 5t-20.5 7.5t-33 3.5q23 5 51 12.5t40 10t27.5 6t26 4t23.5 0.5q14 -7 22 34 |
| | | q7 37 7 90q0 102 -40 150q106 -103 101 -219q-1 -29 -15 -50t-27 -27l-13 -6q-4 -7 -19 -32t-26 -45.5t-26.5 -52t-25 -61t-17 -63t-6.5 -66.5t10 -63q-35 54 -37 80q-22 -24 -34.5 -39t-33.5 -42t-30.5 -46t-16.5 -41t-0.5 -38t25.5 -27q45 -25 144 64t190.5 221.5 |
| | | t122.5 228.5q86 52 145 115.5t86 119.5q47 -93 154 -178q104 -83 167 -80q39 2 46 43zM1794 640q0 -182 -71 -348t-191 -286t-286.5 -191t-348.5 -71t-348.5 71t-286.5 191t-191 286t-71 348t71 348t191 286t286.5 191t348.5 71t348.5 -71t286.5 -191t191 -286t71 -348z" /> |
| | | <glyph glyph-name="uniF2D7" unicode="" |
| | | d="M518 1353v-655q103 -1 191.5 1.5t125.5 5.5l37 3q68 2 90.5 24.5t39.5 94.5l33 142h103l-14 -322l7 -319h-103l-29 127q-15 68 -45 93t-84 26q-87 8 -352 8v-556q0 -78 43.5 -115.5t133.5 -37.5h357q35 0 59.5 2t55 7.5t54 18t48.5 32t46 50.5t39 73l93 216h89 |
| | | q-6 -37 -31.5 -252t-30.5 -276q-146 5 -263.5 8t-162.5 4h-44h-628l-376 -12v102l127 25q67 13 91.5 37t25.5 79l8 643q3 402 -8 645q-2 61 -25.5 84t-91.5 36l-127 24v102l376 -12h702q139 0 374 27q-6 -68 -14 -194.5t-12 -219.5l-5 -92h-93l-32 124q-31 121 -74 179.5 |
| | | t-113 58.5h-548q-28 0 -35.5 -8.5t-7.5 -30.5z" /> |
| | | <glyph glyph-name="uniF2D8" unicode="" |
| | | d="M922 739v-182q0 -4 0.5 -15t0 -15l-1.5 -12t-3.5 -11.5t-6.5 -7.5t-11 -5.5t-16 -1.5v309q9 0 16 -1t11 -5t6.5 -5.5t3.5 -9.5t1 -10.5v-13.5v-14zM1238 643v-121q0 -1 0.5 -12.5t0 -15.5t-2.5 -11.5t-7.5 -10.5t-13.5 -3q-9 0 -14 9q-4 10 -4 165v7v8.5v9t1.5 8.5l3.5 7 |
| | | t5 5.5t8 1.5q6 0 10 -1.5t6.5 -4.5t4 -6t2 -8.5t0.5 -8v-9.5v-9zM180 407h122v472h-122v-472zM614 407h106v472h-159l-28 -221q-20 148 -32 221h-158v-472h107v312l45 -312h76l43 319v-319zM1039 712q0 67 -5 90q-3 16 -11 28.5t-17 20.5t-25 14t-26.5 8.5t-31 4t-29 1.5 |
| | | h-29.5h-12h-91v-472h56q169 -1 197 24.5t25 180.5q-1 62 -1 100zM1356 515v133q0 29 -2 45t-9.5 33.5t-24.5 25t-46 7.5q-46 0 -77 -34v154h-117v-472h110l7 30q30 -36 77 -36q50 0 66 30.5t16 83.5zM1536 1248v-1216q0 -66 -47 -113t-113 -47h-1216q-66 0 -113 47t-47 113 |
| | | v1216q0 66 47 113t113 47h1216q66 0 113 -47t47 -113z" /> |
| | | <glyph glyph-name="uniF2D9" unicode="" horiz-adv-x="2176" |
| | | d="M1143 -197q-6 1 -11 4q-13 8 -36 23t-86 65t-116.5 104.5t-112 140t-89.5 172.5q-17 3 -175 37q66 -213 235 -362t391 -184zM502 409l168 -28q-25 76 -41 167.5t-19 145.5l-4 53q-84 -82 -121 -224q5 -65 17 -114zM612 1018q-43 -64 -77 -148q44 46 74 68zM2049 584 |
| | | q0 161 -62 307t-167.5 252t-250.5 168.5t-304 62.5q-147 0 -281 -52.5t-240 -148.5q-30 -58 -45 -160q60 51 143 83.5t158.5 43t143 13.5t108.5 -1l40 -3q33 -1 53 -15.5t24.5 -33t6.5 -37t-1 -28.5q-126 11 -227.5 0.5t-183 -43.5t-142.5 -71.5t-131 -98.5 |
| | | q4 -36 11.5 -92.5t35.5 -178t62 -179.5q123 -6 247.5 14.5t214.5 53.5t162.5 67t109.5 59l37 24q22 16 39.5 20.5t30.5 -5t17 -34.5q14 -97 -39 -121q-208 -97 -467 -134q-135 -20 -317 -16q41 -96 110 -176.5t137 -127t130.5 -79t101.5 -43.5l39 -12q143 -23 263 15 |
| | | q195 99 314 289t119 418zM2123 621q-14 -135 -40 -212q-70 -208 -181.5 -346.5t-318.5 -253.5q-48 -33 -82 -44q-72 -26 -163 -16q-36 -3 -73 -3q-283 0 -504.5 173t-295.5 442q-1 0 -4 0.5t-5 0.5q-6 -50 2.5 -112.5t26 -115t36 -98t31.5 -71.5l14 -26q8 -12 54 -82 |
| | | q-71 38 -124.5 106.5t-78.5 140t-39.5 137t-17.5 107.5l-2 42q-5 2 -33.5 12.5t-48.5 18t-53 20.5t-57.5 25t-50 25.5t-42.5 27t-25 25.5q19 -10 50.5 -25.5t113 -45.5t145.5 -38l2 32q11 149 94 290q41 202 176 365q28 115 81 214q15 28 32 45t49 32q158 74 303.5 104 |
| | | t302 11t306.5 -97q220 -115 333 -336t87 -474z" /> |
| | | <glyph glyph-name="uniF2DA" unicode="" horiz-adv-x="1792" |
| | | d="M1341 752q29 44 -6.5 129.5t-121.5 142.5q-58 39 -125.5 53.5t-118 4.5t-68.5 -37q-12 -23 -4.5 -28t42.5 -10q23 -3 38.5 -5t44.5 -9.5t56 -17.5q36 -13 67.5 -31.5t53 -37t40 -38.5t30.5 -38t22 -34.5t16.5 -28.5t12 -18.5t10.5 -6t11 9.5zM1704 178 |
| | | q-52 -127 -148.5 -220t-214.5 -141.5t-253 -60.5t-266 13.5t-251 91t-210 161.5t-141.5 235.5t-46.5 303.5q1 41 8.5 84.5t12.5 64t24 80.5t23 73q-51 -208 1 -397t173 -318t291 -206t346 -83t349 74.5t289 244.5q20 27 18 14q0 -4 -4 -14zM1465 627q0 -104 -40.5 -199 |
| | | t-108.5 -164t-162 -109.5t-198 -40.5t-198 40.5t-162 109.5t-108.5 164t-40.5 199t40.5 199t108.5 164t162 109.5t198 40.5t198 -40.5t162 -109.5t108.5 -164t40.5 -199zM1752 915q-65 147 -180.5 251t-253 153.5t-292 53.5t-301 -36.5t-275.5 -129t-220 -211.5t-131 -297 |
| | | t-10 -373q-49 161 -51.5 311.5t35.5 272.5t109 227t165.5 180.5t207 126t232 71t242.5 9t236 -54t216 -124.5t178 -197q33 -50 62 -121t31 -112zM1690 573q12 244 -136.5 416t-396.5 240q-8 0 -10 5t24 8q125 -4 230 -50t173 -120t116 -168.5t58.5 -199t-1 -208 |
| | | t-61.5 -197.5t-122.5 -167t-185 -117.5t-248.5 -46.5q108 30 201.5 80t174 123t129.5 176.5t55 225.5z" /> |
| | | <glyph glyph-name="uniF2DB" unicode="" |
| | | d="M192 256v-128h-112q-16 0 -16 16v16h-48q-16 0 -16 16v32q0 16 16 16h48v16q0 16 16 16h112zM192 512v-128h-112q-16 0 -16 16v16h-48q-16 0 -16 16v32q0 16 16 16h48v16q0 16 16 16h112zM192 768v-128h-112q-16 0 -16 16v16h-48q-16 0 -16 16v32q0 16 16 16h48v16 |
| | | q0 16 16 16h112zM192 1024v-128h-112q-16 0 -16 16v16h-48q-16 0 -16 16v32q0 16 16 16h48v16q0 16 16 16h112zM192 1280v-128h-112q-16 0 -16 16v16h-48q-16 0 -16 16v32q0 16 16 16h48v16q0 16 16 16h112zM1280 1440v-1472q0 -40 -28 -68t-68 -28h-832q-40 0 -68 28 |
| | | t-28 68v1472q0 40 28 68t68 28h832q40 0 68 -28t28 -68zM1536 208v-32q0 -16 -16 -16h-48v-16q0 -16 -16 -16h-112v128h112q16 0 16 -16v-16h48q16 0 16 -16zM1536 464v-32q0 -16 -16 -16h-48v-16q0 -16 -16 -16h-112v128h112q16 0 16 -16v-16h48q16 0 16 -16zM1536 720v-32 |
| | | q0 -16 -16 -16h-48v-16q0 -16 -16 -16h-112v128h112q16 0 16 -16v-16h48q16 0 16 -16zM1536 976v-32q0 -16 -16 -16h-48v-16q0 -16 -16 -16h-112v128h112q16 0 16 -16v-16h48q16 0 16 -16zM1536 1232v-32q0 -16 -16 -16h-48v-16q0 -16 -16 -16h-112v128h112q16 0 16 -16v-16 |
| | | h48q16 0 16 -16z" /> |
| | | <glyph glyph-name="uniF2DC" unicode="" horiz-adv-x="1664" |
| | | d="M1566 419l-167 -33l186 -107q23 -13 29.5 -38.5t-6.5 -48.5q-14 -23 -39 -29.5t-48 6.5l-186 106l55 -160q13 -38 -12 -63.5t-60.5 -20.5t-48.5 42l-102 300l-271 156v-313l208 -238q16 -18 17 -39t-11 -36.5t-28.5 -25t-37 -5.5t-36.5 22l-112 128v-214q0 -26 -19 -45 |
| | | t-45 -19t-45 19t-19 45v214l-112 -128q-16 -18 -36.5 -22t-37 5.5t-28.5 25t-11 36.5t17 39l208 238v313l-271 -156l-102 -300q-13 -37 -48.5 -42t-60.5 20.5t-12 63.5l55 160l-186 -106q-23 -13 -48 -6.5t-39 29.5q-13 23 -6.5 48.5t29.5 38.5l186 107l-167 33 |
| | | q-29 6 -42 29t-8.5 46.5t25.5 40t50 10.5l310 -62l271 157l-271 157l-310 -62q-4 -1 -13 -1q-27 0 -44 18t-19 40t11 43t40 26l167 33l-186 107q-23 13 -29.5 38.5t6.5 48.5t39 30t48 -7l186 -106l-55 160q-13 38 12 63.5t60.5 20.5t48.5 -42l102 -300l271 -156v313 |
| | | l-208 238q-16 18 -17 39t11 36.5t28.5 25t37 5.5t36.5 -22l112 -128v214q0 26 19 45t45 19t45 -19t19 -45v-214l112 128q16 18 36.5 22t37 -5.5t28.5 -25t11 -36.5t-17 -39l-208 -238v-313l271 156l102 300q13 37 48.5 42t60.5 -20.5t12 -63.5l-55 -160l186 106 |
| | | q23 13 48 6.5t39 -29.5q13 -23 6.5 -48.5t-29.5 -38.5l-186 -107l167 -33q27 -5 40 -26t11 -43t-19 -40t-44 -18q-9 0 -13 1l-310 62l-271 -157l271 -157l310 62q29 6 50 -10.5t25.5 -40t-8.5 -46.5t-42 -29z" /> |
| | | <glyph glyph-name="uniF2DD" unicode="" horiz-adv-x="1792" |
| | | d="M1473 607q7 118 -33 226.5t-113 189t-177 131t-221 57.5q-116 7 -225.5 -32t-192 -110.5t-135 -175t-59.5 -220.5q-7 -118 33 -226.5t113 -189t177.5 -131t221.5 -57.5q155 -9 293 59t224 195.5t94 283.5zM1792 1536l-349 -348q120 -117 180.5 -272t50.5 -321 |
| | | q-11 -183 -102 -339t-241 -255.5t-332 -124.5l-999 -132l347 347q-120 116 -180.5 271.5t-50.5 321.5q11 184 102 340t241.5 255.5t332.5 124.5q167 22 500 66t500 66z" /> |
| | | <glyph glyph-name="uniF2DE" unicode="" horiz-adv-x="1792" |
| | | d="M948 508l163 -329h-51l-175 350l-171 -350h-49l179 374l-78 33l21 49l240 -102l-21 -50zM563 1100l304 -130l-130 -304l-304 130zM907 915l240 -103l-103 -239l-239 102zM1188 765l191 -81l-82 -190l-190 81zM1680 640q0 159 -62 304t-167.5 250.5t-250.5 167.5t-304 62 |
| | | t-304 -62t-250.5 -167.5t-167.5 -250.5t-62 -304t62 -304t167.5 -250.5t250.5 -167.5t304 -62t304 62t250.5 167.5t167.5 250.5t62 304zM1792 640q0 -182 -71 -348t-191 -286t-286 -191t-348 -71t-348 71t-286 191t-191 286t-71 348t71 348t191 286t286 191t348 71t348 -71 |
| | | t286 -191t191 -286t71 -348z" /> |
| | | <glyph glyph-name="uniF2E0" unicode="" horiz-adv-x="1920" |
| | | d="M1334 302q-4 24 -27.5 34t-49.5 10.5t-48.5 12.5t-25.5 38q-5 47 33 139.5t75 181t32 127.5q-14 101 -117 103q-45 1 -75 -16l-3 -2l-5 -2.5t-4.5 -2t-5 -2t-5 -0.5t-6 1.5t-6 3.5t-6.5 5q-3 2 -9 8.5t-9 9t-8.5 7.5t-9.5 7.5t-9.5 5.5t-11 4.5t-11.5 2.5q-30 5 -48 -3 |
| | | t-45 -31q-1 -1 -9 -8.5t-12.5 -11t-15 -10t-16.5 -5.5t-17 3q-54 27 -84 40q-41 18 -94 -5t-76 -65q-16 -28 -41 -98.5t-43.5 -132.5t-40 -134t-21.5 -73q-22 -69 18.5 -119t110.5 -46q30 2 50.5 15t38.5 46q7 13 79 199.5t77 194.5q6 11 21.5 18t29.5 0q27 -15 21 -53 |
| | | q-2 -18 -51 -139.5t-50 -132.5q-6 -38 19.5 -56.5t60.5 -7t55 49.5q4 8 45.5 92t81.5 163.5t46 88.5q20 29 41 28q29 0 25 -38q-2 -16 -65.5 -147.5t-70.5 -159.5q-12 -53 13 -103t74 -74q17 -9 51 -15.5t71.5 -8t62.5 14t20 48.5zM383 86q3 -15 -5 -27.5t-23 -15.5 |
| | | q-14 -3 -26.5 5t-15.5 23q-3 14 5 27t22 16t27 -5t16 -23zM953 -177q12 -17 8.5 -37.5t-20.5 -32.5t-37.5 -8t-32.5 21q-11 17 -7.5 37.5t20.5 32.5t37.5 8t31.5 -21zM177 635q-18 -27 -49.5 -33t-57.5 13q-26 18 -32 50t12 58q18 27 49.5 33t57.5 -12q26 -19 32 -50.5 |
| | | t-12 -58.5zM1467 -42q19 -28 13 -61.5t-34 -52.5t-60.5 -13t-51.5 34t-13 61t33 53q28 19 60.5 13t52.5 -34zM1579 562q69 -113 42.5 -244.5t-134.5 -207.5q-90 -63 -199 -60q-20 -80 -84.5 -127t-143.5 -44.5t-140 57.5q-12 -9 -13 -10q-103 -71 -225 -48.5t-193 126.5 |
| | | q-50 73 -53 164q-83 14 -142.5 70.5t-80.5 128t-2 152t81 138.5q-36 60 -38 128t24.5 125t79.5 98.5t121 50.5q32 85 99 148t146.5 91.5t168 17t159.5 -66.5q72 21 140 17.5t128.5 -36t104.5 -80t67.5 -115t17.5 -140.5q52 -16 87 -57t45.5 -89t-5.5 -99.5t-58 -87.5z |
| | | M455 1222q14 -20 9.5 -44.5t-24.5 -38.5q-19 -14 -43.5 -9.5t-37.5 24.5q-14 20 -9.5 44.5t24.5 38.5q19 14 43.5 9.5t37.5 -24.5zM614 1503q4 -16 -5 -30.5t-26 -18.5t-31 5.5t-18 26.5q-3 17 6.5 31t25.5 18q17 4 31 -5.5t17 -26.5zM1800 555q4 -20 -6.5 -37t-30.5 -21 |
| | | q-19 -4 -36 6.5t-21 30.5t6.5 37t30.5 22q20 4 36.5 -7.5t20.5 -30.5zM1136 1448q16 -27 8.5 -58.5t-35.5 -47.5q-27 -16 -57.5 -8.5t-46.5 34.5q-16 28 -8.5 59t34.5 48t58 9t47 -36zM1882 792q4 -15 -4 -27.5t-23 -16.5q-15 -3 -27.5 5.5t-15.5 22.5q-3 15 5 28t23 16 |
| | | q14 3 26.5 -5t15.5 -23zM1691 1033q15 -22 10.5 -49t-26.5 -43q-22 -15 -49 -10t-42 27t-10 49t27 43t48.5 11t41.5 -28z" /> |
| | | <glyph glyph-name="uniF2E1" unicode="" horiz-adv-x="1792" |
| | | /> |
| | | <glyph glyph-name="uniF2E2" unicode="" horiz-adv-x="1792" |
| | | /> |
| | | <glyph glyph-name="uniF2E3" unicode="" horiz-adv-x="1792" |
| | | /> |
| | | <glyph glyph-name="uniF2E4" unicode="" horiz-adv-x="1792" |
| | | /> |
| | | <glyph glyph-name="uniF2E5" unicode="" horiz-adv-x="1792" |
| | | /> |
| | | <glyph glyph-name="uniF2E6" unicode="" horiz-adv-x="1792" |
| | | /> |
| | | <glyph glyph-name="uniF2E7" unicode="" horiz-adv-x="1792" |
| | | /> |
| | | <glyph glyph-name="_698" unicode="" horiz-adv-x="1792" |
| | | /> |
| | | <glyph glyph-name="uniF2E9" unicode="" horiz-adv-x="1792" |
| | | /> |
| | | <glyph glyph-name="uniF2EA" unicode="" horiz-adv-x="1792" |
| | | /> |
| | | <glyph glyph-name="uniF2EB" unicode="" horiz-adv-x="1792" |
| | | /> |
| | | <glyph glyph-name="uniF2EC" unicode="" horiz-adv-x="1792" |
| | | /> |
| | | <glyph glyph-name="uniF2ED" unicode="" horiz-adv-x="1792" |
| | | /> |
| | | <glyph glyph-name="uniF2EE" unicode="" horiz-adv-x="1792" |
| | | /> |
| | | <glyph glyph-name="lessequal" unicode="" horiz-adv-x="1792" |
| | | /> |
| | | </font> |
| | | </defs></svg> |
New file |
| | |
| | | <!doctype html> |
| | | <html> |
| | | <head> |
| | | <meta name="viewport" content="width=device-width, initial-scale=1.0, user-scalable=yes" /> |
| | | <title>模型预览</title> |
| | | |
| | | <script src="js/jquery.min.js"></script> |
| | | <script src="js/jqueryUI.js"></script> |
| | | <link rel="stylesheet" href="css/jquery-ui.css" /> |
| | | |
| | | <link href="https://fonts.googleapis.com/css?family=Titillium+Web" rel="stylesheet" /> |
| | | <link rel="shortcut icon" href="favicon.ico" /> |
| | | |
| | | <link rel="stylesheet" href="css/spectrum.css" /> |
| | | <link rel="stylesheet" href="css/font-awesome.min.css" /> |
| | | |
| | | <link rel="stylesheet" href="css/main_style.css" /> |
| | | |
| | | <!--Three.js scripts--> |
| | | <script src="js/three.js"></script> |
| | | |
| | | <script src="js/Projector.js"></script> |
| | | <script src="js/Detector.js"></script> |
| | | |
| | | <script src="js/loaders/MTLLoader.js"></script> |
| | | <script src="js/loaders/OBJLoader.js"></script> |
| | | <script src="js/loaders/ColladaLoader.js"></script> |
| | | <script src="js/loaders/inflate.min.js"></script> |
| | | <script src="js/loaders/FBXLoader.js"></script> |
| | | <script src="js/loaders/GLTFLoader.js"></script> |
| | | <script src="js/loaders/STLLoader.js"></script> |
| | | <script src="js/loaders/DDSLoader.js"></script> |
| | | |
| | | <script src="js/OrbitControls.js"></script> |
| | | <script src="js/TransformControls.js"></script> |
| | | |
| | | <script src="js/THREEx.FullScreen.js"></script> |
| | | <script src="js/THREEx.WindowResize.js"></script> |
| | | <script src="js/screenfull.min.js"></script> |
| | | |
| | | <!--Post-Processing--> |
| | | <script src="js/effects/EffectComposer.js"></script> |
| | | <script src="js/effects/ShaderPass.js"></script> |
| | | <script src="js/effects/RenderPass.js"></script> |
| | | <script src="js/effects/CopyShader.js"></script> |
| | | <script src="js/effects/OutlinePass.js"></script> |
| | | <script src="js/effects/FXAAShader.js"></script> |
| | | |
| | | <script src="js/jquery.nicescroll.js"></script> |
| | | <script src="js/spectrum.js"></script> |
| | | |
| | | <meta |
| | | name="viewport" |
| | | charset="UTF-8" |
| | | content="width=device-width, initial-scale=1, maximum-scale=1, user-scalable=0" |
| | | /> |
| | | |
| | | <script> |
| | | $(function () { |
| | | $('#red, #green, #blue, #ambient_red, #ambient_green, #ambient_blue').slider({ |
| | | orientation: 'horizontal', |
| | | range: 'min', |
| | | max: 255, |
| | | value: 127 //Default value, Light colour of model set to median value (grey colour) |
| | | }) |
| | | }) |
| | | </script> |
| | | |
| | | <script id="vertexShader" type="x-shader/x-vertex"> |
| | | uniform float p; |
| | | varying float intensity; |
| | | void main() |
| | | { |
| | | vec3 vNormal = normalize( normalMatrix * normal ); |
| | | intensity = pow(1.0 - abs(dot(vNormal, vec3(0, 0, 1))), p); |
| | | gl_Position = projectionMatrix * modelViewMatrix * vec4( position, 1.0 ); |
| | | } |
| | | </script> |
| | | |
| | | <script id="fragmentShader" type="x-shader/x-vertex"> |
| | | uniform vec3 glowColor; |
| | | varying float intensity; |
| | | void main() |
| | | { |
| | | vec3 glow = glowColor * intensity; |
| | | gl_FragColor = vec4( glow, 1.0 ); |
| | | } |
| | | </script> |
| | | |
| | | <script> |
| | | $(document).ready(function () { |
| | | $('#load_help') |
| | | .dialog({ |
| | | autoOpen: false, |
| | | width: 667 |
| | | }) |
| | | .css('font-size', '16px') |
| | | |
| | | $('.qBtn').click(function () { |
| | | $('#load_help').dialog('open') |
| | | }) |
| | | }) |
| | | </script> |
| | | </head> |
| | | |
| | | <body> |
| | | <div id="container"> |
| | | <div id="stats" style="display: none"></div> |
| | | <button id="collapse_side" style="display: none" title="Collapse Side Menu">←</button> |
| | | <!-- <button id="collapse_btm" title="Collapse Bottom Menu">↓</button> --> |
| | | |
| | | <!--Side Menu Start--> |
| | | <div style="display: none" id="customSlide" class="side_menu"> |
| | | <ul class="menu_item"> |
| | | <li id="header"> |
| | | <table style="width: 100%"> |
| | | <tr> |
| | | <th style="font-size: 15px">主题</th> |
| | | <th style="font-size: 11px"><button id="lightSkin">明亮</button></th> |
| | | <th style="font-size: 11px"><button id="darkSkin">暗黑</button></th> |
| | | </tr> |
| | | </table> |
| | | </li> |
| | | |
| | | <li class="dropdown"> |
| | | <a href="#"><img src="images/dir_light_icon.png" class="image" /> 灯光</a> |
| | | <ul> |
| | | <div class="customMenu"> |
| | | <li style="margin: 15px 0"><span>环境光</span></li> |
| | | <li> |
| | | <label class="switch"> |
| | | <input class="check" type="checkbox" id="ambient_light" /> |
| | | <span class="toggle round"></span> |
| | | </label> |
| | | </li> |
| | | </div> |
| | | <li><span style="font-size: 12px">R</span></li> |
| | | <li><div id="ambient_red"></div></li> |
| | | <li><span style="font-size: 12px">G</span></li> |
| | | <li><div id="ambient_green"></div></li> |
| | | <li><span style="font-size: 12px">B</span></li> |
| | | <li><div id="ambient_blue"></div></li> |
| | | |
| | | <li><hr style="margin-top: 15px" /></li> |
| | | <li style="margin: 15px 0">定向光</li> |
| | | <li><span style="font-size: 12px">R</span></li> |
| | | <li><div id="red"></div></li> |
| | | <li><span style="font-size: 12px">G</span></li> |
| | | <li><div id="green"></div></li> |
| | | <li><span style="font-size: 12px">B</span></li> |
| | | <li><div id="blue"></div></li> |
| | | |
| | | <li><hr style="margin-top: 15px" /></li> |
| | | <li style="margin: 15px 0">点光源</li> |
| | | <li style="margin: 15px 0"><span style="font-size: 12px">强度</span></li> |
| | | <li style="margin: 15px 0"><div id="point_light"></div></li> |
| | | </ul> |
| | | </li> |
| | | |
| | | <li class="dropdown"> |
| | | <a href="#"><img src="images/wireframe_cube.png" class="image" />线框视图</a> |
| | | <ul> |
| | | <div class="customMenu"> |
| | | <li style="margin: 15px 0"><span>线框</span></li> |
| | | <li> |
| | | <label class="switch"> |
| | | <input class="check" type="checkbox" name="mod_mat" id="wire_check" /> |
| | | <span class="toggle round"></span> |
| | | </label> |
| | | </li> |
| | | </div> |
| | | <div class="customMenu"> |
| | | <li><span>模型 + 线框</span></li> |
| | | <li> |
| | | <label class="switch"> |
| | | <input class="check" type="checkbox" name="mod_mat" id="model_wire" /> |
| | | <span class="toggle round"></span> |
| | | </label> |
| | | </li> |
| | | </div> |
| | | </ul> |
| | | </li> |
| | | |
| | | <!-- <li class="dropdown"> |
| | | <a href="#"><img src="images/phong_icon.png" class="image" />Phong Shading</a> |
| | | <ul> |
| | | <li><span>Phong Shading </span></li> |
| | | |
| | | <li> |
| | | <label class="switch"> |
| | | <input class="check" type="checkbox" name="mod_phong" id="phong_check" /> |
| | | <span class="toggle round"></span> |
| | | </label> |
| | | </li> |
| | | |
| | | <li><span style="font-size: 12px">Shininess</span></li> |
| | | <li><div id="shine"></div></li> |
| | | </ul> |
| | | </li> --> |
| | | |
| | | <li class="dropdown"> |
| | | <a href="#"><img src="images/XRay.png" class="image" />X 射线</a> |
| | | <ul> |
| | | <div style="margin: 10px 0" class="customMenu"> |
| | | <li><span>X 射线 </span></li> |
| | | <li> |
| | | <label class="switch"> |
| | | <input class="check" type="checkbox" name="mod_xray" id="xray_check" /> |
| | | <span class="toggle round"></span> |
| | | </label> |
| | | </li> |
| | | </div> |
| | | </ul> |
| | | </li> |
| | | |
| | | <li class="dropdown"> |
| | | <a href="#" |
| | | ><img src="images/glowing.png" width="32" height="32" class="image" />发光轮廓</a |
| | | > |
| | | <ul> |
| | | <div style="margin: 10px 0" class="customMenu"> |
| | | <li><span>发光轮廓</span></li> |
| | | <li> |
| | | <label class="switch"> |
| | | <input class="check" type="checkbox" name="mod_mat" id="glow_check" /> |
| | | <span class="toggle round"></span> |
| | | </label> |
| | | </li> |
| | | </div> |
| | | |
| | | <li style="margin: 5px 0"><span style="font-size: 12px">边缘强度</span></li> |
| | | <li style="margin: 10px 0"><div id="edgeStrength"></div></li> |
| | | |
| | | <div style="margin: 10px 0" class="customMenu"> |
| | | <li><span>选择发光颜色 </span></li> |
| | | <li><input type="text" class="glow_select" /></li> |
| | | <!-- <li><em id="basic-log"></em></li> 展示所选的十六进制颜色 --> |
| | | </div> |
| | | </ul> |
| | | </li> |
| | | |
| | | <li class="dropdown"> |
| | | <a href="#" |
| | | ><img src="images/smoothed.png" width="32" height="32" class="image" />平滑模型</a |
| | | > |
| | | <ul> |
| | | <div style="margin: 15px 0" class="customMenu"> |
| | | <li><span id="smooth-model" style="font-size: 15px">光滑模型</span></li> |
| | | <li> |
| | | <label class="switch"> |
| | | <input type="checkbox" id="smooth" /> |
| | | <span class="toggle round"></span> |
| | | </label> |
| | | </li> |
| | | </div> |
| | | </ul> |
| | | </li> |
| | | |
| | | <li class="dropdown"> |
| | | <a href="#"><img src="images/colour_pick.png" class="image" />设置背景色</a> |
| | | <ul> |
| | | <div style="margin: 15px 0" class="customMenu"> |
| | | <li><span>选择背景色</span></li> |
| | | <li><input type="text" class="bg_select" /></li> |
| | | </div> |
| | | <!-- <li><em id="basic_log"></em></li> 展示所选的十六进制颜色 --> |
| | | </ul> |
| | | </li> |
| | | |
| | | <li class="dropdown"> |
| | | <a href="#"><img src="images/rotation.png" class="image" />模型旋转</a> |
| | | <ul> |
| | | <div style="margin: 15px 0" class="customMenu"> |
| | | <li style="display: inline-block; margin: 0 35px 0 0"><span>自动旋转</span></li> |
| | | <li> |
| | | <label class="switch"> |
| | | <input type="checkbox" id="rotation" /> |
| | | <span class="toggle round"></span> |
| | | </label> |
| | | </li> |
| | | </div> |
| | | <li style="margin: 15px 0" style="display: inline-block"> |
| | | <span>旋转速度</span> |
| | | <span style="margin: 5px 0" id="rot_slider"></span> |
| | | </li> |
| | | <!-- <li>Fix Rotation of Imported Models<hr style="margin-top:0px" /></li> |
| | | |
| | | <li> |
| | | <div id="rotation"> |
| | | <div class="radioBtn"> |
| | | <input type="radio" id="r1" name="rotate" value="rotateX"> Rotate X |
| | | </div> |
| | | |
| | | <div class="radioBtn"> |
| | | <input type="radio" id="r2" name="rotate" value="rotateY"> Rotate Y |
| | | </div> |
| | | |
| | | <div class="radioBtn"> |
| | | <input type="radio" id="r3" name="rotate" value="rotateZ"> Rotate Z |
| | | </div> |
| | | </div> |
| | | </li> --> |
| | | |
| | | <!-- <li><button class="resetRotateButton" type='reset' id="reset_rot">Reset</button></li> --> |
| | | </ul> |
| | | </li> |
| | | |
| | | <li class="dropdown"> |
| | | <a href="#"><img src="images/scale.png" class="image" />变换模型</a> |
| | | <ul> |
| | | <li style="margin: 15px 0; margin-left: 25px; font-size: 15px"> |
| | | <label for="transform" class="customMenu"> |
| | | 附加变换控制: |
| | | <label class="switch helper"> |
| | | <input type="checkbox" id="transform" /> |
| | | <span class="toggle grid round"></span> |
| | | </label> |
| | | </label> |
| | | </li> |
| | | <li id="transformKey">快捷键: S: (Scale), T: (Translate), R: (Rotate)</li> |
| | | |
| | | <li style="text-align: center; margin-top: 8px; font-size: 15px"> |
| | | <span>放大:</span> <button |
| | | id="scale_up" |
| | | style="margin: 0 35px 0 0" |
| | | type="button" |
| | | > |
| | | + |
| | | </button> |
| | | <span>缩小:</span> <button id="scale_down" type="button">-</button> |
| | | </li> |
| | | </ul> |
| | | </li> |
| | | |
| | | <li class="dropdown"> |
| | | <a href="#"><img src="images/grid.png" class="image" />模型视图助手</a> |
| | | <ul style="font-size: 13.5px"> |
| | | <li |
| | | style=" |
| | | display: inline-flex; |
| | | line-height: 45px; |
| | | align-items: center; |
| | | margin: 0 25px 0 0; |
| | | " |
| | | > |
| | | <span style="font-size: 15px">网格</span> |
| | | <label class="switch helper"> |
| | | <input type="checkbox" id="grid" /> |
| | | <span class="toggle grid round"></span> |
| | | </label> |
| | | </li> |
| | | <li |
| | | style=" |
| | | display: inline-flex; |
| | | line-height: 40px; |
| | | align-items: center; |
| | | margin: 0 25px 0 0; |
| | | " |
| | | > |
| | | <span style="font-size: 15px">极坐标网格</span> |
| | | <label class="switch helper"> |
| | | <input type="checkbox" id="polar_grid" /> |
| | | <span class="toggle grid round"></span> |
| | | </label> |
| | | </li> |
| | | <li |
| | | style=" |
| | | display: inline-flex; |
| | | line-height: 40px; |
| | | align-items: center; |
| | | margin: 0 25px 0 0; |
| | | " |
| | | > |
| | | <span style="font-size: 15px">轴</span> |
| | | <label class="switch helper"> |
| | | <input type="checkbox" id="axis" /> |
| | | <span class="toggle grid round"></span> |
| | | </label> |
| | | </li> |
| | | <li |
| | | style=" |
| | | display: inline-flex; |
| | | line-height: 40px; |
| | | align-items: center; |
| | | margin: 0 25px 0 0; |
| | | " |
| | | > |
| | | <span style="font-size: 15px">模型盒子</span> |
| | | <label class="switch helper"> |
| | | <input type="checkbox" id="bBox" /> |
| | | <span class="toggle grid round"></span> |
| | | </label> |
| | | </li> |
| | | </ul> |
| | | </li> |
| | | |
| | | <!-- <li class='dropdown'> |
| | | <a href='#'><img src="images/folder_icon.png" class="image" />Select/Drop Model File</a> |
| | | <ul> |
| | | <li style="background: #d9d9f2; color: black; text-align: center">Select from button or drag and drop model onto the viewer</li> |
| | | |
| | | <li style="margin-top: 12px; margin-bottom: 16px;"> |
| | | <label for="obj_file" class="model-upload"> |
| | | <i style="margin-right: 5px;" class="fa fa-upload"></i> Load Model |
| | | </label> |
| | | <button class="qBtn" id="q_btn" title="Model Loading Help"><i class="fa fa-question-circle q_mark"></i></button> |
| | | </li> |
| | | <li><input onclick="this.value=null;" type="file" id="obj_file" /></li> |
| | | |
| | | <li style="margin-top: 12px; margin-bottom: 16px;"> |
| | | <label for="modelPlusTexture" class="model-upload"> |
| | | <i style="margin-right: 5px;" class="fa fa-upload"></i> Model and Textures |
| | | </label> |
| | | </li> |
| | | <li><input id="modelPlusTexture" type="file" name="files[]" multiple="" class="model-upload"></li> |
| | | |
| | | <li><button type="button" id="remove"><i style="margin-right: 5px;" class="fa fa-trash"></i> Remove file</button></li> |
| | | <li><output id="result" /></li> |
| | | </ul> |
| | | </li> --> |
| | | </ul> |
| | | |
| | | <!-- <div id="load_help" title="Loading Models"> |
| | | <p>Locate the model file you wish to view. Textures/associated images of the model |
| | | are supported (.obj, .gltf, .fbx and .dae formats), make sure the images and model file are in the same folder |
| | | on your machine. |
| | | </p> |
| | | <h4>Supported File Types</h4> |
| | | <ul > |
| | | <li><span style="color: green">.obj (+ .mtl)</span></li> |
| | | <li><span style="color: green">.stl</span></li> |
| | | <li><span style="color: green">.dae (Collada)</span></li> |
| | | <li><span style="color: green">.glTF</span></li> |
| | | <li><span style="color: green">.FBX</span></li> |
| | | </ul> |
| | | <p> |
| | | <h4>Model Sizes</h4> |
| | | <hr /> |
| | | Some Models may be out of view of the camera on load. Try to use the mouse wheel and the |
| | | scale up/scale down buttons to see if the model comes into view. |
| | | </p> |
| | | <p> |
| | | <h4>Object Rotation</h4> |
| | | <hr /> |
| | | Some Models load with a different up axis, depending on the software used to create the model. |
| | | The model rotation section contains radio buttons to rotate the model in the x, y or z direction |
| | | in order to fix the orientation for viewing your model. Most often <b>X axis</b> rotation is the one required. |
| | | </p> |
| | | <p> |
| | | <h4>Model Loads in Black</h4> |
| | | <hr /> |
| | | Some Models may load in black, try using the smooth model checkbox, to compute the vertex and face Normals. |
| | | </p> |
| | | </div> --> |
| | | |
| | | <div id="disp_tmp_path"></div> |
| | | </div> |
| | | <!--Side Menu End--> |
| | | |
| | | <!--Bottom Menu Start--> |
| | | <!-- <div id="bottom_menu"> |
| | | <ul class="bottom_menu_item"> |
| | | <li class="dropdown"> |
| | | <a href="#"><img src="images/rotation.png" class="image" />Model Rotation</a> |
| | | <ul> |
| | | <li style="display: inline-block; margin: 0 35px 0 0"><span>Auto Rotate</span></li> |
| | | <li style="display: inline-block"> |
| | | <span>Set Rotation Speed</span> |
| | | <span id="rot_slider"></span> |
| | | </li> |
| | | <li> |
| | | <label class="switch"> |
| | | <input type="checkbox" id="rotation" /> |
| | | <span class="toggle round"></span> |
| | | </label> |
| | | </li> |
| | | <li>Fix Rotation of Imported Models<hr style="margin-top:0px" /></li> |
| | | |
| | | <li> |
| | | <div id="rotation"> |
| | | <div class="radioBtn"> |
| | | <input type="radio" id="r1" name="rotate" value="rotateX"> Rotate X |
| | | </div> |
| | | |
| | | <div class="radioBtn"> |
| | | <input type="radio" id="r2" name="rotate" value="rotateY"> Rotate Y |
| | | </div> |
| | | |
| | | <div class="radioBtn"> |
| | | <input type="radio" id="r3" name="rotate" value="rotateZ"> Rotate Z |
| | | </div> |
| | | </div> |
| | | </li> |
| | | |
| | | <li><button class="resetRotateButton" type='reset' id="reset_rot">Reset</button></li> |
| | | </ul> |
| | | </li> |
| | | |
| | | <li class="dropdown"> |
| | | <a href="#"><img src="images/scale.png" class="image" />Transform Model</a> |
| | | <ul> |
| | | <li style="margin-left: 25px; font-size: 15px"> |
| | | <label for="transform"> |
| | | Attach Transform Controls: |
| | | <label class="switch helper"> |
| | | <input type="checkbox" id="transform" /> |
| | | <span class="toggle grid round"></span> |
| | | </label> |
| | | </label> |
| | | </li> |
| | | <li id="transformKey">Press S: (Scale), T: (Translate), R: (Rotate)</li> |
| | | |
| | | <li style="text-align: center; margin-top: 8px; font-size: 15px"> |
| | | <span>Scale Up:</span> <button |
| | | id="scale_up" |
| | | style="margin: 0 35px 0 0" |
| | | type="button" |
| | | > |
| | | + |
| | | </button> |
| | | <span>Scale Down:</span> <button id="scale_down" type="button">-</button> |
| | | </li> |
| | | </ul> |
| | | </li> |
| | | |
| | | <li class="dropdown"> |
| | | <a href="#"><img src="images/grid.png" class="image" />Model View Helpers</a> |
| | | <ul style="font-size: 13.5px"> |
| | | <li style="display: inline-block; margin: 0 25px 0 0"> |
| | | <span style="font-size: 18px">Grid</span> |
| | | <label class="switch helper"> |
| | | <input type="checkbox" id="grid" /> |
| | | <span class="toggle grid round"></span> |
| | | </label> |
| | | </li> |
| | | <li style="display: inline-block; margin: 0 25px 0 0"> |
| | | <span style="font-size: 18px">Polar-grid</span> |
| | | <label class="switch helper"> |
| | | <input type="checkbox" id="polar_grid" /> |
| | | <span class="toggle grid round"></span> |
| | | </label> |
| | | </li> |
| | | <li style="display: inline-block; margin: 0 25px 0 0"> |
| | | <span style="font-size: 18px">Axis</span> |
| | | <label class="switch helper"> |
| | | <input type="checkbox" id="axis" /> |
| | | <span class="toggle grid round"></span> |
| | | </label> |
| | | </li> |
| | | <li style="display: inline-block; margin: 0 25px 0 0"> |
| | | <span style="font-size: 18px">Model Box</span> |
| | | <label class="switch helper"> |
| | | <input type="checkbox" id="bBox" /> |
| | | <span class="toggle grid round"></span> |
| | | </label> |
| | | </li> |
| | | </ul> |
| | | </li> |
| | | </ul> |
| | | </div> --> |
| | | <!--Bottom Menu End--> |
| | | |
| | | <div id="main_viewer"></div> |
| | | |
| | | <div id="fullscreen"> |
| | | <button |
| | | id="fullscreenBtn" |
| | | title="Fullscreen Mode" |
| | | style="border: 0; float: right; background: transparent" |
| | | > |
| | | <img src="images/fullscreen.png" width="30" height="30" alt="fullscreen" /> |
| | | </button> |
| | | </div> |
| | | |
| | | <div id="sampleMods" style="display: none"> |
| | | Models |
| | | <br /> |
| | | <div class="select"> |
| | | <select id="scenes_list" onchange="selectModel();"> |
| | | <option>models</option> |
| | | <!-- <option>Crash Model (165 KB)</option> --> |
| | | <!-- <option>Bear Model (113 KB)</option> |
| | | <option>Car Model (1.33 MB)</option> |
| | | <option>Tiger Model (3.77 MB)</option> |
| | | <option>Dinosaur Model (5.07 MB)</option> |
| | | <option>Skeleton Model (5.52 MB)</option> --> |
| | | </select> |
| | | <br /><br /> |
| | | </div> |
| | | </div> |
| | | |
| | | <div id="anims"> |
| | | <span>Select Animation</span> |
| | | <div class="select"> |
| | | <select id="animationSelect"></select> |
| | | </div> |
| | | <br /> |
| | | <button class="animBtn" id="play">Play</button> |
| | | <button class="animBtn" id="stop">Stop</button> |
| | | <button class="animBtn" id="playAll">Play All</button> |
| | | </div> |
| | | |
| | | <script src="js/menu.js"></script> |
| | | <script src="js/utils.js"></script> |
| | | <script src="js/main.js"></script> |
| | | <script src="js/userModelTextures.js"></script> |
| | | <script src="js/userModel.js"></script> |
| | | </div> |
| | | <script src="js/ColourTheme.js"></script> |
| | | <script> |
| | | $(document).ready(function () { |
| | | $('html').niceScroll({ styler: 'fb', cursorcolor: '#000' }) |
| | | $('#stats').niceScroll({ horizrailenabled: false }) |
| | | }) |
| | | </script> |
| | | </body> |
| | | </html> |
New file |
| | |
| | | /** |
| | | * @author mrdoob / http://mrdoob.com/ |
| | | */ |
| | | |
| | | THREE.SpriteCanvasMaterial = function (parameters) { |
| | | |
| | | THREE.Material.call(this); |
| | | |
| | | this.type = 'SpriteCanvasMaterial'; |
| | | |
| | | this.color = new THREE.Color(0xffffff); |
| | | this.program = function () { }; |
| | | |
| | | this.setValues(parameters); |
| | | |
| | | }; |
| | | |
| | | THREE.SpriteCanvasMaterial.prototype = Object.create(THREE.Material.prototype); |
| | | THREE.SpriteCanvasMaterial.prototype.constructor = THREE.SpriteCanvasMaterial; |
| | | THREE.SpriteCanvasMaterial.prototype.isSpriteCanvasMaterial = true; |
| | | |
| | | THREE.SpriteCanvasMaterial.prototype.clone = function () { |
| | | |
| | | var material = new THREE.SpriteCanvasMaterial(); |
| | | |
| | | material.copy(this); |
| | | material.color.copy(this.color); |
| | | material.program = this.program; |
| | | |
| | | return material; |
| | | |
| | | }; |
| | | |
| | | // |
| | | |
| | | THREE.CanvasRenderer = function (parameters) { |
| | | |
| | | console.log('THREE.CanvasRenderer', THREE.REVISION); |
| | | |
| | | parameters = parameters || {}; |
| | | |
| | | var _this = this, |
| | | _renderData, _elements, _lights, |
| | | _projector = new THREE.Projector(), |
| | | |
| | | _canvas = parameters.canvas !== undefined |
| | | ? parameters.canvas |
| | | : document.createElement('canvas'), |
| | | |
| | | _canvasWidth = _canvas.width, |
| | | _canvasHeight = _canvas.height, |
| | | _canvasWidthHalf = Math.floor(_canvasWidth / 2), |
| | | _canvasHeightHalf = Math.floor(_canvasHeight / 2), |
| | | |
| | | _viewportX = 0, |
| | | _viewportY = 0, |
| | | _viewportWidth = _canvasWidth, |
| | | _viewportHeight = _canvasHeight, |
| | | |
| | | _pixelRatio = 1, |
| | | |
| | | _context = _canvas.getContext('2d', { |
| | | alpha: parameters.alpha === true |
| | | }), |
| | | |
| | | _clearColor = new THREE.Color(0x000000), |
| | | _clearAlpha = parameters.alpha === true ? 0 : 1, |
| | | |
| | | _contextGlobalAlpha = 1, |
| | | _contextGlobalCompositeOperation = 0, |
| | | _contextStrokeStyle = null, |
| | | _contextFillStyle = null, |
| | | _contextLineWidth = null, |
| | | _contextLineCap = null, |
| | | _contextLineJoin = null, |
| | | _contextLineDash = [], |
| | | |
| | | _v1, _v2, _v3, |
| | | |
| | | _v1x, _v1y, _v2x, _v2y, _v3x, _v3y, |
| | | |
| | | _color = new THREE.Color(), |
| | | |
| | | _diffuseColor = new THREE.Color(), |
| | | _emissiveColor = new THREE.Color(), |
| | | |
| | | _lightColor = new THREE.Color(), |
| | | |
| | | _patterns = {}, |
| | | |
| | | _uvs, |
| | | _uv1x, _uv1y, _uv2x, _uv2y, _uv3x, _uv3y, |
| | | |
| | | _clipBox = new THREE.Box2(), |
| | | _clearBox = new THREE.Box2(), |
| | | _elemBox = new THREE.Box2(), |
| | | |
| | | _ambientLight = new THREE.Color(), |
| | | _directionalLights = new THREE.Color(), |
| | | _pointLights = new THREE.Color(), |
| | | |
| | | _vector3 = new THREE.Vector3(), // Needed for PointLight |
| | | _centroid = new THREE.Vector3(), |
| | | _normal = new THREE.Vector3(), |
| | | _normalViewMatrix = new THREE.Matrix3(); |
| | | |
| | | /* TODO |
| | | _canvas.mozImageSmoothingEnabled = false; |
| | | _canvas.webkitImageSmoothingEnabled = false; |
| | | _canvas.msImageSmoothingEnabled = false; |
| | | _canvas.imageSmoothingEnabled = false; |
| | | */ |
| | | |
| | | // dash+gap fallbacks for Firefox and everything else |
| | | |
| | | if (_context.setLineDash === undefined) { |
| | | |
| | | _context.setLineDash = function () { }; |
| | | |
| | | } |
| | | |
| | | this.domElement = _canvas; |
| | | |
| | | this.autoClear = true; |
| | | this.sortObjects = true; |
| | | this.sortElements = true; |
| | | |
| | | this.info = { |
| | | |
| | | render: { |
| | | |
| | | vertices: 0, |
| | | faces: 0 |
| | | |
| | | } |
| | | |
| | | }; |
| | | |
| | | // WebGLRenderer compatibility |
| | | |
| | | this.supportsVertexTextures = function () { }; |
| | | this.setFaceCulling = function () { }; |
| | | |
| | | // API |
| | | |
| | | this.getContext = function () { |
| | | |
| | | return _context; |
| | | |
| | | }; |
| | | |
| | | this.getContextAttributes = function () { |
| | | |
| | | return _context.getContextAttributes(); |
| | | |
| | | }; |
| | | |
| | | this.getPixelRatio = function () { |
| | | |
| | | return _pixelRatio; |
| | | |
| | | }; |
| | | |
| | | this.setPixelRatio = function (value) { |
| | | |
| | | if (value !== undefined) _pixelRatio = value; |
| | | |
| | | }; |
| | | |
| | | this.setSize = function (width, height, updateStyle) { |
| | | |
| | | _canvasWidth = width * _pixelRatio; |
| | | _canvasHeight = height * _pixelRatio; |
| | | |
| | | _canvas.width = _canvasWidth; |
| | | _canvas.height = _canvasHeight; |
| | | |
| | | _canvasWidthHalf = Math.floor(_canvasWidth / 2); |
| | | _canvasHeightHalf = Math.floor(_canvasHeight / 2); |
| | | |
| | | if (updateStyle !== false) { |
| | | |
| | | _canvas.style.width = width + 'px'; |
| | | _canvas.style.height = height + 'px'; |
| | | |
| | | } |
| | | |
| | | _clipBox.min.set(-_canvasWidthHalf, -_canvasHeightHalf); |
| | | _clipBox.max.set(_canvasWidthHalf, _canvasHeightHalf); |
| | | |
| | | _clearBox.min.set(-_canvasWidthHalf, -_canvasHeightHalf); |
| | | _clearBox.max.set(_canvasWidthHalf, _canvasHeightHalf); |
| | | |
| | | _contextGlobalAlpha = 1; |
| | | _contextGlobalCompositeOperation = 0; |
| | | _contextStrokeStyle = null; |
| | | _contextFillStyle = null; |
| | | _contextLineWidth = null; |
| | | _contextLineCap = null; |
| | | _contextLineJoin = null; |
| | | |
| | | this.setViewport(0, 0, width, height); |
| | | |
| | | }; |
| | | |
| | | this.setViewport = function (x, y, width, height) { |
| | | |
| | | _viewportX = x * _pixelRatio; |
| | | _viewportY = y * _pixelRatio; |
| | | |
| | | _viewportWidth = width * _pixelRatio; |
| | | _viewportHeight = height * _pixelRatio; |
| | | |
| | | }; |
| | | |
| | | this.setScissor = function () { }; |
| | | this.setScissorTest = function () { }; |
| | | |
| | | this.setClearColor = function (color, alpha) { |
| | | |
| | | _clearColor.set(color); |
| | | _clearAlpha = alpha !== undefined ? alpha : 1; |
| | | |
| | | _clearBox.min.set(-_canvasWidthHalf, -_canvasHeightHalf); |
| | | _clearBox.max.set(_canvasWidthHalf, _canvasHeightHalf); |
| | | |
| | | }; |
| | | |
| | | this.setClearColorHex = function (hex, alpha) { |
| | | |
| | | console.warn('THREE.CanvasRenderer: .setClearColorHex() is being removed. Use .setClearColor() instead.'); |
| | | this.setClearColor(hex, alpha); |
| | | |
| | | }; |
| | | |
| | | this.getClearColor = function () { |
| | | |
| | | return _clearColor; |
| | | |
| | | }; |
| | | |
| | | this.getClearAlpha = function () { |
| | | |
| | | return _clearAlpha; |
| | | |
| | | }; |
| | | |
| | | this.getMaxAnisotropy = function () { |
| | | |
| | | return 0; |
| | | |
| | | }; |
| | | |
| | | this.clear = function () { |
| | | |
| | | if (_clearBox.isEmpty() === false) { |
| | | |
| | | _clearBox.intersect(_clipBox); |
| | | _clearBox.expandByScalar(2); |
| | | |
| | | _clearBox.min.x = _clearBox.min.x + _canvasWidthHalf; |
| | | _clearBox.min.y = -_clearBox.min.y + _canvasHeightHalf; // higher y value ! |
| | | _clearBox.max.x = _clearBox.max.x + _canvasWidthHalf; |
| | | _clearBox.max.y = -_clearBox.max.y + _canvasHeightHalf; // lower y value ! |
| | | |
| | | if (_clearAlpha < 1) { |
| | | |
| | | _context.clearRect( |
| | | _clearBox.min.x | 0, |
| | | _clearBox.max.y | 0, |
| | | (_clearBox.max.x - _clearBox.min.x) | 0, |
| | | (_clearBox.min.y - _clearBox.max.y) | 0 |
| | | ); |
| | | |
| | | } |
| | | |
| | | if (_clearAlpha > 0) { |
| | | |
| | | setOpacity(1); |
| | | setBlending(THREE.NormalBlending); |
| | | |
| | | setFillStyle('rgba(' + Math.floor(_clearColor.r * 255) + ',' + Math.floor(_clearColor.g * 255) + ',' + Math.floor(_clearColor.b * 255) + ',' + _clearAlpha + ')'); |
| | | |
| | | _context.fillRect( |
| | | _clearBox.min.x | 0, |
| | | _clearBox.max.y | 0, |
| | | (_clearBox.max.x - _clearBox.min.x) | 0, |
| | | (_clearBox.min.y - _clearBox.max.y) | 0 |
| | | ); |
| | | |
| | | } |
| | | |
| | | _clearBox.makeEmpty(); |
| | | |
| | | } |
| | | |
| | | }; |
| | | |
| | | // compatibility |
| | | |
| | | this.clearColor = function () { }; |
| | | this.clearDepth = function () { }; |
| | | this.clearStencil = function () { }; |
| | | |
| | | this.render = function (scene, camera) { |
| | | |
| | | if (camera.isCamera === undefined) { |
| | | |
| | | console.error('THREE.CanvasRenderer.render: camera is not an instance of THREE.Camera.'); |
| | | return; |
| | | |
| | | } |
| | | |
| | | var background = scene.background; |
| | | |
| | | if (background && background.isColor) { |
| | | |
| | | setOpacity(1); |
| | | setBlending(THREE.NormalBlending); |
| | | |
| | | setFillStyle(background.getStyle()); |
| | | _context.fillRect(0, 0, _canvasWidth, _canvasHeight); |
| | | |
| | | } else if (this.autoClear === true) { |
| | | |
| | | this.clear(); |
| | | |
| | | } |
| | | |
| | | _this.info.render.vertices = 0; |
| | | _this.info.render.faces = 0; |
| | | |
| | | _context.setTransform(_viewportWidth / _canvasWidth, 0, 0, -_viewportHeight / _canvasHeight, _viewportX, _canvasHeight - _viewportY); |
| | | _context.translate(_canvasWidthHalf, _canvasHeightHalf); |
| | | |
| | | _renderData = _projector.projectScene(scene, camera, this.sortObjects, this.sortElements); |
| | | _elements = _renderData.elements; |
| | | _lights = _renderData.lights; |
| | | |
| | | _normalViewMatrix.getNormalMatrix(camera.matrixWorldInverse); |
| | | |
| | | /* DEBUG |
| | | setFillStyle( 'rgba( 0, 255, 255, 0.5 )' ); |
| | | _context.fillRect( _clipBox.min.x, _clipBox.min.y, _clipBox.max.x - _clipBox.min.x, _clipBox.max.y - _clipBox.min.y ); |
| | | */ |
| | | |
| | | calculateLights(); |
| | | |
| | | for (var e = 0, el = _elements.length; e < el; e++) { |
| | | |
| | | var element = _elements[e]; |
| | | |
| | | var material = element.material; |
| | | |
| | | if (material === undefined || material.opacity === 0) continue; |
| | | |
| | | _elemBox.makeEmpty(); |
| | | |
| | | if (element instanceof THREE.RenderableSprite) { |
| | | |
| | | _v1 = element; |
| | | _v1.x *= _canvasWidthHalf; _v1.y *= _canvasHeightHalf; |
| | | |
| | | renderSprite(_v1, element, material); |
| | | |
| | | } else if (element instanceof THREE.RenderableLine) { |
| | | |
| | | _v1 = element.v1; _v2 = element.v2; |
| | | |
| | | _v1.positionScreen.x *= _canvasWidthHalf; _v1.positionScreen.y *= _canvasHeightHalf; |
| | | _v2.positionScreen.x *= _canvasWidthHalf; _v2.positionScreen.y *= _canvasHeightHalf; |
| | | |
| | | _elemBox.setFromPoints([ |
| | | _v1.positionScreen, |
| | | _v2.positionScreen |
| | | ]); |
| | | |
| | | if (_clipBox.intersectsBox(_elemBox) === true) { |
| | | |
| | | renderLine(_v1, _v2, element, material); |
| | | |
| | | } |
| | | |
| | | } else if (element instanceof THREE.RenderableFace) { |
| | | |
| | | _v1 = element.v1; _v2 = element.v2; _v3 = element.v3; |
| | | |
| | | if (_v1.positionScreen.z < -1 || _v1.positionScreen.z > 1) continue; |
| | | if (_v2.positionScreen.z < -1 || _v2.positionScreen.z > 1) continue; |
| | | if (_v3.positionScreen.z < -1 || _v3.positionScreen.z > 1) continue; |
| | | |
| | | _v1.positionScreen.x *= _canvasWidthHalf; _v1.positionScreen.y *= _canvasHeightHalf; |
| | | _v2.positionScreen.x *= _canvasWidthHalf; _v2.positionScreen.y *= _canvasHeightHalf; |
| | | _v3.positionScreen.x *= _canvasWidthHalf; _v3.positionScreen.y *= _canvasHeightHalf; |
| | | |
| | | if (material.overdraw > 0) { |
| | | |
| | | expand(_v1.positionScreen, _v2.positionScreen, material.overdraw); |
| | | expand(_v2.positionScreen, _v3.positionScreen, material.overdraw); |
| | | expand(_v3.positionScreen, _v1.positionScreen, material.overdraw); |
| | | |
| | | } |
| | | |
| | | _elemBox.setFromPoints([ |
| | | _v1.positionScreen, |
| | | _v2.positionScreen, |
| | | _v3.positionScreen |
| | | ]); |
| | | |
| | | if (_clipBox.intersectsBox(_elemBox) === true) { |
| | | |
| | | renderFace3(_v1, _v2, _v3, 0, 1, 2, element, material); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | /* DEBUG |
| | | setLineWidth( 1 ); |
| | | setStrokeStyle( 'rgba( 0, 255, 0, 0.5 )' ); |
| | | _context.strokeRect( _elemBox.min.x, _elemBox.min.y, _elemBox.max.x - _elemBox.min.x, _elemBox.max.y - _elemBox.min.y ); |
| | | */ |
| | | |
| | | _clearBox.union(_elemBox); |
| | | |
| | | } |
| | | |
| | | /* DEBUG |
| | | setLineWidth( 1 ); |
| | | setStrokeStyle( 'rgba( 255, 0, 0, 0.5 )' ); |
| | | _context.strokeRect( _clearBox.min.x, _clearBox.min.y, _clearBox.max.x - _clearBox.min.x, _clearBox.max.y - _clearBox.min.y ); |
| | | */ |
| | | |
| | | _context.setTransform(1, 0, 0, 1, 0, 0); |
| | | |
| | | }; |
| | | |
| | | // |
| | | |
| | | function calculateLights() { |
| | | |
| | | _ambientLight.setRGB(0, 0, 0); |
| | | _directionalLights.setRGB(0, 0, 0); |
| | | _pointLights.setRGB(0, 0, 0); |
| | | |
| | | for (var l = 0, ll = _lights.length; l < ll; l++) { |
| | | |
| | | var light = _lights[l]; |
| | | var lightColor = light.color; |
| | | |
| | | if (light.isAmbientLight) { |
| | | |
| | | _ambientLight.add(lightColor); |
| | | |
| | | } else if (light.isDirectionalLight) { |
| | | |
| | | // for sprites |
| | | |
| | | _directionalLights.add(lightColor); |
| | | |
| | | } else if (light.isPointLight) { |
| | | |
| | | // for sprites |
| | | |
| | | _pointLights.add(lightColor); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | function calculateLight(position, normal, color) { |
| | | |
| | | for (var l = 0, ll = _lights.length; l < ll; l++) { |
| | | |
| | | var light = _lights[l]; |
| | | |
| | | _lightColor.copy(light.color); |
| | | |
| | | if (light.isDirectionalLight) { |
| | | |
| | | var lightPosition = _vector3.setFromMatrixPosition(light.matrixWorld).normalize(); |
| | | |
| | | var amount = normal.dot(lightPosition); |
| | | |
| | | if (amount <= 0) continue; |
| | | |
| | | amount *= light.intensity; |
| | | |
| | | color.add(_lightColor.multiplyScalar(amount)); |
| | | |
| | | } else if (light.isPointLight) { |
| | | |
| | | var lightPosition = _vector3.setFromMatrixPosition(light.matrixWorld); |
| | | |
| | | var amount = normal.dot(_vector3.subVectors(lightPosition, position).normalize()); |
| | | |
| | | if (amount <= 0) continue; |
| | | |
| | | amount *= light.distance == 0 ? 1 : 1 - Math.min(position.distanceTo(lightPosition) / light.distance, 1); |
| | | |
| | | if (amount == 0) continue; |
| | | |
| | | amount *= light.intensity; |
| | | |
| | | color.add(_lightColor.multiplyScalar(amount)); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | function renderSprite(v1, element, material) { |
| | | |
| | | setOpacity(material.opacity); |
| | | setBlending(material.blending); |
| | | |
| | | var scaleX = element.scale.x * _canvasWidthHalf; |
| | | var scaleY = element.scale.y * _canvasHeightHalf; |
| | | |
| | | var dist = Math.sqrt(scaleX * scaleX + scaleY * scaleY); // allow for rotated sprite |
| | | _elemBox.min.set(v1.x - dist, v1.y - dist); |
| | | _elemBox.max.set(v1.x + dist, v1.y + dist); |
| | | |
| | | if (material.isSpriteMaterial) { |
| | | |
| | | var texture = material.map; |
| | | |
| | | if (texture !== null) { |
| | | |
| | | var pattern = _patterns[texture.id]; |
| | | |
| | | if (pattern === undefined || pattern.version !== texture.version) { |
| | | |
| | | pattern = textureToPattern(texture); |
| | | _patterns[texture.id] = pattern; |
| | | |
| | | } |
| | | |
| | | if (pattern.canvas !== undefined) { |
| | | |
| | | setFillStyle(pattern.canvas); |
| | | |
| | | var bitmap = texture.image; |
| | | |
| | | var ox = bitmap.width * texture.offset.x; |
| | | var oy = bitmap.height * texture.offset.y; |
| | | |
| | | var sx = bitmap.width * texture.repeat.x; |
| | | var sy = bitmap.height * texture.repeat.y; |
| | | |
| | | var cx = scaleX / sx; |
| | | var cy = scaleY / sy; |
| | | |
| | | _context.save(); |
| | | _context.translate(v1.x, v1.y); |
| | | if (material.rotation !== 0) _context.rotate(material.rotation); |
| | | _context.translate(-scaleX / 2, -scaleY / 2); |
| | | _context.scale(cx, cy); |
| | | _context.translate(-ox, -oy); |
| | | _context.fillRect(ox, oy, sx, sy); |
| | | _context.restore(); |
| | | |
| | | } |
| | | |
| | | } else { |
| | | |
| | | // no texture |
| | | |
| | | setFillStyle(material.color.getStyle()); |
| | | |
| | | _context.save(); |
| | | _context.translate(v1.x, v1.y); |
| | | if (material.rotation !== 0) _context.rotate(material.rotation); |
| | | _context.scale(scaleX, -scaleY); |
| | | _context.fillRect(-0.5, -0.5, 1, 1); |
| | | _context.restore(); |
| | | |
| | | } |
| | | |
| | | } else if (material.isSpriteCanvasMaterial) { |
| | | |
| | | setStrokeStyle(material.color.getStyle()); |
| | | setFillStyle(material.color.getStyle()); |
| | | |
| | | _context.save(); |
| | | _context.translate(v1.x, v1.y); |
| | | if (material.rotation !== 0) _context.rotate(material.rotation); |
| | | _context.scale(scaleX, scaleY); |
| | | |
| | | material.program(_context); |
| | | |
| | | _context.restore(); |
| | | |
| | | } else if (material.isPointsMaterial) { |
| | | |
| | | setFillStyle(material.color.getStyle()); |
| | | |
| | | _context.save(); |
| | | _context.translate(v1.x, v1.y); |
| | | if (material.rotation !== 0) _context.rotate(material.rotation); |
| | | _context.scale(scaleX * material.size, -scaleY * material.size); |
| | | _context.fillRect(-0.5, -0.5, 1, 1); |
| | | _context.restore(); |
| | | |
| | | } |
| | | |
| | | /* DEBUG |
| | | setStrokeStyle( 'rgb(255,255,0)' ); |
| | | _context.beginPath(); |
| | | _context.moveTo( v1.x - 10, v1.y ); |
| | | _context.lineTo( v1.x + 10, v1.y ); |
| | | _context.moveTo( v1.x, v1.y - 10 ); |
| | | _context.lineTo( v1.x, v1.y + 10 ); |
| | | _context.stroke(); |
| | | */ |
| | | |
| | | } |
| | | |
| | | function renderLine(v1, v2, element, material) { |
| | | |
| | | setOpacity(material.opacity); |
| | | setBlending(material.blending); |
| | | |
| | | _context.beginPath(); |
| | | _context.moveTo(v1.positionScreen.x, v1.positionScreen.y); |
| | | _context.lineTo(v2.positionScreen.x, v2.positionScreen.y); |
| | | |
| | | if (material.isLineBasicMaterial) { |
| | | |
| | | setLineWidth(material.linewidth); |
| | | setLineCap(material.linecap); |
| | | setLineJoin(material.linejoin); |
| | | |
| | | if (material.vertexColors !== THREE.VertexColors) { |
| | | |
| | | setStrokeStyle(material.color.getStyle()); |
| | | |
| | | } else { |
| | | |
| | | var colorStyle1 = element.vertexColors[0].getStyle(); |
| | | var colorStyle2 = element.vertexColors[1].getStyle(); |
| | | |
| | | if (colorStyle1 === colorStyle2) { |
| | | |
| | | setStrokeStyle(colorStyle1); |
| | | |
| | | } else { |
| | | |
| | | try { |
| | | |
| | | var grad = _context.createLinearGradient( |
| | | v1.positionScreen.x, |
| | | v1.positionScreen.y, |
| | | v2.positionScreen.x, |
| | | v2.positionScreen.y |
| | | ); |
| | | grad.addColorStop(0, colorStyle1); |
| | | grad.addColorStop(1, colorStyle2); |
| | | |
| | | } catch (exception) { |
| | | |
| | | grad = colorStyle1; |
| | | |
| | | } |
| | | |
| | | setStrokeStyle(grad); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | if (material.isLineDashedMaterial) { |
| | | |
| | | setLineDash([material.dashSize, material.gapSize]); |
| | | |
| | | } |
| | | |
| | | _context.stroke(); |
| | | _elemBox.expandByScalar(material.linewidth * 2); |
| | | |
| | | if (material.isLineDashedMaterial) { |
| | | |
| | | setLineDash([]); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | function renderFace3(v1, v2, v3, uv1, uv2, uv3, element, material) { |
| | | |
| | | _this.info.render.vertices += 3; |
| | | _this.info.render.faces++; |
| | | |
| | | setOpacity(material.opacity); |
| | | setBlending(material.blending); |
| | | |
| | | _v1x = v1.positionScreen.x; _v1y = v1.positionScreen.y; |
| | | _v2x = v2.positionScreen.x; _v2y = v2.positionScreen.y; |
| | | _v3x = v3.positionScreen.x; _v3y = v3.positionScreen.y; |
| | | |
| | | drawTriangle(_v1x, _v1y, _v2x, _v2y, _v3x, _v3y); |
| | | |
| | | if ((material.isMeshLambertMaterial || material.isMeshPhongMaterial || material.isMeshStandardMaterial) && material.map === null) { |
| | | |
| | | _diffuseColor.copy(material.color); |
| | | _emissiveColor.copy(material.emissive); |
| | | |
| | | if (material.vertexColors === THREE.FaceColors) { |
| | | |
| | | _diffuseColor.multiply(element.color); |
| | | |
| | | } |
| | | |
| | | _color.copy(_ambientLight); |
| | | |
| | | _centroid.copy(v1.positionWorld).add(v2.positionWorld).add(v3.positionWorld).divideScalar(3); |
| | | |
| | | calculateLight(_centroid, element.normalModel, _color); |
| | | |
| | | _color.multiply(_diffuseColor).add(_emissiveColor); |
| | | |
| | | material.wireframe === true |
| | | ? strokePath(_color, material.wireframeLinewidth, material.wireframeLinecap, material.wireframeLinejoin) |
| | | : fillPath(_color); |
| | | |
| | | } else if (material.isMeshBasicMaterial || material.isMeshLambertMaterial || material.isMeshPhongMaterial || material.isMeshStandardMaterial) { |
| | | |
| | | if (material.map !== null) { |
| | | |
| | | var mapping = material.map.mapping; |
| | | |
| | | if (mapping === THREE.UVMapping) { |
| | | |
| | | _uvs = element.uvs; |
| | | patternPath(_v1x, _v1y, _v2x, _v2y, _v3x, _v3y, _uvs[uv1].x, _uvs[uv1].y, _uvs[uv2].x, _uvs[uv2].y, _uvs[uv3].x, _uvs[uv3].y, material.map); |
| | | |
| | | } |
| | | |
| | | } else if (material.envMap !== null) { |
| | | |
| | | if (material.envMap.mapping === THREE.SphericalReflectionMapping) { |
| | | |
| | | _normal.copy(element.vertexNormalsModel[uv1]).applyMatrix3(_normalViewMatrix); |
| | | _uv1x = 0.5 * _normal.x + 0.5; |
| | | _uv1y = 0.5 * _normal.y + 0.5; |
| | | |
| | | _normal.copy(element.vertexNormalsModel[uv2]).applyMatrix3(_normalViewMatrix); |
| | | _uv2x = 0.5 * _normal.x + 0.5; |
| | | _uv2y = 0.5 * _normal.y + 0.5; |
| | | |
| | | _normal.copy(element.vertexNormalsModel[uv3]).applyMatrix3(_normalViewMatrix); |
| | | _uv3x = 0.5 * _normal.x + 0.5; |
| | | _uv3y = 0.5 * _normal.y + 0.5; |
| | | |
| | | patternPath(_v1x, _v1y, _v2x, _v2y, _v3x, _v3y, _uv1x, _uv1y, _uv2x, _uv2y, _uv3x, _uv3y, material.envMap); |
| | | |
| | | } |
| | | |
| | | } else { |
| | | |
| | | _color.copy(material.color); |
| | | |
| | | if (material.vertexColors === THREE.FaceColors) { |
| | | |
| | | _color.multiply(element.color); |
| | | |
| | | } |
| | | |
| | | material.wireframe === true |
| | | ? strokePath(_color, material.wireframeLinewidth, material.wireframeLinecap, material.wireframeLinejoin) |
| | | : fillPath(_color); |
| | | |
| | | } |
| | | |
| | | } else if (material.isMeshNormalMaterial) { |
| | | |
| | | _normal.copy(element.normalModel).applyMatrix3(_normalViewMatrix); |
| | | |
| | | _color.setRGB(_normal.x, _normal.y, _normal.z).multiplyScalar(0.5).addScalar(0.5); |
| | | |
| | | material.wireframe === true |
| | | ? strokePath(_color, material.wireframeLinewidth, material.wireframeLinecap, material.wireframeLinejoin) |
| | | : fillPath(_color); |
| | | |
| | | } else { |
| | | |
| | | _color.setRGB(1, 1, 1); |
| | | |
| | | material.wireframe === true |
| | | ? strokePath(_color, material.wireframeLinewidth, material.wireframeLinecap, material.wireframeLinejoin) |
| | | : fillPath(_color); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | // |
| | | |
| | | function drawTriangle(x0, y0, x1, y1, x2, y2) { |
| | | |
| | | _context.beginPath(); |
| | | _context.moveTo(x0, y0); |
| | | _context.lineTo(x1, y1); |
| | | _context.lineTo(x2, y2); |
| | | _context.closePath(); |
| | | |
| | | } |
| | | |
| | | function strokePath(color, linewidth, linecap, linejoin) { |
| | | |
| | | setLineWidth(linewidth); |
| | | setLineCap(linecap); |
| | | setLineJoin(linejoin); |
| | | setStrokeStyle(color.getStyle()); |
| | | |
| | | _context.stroke(); |
| | | |
| | | _elemBox.expandByScalar(linewidth * 2); |
| | | |
| | | } |
| | | |
| | | function fillPath(color) { |
| | | |
| | | setFillStyle(color.getStyle()); |
| | | _context.fill(); |
| | | |
| | | } |
| | | |
| | | function textureToPattern(texture) { |
| | | |
| | | if (texture.version === 0 || |
| | | texture instanceof THREE.CompressedTexture || |
| | | texture instanceof THREE.DataTexture) { |
| | | |
| | | return { |
| | | canvas: undefined, |
| | | version: texture.version |
| | | }; |
| | | |
| | | } |
| | | |
| | | var image = texture.image; |
| | | |
| | | if (image.complete === false) { |
| | | |
| | | return { |
| | | canvas: undefined, |
| | | version: 0 |
| | | }; |
| | | |
| | | } |
| | | |
| | | var repeatX = texture.wrapS === THREE.RepeatWrapping || texture.wrapS === THREE.MirroredRepeatWrapping; |
| | | var repeatY = texture.wrapT === THREE.RepeatWrapping || texture.wrapT === THREE.MirroredRepeatWrapping; |
| | | |
| | | var mirrorX = texture.wrapS === THREE.MirroredRepeatWrapping; |
| | | var mirrorY = texture.wrapT === THREE.MirroredRepeatWrapping; |
| | | |
| | | // |
| | | |
| | | var canvas = document.createElement('canvas'); |
| | | canvas.width = image.width * (mirrorX ? 2 : 1); |
| | | canvas.height = image.height * (mirrorY ? 2 : 1); |
| | | |
| | | var context = canvas.getContext('2d'); |
| | | context.setTransform(1, 0, 0, -1, 0, image.height); |
| | | context.drawImage(image, 0, 0); |
| | | |
| | | if (mirrorX === true) { |
| | | |
| | | context.setTransform(-1, 0, 0, -1, image.width, image.height); |
| | | context.drawImage(image, -image.width, 0); |
| | | |
| | | } |
| | | |
| | | if (mirrorY === true) { |
| | | |
| | | context.setTransform(1, 0, 0, 1, 0, 0); |
| | | context.drawImage(image, 0, image.height); |
| | | |
| | | } |
| | | |
| | | if (mirrorX === true && mirrorY === true) { |
| | | |
| | | context.setTransform(-1, 0, 0, 1, image.width, 0); |
| | | context.drawImage(image, -image.width, image.height); |
| | | |
| | | } |
| | | |
| | | var repeat = 'no-repeat'; |
| | | |
| | | if (repeatX === true && repeatY === true) { |
| | | |
| | | repeat = 'repeat'; |
| | | |
| | | } else if (repeatX === true) { |
| | | |
| | | repeat = 'repeat-x'; |
| | | |
| | | } else if (repeatY === true) { |
| | | |
| | | repeat = 'repeat-y'; |
| | | |
| | | } |
| | | |
| | | var pattern = _context.createPattern(canvas, repeat); |
| | | |
| | | if (texture.onUpdate) texture.onUpdate(texture); |
| | | |
| | | return { |
| | | canvas: pattern, |
| | | version: texture.version |
| | | }; |
| | | |
| | | } |
| | | |
| | | function patternPath(x0, y0, x1, y1, x2, y2, u0, v0, u1, v1, u2, v2, texture) { |
| | | |
| | | var pattern = _patterns[texture.id]; |
| | | |
| | | if (pattern === undefined || pattern.version !== texture.version) { |
| | | |
| | | pattern = textureToPattern(texture); |
| | | _patterns[texture.id] = pattern; |
| | | |
| | | } |
| | | |
| | | if (pattern.canvas !== undefined) { |
| | | |
| | | setFillStyle(pattern.canvas); |
| | | |
| | | } else { |
| | | |
| | | setFillStyle('rgba( 0, 0, 0, 1)'); |
| | | _context.fill(); |
| | | return; |
| | | |
| | | } |
| | | |
| | | // http://extremelysatisfactorytotalitarianism.com/blog/?p=2120 |
| | | |
| | | var a, b, c, d, e, f, det, idet, |
| | | offsetX = texture.offset.x / texture.repeat.x, |
| | | offsetY = texture.offset.y / texture.repeat.y, |
| | | width = texture.image.width * texture.repeat.x, |
| | | height = texture.image.height * texture.repeat.y; |
| | | |
| | | u0 = (u0 + offsetX) * width; |
| | | v0 = (v0 + offsetY) * height; |
| | | |
| | | u1 = (u1 + offsetX) * width; |
| | | v1 = (v1 + offsetY) * height; |
| | | |
| | | u2 = (u2 + offsetX) * width; |
| | | v2 = (v2 + offsetY) * height; |
| | | |
| | | x1 -= x0; y1 -= y0; |
| | | x2 -= x0; y2 -= y0; |
| | | |
| | | u1 -= u0; v1 -= v0; |
| | | u2 -= u0; v2 -= v0; |
| | | |
| | | det = u1 * v2 - u2 * v1; |
| | | |
| | | if (det === 0) return; |
| | | |
| | | idet = 1 / det; |
| | | |
| | | a = (v2 * x1 - v1 * x2) * idet; |
| | | b = (v2 * y1 - v1 * y2) * idet; |
| | | c = (u1 * x2 - u2 * x1) * idet; |
| | | d = (u1 * y2 - u2 * y1) * idet; |
| | | |
| | | e = x0 - a * u0 - c * v0; |
| | | f = y0 - b * u0 - d * v0; |
| | | |
| | | _context.save(); |
| | | _context.transform(a, b, c, d, e, f); |
| | | _context.fill(); |
| | | _context.restore(); |
| | | |
| | | } |
| | | |
| | | /* |
| | | function clipImage( x0, y0, x1, y1, x2, y2, u0, v0, u1, v1, u2, v2, image ) { |
| | | |
| | | // http://extremelysatisfactorytotalitarianism.com/blog/?p=2120 |
| | | |
| | | var a, b, c, d, e, f, det, idet, |
| | | width = image.width - 1, |
| | | height = image.height - 1; |
| | | |
| | | u0 *= width; v0 *= height; |
| | | u1 *= width; v1 *= height; |
| | | u2 *= width; v2 *= height; |
| | | |
| | | x1 -= x0; y1 -= y0; |
| | | x2 -= x0; y2 -= y0; |
| | | |
| | | u1 -= u0; v1 -= v0; |
| | | u2 -= u0; v2 -= v0; |
| | | |
| | | det = u1 * v2 - u2 * v1; |
| | | |
| | | idet = 1 / det; |
| | | |
| | | a = ( v2 * x1 - v1 * x2 ) * idet; |
| | | b = ( v2 * y1 - v1 * y2 ) * idet; |
| | | c = ( u1 * x2 - u2 * x1 ) * idet; |
| | | d = ( u1 * y2 - u2 * y1 ) * idet; |
| | | |
| | | e = x0 - a * u0 - c * v0; |
| | | f = y0 - b * u0 - d * v0; |
| | | |
| | | _context.save(); |
| | | _context.transform( a, b, c, d, e, f ); |
| | | _context.clip(); |
| | | _context.drawImage( image, 0, 0 ); |
| | | _context.restore(); |
| | | |
| | | } |
| | | */ |
| | | |
| | | // Hide anti-alias gaps |
| | | |
| | | function expand(v1, v2, pixels) { |
| | | |
| | | var x = v2.x - v1.x, y = v2.y - v1.y, |
| | | det = x * x + y * y, idet; |
| | | |
| | | if (det === 0) return; |
| | | |
| | | idet = pixels / Math.sqrt(det); |
| | | |
| | | x *= idet; y *= idet; |
| | | |
| | | v2.x += x; v2.y += y; |
| | | v1.x -= x; v1.y -= y; |
| | | |
| | | } |
| | | |
| | | // Context cached methods. |
| | | |
| | | function setOpacity(value) { |
| | | |
| | | if (_contextGlobalAlpha !== value) { |
| | | |
| | | _context.globalAlpha = value; |
| | | _contextGlobalAlpha = value; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | function setBlending(value) { |
| | | |
| | | if (_contextGlobalCompositeOperation !== value) { |
| | | |
| | | if (value === THREE.NormalBlending) { |
| | | |
| | | _context.globalCompositeOperation = 'source-over'; |
| | | |
| | | } else if (value === THREE.AdditiveBlending) { |
| | | |
| | | _context.globalCompositeOperation = 'lighter'; |
| | | |
| | | } else if (value === THREE.SubtractiveBlending) { |
| | | |
| | | _context.globalCompositeOperation = 'darker'; |
| | | |
| | | } else if (value === THREE.MultiplyBlending) { |
| | | |
| | | _context.globalCompositeOperation = 'multiply'; |
| | | |
| | | } |
| | | |
| | | _contextGlobalCompositeOperation = value; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | function setLineWidth(value) { |
| | | |
| | | if (_contextLineWidth !== value) { |
| | | |
| | | _context.lineWidth = value; |
| | | _contextLineWidth = value; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | function setLineCap(value) { |
| | | |
| | | // "butt", "round", "square" |
| | | |
| | | if (_contextLineCap !== value) { |
| | | |
| | | _context.lineCap = value; |
| | | _contextLineCap = value; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | function setLineJoin(value) { |
| | | |
| | | // "round", "bevel", "miter" |
| | | |
| | | if (_contextLineJoin !== value) { |
| | | |
| | | _context.lineJoin = value; |
| | | _contextLineJoin = value; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | function setStrokeStyle(value) { |
| | | |
| | | if (_contextStrokeStyle !== value) { |
| | | |
| | | _context.strokeStyle = value; |
| | | _contextStrokeStyle = value; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | function setFillStyle(value) { |
| | | |
| | | if (_contextFillStyle !== value) { |
| | | |
| | | _context.fillStyle = value; |
| | | _contextFillStyle = value; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | function setLineDash(value) { |
| | | |
| | | if (_contextLineDash.length !== value.length) { |
| | | |
| | | _context.setLineDash(value); |
| | | _contextLineDash = value; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | }; |
New file |
| | |
| | | var header = document.getElementById("header"); |
| | | var light_btn = document.getElementById("lightSkin"); |
| | | var dark_btn = document.getElementById("darkSkin") |
| | | |
| | | $("#lightSkin").click(function () { |
| | | |
| | | header.style.background = "#e0e0d1"; |
| | | |
| | | //Lighter colour for buttons and hover |
| | | light_btn.style.background = "#8a8a5c"; |
| | | dark_btn.style.background = "#8a8a5c"; |
| | | |
| | | $("#lightSkin").hover(function () { |
| | | $(this).css("background", "#333"); //Light blue colour on hover |
| | | }, function () { |
| | | $(this).css("background", "#333"); //back to light theme colour when not hovering |
| | | }); |
| | | $("#darkSkin").hover(function () { |
| | | $(this).css("background", "#333"); //Light blue colour on hover |
| | | }, function () { |
| | | $(this).css("background", "#333"); //back to light theme colour when not hovering |
| | | }); |
| | | |
| | | /*SET SIDE AND BOTTOM MENU BACKGROUND COLOURS*/ |
| | | $(".side_menu").each(function () { |
| | | $(this).css("background", "#fff"); //b8b894 |
| | | }); |
| | | |
| | | $("#bottom_menu").each(function () { |
| | | $(this).css("background", "#b8b894"); |
| | | }); |
| | | /*SET SIDE AND BOTTOM MENU BACKGROUND COLOURS*/ |
| | | |
| | | //Menu item list items background i.e. the box that contains the options e.g. light sliders |
| | | $(".menu_item > li").each(function () { |
| | | $(this).css("background", "#666"); |
| | | }); |
| | | |
| | | //Each subsequent list item set to same background colour |
| | | $(".menu_item > li > ul > li").each(function () { |
| | | $(this).css("background", "#666"); |
| | | }); |
| | | |
| | | //List item links background colour + darker text colour e.g. wireframe mode, phong shading |
| | | $(".menu_item > li > a").each(function () { |
| | | $(this).css("background", "#fff"); |
| | | $(this).css("color", "#000000"); |
| | | }); |
| | | |
| | | //Hovering over list item links e.g. wireframe mode, phong shading |
| | | $(".menu_item li a").hover(function () { |
| | | $(this).css("background", "#cce6ff"); //Light blue colour on hover |
| | | }, function () { |
| | | $(this).css("background", "#fff"); //back to light theme colour when not hovering |
| | | }); |
| | | |
| | | /***BOTTOM MENU***/ |
| | | //list items background i.e. the box that contains the options e.g. light sliders |
| | | $(".bottom_menu_item > li").each(function () { |
| | | $(this).css("background", "#8a8a5c"); |
| | | }); |
| | | |
| | | //Each subsequent list item set to same background colour |
| | | $(".bottom_menu_item > li > ul > li").each(function () { |
| | | $(this).css("background", "#8a8a5c"); |
| | | }); |
| | | |
| | | //List item links background colour + darker text colour e.g. wireframe mode, phong shading |
| | | $(".bottom_menu_item > li > a").each(function () { |
| | | $(this).css("background", "#e0e0d1"); |
| | | $(this).css("color", "#000000"); |
| | | }); |
| | | |
| | | //Hovering over list item links e.g. wireframe mode, phong shading |
| | | $(".bottom_menu_item li a").hover(function () { |
| | | $(this).css("background", "#cce6ff"); //Light blue colour on hover |
| | | }, function () { |
| | | $(this).css("background", "#e0e0d1"); //back to light theme colour when not hovering |
| | | }); |
| | | |
| | | }); |
| | | |
| | | $("#darkSkin").click(function () |
| | | { |
| | | header.style.background = "#3d5c5c"; |
| | | |
| | | //Lighter colour for buttons and hover |
| | | light_btn.style.background = "#3d5c5c"; |
| | | dark_btn.style.background = "#3d5c5c"; |
| | | |
| | | $("#lightSkin").hover(function () { |
| | | $(this).css("background", "#494a4c"); //Light blue colour on hover |
| | | }, function () { |
| | | $(this).css("background", "#3d5c5c"); //back to light theme colour when not hovering |
| | | }); |
| | | $("#darkSkin").hover(function () { |
| | | $(this).css("background", "#494a4c"); //Light blue colour on hover |
| | | }, function () { |
| | | $(this).css("background", "#3d5c5c"); //back to light theme colour when not hovering |
| | | }); |
| | | |
| | | /*SET SIDE AND BOTTOM MENU BACKGROUND COLOURS*/ |
| | | $(".side_menu").each(function () { |
| | | $(this).css("background", "#494a4c"); |
| | | }); |
| | | |
| | | $("#bottom_menu").each(function () { |
| | | $(this).css("background", "#494a4c"); |
| | | }); |
| | | /*SET SIDE AND BOTTOM MENU BACKGROUND COLOURS*/ |
| | | |
| | | //Menu item list items background except the first (so that header remains different colour) |
| | | $(".menu_item > li").not(":first").each(function () { |
| | | $(this).css("background", "#1d1e1e"); |
| | | }); |
| | | |
| | | //Each subsequent list item set to same background colour |
| | | $(".menu_item > li > ul > li").each(function () { |
| | | $(this).css("background", "#1d1e1e"); |
| | | }); |
| | | |
| | | //List item links background colour + darker text colour e.g. wireframe mode, phong shading |
| | | $(".menu_item > li > a").each(function () { |
| | | $(this).css("background", "#1d1e1e"); |
| | | $(this).css("color", "#fff"); |
| | | }); |
| | | |
| | | //Hovering over list item links e.g. wireframe mode, phong shading |
| | | $(".menu_item li a").hover(function () { |
| | | $(this).css("background", "#494a4c"); |
| | | }, function () { |
| | | $(this).css("background", "#1d1e1e"); |
| | | }); |
| | | |
| | | /*********BOTTOM MENU********/ |
| | | |
| | | //list items background i.e. the box that contains the options e.g. light sliders |
| | | $(".bottom_menu_item > li").each(function () { |
| | | $(this).css("background", "#1d1e1e"); |
| | | }); |
| | | |
| | | //Each subsequent list item set to same background colour |
| | | $(".bottom_menu_item > li > ul > li").each(function () { |
| | | $(this).css("background", "#1d1e1e"); |
| | | }); |
| | | |
| | | //List item links background colour + darker text colour e.g. wireframe mode, phong shading |
| | | $(".bottom_menu_item > li > a").each(function () { |
| | | $(this).css("background", "#1d1e1e"); |
| | | $(this).css("color", "#fff"); |
| | | }); |
| | | |
| | | //Hovering over list item links e.g. wireframe mode, phong shading |
| | | $(".bottom_menu_item li a").hover(function () { |
| | | $(this).css("background", "#494a4c"); |
| | | }, function () { |
| | | $(this).css("background", "#1d1e1e"); |
| | | }); |
| | | |
| | | |
| | | |
| | | }); |
New file |
| | |
| | | /* |
| | | * @author mrdoob / http://mrdoob.com/ |
| | | */ |
| | | |
| | | THREE.DDSLoader = function () { |
| | | |
| | | this._parser = THREE.DDSLoader.parse; |
| | | |
| | | }; |
| | | |
| | | THREE.DDSLoader.prototype = Object.create(THREE.CompressedTextureLoader.prototype); |
| | | THREE.DDSLoader.prototype.constructor = THREE.DDSLoader; |
| | | |
| | | THREE.DDSLoader.parse = function (buffer, loadMipmaps) { |
| | | |
| | | var dds = { mipmaps: [], width: 0, height: 0, format: null, mipmapCount: 1 }; |
| | | |
| | | // Adapted from @toji's DDS utils |
| | | // https://github.com/toji/webgl-texture-utils/blob/master/texture-util/dds.js |
| | | |
| | | // All values and structures referenced from: |
| | | // http://msdn.microsoft.com/en-us/library/bb943991.aspx/ |
| | | |
| | | var DDS_MAGIC = 0x20534444; |
| | | |
| | | var DDSD_CAPS = 0x1, |
| | | DDSD_HEIGHT = 0x2, |
| | | DDSD_WIDTH = 0x4, |
| | | DDSD_PITCH = 0x8, |
| | | DDSD_PIXELFORMAT = 0x1000, |
| | | DDSD_MIPMAPCOUNT = 0x20000, |
| | | DDSD_LINEARSIZE = 0x80000, |
| | | DDSD_DEPTH = 0x800000; |
| | | |
| | | var DDSCAPS_COMPLEX = 0x8, |
| | | DDSCAPS_MIPMAP = 0x400000, |
| | | DDSCAPS_TEXTURE = 0x1000; |
| | | |
| | | var DDSCAPS2_CUBEMAP = 0x200, |
| | | DDSCAPS2_CUBEMAP_POSITIVEX = 0x400, |
| | | DDSCAPS2_CUBEMAP_NEGATIVEX = 0x800, |
| | | DDSCAPS2_CUBEMAP_POSITIVEY = 0x1000, |
| | | DDSCAPS2_CUBEMAP_NEGATIVEY = 0x2000, |
| | | DDSCAPS2_CUBEMAP_POSITIVEZ = 0x4000, |
| | | DDSCAPS2_CUBEMAP_NEGATIVEZ = 0x8000, |
| | | DDSCAPS2_VOLUME = 0x200000; |
| | | |
| | | var DDPF_ALPHAPIXELS = 0x1, |
| | | DDPF_ALPHA = 0x2, |
| | | DDPF_FOURCC = 0x4, |
| | | DDPF_RGB = 0x40, |
| | | DDPF_YUV = 0x200, |
| | | DDPF_LUMINANCE = 0x20000; |
| | | |
| | | function fourCCToInt32(value) { |
| | | |
| | | return value.charCodeAt(0) + |
| | | (value.charCodeAt(1) << 8) + |
| | | (value.charCodeAt(2) << 16) + |
| | | (value.charCodeAt(3) << 24); |
| | | |
| | | } |
| | | |
| | | function int32ToFourCC(value) { |
| | | |
| | | return String.fromCharCode( |
| | | value & 0xff, |
| | | (value >> 8) & 0xff, |
| | | (value >> 16) & 0xff, |
| | | (value >> 24) & 0xff |
| | | ); |
| | | |
| | | } |
| | | |
| | | function loadARGBMip(buffer, dataOffset, width, height) { |
| | | |
| | | var dataLength = width * height * 4; |
| | | var srcBuffer = new Uint8Array(buffer, dataOffset, dataLength); |
| | | var byteArray = new Uint8Array(dataLength); |
| | | var dst = 0; |
| | | var src = 0; |
| | | for (var y = 0; y < height; y++) { |
| | | |
| | | for (var x = 0; x < width; x++) { |
| | | |
| | | var b = srcBuffer[src]; src++; |
| | | var g = srcBuffer[src]; src++; |
| | | var r = srcBuffer[src]; src++; |
| | | var a = srcBuffer[src]; src++; |
| | | byteArray[dst] = r; dst++; //r |
| | | byteArray[dst] = g; dst++; //g |
| | | byteArray[dst] = b; dst++; //b |
| | | byteArray[dst] = a; dst++; //a |
| | | |
| | | } |
| | | |
| | | } |
| | | return byteArray; |
| | | |
| | | } |
| | | |
| | | var FOURCC_DXT1 = fourCCToInt32("DXT1"); |
| | | var FOURCC_DXT3 = fourCCToInt32("DXT3"); |
| | | var FOURCC_DXT5 = fourCCToInt32("DXT5"); |
| | | var FOURCC_ETC1 = fourCCToInt32("ETC1"); |
| | | |
| | | var headerLengthInt = 31; // The header length in 32 bit ints |
| | | |
| | | // Offsets into the header array |
| | | |
| | | var off_magic = 0; |
| | | |
| | | var off_size = 1; |
| | | var off_flags = 2; |
| | | var off_height = 3; |
| | | var off_width = 4; |
| | | |
| | | var off_mipmapCount = 7; |
| | | |
| | | var off_pfFlags = 20; |
| | | var off_pfFourCC = 21; |
| | | var off_RGBBitCount = 22; |
| | | var off_RBitMask = 23; |
| | | var off_GBitMask = 24; |
| | | var off_BBitMask = 25; |
| | | var off_ABitMask = 26; |
| | | |
| | | var off_caps = 27; |
| | | var off_caps2 = 28; |
| | | var off_caps3 = 29; |
| | | var off_caps4 = 30; |
| | | |
| | | // Parse header |
| | | |
| | | var header = new Int32Array(buffer, 0, headerLengthInt); |
| | | |
| | | if (header[off_magic] !== DDS_MAGIC) { |
| | | |
| | | console.error('THREE.DDSLoader.parse: Invalid magic number in DDS header.'); |
| | | return dds; |
| | | |
| | | } |
| | | |
| | | if (!header[off_pfFlags] & DDPF_FOURCC) { |
| | | |
| | | console.error('THREE.DDSLoader.parse: Unsupported format, must contain a FourCC code.'); |
| | | return dds; |
| | | |
| | | } |
| | | |
| | | var blockBytes; |
| | | |
| | | var fourCC = header[off_pfFourCC]; |
| | | |
| | | var isRGBAUncompressed = false; |
| | | |
| | | switch (fourCC) { |
| | | |
| | | case FOURCC_DXT1: |
| | | |
| | | blockBytes = 8; |
| | | dds.format = THREE.RGB_S3TC_DXT1_Format; |
| | | break; |
| | | |
| | | case FOURCC_DXT3: |
| | | |
| | | blockBytes = 16; |
| | | dds.format = THREE.RGBA_S3TC_DXT3_Format; |
| | | break; |
| | | |
| | | case FOURCC_DXT5: |
| | | |
| | | blockBytes = 16; |
| | | dds.format = THREE.RGBA_S3TC_DXT5_Format; |
| | | break; |
| | | |
| | | case FOURCC_ETC1: |
| | | |
| | | blockBytes = 8; |
| | | dds.format = THREE.RGB_ETC1_Format; |
| | | break; |
| | | |
| | | default: |
| | | |
| | | if (header[off_RGBBitCount] === 32 |
| | | && header[off_RBitMask] & 0xff0000 |
| | | && header[off_GBitMask] & 0xff00 |
| | | && header[off_BBitMask] & 0xff |
| | | && header[off_ABitMask] & 0xff000000) { |
| | | |
| | | isRGBAUncompressed = true; |
| | | blockBytes = 64; |
| | | dds.format = THREE.RGBAFormat; |
| | | |
| | | } else { |
| | | |
| | | console.error('THREE.DDSLoader.parse: Unsupported FourCC code ', int32ToFourCC(fourCC)); |
| | | return dds; |
| | | |
| | | } |
| | | } |
| | | |
| | | dds.mipmapCount = 1; |
| | | |
| | | if (header[off_flags] & DDSD_MIPMAPCOUNT && loadMipmaps !== false) { |
| | | |
| | | dds.mipmapCount = Math.max(1, header[off_mipmapCount]); |
| | | |
| | | } |
| | | |
| | | var caps2 = header[off_caps2]; |
| | | dds.isCubemap = caps2 & DDSCAPS2_CUBEMAP ? true : false; |
| | | if (dds.isCubemap && ( |
| | | !(caps2 & DDSCAPS2_CUBEMAP_POSITIVEX) || |
| | | !(caps2 & DDSCAPS2_CUBEMAP_NEGATIVEX) || |
| | | !(caps2 & DDSCAPS2_CUBEMAP_POSITIVEY) || |
| | | !(caps2 & DDSCAPS2_CUBEMAP_NEGATIVEY) || |
| | | !(caps2 & DDSCAPS2_CUBEMAP_POSITIVEZ) || |
| | | !(caps2 & DDSCAPS2_CUBEMAP_NEGATIVEZ) |
| | | )) { |
| | | |
| | | console.error('THREE.DDSLoader.parse: Incomplete cubemap faces'); |
| | | return dds; |
| | | |
| | | } |
| | | |
| | | dds.width = header[off_width]; |
| | | dds.height = header[off_height]; |
| | | |
| | | var dataOffset = header[off_size] + 4; |
| | | |
| | | // Extract mipmaps buffers |
| | | |
| | | var faces = dds.isCubemap ? 6 : 1; |
| | | |
| | | for (var face = 0; face < faces; face++) { |
| | | |
| | | var width = dds.width; |
| | | var height = dds.height; |
| | | |
| | | for (var i = 0; i < dds.mipmapCount; i++) { |
| | | |
| | | if (isRGBAUncompressed) { |
| | | |
| | | var byteArray = loadARGBMip(buffer, dataOffset, width, height); |
| | | var dataLength = byteArray.length; |
| | | |
| | | } else { |
| | | |
| | | var dataLength = Math.max(4, width) / 4 * Math.max(4, height) / 4 * blockBytes; |
| | | var byteArray = new Uint8Array(buffer, dataOffset, dataLength); |
| | | |
| | | } |
| | | |
| | | var mipmap = { "data": byteArray, "width": width, "height": height }; |
| | | dds.mipmaps.push(mipmap); |
| | | |
| | | dataOffset += dataLength; |
| | | |
| | | width = Math.max(width >> 1, 1); |
| | | height = Math.max(height >> 1, 1); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | return dds; |
| | | |
| | | }; |
New file |
| | |
| | | /** |
| | | * @author alteredq / http://alteredqualia.com/ |
| | | * @author mr.doob / http://mrdoob.com/ |
| | | */ |
| | | |
| | | var Detector = { |
| | | |
| | | canvas: !!window.CanvasRenderingContext2D, |
| | | webgl: (function () { |
| | | |
| | | try { |
| | | |
| | | var canvas = document.createElement('canvas'); return !!(window.WebGLRenderingContext && (canvas.getContext('webgl') || canvas.getContext('experimental-webgl'))); |
| | | |
| | | } catch (e) { |
| | | |
| | | return false; |
| | | |
| | | } |
| | | |
| | | })(), |
| | | workers: !!window.Worker, |
| | | fileapi: window.File && window.FileReader && window.FileList && window.Blob, |
| | | |
| | | getWebGLErrorMessage: function () { |
| | | |
| | | var element = document.createElement('div'); |
| | | element.id = 'webgl-error-message'; |
| | | element.style.fontFamily = 'monospace'; |
| | | element.style.fontSize = '13px'; |
| | | element.style.fontWeight = 'normal'; |
| | | element.style.textAlign = 'center'; |
| | | element.style.background = '#fff'; |
| | | element.style.color = '#000'; |
| | | element.style.padding = '1.5em'; |
| | | element.style.width = '400px'; |
| | | element.style.margin = '5em auto 0'; |
| | | |
| | | if (!this.webgl) { |
| | | |
| | | element.innerHTML = window.WebGLRenderingContext ? [ |
| | | 'Your graphics card does not seem to support <a href="http://khronos.org/webgl/wiki/Getting_a_WebGL_Implementation" style="color:#000">WebGL</a>.<br />', |
| | | 'Find out how to get it <a href="http://get.webgl.org/" style="color:#000">here</a>.' |
| | | ].join('\n') : [ |
| | | 'Your browser does not seem to support <a href="http://khronos.org/webgl/wiki/Getting_a_WebGL_Implementation" style="color:#000">WebGL</a>.<br/>', |
| | | 'Find out how to get it <a href="http://get.webgl.org/" style="color:#000">here</a>.' |
| | | ].join('\n'); |
| | | |
| | | } |
| | | |
| | | return element; |
| | | |
| | | }, |
| | | |
| | | addGetWebGLMessage: function (parameters) { |
| | | |
| | | var parent, id, element; |
| | | |
| | | parameters = parameters || {}; |
| | | |
| | | parent = parameters.parent !== undefined ? parameters.parent : document.body; |
| | | id = parameters.id !== undefined ? parameters.id : 'oldie'; |
| | | |
| | | element = Detector.getWebGLErrorMessage(); |
| | | element.id = id; |
| | | |
| | | parent.appendChild(element); |
| | | |
| | | } |
| | | |
| | | }; |
| | | |
| | | // browserify support |
| | | if (typeof module === 'object') { |
| | | |
| | | module.exports = Detector; |
| | | |
| | | } |
New file |
| | |
| | | /** |
| | | * @author qiao / https://github.com/qiao |
| | | * @author mrdoob / http://mrdoob.com |
| | | * @author alteredq / http://alteredqualia.com/ |
| | | * @author WestLangley / http://github.com/WestLangley |
| | | * @author erich666 / http://erichaines.com |
| | | */ |
| | | |
| | | // This set of controls performs orbiting, dollying (zooming), and panning. |
| | | // Unlike TrackballControls, it maintains the "up" direction object.up (+Y by default). |
| | | // |
| | | // Orbit - left mouse / touch: one finger move |
| | | // Zoom - middle mouse, or mousewheel / touch: two finger spread or squish |
| | | // Pan - right mouse, or arrow keys / touch: three finter swipe |
| | | |
| | | THREE.OrbitControls = function (object, domElement) { |
| | | |
| | | this.object = object; |
| | | |
| | | this.domElement = (domElement !== undefined) ? domElement : document; |
| | | |
| | | // Set to false to disable this control |
| | | this.enabled = true; |
| | | |
| | | // "target" sets the location of focus, where the object orbits around |
| | | this.target = new THREE.Vector3(); |
| | | |
| | | // How far you can dolly in and out ( PerspectiveCamera only ) |
| | | this.minDistance = 0; |
| | | this.maxDistance = Infinity; |
| | | |
| | | // How far you can zoom in and out ( OrthographicCamera only ) |
| | | this.minZoom = 0; |
| | | this.maxZoom = Infinity; |
| | | |
| | | // How far you can orbit vertically, upper and lower limits. |
| | | // Range is 0 to Math.PI radians. |
| | | this.minPolarAngle = 0; // radians |
| | | this.maxPolarAngle = Math.PI; // radians |
| | | |
| | | // How far you can orbit horizontally, upper and lower limits. |
| | | // If set, must be a sub-interval of the interval [ - Math.PI, Math.PI ]. |
| | | this.minAzimuthAngle = -Infinity; // radians |
| | | this.maxAzimuthAngle = Infinity; // radians |
| | | |
| | | // Set to true to enable damping (inertia) |
| | | // If damping is enabled, you must call controls.update() in your animation loop |
| | | this.enableDamping = false; |
| | | this.dampingFactor = 0.25; |
| | | |
| | | // This option actually enables dollying in and out; left as "zoom" for backwards compatibility. |
| | | // Set to false to disable zooming |
| | | this.enableZoom = true; |
| | | this.zoomSpeed = 1.0; |
| | | |
| | | // Set to false to disable rotating |
| | | this.enableRotate = true; |
| | | this.rotateSpeed = 1.0; |
| | | |
| | | // Set to false to disable panning |
| | | this.enablePan = true; |
| | | this.keyPanSpeed = 7.0; // pixels moved per arrow key push |
| | | |
| | | // Set to true to automatically rotate around the target |
| | | // If auto-rotate is enabled, you must call controls.update() in your animation loop |
| | | this.autoRotate = false; |
| | | this.autoRotateSpeed = 2.0; // 30 seconds per round when fps is 60 |
| | | |
| | | // Set to false to disable use of the keys |
| | | this.enableKeys = true; |
| | | |
| | | // The four arrow keys |
| | | this.keys = { LEFT: 37, UP: 38, RIGHT: 39, BOTTOM: 40 }; |
| | | |
| | | // Mouse buttons |
| | | this.mouseButtons = { ORBIT: THREE.MOUSE.LEFT, ZOOM: THREE.MOUSE.MIDDLE, PAN: THREE.MOUSE.RIGHT }; |
| | | |
| | | // for reset |
| | | this.target0 = this.target.clone(); |
| | | this.position0 = this.object.position.clone(); |
| | | this.zoom0 = this.object.zoom; |
| | | |
| | | // |
| | | // public methods |
| | | // |
| | | |
| | | this.getPolarAngle = function () { |
| | | |
| | | return spherical.phi; |
| | | |
| | | }; |
| | | |
| | | this.getAzimuthalAngle = function () { |
| | | |
| | | return spherical.theta; |
| | | |
| | | }; |
| | | |
| | | this.reset = function () { |
| | | |
| | | scope.target.copy(scope.target0); |
| | | scope.object.position.copy(scope.position0); |
| | | scope.object.zoom = scope.zoom0; |
| | | |
| | | scope.object.updateProjectionMatrix(); |
| | | scope.dispatchEvent(changeEvent); |
| | | |
| | | scope.update(); |
| | | |
| | | state = STATE.NONE; |
| | | |
| | | }; |
| | | |
| | | // this method is exposed, but perhaps it would be better if we can make it private... |
| | | this.update = function () { |
| | | |
| | | var offset = new THREE.Vector3(); |
| | | |
| | | // so camera.up is the orbit axis |
| | | var quat = new THREE.Quaternion().setFromUnitVectors(object.up, new THREE.Vector3(0, 1, 0)); |
| | | var quatInverse = quat.clone().inverse(); |
| | | |
| | | var lastPosition = new THREE.Vector3(); |
| | | var lastQuaternion = new THREE.Quaternion(); |
| | | |
| | | return function () { |
| | | |
| | | var position = scope.object.position; |
| | | |
| | | offset.copy(position).sub(scope.target); |
| | | |
| | | // rotate offset to "y-axis-is-up" space |
| | | offset.applyQuaternion(quat); |
| | | |
| | | // angle from z-axis around y-axis |
| | | spherical.setFromVector3(offset); |
| | | |
| | | if (scope.autoRotate && state === STATE.NONE) { |
| | | |
| | | rotateLeft(getAutoRotationAngle()); |
| | | |
| | | } |
| | | |
| | | spherical.theta += sphericalDelta.theta; |
| | | spherical.phi += sphericalDelta.phi; |
| | | |
| | | // restrict theta to be between desired limits |
| | | spherical.theta = Math.max(scope.minAzimuthAngle, Math.min(scope.maxAzimuthAngle, spherical.theta)); |
| | | |
| | | // restrict phi to be between desired limits |
| | | spherical.phi = Math.max(scope.minPolarAngle, Math.min(scope.maxPolarAngle, spherical.phi)); |
| | | |
| | | spherical.makeSafe(); |
| | | |
| | | |
| | | spherical.radius *= scale; |
| | | |
| | | // restrict radius to be between desired limits |
| | | spherical.radius = Math.max(scope.minDistance, Math.min(scope.maxDistance, spherical.radius)); |
| | | |
| | | // move target to panned location |
| | | scope.target.add(panOffset); |
| | | |
| | | offset.setFromSpherical(spherical); |
| | | |
| | | // rotate offset back to "camera-up-vector-is-up" space |
| | | offset.applyQuaternion(quatInverse); |
| | | |
| | | position.copy(scope.target).add(offset); |
| | | |
| | | scope.object.lookAt(scope.target); |
| | | |
| | | if (scope.enableDamping === true) { |
| | | |
| | | sphericalDelta.theta *= (1 - scope.dampingFactor); |
| | | sphericalDelta.phi *= (1 - scope.dampingFactor); |
| | | |
| | | } else { |
| | | |
| | | sphericalDelta.set(0, 0, 0); |
| | | |
| | | } |
| | | |
| | | scale = 1; |
| | | panOffset.set(0, 0, 0); |
| | | |
| | | // update condition is: |
| | | // min(camera displacement, camera rotation in radians)^2 > EPS |
| | | // using small-angle approximation cos(x/2) = 1 - x^2 / 8 |
| | | |
| | | if (zoomChanged || |
| | | lastPosition.distanceToSquared(scope.object.position) > EPS || |
| | | 8 * (1 - lastQuaternion.dot(scope.object.quaternion)) > EPS) { |
| | | |
| | | scope.dispatchEvent(changeEvent); |
| | | |
| | | lastPosition.copy(scope.object.position); |
| | | lastQuaternion.copy(scope.object.quaternion); |
| | | zoomChanged = false; |
| | | |
| | | return true; |
| | | |
| | | } |
| | | |
| | | return false; |
| | | |
| | | }; |
| | | |
| | | }(); |
| | | |
| | | this.dispose = function () { |
| | | |
| | | scope.domElement.removeEventListener('contextmenu', onContextMenu, false); |
| | | scope.domElement.removeEventListener('mousedown', onMouseDown, false); |
| | | scope.domElement.removeEventListener('mousewheel', onMouseWheel, false); |
| | | scope.domElement.removeEventListener('MozMousePixelScroll', onMouseWheel, false); // firefox |
| | | |
| | | scope.domElement.removeEventListener('touchstart', onTouchStart, false); |
| | | scope.domElement.removeEventListener('touchend', onTouchEnd, false); |
| | | scope.domElement.removeEventListener('touchmove', onTouchMove, false); |
| | | |
| | | document.removeEventListener('mousemove', onMouseMove, false); |
| | | document.removeEventListener('mouseup', onMouseUp, false); |
| | | document.removeEventListener('mouseout', onMouseUp, false); |
| | | |
| | | window.removeEventListener('keydown', onKeyDown, false); |
| | | |
| | | //scope.dispatchEvent( { type: 'dispose' } ); // should this be added here? |
| | | |
| | | }; |
| | | |
| | | // |
| | | // internals |
| | | // |
| | | |
| | | var scope = this; |
| | | |
| | | var changeEvent = { type: 'change' }; |
| | | var startEvent = { type: 'start' }; |
| | | var endEvent = { type: 'end' }; |
| | | |
| | | var STATE = { NONE: -1, ROTATE: 0, DOLLY: 1, PAN: 2, TOUCH_ROTATE: 3, TOUCH_DOLLY: 4, TOUCH_PAN: 5 }; |
| | | |
| | | var state = STATE.NONE; |
| | | |
| | | var EPS = 0.000001; |
| | | |
| | | // current position in spherical coordinates |
| | | var spherical = new THREE.Spherical(); |
| | | var sphericalDelta = new THREE.Spherical(); |
| | | |
| | | var scale = 1; |
| | | var panOffset = new THREE.Vector3(); |
| | | var zoomChanged = false; |
| | | |
| | | var rotateStart = new THREE.Vector2(); |
| | | var rotateEnd = new THREE.Vector2(); |
| | | var rotateDelta = new THREE.Vector2(); |
| | | |
| | | var panStart = new THREE.Vector2(); |
| | | var panEnd = new THREE.Vector2(); |
| | | var panDelta = new THREE.Vector2(); |
| | | |
| | | var dollyStart = new THREE.Vector2(); |
| | | var dollyEnd = new THREE.Vector2(); |
| | | var dollyDelta = new THREE.Vector2(); |
| | | |
| | | function getAutoRotationAngle() { |
| | | |
| | | return 2 * Math.PI / 60 / 60 * scope.autoRotateSpeed; |
| | | |
| | | } |
| | | |
| | | function getZoomScale() { |
| | | |
| | | return Math.pow(0.95, scope.zoomSpeed); |
| | | |
| | | } |
| | | |
| | | function rotateLeft(angle) { |
| | | |
| | | sphericalDelta.theta -= angle; |
| | | |
| | | } |
| | | |
| | | function rotateUp(angle) { |
| | | |
| | | sphericalDelta.phi -= angle; |
| | | |
| | | } |
| | | |
| | | var panLeft = function () { |
| | | |
| | | var v = new THREE.Vector3(); |
| | | |
| | | return function panLeft(distance, objectMatrix) { |
| | | |
| | | v.setFromMatrixColumn(objectMatrix, 0); // get X column of objectMatrix |
| | | v.multiplyScalar(-distance); |
| | | |
| | | panOffset.add(v); |
| | | |
| | | }; |
| | | |
| | | }(); |
| | | |
| | | var panUp = function () { |
| | | |
| | | var v = new THREE.Vector3(); |
| | | |
| | | return function panUp(distance, objectMatrix) { |
| | | |
| | | v.setFromMatrixColumn(objectMatrix, 1); // get Y column of objectMatrix |
| | | v.multiplyScalar(distance); |
| | | |
| | | panOffset.add(v); |
| | | |
| | | }; |
| | | |
| | | }(); |
| | | |
| | | // deltaX and deltaY are in pixels; right and down are positive |
| | | var pan = function () { |
| | | |
| | | var offset = new THREE.Vector3(); |
| | | |
| | | return function (deltaX, deltaY) { |
| | | |
| | | var element = scope.domElement === document ? scope.domElement.body : scope.domElement; |
| | | |
| | | if (scope.object instanceof THREE.PerspectiveCamera) { |
| | | |
| | | // perspective |
| | | var position = scope.object.position; |
| | | offset.copy(position).sub(scope.target); |
| | | var targetDistance = offset.length(); |
| | | |
| | | // half of the fov is center to top of screen |
| | | targetDistance *= Math.tan((scope.object.fov / 2) * Math.PI / 180.0); |
| | | |
| | | // we actually don't use screenWidth, since perspective camera is fixed to screen height |
| | | panLeft(2 * deltaX * targetDistance / element.clientHeight, scope.object.matrix); |
| | | panUp(2 * deltaY * targetDistance / element.clientHeight, scope.object.matrix); |
| | | |
| | | } else if (scope.object instanceof THREE.OrthographicCamera) { |
| | | |
| | | // orthographic |
| | | panLeft(deltaX * (scope.object.right - scope.object.left) / scope.object.zoom / element.clientWidth, scope.object.matrix); |
| | | panUp(deltaY * (scope.object.top - scope.object.bottom) / scope.object.zoom / element.clientHeight, scope.object.matrix); |
| | | |
| | | } else { |
| | | |
| | | // camera neither orthographic nor perspective |
| | | console.warn('WARNING: OrbitControls.js encountered an unknown camera type - pan disabled.'); |
| | | scope.enablePan = false; |
| | | |
| | | } |
| | | |
| | | }; |
| | | |
| | | }(); |
| | | |
| | | function dollyIn(dollyScale) { |
| | | |
| | | if (scope.object instanceof THREE.PerspectiveCamera) { |
| | | |
| | | scale /= dollyScale; |
| | | |
| | | } else if (scope.object instanceof THREE.OrthographicCamera) { |
| | | |
| | | scope.object.zoom = Math.max(scope.minZoom, Math.min(scope.maxZoom, scope.object.zoom * dollyScale)); |
| | | scope.object.updateProjectionMatrix(); |
| | | zoomChanged = true; |
| | | |
| | | } else { |
| | | |
| | | console.warn('WARNING: OrbitControls.js encountered an unknown camera type - dolly/zoom disabled.'); |
| | | scope.enableZoom = false; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | function dollyOut(dollyScale) { |
| | | |
| | | if (scope.object instanceof THREE.PerspectiveCamera) { |
| | | |
| | | scale *= dollyScale; |
| | | |
| | | } else if (scope.object instanceof THREE.OrthographicCamera) { |
| | | |
| | | scope.object.zoom = Math.max(scope.minZoom, Math.min(scope.maxZoom, scope.object.zoom / dollyScale)); |
| | | scope.object.updateProjectionMatrix(); |
| | | zoomChanged = true; |
| | | |
| | | } else { |
| | | |
| | | console.warn('WARNING: OrbitControls.js encountered an unknown camera type - dolly/zoom disabled.'); |
| | | scope.enableZoom = false; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | // |
| | | // event callbacks - update the object state |
| | | // |
| | | |
| | | function handleMouseDownRotate(event) { |
| | | |
| | | //console.log( 'handleMouseDownRotate' ); |
| | | |
| | | rotateStart.set(event.clientX, event.clientY); |
| | | |
| | | } |
| | | |
| | | function handleMouseDownDolly(event) { |
| | | |
| | | //console.log( 'handleMouseDownDolly' ); |
| | | |
| | | dollyStart.set(event.clientX, event.clientY); |
| | | |
| | | } |
| | | |
| | | function handleMouseDownPan(event) { |
| | | |
| | | //console.log( 'handleMouseDownPan' ); |
| | | |
| | | panStart.set(event.clientX, event.clientY); |
| | | |
| | | } |
| | | |
| | | function handleMouseMoveRotate(event) { |
| | | |
| | | //console.log( 'handleMouseMoveRotate' ); |
| | | |
| | | rotateEnd.set(event.clientX, event.clientY); |
| | | rotateDelta.subVectors(rotateEnd, rotateStart); |
| | | |
| | | var element = scope.domElement === document ? scope.domElement.body : scope.domElement; |
| | | |
| | | // rotating across whole screen goes 360 degrees around |
| | | rotateLeft(2 * Math.PI * rotateDelta.x / element.clientWidth * scope.rotateSpeed); |
| | | |
| | | // rotating up and down along whole screen attempts to go 360, but limited to 180 |
| | | rotateUp(2 * Math.PI * rotateDelta.y / element.clientHeight * scope.rotateSpeed); |
| | | |
| | | rotateStart.copy(rotateEnd); |
| | | |
| | | scope.update(); |
| | | |
| | | } |
| | | |
| | | function handleMouseMoveDolly(event) { |
| | | |
| | | //console.log( 'handleMouseMoveDolly' ); |
| | | |
| | | dollyEnd.set(event.clientX, event.clientY); |
| | | |
| | | dollyDelta.subVectors(dollyEnd, dollyStart); |
| | | |
| | | if (dollyDelta.y > 0) { |
| | | |
| | | dollyIn(getZoomScale()); |
| | | |
| | | } else if (dollyDelta.y < 0) { |
| | | |
| | | dollyOut(getZoomScale()); |
| | | |
| | | } |
| | | |
| | | dollyStart.copy(dollyEnd); |
| | | |
| | | scope.update(); |
| | | |
| | | } |
| | | |
| | | function handleMouseMovePan(event) { |
| | | |
| | | //console.log( 'handleMouseMovePan' ); |
| | | |
| | | panEnd.set(event.clientX, event.clientY); |
| | | |
| | | panDelta.subVectors(panEnd, panStart); |
| | | |
| | | pan(panDelta.x, panDelta.y); |
| | | |
| | | panStart.copy(panEnd); |
| | | |
| | | scope.update(); |
| | | |
| | | } |
| | | |
| | | function handleMouseUp(event) { |
| | | |
| | | //console.log( 'handleMouseUp' ); |
| | | |
| | | } |
| | | |
| | | function handleMouseWheel(event) { |
| | | |
| | | //console.log( 'handleMouseWheel' ); |
| | | |
| | | var delta = 0; |
| | | |
| | | if (event.wheelDelta !== undefined) { |
| | | |
| | | // WebKit / Opera / Explorer 9 |
| | | |
| | | delta = event.wheelDelta; |
| | | |
| | | } else if (event.detail !== undefined) { |
| | | |
| | | // Firefox |
| | | |
| | | delta = - event.detail; |
| | | |
| | | } |
| | | |
| | | if (delta > 0) { |
| | | |
| | | dollyOut(getZoomScale()); |
| | | |
| | | } else if (delta < 0) { |
| | | |
| | | dollyIn(getZoomScale()); |
| | | |
| | | } |
| | | |
| | | scope.update(); |
| | | |
| | | } |
| | | |
| | | function handleKeyDown(event) { |
| | | |
| | | //console.log( 'handleKeyDown' ); |
| | | |
| | | switch (event.keyCode) { |
| | | |
| | | case scope.keys.UP: |
| | | pan(0, scope.keyPanSpeed); |
| | | scope.update(); |
| | | break; |
| | | |
| | | case scope.keys.BOTTOM: |
| | | pan(0, -scope.keyPanSpeed); |
| | | scope.update(); |
| | | break; |
| | | |
| | | case scope.keys.LEFT: |
| | | pan(scope.keyPanSpeed, 0); |
| | | scope.update(); |
| | | break; |
| | | |
| | | case scope.keys.RIGHT: |
| | | pan(-scope.keyPanSpeed, 0); |
| | | scope.update(); |
| | | break; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | function handleTouchStartRotate(event) { |
| | | |
| | | //console.log( 'handleTouchStartRotate' ); |
| | | |
| | | rotateStart.set(event.touches[0].pageX, event.touches[0].pageY); |
| | | |
| | | } |
| | | |
| | | function handleTouchStartDolly(event) { |
| | | |
| | | //console.log( 'handleTouchStartDolly' ); |
| | | |
| | | var dx = event.touches[0].pageX - event.touches[1].pageX; |
| | | var dy = event.touches[0].pageY - event.touches[1].pageY; |
| | | |
| | | var distance = Math.sqrt(dx * dx + dy * dy); |
| | | |
| | | dollyStart.set(0, distance); |
| | | |
| | | } |
| | | |
| | | function handleTouchStartPan(event) { |
| | | |
| | | //console.log( 'handleTouchStartPan' ); |
| | | |
| | | panStart.set(event.touches[0].pageX, event.touches[0].pageY); |
| | | |
| | | } |
| | | |
| | | function handleTouchMoveRotate(event) { |
| | | |
| | | //console.log( 'handleTouchMoveRotate' ); |
| | | |
| | | rotateEnd.set(event.touches[0].pageX, event.touches[0].pageY); |
| | | rotateDelta.subVectors(rotateEnd, rotateStart); |
| | | |
| | | var element = scope.domElement === document ? scope.domElement.body : scope.domElement; |
| | | |
| | | // rotating across whole screen goes 360 degrees around |
| | | rotateLeft(2 * Math.PI * rotateDelta.x / element.clientWidth * scope.rotateSpeed); |
| | | |
| | | // rotating up and down along whole screen attempts to go 360, but limited to 180 |
| | | rotateUp(2 * Math.PI * rotateDelta.y / element.clientHeight * scope.rotateSpeed); |
| | | |
| | | rotateStart.copy(rotateEnd); |
| | | |
| | | scope.update(); |
| | | |
| | | } |
| | | |
| | | function handleTouchMoveDolly(event) { |
| | | |
| | | //console.log( 'handleTouchMoveDolly' ); |
| | | |
| | | var dx = event.touches[0].pageX - event.touches[1].pageX; |
| | | var dy = event.touches[0].pageY - event.touches[1].pageY; |
| | | |
| | | var distance = Math.sqrt(dx * dx + dy * dy); |
| | | |
| | | dollyEnd.set(0, distance); |
| | | |
| | | dollyDelta.subVectors(dollyEnd, dollyStart); |
| | | |
| | | if (dollyDelta.y > 0) { |
| | | |
| | | dollyOut(getZoomScale()); |
| | | |
| | | } else if (dollyDelta.y < 0) { |
| | | |
| | | dollyIn(getZoomScale()); |
| | | |
| | | } |
| | | |
| | | dollyStart.copy(dollyEnd); |
| | | |
| | | scope.update(); |
| | | |
| | | } |
| | | |
| | | function handleTouchMovePan(event) { |
| | | |
| | | //console.log( 'handleTouchMovePan' ); |
| | | |
| | | panEnd.set(event.touches[0].pageX, event.touches[0].pageY); |
| | | |
| | | panDelta.subVectors(panEnd, panStart); |
| | | |
| | | pan(panDelta.x, panDelta.y); |
| | | |
| | | panStart.copy(panEnd); |
| | | |
| | | scope.update(); |
| | | |
| | | } |
| | | |
| | | function handleTouchEnd(event) { |
| | | |
| | | //console.log( 'handleTouchEnd' ); |
| | | |
| | | } |
| | | |
| | | // |
| | | // event handlers - FSM: listen for events and reset state |
| | | // |
| | | |
| | | function onMouseDown(event) { |
| | | |
| | | if (scope.enabled === false) return; |
| | | |
| | | event.preventDefault(); |
| | | |
| | | if (event.button === scope.mouseButtons.ORBIT) { |
| | | |
| | | if (scope.enableRotate === false) return; |
| | | |
| | | handleMouseDownRotate(event); |
| | | |
| | | state = STATE.ROTATE; |
| | | |
| | | } else if (event.button === scope.mouseButtons.ZOOM) { |
| | | |
| | | if (scope.enableZoom === false) return; |
| | | |
| | | handleMouseDownDolly(event); |
| | | |
| | | state = STATE.DOLLY; |
| | | |
| | | } else if (event.button === scope.mouseButtons.PAN) { |
| | | |
| | | if (scope.enablePan === false) return; |
| | | |
| | | handleMouseDownPan(event); |
| | | |
| | | state = STATE.PAN; |
| | | |
| | | } |
| | | |
| | | if (state !== STATE.NONE) { |
| | | |
| | | document.addEventListener('mousemove', onMouseMove, false); |
| | | document.addEventListener('mouseup', onMouseUp, false); |
| | | document.addEventListener('mouseout', onMouseUp, false); |
| | | |
| | | scope.dispatchEvent(startEvent); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | function onMouseMove(event) { |
| | | |
| | | if (scope.enabled === false) return; |
| | | |
| | | event.preventDefault(); |
| | | |
| | | if (state === STATE.ROTATE) { |
| | | |
| | | if (scope.enableRotate === false) return; |
| | | |
| | | handleMouseMoveRotate(event); |
| | | |
| | | } else if (state === STATE.DOLLY) { |
| | | |
| | | if (scope.enableZoom === false) return; |
| | | |
| | | handleMouseMoveDolly(event); |
| | | |
| | | } else if (state === STATE.PAN) { |
| | | |
| | | if (scope.enablePan === false) return; |
| | | |
| | | handleMouseMovePan(event); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | function onMouseUp(event) { |
| | | |
| | | if (scope.enabled === false) return; |
| | | |
| | | handleMouseUp(event); |
| | | |
| | | document.removeEventListener('mousemove', onMouseMove, false); |
| | | document.removeEventListener('mouseup', onMouseUp, false); |
| | | document.removeEventListener('mouseout', onMouseUp, false); |
| | | |
| | | scope.dispatchEvent(endEvent); |
| | | |
| | | state = STATE.NONE; |
| | | |
| | | } |
| | | |
| | | function onMouseWheel(event) { |
| | | |
| | | if (scope.enabled === false || scope.enableZoom === false || (state !== STATE.NONE && state !== STATE.ROTATE)) return; |
| | | |
| | | event.preventDefault(); |
| | | event.stopPropagation(); |
| | | |
| | | handleMouseWheel(event); |
| | | |
| | | scope.dispatchEvent(startEvent); // not sure why these are here... |
| | | scope.dispatchEvent(endEvent); |
| | | |
| | | } |
| | | |
| | | function onKeyDown(event) { |
| | | |
| | | if (scope.enabled === false || scope.enableKeys === false || scope.enablePan === false) return; |
| | | |
| | | handleKeyDown(event); |
| | | |
| | | } |
| | | |
| | | function onTouchStart(event) { |
| | | |
| | | if (scope.enabled === false) return; |
| | | |
| | | switch (event.touches.length) { |
| | | |
| | | case 1: // one-fingered touch: rotate |
| | | |
| | | if (scope.enableRotate === false) return; |
| | | |
| | | handleTouchStartRotate(event); |
| | | |
| | | state = STATE.TOUCH_ROTATE; |
| | | |
| | | break; |
| | | |
| | | case 2: // two-fingered touch: dolly |
| | | |
| | | if (scope.enableZoom === false) return; |
| | | |
| | | handleTouchStartDolly(event); |
| | | |
| | | state = STATE.TOUCH_DOLLY; |
| | | |
| | | break; |
| | | |
| | | case 3: // three-fingered touch: pan |
| | | |
| | | if (scope.enablePan === false) return; |
| | | |
| | | handleTouchStartPan(event); |
| | | |
| | | state = STATE.TOUCH_PAN; |
| | | |
| | | break; |
| | | |
| | | default: |
| | | |
| | | state = STATE.NONE; |
| | | |
| | | } |
| | | |
| | | if (state !== STATE.NONE) { |
| | | |
| | | scope.dispatchEvent(startEvent); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | function onTouchMove(event) { |
| | | |
| | | if (scope.enabled === false) return; |
| | | |
| | | event.preventDefault(); |
| | | event.stopPropagation(); |
| | | |
| | | switch (event.touches.length) { |
| | | |
| | | case 1: // one-fingered touch: rotate |
| | | |
| | | if (scope.enableRotate === false) return; |
| | | if (state !== STATE.TOUCH_ROTATE) return; // is this needed?... |
| | | |
| | | handleTouchMoveRotate(event); |
| | | |
| | | break; |
| | | |
| | | case 2: // two-fingered touch: dolly |
| | | |
| | | if (scope.enableZoom === false) return; |
| | | if (state !== STATE.TOUCH_DOLLY) return; // is this needed?... |
| | | |
| | | handleTouchMoveDolly(event); |
| | | |
| | | break; |
| | | |
| | | case 3: // three-fingered touch: pan |
| | | |
| | | if (scope.enablePan === false) return; |
| | | if (state !== STATE.TOUCH_PAN) return; // is this needed?... |
| | | |
| | | handleTouchMovePan(event); |
| | | |
| | | break; |
| | | |
| | | default: |
| | | |
| | | state = STATE.NONE; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | function onTouchEnd(event) { |
| | | |
| | | if (scope.enabled === false) return; |
| | | |
| | | handleTouchEnd(event); |
| | | |
| | | scope.dispatchEvent(endEvent); |
| | | |
| | | state = STATE.NONE; |
| | | |
| | | } |
| | | |
| | | function onContextMenu(event) { |
| | | |
| | | event.preventDefault(); |
| | | |
| | | } |
| | | |
| | | // |
| | | |
| | | scope.domElement.addEventListener('contextmenu', onContextMenu, false); |
| | | |
| | | scope.domElement.addEventListener('mousedown', onMouseDown, false); |
| | | scope.domElement.addEventListener('mousewheel', onMouseWheel, false); |
| | | scope.domElement.addEventListener('MozMousePixelScroll', onMouseWheel, false); // firefox |
| | | |
| | | scope.domElement.addEventListener('touchstart', onTouchStart, false); |
| | | scope.domElement.addEventListener('touchend', onTouchEnd, false); |
| | | scope.domElement.addEventListener('touchmove', onTouchMove, false); |
| | | |
| | | window.addEventListener('keydown', onKeyDown, false); |
| | | |
| | | // force an update at start |
| | | |
| | | this.update(); |
| | | |
| | | }; |
| | | |
| | | THREE.OrbitControls.prototype = Object.create(THREE.EventDispatcher.prototype); |
| | | THREE.OrbitControls.prototype.constructor = THREE.OrbitControls; |
| | | |
| | | Object.defineProperties(THREE.OrbitControls.prototype, { |
| | | |
| | | center: { |
| | | |
| | | get: function () { |
| | | |
| | | console.warn('THREE.OrbitControls: .center has been renamed to .target'); |
| | | return this.target; |
| | | |
| | | } |
| | | |
| | | }, |
| | | |
| | | // backward compatibility |
| | | |
| | | noZoom: { |
| | | |
| | | get: function () { |
| | | |
| | | console.warn('THREE.OrbitControls: .noZoom has been deprecated. Use .enableZoom instead.'); |
| | | return !this.enableZoom; |
| | | |
| | | }, |
| | | |
| | | set: function (value) { |
| | | |
| | | console.warn('THREE.OrbitControls: .noZoom has been deprecated. Use .enableZoom instead.'); |
| | | this.enableZoom = !value; |
| | | |
| | | } |
| | | |
| | | }, |
| | | |
| | | noRotate: { |
| | | |
| | | get: function () { |
| | | |
| | | console.warn('THREE.OrbitControls: .noRotate has been deprecated. Use .enableRotate instead.'); |
| | | return !this.enableRotate; |
| | | |
| | | }, |
| | | |
| | | set: function (value) { |
| | | |
| | | console.warn('THREE.OrbitControls: .noRotate has been deprecated. Use .enableRotate instead.'); |
| | | this.enableRotate = !value; |
| | | |
| | | } |
| | | |
| | | }, |
| | | |
| | | noPan: { |
| | | |
| | | get: function () { |
| | | |
| | | console.warn('THREE.OrbitControls: .noPan has been deprecated. Use .enablePan instead.'); |
| | | return !this.enablePan; |
| | | |
| | | }, |
| | | |
| | | set: function (value) { |
| | | |
| | | console.warn('THREE.OrbitControls: .noPan has been deprecated. Use .enablePan instead.'); |
| | | this.enablePan = !value; |
| | | |
| | | } |
| | | |
| | | }, |
| | | |
| | | noKeys: { |
| | | |
| | | get: function () { |
| | | |
| | | console.warn('THREE.OrbitControls: .noKeys has been deprecated. Use .enableKeys instead.'); |
| | | return !this.enableKeys; |
| | | |
| | | }, |
| | | |
| | | set: function (value) { |
| | | |
| | | console.warn('THREE.OrbitControls: .noKeys has been deprecated. Use .enableKeys instead.'); |
| | | this.enableKeys = !value; |
| | | |
| | | } |
| | | |
| | | }, |
| | | |
| | | staticMoving: { |
| | | |
| | | get: function () { |
| | | |
| | | console.warn('THREE.OrbitControls: .staticMoving has been deprecated. Use .enableDamping instead.'); |
| | | return !this.enableDamping; |
| | | |
| | | }, |
| | | |
| | | set: function (value) { |
| | | |
| | | console.warn('THREE.OrbitControls: .staticMoving has been deprecated. Use .enableDamping instead.'); |
| | | this.enableDamping = !value; |
| | | |
| | | } |
| | | |
| | | }, |
| | | |
| | | dynamicDampingFactor: { |
| | | |
| | | get: function () { |
| | | |
| | | console.warn('THREE.OrbitControls: .dynamicDampingFactor has been renamed. Use .dampingFactor instead.'); |
| | | return this.dampingFactor; |
| | | |
| | | }, |
| | | |
| | | set: function (value) { |
| | | |
| | | console.warn('THREE.OrbitControls: .dynamicDampingFactor has been renamed. Use .dampingFactor instead.'); |
| | | this.dampingFactor = value; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | }); |
New file |
| | |
| | | /** |
| | | * @author mrdoob / http://mrdoob.com/ |
| | | * @author supereggbert / http://www.paulbrunt.co.uk/ |
| | | * @author julianwa / https://github.com/julianwa |
| | | */ |
| | | |
| | | THREE.RenderableObject = function () { |
| | | |
| | | this.id = 0; |
| | | |
| | | this.object = null; |
| | | this.z = 0; |
| | | this.renderOrder = 0; |
| | | |
| | | }; |
| | | |
| | | // |
| | | |
| | | THREE.RenderableFace = function () { |
| | | |
| | | this.id = 0; |
| | | |
| | | this.v1 = new THREE.RenderableVertex(); |
| | | this.v2 = new THREE.RenderableVertex(); |
| | | this.v3 = new THREE.RenderableVertex(); |
| | | |
| | | this.normalModel = new THREE.Vector3(); |
| | | |
| | | this.vertexNormalsModel = [new THREE.Vector3(), new THREE.Vector3(), new THREE.Vector3()]; |
| | | this.vertexNormalsLength = 0; |
| | | |
| | | this.color = new THREE.Color(); |
| | | this.material = null; |
| | | this.uvs = [new THREE.Vector2(), new THREE.Vector2(), new THREE.Vector2()]; |
| | | |
| | | this.z = 0; |
| | | this.renderOrder = 0; |
| | | |
| | | }; |
| | | |
| | | // |
| | | |
| | | THREE.RenderableVertex = function () { |
| | | |
| | | this.position = new THREE.Vector3(); |
| | | this.positionWorld = new THREE.Vector3(); |
| | | this.positionScreen = new THREE.Vector4(); |
| | | |
| | | this.visible = true; |
| | | |
| | | }; |
| | | |
| | | THREE.RenderableVertex.prototype.copy = function (vertex) { |
| | | |
| | | this.positionWorld.copy(vertex.positionWorld); |
| | | this.positionScreen.copy(vertex.positionScreen); |
| | | |
| | | }; |
| | | |
| | | // |
| | | |
| | | THREE.RenderableLine = function () { |
| | | |
| | | this.id = 0; |
| | | |
| | | this.v1 = new THREE.RenderableVertex(); |
| | | this.v2 = new THREE.RenderableVertex(); |
| | | |
| | | this.vertexColors = [new THREE.Color(), new THREE.Color()]; |
| | | this.material = null; |
| | | |
| | | this.z = 0; |
| | | this.renderOrder = 0; |
| | | |
| | | }; |
| | | |
| | | // |
| | | |
| | | THREE.RenderableSprite = function () { |
| | | |
| | | this.id = 0; |
| | | |
| | | this.object = null; |
| | | |
| | | this.x = 0; |
| | | this.y = 0; |
| | | this.z = 0; |
| | | |
| | | this.rotation = 0; |
| | | this.scale = new THREE.Vector2(); |
| | | |
| | | this.material = null; |
| | | this.renderOrder = 0; |
| | | |
| | | }; |
| | | |
| | | // |
| | | |
| | | THREE.Projector = function () { |
| | | |
| | | var _object, _objectCount, _objectPool = [], _objectPoolLength = 0, |
| | | _vertex, _vertexCount, _vertexPool = [], _vertexPoolLength = 0, |
| | | _face, _faceCount, _facePool = [], _facePoolLength = 0, |
| | | _line, _lineCount, _linePool = [], _linePoolLength = 0, |
| | | _sprite, _spriteCount, _spritePool = [], _spritePoolLength = 0, |
| | | |
| | | _renderData = { objects: [], lights: [], elements: [] }, |
| | | |
| | | _vector3 = new THREE.Vector3(), |
| | | _vector4 = new THREE.Vector4(), |
| | | |
| | | _clipBox = new THREE.Box3(new THREE.Vector3(-1, -1, -1), new THREE.Vector3(1, 1, 1)), |
| | | _boundingBox = new THREE.Box3(), |
| | | _points3 = new Array(3), |
| | | |
| | | _viewMatrix = new THREE.Matrix4(), |
| | | _viewProjectionMatrix = new THREE.Matrix4(), |
| | | |
| | | _modelMatrix, |
| | | _modelViewProjectionMatrix = new THREE.Matrix4(), |
| | | |
| | | _normalMatrix = new THREE.Matrix3(), |
| | | |
| | | _frustum = new THREE.Frustum(), |
| | | |
| | | _clippedVertex1PositionScreen = new THREE.Vector4(), |
| | | _clippedVertex2PositionScreen = new THREE.Vector4(); |
| | | |
| | | // |
| | | |
| | | this.projectVector = function (vector, camera) { |
| | | |
| | | console.warn('THREE.Projector: .projectVector() is now vector.project().'); |
| | | vector.project(camera); |
| | | |
| | | }; |
| | | |
| | | this.unprojectVector = function (vector, camera) { |
| | | |
| | | console.warn('THREE.Projector: .unprojectVector() is now vector.unproject().'); |
| | | vector.unproject(camera); |
| | | |
| | | }; |
| | | |
| | | this.pickingRay = function () { |
| | | |
| | | console.error('THREE.Projector: .pickingRay() is now raycaster.setFromCamera().'); |
| | | |
| | | }; |
| | | |
| | | // |
| | | |
| | | var RenderList = function () { |
| | | |
| | | var normals = []; |
| | | var colors = []; |
| | | var uvs = []; |
| | | |
| | | var object = null; |
| | | var material = null; |
| | | |
| | | var normalMatrix = new THREE.Matrix3(); |
| | | |
| | | function setObject(value) { |
| | | |
| | | object = value; |
| | | material = object.material; |
| | | |
| | | normalMatrix.getNormalMatrix(object.matrixWorld); |
| | | |
| | | normals.length = 0; |
| | | colors.length = 0; |
| | | uvs.length = 0; |
| | | |
| | | } |
| | | |
| | | function projectVertex(vertex) { |
| | | |
| | | var position = vertex.position; |
| | | var positionWorld = vertex.positionWorld; |
| | | var positionScreen = vertex.positionScreen; |
| | | |
| | | positionWorld.copy(position).applyMatrix4(_modelMatrix); |
| | | positionScreen.copy(positionWorld).applyMatrix4(_viewProjectionMatrix); |
| | | |
| | | var invW = 1 / positionScreen.w; |
| | | |
| | | positionScreen.x *= invW; |
| | | positionScreen.y *= invW; |
| | | positionScreen.z *= invW; |
| | | |
| | | vertex.visible = positionScreen.x >= -1 && positionScreen.x <= 1 && |
| | | positionScreen.y >= -1 && positionScreen.y <= 1 && |
| | | positionScreen.z >= -1 && positionScreen.z <= 1; |
| | | |
| | | } |
| | | |
| | | function pushVertex(x, y, z) { |
| | | |
| | | _vertex = getNextVertexInPool(); |
| | | _vertex.position.set(x, y, z); |
| | | |
| | | projectVertex(_vertex); |
| | | |
| | | } |
| | | |
| | | function pushNormal(x, y, z) { |
| | | |
| | | normals.push(x, y, z); |
| | | |
| | | } |
| | | |
| | | function pushColor(r, g, b) { |
| | | |
| | | colors.push(r, g, b); |
| | | |
| | | } |
| | | |
| | | function pushUv(x, y) { |
| | | |
| | | uvs.push(x, y); |
| | | |
| | | } |
| | | |
| | | function checkTriangleVisibility(v1, v2, v3) { |
| | | |
| | | if (v1.visible === true || v2.visible === true || v3.visible === true) return true; |
| | | |
| | | _points3[0] = v1.positionScreen; |
| | | _points3[1] = v2.positionScreen; |
| | | _points3[2] = v3.positionScreen; |
| | | |
| | | return _clipBox.intersectsBox(_boundingBox.setFromPoints(_points3)); |
| | | |
| | | } |
| | | |
| | | function checkBackfaceCulling(v1, v2, v3) { |
| | | |
| | | return ((v3.positionScreen.x - v1.positionScreen.x) * |
| | | (v2.positionScreen.y - v1.positionScreen.y) - |
| | | (v3.positionScreen.y - v1.positionScreen.y) * |
| | | (v2.positionScreen.x - v1.positionScreen.x)) < 0; |
| | | |
| | | } |
| | | |
| | | function pushLine(a, b) { |
| | | |
| | | var v1 = _vertexPool[a]; |
| | | var v2 = _vertexPool[b]; |
| | | |
| | | // Clip |
| | | |
| | | v1.positionScreen.copy(v1.position).applyMatrix4(_modelViewProjectionMatrix); |
| | | v2.positionScreen.copy(v2.position).applyMatrix4(_modelViewProjectionMatrix); |
| | | |
| | | if (clipLine(v1.positionScreen, v2.positionScreen) === true) { |
| | | |
| | | // Perform the perspective divide |
| | | v1.positionScreen.multiplyScalar(1 / v1.positionScreen.w); |
| | | v2.positionScreen.multiplyScalar(1 / v2.positionScreen.w); |
| | | |
| | | _line = getNextLineInPool(); |
| | | _line.id = object.id; |
| | | _line.v1.copy(v1); |
| | | _line.v2.copy(v2); |
| | | _line.z = Math.max(v1.positionScreen.z, v2.positionScreen.z); |
| | | _line.renderOrder = object.renderOrder; |
| | | |
| | | _line.material = object.material; |
| | | |
| | | if (object.material.vertexColors === THREE.VertexColors) { |
| | | |
| | | _line.vertexColors[0].fromArray(colors, a * 3); |
| | | _line.vertexColors[1].fromArray(colors, b * 3); |
| | | |
| | | } |
| | | |
| | | _renderData.elements.push(_line); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | function pushTriangle(a, b, c) { |
| | | |
| | | var v1 = _vertexPool[a]; |
| | | var v2 = _vertexPool[b]; |
| | | var v3 = _vertexPool[c]; |
| | | |
| | | if (checkTriangleVisibility(v1, v2, v3) === false) return; |
| | | |
| | | if (material.side === THREE.DoubleSide || checkBackfaceCulling(v1, v2, v3) === true) { |
| | | |
| | | _face = getNextFaceInPool(); |
| | | |
| | | _face.id = object.id; |
| | | _face.v1.copy(v1); |
| | | _face.v2.copy(v2); |
| | | _face.v3.copy(v3); |
| | | _face.z = (v1.positionScreen.z + v2.positionScreen.z + v3.positionScreen.z) / 3; |
| | | _face.renderOrder = object.renderOrder; |
| | | |
| | | // use first vertex normal as face normal |
| | | |
| | | _face.normalModel.fromArray(normals, a * 3); |
| | | _face.normalModel.applyMatrix3(normalMatrix).normalize(); |
| | | |
| | | for (var i = 0; i < 3; i++) { |
| | | |
| | | var normal = _face.vertexNormalsModel[i]; |
| | | normal.fromArray(normals, arguments[i] * 3); |
| | | normal.applyMatrix3(normalMatrix).normalize(); |
| | | |
| | | var uv = _face.uvs[i]; |
| | | uv.fromArray(uvs, arguments[i] * 2); |
| | | |
| | | } |
| | | |
| | | _face.vertexNormalsLength = 3; |
| | | |
| | | _face.material = object.material; |
| | | |
| | | _renderData.elements.push(_face); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | return { |
| | | setObject: setObject, |
| | | projectVertex: projectVertex, |
| | | checkTriangleVisibility: checkTriangleVisibility, |
| | | checkBackfaceCulling: checkBackfaceCulling, |
| | | pushVertex: pushVertex, |
| | | pushNormal: pushNormal, |
| | | pushColor: pushColor, |
| | | pushUv: pushUv, |
| | | pushLine: pushLine, |
| | | pushTriangle: pushTriangle |
| | | }; |
| | | |
| | | }; |
| | | |
| | | var renderList = new RenderList(); |
| | | |
| | | function projectObject(object) { |
| | | |
| | | if (object.visible === false) return; |
| | | |
| | | if (object instanceof THREE.Light) { |
| | | |
| | | _renderData.lights.push(object); |
| | | |
| | | } else if (object instanceof THREE.Mesh || object instanceof THREE.Line || object instanceof THREE.Points) { |
| | | |
| | | if (object.material.visible === false) return; |
| | | if (object.frustumCulled === true && _frustum.intersectsObject(object) === false) return; |
| | | |
| | | addObject(object); |
| | | |
| | | } else if (object instanceof THREE.Sprite) { |
| | | |
| | | if (object.material.visible === false) return; |
| | | if (object.frustumCulled === true && _frustum.intersectsSprite(object) === false) return; |
| | | |
| | | addObject(object); |
| | | |
| | | } |
| | | |
| | | var children = object.children; |
| | | |
| | | for (var i = 0, l = children.length; i < l; i++) { |
| | | |
| | | projectObject(children[i]); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | function addObject(object) { |
| | | |
| | | _object = getNextObjectInPool(); |
| | | _object.id = object.id; |
| | | _object.object = object; |
| | | |
| | | _vector3.setFromMatrixPosition(object.matrixWorld); |
| | | _vector3.applyMatrix4(_viewProjectionMatrix); |
| | | _object.z = _vector3.z; |
| | | _object.renderOrder = object.renderOrder; |
| | | |
| | | _renderData.objects.push(_object); |
| | | |
| | | } |
| | | |
| | | this.projectScene = function (scene, camera, sortObjects, sortElements) { |
| | | |
| | | _faceCount = 0; |
| | | _lineCount = 0; |
| | | _spriteCount = 0; |
| | | |
| | | _renderData.elements.length = 0; |
| | | |
| | | if (scene.autoUpdate === true) scene.updateMatrixWorld(); |
| | | if (camera.parent === null) camera.updateMatrixWorld(); |
| | | |
| | | _viewMatrix.copy(camera.matrixWorldInverse); |
| | | _viewProjectionMatrix.multiplyMatrices(camera.projectionMatrix, _viewMatrix); |
| | | |
| | | _frustum.setFromMatrix(_viewProjectionMatrix); |
| | | |
| | | // |
| | | |
| | | _objectCount = 0; |
| | | |
| | | _renderData.objects.length = 0; |
| | | _renderData.lights.length = 0; |
| | | |
| | | projectObject(scene); |
| | | |
| | | if (sortObjects === true) { |
| | | |
| | | _renderData.objects.sort(painterSort); |
| | | |
| | | } |
| | | |
| | | // |
| | | |
| | | var objects = _renderData.objects; |
| | | |
| | | for (var o = 0, ol = objects.length; o < ol; o++) { |
| | | |
| | | var object = objects[o].object; |
| | | var geometry = object.geometry; |
| | | |
| | | renderList.setObject(object); |
| | | |
| | | _modelMatrix = object.matrixWorld; |
| | | |
| | | _vertexCount = 0; |
| | | |
| | | if (object instanceof THREE.Mesh) { |
| | | |
| | | if (geometry instanceof THREE.BufferGeometry) { |
| | | |
| | | var attributes = geometry.attributes; |
| | | var groups = geometry.groups; |
| | | |
| | | if (attributes.position === undefined) continue; |
| | | |
| | | var positions = attributes.position.array; |
| | | |
| | | for (var i = 0, l = positions.length; i < l; i += 3) { |
| | | |
| | | renderList.pushVertex(positions[i], positions[i + 1], positions[i + 2]); |
| | | |
| | | } |
| | | |
| | | if (attributes.normal !== undefined) { |
| | | |
| | | var normals = attributes.normal.array; |
| | | |
| | | for (var i = 0, l = normals.length; i < l; i += 3) { |
| | | |
| | | renderList.pushNormal(normals[i], normals[i + 1], normals[i + 2]); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | if (attributes.uv !== undefined) { |
| | | |
| | | var uvs = attributes.uv.array; |
| | | |
| | | for (var i = 0, l = uvs.length; i < l; i += 2) { |
| | | |
| | | renderList.pushUv(uvs[i], uvs[i + 1]); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | if (geometry.index !== null) { |
| | | |
| | | var indices = geometry.index.array; |
| | | |
| | | if (groups.length > 0) { |
| | | |
| | | for (var g = 0; g < groups.length; g++) { |
| | | |
| | | var group = groups[g]; |
| | | |
| | | for (var i = group.start, l = group.start + group.count; i < l; i += 3) { |
| | | |
| | | renderList.pushTriangle(indices[i], indices[i + 1], indices[i + 2]); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | } else { |
| | | |
| | | for (var i = 0, l = indices.length; i < l; i += 3) { |
| | | |
| | | renderList.pushTriangle(indices[i], indices[i + 1], indices[i + 2]); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | } else { |
| | | |
| | | for (var i = 0, l = positions.length / 3; i < l; i += 3) { |
| | | |
| | | renderList.pushTriangle(i, i + 1, i + 2); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | } else if (geometry instanceof THREE.Geometry) { |
| | | |
| | | var vertices = geometry.vertices; |
| | | var faces = geometry.faces; |
| | | var faceVertexUvs = geometry.faceVertexUvs[0]; |
| | | |
| | | _normalMatrix.getNormalMatrix(_modelMatrix); |
| | | |
| | | var material = object.material; |
| | | |
| | | var isMultiMaterial = Array.isArray(material); |
| | | |
| | | for (var v = 0, vl = vertices.length; v < vl; v++) { |
| | | |
| | | var vertex = vertices[v]; |
| | | |
| | | _vector3.copy(vertex); |
| | | |
| | | if (material.morphTargets === true) { |
| | | |
| | | var morphTargets = geometry.morphTargets; |
| | | var morphInfluences = object.morphTargetInfluences; |
| | | |
| | | for (var t = 0, tl = morphTargets.length; t < tl; t++) { |
| | | |
| | | var influence = morphInfluences[t]; |
| | | |
| | | if (influence === 0) continue; |
| | | |
| | | var target = morphTargets[t]; |
| | | var targetVertex = target.vertices[v]; |
| | | |
| | | _vector3.x += (targetVertex.x - vertex.x) * influence; |
| | | _vector3.y += (targetVertex.y - vertex.y) * influence; |
| | | _vector3.z += (targetVertex.z - vertex.z) * influence; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | renderList.pushVertex(_vector3.x, _vector3.y, _vector3.z); |
| | | |
| | | } |
| | | |
| | | for (var f = 0, fl = faces.length; f < fl; f++) { |
| | | |
| | | var face = faces[f]; |
| | | |
| | | material = isMultiMaterial === true |
| | | ? object.material[face.materialIndex] |
| | | : object.material; |
| | | |
| | | if (material === undefined) continue; |
| | | |
| | | var side = material.side; |
| | | |
| | | var v1 = _vertexPool[face.a]; |
| | | var v2 = _vertexPool[face.b]; |
| | | var v3 = _vertexPool[face.c]; |
| | | |
| | | if (renderList.checkTriangleVisibility(v1, v2, v3) === false) continue; |
| | | |
| | | var visible = renderList.checkBackfaceCulling(v1, v2, v3); |
| | | |
| | | if (side !== THREE.DoubleSide) { |
| | | |
| | | if (side === THREE.FrontSide && visible === false) continue; |
| | | if (side === THREE.BackSide && visible === true) continue; |
| | | |
| | | } |
| | | |
| | | _face = getNextFaceInPool(); |
| | | |
| | | _face.id = object.id; |
| | | _face.v1.copy(v1); |
| | | _face.v2.copy(v2); |
| | | _face.v3.copy(v3); |
| | | |
| | | _face.normalModel.copy(face.normal); |
| | | |
| | | if (visible === false && (side === THREE.BackSide || side === THREE.DoubleSide)) { |
| | | |
| | | _face.normalModel.negate(); |
| | | |
| | | } |
| | | |
| | | _face.normalModel.applyMatrix3(_normalMatrix).normalize(); |
| | | |
| | | var faceVertexNormals = face.vertexNormals; |
| | | |
| | | for (var n = 0, nl = Math.min(faceVertexNormals.length, 3) ; n < nl; n++) { |
| | | |
| | | var normalModel = _face.vertexNormalsModel[n]; |
| | | normalModel.copy(faceVertexNormals[n]); |
| | | |
| | | if (visible === false && (side === THREE.BackSide || side === THREE.DoubleSide)) { |
| | | |
| | | normalModel.negate(); |
| | | |
| | | } |
| | | |
| | | normalModel.applyMatrix3(_normalMatrix).normalize(); |
| | | |
| | | } |
| | | |
| | | _face.vertexNormalsLength = faceVertexNormals.length; |
| | | |
| | | var vertexUvs = faceVertexUvs[f]; |
| | | |
| | | if (vertexUvs !== undefined) { |
| | | |
| | | for (var u = 0; u < 3; u++) { |
| | | |
| | | _face.uvs[u].copy(vertexUvs[u]); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | _face.color = face.color; |
| | | _face.material = material; |
| | | |
| | | _face.z = (v1.positionScreen.z + v2.positionScreen.z + v3.positionScreen.z) / 3; |
| | | _face.renderOrder = object.renderOrder; |
| | | |
| | | _renderData.elements.push(_face); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | } else if (object instanceof THREE.Line) { |
| | | |
| | | _modelViewProjectionMatrix.multiplyMatrices(_viewProjectionMatrix, _modelMatrix); |
| | | |
| | | if (geometry instanceof THREE.BufferGeometry) { |
| | | |
| | | var attributes = geometry.attributes; |
| | | |
| | | if (attributes.position !== undefined) { |
| | | |
| | | var positions = attributes.position.array; |
| | | |
| | | for (var i = 0, l = positions.length; i < l; i += 3) { |
| | | |
| | | renderList.pushVertex(positions[i], positions[i + 1], positions[i + 2]); |
| | | |
| | | } |
| | | |
| | | if (attributes.color !== undefined) { |
| | | |
| | | var colors = attributes.color.array; |
| | | |
| | | for (var i = 0, l = colors.length; i < l; i += 3) { |
| | | |
| | | renderList.pushColor(colors[i], colors[i + 1], colors[i + 2]); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | if (geometry.index !== null) { |
| | | |
| | | var indices = geometry.index.array; |
| | | |
| | | for (var i = 0, l = indices.length; i < l; i += 2) { |
| | | |
| | | renderList.pushLine(indices[i], indices[i + 1]); |
| | | |
| | | } |
| | | |
| | | } else { |
| | | |
| | | var step = object instanceof THREE.LineSegments ? 2 : 1; |
| | | |
| | | for (var i = 0, l = (positions.length / 3) - 1; i < l; i += step) { |
| | | |
| | | renderList.pushLine(i, i + 1); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | } else if (geometry instanceof THREE.Geometry) { |
| | | |
| | | var vertices = object.geometry.vertices; |
| | | |
| | | if (vertices.length === 0) continue; |
| | | |
| | | v1 = getNextVertexInPool(); |
| | | v1.positionScreen.copy(vertices[0]).applyMatrix4(_modelViewProjectionMatrix); |
| | | |
| | | var step = object instanceof THREE.LineSegments ? 2 : 1; |
| | | |
| | | for (var v = 1, vl = vertices.length; v < vl; v++) { |
| | | |
| | | v1 = getNextVertexInPool(); |
| | | v1.positionScreen.copy(vertices[v]).applyMatrix4(_modelViewProjectionMatrix); |
| | | |
| | | if ((v + 1) % step > 0) continue; |
| | | |
| | | v2 = _vertexPool[_vertexCount - 2]; |
| | | |
| | | _clippedVertex1PositionScreen.copy(v1.positionScreen); |
| | | _clippedVertex2PositionScreen.copy(v2.positionScreen); |
| | | |
| | | if (clipLine(_clippedVertex1PositionScreen, _clippedVertex2PositionScreen) === true) { |
| | | |
| | | // Perform the perspective divide |
| | | _clippedVertex1PositionScreen.multiplyScalar(1 / _clippedVertex1PositionScreen.w); |
| | | _clippedVertex2PositionScreen.multiplyScalar(1 / _clippedVertex2PositionScreen.w); |
| | | |
| | | _line = getNextLineInPool(); |
| | | |
| | | _line.id = object.id; |
| | | _line.v1.positionScreen.copy(_clippedVertex1PositionScreen); |
| | | _line.v2.positionScreen.copy(_clippedVertex2PositionScreen); |
| | | |
| | | _line.z = Math.max(_clippedVertex1PositionScreen.z, _clippedVertex2PositionScreen.z); |
| | | _line.renderOrder = object.renderOrder; |
| | | |
| | | _line.material = object.material; |
| | | |
| | | if (object.material.vertexColors === THREE.VertexColors) { |
| | | |
| | | _line.vertexColors[0].copy(object.geometry.colors[v]); |
| | | _line.vertexColors[1].copy(object.geometry.colors[v - 1]); |
| | | |
| | | } |
| | | |
| | | _renderData.elements.push(_line); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | } else if (object instanceof THREE.Points) { |
| | | |
| | | _modelViewProjectionMatrix.multiplyMatrices(_viewProjectionMatrix, _modelMatrix); |
| | | |
| | | if (geometry instanceof THREE.Geometry) { |
| | | |
| | | var vertices = object.geometry.vertices; |
| | | |
| | | for (var v = 0, vl = vertices.length; v < vl; v++) { |
| | | |
| | | var vertex = vertices[v]; |
| | | |
| | | _vector4.set(vertex.x, vertex.y, vertex.z, 1); |
| | | _vector4.applyMatrix4(_modelViewProjectionMatrix); |
| | | |
| | | pushPoint(_vector4, object, camera); |
| | | |
| | | } |
| | | |
| | | } else if (geometry instanceof THREE.BufferGeometry) { |
| | | |
| | | var attributes = geometry.attributes; |
| | | |
| | | if (attributes.position !== undefined) { |
| | | |
| | | var positions = attributes.position.array; |
| | | |
| | | for (var i = 0, l = positions.length; i < l; i += 3) { |
| | | |
| | | _vector4.set(positions[i], positions[i + 1], positions[i + 2], 1); |
| | | _vector4.applyMatrix4(_modelViewProjectionMatrix); |
| | | |
| | | pushPoint(_vector4, object, camera); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | } else if (object instanceof THREE.Sprite) { |
| | | |
| | | _vector4.set(_modelMatrix.elements[12], _modelMatrix.elements[13], _modelMatrix.elements[14], 1); |
| | | _vector4.applyMatrix4(_viewProjectionMatrix); |
| | | |
| | | pushPoint(_vector4, object, camera); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | if (sortElements === true) { |
| | | |
| | | _renderData.elements.sort(painterSort); |
| | | |
| | | } |
| | | |
| | | return _renderData; |
| | | |
| | | }; |
| | | |
| | | function pushPoint(_vector4, object, camera) { |
| | | |
| | | var invW = 1 / _vector4.w; |
| | | |
| | | _vector4.z *= invW; |
| | | |
| | | if (_vector4.z >= -1 && _vector4.z <= 1) { |
| | | |
| | | _sprite = getNextSpriteInPool(); |
| | | _sprite.id = object.id; |
| | | _sprite.x = _vector4.x * invW; |
| | | _sprite.y = _vector4.y * invW; |
| | | _sprite.z = _vector4.z; |
| | | _sprite.renderOrder = object.renderOrder; |
| | | _sprite.object = object; |
| | | |
| | | _sprite.rotation = object.rotation; |
| | | |
| | | _sprite.scale.x = object.scale.x * Math.abs(_sprite.x - (_vector4.x + camera.projectionMatrix.elements[0]) / (_vector4.w + camera.projectionMatrix.elements[12])); |
| | | _sprite.scale.y = object.scale.y * Math.abs(_sprite.y - (_vector4.y + camera.projectionMatrix.elements[5]) / (_vector4.w + camera.projectionMatrix.elements[13])); |
| | | |
| | | _sprite.material = object.material; |
| | | |
| | | _renderData.elements.push(_sprite); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | // Pools |
| | | |
| | | function getNextObjectInPool() { |
| | | |
| | | if (_objectCount === _objectPoolLength) { |
| | | |
| | | var object = new THREE.RenderableObject(); |
| | | _objectPool.push(object); |
| | | _objectPoolLength++; |
| | | _objectCount++; |
| | | return object; |
| | | |
| | | } |
| | | |
| | | return _objectPool[_objectCount++]; |
| | | |
| | | } |
| | | |
| | | function getNextVertexInPool() { |
| | | |
| | | if (_vertexCount === _vertexPoolLength) { |
| | | |
| | | var vertex = new THREE.RenderableVertex(); |
| | | _vertexPool.push(vertex); |
| | | _vertexPoolLength++; |
| | | _vertexCount++; |
| | | return vertex; |
| | | |
| | | } |
| | | |
| | | return _vertexPool[_vertexCount++]; |
| | | |
| | | } |
| | | |
| | | function getNextFaceInPool() { |
| | | |
| | | if (_faceCount === _facePoolLength) { |
| | | |
| | | var face = new THREE.RenderableFace(); |
| | | _facePool.push(face); |
| | | _facePoolLength++; |
| | | _faceCount++; |
| | | return face; |
| | | |
| | | } |
| | | |
| | | return _facePool[_faceCount++]; |
| | | |
| | | |
| | | } |
| | | |
| | | function getNextLineInPool() { |
| | | |
| | | if (_lineCount === _linePoolLength) { |
| | | |
| | | var line = new THREE.RenderableLine(); |
| | | _linePool.push(line); |
| | | _linePoolLength++; |
| | | _lineCount++; |
| | | return line; |
| | | |
| | | } |
| | | |
| | | return _linePool[_lineCount++]; |
| | | |
| | | } |
| | | |
| | | function getNextSpriteInPool() { |
| | | |
| | | if (_spriteCount === _spritePoolLength) { |
| | | |
| | | var sprite = new THREE.RenderableSprite(); |
| | | _spritePool.push(sprite); |
| | | _spritePoolLength++; |
| | | _spriteCount++; |
| | | return sprite; |
| | | |
| | | } |
| | | |
| | | return _spritePool[_spriteCount++]; |
| | | |
| | | } |
| | | |
| | | // |
| | | |
| | | function painterSort(a, b) { |
| | | |
| | | if (a.renderOrder !== b.renderOrder) { |
| | | |
| | | return a.renderOrder - b.renderOrder; |
| | | |
| | | } else if (a.z !== b.z) { |
| | | |
| | | return b.z - a.z; |
| | | |
| | | } else if (a.id !== b.id) { |
| | | |
| | | return a.id - b.id; |
| | | |
| | | } else { |
| | | |
| | | return 0; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | function clipLine(s1, s2) { |
| | | |
| | | var alpha1 = 0, alpha2 = 1, |
| | | |
| | | // Calculate the boundary coordinate of each vertex for the near and far clip planes, |
| | | // Z = -1 and Z = +1, respectively. |
| | | |
| | | bc1near = s1.z + s1.w, |
| | | bc2near = s2.z + s2.w, |
| | | bc1far = -s1.z + s1.w, |
| | | bc2far = -s2.z + s2.w; |
| | | |
| | | if (bc1near >= 0 && bc2near >= 0 && bc1far >= 0 && bc2far >= 0) { |
| | | |
| | | // Both vertices lie entirely within all clip planes. |
| | | return true; |
| | | |
| | | } else if ((bc1near < 0 && bc2near < 0) || (bc1far < 0 && bc2far < 0)) { |
| | | |
| | | // Both vertices lie entirely outside one of the clip planes. |
| | | return false; |
| | | |
| | | } else { |
| | | |
| | | // The line segment spans at least one clip plane. |
| | | |
| | | if (bc1near < 0) { |
| | | |
| | | // v1 lies outside the near plane, v2 inside |
| | | alpha1 = Math.max(alpha1, bc1near / (bc1near - bc2near)); |
| | | |
| | | } else if (bc2near < 0) { |
| | | |
| | | // v2 lies outside the near plane, v1 inside |
| | | alpha2 = Math.min(alpha2, bc1near / (bc1near - bc2near)); |
| | | |
| | | } |
| | | |
| | | if (bc1far < 0) { |
| | | |
| | | // v1 lies outside the far plane, v2 inside |
| | | alpha1 = Math.max(alpha1, bc1far / (bc1far - bc2far)); |
| | | |
| | | } else if (bc2far < 0) { |
| | | |
| | | // v2 lies outside the far plane, v2 inside |
| | | alpha2 = Math.min(alpha2, bc1far / (bc1far - bc2far)); |
| | | |
| | | } |
| | | |
| | | if (alpha2 < alpha1) { |
| | | |
| | | // The line segment spans two boundaries, but is outside both of them. |
| | | // (This can't happen when we're only clipping against just near/far but good |
| | | // to leave the check here for future usage if other clip planes are added.) |
| | | return false; |
| | | |
| | | } else { |
| | | |
| | | // Update the s1 and s2 vertices to match the clipped line segment. |
| | | s1.lerp(s2, alpha1); |
| | | s2.lerp(s1, 1 - alpha2); |
| | | |
| | | return true; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | }; |
New file |
| | |
| | | // This THREEx helper makes it easy to handle the fullscreen API |
| | | // * it hides the prefix for each browser |
| | | // * it hides the little discrepencies of the various vendor API |
| | | // * at the time of this writing (nov 2011) it is available in |
| | | // [firefox nightly](http://blog.pearce.org.nz/2011/11/firefoxs-html-full-screen-api-enabled.html), |
| | | // [webkit nightly](http://peter.sh/2011/01/javascript-full-screen-api-navigation-timing-and-repeating-css-gradients/) and |
| | | // [chrome stable](http://updates.html5rocks.com/2011/10/Let-Your-Content-Do-the-Talking-Fullscreen-API). |
| | | |
| | | // |
| | | // # Code |
| | | |
| | | // |
| | | |
| | | /** @namespace */ |
| | | var THREEx = THREEx || {}; |
| | | THREEx.FullScreen = THREEx.FullScreen || {}; |
| | | |
| | | /** |
| | | * test if it is possible to have fullscreen |
| | | * |
| | | * @returns {Boolean} true if fullscreen API is available, false otherwise |
| | | */ |
| | | THREEx.FullScreen.available = function () { |
| | | return this._hasWebkitFullScreen || this._hasMozFullScreen; |
| | | } |
| | | |
| | | /** |
| | | * test if fullscreen is currently activated |
| | | * |
| | | * @returns {Boolean} true if fullscreen is currently activated, false otherwise |
| | | */ |
| | | THREEx.FullScreen.activated = function () { |
| | | if (this._hasWebkitFullScreen) { |
| | | return document.webkitIsFullScreen; |
| | | } else if (this._hasMozFullScreen) { |
| | | return document.mozFullScreen; |
| | | } else { |
| | | console.assert(false); |
| | | } |
| | | } |
| | | |
| | | /** |
| | | * Request fullscreen on a given element |
| | | * @param {DomElement} element to make fullscreen. optional. default to document.body |
| | | */ |
| | | THREEx.FullScreen.request = function (element) { |
| | | element = element || document.body; |
| | | if (this._hasWebkitFullScreen) { |
| | | element.webkitRequestFullScreen(); |
| | | } else if (this._hasMozFullScreen) { |
| | | element.mozRequestFullScreen(); |
| | | } else { |
| | | console.assert(false); |
| | | } |
| | | } |
| | | |
| | | /** |
| | | * Cancel fullscreen |
| | | */ |
| | | THREEx.FullScreen.cancel = function () { |
| | | if (this._hasWebkitFullScreen) { |
| | | document.webkitCancelFullScreen(); |
| | | } else if (this._hasMozFullScreen) { |
| | | document.mozCancelFullScreen(); |
| | | } else { |
| | | console.assert(false); |
| | | } |
| | | } |
| | | |
| | | // internal functions to know which fullscreen API implementation is available |
| | | THREEx.FullScreen._hasWebkitFullScreen = 'webkitCancelFullScreen' in document ? true : false; |
| | | THREEx.FullScreen._hasMozFullScreen = 'mozCancelFullScreen' in document ? true : false; |
| | | |
| | | /** |
| | | * Bind a key to renderer screenshot |
| | | * usage: THREEx.FullScreen.bindKey({ charCode : 'a'.charCodeAt(0) }); |
| | | */ |
| | | THREEx.FullScreen.bindKey = function (opts) { |
| | | opts = opts || {}; |
| | | var charCode = opts.charCode || 'f'.charCodeAt(0); |
| | | var dblclick = opts.dblclick !== undefined ? opts.dblclick : false; |
| | | var element = opts.element |
| | | |
| | | var toggle = function () { |
| | | if (THREEx.FullScreen.activated()) { |
| | | THREEx.FullScreen.cancel(); |
| | | } else { |
| | | THREEx.FullScreen.request(element); |
| | | } |
| | | } |
| | | |
| | | var onKeyPress = function (event) { |
| | | if (event.which !== charCode) return; |
| | | toggle(); |
| | | }.bind(this); |
| | | |
| | | document.addEventListener('keypress', onKeyPress, false); |
| | | |
| | | dblclick && document.addEventListener('dblclick', toggle, false); |
| | | |
| | | return { |
| | | unbind: function () { |
| | | document.removeEventListener('keypress', onKeyPress, false); |
| | | dblclick && document.removeEventListener('dblclick', toggle, false); |
| | | } |
| | | }; |
| | | } |
New file |
| | |
| | | // This THREEx helper makes it easy to handle window resize. |
| | | // It will update renderer and camera when window is resized. |
| | | // |
| | | // # Usage |
| | | // |
| | | // **Step 1**: Start updating renderer and camera |
| | | // |
| | | // ```var windowResize = THREEx.WindowResize(aRenderer, aCamera)``` |
| | | // |
| | | // **Step 2**: Start updating renderer and camera |
| | | // |
| | | // ```windowResize.stop()``` |
| | | // # Code |
| | | |
| | | // |
| | | |
| | | /** @namespace */ |
| | | var THREEx = THREEx || {}; |
| | | |
| | | /** |
| | | * Update renderer and camera when the window is resized |
| | | * |
| | | * @param {Object} renderer the renderer to update |
| | | * @param {Object} Camera the camera to update |
| | | */ |
| | | THREEx.WindowResize = function (renderer, camera) { |
| | | var callback = function () { |
| | | // notify the renderer of the size change |
| | | renderer.setSize(window.innerWidth, window.innerHeight); |
| | | // update the camera |
| | | camera.aspect = window.innerWidth / window.innerHeight; |
| | | camera.updateProjectionMatrix(); |
| | | } |
| | | // bind the resize event |
| | | window.addEventListener('resize', callback, false); |
| | | // return .stop() the function to stop watching window resize |
| | | return { |
| | | /** |
| | | * Stop watching window resize |
| | | */ |
| | | stop: function () { |
| | | window.removeEventListener('resize', callback); |
| | | } |
| | | }; |
| | | } |
New file |
| | |
| | | /** |
| | | * @author arodic / https://github.com/arodic |
| | | */ |
| | | |
| | | (function () { |
| | | |
| | | 'use strict'; |
| | | |
| | | var GizmoMaterial = function (parameters) { |
| | | |
| | | THREE.MeshBasicMaterial.call(this); |
| | | |
| | | this.depthTest = false; |
| | | this.depthWrite = false; |
| | | this.fog = false; |
| | | this.side = THREE.FrontSide; |
| | | this.transparent = true; |
| | | |
| | | this.setValues(parameters); |
| | | |
| | | this.oldColor = this.color.clone(); |
| | | this.oldOpacity = this.opacity; |
| | | |
| | | this.highlight = function (highlighted) { |
| | | |
| | | if (highlighted) { |
| | | |
| | | this.color.setRGB(1, 1, 0); |
| | | this.opacity = 1; |
| | | |
| | | } else { |
| | | |
| | | this.color.copy(this.oldColor); |
| | | this.opacity = this.oldOpacity; |
| | | |
| | | } |
| | | |
| | | }; |
| | | |
| | | }; |
| | | |
| | | GizmoMaterial.prototype = Object.create(THREE.MeshBasicMaterial.prototype); |
| | | GizmoMaterial.prototype.constructor = GizmoMaterial; |
| | | |
| | | |
| | | var GizmoLineMaterial = function (parameters) { |
| | | |
| | | THREE.LineBasicMaterial.call(this); |
| | | |
| | | this.depthTest = false; |
| | | this.depthWrite = false; |
| | | this.fog = false; |
| | | this.transparent = true; |
| | | this.linewidth = 1; |
| | | |
| | | this.setValues(parameters); |
| | | |
| | | this.oldColor = this.color.clone(); |
| | | this.oldOpacity = this.opacity; |
| | | |
| | | this.highlight = function (highlighted) { |
| | | |
| | | if (highlighted) { |
| | | |
| | | this.color.setRGB(1, 1, 0); |
| | | this.opacity = 1; |
| | | |
| | | } else { |
| | | |
| | | this.color.copy(this.oldColor); |
| | | this.opacity = this.oldOpacity; |
| | | |
| | | } |
| | | |
| | | }; |
| | | |
| | | }; |
| | | |
| | | GizmoLineMaterial.prototype = Object.create(THREE.LineBasicMaterial.prototype); |
| | | GizmoLineMaterial.prototype.constructor = GizmoLineMaterial; |
| | | |
| | | |
| | | var pickerMaterial = new GizmoMaterial({ visible: false, transparent: false }); |
| | | |
| | | |
| | | THREE.TransformGizmo = function () { |
| | | |
| | | this.init = function () { |
| | | |
| | | THREE.Object3D.call(this); |
| | | |
| | | this.handles = new THREE.Object3D(); |
| | | this.pickers = new THREE.Object3D(); |
| | | this.planes = new THREE.Object3D(); |
| | | |
| | | this.add(this.handles); |
| | | this.add(this.pickers); |
| | | this.add(this.planes); |
| | | |
| | | //// PLANES |
| | | |
| | | var planeGeometry = new THREE.PlaneBufferGeometry(50, 50, 2, 2); |
| | | var planeMaterial = new THREE.MeshBasicMaterial({ visible: false, side: THREE.DoubleSide }); |
| | | |
| | | var planes = { |
| | | "XY": new THREE.Mesh(planeGeometry, planeMaterial), |
| | | "YZ": new THREE.Mesh(planeGeometry, planeMaterial), |
| | | "XZ": new THREE.Mesh(planeGeometry, planeMaterial), |
| | | "XYZE": new THREE.Mesh(planeGeometry, planeMaterial) |
| | | }; |
| | | |
| | | this.activePlane = planes["XYZE"]; |
| | | |
| | | planes["YZ"].rotation.set(0, Math.PI / 2, 0); |
| | | planes["XZ"].rotation.set(-Math.PI / 2, 0, 0); |
| | | |
| | | for (var i in planes) { |
| | | |
| | | planes[i].name = i; |
| | | this.planes.add(planes[i]); |
| | | this.planes[i] = planes[i]; |
| | | |
| | | } |
| | | |
| | | //// HANDLES AND PICKERS |
| | | |
| | | var setupGizmos = function (gizmoMap, parent) { |
| | | |
| | | for (var name in gizmoMap) { |
| | | |
| | | for (i = gizmoMap[name].length; i--;) { |
| | | |
| | | var object = gizmoMap[name][i][0]; |
| | | var position = gizmoMap[name][i][1]; |
| | | var rotation = gizmoMap[name][i][2]; |
| | | |
| | | object.name = name; |
| | | |
| | | object.renderOrder = Infinity; // avoid being hidden by other transparent objects |
| | | |
| | | if (position) object.position.set(position[0], position[1], position[2]); |
| | | if (rotation) object.rotation.set(rotation[0], rotation[1], rotation[2]); |
| | | |
| | | parent.add(object); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | }; |
| | | |
| | | setupGizmos(this.handleGizmos, this.handles); |
| | | setupGizmos(this.pickerGizmos, this.pickers); |
| | | |
| | | // reset Transformations |
| | | |
| | | this.traverse(function (child) { |
| | | |
| | | if (child instanceof THREE.Mesh) { |
| | | |
| | | child.updateMatrix(); |
| | | |
| | | var tempGeometry = child.geometry.clone(); |
| | | tempGeometry.applyMatrix(child.matrix); |
| | | child.geometry = tempGeometry; |
| | | |
| | | child.position.set(0, 0, 0); |
| | | child.rotation.set(0, 0, 0); |
| | | child.scale.set(1, 1, 1); |
| | | |
| | | } |
| | | |
| | | }); |
| | | |
| | | }; |
| | | |
| | | this.highlight = function (axis) { |
| | | |
| | | this.traverse(function (child) { |
| | | |
| | | if (child.material && child.material.highlight) { |
| | | |
| | | if (child.name === axis) { |
| | | |
| | | child.material.highlight(true); |
| | | |
| | | } else { |
| | | |
| | | child.material.highlight(false); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | }); |
| | | |
| | | }; |
| | | |
| | | }; |
| | | |
| | | THREE.TransformGizmo.prototype = Object.create(THREE.Object3D.prototype); |
| | | THREE.TransformGizmo.prototype.constructor = THREE.TransformGizmo; |
| | | |
| | | THREE.TransformGizmo.prototype.update = function (rotation, eye) { |
| | | |
| | | var vec1 = new THREE.Vector3(0, 0, 0); |
| | | var vec2 = new THREE.Vector3(0, 1, 0); |
| | | var lookAtMatrix = new THREE.Matrix4(); |
| | | |
| | | this.traverse(function (child) { |
| | | |
| | | if (child.name.search("E") !== -1) { |
| | | |
| | | child.quaternion.setFromRotationMatrix(lookAtMatrix.lookAt(eye, vec1, vec2)); |
| | | |
| | | } else if (child.name.search("X") !== -1 || child.name.search("Y") !== -1 || child.name.search("Z") !== -1) { |
| | | |
| | | child.quaternion.setFromEuler(rotation); |
| | | |
| | | } |
| | | |
| | | }); |
| | | |
| | | }; |
| | | |
| | | THREE.TransformGizmoTranslate = function () { |
| | | |
| | | THREE.TransformGizmo.call(this); |
| | | |
| | | var arrowGeometry = new THREE.ConeBufferGeometry(0.05, 0.2, 12, 1, false); |
| | | arrowGeometry.translate(0, 0.5, 0); |
| | | |
| | | var lineXGeometry = new THREE.BufferGeometry(); |
| | | lineXGeometry.addAttribute('position', new THREE.Float32BufferAttribute([0, 0, 0, 1, 0, 0], 3)); |
| | | |
| | | var lineYGeometry = new THREE.BufferGeometry(); |
| | | lineYGeometry.addAttribute('position', new THREE.Float32BufferAttribute([0, 0, 0, 0, 1, 0], 3)); |
| | | |
| | | var lineZGeometry = new THREE.BufferGeometry(); |
| | | lineZGeometry.addAttribute('position', new THREE.Float32BufferAttribute([0, 0, 0, 0, 0, 1], 3)); |
| | | |
| | | this.handleGizmos = { |
| | | |
| | | X: [ |
| | | [new THREE.Mesh(arrowGeometry, new GizmoMaterial({ color: 0xff0000 })), [0.5, 0, 0], [0, 0, -Math.PI / 2]], |
| | | [new THREE.Line(lineXGeometry, new GizmoLineMaterial({ color: 0xff0000 }))] |
| | | ], |
| | | |
| | | Y: [ |
| | | [new THREE.Mesh(arrowGeometry, new GizmoMaterial({ color: 0x00ff00 })), [0, 0.5, 0]], |
| | | [new THREE.Line(lineYGeometry, new GizmoLineMaterial({ color: 0x00ff00 }))] |
| | | ], |
| | | |
| | | Z: [ |
| | | [new THREE.Mesh(arrowGeometry, new GizmoMaterial({ color: 0x0000ff })), [0, 0, 0.5], [Math.PI / 2, 0, 0]], |
| | | [new THREE.Line(lineZGeometry, new GizmoLineMaterial({ color: 0x0000ff }))] |
| | | ], |
| | | |
| | | XYZ: [ |
| | | [new THREE.Mesh(new THREE.OctahedronGeometry(0.1, 0), new GizmoMaterial({ color: 0xffffff, opacity: 0.25 })), [0, 0, 0], [0, 0, 0]] |
| | | ], |
| | | |
| | | XY: [ |
| | | [new THREE.Mesh(new THREE.PlaneBufferGeometry(0.29, 0.29), new GizmoMaterial({ color: 0xffff00, opacity: 0.25 })), [0.15, 0.15, 0]] |
| | | ], |
| | | |
| | | YZ: [ |
| | | [new THREE.Mesh(new THREE.PlaneBufferGeometry(0.29, 0.29), new GizmoMaterial({ color: 0x00ffff, opacity: 0.25 })), [0, 0.15, 0.15], [0, Math.PI / 2, 0]] |
| | | ], |
| | | |
| | | XZ: [ |
| | | [new THREE.Mesh(new THREE.PlaneBufferGeometry(0.29, 0.29), new GizmoMaterial({ color: 0xff00ff, opacity: 0.25 })), [0.15, 0, 0.15], [-Math.PI / 2, 0, 0]] |
| | | ] |
| | | |
| | | }; |
| | | |
| | | this.pickerGizmos = { |
| | | |
| | | X: [ |
| | | [new THREE.Mesh(new THREE.CylinderBufferGeometry(0.2, 0, 1, 4, 1, false), pickerMaterial), [0.6, 0, 0], [0, 0, -Math.PI / 2]] |
| | | ], |
| | | |
| | | Y: [ |
| | | [new THREE.Mesh(new THREE.CylinderBufferGeometry(0.2, 0, 1, 4, 1, false), pickerMaterial), [0, 0.6, 0]] |
| | | ], |
| | | |
| | | Z: [ |
| | | [new THREE.Mesh(new THREE.CylinderBufferGeometry(0.2, 0, 1, 4, 1, false), pickerMaterial), [0, 0, 0.6], [Math.PI / 2, 0, 0]] |
| | | ], |
| | | |
| | | XYZ: [ |
| | | [new THREE.Mesh(new THREE.OctahedronGeometry(0.2, 0), pickerMaterial)] |
| | | ], |
| | | |
| | | XY: [ |
| | | [new THREE.Mesh(new THREE.PlaneBufferGeometry(0.4, 0.4), pickerMaterial), [0.2, 0.2, 0]] |
| | | ], |
| | | |
| | | YZ: [ |
| | | [new THREE.Mesh(new THREE.PlaneBufferGeometry(0.4, 0.4), pickerMaterial), [0, 0.2, 0.2], [0, Math.PI / 2, 0]] |
| | | ], |
| | | |
| | | XZ: [ |
| | | [new THREE.Mesh(new THREE.PlaneBufferGeometry(0.4, 0.4), pickerMaterial), [0.2, 0, 0.2], [-Math.PI / 2, 0, 0]] |
| | | ] |
| | | |
| | | }; |
| | | |
| | | this.setActivePlane = function (axis, eye) { |
| | | |
| | | var tempMatrix = new THREE.Matrix4(); |
| | | eye.applyMatrix4(tempMatrix.getInverse(tempMatrix.extractRotation(this.planes["XY"].matrixWorld))); |
| | | |
| | | if (axis === "X") { |
| | | |
| | | this.activePlane = this.planes["XY"]; |
| | | |
| | | if (Math.abs(eye.y) > Math.abs(eye.z)) this.activePlane = this.planes["XZ"]; |
| | | |
| | | } |
| | | |
| | | if (axis === "Y") { |
| | | |
| | | this.activePlane = this.planes["XY"]; |
| | | |
| | | if (Math.abs(eye.x) > Math.abs(eye.z)) this.activePlane = this.planes["YZ"]; |
| | | |
| | | } |
| | | |
| | | if (axis === "Z") { |
| | | |
| | | this.activePlane = this.planes["XZ"]; |
| | | |
| | | if (Math.abs(eye.x) > Math.abs(eye.y)) this.activePlane = this.planes["YZ"]; |
| | | |
| | | } |
| | | |
| | | if (axis === "XYZ") this.activePlane = this.planes["XYZE"]; |
| | | |
| | | if (axis === "XY") this.activePlane = this.planes["XY"]; |
| | | |
| | | if (axis === "YZ") this.activePlane = this.planes["YZ"]; |
| | | |
| | | if (axis === "XZ") this.activePlane = this.planes["XZ"]; |
| | | |
| | | }; |
| | | |
| | | this.init(); |
| | | |
| | | }; |
| | | |
| | | THREE.TransformGizmoTranslate.prototype = Object.create(THREE.TransformGizmo.prototype); |
| | | THREE.TransformGizmoTranslate.prototype.constructor = THREE.TransformGizmoTranslate; |
| | | |
| | | THREE.TransformGizmoRotate = function () { |
| | | |
| | | THREE.TransformGizmo.call(this); |
| | | |
| | | var CircleGeometry = function (radius, facing, arc) { |
| | | |
| | | var geometry = new THREE.BufferGeometry(); |
| | | var vertices = []; |
| | | arc = arc ? arc : 1; |
| | | |
| | | for (var i = 0; i <= 64 * arc; ++i) { |
| | | |
| | | if (facing === 'x') vertices.push(0, Math.cos(i / 32 * Math.PI) * radius, Math.sin(i / 32 * Math.PI) * radius); |
| | | if (facing === 'y') vertices.push(Math.cos(i / 32 * Math.PI) * radius, 0, Math.sin(i / 32 * Math.PI) * radius); |
| | | if (facing === 'z') vertices.push(Math.sin(i / 32 * Math.PI) * radius, Math.cos(i / 32 * Math.PI) * radius, 0); |
| | | |
| | | } |
| | | |
| | | geometry.addAttribute('position', new THREE.Float32BufferAttribute(vertices, 3)); |
| | | return geometry; |
| | | |
| | | }; |
| | | |
| | | this.handleGizmos = { |
| | | |
| | | X: [ |
| | | [new THREE.Line(new CircleGeometry(1, 'x', 0.5), new GizmoLineMaterial({ color: 0xff0000 }))] |
| | | ], |
| | | |
| | | Y: [ |
| | | [new THREE.Line(new CircleGeometry(1, 'y', 0.5), new GizmoLineMaterial({ color: 0x00ff00 }))] |
| | | ], |
| | | |
| | | Z: [ |
| | | [new THREE.Line(new CircleGeometry(1, 'z', 0.5), new GizmoLineMaterial({ color: 0x0000ff }))] |
| | | ], |
| | | |
| | | E: [ |
| | | [new THREE.Line(new CircleGeometry(1.25, 'z', 1), new GizmoLineMaterial({ color: 0xcccc00 }))] |
| | | ], |
| | | |
| | | XYZE: [ |
| | | [new THREE.Line(new CircleGeometry(1, 'z', 1), new GizmoLineMaterial({ color: 0x787878 }))] |
| | | ] |
| | | |
| | | }; |
| | | |
| | | this.pickerGizmos = { |
| | | |
| | | X: [ |
| | | [new THREE.Mesh(new THREE.TorusBufferGeometry(1, 0.12, 4, 12, Math.PI), pickerMaterial), [0, 0, 0], [0, -Math.PI / 2, -Math.PI / 2]] |
| | | ], |
| | | |
| | | Y: [ |
| | | [new THREE.Mesh(new THREE.TorusBufferGeometry(1, 0.12, 4, 12, Math.PI), pickerMaterial), [0, 0, 0], [Math.PI / 2, 0, 0]] |
| | | ], |
| | | |
| | | Z: [ |
| | | [new THREE.Mesh(new THREE.TorusBufferGeometry(1, 0.12, 4, 12, Math.PI), pickerMaterial), [0, 0, 0], [0, 0, -Math.PI / 2]] |
| | | ], |
| | | |
| | | E: [ |
| | | [new THREE.Mesh(new THREE.TorusBufferGeometry(1.25, 0.12, 2, 24), pickerMaterial)] |
| | | ], |
| | | |
| | | XYZE: [ |
| | | [new THREE.Mesh(new THREE.TorusBufferGeometry(1, 0.12, 2, 24), pickerMaterial)] |
| | | ] |
| | | |
| | | }; |
| | | |
| | | this.pickerGizmos.XYZE[0][0].visible = false; // disable XYZE picker gizmo |
| | | |
| | | this.setActivePlane = function (axis) { |
| | | |
| | | if (axis === "E") this.activePlane = this.planes["XYZE"]; |
| | | |
| | | if (axis === "X") this.activePlane = this.planes["YZ"]; |
| | | |
| | | if (axis === "Y") this.activePlane = this.planes["XZ"]; |
| | | |
| | | if (axis === "Z") this.activePlane = this.planes["XY"]; |
| | | |
| | | }; |
| | | |
| | | this.update = function (rotation, eye2) { |
| | | |
| | | THREE.TransformGizmo.prototype.update.apply(this, arguments); |
| | | |
| | | var tempMatrix = new THREE.Matrix4(); |
| | | var worldRotation = new THREE.Euler(0, 0, 1); |
| | | var tempQuaternion = new THREE.Quaternion(); |
| | | var unitX = new THREE.Vector3(1, 0, 0); |
| | | var unitY = new THREE.Vector3(0, 1, 0); |
| | | var unitZ = new THREE.Vector3(0, 0, 1); |
| | | var quaternionX = new THREE.Quaternion(); |
| | | var quaternionY = new THREE.Quaternion(); |
| | | var quaternionZ = new THREE.Quaternion(); |
| | | var eye = eye2.clone(); |
| | | |
| | | worldRotation.copy(this.planes["XY"].rotation); |
| | | tempQuaternion.setFromEuler(worldRotation); |
| | | |
| | | tempMatrix.makeRotationFromQuaternion(tempQuaternion).getInverse(tempMatrix); |
| | | eye.applyMatrix4(tempMatrix); |
| | | |
| | | this.traverse(function (child) { |
| | | |
| | | tempQuaternion.setFromEuler(worldRotation); |
| | | |
| | | if (child.name === "X") { |
| | | |
| | | quaternionX.setFromAxisAngle(unitX, Math.atan2(-eye.y, eye.z)); |
| | | tempQuaternion.multiplyQuaternions(tempQuaternion, quaternionX); |
| | | child.quaternion.copy(tempQuaternion); |
| | | |
| | | } |
| | | |
| | | if (child.name === "Y") { |
| | | |
| | | quaternionY.setFromAxisAngle(unitY, Math.atan2(eye.x, eye.z)); |
| | | tempQuaternion.multiplyQuaternions(tempQuaternion, quaternionY); |
| | | child.quaternion.copy(tempQuaternion); |
| | | |
| | | } |
| | | |
| | | if (child.name === "Z") { |
| | | |
| | | quaternionZ.setFromAxisAngle(unitZ, Math.atan2(eye.y, eye.x)); |
| | | tempQuaternion.multiplyQuaternions(tempQuaternion, quaternionZ); |
| | | child.quaternion.copy(tempQuaternion); |
| | | |
| | | } |
| | | |
| | | }); |
| | | |
| | | }; |
| | | |
| | | this.init(); |
| | | |
| | | }; |
| | | |
| | | THREE.TransformGizmoRotate.prototype = Object.create(THREE.TransformGizmo.prototype); |
| | | THREE.TransformGizmoRotate.prototype.constructor = THREE.TransformGizmoRotate; |
| | | |
| | | THREE.TransformGizmoScale = function () { |
| | | |
| | | THREE.TransformGizmo.call(this); |
| | | |
| | | var arrowGeometry = new THREE.BoxBufferGeometry(0.125, 0.125, 0.125); |
| | | arrowGeometry.translate(0, 0.5, 0); |
| | | |
| | | var lineXGeometry = new THREE.BufferGeometry(); |
| | | lineXGeometry.addAttribute('position', new THREE.Float32BufferAttribute([0, 0, 0, 1, 0, 0], 3)); |
| | | |
| | | var lineYGeometry = new THREE.BufferGeometry(); |
| | | lineYGeometry.addAttribute('position', new THREE.Float32BufferAttribute([0, 0, 0, 0, 1, 0], 3)); |
| | | |
| | | var lineZGeometry = new THREE.BufferGeometry(); |
| | | lineZGeometry.addAttribute('position', new THREE.Float32BufferAttribute([0, 0, 0, 0, 0, 1], 3)); |
| | | |
| | | this.handleGizmos = { |
| | | |
| | | X: [ |
| | | [new THREE.Mesh(arrowGeometry, new GizmoMaterial({ color: 0xff0000 })), [0.5, 0, 0], [0, 0, -Math.PI / 2]], |
| | | [new THREE.Line(lineXGeometry, new GizmoLineMaterial({ color: 0xff0000 }))] |
| | | ], |
| | | |
| | | Y: [ |
| | | [new THREE.Mesh(arrowGeometry, new GizmoMaterial({ color: 0x00ff00 })), [0, 0.5, 0]], |
| | | [new THREE.Line(lineYGeometry, new GizmoLineMaterial({ color: 0x00ff00 }))] |
| | | ], |
| | | |
| | | Z: [ |
| | | [new THREE.Mesh(arrowGeometry, new GizmoMaterial({ color: 0x0000ff })), [0, 0, 0.5], [Math.PI / 2, 0, 0]], |
| | | [new THREE.Line(lineZGeometry, new GizmoLineMaterial({ color: 0x0000ff }))] |
| | | ], |
| | | |
| | | XYZ: [ |
| | | [new THREE.Mesh(new THREE.BoxBufferGeometry(0.125, 0.125, 0.125), new GizmoMaterial({ color: 0xffffff, opacity: 0.25 }))] |
| | | ] |
| | | |
| | | }; |
| | | |
| | | this.pickerGizmos = { |
| | | |
| | | X: [ |
| | | [new THREE.Mesh(new THREE.CylinderBufferGeometry(0.2, 0, 1, 4, 1, false), pickerMaterial), [0.6, 0, 0], [0, 0, -Math.PI / 2]] |
| | | ], |
| | | |
| | | Y: [ |
| | | [new THREE.Mesh(new THREE.CylinderBufferGeometry(0.2, 0, 1, 4, 1, false), pickerMaterial), [0, 0.6, 0]] |
| | | ], |
| | | |
| | | Z: [ |
| | | [new THREE.Mesh(new THREE.CylinderBufferGeometry(0.2, 0, 1, 4, 1, false), pickerMaterial), [0, 0, 0.6], [Math.PI / 2, 0, 0]] |
| | | ], |
| | | |
| | | XYZ: [ |
| | | [new THREE.Mesh(new THREE.BoxBufferGeometry(0.4, 0.4, 0.4), pickerMaterial)] |
| | | ] |
| | | |
| | | }; |
| | | |
| | | this.setActivePlane = function (axis, eye) { |
| | | |
| | | var tempMatrix = new THREE.Matrix4(); |
| | | eye.applyMatrix4(tempMatrix.getInverse(tempMatrix.extractRotation(this.planes["XY"].matrixWorld))); |
| | | |
| | | if (axis === "X") { |
| | | |
| | | this.activePlane = this.planes["XY"]; |
| | | if (Math.abs(eye.y) > Math.abs(eye.z)) this.activePlane = this.planes["XZ"]; |
| | | |
| | | } |
| | | |
| | | if (axis === "Y") { |
| | | |
| | | this.activePlane = this.planes["XY"]; |
| | | if (Math.abs(eye.x) > Math.abs(eye.z)) this.activePlane = this.planes["YZ"]; |
| | | |
| | | } |
| | | |
| | | if (axis === "Z") { |
| | | |
| | | this.activePlane = this.planes["XZ"]; |
| | | if (Math.abs(eye.x) > Math.abs(eye.y)) this.activePlane = this.planes["YZ"]; |
| | | |
| | | } |
| | | |
| | | if (axis === "XYZ") this.activePlane = this.planes["XYZE"]; |
| | | |
| | | }; |
| | | |
| | | this.init(); |
| | | |
| | | }; |
| | | |
| | | THREE.TransformGizmoScale.prototype = Object.create(THREE.TransformGizmo.prototype); |
| | | THREE.TransformGizmoScale.prototype.constructor = THREE.TransformGizmoScale; |
| | | |
| | | THREE.TransformControls = function (camera, domElement) { |
| | | |
| | | // TODO: Make non-uniform scale and rotate play nice in hierarchies |
| | | // TODO: ADD RXYZ contol |
| | | |
| | | THREE.Object3D.call(this); |
| | | |
| | | domElement = (domElement !== undefined) ? domElement : document; |
| | | |
| | | this.object = undefined; |
| | | this.visible = false; |
| | | this.translationSnap = null; |
| | | this.rotationSnap = null; |
| | | this.space = "world"; |
| | | this.size = 1; |
| | | this.axis = null; |
| | | |
| | | var scope = this; |
| | | |
| | | var _mode = "translate"; |
| | | var _dragging = false; |
| | | var _gizmo = { |
| | | |
| | | "translate": new THREE.TransformGizmoTranslate(), |
| | | "rotate": new THREE.TransformGizmoRotate(), |
| | | "scale": new THREE.TransformGizmoScale() |
| | | }; |
| | | |
| | | for (var type in _gizmo) { |
| | | |
| | | var gizmoObj = _gizmo[type]; |
| | | |
| | | gizmoObj.visible = (type === _mode); |
| | | this.add(gizmoObj); |
| | | |
| | | } |
| | | |
| | | var changeEvent = { type: "change" }; |
| | | var mouseDownEvent = { type: "mouseDown" }; |
| | | var mouseUpEvent = { type: "mouseUp", mode: _mode }; |
| | | var objectChangeEvent = { type: "objectChange" }; |
| | | |
| | | var ray = new THREE.Raycaster(); |
| | | var pointerVector = new THREE.Vector2(); |
| | | |
| | | var point = new THREE.Vector3(); |
| | | var offset = new THREE.Vector3(); |
| | | |
| | | var rotation = new THREE.Vector3(); |
| | | var offsetRotation = new THREE.Vector3(); |
| | | var scale = 1; |
| | | |
| | | var lookAtMatrix = new THREE.Matrix4(); |
| | | var eye = new THREE.Vector3(); |
| | | |
| | | var tempMatrix = new THREE.Matrix4(); |
| | | var tempVector = new THREE.Vector3(); |
| | | var tempQuaternion = new THREE.Quaternion(); |
| | | var unitX = new THREE.Vector3(1, 0, 0); |
| | | var unitY = new THREE.Vector3(0, 1, 0); |
| | | var unitZ = new THREE.Vector3(0, 0, 1); |
| | | |
| | | var quaternionXYZ = new THREE.Quaternion(); |
| | | var quaternionX = new THREE.Quaternion(); |
| | | var quaternionY = new THREE.Quaternion(); |
| | | var quaternionZ = new THREE.Quaternion(); |
| | | var quaternionE = new THREE.Quaternion(); |
| | | |
| | | var oldPosition = new THREE.Vector3(); |
| | | var oldScale = new THREE.Vector3(); |
| | | var oldRotationMatrix = new THREE.Matrix4(); |
| | | |
| | | var parentRotationMatrix = new THREE.Matrix4(); |
| | | var parentScale = new THREE.Vector3(); |
| | | |
| | | var worldPosition = new THREE.Vector3(); |
| | | var worldRotation = new THREE.Euler(); |
| | | var worldRotationMatrix = new THREE.Matrix4(); |
| | | var camPosition = new THREE.Vector3(); |
| | | var camRotation = new THREE.Euler(); |
| | | |
| | | domElement.addEventListener("mousedown", onPointerDown, false); |
| | | domElement.addEventListener("touchstart", onPointerDown, false); |
| | | |
| | | domElement.addEventListener("mousemove", onPointerHover, false); |
| | | domElement.addEventListener("touchmove", onPointerHover, false); |
| | | |
| | | domElement.addEventListener("mousemove", onPointerMove, false); |
| | | domElement.addEventListener("touchmove", onPointerMove, false); |
| | | |
| | | domElement.addEventListener("mouseup", onPointerUp, false); |
| | | domElement.addEventListener("mouseout", onPointerUp, false); |
| | | domElement.addEventListener("touchend", onPointerUp, false); |
| | | domElement.addEventListener("touchcancel", onPointerUp, false); |
| | | domElement.addEventListener("touchleave", onPointerUp, false); |
| | | |
| | | this.dispose = function () { |
| | | |
| | | domElement.removeEventListener("mousedown", onPointerDown); |
| | | domElement.removeEventListener("touchstart", onPointerDown); |
| | | |
| | | domElement.removeEventListener("mousemove", onPointerHover); |
| | | domElement.removeEventListener("touchmove", onPointerHover); |
| | | |
| | | domElement.removeEventListener("mousemove", onPointerMove); |
| | | domElement.removeEventListener("touchmove", onPointerMove); |
| | | |
| | | domElement.removeEventListener("mouseup", onPointerUp); |
| | | domElement.removeEventListener("mouseout", onPointerUp); |
| | | domElement.removeEventListener("touchend", onPointerUp); |
| | | domElement.removeEventListener("touchcancel", onPointerUp); |
| | | domElement.removeEventListener("touchleave", onPointerUp); |
| | | |
| | | }; |
| | | |
| | | this.attach = function (object) { |
| | | |
| | | this.object = object; |
| | | this.visible = true; |
| | | this.update(); |
| | | |
| | | }; |
| | | |
| | | this.detach = function () { |
| | | |
| | | this.object = undefined; |
| | | this.visible = false; |
| | | this.axis = null; |
| | | |
| | | }; |
| | | |
| | | this.getMode = function () { |
| | | |
| | | return _mode; |
| | | |
| | | }; |
| | | |
| | | this.setMode = function (mode) { |
| | | |
| | | _mode = mode ? mode : _mode; |
| | | |
| | | if (_mode === "scale") scope.space = "local"; |
| | | |
| | | for (var type in _gizmo) _gizmo[type].visible = (type === _mode); |
| | | |
| | | this.update(); |
| | | scope.dispatchEvent(changeEvent); |
| | | |
| | | }; |
| | | |
| | | this.setTranslationSnap = function (translationSnap) { |
| | | |
| | | scope.translationSnap = translationSnap; |
| | | |
| | | }; |
| | | |
| | | this.setRotationSnap = function (rotationSnap) { |
| | | |
| | | scope.rotationSnap = rotationSnap; |
| | | |
| | | }; |
| | | |
| | | this.setSize = function (size) { |
| | | |
| | | scope.size = size; |
| | | this.update(); |
| | | scope.dispatchEvent(changeEvent); |
| | | |
| | | }; |
| | | |
| | | this.setSpace = function (space) { |
| | | |
| | | scope.space = space; |
| | | this.update(); |
| | | scope.dispatchEvent(changeEvent); |
| | | |
| | | }; |
| | | |
| | | this.update = function () { |
| | | |
| | | if (scope.object === undefined) return; |
| | | |
| | | scope.object.updateMatrixWorld(); |
| | | worldPosition.setFromMatrixPosition(scope.object.matrixWorld); |
| | | worldRotation.setFromRotationMatrix(tempMatrix.extractRotation(scope.object.matrixWorld)); |
| | | |
| | | camera.updateMatrixWorld(); |
| | | camPosition.setFromMatrixPosition(camera.matrixWorld); |
| | | camRotation.setFromRotationMatrix(tempMatrix.extractRotation(camera.matrixWorld)); |
| | | |
| | | scale = worldPosition.distanceTo(camPosition) / 6 * scope.size; |
| | | this.position.copy(worldPosition); |
| | | this.scale.set(scale, scale, scale); |
| | | |
| | | if (camera instanceof THREE.PerspectiveCamera) { |
| | | |
| | | eye.copy(camPosition).sub(worldPosition).normalize(); |
| | | |
| | | } else if (camera instanceof THREE.OrthographicCamera) { |
| | | |
| | | eye.copy(camPosition).normalize(); |
| | | |
| | | } |
| | | |
| | | if (scope.space === "local") { |
| | | |
| | | _gizmo[_mode].update(worldRotation, eye); |
| | | |
| | | } else if (scope.space === "world") { |
| | | |
| | | _gizmo[_mode].update(new THREE.Euler(), eye); |
| | | |
| | | } |
| | | |
| | | _gizmo[_mode].highlight(scope.axis); |
| | | |
| | | }; |
| | | |
| | | function onPointerHover(event) { |
| | | |
| | | if (scope.object === undefined || _dragging === true || (event.button !== undefined && event.button !== 0)) return; |
| | | |
| | | var pointer = event.changedTouches ? event.changedTouches[0] : event; |
| | | |
| | | var intersect = intersectObjects(pointer, _gizmo[_mode].pickers.children); |
| | | |
| | | var axis = null; |
| | | |
| | | if (intersect) { |
| | | |
| | | axis = intersect.object.name; |
| | | |
| | | event.preventDefault(); |
| | | |
| | | } |
| | | |
| | | if (scope.axis !== axis) { |
| | | |
| | | scope.axis = axis; |
| | | scope.update(); |
| | | scope.dispatchEvent(changeEvent); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | function onPointerDown(event) { |
| | | |
| | | if (scope.object === undefined || _dragging === true || (event.button !== undefined && event.button !== 0)) return; |
| | | |
| | | var pointer = event.changedTouches ? event.changedTouches[0] : event; |
| | | |
| | | if (pointer.button === 0 || pointer.button === undefined) { |
| | | |
| | | var intersect = intersectObjects(pointer, _gizmo[_mode].pickers.children); |
| | | |
| | | if (intersect) { |
| | | |
| | | event.preventDefault(); |
| | | event.stopPropagation(); |
| | | |
| | | scope.axis = intersect.object.name; |
| | | |
| | | scope.dispatchEvent(mouseDownEvent); |
| | | |
| | | scope.update(); |
| | | |
| | | eye.copy(camPosition).sub(worldPosition).normalize(); |
| | | |
| | | _gizmo[_mode].setActivePlane(scope.axis, eye); |
| | | |
| | | var planeIntersect = intersectObjects(pointer, [_gizmo[_mode].activePlane]); |
| | | |
| | | if (planeIntersect) { |
| | | |
| | | oldPosition.copy(scope.object.position); |
| | | oldScale.copy(scope.object.scale); |
| | | |
| | | oldRotationMatrix.extractRotation(scope.object.matrix); |
| | | worldRotationMatrix.extractRotation(scope.object.matrixWorld); |
| | | |
| | | parentRotationMatrix.extractRotation(scope.object.parent.matrixWorld); |
| | | parentScale.setFromMatrixScale(tempMatrix.getInverse(scope.object.parent.matrixWorld)); |
| | | |
| | | offset.copy(planeIntersect.point); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | _dragging = true; |
| | | |
| | | } |
| | | |
| | | function onPointerMove(event) { |
| | | |
| | | if (scope.object === undefined || scope.axis === null || _dragging === false || (event.button !== undefined && event.button !== 0)) return; |
| | | |
| | | var pointer = event.changedTouches ? event.changedTouches[0] : event; |
| | | |
| | | var planeIntersect = intersectObjects(pointer, [_gizmo[_mode].activePlane]); |
| | | |
| | | if (planeIntersect === false) return; |
| | | |
| | | event.preventDefault(); |
| | | event.stopPropagation(); |
| | | |
| | | point.copy(planeIntersect.point); |
| | | |
| | | if (_mode === "translate") { |
| | | |
| | | point.sub(offset); |
| | | point.multiply(parentScale); |
| | | |
| | | if (scope.space === "local") { |
| | | |
| | | point.applyMatrix4(tempMatrix.getInverse(worldRotationMatrix)); |
| | | |
| | | if (scope.axis.search("X") === -1) point.x = 0; |
| | | if (scope.axis.search("Y") === -1) point.y = 0; |
| | | if (scope.axis.search("Z") === -1) point.z = 0; |
| | | |
| | | point.applyMatrix4(oldRotationMatrix); |
| | | |
| | | scope.object.position.copy(oldPosition); |
| | | scope.object.position.add(point); |
| | | |
| | | } |
| | | |
| | | if (scope.space === "world" || scope.axis.search("XYZ") !== -1) { |
| | | |
| | | if (scope.axis.search("X") === -1) point.x = 0; |
| | | if (scope.axis.search("Y") === -1) point.y = 0; |
| | | if (scope.axis.search("Z") === -1) point.z = 0; |
| | | |
| | | point.applyMatrix4(tempMatrix.getInverse(parentRotationMatrix)); |
| | | |
| | | scope.object.position.copy(oldPosition); |
| | | scope.object.position.add(point); |
| | | |
| | | } |
| | | |
| | | if (scope.translationSnap !== null) { |
| | | |
| | | if (scope.space === "local") { |
| | | |
| | | scope.object.position.applyMatrix4(tempMatrix.getInverse(worldRotationMatrix)); |
| | | |
| | | } |
| | | |
| | | if (scope.axis.search("X") !== -1) scope.object.position.x = Math.round(scope.object.position.x / scope.translationSnap) * scope.translationSnap; |
| | | if (scope.axis.search("Y") !== -1) scope.object.position.y = Math.round(scope.object.position.y / scope.translationSnap) * scope.translationSnap; |
| | | if (scope.axis.search("Z") !== -1) scope.object.position.z = Math.round(scope.object.position.z / scope.translationSnap) * scope.translationSnap; |
| | | |
| | | if (scope.space === "local") { |
| | | |
| | | scope.object.position.applyMatrix4(worldRotationMatrix); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | } else if (_mode === "scale") { |
| | | |
| | | point.sub(offset); |
| | | point.multiply(parentScale); |
| | | |
| | | if (scope.space === "local") { |
| | | |
| | | if (scope.axis === "XYZ") { |
| | | |
| | | scale = 1 + ((point.y) / Math.max(oldScale.x, oldScale.y, oldScale.z)); |
| | | |
| | | scope.object.scale.x = oldScale.x * scale; |
| | | scope.object.scale.y = oldScale.y * scale; |
| | | scope.object.scale.z = oldScale.z * scale; |
| | | |
| | | } else { |
| | | |
| | | point.applyMatrix4(tempMatrix.getInverse(worldRotationMatrix)); |
| | | |
| | | if (scope.axis === "X") scope.object.scale.x = oldScale.x * (1 + point.x / oldScale.x); |
| | | if (scope.axis === "Y") scope.object.scale.y = oldScale.y * (1 + point.y / oldScale.y); |
| | | if (scope.axis === "Z") scope.object.scale.z = oldScale.z * (1 + point.z / oldScale.z); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | } else if (_mode === "rotate") { |
| | | |
| | | point.sub(worldPosition); |
| | | point.multiply(parentScale); |
| | | tempVector.copy(offset).sub(worldPosition); |
| | | tempVector.multiply(parentScale); |
| | | |
| | | if (scope.axis === "E") { |
| | | |
| | | point.applyMatrix4(tempMatrix.getInverse(lookAtMatrix)); |
| | | tempVector.applyMatrix4(tempMatrix.getInverse(lookAtMatrix)); |
| | | |
| | | rotation.set(Math.atan2(point.z, point.y), Math.atan2(point.x, point.z), Math.atan2(point.y, point.x)); |
| | | offsetRotation.set(Math.atan2(tempVector.z, tempVector.y), Math.atan2(tempVector.x, tempVector.z), Math.atan2(tempVector.y, tempVector.x)); |
| | | |
| | | tempQuaternion.setFromRotationMatrix(tempMatrix.getInverse(parentRotationMatrix)); |
| | | |
| | | quaternionE.setFromAxisAngle(eye, rotation.z - offsetRotation.z); |
| | | quaternionXYZ.setFromRotationMatrix(worldRotationMatrix); |
| | | |
| | | tempQuaternion.multiplyQuaternions(tempQuaternion, quaternionE); |
| | | tempQuaternion.multiplyQuaternions(tempQuaternion, quaternionXYZ); |
| | | |
| | | scope.object.quaternion.copy(tempQuaternion); |
| | | |
| | | } else if (scope.axis === "XYZE") { |
| | | |
| | | quaternionE.setFromEuler(point.clone().cross(tempVector).normalize()); // rotation axis |
| | | |
| | | tempQuaternion.setFromRotationMatrix(tempMatrix.getInverse(parentRotationMatrix)); |
| | | quaternionX.setFromAxisAngle(quaternionE, -point.clone().angleTo(tempVector)); |
| | | quaternionXYZ.setFromRotationMatrix(worldRotationMatrix); |
| | | |
| | | tempQuaternion.multiplyQuaternions(tempQuaternion, quaternionX); |
| | | tempQuaternion.multiplyQuaternions(tempQuaternion, quaternionXYZ); |
| | | |
| | | scope.object.quaternion.copy(tempQuaternion); |
| | | |
| | | } else if (scope.space === "local") { |
| | | |
| | | point.applyMatrix4(tempMatrix.getInverse(worldRotationMatrix)); |
| | | |
| | | tempVector.applyMatrix4(tempMatrix.getInverse(worldRotationMatrix)); |
| | | |
| | | rotation.set(Math.atan2(point.z, point.y), Math.atan2(point.x, point.z), Math.atan2(point.y, point.x)); |
| | | offsetRotation.set(Math.atan2(tempVector.z, tempVector.y), Math.atan2(tempVector.x, tempVector.z), Math.atan2(tempVector.y, tempVector.x)); |
| | | |
| | | quaternionXYZ.setFromRotationMatrix(oldRotationMatrix); |
| | | |
| | | if (scope.rotationSnap !== null) { |
| | | |
| | | quaternionX.setFromAxisAngle(unitX, Math.round((rotation.x - offsetRotation.x) / scope.rotationSnap) * scope.rotationSnap); |
| | | quaternionY.setFromAxisAngle(unitY, Math.round((rotation.y - offsetRotation.y) / scope.rotationSnap) * scope.rotationSnap); |
| | | quaternionZ.setFromAxisAngle(unitZ, Math.round((rotation.z - offsetRotation.z) / scope.rotationSnap) * scope.rotationSnap); |
| | | |
| | | } else { |
| | | |
| | | quaternionX.setFromAxisAngle(unitX, rotation.x - offsetRotation.x); |
| | | quaternionY.setFromAxisAngle(unitY, rotation.y - offsetRotation.y); |
| | | quaternionZ.setFromAxisAngle(unitZ, rotation.z - offsetRotation.z); |
| | | |
| | | } |
| | | |
| | | if (scope.axis === "X") quaternionXYZ.multiplyQuaternions(quaternionXYZ, quaternionX); |
| | | if (scope.axis === "Y") quaternionXYZ.multiplyQuaternions(quaternionXYZ, quaternionY); |
| | | if (scope.axis === "Z") quaternionXYZ.multiplyQuaternions(quaternionXYZ, quaternionZ); |
| | | |
| | | scope.object.quaternion.copy(quaternionXYZ); |
| | | |
| | | } else if (scope.space === "world") { |
| | | |
| | | rotation.set(Math.atan2(point.z, point.y), Math.atan2(point.x, point.z), Math.atan2(point.y, point.x)); |
| | | offsetRotation.set(Math.atan2(tempVector.z, tempVector.y), Math.atan2(tempVector.x, tempVector.z), Math.atan2(tempVector.y, tempVector.x)); |
| | | |
| | | tempQuaternion.setFromRotationMatrix(tempMatrix.getInverse(parentRotationMatrix)); |
| | | |
| | | if (scope.rotationSnap !== null) { |
| | | |
| | | quaternionX.setFromAxisAngle(unitX, Math.round((rotation.x - offsetRotation.x) / scope.rotationSnap) * scope.rotationSnap); |
| | | quaternionY.setFromAxisAngle(unitY, Math.round((rotation.y - offsetRotation.y) / scope.rotationSnap) * scope.rotationSnap); |
| | | quaternionZ.setFromAxisAngle(unitZ, Math.round((rotation.z - offsetRotation.z) / scope.rotationSnap) * scope.rotationSnap); |
| | | |
| | | } else { |
| | | |
| | | quaternionX.setFromAxisAngle(unitX, rotation.x - offsetRotation.x); |
| | | quaternionY.setFromAxisAngle(unitY, rotation.y - offsetRotation.y); |
| | | quaternionZ.setFromAxisAngle(unitZ, rotation.z - offsetRotation.z); |
| | | |
| | | } |
| | | |
| | | quaternionXYZ.setFromRotationMatrix(worldRotationMatrix); |
| | | |
| | | if (scope.axis === "X") tempQuaternion.multiplyQuaternions(tempQuaternion, quaternionX); |
| | | if (scope.axis === "Y") tempQuaternion.multiplyQuaternions(tempQuaternion, quaternionY); |
| | | if (scope.axis === "Z") tempQuaternion.multiplyQuaternions(tempQuaternion, quaternionZ); |
| | | |
| | | tempQuaternion.multiplyQuaternions(tempQuaternion, quaternionXYZ); |
| | | |
| | | scope.object.quaternion.copy(tempQuaternion); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | scope.update(); |
| | | scope.dispatchEvent(changeEvent); |
| | | scope.dispatchEvent(objectChangeEvent); |
| | | |
| | | } |
| | | |
| | | function onPointerUp(event) { |
| | | |
| | | event.preventDefault(); // Prevent MouseEvent on mobile |
| | | |
| | | if (event.button !== undefined && event.button !== 0) return; |
| | | |
| | | if (_dragging && (scope.axis !== null)) { |
| | | |
| | | mouseUpEvent.mode = _mode; |
| | | scope.dispatchEvent(mouseUpEvent); |
| | | |
| | | } |
| | | |
| | | _dragging = false; |
| | | |
| | | if ('TouchEvent' in window && event instanceof TouchEvent) { |
| | | |
| | | // Force "rollover" |
| | | |
| | | scope.axis = null; |
| | | scope.update(); |
| | | scope.dispatchEvent(changeEvent); |
| | | |
| | | } else { |
| | | |
| | | onPointerHover(event); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | function intersectObjects(pointer, objects) { |
| | | |
| | | var rect = domElement.getBoundingClientRect(); |
| | | var x = (pointer.clientX - rect.left) / rect.width; |
| | | var y = (pointer.clientY - rect.top) / rect.height; |
| | | |
| | | pointerVector.set((x * 2) - 1, -(y * 2) + 1); |
| | | ray.setFromCamera(pointerVector, camera); |
| | | |
| | | var intersections = ray.intersectObjects(objects, true); |
| | | return intersections[0] ? intersections[0] : false; |
| | | |
| | | } |
| | | |
| | | }; |
| | | |
| | | THREE.TransformControls.prototype = Object.create(THREE.Object3D.prototype); |
| | | THREE.TransformControls.prototype.constructor = THREE.TransformControls; |
| | | |
| | | }()); |
New file |
| | |
| | | /** |
| | | * @author alteredq / http://alteredqualia.com/ |
| | | * |
| | | * Full-screen textured quad shader |
| | | */ |
| | | |
| | | THREE.CopyShader = { |
| | | |
| | | uniforms: { |
| | | |
| | | "tDiffuse": { value: null }, |
| | | "opacity": { value: 1.0 } |
| | | |
| | | }, |
| | | |
| | | vertexShader: [ |
| | | |
| | | "varying vec2 vUv;", |
| | | |
| | | "void main() {", |
| | | |
| | | "vUv = uv;", |
| | | "gl_Position = projectionMatrix * modelViewMatrix * vec4( position, 1.0 );", |
| | | |
| | | "}" |
| | | |
| | | ].join("\n"), |
| | | |
| | | fragmentShader: [ |
| | | |
| | | "uniform float opacity;", |
| | | |
| | | "uniform sampler2D tDiffuse;", |
| | | |
| | | "varying vec2 vUv;", |
| | | |
| | | "void main() {", |
| | | |
| | | "vec4 texel = texture2D( tDiffuse, vUv );", |
| | | "gl_FragColor = opacity * texel;", |
| | | |
| | | "}" |
| | | |
| | | ].join("\n") |
| | | |
| | | }; |
New file |
| | |
| | | /** |
| | | * @author alteredq / http://alteredqualia.com/ |
| | | */ |
| | | |
| | | THREE.EffectComposer = function (renderer, renderTarget) { |
| | | |
| | | this.renderer = renderer; |
| | | |
| | | if (renderTarget === undefined) { |
| | | |
| | | var parameters = { |
| | | minFilter: THREE.LinearFilter, |
| | | magFilter: THREE.LinearFilter, |
| | | format: THREE.RGBAFormat, |
| | | stencilBuffer: false |
| | | }; |
| | | |
| | | var size = renderer.getDrawingBufferSize(); |
| | | renderTarget = new THREE.WebGLRenderTarget(size.width, size.height, parameters); |
| | | renderTarget.texture.name = 'EffectComposer.rt1'; |
| | | |
| | | } |
| | | |
| | | this.renderTarget1 = renderTarget; |
| | | this.renderTarget2 = renderTarget.clone(); |
| | | this.renderTarget2.texture.name = 'EffectComposer.rt2'; |
| | | |
| | | this.writeBuffer = this.renderTarget1; |
| | | this.readBuffer = this.renderTarget2; |
| | | |
| | | this.passes = []; |
| | | |
| | | // dependencies |
| | | |
| | | if (THREE.CopyShader === undefined) { |
| | | |
| | | console.error('THREE.EffectComposer relies on THREE.CopyShader'); |
| | | |
| | | } |
| | | |
| | | if (THREE.ShaderPass === undefined) { |
| | | |
| | | console.error('THREE.EffectComposer relies on THREE.ShaderPass'); |
| | | |
| | | } |
| | | |
| | | this.copyPass = new THREE.ShaderPass(THREE.CopyShader); |
| | | |
| | | }; |
| | | |
| | | Object.assign(THREE.EffectComposer.prototype, { |
| | | |
| | | swapBuffers: function () { |
| | | |
| | | var tmp = this.readBuffer; |
| | | this.readBuffer = this.writeBuffer; |
| | | this.writeBuffer = tmp; |
| | | |
| | | }, |
| | | |
| | | addPass: function (pass) { |
| | | |
| | | this.passes.push(pass); |
| | | |
| | | var size = this.renderer.getDrawingBufferSize(); |
| | | pass.setSize(size.width, size.height); |
| | | |
| | | }, |
| | | |
| | | insertPass: function (pass, index) { |
| | | |
| | | this.passes.splice(index, 0, pass); |
| | | |
| | | }, |
| | | |
| | | render: function (delta) { |
| | | |
| | | var maskActive = false; |
| | | |
| | | var pass, i, il = this.passes.length; |
| | | |
| | | for (i = 0; i < il; i++) { |
| | | |
| | | pass = this.passes[i]; |
| | | |
| | | if (pass.enabled === false) continue; |
| | | |
| | | pass.render(this.renderer, this.writeBuffer, this.readBuffer, delta, maskActive); |
| | | |
| | | if (pass.needsSwap) { |
| | | |
| | | if (maskActive) { |
| | | |
| | | var context = this.renderer.context; |
| | | |
| | | context.stencilFunc(context.NOTEQUAL, 1, 0xffffffff); |
| | | |
| | | this.copyPass.render(this.renderer, this.writeBuffer, this.readBuffer, delta); |
| | | |
| | | context.stencilFunc(context.EQUAL, 1, 0xffffffff); |
| | | |
| | | } |
| | | |
| | | this.swapBuffers(); |
| | | |
| | | } |
| | | |
| | | if (THREE.MaskPass !== undefined) { |
| | | |
| | | if (pass instanceof THREE.MaskPass) { |
| | | |
| | | maskActive = true; |
| | | |
| | | } else if (pass instanceof THREE.ClearMaskPass) { |
| | | |
| | | maskActive = false; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | }, |
| | | |
| | | reset: function (renderTarget) { |
| | | |
| | | if (renderTarget === undefined) { |
| | | |
| | | var size = this.renderer.getDrawingBufferSize(); |
| | | |
| | | renderTarget = this.renderTarget1.clone(); |
| | | renderTarget.setSize(size.width, size.height); |
| | | |
| | | } |
| | | |
| | | this.renderTarget1.dispose(); |
| | | this.renderTarget2.dispose(); |
| | | this.renderTarget1 = renderTarget; |
| | | this.renderTarget2 = renderTarget.clone(); |
| | | |
| | | this.writeBuffer = this.renderTarget1; |
| | | this.readBuffer = this.renderTarget2; |
| | | |
| | | }, |
| | | |
| | | setSize: function (width, height) { |
| | | |
| | | this.renderTarget1.setSize(width, height); |
| | | this.renderTarget2.setSize(width, height); |
| | | |
| | | for (var i = 0; i < this.passes.length; i++) { |
| | | |
| | | this.passes[i].setSize(width, height); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | }); |
| | | |
| | | |
| | | THREE.Pass = function () { |
| | | |
| | | // if set to true, the pass is processed by the composer |
| | | this.enabled = true; |
| | | |
| | | // if set to true, the pass indicates to swap read and write buffer after rendering |
| | | this.needsSwap = true; |
| | | |
| | | // if set to true, the pass clears its buffer before rendering |
| | | this.clear = false; |
| | | |
| | | // if set to true, the result of the pass is rendered to screen |
| | | this.renderToScreen = false; |
| | | |
| | | }; |
| | | |
| | | Object.assign(THREE.Pass.prototype, { |
| | | |
| | | setSize: function (width, height) { }, |
| | | |
| | | render: function (renderer, writeBuffer, readBuffer, delta, maskActive) { |
| | | |
| | | console.error('THREE.Pass: .render() must be implemented in derived pass.'); |
| | | |
| | | } |
| | | |
| | | }); |
New file |
| | |
| | | /** |
| | | * @author alteredq / http://alteredqualia.com/ |
| | | * @author davidedc / http://www.sketchpatch.net/ |
| | | * |
| | | * NVIDIA FXAA by Timothy Lottes |
| | | * http://timothylottes.blogspot.com/2011/06/fxaa3-source-released.html |
| | | * - WebGL port by @supereggbert |
| | | * http://www.glge.org/demos/fxaa/ |
| | | */ |
| | | |
| | | THREE.FXAAShader = { |
| | | |
| | | uniforms: { |
| | | |
| | | "tDiffuse": { value: null }, |
| | | "resolution": { value: new THREE.Vector2(1 / 1024, 1 / 512) } |
| | | |
| | | }, |
| | | |
| | | vertexShader: [ |
| | | |
| | | "varying vec2 vUv;", |
| | | |
| | | "void main() {", |
| | | |
| | | "vUv = uv;", |
| | | "gl_Position = projectionMatrix * modelViewMatrix * vec4( position, 1.0 );", |
| | | |
| | | "}" |
| | | |
| | | ].join("\n"), |
| | | |
| | | fragmentShader: [ |
| | | "precision highp float;", |
| | | "", |
| | | "uniform sampler2D tDiffuse;", |
| | | "", |
| | | "uniform vec2 resolution;", |
| | | "", |
| | | "varying vec2 vUv;", |
| | | "", |
| | | "// FXAA 3.11 implementation by NVIDIA, ported to WebGL by Agost Biro (biro@archilogic.com)", |
| | | "", |
| | | "//----------------------------------------------------------------------------------", |
| | | "// File: es3-kepler\FXAA\assets\shaders/FXAA_DefaultES.frag", |
| | | "// SDK Version: v3.00", |
| | | "// Email: gameworks@nvidia.com", |
| | | "// Site: http://developer.nvidia.com/", |
| | | "//", |
| | | "// Copyright (c) 2014-2015, NVIDIA CORPORATION. All rights reserved.", |
| | | "//", |
| | | "// Redistribution and use in source and binary forms, with or without", |
| | | "// modification, are permitted provided that the following conditions", |
| | | "// are met:", |
| | | "// * Redistributions of source code must retain the above copyright", |
| | | "// notice, this list of conditions and the following disclaimer.", |
| | | "// * Redistributions in binary form must reproduce the above copyright", |
| | | "// notice, this list of conditions and the following disclaimer in the", |
| | | "// documentation and/or other materials provided with the distribution.", |
| | | "// * Neither the name of NVIDIA CORPORATION nor the names of its", |
| | | "// contributors may be used to endorse or promote products derived", |
| | | "// from this software without specific prior written permission.", |
| | | "//", |
| | | "// THIS SOFTWARE IS PROVIDED BY THE COPYRIGHT HOLDERS ``AS IS'' AND ANY", |
| | | "// EXPRESS OR IMPLIED WARRANTIES, INCLUDING, BUT NOT LIMITED TO, THE", |
| | | "// IMPLIED WARRANTIES OF MERCHANTABILITY AND FITNESS FOR A PARTICULAR", |
| | | "// PURPOSE ARE DISCLAIMED. IN NO EVENT SHALL THE COPYRIGHT OWNER OR", |
| | | "// CONTRIBUTORS BE LIABLE FOR ANY DIRECT, INDIRECT, INCIDENTAL, SPECIAL,", |
| | | "// EXEMPLARY, OR CONSEQUENTIAL DAMAGES (INCLUDING, BUT NOT LIMITED TO,", |
| | | "// PROCUREMENT OF SUBSTITUTE GOODS OR SERVICES; LOSS OF USE, DATA, OR", |
| | | "// PROFITS; OR BUSINESS INTERRUPTION) HOWEVER CAUSED AND ON ANY THEORY", |
| | | "// OF LIABILITY, WHETHER IN CONTRACT, STRICT LIABILITY, OR TORT", |
| | | "// (INCLUDING NEGLIGENCE OR OTHERWISE) ARISING IN ANY WAY OUT OF THE USE", |
| | | "// OF THIS SOFTWARE, EVEN IF ADVISED OF THE POSSIBILITY OF SUCH DAMAGE.", |
| | | "//", |
| | | "//----------------------------------------------------------------------------------", |
| | | "", |
| | | "#define FXAA_PC 1", |
| | | "#define FXAA_GLSL_100 1", |
| | | "#define FXAA_QUALITY_PRESET 12", |
| | | "", |
| | | "#define FXAA_GREEN_AS_LUMA 1", |
| | | "", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | "#ifndef FXAA_PC_CONSOLE", |
| | | " //", |
| | | " // The console algorithm for PC is included", |
| | | " // for developers targeting really low spec machines.", |
| | | " // Likely better to just run FXAA_PC, and use a really low preset.", |
| | | " //", |
| | | " #define FXAA_PC_CONSOLE 0", |
| | | "#endif", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | "#ifndef FXAA_GLSL_120", |
| | | " #define FXAA_GLSL_120 0", |
| | | "#endif", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | "#ifndef FXAA_GLSL_130", |
| | | " #define FXAA_GLSL_130 0", |
| | | "#endif", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | "#ifndef FXAA_HLSL_3", |
| | | " #define FXAA_HLSL_3 0", |
| | | "#endif", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | "#ifndef FXAA_HLSL_4", |
| | | " #define FXAA_HLSL_4 0", |
| | | "#endif", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | "#ifndef FXAA_HLSL_5", |
| | | " #define FXAA_HLSL_5 0", |
| | | "#endif", |
| | | "/*==========================================================================*/", |
| | | "#ifndef FXAA_GREEN_AS_LUMA", |
| | | " //", |
| | | " // For those using non-linear color,", |
| | | " // and either not able to get luma in alpha, or not wanting to,", |
| | | " // this enables FXAA to run using green as a proxy for luma.", |
| | | " // So with this enabled, no need to pack luma in alpha.", |
| | | " //", |
| | | " // This will turn off AA on anything which lacks some amount of green.", |
| | | " // Pure red and blue or combination of only R and B, will get no AA.", |
| | | " //", |
| | | " // Might want to lower the settings for both,", |
| | | " // fxaaConsoleEdgeThresholdMin", |
| | | " // fxaaQualityEdgeThresholdMin", |
| | | " // In order to insure AA does not get turned off on colors", |
| | | " // which contain a minor amount of green.", |
| | | " //", |
| | | " // 1 = On.", |
| | | " // 0 = Off.", |
| | | " //", |
| | | " #define FXAA_GREEN_AS_LUMA 0", |
| | | "#endif", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | "#ifndef FXAA_EARLY_EXIT", |
| | | " //", |
| | | " // Controls algorithm's early exit path.", |
| | | " // On PS3 turning this ON adds 2 cycles to the shader.", |
| | | " // On 360 turning this OFF adds 10ths of a millisecond to the shader.", |
| | | " // Turning this off on console will result in a more blurry image.", |
| | | " // So this defaults to on.", |
| | | " //", |
| | | " // 1 = On.", |
| | | " // 0 = Off.", |
| | | " //", |
| | | " #define FXAA_EARLY_EXIT 1", |
| | | "#endif", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | "#ifndef FXAA_DISCARD", |
| | | " //", |
| | | " // Only valid for PC OpenGL currently.", |
| | | " // Probably will not work when FXAA_GREEN_AS_LUMA = 1.", |
| | | " //", |
| | | " // 1 = Use discard on pixels which don't need AA.", |
| | | " // For APIs which enable concurrent TEX+ROP from same surface.", |
| | | " // 0 = Return unchanged color on pixels which don't need AA.", |
| | | " //", |
| | | " #define FXAA_DISCARD 0", |
| | | "#endif", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | "#ifndef FXAA_FAST_PIXEL_OFFSET", |
| | | " //", |
| | | " // Used for GLSL 120 only.", |
| | | " //", |
| | | " // 1 = GL API supports fast pixel offsets", |
| | | " // 0 = do not use fast pixel offsets", |
| | | " //", |
| | | " #ifdef GL_EXT_gpu_shader4", |
| | | " #define FXAA_FAST_PIXEL_OFFSET 1", |
| | | " #endif", |
| | | " #ifdef GL_NV_gpu_shader5", |
| | | " #define FXAA_FAST_PIXEL_OFFSET 1", |
| | | " #endif", |
| | | " #ifdef GL_ARB_gpu_shader5", |
| | | " #define FXAA_FAST_PIXEL_OFFSET 1", |
| | | " #endif", |
| | | " #ifndef FXAA_FAST_PIXEL_OFFSET", |
| | | " #define FXAA_FAST_PIXEL_OFFSET 0", |
| | | " #endif", |
| | | "#endif", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | "#ifndef FXAA_GATHER4_ALPHA", |
| | | " //", |
| | | " // 1 = API supports gather4 on alpha channel.", |
| | | " // 0 = API does not support gather4 on alpha channel.", |
| | | " //", |
| | | " #if (FXAA_HLSL_5 == 1)", |
| | | " #define FXAA_GATHER4_ALPHA 1", |
| | | " #endif", |
| | | " #ifdef GL_ARB_gpu_shader5", |
| | | " #define FXAA_GATHER4_ALPHA 1", |
| | | " #endif", |
| | | " #ifdef GL_NV_gpu_shader5", |
| | | " #define FXAA_GATHER4_ALPHA 1", |
| | | " #endif", |
| | | " #ifndef FXAA_GATHER4_ALPHA", |
| | | " #define FXAA_GATHER4_ALPHA 0", |
| | | " #endif", |
| | | "#endif", |
| | | "", |
| | | "", |
| | | "/*============================================================================", |
| | | " FXAA QUALITY - TUNING KNOBS", |
| | | "------------------------------------------------------------------------------", |
| | | "NOTE the other tuning knobs are now in the shader function inputs!", |
| | | "============================================================================*/", |
| | | "#ifndef FXAA_QUALITY_PRESET", |
| | | " //", |
| | | " // Choose the quality preset.", |
| | | " // This needs to be compiled into the shader as it effects code.", |
| | | " // Best option to include multiple presets is to", |
| | | " // in each shader define the preset, then include this file.", |
| | | " //", |
| | | " // OPTIONS", |
| | | " // -----------------------------------------------------------------------", |
| | | " // 10 to 15 - default medium dither (10=fastest, 15=highest quality)", |
| | | " // 20 to 29 - less dither, more expensive (20=fastest, 29=highest quality)", |
| | | " // 39 - no dither, very expensive", |
| | | " //", |
| | | " // NOTES", |
| | | " // -----------------------------------------------------------------------", |
| | | " // 12 = slightly faster then FXAA 3.9 and higher edge quality (default)", |
| | | " // 13 = about same speed as FXAA 3.9 and better than 12", |
| | | " // 23 = closest to FXAA 3.9 visually and performance wise", |
| | | " // _ = the lowest digit is directly related to performance", |
| | | " // _ = the highest digit is directly related to style", |
| | | " //", |
| | | " #define FXAA_QUALITY_PRESET 12", |
| | | "#endif", |
| | | "", |
| | | "", |
| | | "/*============================================================================", |
| | | "", |
| | | " FXAA QUALITY - PRESETS", |
| | | "", |
| | | "============================================================================*/", |
| | | "", |
| | | "/*============================================================================", |
| | | " FXAA QUALITY - MEDIUM DITHER PRESETS", |
| | | "============================================================================*/", |
| | | "#if (FXAA_QUALITY_PRESET == 10)", |
| | | " #define FXAA_QUALITY_PS 3", |
| | | " #define FXAA_QUALITY_P0 1.5", |
| | | " #define FXAA_QUALITY_P1 3.0", |
| | | " #define FXAA_QUALITY_P2 12.0", |
| | | "#endif", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | "#if (FXAA_QUALITY_PRESET == 11)", |
| | | " #define FXAA_QUALITY_PS 4", |
| | | " #define FXAA_QUALITY_P0 1.0", |
| | | " #define FXAA_QUALITY_P1 1.5", |
| | | " #define FXAA_QUALITY_P2 3.0", |
| | | " #define FXAA_QUALITY_P3 12.0", |
| | | "#endif", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | "#if (FXAA_QUALITY_PRESET == 12)", |
| | | " #define FXAA_QUALITY_PS 5", |
| | | " #define FXAA_QUALITY_P0 1.0", |
| | | " #define FXAA_QUALITY_P1 1.5", |
| | | " #define FXAA_QUALITY_P2 2.0", |
| | | " #define FXAA_QUALITY_P3 4.0", |
| | | " #define FXAA_QUALITY_P4 12.0", |
| | | "#endif", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | "#if (FXAA_QUALITY_PRESET == 13)", |
| | | " #define FXAA_QUALITY_PS 6", |
| | | " #define FXAA_QUALITY_P0 1.0", |
| | | " #define FXAA_QUALITY_P1 1.5", |
| | | " #define FXAA_QUALITY_P2 2.0", |
| | | " #define FXAA_QUALITY_P3 2.0", |
| | | " #define FXAA_QUALITY_P4 4.0", |
| | | " #define FXAA_QUALITY_P5 12.0", |
| | | "#endif", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | "#if (FXAA_QUALITY_PRESET == 14)", |
| | | " #define FXAA_QUALITY_PS 7", |
| | | " #define FXAA_QUALITY_P0 1.0", |
| | | " #define FXAA_QUALITY_P1 1.5", |
| | | " #define FXAA_QUALITY_P2 2.0", |
| | | " #define FXAA_QUALITY_P3 2.0", |
| | | " #define FXAA_QUALITY_P4 2.0", |
| | | " #define FXAA_QUALITY_P5 4.0", |
| | | " #define FXAA_QUALITY_P6 12.0", |
| | | "#endif", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | "#if (FXAA_QUALITY_PRESET == 15)", |
| | | " #define FXAA_QUALITY_PS 8", |
| | | " #define FXAA_QUALITY_P0 1.0", |
| | | " #define FXAA_QUALITY_P1 1.5", |
| | | " #define FXAA_QUALITY_P2 2.0", |
| | | " #define FXAA_QUALITY_P3 2.0", |
| | | " #define FXAA_QUALITY_P4 2.0", |
| | | " #define FXAA_QUALITY_P5 2.0", |
| | | " #define FXAA_QUALITY_P6 4.0", |
| | | " #define FXAA_QUALITY_P7 12.0", |
| | | "#endif", |
| | | "", |
| | | "/*============================================================================", |
| | | " FXAA QUALITY - LOW DITHER PRESETS", |
| | | "============================================================================*/", |
| | | "#if (FXAA_QUALITY_PRESET == 20)", |
| | | " #define FXAA_QUALITY_PS 3", |
| | | " #define FXAA_QUALITY_P0 1.5", |
| | | " #define FXAA_QUALITY_P1 2.0", |
| | | " #define FXAA_QUALITY_P2 8.0", |
| | | "#endif", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | "#if (FXAA_QUALITY_PRESET == 21)", |
| | | " #define FXAA_QUALITY_PS 4", |
| | | " #define FXAA_QUALITY_P0 1.0", |
| | | " #define FXAA_QUALITY_P1 1.5", |
| | | " #define FXAA_QUALITY_P2 2.0", |
| | | " #define FXAA_QUALITY_P3 8.0", |
| | | "#endif", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | "#if (FXAA_QUALITY_PRESET == 22)", |
| | | " #define FXAA_QUALITY_PS 5", |
| | | " #define FXAA_QUALITY_P0 1.0", |
| | | " #define FXAA_QUALITY_P1 1.5", |
| | | " #define FXAA_QUALITY_P2 2.0", |
| | | " #define FXAA_QUALITY_P3 2.0", |
| | | " #define FXAA_QUALITY_P4 8.0", |
| | | "#endif", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | "#if (FXAA_QUALITY_PRESET == 23)", |
| | | " #define FXAA_QUALITY_PS 6", |
| | | " #define FXAA_QUALITY_P0 1.0", |
| | | " #define FXAA_QUALITY_P1 1.5", |
| | | " #define FXAA_QUALITY_P2 2.0", |
| | | " #define FXAA_QUALITY_P3 2.0", |
| | | " #define FXAA_QUALITY_P4 2.0", |
| | | " #define FXAA_QUALITY_P5 8.0", |
| | | "#endif", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | "#if (FXAA_QUALITY_PRESET == 24)", |
| | | " #define FXAA_QUALITY_PS 7", |
| | | " #define FXAA_QUALITY_P0 1.0", |
| | | " #define FXAA_QUALITY_P1 1.5", |
| | | " #define FXAA_QUALITY_P2 2.0", |
| | | " #define FXAA_QUALITY_P3 2.0", |
| | | " #define FXAA_QUALITY_P4 2.0", |
| | | " #define FXAA_QUALITY_P5 3.0", |
| | | " #define FXAA_QUALITY_P6 8.0", |
| | | "#endif", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | "#if (FXAA_QUALITY_PRESET == 25)", |
| | | " #define FXAA_QUALITY_PS 8", |
| | | " #define FXAA_QUALITY_P0 1.0", |
| | | " #define FXAA_QUALITY_P1 1.5", |
| | | " #define FXAA_QUALITY_P2 2.0", |
| | | " #define FXAA_QUALITY_P3 2.0", |
| | | " #define FXAA_QUALITY_P4 2.0", |
| | | " #define FXAA_QUALITY_P5 2.0", |
| | | " #define FXAA_QUALITY_P6 4.0", |
| | | " #define FXAA_QUALITY_P7 8.0", |
| | | "#endif", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | "#if (FXAA_QUALITY_PRESET == 26)", |
| | | " #define FXAA_QUALITY_PS 9", |
| | | " #define FXAA_QUALITY_P0 1.0", |
| | | " #define FXAA_QUALITY_P1 1.5", |
| | | " #define FXAA_QUALITY_P2 2.0", |
| | | " #define FXAA_QUALITY_P3 2.0", |
| | | " #define FXAA_QUALITY_P4 2.0", |
| | | " #define FXAA_QUALITY_P5 2.0", |
| | | " #define FXAA_QUALITY_P6 2.0", |
| | | " #define FXAA_QUALITY_P7 4.0", |
| | | " #define FXAA_QUALITY_P8 8.0", |
| | | "#endif", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | "#if (FXAA_QUALITY_PRESET == 27)", |
| | | " #define FXAA_QUALITY_PS 10", |
| | | " #define FXAA_QUALITY_P0 1.0", |
| | | " #define FXAA_QUALITY_P1 1.5", |
| | | " #define FXAA_QUALITY_P2 2.0", |
| | | " #define FXAA_QUALITY_P3 2.0", |
| | | " #define FXAA_QUALITY_P4 2.0", |
| | | " #define FXAA_QUALITY_P5 2.0", |
| | | " #define FXAA_QUALITY_P6 2.0", |
| | | " #define FXAA_QUALITY_P7 2.0", |
| | | " #define FXAA_QUALITY_P8 4.0", |
| | | " #define FXAA_QUALITY_P9 8.0", |
| | | "#endif", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | "#if (FXAA_QUALITY_PRESET == 28)", |
| | | " #define FXAA_QUALITY_PS 11", |
| | | " #define FXAA_QUALITY_P0 1.0", |
| | | " #define FXAA_QUALITY_P1 1.5", |
| | | " #define FXAA_QUALITY_P2 2.0", |
| | | " #define FXAA_QUALITY_P3 2.0", |
| | | " #define FXAA_QUALITY_P4 2.0", |
| | | " #define FXAA_QUALITY_P5 2.0", |
| | | " #define FXAA_QUALITY_P6 2.0", |
| | | " #define FXAA_QUALITY_P7 2.0", |
| | | " #define FXAA_QUALITY_P8 2.0", |
| | | " #define FXAA_QUALITY_P9 4.0", |
| | | " #define FXAA_QUALITY_P10 8.0", |
| | | "#endif", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | "#if (FXAA_QUALITY_PRESET == 29)", |
| | | " #define FXAA_QUALITY_PS 12", |
| | | " #define FXAA_QUALITY_P0 1.0", |
| | | " #define FXAA_QUALITY_P1 1.5", |
| | | " #define FXAA_QUALITY_P2 2.0", |
| | | " #define FXAA_QUALITY_P3 2.0", |
| | | " #define FXAA_QUALITY_P4 2.0", |
| | | " #define FXAA_QUALITY_P5 2.0", |
| | | " #define FXAA_QUALITY_P6 2.0", |
| | | " #define FXAA_QUALITY_P7 2.0", |
| | | " #define FXAA_QUALITY_P8 2.0", |
| | | " #define FXAA_QUALITY_P9 2.0", |
| | | " #define FXAA_QUALITY_P10 4.0", |
| | | " #define FXAA_QUALITY_P11 8.0", |
| | | "#endif", |
| | | "", |
| | | "/*============================================================================", |
| | | " FXAA QUALITY - EXTREME QUALITY", |
| | | "============================================================================*/", |
| | | "#if (FXAA_QUALITY_PRESET == 39)", |
| | | " #define FXAA_QUALITY_PS 12", |
| | | " #define FXAA_QUALITY_P0 1.0", |
| | | " #define FXAA_QUALITY_P1 1.0", |
| | | " #define FXAA_QUALITY_P2 1.0", |
| | | " #define FXAA_QUALITY_P3 1.0", |
| | | " #define FXAA_QUALITY_P4 1.0", |
| | | " #define FXAA_QUALITY_P5 1.5", |
| | | " #define FXAA_QUALITY_P6 2.0", |
| | | " #define FXAA_QUALITY_P7 2.0", |
| | | " #define FXAA_QUALITY_P8 2.0", |
| | | " #define FXAA_QUALITY_P9 2.0", |
| | | " #define FXAA_QUALITY_P10 4.0", |
| | | " #define FXAA_QUALITY_P11 8.0", |
| | | "#endif", |
| | | "", |
| | | "", |
| | | "", |
| | | "/*============================================================================", |
| | | "", |
| | | " API PORTING", |
| | | "", |
| | | "============================================================================*/", |
| | | "#if (FXAA_GLSL_100 == 1) || (FXAA_GLSL_120 == 1) || (FXAA_GLSL_130 == 1)", |
| | | " #define FxaaBool bool", |
| | | " #define FxaaDiscard discard", |
| | | " #define FxaaFloat float", |
| | | " #define FxaaFloat2 vec2", |
| | | " #define FxaaFloat3 vec3", |
| | | " #define FxaaFloat4 vec4", |
| | | " #define FxaaHalf float", |
| | | " #define FxaaHalf2 vec2", |
| | | " #define FxaaHalf3 vec3", |
| | | " #define FxaaHalf4 vec4", |
| | | " #define FxaaInt2 ivec2", |
| | | " #define FxaaSat(x) clamp(x, 0.0, 1.0)", |
| | | " #define FxaaTex sampler2D", |
| | | "#else", |
| | | " #define FxaaBool bool", |
| | | " #define FxaaDiscard clip(-1)", |
| | | " #define FxaaFloat float", |
| | | " #define FxaaFloat2 float2", |
| | | " #define FxaaFloat3 float3", |
| | | " #define FxaaFloat4 float4", |
| | | " #define FxaaHalf half", |
| | | " #define FxaaHalf2 half2", |
| | | " #define FxaaHalf3 half3", |
| | | " #define FxaaHalf4 half4", |
| | | " #define FxaaSat(x) saturate(x)", |
| | | "#endif", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | "#if (FXAA_GLSL_100 == 1)", |
| | | " #define FxaaTexTop(t, p) texture2D(t, p, 0.0)", |
| | | " #define FxaaTexOff(t, p, o, r) texture2D(t, p + (o * r), 0.0)", |
| | | "#endif", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | "#if (FXAA_GLSL_120 == 1)", |
| | | " // Requires,", |
| | | " // #version 120", |
| | | " // And at least,", |
| | | " // #extension GL_EXT_gpu_shader4 : enable", |
| | | " // (or set FXAA_FAST_PIXEL_OFFSET 1 to work like DX9)", |
| | | " #define FxaaTexTop(t, p) texture2DLod(t, p, 0.0)", |
| | | " #if (FXAA_FAST_PIXEL_OFFSET == 1)", |
| | | " #define FxaaTexOff(t, p, o, r) texture2DLodOffset(t, p, 0.0, o)", |
| | | " #else", |
| | | " #define FxaaTexOff(t, p, o, r) texture2DLod(t, p + (o * r), 0.0)", |
| | | " #endif", |
| | | " #if (FXAA_GATHER4_ALPHA == 1)", |
| | | " // use #extension GL_ARB_gpu_shader5 : enable", |
| | | " #define FxaaTexAlpha4(t, p) textureGather(t, p, 3)", |
| | | " #define FxaaTexOffAlpha4(t, p, o) textureGatherOffset(t, p, o, 3)", |
| | | " #define FxaaTexGreen4(t, p) textureGather(t, p, 1)", |
| | | " #define FxaaTexOffGreen4(t, p, o) textureGatherOffset(t, p, o, 1)", |
| | | " #endif", |
| | | "#endif", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | "#if (FXAA_GLSL_130 == 1)", |
| | | " // Requires \"#version 130\" or better", |
| | | " #define FxaaTexTop(t, p) textureLod(t, p, 0.0)", |
| | | " #define FxaaTexOff(t, p, o, r) textureLodOffset(t, p, 0.0, o)", |
| | | " #if (FXAA_GATHER4_ALPHA == 1)", |
| | | " // use #extension GL_ARB_gpu_shader5 : enable", |
| | | " #define FxaaTexAlpha4(t, p) textureGather(t, p, 3)", |
| | | " #define FxaaTexOffAlpha4(t, p, o) textureGatherOffset(t, p, o, 3)", |
| | | " #define FxaaTexGreen4(t, p) textureGather(t, p, 1)", |
| | | " #define FxaaTexOffGreen4(t, p, o) textureGatherOffset(t, p, o, 1)", |
| | | " #endif", |
| | | "#endif", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | "#if (FXAA_HLSL_3 == 1)", |
| | | " #define FxaaInt2 float2", |
| | | " #define FxaaTex sampler2D", |
| | | " #define FxaaTexTop(t, p) tex2Dlod(t, float4(p, 0.0, 0.0))", |
| | | " #define FxaaTexOff(t, p, o, r) tex2Dlod(t, float4(p + (o * r), 0, 0))", |
| | | "#endif", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | "#if (FXAA_HLSL_4 == 1)", |
| | | " #define FxaaInt2 int2", |
| | | " struct FxaaTex { SamplerState smpl; Texture2D tex; };", |
| | | " #define FxaaTexTop(t, p) t.tex.SampleLevel(t.smpl, p, 0.0)", |
| | | " #define FxaaTexOff(t, p, o, r) t.tex.SampleLevel(t.smpl, p, 0.0, o)", |
| | | "#endif", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | "#if (FXAA_HLSL_5 == 1)", |
| | | " #define FxaaInt2 int2", |
| | | " struct FxaaTex { SamplerState smpl; Texture2D tex; };", |
| | | " #define FxaaTexTop(t, p) t.tex.SampleLevel(t.smpl, p, 0.0)", |
| | | " #define FxaaTexOff(t, p, o, r) t.tex.SampleLevel(t.smpl, p, 0.0, o)", |
| | | " #define FxaaTexAlpha4(t, p) t.tex.GatherAlpha(t.smpl, p)", |
| | | " #define FxaaTexOffAlpha4(t, p, o) t.tex.GatherAlpha(t.smpl, p, o)", |
| | | " #define FxaaTexGreen4(t, p) t.tex.GatherGreen(t.smpl, p)", |
| | | " #define FxaaTexOffGreen4(t, p, o) t.tex.GatherGreen(t.smpl, p, o)", |
| | | "#endif", |
| | | "", |
| | | "", |
| | | "/*============================================================================", |
| | | " GREEN AS LUMA OPTION SUPPORT FUNCTION", |
| | | "============================================================================*/", |
| | | "#if (FXAA_GREEN_AS_LUMA == 0)", |
| | | " FxaaFloat FxaaLuma(FxaaFloat4 rgba) { return rgba.w; }", |
| | | "#else", |
| | | " FxaaFloat FxaaLuma(FxaaFloat4 rgba) { return rgba.y; }", |
| | | "#endif", |
| | | "", |
| | | "", |
| | | "", |
| | | "", |
| | | "/*============================================================================", |
| | | "", |
| | | " FXAA3 QUALITY - PC", |
| | | "", |
| | | "============================================================================*/", |
| | | "#if (FXAA_PC == 1)", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | "FxaaFloat4 FxaaPixelShader(", |
| | | " //", |
| | | " // Use noperspective interpolation here (turn off perspective interpolation).", |
| | | " // {xy} = center of pixel", |
| | | " FxaaFloat2 pos,", |
| | | " //", |
| | | " // Used only for FXAA Console, and not used on the 360 version.", |
| | | " // Use noperspective interpolation here (turn off perspective interpolation).", |
| | | " // {xy_} = upper left of pixel", |
| | | " // {_zw} = lower right of pixel", |
| | | " FxaaFloat4 fxaaConsolePosPos,", |
| | | " //", |
| | | " // Input color texture.", |
| | | " // {rgb_} = color in linear or perceptual color space", |
| | | " // if (FXAA_GREEN_AS_LUMA == 0)", |
| | | " // {__a} = luma in perceptual color space (not linear)", |
| | | " FxaaTex tex,", |
| | | " //", |
| | | " // Only used on the optimized 360 version of FXAA Console.", |
| | | " // For everything but 360, just use the same input here as for \"tex\".", |
| | | " // For 360, same texture, just alias with a 2nd sampler.", |
| | | " // This sampler needs to have an exponent bias of -1.", |
| | | " FxaaTex fxaaConsole360TexExpBiasNegOne,", |
| | | " //", |
| | | " // Only used on the optimized 360 version of FXAA Console.", |
| | | " // For everything but 360, just use the same input here as for \"tex\".", |
| | | " // For 360, same texture, just alias with a 3nd sampler.", |
| | | " // This sampler needs to have an exponent bias of -2.", |
| | | " FxaaTex fxaaConsole360TexExpBiasNegTwo,", |
| | | " //", |
| | | " // Only used on FXAA Quality.", |
| | | " // This must be from a constant/uniform.", |
| | | " // {x_} = 1.0/screenWidthInPixels", |
| | | " // {_y} = 1.0/screenHeightInPixels", |
| | | " FxaaFloat2 fxaaQualityRcpFrame,", |
| | | " //", |
| | | " // Only used on FXAA Console.", |
| | | " // This must be from a constant/uniform.", |
| | | " // This effects sub-pixel AA quality and inversely sharpness.", |
| | | " // Where N ranges between,", |
| | | " // N = 0.50 (default)", |
| | | " // N = 0.33 (sharper)", |
| | | " // {x__} = -N/screenWidthInPixels", |
| | | " // {_y_} = -N/screenHeightInPixels", |
| | | " // {_z_} = N/screenWidthInPixels", |
| | | " // {__w} = N/screenHeightInPixels", |
| | | " FxaaFloat4 fxaaConsoleRcpFrameOpt,", |
| | | " //", |
| | | " // Only used on FXAA Console.", |
| | | " // Not used on 360, but used on PS3 and PC.", |
| | | " // This must be from a constant/uniform.", |
| | | " // {x__} = -2.0/screenWidthInPixels", |
| | | " // {_y_} = -2.0/screenHeightInPixels", |
| | | " // {_z_} = 2.0/screenWidthInPixels", |
| | | " // {__w} = 2.0/screenHeightInPixels", |
| | | " FxaaFloat4 fxaaConsoleRcpFrameOpt2,", |
| | | " //", |
| | | " // Only used on FXAA Console.", |
| | | " // Only used on 360 in place of fxaaConsoleRcpFrameOpt2.", |
| | | " // This must be from a constant/uniform.", |
| | | " // {x__} = 8.0/screenWidthInPixels", |
| | | " // {_y_} = 8.0/screenHeightInPixels", |
| | | " // {_z_} = -4.0/screenWidthInPixels", |
| | | " // {__w} = -4.0/screenHeightInPixels", |
| | | " FxaaFloat4 fxaaConsole360RcpFrameOpt2,", |
| | | " //", |
| | | " // Only used on FXAA Quality.", |
| | | " // This used to be the FXAA_QUALITY_SUBPIX define.", |
| | | " // It is here now to allow easier tuning.", |
| | | " // Choose the amount of sub-pixel aliasing removal.", |
| | | " // This can effect sharpness.", |
| | | " // 1.00 - upper limit (softer)", |
| | | " // 0.75 - default amount of filtering", |
| | | " // 0.50 - lower limit (sharper, less sub-pixel aliasing removal)", |
| | | " // 0.25 - almost off", |
| | | " // 0.00 - completely off", |
| | | " FxaaFloat fxaaQualitySubpix,", |
| | | " //", |
| | | " // Only used on FXAA Quality.", |
| | | " // This used to be the FXAA_QUALITY_EDGE_THRESHOLD define.", |
| | | " // It is here now to allow easier tuning.", |
| | | " // The minimum amount of local contrast required to apply algorithm.", |
| | | " // 0.333 - too little (faster)", |
| | | " // 0.250 - low quality", |
| | | " // 0.166 - default", |
| | | " // 0.125 - high quality", |
| | | " // 0.063 - overkill (slower)", |
| | | " FxaaFloat fxaaQualityEdgeThreshold,", |
| | | " //", |
| | | " // Only used on FXAA Quality.", |
| | | " // This used to be the FXAA_QUALITY_EDGE_THRESHOLD_MIN define.", |
| | | " // It is here now to allow easier tuning.", |
| | | " // Trims the algorithm from processing darks.", |
| | | " // 0.0833 - upper limit (default, the start of visible unfiltered edges)", |
| | | " // 0.0625 - high quality (faster)", |
| | | " // 0.0312 - visible limit (slower)", |
| | | " // Special notes when using FXAA_GREEN_AS_LUMA,", |
| | | " // Likely want to set this to zero.", |
| | | " // As colors that are mostly not-green", |
| | | " // will appear very dark in the green channel!", |
| | | " // Tune by looking at mostly non-green content,", |
| | | " // then start at zero and increase until aliasing is a problem.", |
| | | " FxaaFloat fxaaQualityEdgeThresholdMin,", |
| | | " //", |
| | | " // Only used on FXAA Console.", |
| | | " // This used to be the FXAA_CONSOLE_EDGE_SHARPNESS define.", |
| | | " // It is here now to allow easier tuning.", |
| | | " // This does not effect PS3, as this needs to be compiled in.", |
| | | " // Use FXAA_CONSOLE_PS3_EDGE_SHARPNESS for PS3.", |
| | | " // Due to the PS3 being ALU bound,", |
| | | " // there are only three safe values here: 2 and 4 and 8.", |
| | | " // These options use the shaders ability to a free *|/ by 2|4|8.", |
| | | " // For all other platforms can be a non-power of two.", |
| | | " // 8.0 is sharper (default!!!)", |
| | | " // 4.0 is softer", |
| | | " // 2.0 is really soft (good only for vector graphics inputs)", |
| | | " FxaaFloat fxaaConsoleEdgeSharpness,", |
| | | " //", |
| | | " // Only used on FXAA Console.", |
| | | " // This used to be the FXAA_CONSOLE_EDGE_THRESHOLD define.", |
| | | " // It is here now to allow easier tuning.", |
| | | " // This does not effect PS3, as this needs to be compiled in.", |
| | | " // Use FXAA_CONSOLE_PS3_EDGE_THRESHOLD for PS3.", |
| | | " // Due to the PS3 being ALU bound,", |
| | | " // there are only two safe values here: 1/4 and 1/8.", |
| | | " // These options use the shaders ability to a free *|/ by 2|4|8.", |
| | | " // The console setting has a different mapping than the quality setting.", |
| | | " // Other platforms can use other values.", |
| | | " // 0.125 leaves less aliasing, but is softer (default!!!)", |
| | | " // 0.25 leaves more aliasing, and is sharper", |
| | | " FxaaFloat fxaaConsoleEdgeThreshold,", |
| | | " //", |
| | | " // Only used on FXAA Console.", |
| | | " // This used to be the FXAA_CONSOLE_EDGE_THRESHOLD_MIN define.", |
| | | " // It is here now to allow easier tuning.", |
| | | " // Trims the algorithm from processing darks.", |
| | | " // The console setting has a different mapping than the quality setting.", |
| | | " // This only applies when FXAA_EARLY_EXIT is 1.", |
| | | " // This does not apply to PS3,", |
| | | " // PS3 was simplified to avoid more shader instructions.", |
| | | " // 0.06 - faster but more aliasing in darks", |
| | | " // 0.05 - default", |
| | | " // 0.04 - slower and less aliasing in darks", |
| | | " // Special notes when using FXAA_GREEN_AS_LUMA,", |
| | | " // Likely want to set this to zero.", |
| | | " // As colors that are mostly not-green", |
| | | " // will appear very dark in the green channel!", |
| | | " // Tune by looking at mostly non-green content,", |
| | | " // then start at zero and increase until aliasing is a problem.", |
| | | " FxaaFloat fxaaConsoleEdgeThresholdMin,", |
| | | " //", |
| | | " // Extra constants for 360 FXAA Console only.", |
| | | " // Use zeros or anything else for other platforms.", |
| | | " // These must be in physical constant registers and NOT immedates.", |
| | | " // Immedates will result in compiler un-optimizing.", |
| | | " // {xyzw} = float4(1.0, -1.0, 0.25, -0.25)", |
| | | " FxaaFloat4 fxaaConsole360ConstDir", |
| | | ") {", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | " FxaaFloat2 posM;", |
| | | " posM.x = pos.x;", |
| | | " posM.y = pos.y;", |
| | | " #if (FXAA_GATHER4_ALPHA == 1)", |
| | | " #if (FXAA_DISCARD == 0)", |
| | | " FxaaFloat4 rgbyM = FxaaTexTop(tex, posM);", |
| | | " #if (FXAA_GREEN_AS_LUMA == 0)", |
| | | " #define lumaM rgbyM.w", |
| | | " #else", |
| | | " #define lumaM rgbyM.y", |
| | | " #endif", |
| | | " #endif", |
| | | " #if (FXAA_GREEN_AS_LUMA == 0)", |
| | | " FxaaFloat4 luma4A = FxaaTexAlpha4(tex, posM);", |
| | | " FxaaFloat4 luma4B = FxaaTexOffAlpha4(tex, posM, FxaaInt2(-1, -1));", |
| | | " #else", |
| | | " FxaaFloat4 luma4A = FxaaTexGreen4(tex, posM);", |
| | | " FxaaFloat4 luma4B = FxaaTexOffGreen4(tex, posM, FxaaInt2(-1, -1));", |
| | | " #endif", |
| | | " #if (FXAA_DISCARD == 1)", |
| | | " #define lumaM luma4A.w", |
| | | " #endif", |
| | | " #define lumaE luma4A.z", |
| | | " #define lumaS luma4A.x", |
| | | " #define lumaSE luma4A.y", |
| | | " #define lumaNW luma4B.w", |
| | | " #define lumaN luma4B.z", |
| | | " #define lumaW luma4B.x", |
| | | " #else", |
| | | " FxaaFloat4 rgbyM = FxaaTexTop(tex, posM);", |
| | | " #if (FXAA_GREEN_AS_LUMA == 0)", |
| | | " #define lumaM rgbyM.w", |
| | | " #else", |
| | | " #define lumaM rgbyM.y", |
| | | " #endif", |
| | | " #if (FXAA_GLSL_100 == 1)", |
| | | " FxaaFloat lumaS = FxaaLuma(FxaaTexOff(tex, posM, FxaaFloat2( 0.0, 1.0), fxaaQualityRcpFrame.xy));", |
| | | " FxaaFloat lumaE = FxaaLuma(FxaaTexOff(tex, posM, FxaaFloat2( 1.0, 0.0), fxaaQualityRcpFrame.xy));", |
| | | " FxaaFloat lumaN = FxaaLuma(FxaaTexOff(tex, posM, FxaaFloat2( 0.0,-1.0), fxaaQualityRcpFrame.xy));", |
| | | " FxaaFloat lumaW = FxaaLuma(FxaaTexOff(tex, posM, FxaaFloat2(-1.0, 0.0), fxaaQualityRcpFrame.xy));", |
| | | " #else", |
| | | " FxaaFloat lumaS = FxaaLuma(FxaaTexOff(tex, posM, FxaaInt2( 0, 1), fxaaQualityRcpFrame.xy));", |
| | | " FxaaFloat lumaE = FxaaLuma(FxaaTexOff(tex, posM, FxaaInt2( 1, 0), fxaaQualityRcpFrame.xy));", |
| | | " FxaaFloat lumaN = FxaaLuma(FxaaTexOff(tex, posM, FxaaInt2( 0,-1), fxaaQualityRcpFrame.xy));", |
| | | " FxaaFloat lumaW = FxaaLuma(FxaaTexOff(tex, posM, FxaaInt2(-1, 0), fxaaQualityRcpFrame.xy));", |
| | | " #endif", |
| | | " #endif", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | " FxaaFloat maxSM = max(lumaS, lumaM);", |
| | | " FxaaFloat minSM = min(lumaS, lumaM);", |
| | | " FxaaFloat maxESM = max(lumaE, maxSM);", |
| | | " FxaaFloat minESM = min(lumaE, minSM);", |
| | | " FxaaFloat maxWN = max(lumaN, lumaW);", |
| | | " FxaaFloat minWN = min(lumaN, lumaW);", |
| | | " FxaaFloat rangeMax = max(maxWN, maxESM);", |
| | | " FxaaFloat rangeMin = min(minWN, minESM);", |
| | | " FxaaFloat rangeMaxScaled = rangeMax * fxaaQualityEdgeThreshold;", |
| | | " FxaaFloat range = rangeMax - rangeMin;", |
| | | " FxaaFloat rangeMaxClamped = max(fxaaQualityEdgeThresholdMin, rangeMaxScaled);", |
| | | " FxaaBool earlyExit = range < rangeMaxClamped;", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | " if(earlyExit)", |
| | | " #if (FXAA_DISCARD == 1)", |
| | | " FxaaDiscard;", |
| | | " #else", |
| | | " return rgbyM;", |
| | | " #endif", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | " #if (FXAA_GATHER4_ALPHA == 0)", |
| | | " #if (FXAA_GLSL_100 == 1)", |
| | | " FxaaFloat lumaNW = FxaaLuma(FxaaTexOff(tex, posM, FxaaFloat2(-1.0,-1.0), fxaaQualityRcpFrame.xy));", |
| | | " FxaaFloat lumaSE = FxaaLuma(FxaaTexOff(tex, posM, FxaaFloat2( 1.0, 1.0), fxaaQualityRcpFrame.xy));", |
| | | " FxaaFloat lumaNE = FxaaLuma(FxaaTexOff(tex, posM, FxaaFloat2( 1.0,-1.0), fxaaQualityRcpFrame.xy));", |
| | | " FxaaFloat lumaSW = FxaaLuma(FxaaTexOff(tex, posM, FxaaFloat2(-1.0, 1.0), fxaaQualityRcpFrame.xy));", |
| | | " #else", |
| | | " FxaaFloat lumaNW = FxaaLuma(FxaaTexOff(tex, posM, FxaaInt2(-1,-1), fxaaQualityRcpFrame.xy));", |
| | | " FxaaFloat lumaSE = FxaaLuma(FxaaTexOff(tex, posM, FxaaInt2( 1, 1), fxaaQualityRcpFrame.xy));", |
| | | " FxaaFloat lumaNE = FxaaLuma(FxaaTexOff(tex, posM, FxaaInt2( 1,-1), fxaaQualityRcpFrame.xy));", |
| | | " FxaaFloat lumaSW = FxaaLuma(FxaaTexOff(tex, posM, FxaaInt2(-1, 1), fxaaQualityRcpFrame.xy));", |
| | | " #endif", |
| | | " #else", |
| | | " FxaaFloat lumaNE = FxaaLuma(FxaaTexOff(tex, posM, FxaaInt2(1, -1), fxaaQualityRcpFrame.xy));", |
| | | " FxaaFloat lumaSW = FxaaLuma(FxaaTexOff(tex, posM, FxaaInt2(-1, 1), fxaaQualityRcpFrame.xy));", |
| | | " #endif", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | " FxaaFloat lumaNS = lumaN + lumaS;", |
| | | " FxaaFloat lumaWE = lumaW + lumaE;", |
| | | " FxaaFloat subpixRcpRange = 1.0/range;", |
| | | " FxaaFloat subpixNSWE = lumaNS + lumaWE;", |
| | | " FxaaFloat edgeHorz1 = (-2.0 * lumaM) + lumaNS;", |
| | | " FxaaFloat edgeVert1 = (-2.0 * lumaM) + lumaWE;", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | " FxaaFloat lumaNESE = lumaNE + lumaSE;", |
| | | " FxaaFloat lumaNWNE = lumaNW + lumaNE;", |
| | | " FxaaFloat edgeHorz2 = (-2.0 * lumaE) + lumaNESE;", |
| | | " FxaaFloat edgeVert2 = (-2.0 * lumaN) + lumaNWNE;", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | " FxaaFloat lumaNWSW = lumaNW + lumaSW;", |
| | | " FxaaFloat lumaSWSE = lumaSW + lumaSE;", |
| | | " FxaaFloat edgeHorz4 = (abs(edgeHorz1) * 2.0) + abs(edgeHorz2);", |
| | | " FxaaFloat edgeVert4 = (abs(edgeVert1) * 2.0) + abs(edgeVert2);", |
| | | " FxaaFloat edgeHorz3 = (-2.0 * lumaW) + lumaNWSW;", |
| | | " FxaaFloat edgeVert3 = (-2.0 * lumaS) + lumaSWSE;", |
| | | " FxaaFloat edgeHorz = abs(edgeHorz3) + edgeHorz4;", |
| | | " FxaaFloat edgeVert = abs(edgeVert3) + edgeVert4;", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | " FxaaFloat subpixNWSWNESE = lumaNWSW + lumaNESE;", |
| | | " FxaaFloat lengthSign = fxaaQualityRcpFrame.x;", |
| | | " FxaaBool horzSpan = edgeHorz >= edgeVert;", |
| | | " FxaaFloat subpixA = subpixNSWE * 2.0 + subpixNWSWNESE;", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | " if(!horzSpan) lumaN = lumaW;", |
| | | " if(!horzSpan) lumaS = lumaE;", |
| | | " if(horzSpan) lengthSign = fxaaQualityRcpFrame.y;", |
| | | " FxaaFloat subpixB = (subpixA * (1.0/12.0)) - lumaM;", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | " FxaaFloat gradientN = lumaN - lumaM;", |
| | | " FxaaFloat gradientS = lumaS - lumaM;", |
| | | " FxaaFloat lumaNN = lumaN + lumaM;", |
| | | " FxaaFloat lumaSS = lumaS + lumaM;", |
| | | " FxaaBool pairN = abs(gradientN) >= abs(gradientS);", |
| | | " FxaaFloat gradient = max(abs(gradientN), abs(gradientS));", |
| | | " if(pairN) lengthSign = -lengthSign;", |
| | | " FxaaFloat subpixC = FxaaSat(abs(subpixB) * subpixRcpRange);", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | " FxaaFloat2 posB;", |
| | | " posB.x = posM.x;", |
| | | " posB.y = posM.y;", |
| | | " FxaaFloat2 offNP;", |
| | | " offNP.x = (!horzSpan) ? 0.0 : fxaaQualityRcpFrame.x;", |
| | | " offNP.y = ( horzSpan) ? 0.0 : fxaaQualityRcpFrame.y;", |
| | | " if(!horzSpan) posB.x += lengthSign * 0.5;", |
| | | " if( horzSpan) posB.y += lengthSign * 0.5;", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | " FxaaFloat2 posN;", |
| | | " posN.x = posB.x - offNP.x * FXAA_QUALITY_P0;", |
| | | " posN.y = posB.y - offNP.y * FXAA_QUALITY_P0;", |
| | | " FxaaFloat2 posP;", |
| | | " posP.x = posB.x + offNP.x * FXAA_QUALITY_P0;", |
| | | " posP.y = posB.y + offNP.y * FXAA_QUALITY_P0;", |
| | | " FxaaFloat subpixD = ((-2.0)*subpixC) + 3.0;", |
| | | " FxaaFloat lumaEndN = FxaaLuma(FxaaTexTop(tex, posN));", |
| | | " FxaaFloat subpixE = subpixC * subpixC;", |
| | | " FxaaFloat lumaEndP = FxaaLuma(FxaaTexTop(tex, posP));", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | " if(!pairN) lumaNN = lumaSS;", |
| | | " FxaaFloat gradientScaled = gradient * 1.0/4.0;", |
| | | " FxaaFloat lumaMM = lumaM - lumaNN * 0.5;", |
| | | " FxaaFloat subpixF = subpixD * subpixE;", |
| | | " FxaaBool lumaMLTZero = lumaMM < 0.0;", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | " lumaEndN -= lumaNN * 0.5;", |
| | | " lumaEndP -= lumaNN * 0.5;", |
| | | " FxaaBool doneN = abs(lumaEndN) >= gradientScaled;", |
| | | " FxaaBool doneP = abs(lumaEndP) >= gradientScaled;", |
| | | " if(!doneN) posN.x -= offNP.x * FXAA_QUALITY_P1;", |
| | | " if(!doneN) posN.y -= offNP.y * FXAA_QUALITY_P1;", |
| | | " FxaaBool doneNP = (!doneN) || (!doneP);", |
| | | " if(!doneP) posP.x += offNP.x * FXAA_QUALITY_P1;", |
| | | " if(!doneP) posP.y += offNP.y * FXAA_QUALITY_P1;", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | " if(doneNP) {", |
| | | " if(!doneN) lumaEndN = FxaaLuma(FxaaTexTop(tex, posN.xy));", |
| | | " if(!doneP) lumaEndP = FxaaLuma(FxaaTexTop(tex, posP.xy));", |
| | | " if(!doneN) lumaEndN = lumaEndN - lumaNN * 0.5;", |
| | | " if(!doneP) lumaEndP = lumaEndP - lumaNN * 0.5;", |
| | | " doneN = abs(lumaEndN) >= gradientScaled;", |
| | | " doneP = abs(lumaEndP) >= gradientScaled;", |
| | | " if(!doneN) posN.x -= offNP.x * FXAA_QUALITY_P2;", |
| | | " if(!doneN) posN.y -= offNP.y * FXAA_QUALITY_P2;", |
| | | " doneNP = (!doneN) || (!doneP);", |
| | | " if(!doneP) posP.x += offNP.x * FXAA_QUALITY_P2;", |
| | | " if(!doneP) posP.y += offNP.y * FXAA_QUALITY_P2;", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | " #if (FXAA_QUALITY_PS > 3)", |
| | | " if(doneNP) {", |
| | | " if(!doneN) lumaEndN = FxaaLuma(FxaaTexTop(tex, posN.xy));", |
| | | " if(!doneP) lumaEndP = FxaaLuma(FxaaTexTop(tex, posP.xy));", |
| | | " if(!doneN) lumaEndN = lumaEndN - lumaNN * 0.5;", |
| | | " if(!doneP) lumaEndP = lumaEndP - lumaNN * 0.5;", |
| | | " doneN = abs(lumaEndN) >= gradientScaled;", |
| | | " doneP = abs(lumaEndP) >= gradientScaled;", |
| | | " if(!doneN) posN.x -= offNP.x * FXAA_QUALITY_P3;", |
| | | " if(!doneN) posN.y -= offNP.y * FXAA_QUALITY_P3;", |
| | | " doneNP = (!doneN) || (!doneP);", |
| | | " if(!doneP) posP.x += offNP.x * FXAA_QUALITY_P3;", |
| | | " if(!doneP) posP.y += offNP.y * FXAA_QUALITY_P3;", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | " #if (FXAA_QUALITY_PS > 4)", |
| | | " if(doneNP) {", |
| | | " if(!doneN) lumaEndN = FxaaLuma(FxaaTexTop(tex, posN.xy));", |
| | | " if(!doneP) lumaEndP = FxaaLuma(FxaaTexTop(tex, posP.xy));", |
| | | " if(!doneN) lumaEndN = lumaEndN - lumaNN * 0.5;", |
| | | " if(!doneP) lumaEndP = lumaEndP - lumaNN * 0.5;", |
| | | " doneN = abs(lumaEndN) >= gradientScaled;", |
| | | " doneP = abs(lumaEndP) >= gradientScaled;", |
| | | " if(!doneN) posN.x -= offNP.x * FXAA_QUALITY_P4;", |
| | | " if(!doneN) posN.y -= offNP.y * FXAA_QUALITY_P4;", |
| | | " doneNP = (!doneN) || (!doneP);", |
| | | " if(!doneP) posP.x += offNP.x * FXAA_QUALITY_P4;", |
| | | " if(!doneP) posP.y += offNP.y * FXAA_QUALITY_P4;", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | " #if (FXAA_QUALITY_PS > 5)", |
| | | " if(doneNP) {", |
| | | " if(!doneN) lumaEndN = FxaaLuma(FxaaTexTop(tex, posN.xy));", |
| | | " if(!doneP) lumaEndP = FxaaLuma(FxaaTexTop(tex, posP.xy));", |
| | | " if(!doneN) lumaEndN = lumaEndN - lumaNN * 0.5;", |
| | | " if(!doneP) lumaEndP = lumaEndP - lumaNN * 0.5;", |
| | | " doneN = abs(lumaEndN) >= gradientScaled;", |
| | | " doneP = abs(lumaEndP) >= gradientScaled;", |
| | | " if(!doneN) posN.x -= offNP.x * FXAA_QUALITY_P5;", |
| | | " if(!doneN) posN.y -= offNP.y * FXAA_QUALITY_P5;", |
| | | " doneNP = (!doneN) || (!doneP);", |
| | | " if(!doneP) posP.x += offNP.x * FXAA_QUALITY_P5;", |
| | | " if(!doneP) posP.y += offNP.y * FXAA_QUALITY_P5;", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | " #if (FXAA_QUALITY_PS > 6)", |
| | | " if(doneNP) {", |
| | | " if(!doneN) lumaEndN = FxaaLuma(FxaaTexTop(tex, posN.xy));", |
| | | " if(!doneP) lumaEndP = FxaaLuma(FxaaTexTop(tex, posP.xy));", |
| | | " if(!doneN) lumaEndN = lumaEndN - lumaNN * 0.5;", |
| | | " if(!doneP) lumaEndP = lumaEndP - lumaNN * 0.5;", |
| | | " doneN = abs(lumaEndN) >= gradientScaled;", |
| | | " doneP = abs(lumaEndP) >= gradientScaled;", |
| | | " if(!doneN) posN.x -= offNP.x * FXAA_QUALITY_P6;", |
| | | " if(!doneN) posN.y -= offNP.y * FXAA_QUALITY_P6;", |
| | | " doneNP = (!doneN) || (!doneP);", |
| | | " if(!doneP) posP.x += offNP.x * FXAA_QUALITY_P6;", |
| | | " if(!doneP) posP.y += offNP.y * FXAA_QUALITY_P6;", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | " #if (FXAA_QUALITY_PS > 7)", |
| | | " if(doneNP) {", |
| | | " if(!doneN) lumaEndN = FxaaLuma(FxaaTexTop(tex, posN.xy));", |
| | | " if(!doneP) lumaEndP = FxaaLuma(FxaaTexTop(tex, posP.xy));", |
| | | " if(!doneN) lumaEndN = lumaEndN - lumaNN * 0.5;", |
| | | " if(!doneP) lumaEndP = lumaEndP - lumaNN * 0.5;", |
| | | " doneN = abs(lumaEndN) >= gradientScaled;", |
| | | " doneP = abs(lumaEndP) >= gradientScaled;", |
| | | " if(!doneN) posN.x -= offNP.x * FXAA_QUALITY_P7;", |
| | | " if(!doneN) posN.y -= offNP.y * FXAA_QUALITY_P7;", |
| | | " doneNP = (!doneN) || (!doneP);", |
| | | " if(!doneP) posP.x += offNP.x * FXAA_QUALITY_P7;", |
| | | " if(!doneP) posP.y += offNP.y * FXAA_QUALITY_P7;", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | " #if (FXAA_QUALITY_PS > 8)", |
| | | " if(doneNP) {", |
| | | " if(!doneN) lumaEndN = FxaaLuma(FxaaTexTop(tex, posN.xy));", |
| | | " if(!doneP) lumaEndP = FxaaLuma(FxaaTexTop(tex, posP.xy));", |
| | | " if(!doneN) lumaEndN = lumaEndN - lumaNN * 0.5;", |
| | | " if(!doneP) lumaEndP = lumaEndP - lumaNN * 0.5;", |
| | | " doneN = abs(lumaEndN) >= gradientScaled;", |
| | | " doneP = abs(lumaEndP) >= gradientScaled;", |
| | | " if(!doneN) posN.x -= offNP.x * FXAA_QUALITY_P8;", |
| | | " if(!doneN) posN.y -= offNP.y * FXAA_QUALITY_P8;", |
| | | " doneNP = (!doneN) || (!doneP);", |
| | | " if(!doneP) posP.x += offNP.x * FXAA_QUALITY_P8;", |
| | | " if(!doneP) posP.y += offNP.y * FXAA_QUALITY_P8;", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | " #if (FXAA_QUALITY_PS > 9)", |
| | | " if(doneNP) {", |
| | | " if(!doneN) lumaEndN = FxaaLuma(FxaaTexTop(tex, posN.xy));", |
| | | " if(!doneP) lumaEndP = FxaaLuma(FxaaTexTop(tex, posP.xy));", |
| | | " if(!doneN) lumaEndN = lumaEndN - lumaNN * 0.5;", |
| | | " if(!doneP) lumaEndP = lumaEndP - lumaNN * 0.5;", |
| | | " doneN = abs(lumaEndN) >= gradientScaled;", |
| | | " doneP = abs(lumaEndP) >= gradientScaled;", |
| | | " if(!doneN) posN.x -= offNP.x * FXAA_QUALITY_P9;", |
| | | " if(!doneN) posN.y -= offNP.y * FXAA_QUALITY_P9;", |
| | | " doneNP = (!doneN) || (!doneP);", |
| | | " if(!doneP) posP.x += offNP.x * FXAA_QUALITY_P9;", |
| | | " if(!doneP) posP.y += offNP.y * FXAA_QUALITY_P9;", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | " #if (FXAA_QUALITY_PS > 10)", |
| | | " if(doneNP) {", |
| | | " if(!doneN) lumaEndN = FxaaLuma(FxaaTexTop(tex, posN.xy));", |
| | | " if(!doneP) lumaEndP = FxaaLuma(FxaaTexTop(tex, posP.xy));", |
| | | " if(!doneN) lumaEndN = lumaEndN - lumaNN * 0.5;", |
| | | " if(!doneP) lumaEndP = lumaEndP - lumaNN * 0.5;", |
| | | " doneN = abs(lumaEndN) >= gradientScaled;", |
| | | " doneP = abs(lumaEndP) >= gradientScaled;", |
| | | " if(!doneN) posN.x -= offNP.x * FXAA_QUALITY_P10;", |
| | | " if(!doneN) posN.y -= offNP.y * FXAA_QUALITY_P10;", |
| | | " doneNP = (!doneN) || (!doneP);", |
| | | " if(!doneP) posP.x += offNP.x * FXAA_QUALITY_P10;", |
| | | " if(!doneP) posP.y += offNP.y * FXAA_QUALITY_P10;", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | " #if (FXAA_QUALITY_PS > 11)", |
| | | " if(doneNP) {", |
| | | " if(!doneN) lumaEndN = FxaaLuma(FxaaTexTop(tex, posN.xy));", |
| | | " if(!doneP) lumaEndP = FxaaLuma(FxaaTexTop(tex, posP.xy));", |
| | | " if(!doneN) lumaEndN = lumaEndN - lumaNN * 0.5;", |
| | | " if(!doneP) lumaEndP = lumaEndP - lumaNN * 0.5;", |
| | | " doneN = abs(lumaEndN) >= gradientScaled;", |
| | | " doneP = abs(lumaEndP) >= gradientScaled;", |
| | | " if(!doneN) posN.x -= offNP.x * FXAA_QUALITY_P11;", |
| | | " if(!doneN) posN.y -= offNP.y * FXAA_QUALITY_P11;", |
| | | " doneNP = (!doneN) || (!doneP);", |
| | | " if(!doneP) posP.x += offNP.x * FXAA_QUALITY_P11;", |
| | | " if(!doneP) posP.y += offNP.y * FXAA_QUALITY_P11;", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | " #if (FXAA_QUALITY_PS > 12)", |
| | | " if(doneNP) {", |
| | | " if(!doneN) lumaEndN = FxaaLuma(FxaaTexTop(tex, posN.xy));", |
| | | " if(!doneP) lumaEndP = FxaaLuma(FxaaTexTop(tex, posP.xy));", |
| | | " if(!doneN) lumaEndN = lumaEndN - lumaNN * 0.5;", |
| | | " if(!doneP) lumaEndP = lumaEndP - lumaNN * 0.5;", |
| | | " doneN = abs(lumaEndN) >= gradientScaled;", |
| | | " doneP = abs(lumaEndP) >= gradientScaled;", |
| | | " if(!doneN) posN.x -= offNP.x * FXAA_QUALITY_P12;", |
| | | " if(!doneN) posN.y -= offNP.y * FXAA_QUALITY_P12;", |
| | | " doneNP = (!doneN) || (!doneP);", |
| | | " if(!doneP) posP.x += offNP.x * FXAA_QUALITY_P12;", |
| | | " if(!doneP) posP.y += offNP.y * FXAA_QUALITY_P12;", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | " }", |
| | | " #endif", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | " }", |
| | | " #endif", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | " }", |
| | | " #endif", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | " }", |
| | | " #endif", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | " }", |
| | | " #endif", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | " }", |
| | | " #endif", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | " }", |
| | | " #endif", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | " }", |
| | | " #endif", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | " }", |
| | | " #endif", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | " }", |
| | | " #endif", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | " }", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | " FxaaFloat dstN = posM.x - posN.x;", |
| | | " FxaaFloat dstP = posP.x - posM.x;", |
| | | " if(!horzSpan) dstN = posM.y - posN.y;", |
| | | " if(!horzSpan) dstP = posP.y - posM.y;", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | " FxaaBool goodSpanN = (lumaEndN < 0.0) != lumaMLTZero;", |
| | | " FxaaFloat spanLength = (dstP + dstN);", |
| | | " FxaaBool goodSpanP = (lumaEndP < 0.0) != lumaMLTZero;", |
| | | " FxaaFloat spanLengthRcp = 1.0/spanLength;", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | " FxaaBool directionN = dstN < dstP;", |
| | | " FxaaFloat dst = min(dstN, dstP);", |
| | | " FxaaBool goodSpan = directionN ? goodSpanN : goodSpanP;", |
| | | " FxaaFloat subpixG = subpixF * subpixF;", |
| | | " FxaaFloat pixelOffset = (dst * (-spanLengthRcp)) + 0.5;", |
| | | " FxaaFloat subpixH = subpixG * fxaaQualitySubpix;", |
| | | "/*--------------------------------------------------------------------------*/", |
| | | " FxaaFloat pixelOffsetGood = goodSpan ? pixelOffset : 0.0;", |
| | | " FxaaFloat pixelOffsetSubpix = max(pixelOffsetGood, subpixH);", |
| | | " if(!horzSpan) posM.x += pixelOffsetSubpix * lengthSign;", |
| | | " if( horzSpan) posM.y += pixelOffsetSubpix * lengthSign;", |
| | | " #if (FXAA_DISCARD == 1)", |
| | | " return FxaaTexTop(tex, posM);", |
| | | " #else", |
| | | " return FxaaFloat4(FxaaTexTop(tex, posM).xyz, lumaM);", |
| | | " #endif", |
| | | "}", |
| | | "/*==========================================================================*/", |
| | | "#endif", |
| | | "", |
| | | "void main() {", |
| | | " gl_FragColor = FxaaPixelShader(", |
| | | " vUv,", |
| | | " vec4(0.0),", |
| | | " tDiffuse,", |
| | | " tDiffuse,", |
| | | " tDiffuse,", |
| | | " resolution,", |
| | | " vec4(0.0),", |
| | | " vec4(0.0),", |
| | | " vec4(0.0),", |
| | | " 0.75,", |
| | | " 0.166,", |
| | | " 0.0833,", |
| | | " 0.0,", |
| | | " 0.0,", |
| | | " 0.0,", |
| | | " vec4(0.0)", |
| | | " );", |
| | | "", |
| | | " // TODO avoid querying texture twice for same texel", |
| | | " gl_FragColor.a = texture2D(tDiffuse, vUv).a;", |
| | | "}" |
| | | ].join("\n") |
| | | |
| | | }; |
New file |
| | |
| | | /** |
| | | * @author spidersharma / http://eduperiment.com/ |
| | | */ |
| | | |
| | | THREE.OutlinePass = function (resolution, scene, camera, selectedObjects) { |
| | | |
| | | this.renderScene = scene; |
| | | this.renderCamera = camera; |
| | | this.selectedObjects = selectedObjects !== undefined ? selectedObjects : []; |
| | | this.visibleEdgeColor = new THREE.Color(1, 1, 1); |
| | | this.hiddenEdgeColor = new THREE.Color(0.1, 0.04, 0.02); |
| | | this.edgeGlow = 0.0; |
| | | this.usePatternTexture = false; |
| | | this.edgeThickness = 1.0; |
| | | this.edgeStrength = 3.0; |
| | | this.downSampleRatio = 2; |
| | | this.pulsePeriod = 0; |
| | | |
| | | THREE.Pass.call(this); |
| | | |
| | | this.resolution = (resolution !== undefined) ? new THREE.Vector2(resolution.x, resolution.y) : new THREE.Vector2(256, 256); |
| | | |
| | | var pars = { minFilter: THREE.LinearFilter, magFilter: THREE.LinearFilter, format: THREE.RGBAFormat }; |
| | | |
| | | var resx = Math.round(this.resolution.x / this.downSampleRatio); |
| | | var resy = Math.round(this.resolution.y / this.downSampleRatio); |
| | | |
| | | this.maskBufferMaterial = new THREE.MeshBasicMaterial({ color: 0xffffff }); |
| | | this.maskBufferMaterial.side = THREE.DoubleSide; |
| | | this.renderTargetMaskBuffer = new THREE.WebGLRenderTarget(this.resolution.x, this.resolution.y, pars); |
| | | this.renderTargetMaskBuffer.texture.name = "OutlinePass.mask"; |
| | | this.renderTargetMaskBuffer.texture.generateMipmaps = false; |
| | | |
| | | this.depthMaterial = new THREE.MeshDepthMaterial(); |
| | | this.depthMaterial.side = THREE.DoubleSide; |
| | | this.depthMaterial.depthPacking = THREE.RGBADepthPacking; |
| | | this.depthMaterial.blending = THREE.NoBlending; |
| | | |
| | | this.prepareMaskMaterial = this.getPrepareMaskMaterial(); |
| | | this.prepareMaskMaterial.side = THREE.DoubleSide; |
| | | this.prepareMaskMaterial.fragmentShader = replaceDepthToViewZ(this.prepareMaskMaterial.fragmentShader, this.renderCamera); |
| | | |
| | | this.renderTargetDepthBuffer = new THREE.WebGLRenderTarget(this.resolution.x, this.resolution.y, pars); |
| | | this.renderTargetDepthBuffer.texture.name = "OutlinePass.depth"; |
| | | this.renderTargetDepthBuffer.texture.generateMipmaps = false; |
| | | |
| | | this.renderTargetMaskDownSampleBuffer = new THREE.WebGLRenderTarget(resx, resy, pars); |
| | | this.renderTargetMaskDownSampleBuffer.texture.name = "OutlinePass.depthDownSample"; |
| | | this.renderTargetMaskDownSampleBuffer.texture.generateMipmaps = false; |
| | | |
| | | this.renderTargetBlurBuffer1 = new THREE.WebGLRenderTarget(resx, resy, pars); |
| | | this.renderTargetBlurBuffer1.texture.name = "OutlinePass.blur1"; |
| | | this.renderTargetBlurBuffer1.texture.generateMipmaps = false; |
| | | this.renderTargetBlurBuffer2 = new THREE.WebGLRenderTarget(Math.round(resx / 2), Math.round(resy / 2), pars); |
| | | this.renderTargetBlurBuffer2.texture.name = "OutlinePass.blur2"; |
| | | this.renderTargetBlurBuffer2.texture.generateMipmaps = false; |
| | | |
| | | this.edgeDetectionMaterial = this.getEdgeDetectionMaterial(); |
| | | this.renderTargetEdgeBuffer1 = new THREE.WebGLRenderTarget(resx, resy, pars); |
| | | this.renderTargetEdgeBuffer1.texture.name = "OutlinePass.edge1"; |
| | | this.renderTargetEdgeBuffer1.texture.generateMipmaps = false; |
| | | this.renderTargetEdgeBuffer2 = new THREE.WebGLRenderTarget(Math.round(resx / 2), Math.round(resy / 2), pars); |
| | | this.renderTargetEdgeBuffer2.texture.name = "OutlinePass.edge2"; |
| | | this.renderTargetEdgeBuffer2.texture.generateMipmaps = false; |
| | | |
| | | var MAX_EDGE_THICKNESS = 4; |
| | | var MAX_EDGE_GLOW = 4; |
| | | |
| | | this.separableBlurMaterial1 = this.getSeperableBlurMaterial(MAX_EDGE_THICKNESS); |
| | | this.separableBlurMaterial1.uniforms["texSize"].value = new THREE.Vector2(resx, resy); |
| | | this.separableBlurMaterial1.uniforms["kernelRadius"].value = 1; |
| | | this.separableBlurMaterial2 = this.getSeperableBlurMaterial(MAX_EDGE_GLOW); |
| | | this.separableBlurMaterial2.uniforms["texSize"].value = new THREE.Vector2(Math.round(resx / 2), Math.round(resy / 2)); |
| | | this.separableBlurMaterial2.uniforms["kernelRadius"].value = MAX_EDGE_GLOW; |
| | | |
| | | // Overlay material |
| | | this.overlayMaterial = this.getOverlayMaterial(); |
| | | |
| | | // copy material |
| | | if (THREE.CopyShader === undefined) |
| | | console.error("THREE.OutlinePass relies on THREE.CopyShader"); |
| | | |
| | | var copyShader = THREE.CopyShader; |
| | | |
| | | this.copyUniforms = THREE.UniformsUtils.clone(copyShader.uniforms); |
| | | this.copyUniforms["opacity"].value = 1.0; |
| | | |
| | | this.materialCopy = new THREE.ShaderMaterial({ |
| | | uniforms: this.copyUniforms, |
| | | vertexShader: copyShader.vertexShader, |
| | | fragmentShader: copyShader.fragmentShader, |
| | | blending: THREE.NoBlending, |
| | | depthTest: false, |
| | | depthWrite: false, |
| | | transparent: true |
| | | }); |
| | | |
| | | this.enabled = true; |
| | | this.needsSwap = false; |
| | | |
| | | this.oldClearColor = new THREE.Color(); |
| | | this.oldClearAlpha = 1; |
| | | |
| | | this.camera = new THREE.OrthographicCamera(-1, 1, 1, -1, 0, 1); |
| | | this.scene = new THREE.Scene(); |
| | | |
| | | this.quad = new THREE.Mesh(new THREE.PlaneBufferGeometry(2, 2), null); |
| | | this.quad.frustumCulled = false; // Avoid getting clipped |
| | | this.scene.add(this.quad); |
| | | |
| | | this.tempPulseColor1 = new THREE.Color(); |
| | | this.tempPulseColor2 = new THREE.Color(); |
| | | this.textureMatrix = new THREE.Matrix4(); |
| | | |
| | | function replaceDepthToViewZ(string, camera) { |
| | | |
| | | var type = camera.isPerspectiveCamera ? 'perspective' : 'orthographic'; |
| | | |
| | | return string.replace(/DEPTH_TO_VIEW_Z/g, type + 'DepthToViewZ'); |
| | | |
| | | } |
| | | |
| | | }; |
| | | |
| | | THREE.OutlinePass.prototype = Object.assign(Object.create(THREE.Pass.prototype), { |
| | | |
| | | constructor: THREE.OutlinePass, |
| | | |
| | | dispose: function () { |
| | | |
| | | this.renderTargetMaskBuffer.dispose(); |
| | | this.renderTargetDepthBuffer.dispose(); |
| | | this.renderTargetMaskDownSampleBuffer.dispose(); |
| | | this.renderTargetBlurBuffer1.dispose(); |
| | | this.renderTargetBlurBuffer2.dispose(); |
| | | this.renderTargetEdgeBuffer1.dispose(); |
| | | this.renderTargetEdgeBuffer2.dispose(); |
| | | |
| | | }, |
| | | |
| | | setSize: function (width, height) { |
| | | |
| | | this.renderTargetMaskBuffer.setSize(width, height); |
| | | |
| | | var resx = Math.round(width / this.downSampleRatio); |
| | | var resy = Math.round(height / this.downSampleRatio); |
| | | this.renderTargetMaskDownSampleBuffer.setSize(resx, resy); |
| | | this.renderTargetBlurBuffer1.setSize(resx, resy); |
| | | this.renderTargetEdgeBuffer1.setSize(resx, resy); |
| | | this.separableBlurMaterial1.uniforms["texSize"].value = new THREE.Vector2(resx, resy); |
| | | |
| | | resx = Math.round(resx / 2); |
| | | resy = Math.round(resy / 2); |
| | | |
| | | this.renderTargetBlurBuffer2.setSize(resx, resy); |
| | | this.renderTargetEdgeBuffer2.setSize(resx, resy); |
| | | |
| | | this.separableBlurMaterial2.uniforms["texSize"].value = new THREE.Vector2(resx, resy); |
| | | |
| | | }, |
| | | |
| | | changeVisibilityOfSelectedObjects: function (bVisible) { |
| | | |
| | | function gatherSelectedMeshesCallBack(object) { |
| | | |
| | | if (object.isMesh) { |
| | | |
| | | if (bVisible) { |
| | | |
| | | object.visible = object.userData.oldVisible; |
| | | delete object.userData.oldVisible; |
| | | |
| | | } else { |
| | | |
| | | object.userData.oldVisible = object.visible; |
| | | object.visible = bVisible; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | for (var i = 0; i < this.selectedObjects.length; i++) { |
| | | |
| | | var selectedObject = this.selectedObjects[i]; |
| | | selectedObject.traverse(gatherSelectedMeshesCallBack); |
| | | |
| | | } |
| | | |
| | | }, |
| | | |
| | | changeVisibilityOfNonSelectedObjects: function (bVisible) { |
| | | |
| | | var selectedMeshes = []; |
| | | |
| | | function gatherSelectedMeshesCallBack(object) { |
| | | |
| | | if (object.isMesh) selectedMeshes.push(object); |
| | | |
| | | } |
| | | |
| | | for (var i = 0; i < this.selectedObjects.length; i++) { |
| | | |
| | | var selectedObject = this.selectedObjects[i]; |
| | | selectedObject.traverse(gatherSelectedMeshesCallBack); |
| | | |
| | | } |
| | | |
| | | function VisibilityChangeCallBack(object) { |
| | | |
| | | if (object.isMesh || object.isLine || object.isSprite) { |
| | | |
| | | var bFound = false; |
| | | |
| | | for (var i = 0; i < selectedMeshes.length; i++) { |
| | | |
| | | var selectedObjectId = selectedMeshes[i].id; |
| | | |
| | | if (selectedObjectId === object.id) { |
| | | |
| | | bFound = true; |
| | | break; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | if (!bFound) { |
| | | |
| | | var visibility = object.visible; |
| | | |
| | | if (!bVisible || object.bVisible) object.visible = bVisible; |
| | | |
| | | object.bVisible = visibility; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | this.renderScene.traverse(VisibilityChangeCallBack); |
| | | |
| | | }, |
| | | |
| | | updateTextureMatrix: function () { |
| | | |
| | | this.textureMatrix.set(0.5, 0.0, 0.0, 0.5, |
| | | 0.0, 0.5, 0.0, 0.5, |
| | | 0.0, 0.0, 0.5, 0.5, |
| | | 0.0, 0.0, 0.0, 1.0); |
| | | this.textureMatrix.multiply(this.renderCamera.projectionMatrix); |
| | | this.textureMatrix.multiply(this.renderCamera.matrixWorldInverse); |
| | | |
| | | }, |
| | | |
| | | render: function (renderer, writeBuffer, readBuffer, delta, maskActive) { |
| | | |
| | | if (this.selectedObjects.length > 0) { |
| | | |
| | | this.oldClearColor.copy(renderer.getClearColor()); |
| | | this.oldClearAlpha = renderer.getClearAlpha(); |
| | | var oldAutoClear = renderer.autoClear; |
| | | |
| | | renderer.autoClear = false; |
| | | |
| | | if (maskActive) renderer.context.disable(renderer.context.STENCIL_TEST); |
| | | |
| | | renderer.setClearColor(0xffffff, 1); |
| | | |
| | | // Make selected objects invisible |
| | | this.changeVisibilityOfSelectedObjects(false); |
| | | |
| | | var currentBackground = this.renderScene.background; |
| | | this.renderScene.background = null; |
| | | |
| | | // 1. Draw Non Selected objects in the depth buffer |
| | | this.renderScene.overrideMaterial = this.depthMaterial; |
| | | renderer.render(this.renderScene, this.renderCamera, this.renderTargetDepthBuffer, true); |
| | | |
| | | // Make selected objects visible |
| | | this.changeVisibilityOfSelectedObjects(true); |
| | | |
| | | // Update Texture Matrix for Depth compare |
| | | this.updateTextureMatrix(); |
| | | |
| | | // Make non selected objects invisible, and draw only the selected objects, by comparing the depth buffer of non selected objects |
| | | this.changeVisibilityOfNonSelectedObjects(false); |
| | | this.renderScene.overrideMaterial = this.prepareMaskMaterial; |
| | | this.prepareMaskMaterial.uniforms["cameraNearFar"].value = new THREE.Vector2(this.renderCamera.near, this.renderCamera.far); |
| | | this.prepareMaskMaterial.uniforms["depthTexture"].value = this.renderTargetDepthBuffer.texture; |
| | | this.prepareMaskMaterial.uniforms["textureMatrix"].value = this.textureMatrix; |
| | | renderer.render(this.renderScene, this.renderCamera, this.renderTargetMaskBuffer, true); |
| | | this.renderScene.overrideMaterial = null; |
| | | this.changeVisibilityOfNonSelectedObjects(true); |
| | | |
| | | this.renderScene.background = currentBackground; |
| | | |
| | | // 2. Downsample to Half resolution |
| | | this.quad.material = this.materialCopy; |
| | | this.copyUniforms["tDiffuse"].value = this.renderTargetMaskBuffer.texture; |
| | | renderer.render(this.scene, this.camera, this.renderTargetMaskDownSampleBuffer, true); |
| | | |
| | | this.tempPulseColor1.copy(this.visibleEdgeColor); |
| | | this.tempPulseColor2.copy(this.hiddenEdgeColor); |
| | | |
| | | if (this.pulsePeriod > 0) { |
| | | |
| | | var scalar = (1 + 0.25) / 2 + Math.cos(performance.now() * 0.01 / this.pulsePeriod) * (1.0 - 0.25) / 2; |
| | | this.tempPulseColor1.multiplyScalar(scalar); |
| | | this.tempPulseColor2.multiplyScalar(scalar); |
| | | |
| | | } |
| | | |
| | | // 3. Apply Edge Detection Pass |
| | | this.quad.material = this.edgeDetectionMaterial; |
| | | this.edgeDetectionMaterial.uniforms["maskTexture"].value = this.renderTargetMaskDownSampleBuffer.texture; |
| | | this.edgeDetectionMaterial.uniforms["texSize"].value = new THREE.Vector2(this.renderTargetMaskDownSampleBuffer.width, this.renderTargetMaskDownSampleBuffer.height); |
| | | this.edgeDetectionMaterial.uniforms["visibleEdgeColor"].value = this.tempPulseColor1; |
| | | this.edgeDetectionMaterial.uniforms["hiddenEdgeColor"].value = this.tempPulseColor2; |
| | | renderer.render(this.scene, this.camera, this.renderTargetEdgeBuffer1, true); |
| | | |
| | | // 4. Apply Blur on Half res |
| | | this.quad.material = this.separableBlurMaterial1; |
| | | this.separableBlurMaterial1.uniforms["colorTexture"].value = this.renderTargetEdgeBuffer1.texture; |
| | | this.separableBlurMaterial1.uniforms["direction"].value = THREE.OutlinePass.BlurDirectionX; |
| | | this.separableBlurMaterial1.uniforms["kernelRadius"].value = this.edgeThickness; |
| | | renderer.render(this.scene, this.camera, this.renderTargetBlurBuffer1, true); |
| | | this.separableBlurMaterial1.uniforms["colorTexture"].value = this.renderTargetBlurBuffer1.texture; |
| | | this.separableBlurMaterial1.uniforms["direction"].value = THREE.OutlinePass.BlurDirectionY; |
| | | renderer.render(this.scene, this.camera, this.renderTargetEdgeBuffer1, true); |
| | | |
| | | // Apply Blur on quarter res |
| | | this.quad.material = this.separableBlurMaterial2; |
| | | this.separableBlurMaterial2.uniforms["colorTexture"].value = this.renderTargetEdgeBuffer1.texture; |
| | | this.separableBlurMaterial2.uniforms["direction"].value = THREE.OutlinePass.BlurDirectionX; |
| | | renderer.render(this.scene, this.camera, this.renderTargetBlurBuffer2, true); |
| | | this.separableBlurMaterial2.uniforms["colorTexture"].value = this.renderTargetBlurBuffer2.texture; |
| | | this.separableBlurMaterial2.uniforms["direction"].value = THREE.OutlinePass.BlurDirectionY; |
| | | renderer.render(this.scene, this.camera, this.renderTargetEdgeBuffer2, true); |
| | | |
| | | // Blend it additively over the input texture |
| | | this.quad.material = this.overlayMaterial; |
| | | this.overlayMaterial.uniforms["maskTexture"].value = this.renderTargetMaskBuffer.texture; |
| | | this.overlayMaterial.uniforms["edgeTexture1"].value = this.renderTargetEdgeBuffer1.texture; |
| | | this.overlayMaterial.uniforms["edgeTexture2"].value = this.renderTargetEdgeBuffer2.texture; |
| | | this.overlayMaterial.uniforms["patternTexture"].value = this.patternTexture; |
| | | this.overlayMaterial.uniforms["edgeStrength"].value = this.edgeStrength; |
| | | this.overlayMaterial.uniforms["edgeGlow"].value = this.edgeGlow; |
| | | this.overlayMaterial.uniforms["usePatternTexture"].value = this.usePatternTexture; |
| | | |
| | | |
| | | if (maskActive) renderer.context.enable(renderer.context.STENCIL_TEST); |
| | | |
| | | renderer.render(this.scene, this.camera, readBuffer, false); |
| | | |
| | | renderer.setClearColor(this.oldClearColor, this.oldClearAlpha); |
| | | renderer.autoClear = oldAutoClear; |
| | | |
| | | } |
| | | |
| | | if (this.renderToScreen) { |
| | | |
| | | this.quad.material = this.materialCopy; |
| | | this.copyUniforms["tDiffuse"].value = readBuffer.texture; |
| | | renderer.render(this.scene, this.camera); |
| | | |
| | | } |
| | | |
| | | }, |
| | | |
| | | getPrepareMaskMaterial: function () { |
| | | |
| | | return new THREE.ShaderMaterial({ |
| | | |
| | | uniforms: { |
| | | "depthTexture": { value: null }, |
| | | "cameraNearFar": { value: new THREE.Vector2(0.5, 0.5) }, |
| | | "textureMatrix": { value: new THREE.Matrix4() } |
| | | }, |
| | | |
| | | vertexShader: [ |
| | | 'varying vec4 projTexCoord;', |
| | | 'varying vec4 vPosition;', |
| | | 'uniform mat4 textureMatrix;', |
| | | |
| | | 'void main() {', |
| | | |
| | | ' vPosition = modelViewMatrix * vec4( position, 1.0 );', |
| | | ' vec4 worldPosition = modelMatrix * vec4( position, 1.0 );', |
| | | ' projTexCoord = textureMatrix * worldPosition;', |
| | | ' gl_Position = projectionMatrix * modelViewMatrix * vec4( position, 1.0 );', |
| | | |
| | | '}' |
| | | ].join('\n'), |
| | | |
| | | fragmentShader: [ |
| | | '#include <packing>', |
| | | 'varying vec4 vPosition;', |
| | | 'varying vec4 projTexCoord;', |
| | | 'uniform sampler2D depthTexture;', |
| | | 'uniform vec2 cameraNearFar;', |
| | | |
| | | 'void main() {', |
| | | |
| | | ' float depth = unpackRGBAToDepth(texture2DProj( depthTexture, projTexCoord ));', |
| | | ' float viewZ = - DEPTH_TO_VIEW_Z( depth, cameraNearFar.x, cameraNearFar.y );', |
| | | ' float depthTest = (-vPosition.z > viewZ) ? 1.0 : 0.0;', |
| | | ' gl_FragColor = vec4(0.0, depthTest, 1.0, 1.0);', |
| | | |
| | | '}' |
| | | ].join('\n') |
| | | |
| | | }); |
| | | |
| | | }, |
| | | |
| | | getEdgeDetectionMaterial: function () { |
| | | |
| | | return new THREE.ShaderMaterial({ |
| | | |
| | | uniforms: { |
| | | "maskTexture": { value: null }, |
| | | "texSize": { value: new THREE.Vector2(0.5, 0.5) }, |
| | | "visibleEdgeColor": { value: new THREE.Vector3(1.0, 1.0, 1.0) }, |
| | | "hiddenEdgeColor": { value: new THREE.Vector3(1.0, 1.0, 1.0) }, |
| | | }, |
| | | |
| | | vertexShader: |
| | | "varying vec2 vUv;\n\ |
| | | void main() {\n\ |
| | | vUv = uv;\n\ |
| | | gl_Position = projectionMatrix * modelViewMatrix * vec4( position, 1.0 );\n\ |
| | | }", |
| | | |
| | | fragmentShader: |
| | | "varying vec2 vUv;\ |
| | | uniform sampler2D maskTexture;\ |
| | | uniform vec2 texSize;\ |
| | | uniform vec3 visibleEdgeColor;\ |
| | | uniform vec3 hiddenEdgeColor;\ |
| | | \ |
| | | void main() {\n\ |
| | | vec2 invSize = 1.0 / texSize;\ |
| | | vec4 uvOffset = vec4(1.0, 0.0, 0.0, 1.0) * vec4(invSize, invSize);\ |
| | | vec4 c1 = texture2D( maskTexture, vUv + uvOffset.xy);\ |
| | | vec4 c2 = texture2D( maskTexture, vUv - uvOffset.xy);\ |
| | | vec4 c3 = texture2D( maskTexture, vUv + uvOffset.yw);\ |
| | | vec4 c4 = texture2D( maskTexture, vUv - uvOffset.yw);\ |
| | | float diff1 = (c1.r - c2.r)*0.5;\ |
| | | float diff2 = (c3.r - c4.r)*0.5;\ |
| | | float d = length( vec2(diff1, diff2) );\ |
| | | float a1 = min(c1.g, c2.g);\ |
| | | float a2 = min(c3.g, c4.g);\ |
| | | float visibilityFactor = min(a1, a2);\ |
| | | vec3 edgeColor = 1.0 - visibilityFactor > 0.001 ? visibleEdgeColor : hiddenEdgeColor;\ |
| | | gl_FragColor = vec4(edgeColor, 1.0) * vec4(d);\ |
| | | }" |
| | | }); |
| | | |
| | | }, |
| | | |
| | | getSeperableBlurMaterial: function (maxRadius) { |
| | | |
| | | return new THREE.ShaderMaterial({ |
| | | |
| | | defines: { |
| | | "MAX_RADIUS": maxRadius, |
| | | }, |
| | | |
| | | uniforms: { |
| | | "colorTexture": { value: null }, |
| | | "texSize": { value: new THREE.Vector2(0.5, 0.5) }, |
| | | "direction": { value: new THREE.Vector2(0.5, 0.5) }, |
| | | "kernelRadius": { value: 1.0 } |
| | | }, |
| | | |
| | | vertexShader: |
| | | "varying vec2 vUv;\n\ |
| | | void main() {\n\ |
| | | vUv = uv;\n\ |
| | | gl_Position = projectionMatrix * modelViewMatrix * vec4( position, 1.0 );\n\ |
| | | }", |
| | | |
| | | fragmentShader: |
| | | "#include <common>\ |
| | | varying vec2 vUv;\ |
| | | uniform sampler2D colorTexture;\ |
| | | uniform vec2 texSize;\ |
| | | uniform vec2 direction;\ |
| | | uniform float kernelRadius;\ |
| | | \ |
| | | float gaussianPdf(in float x, in float sigma) {\ |
| | | return 0.39894 * exp( -0.5 * x * x/( sigma * sigma))/sigma;\ |
| | | }\ |
| | | void main() {\ |
| | | vec2 invSize = 1.0 / texSize;\ |
| | | float weightSum = gaussianPdf(0.0, kernelRadius);\ |
| | | vec3 diffuseSum = texture2D( colorTexture, vUv).rgb * weightSum;\ |
| | | vec2 delta = direction * invSize * kernelRadius/float(MAX_RADIUS);\ |
| | | vec2 uvOffset = delta;\ |
| | | for( int i = 1; i <= MAX_RADIUS; i ++ ) {\ |
| | | float w = gaussianPdf(uvOffset.x, kernelRadius);\ |
| | | vec3 sample1 = texture2D( colorTexture, vUv + uvOffset).rgb;\ |
| | | vec3 sample2 = texture2D( colorTexture, vUv - uvOffset).rgb;\ |
| | | diffuseSum += ((sample1 + sample2) * w);\ |
| | | weightSum += (2.0 * w);\ |
| | | uvOffset += delta;\ |
| | | }\ |
| | | gl_FragColor = vec4(diffuseSum/weightSum, 1.0);\ |
| | | }" |
| | | }); |
| | | |
| | | }, |
| | | |
| | | getOverlayMaterial: function () { |
| | | |
| | | return new THREE.ShaderMaterial({ |
| | | |
| | | uniforms: { |
| | | "maskTexture": { value: null }, |
| | | "edgeTexture1": { value: null }, |
| | | "edgeTexture2": { value: null }, |
| | | "patternTexture": { value: null }, |
| | | "edgeStrength": { value: 1.0 }, |
| | | "edgeGlow": { value: 1.0 }, |
| | | "usePatternTexture": { value: 0.0 } |
| | | }, |
| | | |
| | | vertexShader: |
| | | "varying vec2 vUv;\n\ |
| | | void main() {\n\ |
| | | vUv = uv;\n\ |
| | | gl_Position = projectionMatrix * modelViewMatrix * vec4( position, 1.0 );\n\ |
| | | }", |
| | | |
| | | fragmentShader: |
| | | "varying vec2 vUv;\ |
| | | uniform sampler2D maskTexture;\ |
| | | uniform sampler2D edgeTexture1;\ |
| | | uniform sampler2D edgeTexture2;\ |
| | | uniform sampler2D patternTexture;\ |
| | | uniform float edgeStrength;\ |
| | | uniform float edgeGlow;\ |
| | | uniform bool usePatternTexture;\ |
| | | \ |
| | | void main() {\ |
| | | vec4 edgeValue1 = texture2D(edgeTexture1, vUv);\ |
| | | vec4 edgeValue2 = texture2D(edgeTexture2, vUv);\ |
| | | vec4 maskColor = texture2D(maskTexture, vUv);\ |
| | | vec4 patternColor = texture2D(patternTexture, 6.0 * vUv);\ |
| | | float visibilityFactor = 1.0 - maskColor.g > 0.0 ? 1.0 : 0.5;\ |
| | | vec4 edgeValue = edgeValue1 + edgeValue2 * edgeGlow;\ |
| | | vec4 finalColor = edgeStrength * maskColor.r * edgeValue;\ |
| | | if(usePatternTexture)\ |
| | | finalColor += + visibilityFactor * (1.0 - maskColor.r) * (1.0 - patternColor.r);\ |
| | | gl_FragColor = finalColor;\ |
| | | }", |
| | | blending: THREE.AdditiveBlending, |
| | | depthTest: false, |
| | | depthWrite: false, |
| | | transparent: true |
| | | }); |
| | | |
| | | } |
| | | |
| | | }); |
| | | |
| | | THREE.OutlinePass.BlurDirectionX = new THREE.Vector2(1.0, 0.0); |
| | | THREE.OutlinePass.BlurDirectionY = new THREE.Vector2(0.0, 1.0); |
New file |
| | |
| | | /** |
| | | * @author alteredq / http://alteredqualia.com/ |
| | | */ |
| | | |
| | | THREE.RenderPass = function (scene, camera, overrideMaterial, clearColor, clearAlpha) { |
| | | |
| | | THREE.Pass.call(this); |
| | | |
| | | this.scene = scene; |
| | | this.camera = camera; |
| | | |
| | | this.overrideMaterial = overrideMaterial; |
| | | |
| | | this.clearColor = clearColor; |
| | | this.clearAlpha = (clearAlpha !== undefined) ? clearAlpha : 0; |
| | | |
| | | this.clear = true; |
| | | this.clearDepth = false; |
| | | this.needsSwap = false; |
| | | |
| | | }; |
| | | |
| | | THREE.RenderPass.prototype = Object.assign(Object.create(THREE.Pass.prototype), { |
| | | |
| | | constructor: THREE.RenderPass, |
| | | |
| | | render: function (renderer, writeBuffer, readBuffer, delta, maskActive) { |
| | | |
| | | var oldAutoClear = renderer.autoClear; |
| | | renderer.autoClear = false; |
| | | |
| | | this.scene.overrideMaterial = this.overrideMaterial; |
| | | |
| | | var oldClearColor, oldClearAlpha; |
| | | |
| | | if (this.clearColor) { |
| | | |
| | | oldClearColor = renderer.getClearColor().getHex(); |
| | | oldClearAlpha = renderer.getClearAlpha(); |
| | | |
| | | renderer.setClearColor(this.clearColor, this.clearAlpha); |
| | | |
| | | } |
| | | |
| | | if (this.clearDepth) { |
| | | |
| | | renderer.clearDepth(); |
| | | |
| | | } |
| | | |
| | | renderer.render(this.scene, this.camera, this.renderToScreen ? null : readBuffer, this.clear); |
| | | |
| | | if (this.clearColor) { |
| | | |
| | | renderer.setClearColor(oldClearColor, oldClearAlpha); |
| | | |
| | | } |
| | | |
| | | this.scene.overrideMaterial = null; |
| | | renderer.autoClear = oldAutoClear; |
| | | } |
| | | |
| | | }); |
New file |
| | |
| | | /** |
| | | * |
| | | * Supersample Anti-Aliasing Render Pass |
| | | * |
| | | * @author bhouston / http://clara.io/ |
| | | * |
| | | * This manual approach to SSAA re-renders the scene ones for each sample with camera jitter and accumulates the results. |
| | | * |
| | | * References: https://en.wikipedia.org/wiki/Supersampling |
| | | * |
| | | */ |
| | | |
| | | THREE.SSAARenderPass = function (scene, camera, clearColor, clearAlpha) { |
| | | |
| | | THREE.Pass.call(this); |
| | | |
| | | this.scene = scene; |
| | | this.camera = camera; |
| | | |
| | | this.sampleLevel = 4; // specified as n, where the number of samples is 2^n, so sampleLevel = 4, is 2^4 samples, 16. |
| | | this.unbiased = true; |
| | | |
| | | // as we need to clear the buffer in this pass, clearColor must be set to something, defaults to black. |
| | | this.clearColor = (clearColor !== undefined) ? clearColor : 0x000000; |
| | | this.clearAlpha = (clearAlpha !== undefined) ? clearAlpha : 0; |
| | | |
| | | if (THREE.CopyShader === undefined) console.error("THREE.SSAARenderPass relies on THREE.CopyShader"); |
| | | |
| | | var copyShader = THREE.CopyShader; |
| | | this.copyUniforms = THREE.UniformsUtils.clone(copyShader.uniforms); |
| | | |
| | | this.copyMaterial = new THREE.ShaderMaterial({ |
| | | uniforms: this.copyUniforms, |
| | | vertexShader: copyShader.vertexShader, |
| | | fragmentShader: copyShader.fragmentShader, |
| | | premultipliedAlpha: true, |
| | | transparent: true, |
| | | blending: THREE.AdditiveBlending, |
| | | depthTest: false, |
| | | depthWrite: false |
| | | }); |
| | | |
| | | this.camera2 = new THREE.OrthographicCamera(-1, 1, 1, -1, 0, 1); |
| | | this.scene2 = new THREE.Scene(); |
| | | this.quad2 = new THREE.Mesh(new THREE.PlaneBufferGeometry(2, 2), this.copyMaterial); |
| | | this.quad2.frustumCulled = false; // Avoid getting clipped |
| | | this.scene2.add(this.quad2); |
| | | |
| | | }; |
| | | |
| | | THREE.SSAARenderPass.prototype = Object.assign(Object.create(THREE.Pass.prototype), { |
| | | |
| | | constructor: THREE.SSAARenderPass, |
| | | |
| | | dispose: function () { |
| | | |
| | | if (this.sampleRenderTarget) { |
| | | |
| | | this.sampleRenderTarget.dispose(); |
| | | this.sampleRenderTarget = null; |
| | | |
| | | } |
| | | |
| | | }, |
| | | |
| | | setSize: function (width, height) { |
| | | |
| | | if (this.sampleRenderTarget) this.sampleRenderTarget.setSize(width, height); |
| | | |
| | | }, |
| | | |
| | | render: function (renderer, writeBuffer, readBuffer) { |
| | | |
| | | if (!this.sampleRenderTarget) { |
| | | |
| | | this.sampleRenderTarget = new THREE.WebGLRenderTarget(readBuffer.width, readBuffer.height, { minFilter: THREE.LinearFilter, magFilter: THREE.LinearFilter, format: THREE.RGBAFormat }); |
| | | this.sampleRenderTarget.texture.name = "SSAARenderPass.sample"; |
| | | |
| | | } |
| | | |
| | | var jitterOffsets = THREE.SSAARenderPass.JitterVectors[Math.max(0, Math.min(this.sampleLevel, 5))]; |
| | | |
| | | var autoClear = renderer.autoClear; |
| | | renderer.autoClear = false; |
| | | |
| | | var oldClearColor = renderer.getClearColor().getHex(); |
| | | var oldClearAlpha = renderer.getClearAlpha(); |
| | | |
| | | var baseSampleWeight = 1.0 / jitterOffsets.length; |
| | | var roundingRange = 1 / 32; |
| | | this.copyUniforms["tDiffuse"].value = this.sampleRenderTarget.texture; |
| | | |
| | | var width = readBuffer.width, height = readBuffer.height; |
| | | |
| | | // render the scene multiple times, each slightly jitter offset from the last and accumulate the results. |
| | | for (var i = 0; i < jitterOffsets.length; i++) { |
| | | |
| | | var jitterOffset = jitterOffsets[i]; |
| | | |
| | | if (this.camera.setViewOffset) { |
| | | |
| | | this.camera.setViewOffset(width, height, |
| | | jitterOffset[0] * 0.0625, jitterOffset[1] * 0.0625, // 0.0625 = 1 / 16 |
| | | width, height); |
| | | |
| | | } |
| | | |
| | | var sampleWeight = baseSampleWeight; |
| | | |
| | | if (this.unbiased) { |
| | | |
| | | // the theory is that equal weights for each sample lead to an accumulation of rounding errors. |
| | | // The following equation varies the sampleWeight per sample so that it is uniformly distributed |
| | | // across a range of values whose rounding errors cancel each other out. |
| | | |
| | | var uniformCenteredDistribution = (-0.5 + (i + 0.5) / jitterOffsets.length); |
| | | sampleWeight += roundingRange * uniformCenteredDistribution; |
| | | |
| | | } |
| | | |
| | | this.copyUniforms["opacity"].value = sampleWeight; |
| | | renderer.setClearColor(this.clearColor, this.clearAlpha); |
| | | renderer.render(this.scene, this.camera, this.sampleRenderTarget, true); |
| | | |
| | | if (i === 0) { |
| | | |
| | | renderer.setClearColor(0x000000, 0.0); |
| | | |
| | | } |
| | | |
| | | renderer.render(this.scene2, this.camera2, this.renderToScreen ? null : writeBuffer, (i === 0)); |
| | | |
| | | } |
| | | |
| | | if (this.camera.clearViewOffset) this.camera.clearViewOffset(); |
| | | |
| | | renderer.autoClear = autoClear; |
| | | renderer.setClearColor(oldClearColor, oldClearAlpha); |
| | | |
| | | } |
| | | |
| | | }); |
| | | |
| | | |
| | | // These jitter vectors are specified in integers because it is easier. |
| | | // I am assuming a [-8,8) integer grid, but it needs to be mapped onto [-0.5,0.5) |
| | | // before being used, thus these integers need to be scaled by 1/16. |
| | | // |
| | | // Sample patterns reference: https://msdn.microsoft.com/en-us/library/windows/desktop/ff476218%28v=vs.85%29.aspx?f=255&MSPPError=-2147217396 |
| | | THREE.SSAARenderPass.JitterVectors = [ |
| | | [ |
| | | [0, 0] |
| | | ], |
| | | [ |
| | | [4, 4], [-4, -4] |
| | | ], |
| | | [ |
| | | [-2, -6], [6, -2], [-6, 2], [2, 6] |
| | | ], |
| | | [ |
| | | [1, -3], [-1, 3], [5, 1], [-3, -5], |
| | | [-5, 5], [-7, -1], [3, 7], [7, -7] |
| | | ], |
| | | [ |
| | | [1, 1], [-1, -3], [-3, 2], [4, -1], |
| | | [-5, -2], [2, 5], [5, 3], [3, -5], |
| | | [-2, 6], [0, -7], [-4, -6], [-6, 4], |
| | | [-8, 0], [7, -4], [6, 7], [-7, -8] |
| | | ], |
| | | [ |
| | | [-4, -7], [-7, -5], [-3, -5], [-5, -4], |
| | | [-1, -4], [-2, -2], [-6, -1], [-4, 0], |
| | | [-7, 1], [-1, 2], [-6, 3], [-3, 3], |
| | | [-7, 6], [-3, 6], [-5, 7], [-1, 7], |
| | | [5, -7], [1, -6], [6, -5], [4, -4], |
| | | [2, -3], [7, -2], [1, -1], [4, -1], |
| | | [2, 1], [6, 2], [0, 4], [4, 4], |
| | | [2, 5], [7, 5], [5, 6], [3, 7] |
| | | ] |
| | | ]; |
New file |
| | |
| | | /** |
| | | * @author alteredq / http://alteredqualia.com/ |
| | | */ |
| | | |
| | | THREE.ShaderPass = function (shader, textureID) { |
| | | |
| | | THREE.Pass.call(this); |
| | | |
| | | this.textureID = (textureID !== undefined) ? textureID : "tDiffuse"; |
| | | |
| | | if (shader instanceof THREE.ShaderMaterial) { |
| | | |
| | | this.uniforms = shader.uniforms; |
| | | |
| | | this.material = shader; |
| | | |
| | | } else if (shader) { |
| | | |
| | | this.uniforms = THREE.UniformsUtils.clone(shader.uniforms); |
| | | |
| | | this.material = new THREE.ShaderMaterial({ |
| | | |
| | | defines: Object.assign({}, shader.defines), |
| | | uniforms: this.uniforms, |
| | | vertexShader: shader.vertexShader, |
| | | fragmentShader: shader.fragmentShader |
| | | |
| | | }); |
| | | |
| | | } |
| | | |
| | | this.camera = new THREE.OrthographicCamera(-1, 1, 1, -1, 0, 1); |
| | | this.scene = new THREE.Scene(); |
| | | |
| | | this.quad = new THREE.Mesh(new THREE.PlaneBufferGeometry(2, 2), null); |
| | | this.quad.frustumCulled = false; // Avoid getting clipped |
| | | this.scene.add(this.quad); |
| | | |
| | | }; |
| | | |
| | | THREE.ShaderPass.prototype = Object.assign(Object.create(THREE.Pass.prototype), { |
| | | |
| | | constructor: THREE.ShaderPass, |
| | | |
| | | render: function (renderer, writeBuffer, readBuffer, delta, maskActive) { |
| | | |
| | | if (this.uniforms[this.textureID]) { |
| | | |
| | | this.uniforms[this.textureID].value = readBuffer.texture; |
| | | |
| | | } |
| | | |
| | | this.quad.material = this.material; |
| | | |
| | | if (this.renderToScreen) { |
| | | |
| | | renderer.render(this.scene, this.camera); |
| | | |
| | | } else { |
| | | |
| | | renderer.render(this.scene, this.camera, writeBuffer, this.clear); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | }); |
New file |
| | |
| | | /*! jQuery v2.2.4 | (c) jQuery Foundation | jquery.org/license */ |
| | | !function(a,b){"object"==typeof module&&"object"==typeof module.exports?module.exports=a.document?b(a,!0):function(a){if(!a.document)throw new Error("jQuery requires a window with a document");return b(a)}:b(a)}("undefined"!=typeof window?window:this,function(a,b){var c=[],d=a.document,e=c.slice,f=c.concat,g=c.push,h=c.indexOf,i={},j=i.toString,k=i.hasOwnProperty,l={},m="2.2.4",n=function(a,b){return new n.fn.init(a,b)},o=/^[\s\uFEFF\xA0]+|[\s\uFEFF\xA0]+$/g,p=/^-ms-/,q=/-([\da-z])/gi,r=function(a,b){return b.toUpperCase()};n.fn=n.prototype={jquery:m,constructor:n,selector:"",length:0,toArray:function(){return e.call(this)},get:function(a){return null!=a?0>a?this[a+this.length]:this[a]:e.call(this)},pushStack:function(a){var b=n.merge(this.constructor(),a);return b.prevObject=this,b.context=this.context,b},each:function(a){return n.each(this,a)},map:function(a){return this.pushStack(n.map(this,function(b,c){return a.call(b,c,b)}))},slice:function(){return this.pushStack(e.apply(this,arguments))},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},eq:function(a){var b=this.length,c=+a+(0>a?b:0);return this.pushStack(c>=0&&b>c?[this[c]]:[])},end:function(){return this.prevObject||this.constructor()},push:g,sort:c.sort,splice:c.splice},n.extend=n.fn.extend=function(){var a,b,c,d,e,f,g=arguments[0]||{},h=1,i=arguments.length,j=!1;for("boolean"==typeof g&&(j=g,g=arguments[h]||{},h++),"object"==typeof g||n.isFunction(g)||(g={}),h===i&&(g=this,h--);i>h;h++)if(null!=(a=arguments[h]))for(b in a)c=g[b],d=a[b],g!==d&&(j&&d&&(n.isPlainObject(d)||(e=n.isArray(d)))?(e?(e=!1,f=c&&n.isArray(c)?c:[]):f=c&&n.isPlainObject(c)?c:{},g[b]=n.extend(j,f,d)):void 0!==d&&(g[b]=d));return g},n.extend({expando:"jQuery"+(m+Math.random()).replace(/\D/g,""),isReady:!0,error:function(a){throw new Error(a)},noop:function(){},isFunction:function(a){return"function"===n.type(a)},isArray:Array.isArray,isWindow:function(a){return null!=a&&a===a.window},isNumeric:function(a){var b=a&&a.toString();return!n.isArray(a)&&b-parseFloat(b)+1>=0},isPlainObject:function(a){var b;if("object"!==n.type(a)||a.nodeType||n.isWindow(a))return!1;if(a.constructor&&!k.call(a,"constructor")&&!k.call(a.constructor.prototype||{},"isPrototypeOf"))return!1;for(b in a);return void 0===b||k.call(a,b)},isEmptyObject:function(a){var b;for(b in a)return!1;return!0},type:function(a){return null==a?a+"":"object"==typeof a||"function"==typeof a?i[j.call(a)]||"object":typeof a},globalEval:function(a){var b,c=eval;a=n.trim(a),a&&(1===a.indexOf("use strict")?(b=d.createElement("script"),b.text=a,d.head.appendChild(b).parentNode.removeChild(b)):c(a))},camelCase:function(a){return a.replace(p,"ms-").replace(q,r)},nodeName:function(a,b){return a.nodeName&&a.nodeName.toLowerCase()===b.toLowerCase()},each:function(a,b){var c,d=0;if(s(a)){for(c=a.length;c>d;d++)if(b.call(a[d],d,a[d])===!1)break}else for(d in a)if(b.call(a[d],d,a[d])===!1)break;return a},trim:function(a){return null==a?"":(a+"").replace(o,"")},makeArray:function(a,b){var c=b||[];return null!=a&&(s(Object(a))?n.merge(c,"string"==typeof a?[a]:a):g.call(c,a)),c},inArray:function(a,b,c){return null==b?-1:h.call(b,a,c)},merge:function(a,b){for(var c=+b.length,d=0,e=a.length;c>d;d++)a[e++]=b[d];return a.length=e,a},grep:function(a,b,c){for(var d,e=[],f=0,g=a.length,h=!c;g>f;f++)d=!b(a[f],f),d!==h&&e.push(a[f]);return e},map:function(a,b,c){var d,e,g=0,h=[];if(s(a))for(d=a.length;d>g;g++)e=b(a[g],g,c),null!=e&&h.push(e);else for(g in a)e=b(a[g],g,c),null!=e&&h.push(e);return f.apply([],h)},guid:1,proxy:function(a,b){var c,d,f;return"string"==typeof b&&(c=a[b],b=a,a=c),n.isFunction(a)?(d=e.call(arguments,2),f=function(){return a.apply(b||this,d.concat(e.call(arguments)))},f.guid=a.guid=a.guid||n.guid++,f):void 0},now:Date.now,support:l}),"function"==typeof Symbol&&(n.fn[Symbol.iterator]=c[Symbol.iterator]),n.each("Boolean Number String Function Array Date RegExp Object Error Symbol".split(" "),function(a,b){i["[object "+b+"]"]=b.toLowerCase()});function s(a){var b=!!a&&"length"in a&&a.length,c=n.type(a);return"function"===c||n.isWindow(a)?!1:"array"===c||0===b||"number"==typeof b&&b>0&&b-1 in a}var t=function(a){var b,c,d,e,f,g,h,i,j,k,l,m,n,o,p,q,r,s,t,u="sizzle"+1*new Date,v=a.document,w=0,x=0,y=ga(),z=ga(),A=ga(),B=function(a,b){return a===b&&(l=!0),0},C=1<<31,D={}.hasOwnProperty,E=[],F=E.pop,G=E.push,H=E.push,I=E.slice,J=function(a,b){for(var c=0,d=a.length;d>c;c++)if(a[c]===b)return c;return-1},K="checked|selected|async|autofocus|autoplay|controls|defer|disabled|hidden|ismap|loop|multiple|open|readonly|required|scoped",L="[\\x20\\t\\r\\n\\f]",M="(?:\\\\.|[\\w-]|[^\\x00-\\xa0])+",N="\\["+L+"*("+M+")(?:"+L+"*([*^$|!~]?=)"+L+"*(?:'((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\"|("+M+"))|)"+L+"*\\]",O=":("+M+")(?:\\((('((?:\\\\.|[^\\\\'])*)'|\"((?:\\\\.|[^\\\\\"])*)\")|((?:\\\\.|[^\\\\()[\\]]|"+N+")*)|.*)\\)|)",P=new RegExp(L+"+","g"),Q=new RegExp("^"+L+"+|((?:^|[^\\\\])(?:\\\\.)*)"+L+"+$","g"),R=new RegExp("^"+L+"*,"+L+"*"),S=new RegExp("^"+L+"*([>+~]|"+L+")"+L+"*"),T=new RegExp("="+L+"*([^\\]'\"]*?)"+L+"*\\]","g"),U=new RegExp(O),V=new RegExp("^"+M+"$"),W={ID:new RegExp("^#("+M+")"),CLASS:new RegExp("^\\.("+M+")"),TAG:new RegExp("^("+M+"|[*])"),ATTR:new RegExp("^"+N),PSEUDO:new RegExp("^"+O),CHILD:new RegExp("^:(only|first|last|nth|nth-last)-(child|of-type)(?:\\("+L+"*(even|odd|(([+-]|)(\\d*)n|)"+L+"*(?:([+-]|)"+L+"*(\\d+)|))"+L+"*\\)|)","i"),bool:new RegExp("^(?:"+K+")$","i"),needsContext:new RegExp("^"+L+"*[>+~]|:(even|odd|eq|gt|lt|nth|first|last)(?:\\("+L+"*((?:-\\d)?\\d*)"+L+"*\\)|)(?=[^-]|$)","i")},X=/^(?:input|select|textarea|button)$/i,Y=/^h\d$/i,Z=/^[^{]+\{\s*\[native \w/,$=/^(?:#([\w-]+)|(\w+)|\.([\w-]+))$/,_=/[+~]/,aa=/'|\\/g,ba=new RegExp("\\\\([\\da-f]{1,6}"+L+"?|("+L+")|.)","ig"),ca=function(a,b,c){var d="0x"+b-65536;return d!==d||c?b:0>d?String.fromCharCode(d+65536):String.fromCharCode(d>>10|55296,1023&d|56320)},da=function(){m()};try{H.apply(E=I.call(v.childNodes),v.childNodes),E[v.childNodes.length].nodeType}catch(ea){H={apply:E.length?function(a,b){G.apply(a,I.call(b))}:function(a,b){var c=a.length,d=0;while(a[c++]=b[d++]);a.length=c-1}}}function fa(a,b,d,e){var f,h,j,k,l,o,r,s,w=b&&b.ownerDocument,x=b?b.nodeType:9;if(d=d||[],"string"!=typeof a||!a||1!==x&&9!==x&&11!==x)return d;if(!e&&((b?b.ownerDocument||b:v)!==n&&m(b),b=b||n,p)){if(11!==x&&(o=$.exec(a)))if(f=o[1]){if(9===x){if(!(j=b.getElementById(f)))return d;if(j.id===f)return d.push(j),d}else if(w&&(j=w.getElementById(f))&&t(b,j)&&j.id===f)return d.push(j),d}else{if(o[2])return H.apply(d,b.getElementsByTagName(a)),d;if((f=o[3])&&c.getElementsByClassName&&b.getElementsByClassName)return H.apply(d,b.getElementsByClassName(f)),d}if(c.qsa&&!A[a+" "]&&(!q||!q.test(a))){if(1!==x)w=b,s=a;else if("object"!==b.nodeName.toLowerCase()){(k=b.getAttribute("id"))?k=k.replace(aa,"\\$&"):b.setAttribute("id",k=u),r=g(a),h=r.length,l=V.test(k)?"#"+k:"[id='"+k+"']";while(h--)r[h]=l+" "+qa(r[h]);s=r.join(","),w=_.test(a)&&oa(b.parentNode)||b}if(s)try{return H.apply(d,w.querySelectorAll(s)),d}catch(y){}finally{k===u&&b.removeAttribute("id")}}}return i(a.replace(Q,"$1"),b,d,e)}function ga(){var a=[];function b(c,e){return a.push(c+" ")>d.cacheLength&&delete b[a.shift()],b[c+" "]=e}return b}function ha(a){return a[u]=!0,a}function ia(a){var b=n.createElement("div");try{return!!a(b)}catch(c){return!1}finally{b.parentNode&&b.parentNode.removeChild(b),b=null}}function ja(a,b){var c=a.split("|"),e=c.length;while(e--)d.attrHandle[c[e]]=b}function ka(a,b){var c=b&&a,d=c&&1===a.nodeType&&1===b.nodeType&&(~b.sourceIndex||C)-(~a.sourceIndex||C);if(d)return d;if(c)while(c=c.nextSibling)if(c===b)return-1;return a?1:-1}function la(a){return function(b){var c=b.nodeName.toLowerCase();return"input"===c&&b.type===a}}function ma(a){return function(b){var c=b.nodeName.toLowerCase();return("input"===c||"button"===c)&&b.type===a}}function na(a){return ha(function(b){return b=+b,ha(function(c,d){var e,f=a([],c.length,b),g=f.length;while(g--)c[e=f[g]]&&(c[e]=!(d[e]=c[e]))})})}function oa(a){return a&&"undefined"!=typeof a.getElementsByTagName&&a}c=fa.support={},f=fa.isXML=function(a){var b=a&&(a.ownerDocument||a).documentElement;return b?"HTML"!==b.nodeName:!1},m=fa.setDocument=function(a){var b,e,g=a?a.ownerDocument||a:v;return g!==n&&9===g.nodeType&&g.documentElement?(n=g,o=n.documentElement,p=!f(n),(e=n.defaultView)&&e.top!==e&&(e.addEventListener?e.addEventListener("unload",da,!1):e.attachEvent&&e.attachEvent("onunload",da)),c.attributes=ia(function(a){return a.className="i",!a.getAttribute("className")}),c.getElementsByTagName=ia(function(a){return a.appendChild(n.createComment("")),!a.getElementsByTagName("*").length}),c.getElementsByClassName=Z.test(n.getElementsByClassName),c.getById=ia(function(a){return o.appendChild(a).id=u,!n.getElementsByName||!n.getElementsByName(u).length}),c.getById?(d.find.ID=function(a,b){if("undefined"!=typeof b.getElementById&&p){var c=b.getElementById(a);return c?[c]:[]}},d.filter.ID=function(a){var b=a.replace(ba,ca);return function(a){return a.getAttribute("id")===b}}):(delete d.find.ID,d.filter.ID=function(a){var b=a.replace(ba,ca);return function(a){var c="undefined"!=typeof a.getAttributeNode&&a.getAttributeNode("id");return c&&c.value===b}}),d.find.TAG=c.getElementsByTagName?function(a,b){return"undefined"!=typeof b.getElementsByTagName?b.getElementsByTagName(a):c.qsa?b.querySelectorAll(a):void 0}:function(a,b){var c,d=[],e=0,f=b.getElementsByTagName(a);if("*"===a){while(c=f[e++])1===c.nodeType&&d.push(c);return d}return f},d.find.CLASS=c.getElementsByClassName&&function(a,b){return"undefined"!=typeof b.getElementsByClassName&&p?b.getElementsByClassName(a):void 0},r=[],q=[],(c.qsa=Z.test(n.querySelectorAll))&&(ia(function(a){o.appendChild(a).innerHTML="<a id='"+u+"'></a><select id='"+u+"-\r\\' msallowcapture=''><option selected=''></option></select>",a.querySelectorAll("[msallowcapture^='']").length&&q.push("[*^$]="+L+"*(?:''|\"\")"),a.querySelectorAll("[selected]").length||q.push("\\["+L+"*(?:value|"+K+")"),a.querySelectorAll("[id~="+u+"-]").length||q.push("~="),a.querySelectorAll(":checked").length||q.push(":checked"),a.querySelectorAll("a#"+u+"+*").length||q.push(".#.+[+~]")}),ia(function(a){var b=n.createElement("input");b.setAttribute("type","hidden"),a.appendChild(b).setAttribute("name","D"),a.querySelectorAll("[name=d]").length&&q.push("name"+L+"*[*^$|!~]?="),a.querySelectorAll(":enabled").length||q.push(":enabled",":disabled"),a.querySelectorAll("*,:x"),q.push(",.*:")})),(c.matchesSelector=Z.test(s=o.matches||o.webkitMatchesSelector||o.mozMatchesSelector||o.oMatchesSelector||o.msMatchesSelector))&&ia(function(a){c.disconnectedMatch=s.call(a,"div"),s.call(a,"[s!='']:x"),r.push("!=",O)}),q=q.length&&new RegExp(q.join("|")),r=r.length&&new RegExp(r.join("|")),b=Z.test(o.compareDocumentPosition),t=b||Z.test(o.contains)?function(a,b){var c=9===a.nodeType?a.documentElement:a,d=b&&b.parentNode;return a===d||!(!d||1!==d.nodeType||!(c.contains?c.contains(d):a.compareDocumentPosition&&16&a.compareDocumentPosition(d)))}:function(a,b){if(b)while(b=b.parentNode)if(b===a)return!0;return!1},B=b?function(a,b){if(a===b)return l=!0,0;var d=!a.compareDocumentPosition-!b.compareDocumentPosition;return d?d:(d=(a.ownerDocument||a)===(b.ownerDocument||b)?a.compareDocumentPosition(b):1,1&d||!c.sortDetached&&b.compareDocumentPosition(a)===d?a===n||a.ownerDocument===v&&t(v,a)?-1:b===n||b.ownerDocument===v&&t(v,b)?1:k?J(k,a)-J(k,b):0:4&d?-1:1)}:function(a,b){if(a===b)return l=!0,0;var c,d=0,e=a.parentNode,f=b.parentNode,g=[a],h=[b];if(!e||!f)return a===n?-1:b===n?1:e?-1:f?1:k?J(k,a)-J(k,b):0;if(e===f)return ka(a,b);c=a;while(c=c.parentNode)g.unshift(c);c=b;while(c=c.parentNode)h.unshift(c);while(g[d]===h[d])d++;return d?ka(g[d],h[d]):g[d]===v?-1:h[d]===v?1:0},n):n},fa.matches=function(a,b){return fa(a,null,null,b)},fa.matchesSelector=function(a,b){if((a.ownerDocument||a)!==n&&m(a),b=b.replace(T,"='$1']"),c.matchesSelector&&p&&!A[b+" "]&&(!r||!r.test(b))&&(!q||!q.test(b)))try{var d=s.call(a,b);if(d||c.disconnectedMatch||a.document&&11!==a.document.nodeType)return d}catch(e){}return fa(b,n,null,[a]).length>0},fa.contains=function(a,b){return(a.ownerDocument||a)!==n&&m(a),t(a,b)},fa.attr=function(a,b){(a.ownerDocument||a)!==n&&m(a);var e=d.attrHandle[b.toLowerCase()],f=e&&D.call(d.attrHandle,b.toLowerCase())?e(a,b,!p):void 0;return void 0!==f?f:c.attributes||!p?a.getAttribute(b):(f=a.getAttributeNode(b))&&f.specified?f.value:null},fa.error=function(a){throw new Error("Syntax error, unrecognized expression: "+a)},fa.uniqueSort=function(a){var b,d=[],e=0,f=0;if(l=!c.detectDuplicates,k=!c.sortStable&&a.slice(0),a.sort(B),l){while(b=a[f++])b===a[f]&&(e=d.push(f));while(e--)a.splice(d[e],1)}return k=null,a},e=fa.getText=function(a){var b,c="",d=0,f=a.nodeType;if(f){if(1===f||9===f||11===f){if("string"==typeof a.textContent)return a.textContent;for(a=a.firstChild;a;a=a.nextSibling)c+=e(a)}else if(3===f||4===f)return a.nodeValue}else while(b=a[d++])c+=e(b);return c},d=fa.selectors={cacheLength:50,createPseudo:ha,match:W,attrHandle:{},find:{},relative:{">":{dir:"parentNode",first:!0}," ":{dir:"parentNode"},"+":{dir:"previousSibling",first:!0},"~":{dir:"previousSibling"}},preFilter:{ATTR:function(a){return a[1]=a[1].replace(ba,ca),a[3]=(a[3]||a[4]||a[5]||"").replace(ba,ca),"~="===a[2]&&(a[3]=" "+a[3]+" "),a.slice(0,4)},CHILD:function(a){return a[1]=a[1].toLowerCase(),"nth"===a[1].slice(0,3)?(a[3]||fa.error(a[0]),a[4]=+(a[4]?a[5]+(a[6]||1):2*("even"===a[3]||"odd"===a[3])),a[5]=+(a[7]+a[8]||"odd"===a[3])):a[3]&&fa.error(a[0]),a},PSEUDO:function(a){var b,c=!a[6]&&a[2];return W.CHILD.test(a[0])?null:(a[3]?a[2]=a[4]||a[5]||"":c&&U.test(c)&&(b=g(c,!0))&&(b=c.indexOf(")",c.length-b)-c.length)&&(a[0]=a[0].slice(0,b),a[2]=c.slice(0,b)),a.slice(0,3))}},filter:{TAG:function(a){var b=a.replace(ba,ca).toLowerCase();return"*"===a?function(){return!0}:function(a){return a.nodeName&&a.nodeName.toLowerCase()===b}},CLASS:function(a){var b=y[a+" "];return b||(b=new RegExp("(^|"+L+")"+a+"("+L+"|$)"))&&y(a,function(a){return b.test("string"==typeof a.className&&a.className||"undefined"!=typeof a.getAttribute&&a.getAttribute("class")||"")})},ATTR:function(a,b,c){return function(d){var e=fa.attr(d,a);return null==e?"!="===b:b?(e+="","="===b?e===c:"!="===b?e!==c:"^="===b?c&&0===e.indexOf(c):"*="===b?c&&e.indexOf(c)>-1:"$="===b?c&&e.slice(-c.length)===c:"~="===b?(" "+e.replace(P," ")+" ").indexOf(c)>-1:"|="===b?e===c||e.slice(0,c.length+1)===c+"-":!1):!0}},CHILD:function(a,b,c,d,e){var f="nth"!==a.slice(0,3),g="last"!==a.slice(-4),h="of-type"===b;return 1===d&&0===e?function(a){return!!a.parentNode}:function(b,c,i){var j,k,l,m,n,o,p=f!==g?"nextSibling":"previousSibling",q=b.parentNode,r=h&&b.nodeName.toLowerCase(),s=!i&&!h,t=!1;if(q){if(f){while(p){m=b;while(m=m[p])if(h?m.nodeName.toLowerCase()===r:1===m.nodeType)return!1;o=p="only"===a&&!o&&"nextSibling"}return!0}if(o=[g?q.firstChild:q.lastChild],g&&s){m=q,l=m[u]||(m[u]={}),k=l[m.uniqueID]||(l[m.uniqueID]={}),j=k[a]||[],n=j[0]===w&&j[1],t=n&&j[2],m=n&&q.childNodes[n];while(m=++n&&m&&m[p]||(t=n=0)||o.pop())if(1===m.nodeType&&++t&&m===b){k[a]=[w,n,t];break}}else if(s&&(m=b,l=m[u]||(m[u]={}),k=l[m.uniqueID]||(l[m.uniqueID]={}),j=k[a]||[],n=j[0]===w&&j[1],t=n),t===!1)while(m=++n&&m&&m[p]||(t=n=0)||o.pop())if((h?m.nodeName.toLowerCase()===r:1===m.nodeType)&&++t&&(s&&(l=m[u]||(m[u]={}),k=l[m.uniqueID]||(l[m.uniqueID]={}),k[a]=[w,t]),m===b))break;return t-=e,t===d||t%d===0&&t/d>=0}}},PSEUDO:function(a,b){var c,e=d.pseudos[a]||d.setFilters[a.toLowerCase()]||fa.error("unsupported pseudo: "+a);return e[u]?e(b):e.length>1?(c=[a,a,"",b],d.setFilters.hasOwnProperty(a.toLowerCase())?ha(function(a,c){var d,f=e(a,b),g=f.length;while(g--)d=J(a,f[g]),a[d]=!(c[d]=f[g])}):function(a){return e(a,0,c)}):e}},pseudos:{not:ha(function(a){var b=[],c=[],d=h(a.replace(Q,"$1"));return d[u]?ha(function(a,b,c,e){var f,g=d(a,null,e,[]),h=a.length;while(h--)(f=g[h])&&(a[h]=!(b[h]=f))}):function(a,e,f){return b[0]=a,d(b,null,f,c),b[0]=null,!c.pop()}}),has:ha(function(a){return function(b){return fa(a,b).length>0}}),contains:ha(function(a){return a=a.replace(ba,ca),function(b){return(b.textContent||b.innerText||e(b)).indexOf(a)>-1}}),lang:ha(function(a){return V.test(a||"")||fa.error("unsupported lang: "+a),a=a.replace(ba,ca).toLowerCase(),function(b){var c;do if(c=p?b.lang:b.getAttribute("xml:lang")||b.getAttribute("lang"))return c=c.toLowerCase(),c===a||0===c.indexOf(a+"-");while((b=b.parentNode)&&1===b.nodeType);return!1}}),target:function(b){var c=a.location&&a.location.hash;return c&&c.slice(1)===b.id},root:function(a){return a===o},focus:function(a){return a===n.activeElement&&(!n.hasFocus||n.hasFocus())&&!!(a.type||a.href||~a.tabIndex)},enabled:function(a){return a.disabled===!1},disabled:function(a){return a.disabled===!0},checked:function(a){var b=a.nodeName.toLowerCase();return"input"===b&&!!a.checked||"option"===b&&!!a.selected},selected:function(a){return a.parentNode&&a.parentNode.selectedIndex,a.selected===!0},empty:function(a){for(a=a.firstChild;a;a=a.nextSibling)if(a.nodeType<6)return!1;return!0},parent:function(a){return!d.pseudos.empty(a)},header:function(a){return Y.test(a.nodeName)},input:function(a){return X.test(a.nodeName)},button:function(a){var b=a.nodeName.toLowerCase();return"input"===b&&"button"===a.type||"button"===b},text:function(a){var b;return"input"===a.nodeName.toLowerCase()&&"text"===a.type&&(null==(b=a.getAttribute("type"))||"text"===b.toLowerCase())},first:na(function(){return[0]}),last:na(function(a,b){return[b-1]}),eq:na(function(a,b,c){return[0>c?c+b:c]}),even:na(function(a,b){for(var c=0;b>c;c+=2)a.push(c);return a}),odd:na(function(a,b){for(var c=1;b>c;c+=2)a.push(c);return a}),lt:na(function(a,b,c){for(var d=0>c?c+b:c;--d>=0;)a.push(d);return a}),gt:na(function(a,b,c){for(var d=0>c?c+b:c;++d<b;)a.push(d);return a})}},d.pseudos.nth=d.pseudos.eq;for(b in{radio:!0,checkbox:!0,file:!0,password:!0,image:!0})d.pseudos[b]=la(b);for(b in{submit:!0,reset:!0})d.pseudos[b]=ma(b);function pa(){}pa.prototype=d.filters=d.pseudos,d.setFilters=new pa,g=fa.tokenize=function(a,b){var c,e,f,g,h,i,j,k=z[a+" "];if(k)return b?0:k.slice(0);h=a,i=[],j=d.preFilter;while(h){c&&!(e=R.exec(h))||(e&&(h=h.slice(e[0].length)||h),i.push(f=[])),c=!1,(e=S.exec(h))&&(c=e.shift(),f.push({value:c,type:e[0].replace(Q," ")}),h=h.slice(c.length));for(g in d.filter)!(e=W[g].exec(h))||j[g]&&!(e=j[g](e))||(c=e.shift(),f.push({value:c,type:g,matches:e}),h=h.slice(c.length));if(!c)break}return b?h.length:h?fa.error(a):z(a,i).slice(0)};function qa(a){for(var b=0,c=a.length,d="";c>b;b++)d+=a[b].value;return d}function ra(a,b,c){var d=b.dir,e=c&&"parentNode"===d,f=x++;return b.first?function(b,c,f){while(b=b[d])if(1===b.nodeType||e)return a(b,c,f)}:function(b,c,g){var h,i,j,k=[w,f];if(g){while(b=b[d])if((1===b.nodeType||e)&&a(b,c,g))return!0}else while(b=b[d])if(1===b.nodeType||e){if(j=b[u]||(b[u]={}),i=j[b.uniqueID]||(j[b.uniqueID]={}),(h=i[d])&&h[0]===w&&h[1]===f)return k[2]=h[2];if(i[d]=k,k[2]=a(b,c,g))return!0}}}function sa(a){return a.length>1?function(b,c,d){var e=a.length;while(e--)if(!a[e](b,c,d))return!1;return!0}:a[0]}function ta(a,b,c){for(var d=0,e=b.length;e>d;d++)fa(a,b[d],c);return c}function ua(a,b,c,d,e){for(var f,g=[],h=0,i=a.length,j=null!=b;i>h;h++)(f=a[h])&&(c&&!c(f,d,e)||(g.push(f),j&&b.push(h)));return g}function va(a,b,c,d,e,f){return d&&!d[u]&&(d=va(d)),e&&!e[u]&&(e=va(e,f)),ha(function(f,g,h,i){var j,k,l,m=[],n=[],o=g.length,p=f||ta(b||"*",h.nodeType?[h]:h,[]),q=!a||!f&&b?p:ua(p,m,a,h,i),r=c?e||(f?a:o||d)?[]:g:q;if(c&&c(q,r,h,i),d){j=ua(r,n),d(j,[],h,i),k=j.length;while(k--)(l=j[k])&&(r[n[k]]=!(q[n[k]]=l))}if(f){if(e||a){if(e){j=[],k=r.length;while(k--)(l=r[k])&&j.push(q[k]=l);e(null,r=[],j,i)}k=r.length;while(k--)(l=r[k])&&(j=e?J(f,l):m[k])>-1&&(f[j]=!(g[j]=l))}}else r=ua(r===g?r.splice(o,r.length):r),e?e(null,g,r,i):H.apply(g,r)})}function wa(a){for(var b,c,e,f=a.length,g=d.relative[a[0].type],h=g||d.relative[" "],i=g?1:0,k=ra(function(a){return a===b},h,!0),l=ra(function(a){return J(b,a)>-1},h,!0),m=[function(a,c,d){var e=!g&&(d||c!==j)||((b=c).nodeType?k(a,c,d):l(a,c,d));return b=null,e}];f>i;i++)if(c=d.relative[a[i].type])m=[ra(sa(m),c)];else{if(c=d.filter[a[i].type].apply(null,a[i].matches),c[u]){for(e=++i;f>e;e++)if(d.relative[a[e].type])break;return va(i>1&&sa(m),i>1&&qa(a.slice(0,i-1).concat({value:" "===a[i-2].type?"*":""})).replace(Q,"$1"),c,e>i&&wa(a.slice(i,e)),f>e&&wa(a=a.slice(e)),f>e&&qa(a))}m.push(c)}return sa(m)}function xa(a,b){var c=b.length>0,e=a.length>0,f=function(f,g,h,i,k){var l,o,q,r=0,s="0",t=f&&[],u=[],v=j,x=f||e&&d.find.TAG("*",k),y=w+=null==v?1:Math.random()||.1,z=x.length;for(k&&(j=g===n||g||k);s!==z&&null!=(l=x[s]);s++){if(e&&l){o=0,g||l.ownerDocument===n||(m(l),h=!p);while(q=a[o++])if(q(l,g||n,h)){i.push(l);break}k&&(w=y)}c&&((l=!q&&l)&&r--,f&&t.push(l))}if(r+=s,c&&s!==r){o=0;while(q=b[o++])q(t,u,g,h);if(f){if(r>0)while(s--)t[s]||u[s]||(u[s]=F.call(i));u=ua(u)}H.apply(i,u),k&&!f&&u.length>0&&r+b.length>1&&fa.uniqueSort(i)}return k&&(w=y,j=v),t};return c?ha(f):f}return h=fa.compile=function(a,b){var c,d=[],e=[],f=A[a+" "];if(!f){b||(b=g(a)),c=b.length;while(c--)f=wa(b[c]),f[u]?d.push(f):e.push(f);f=A(a,xa(e,d)),f.selector=a}return f},i=fa.select=function(a,b,e,f){var i,j,k,l,m,n="function"==typeof a&&a,o=!f&&g(a=n.selector||a);if(e=e||[],1===o.length){if(j=o[0]=o[0].slice(0),j.length>2&&"ID"===(k=j[0]).type&&c.getById&&9===b.nodeType&&p&&d.relative[j[1].type]){if(b=(d.find.ID(k.matches[0].replace(ba,ca),b)||[])[0],!b)return e;n&&(b=b.parentNode),a=a.slice(j.shift().value.length)}i=W.needsContext.test(a)?0:j.length;while(i--){if(k=j[i],d.relative[l=k.type])break;if((m=d.find[l])&&(f=m(k.matches[0].replace(ba,ca),_.test(j[0].type)&&oa(b.parentNode)||b))){if(j.splice(i,1),a=f.length&&qa(j),!a)return H.apply(e,f),e;break}}}return(n||h(a,o))(f,b,!p,e,!b||_.test(a)&&oa(b.parentNode)||b),e},c.sortStable=u.split("").sort(B).join("")===u,c.detectDuplicates=!!l,m(),c.sortDetached=ia(function(a){return 1&a.compareDocumentPosition(n.createElement("div"))}),ia(function(a){return a.innerHTML="<a href='#'></a>","#"===a.firstChild.getAttribute("href")})||ja("type|href|height|width",function(a,b,c){return c?void 0:a.getAttribute(b,"type"===b.toLowerCase()?1:2)}),c.attributes&&ia(function(a){return a.innerHTML="<input/>",a.firstChild.setAttribute("value",""),""===a.firstChild.getAttribute("value")})||ja("value",function(a,b,c){return c||"input"!==a.nodeName.toLowerCase()?void 0:a.defaultValue}),ia(function(a){return null==a.getAttribute("disabled")})||ja(K,function(a,b,c){var d;return c?void 0:a[b]===!0?b.toLowerCase():(d=a.getAttributeNode(b))&&d.specified?d.value:null}),fa}(a);n.find=t,n.expr=t.selectors,n.expr[":"]=n.expr.pseudos,n.uniqueSort=n.unique=t.uniqueSort,n.text=t.getText,n.isXMLDoc=t.isXML,n.contains=t.contains;var u=function(a,b,c){var d=[],e=void 0!==c;while((a=a[b])&&9!==a.nodeType)if(1===a.nodeType){if(e&&n(a).is(c))break;d.push(a)}return d},v=function(a,b){for(var c=[];a;a=a.nextSibling)1===a.nodeType&&a!==b&&c.push(a);return c},w=n.expr.match.needsContext,x=/^<([\w-]+)\s*\/?>(?:<\/\1>|)$/,y=/^.[^:#\[\.,]*$/;function z(a,b,c){if(n.isFunction(b))return n.grep(a,function(a,d){return!!b.call(a,d,a)!==c});if(b.nodeType)return n.grep(a,function(a){return a===b!==c});if("string"==typeof b){if(y.test(b))return n.filter(b,a,c);b=n.filter(b,a)}return n.grep(a,function(a){return h.call(b,a)>-1!==c})}n.filter=function(a,b,c){var d=b[0];return c&&(a=":not("+a+")"),1===b.length&&1===d.nodeType?n.find.matchesSelector(d,a)?[d]:[]:n.find.matches(a,n.grep(b,function(a){return 1===a.nodeType}))},n.fn.extend({find:function(a){var b,c=this.length,d=[],e=this;if("string"!=typeof a)return this.pushStack(n(a).filter(function(){for(b=0;c>b;b++)if(n.contains(e[b],this))return!0}));for(b=0;c>b;b++)n.find(a,e[b],d);return d=this.pushStack(c>1?n.unique(d):d),d.selector=this.selector?this.selector+" "+a:a,d},filter:function(a){return this.pushStack(z(this,a||[],!1))},not:function(a){return this.pushStack(z(this,a||[],!0))},is:function(a){return!!z(this,"string"==typeof a&&w.test(a)?n(a):a||[],!1).length}});var A,B=/^(?:\s*(<[\w\W]+>)[^>]*|#([\w-]*))$/,C=n.fn.init=function(a,b,c){var e,f;if(!a)return this;if(c=c||A,"string"==typeof a){if(e="<"===a[0]&&">"===a[a.length-1]&&a.length>=3?[null,a,null]:B.exec(a),!e||!e[1]&&b)return!b||b.jquery?(b||c).find(a):this.constructor(b).find(a);if(e[1]){if(b=b instanceof n?b[0]:b,n.merge(this,n.parseHTML(e[1],b&&b.nodeType?b.ownerDocument||b:d,!0)),x.test(e[1])&&n.isPlainObject(b))for(e in b)n.isFunction(this[e])?this[e](b[e]):this.attr(e,b[e]);return this}return f=d.getElementById(e[2]),f&&f.parentNode&&(this.length=1,this[0]=f),this.context=d,this.selector=a,this}return a.nodeType?(this.context=this[0]=a,this.length=1,this):n.isFunction(a)?void 0!==c.ready?c.ready(a):a(n):(void 0!==a.selector&&(this.selector=a.selector,this.context=a.context),n.makeArray(a,this))};C.prototype=n.fn,A=n(d);var D=/^(?:parents|prev(?:Until|All))/,E={children:!0,contents:!0,next:!0,prev:!0};n.fn.extend({has:function(a){var b=n(a,this),c=b.length;return this.filter(function(){for(var a=0;c>a;a++)if(n.contains(this,b[a]))return!0})},closest:function(a,b){for(var c,d=0,e=this.length,f=[],g=w.test(a)||"string"!=typeof a?n(a,b||this.context):0;e>d;d++)for(c=this[d];c&&c!==b;c=c.parentNode)if(c.nodeType<11&&(g?g.index(c)>-1:1===c.nodeType&&n.find.matchesSelector(c,a))){f.push(c);break}return this.pushStack(f.length>1?n.uniqueSort(f):f)},index:function(a){return a?"string"==typeof a?h.call(n(a),this[0]):h.call(this,a.jquery?a[0]:a):this[0]&&this[0].parentNode?this.first().prevAll().length:-1},add:function(a,b){return this.pushStack(n.uniqueSort(n.merge(this.get(),n(a,b))))},addBack:function(a){return this.add(null==a?this.prevObject:this.prevObject.filter(a))}});function F(a,b){while((a=a[b])&&1!==a.nodeType);return a}n.each({parent:function(a){var b=a.parentNode;return b&&11!==b.nodeType?b:null},parents:function(a){return u(a,"parentNode")},parentsUntil:function(a,b,c){return u(a,"parentNode",c)},next:function(a){return F(a,"nextSibling")},prev:function(a){return F(a,"previousSibling")},nextAll:function(a){return u(a,"nextSibling")},prevAll:function(a){return u(a,"previousSibling")},nextUntil:function(a,b,c){return u(a,"nextSibling",c)},prevUntil:function(a,b,c){return u(a,"previousSibling",c)},siblings:function(a){return v((a.parentNode||{}).firstChild,a)},children:function(a){return v(a.firstChild)},contents:function(a){return a.contentDocument||n.merge([],a.childNodes)}},function(a,b){n.fn[a]=function(c,d){var e=n.map(this,b,c);return"Until"!==a.slice(-5)&&(d=c),d&&"string"==typeof d&&(e=n.filter(d,e)),this.length>1&&(E[a]||n.uniqueSort(e),D.test(a)&&e.reverse()),this.pushStack(e)}});var G=/\S+/g;function H(a){var b={};return n.each(a.match(G)||[],function(a,c){b[c]=!0}),b}n.Callbacks=function(a){a="string"==typeof a?H(a):n.extend({},a);var b,c,d,e,f=[],g=[],h=-1,i=function(){for(e=a.once,d=b=!0;g.length;h=-1){c=g.shift();while(++h<f.length)f[h].apply(c[0],c[1])===!1&&a.stopOnFalse&&(h=f.length,c=!1)}a.memory||(c=!1),b=!1,e&&(f=c?[]:"")},j={add:function(){return f&&(c&&!b&&(h=f.length-1,g.push(c)),function d(b){n.each(b,function(b,c){n.isFunction(c)?a.unique&&j.has(c)||f.push(c):c&&c.length&&"string"!==n.type(c)&&d(c)})}(arguments),c&&!b&&i()),this},remove:function(){return n.each(arguments,function(a,b){var c;while((c=n.inArray(b,f,c))>-1)f.splice(c,1),h>=c&&h--}),this},has:function(a){return a?n.inArray(a,f)>-1:f.length>0},empty:function(){return f&&(f=[]),this},disable:function(){return e=g=[],f=c="",this},disabled:function(){return!f},lock:function(){return e=g=[],c||(f=c=""),this},locked:function(){return!!e},fireWith:function(a,c){return e||(c=c||[],c=[a,c.slice?c.slice():c],g.push(c),b||i()),this},fire:function(){return j.fireWith(this,arguments),this},fired:function(){return!!d}};return j},n.extend({Deferred:function(a){var b=[["resolve","done",n.Callbacks("once memory"),"resolved"],["reject","fail",n.Callbacks("once memory"),"rejected"],["notify","progress",n.Callbacks("memory")]],c="pending",d={state:function(){return c},always:function(){return e.done(arguments).fail(arguments),this},then:function(){var a=arguments;return n.Deferred(function(c){n.each(b,function(b,f){var g=n.isFunction(a[b])&&a[b];e[f[1]](function(){var a=g&&g.apply(this,arguments);a&&n.isFunction(a.promise)?a.promise().progress(c.notify).done(c.resolve).fail(c.reject):c[f[0]+"With"](this===d?c.promise():this,g?[a]:arguments)})}),a=null}).promise()},promise:function(a){return null!=a?n.extend(a,d):d}},e={};return d.pipe=d.then,n.each(b,function(a,f){var g=f[2],h=f[3];d[f[1]]=g.add,h&&g.add(function(){c=h},b[1^a][2].disable,b[2][2].lock),e[f[0]]=function(){return e[f[0]+"With"](this===e?d:this,arguments),this},e[f[0]+"With"]=g.fireWith}),d.promise(e),a&&a.call(e,e),e},when:function(a){var b=0,c=e.call(arguments),d=c.length,f=1!==d||a&&n.isFunction(a.promise)?d:0,g=1===f?a:n.Deferred(),h=function(a,b,c){return function(d){b[a]=this,c[a]=arguments.length>1?e.call(arguments):d,c===i?g.notifyWith(b,c):--f||g.resolveWith(b,c)}},i,j,k;if(d>1)for(i=new Array(d),j=new Array(d),k=new Array(d);d>b;b++)c[b]&&n.isFunction(c[b].promise)?c[b].promise().progress(h(b,j,i)).done(h(b,k,c)).fail(g.reject):--f;return f||g.resolveWith(k,c),g.promise()}});var I;n.fn.ready=function(a){return n.ready.promise().done(a),this},n.extend({isReady:!1,readyWait:1,holdReady:function(a){a?n.readyWait++:n.ready(!0)},ready:function(a){(a===!0?--n.readyWait:n.isReady)||(n.isReady=!0,a!==!0&&--n.readyWait>0||(I.resolveWith(d,[n]),n.fn.triggerHandler&&(n(d).triggerHandler("ready"),n(d).off("ready"))))}});function J(){d.removeEventListener("DOMContentLoaded",J),a.removeEventListener("load",J),n.ready()}n.ready.promise=function(b){return I||(I=n.Deferred(),"complete"===d.readyState||"loading"!==d.readyState&&!d.documentElement.doScroll?a.setTimeout(n.ready):(d.addEventListener("DOMContentLoaded",J),a.addEventListener("load",J))),I.promise(b)},n.ready.promise();var K=function(a,b,c,d,e,f,g){var h=0,i=a.length,j=null==c;if("object"===n.type(c)){e=!0;for(h in c)K(a,b,h,c[h],!0,f,g)}else if(void 0!==d&&(e=!0,n.isFunction(d)||(g=!0),j&&(g?(b.call(a,d),b=null):(j=b,b=function(a,b,c){return j.call(n(a),c)})),b))for(;i>h;h++)b(a[h],c,g?d:d.call(a[h],h,b(a[h],c)));return e?a:j?b.call(a):i?b(a[0],c):f},L=function(a){return 1===a.nodeType||9===a.nodeType||!+a.nodeType};function M(){this.expando=n.expando+M.uid++}M.uid=1,M.prototype={register:function(a,b){var c=b||{};return a.nodeType?a[this.expando]=c:Object.defineProperty(a,this.expando,{value:c,writable:!0,configurable:!0}),a[this.expando]},cache:function(a){if(!L(a))return{};var b=a[this.expando];return b||(b={},L(a)&&(a.nodeType?a[this.expando]=b:Object.defineProperty(a,this.expando,{value:b,configurable:!0}))),b},set:function(a,b,c){var d,e=this.cache(a);if("string"==typeof b)e[b]=c;else for(d in b)e[d]=b[d];return e},get:function(a,b){return void 0===b?this.cache(a):a[this.expando]&&a[this.expando][b]},access:function(a,b,c){var d;return void 0===b||b&&"string"==typeof b&&void 0===c?(d=this.get(a,b),void 0!==d?d:this.get(a,n.camelCase(b))):(this.set(a,b,c),void 0!==c?c:b)},remove:function(a,b){var c,d,e,f=a[this.expando];if(void 0!==f){if(void 0===b)this.register(a);else{n.isArray(b)?d=b.concat(b.map(n.camelCase)):(e=n.camelCase(b),b in f?d=[b,e]:(d=e,d=d in f?[d]:d.match(G)||[])),c=d.length;while(c--)delete f[d[c]]}(void 0===b||n.isEmptyObject(f))&&(a.nodeType?a[this.expando]=void 0:delete a[this.expando])}},hasData:function(a){var b=a[this.expando];return void 0!==b&&!n.isEmptyObject(b)}};var N=new M,O=new M,P=/^(?:\{[\w\W]*\}|\[[\w\W]*\])$/,Q=/[A-Z]/g;function R(a,b,c){var d;if(void 0===c&&1===a.nodeType)if(d="data-"+b.replace(Q,"-$&").toLowerCase(),c=a.getAttribute(d),"string"==typeof c){try{c="true"===c?!0:"false"===c?!1:"null"===c?null:+c+""===c?+c:P.test(c)?n.parseJSON(c):c; |
| | | }catch(e){}O.set(a,b,c)}else c=void 0;return c}n.extend({hasData:function(a){return O.hasData(a)||N.hasData(a)},data:function(a,b,c){return O.access(a,b,c)},removeData:function(a,b){O.remove(a,b)},_data:function(a,b,c){return N.access(a,b,c)},_removeData:function(a,b){N.remove(a,b)}}),n.fn.extend({data:function(a,b){var c,d,e,f=this[0],g=f&&f.attributes;if(void 0===a){if(this.length&&(e=O.get(f),1===f.nodeType&&!N.get(f,"hasDataAttrs"))){c=g.length;while(c--)g[c]&&(d=g[c].name,0===d.indexOf("data-")&&(d=n.camelCase(d.slice(5)),R(f,d,e[d])));N.set(f,"hasDataAttrs",!0)}return e}return"object"==typeof a?this.each(function(){O.set(this,a)}):K(this,function(b){var c,d;if(f&&void 0===b){if(c=O.get(f,a)||O.get(f,a.replace(Q,"-$&").toLowerCase()),void 0!==c)return c;if(d=n.camelCase(a),c=O.get(f,d),void 0!==c)return c;if(c=R(f,d,void 0),void 0!==c)return c}else d=n.camelCase(a),this.each(function(){var c=O.get(this,d);O.set(this,d,b),a.indexOf("-")>-1&&void 0!==c&&O.set(this,a,b)})},null,b,arguments.length>1,null,!0)},removeData:function(a){return this.each(function(){O.remove(this,a)})}}),n.extend({queue:function(a,b,c){var d;return a?(b=(b||"fx")+"queue",d=N.get(a,b),c&&(!d||n.isArray(c)?d=N.access(a,b,n.makeArray(c)):d.push(c)),d||[]):void 0},dequeue:function(a,b){b=b||"fx";var c=n.queue(a,b),d=c.length,e=c.shift(),f=n._queueHooks(a,b),g=function(){n.dequeue(a,b)};"inprogress"===e&&(e=c.shift(),d--),e&&("fx"===b&&c.unshift("inprogress"),delete f.stop,e.call(a,g,f)),!d&&f&&f.empty.fire()},_queueHooks:function(a,b){var c=b+"queueHooks";return N.get(a,c)||N.access(a,c,{empty:n.Callbacks("once memory").add(function(){N.remove(a,[b+"queue",c])})})}}),n.fn.extend({queue:function(a,b){var c=2;return"string"!=typeof a&&(b=a,a="fx",c--),arguments.length<c?n.queue(this[0],a):void 0===b?this:this.each(function(){var c=n.queue(this,a,b);n._queueHooks(this,a),"fx"===a&&"inprogress"!==c[0]&&n.dequeue(this,a)})},dequeue:function(a){return this.each(function(){n.dequeue(this,a)})},clearQueue:function(a){return this.queue(a||"fx",[])},promise:function(a,b){var c,d=1,e=n.Deferred(),f=this,g=this.length,h=function(){--d||e.resolveWith(f,[f])};"string"!=typeof a&&(b=a,a=void 0),a=a||"fx";while(g--)c=N.get(f[g],a+"queueHooks"),c&&c.empty&&(d++,c.empty.add(h));return h(),e.promise(b)}});var S=/[+-]?(?:\d*\.|)\d+(?:[eE][+-]?\d+|)/.source,T=new RegExp("^(?:([+-])=|)("+S+")([a-z%]*)$","i"),U=["Top","Right","Bottom","Left"],V=function(a,b){return a=b||a,"none"===n.css(a,"display")||!n.contains(a.ownerDocument,a)};function W(a,b,c,d){var e,f=1,g=20,h=d?function(){return d.cur()}:function(){return n.css(a,b,"")},i=h(),j=c&&c[3]||(n.cssNumber[b]?"":"px"),k=(n.cssNumber[b]||"px"!==j&&+i)&&T.exec(n.css(a,b));if(k&&k[3]!==j){j=j||k[3],c=c||[],k=+i||1;do f=f||".5",k/=f,n.style(a,b,k+j);while(f!==(f=h()/i)&&1!==f&&--g)}return c&&(k=+k||+i||0,e=c[1]?k+(c[1]+1)*c[2]:+c[2],d&&(d.unit=j,d.start=k,d.end=e)),e}var X=/^(?:checkbox|radio)$/i,Y=/<([\w:-]+)/,Z=/^$|\/(?:java|ecma)script/i,$={option:[1,"<select multiple='multiple'>","</select>"],thead:[1,"<table>","</table>"],col:[2,"<table><colgroup>","</colgroup></table>"],tr:[2,"<table><tbody>","</tbody></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],_default:[0,"",""]};$.optgroup=$.option,$.tbody=$.tfoot=$.colgroup=$.caption=$.thead,$.th=$.td;function _(a,b){var c="undefined"!=typeof a.getElementsByTagName?a.getElementsByTagName(b||"*"):"undefined"!=typeof a.querySelectorAll?a.querySelectorAll(b||"*"):[];return void 0===b||b&&n.nodeName(a,b)?n.merge([a],c):c}function aa(a,b){for(var c=0,d=a.length;d>c;c++)N.set(a[c],"globalEval",!b||N.get(b[c],"globalEval"))}var ba=/<|&#?\w+;/;function ca(a,b,c,d,e){for(var f,g,h,i,j,k,l=b.createDocumentFragment(),m=[],o=0,p=a.length;p>o;o++)if(f=a[o],f||0===f)if("object"===n.type(f))n.merge(m,f.nodeType?[f]:f);else if(ba.test(f)){g=g||l.appendChild(b.createElement("div")),h=(Y.exec(f)||["",""])[1].toLowerCase(),i=$[h]||$._default,g.innerHTML=i[1]+n.htmlPrefilter(f)+i[2],k=i[0];while(k--)g=g.lastChild;n.merge(m,g.childNodes),g=l.firstChild,g.textContent=""}else m.push(b.createTextNode(f));l.textContent="",o=0;while(f=m[o++])if(d&&n.inArray(f,d)>-1)e&&e.push(f);else if(j=n.contains(f.ownerDocument,f),g=_(l.appendChild(f),"script"),j&&aa(g),c){k=0;while(f=g[k++])Z.test(f.type||"")&&c.push(f)}return l}!function(){var a=d.createDocumentFragment(),b=a.appendChild(d.createElement("div")),c=d.createElement("input");c.setAttribute("type","radio"),c.setAttribute("checked","checked"),c.setAttribute("name","t"),b.appendChild(c),l.checkClone=b.cloneNode(!0).cloneNode(!0).lastChild.checked,b.innerHTML="<textarea>x</textarea>",l.noCloneChecked=!!b.cloneNode(!0).lastChild.defaultValue}();var da=/^key/,ea=/^(?:mouse|pointer|contextmenu|drag|drop)|click/,fa=/^([^.]*)(?:\.(.+)|)/;function ga(){return!0}function ha(){return!1}function ia(){try{return d.activeElement}catch(a){}}function ja(a,b,c,d,e,f){var g,h;if("object"==typeof b){"string"!=typeof c&&(d=d||c,c=void 0);for(h in b)ja(a,h,c,d,b[h],f);return a}if(null==d&&null==e?(e=c,d=c=void 0):null==e&&("string"==typeof c?(e=d,d=void 0):(e=d,d=c,c=void 0)),e===!1)e=ha;else if(!e)return a;return 1===f&&(g=e,e=function(a){return n().off(a),g.apply(this,arguments)},e.guid=g.guid||(g.guid=n.guid++)),a.each(function(){n.event.add(this,b,e,d,c)})}n.event={global:{},add:function(a,b,c,d,e){var f,g,h,i,j,k,l,m,o,p,q,r=N.get(a);if(r){c.handler&&(f=c,c=f.handler,e=f.selector),c.guid||(c.guid=n.guid++),(i=r.events)||(i=r.events={}),(g=r.handle)||(g=r.handle=function(b){return"undefined"!=typeof n&&n.event.triggered!==b.type?n.event.dispatch.apply(a,arguments):void 0}),b=(b||"").match(G)||[""],j=b.length;while(j--)h=fa.exec(b[j])||[],o=q=h[1],p=(h[2]||"").split(".").sort(),o&&(l=n.event.special[o]||{},o=(e?l.delegateType:l.bindType)||o,l=n.event.special[o]||{},k=n.extend({type:o,origType:q,data:d,handler:c,guid:c.guid,selector:e,needsContext:e&&n.expr.match.needsContext.test(e),namespace:p.join(".")},f),(m=i[o])||(m=i[o]=[],m.delegateCount=0,l.setup&&l.setup.call(a,d,p,g)!==!1||a.addEventListener&&a.addEventListener(o,g)),l.add&&(l.add.call(a,k),k.handler.guid||(k.handler.guid=c.guid)),e?m.splice(m.delegateCount++,0,k):m.push(k),n.event.global[o]=!0)}},remove:function(a,b,c,d,e){var f,g,h,i,j,k,l,m,o,p,q,r=N.hasData(a)&&N.get(a);if(r&&(i=r.events)){b=(b||"").match(G)||[""],j=b.length;while(j--)if(h=fa.exec(b[j])||[],o=q=h[1],p=(h[2]||"").split(".").sort(),o){l=n.event.special[o]||{},o=(d?l.delegateType:l.bindType)||o,m=i[o]||[],h=h[2]&&new RegExp("(^|\\.)"+p.join("\\.(?:.*\\.|)")+"(\\.|$)"),g=f=m.length;while(f--)k=m[f],!e&&q!==k.origType||c&&c.guid!==k.guid||h&&!h.test(k.namespace)||d&&d!==k.selector&&("**"!==d||!k.selector)||(m.splice(f,1),k.selector&&m.delegateCount--,l.remove&&l.remove.call(a,k));g&&!m.length&&(l.teardown&&l.teardown.call(a,p,r.handle)!==!1||n.removeEvent(a,o,r.handle),delete i[o])}else for(o in i)n.event.remove(a,o+b[j],c,d,!0);n.isEmptyObject(i)&&N.remove(a,"handle events")}},dispatch:function(a){a=n.event.fix(a);var b,c,d,f,g,h=[],i=e.call(arguments),j=(N.get(this,"events")||{})[a.type]||[],k=n.event.special[a.type]||{};if(i[0]=a,a.delegateTarget=this,!k.preDispatch||k.preDispatch.call(this,a)!==!1){h=n.event.handlers.call(this,a,j),b=0;while((f=h[b++])&&!a.isPropagationStopped()){a.currentTarget=f.elem,c=0;while((g=f.handlers[c++])&&!a.isImmediatePropagationStopped())a.rnamespace&&!a.rnamespace.test(g.namespace)||(a.handleObj=g,a.data=g.data,d=((n.event.special[g.origType]||{}).handle||g.handler).apply(f.elem,i),void 0!==d&&(a.result=d)===!1&&(a.preventDefault(),a.stopPropagation()))}return k.postDispatch&&k.postDispatch.call(this,a),a.result}},handlers:function(a,b){var c,d,e,f,g=[],h=b.delegateCount,i=a.target;if(h&&i.nodeType&&("click"!==a.type||isNaN(a.button)||a.button<1))for(;i!==this;i=i.parentNode||this)if(1===i.nodeType&&(i.disabled!==!0||"click"!==a.type)){for(d=[],c=0;h>c;c++)f=b[c],e=f.selector+" ",void 0===d[e]&&(d[e]=f.needsContext?n(e,this).index(i)>-1:n.find(e,this,null,[i]).length),d[e]&&d.push(f);d.length&&g.push({elem:i,handlers:d})}return h<b.length&&g.push({elem:this,handlers:b.slice(h)}),g},props:"altKey bubbles cancelable ctrlKey currentTarget detail eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "),fixHooks:{},keyHooks:{props:"char charCode key keyCode".split(" "),filter:function(a,b){return null==a.which&&(a.which=null!=b.charCode?b.charCode:b.keyCode),a}},mouseHooks:{props:"button buttons clientX clientY offsetX offsetY pageX pageY screenX screenY toElement".split(" "),filter:function(a,b){var c,e,f,g=b.button;return null==a.pageX&&null!=b.clientX&&(c=a.target.ownerDocument||d,e=c.documentElement,f=c.body,a.pageX=b.clientX+(e&&e.scrollLeft||f&&f.scrollLeft||0)-(e&&e.clientLeft||f&&f.clientLeft||0),a.pageY=b.clientY+(e&&e.scrollTop||f&&f.scrollTop||0)-(e&&e.clientTop||f&&f.clientTop||0)),a.which||void 0===g||(a.which=1&g?1:2&g?3:4&g?2:0),a}},fix:function(a){if(a[n.expando])return a;var b,c,e,f=a.type,g=a,h=this.fixHooks[f];h||(this.fixHooks[f]=h=ea.test(f)?this.mouseHooks:da.test(f)?this.keyHooks:{}),e=h.props?this.props.concat(h.props):this.props,a=new n.Event(g),b=e.length;while(b--)c=e[b],a[c]=g[c];return a.target||(a.target=d),3===a.target.nodeType&&(a.target=a.target.parentNode),h.filter?h.filter(a,g):a},special:{load:{noBubble:!0},focus:{trigger:function(){return this!==ia()&&this.focus?(this.focus(),!1):void 0},delegateType:"focusin"},blur:{trigger:function(){return this===ia()&&this.blur?(this.blur(),!1):void 0},delegateType:"focusout"},click:{trigger:function(){return"checkbox"===this.type&&this.click&&n.nodeName(this,"input")?(this.click(),!1):void 0},_default:function(a){return n.nodeName(a.target,"a")}},beforeunload:{postDispatch:function(a){void 0!==a.result&&a.originalEvent&&(a.originalEvent.returnValue=a.result)}}}},n.removeEvent=function(a,b,c){a.removeEventListener&&a.removeEventListener(b,c)},n.Event=function(a,b){return this instanceof n.Event?(a&&a.type?(this.originalEvent=a,this.type=a.type,this.isDefaultPrevented=a.defaultPrevented||void 0===a.defaultPrevented&&a.returnValue===!1?ga:ha):this.type=a,b&&n.extend(this,b),this.timeStamp=a&&a.timeStamp||n.now(),void(this[n.expando]=!0)):new n.Event(a,b)},n.Event.prototype={constructor:n.Event,isDefaultPrevented:ha,isPropagationStopped:ha,isImmediatePropagationStopped:ha,isSimulated:!1,preventDefault:function(){var a=this.originalEvent;this.isDefaultPrevented=ga,a&&!this.isSimulated&&a.preventDefault()},stopPropagation:function(){var a=this.originalEvent;this.isPropagationStopped=ga,a&&!this.isSimulated&&a.stopPropagation()},stopImmediatePropagation:function(){var a=this.originalEvent;this.isImmediatePropagationStopped=ga,a&&!this.isSimulated&&a.stopImmediatePropagation(),this.stopPropagation()}},n.each({mouseenter:"mouseover",mouseleave:"mouseout",pointerenter:"pointerover",pointerleave:"pointerout"},function(a,b){n.event.special[a]={delegateType:b,bindType:b,handle:function(a){var c,d=this,e=a.relatedTarget,f=a.handleObj;return e&&(e===d||n.contains(d,e))||(a.type=f.origType,c=f.handler.apply(this,arguments),a.type=b),c}}}),n.fn.extend({on:function(a,b,c,d){return ja(this,a,b,c,d)},one:function(a,b,c,d){return ja(this,a,b,c,d,1)},off:function(a,b,c){var d,e;if(a&&a.preventDefault&&a.handleObj)return d=a.handleObj,n(a.delegateTarget).off(d.namespace?d.origType+"."+d.namespace:d.origType,d.selector,d.handler),this;if("object"==typeof a){for(e in a)this.off(e,b,a[e]);return this}return b!==!1&&"function"!=typeof b||(c=b,b=void 0),c===!1&&(c=ha),this.each(function(){n.event.remove(this,a,c,b)})}});var ka=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:-]+)[^>]*)\/>/gi,la=/<script|<style|<link/i,ma=/checked\s*(?:[^=]|=\s*.checked.)/i,na=/^true\/(.*)/,oa=/^\s*<!(?:\[CDATA\[|--)|(?:\]\]|--)>\s*$/g;function pa(a,b){return n.nodeName(a,"table")&&n.nodeName(11!==b.nodeType?b:b.firstChild,"tr")?a.getElementsByTagName("tbody")[0]||a.appendChild(a.ownerDocument.createElement("tbody")):a}function qa(a){return a.type=(null!==a.getAttribute("type"))+"/"+a.type,a}function ra(a){var b=na.exec(a.type);return b?a.type=b[1]:a.removeAttribute("type"),a}function sa(a,b){var c,d,e,f,g,h,i,j;if(1===b.nodeType){if(N.hasData(a)&&(f=N.access(a),g=N.set(b,f),j=f.events)){delete g.handle,g.events={};for(e in j)for(c=0,d=j[e].length;d>c;c++)n.event.add(b,e,j[e][c])}O.hasData(a)&&(h=O.access(a),i=n.extend({},h),O.set(b,i))}}function ta(a,b){var c=b.nodeName.toLowerCase();"input"===c&&X.test(a.type)?b.checked=a.checked:"input"!==c&&"textarea"!==c||(b.defaultValue=a.defaultValue)}function ua(a,b,c,d){b=f.apply([],b);var e,g,h,i,j,k,m=0,o=a.length,p=o-1,q=b[0],r=n.isFunction(q);if(r||o>1&&"string"==typeof q&&!l.checkClone&&ma.test(q))return a.each(function(e){var f=a.eq(e);r&&(b[0]=q.call(this,e,f.html())),ua(f,b,c,d)});if(o&&(e=ca(b,a[0].ownerDocument,!1,a,d),g=e.firstChild,1===e.childNodes.length&&(e=g),g||d)){for(h=n.map(_(e,"script"),qa),i=h.length;o>m;m++)j=e,m!==p&&(j=n.clone(j,!0,!0),i&&n.merge(h,_(j,"script"))),c.call(a[m],j,m);if(i)for(k=h[h.length-1].ownerDocument,n.map(h,ra),m=0;i>m;m++)j=h[m],Z.test(j.type||"")&&!N.access(j,"globalEval")&&n.contains(k,j)&&(j.src?n._evalUrl&&n._evalUrl(j.src):n.globalEval(j.textContent.replace(oa,"")))}return a}function va(a,b,c){for(var d,e=b?n.filter(b,a):a,f=0;null!=(d=e[f]);f++)c||1!==d.nodeType||n.cleanData(_(d)),d.parentNode&&(c&&n.contains(d.ownerDocument,d)&&aa(_(d,"script")),d.parentNode.removeChild(d));return a}n.extend({htmlPrefilter:function(a){return a.replace(ka,"<$1></$2>")},clone:function(a,b,c){var d,e,f,g,h=a.cloneNode(!0),i=n.contains(a.ownerDocument,a);if(!(l.noCloneChecked||1!==a.nodeType&&11!==a.nodeType||n.isXMLDoc(a)))for(g=_(h),f=_(a),d=0,e=f.length;e>d;d++)ta(f[d],g[d]);if(b)if(c)for(f=f||_(a),g=g||_(h),d=0,e=f.length;e>d;d++)sa(f[d],g[d]);else sa(a,h);return g=_(h,"script"),g.length>0&&aa(g,!i&&_(a,"script")),h},cleanData:function(a){for(var b,c,d,e=n.event.special,f=0;void 0!==(c=a[f]);f++)if(L(c)){if(b=c[N.expando]){if(b.events)for(d in b.events)e[d]?n.event.remove(c,d):n.removeEvent(c,d,b.handle);c[N.expando]=void 0}c[O.expando]&&(c[O.expando]=void 0)}}}),n.fn.extend({domManip:ua,detach:function(a){return va(this,a,!0)},remove:function(a){return va(this,a)},text:function(a){return K(this,function(a){return void 0===a?n.text(this):this.empty().each(function(){1!==this.nodeType&&11!==this.nodeType&&9!==this.nodeType||(this.textContent=a)})},null,a,arguments.length)},append:function(){return ua(this,arguments,function(a){if(1===this.nodeType||11===this.nodeType||9===this.nodeType){var b=pa(this,a);b.appendChild(a)}})},prepend:function(){return ua(this,arguments,function(a){if(1===this.nodeType||11===this.nodeType||9===this.nodeType){var b=pa(this,a);b.insertBefore(a,b.firstChild)}})},before:function(){return ua(this,arguments,function(a){this.parentNode&&this.parentNode.insertBefore(a,this)})},after:function(){return ua(this,arguments,function(a){this.parentNode&&this.parentNode.insertBefore(a,this.nextSibling)})},empty:function(){for(var a,b=0;null!=(a=this[b]);b++)1===a.nodeType&&(n.cleanData(_(a,!1)),a.textContent="");return this},clone:function(a,b){return a=null==a?!1:a,b=null==b?a:b,this.map(function(){return n.clone(this,a,b)})},html:function(a){return K(this,function(a){var b=this[0]||{},c=0,d=this.length;if(void 0===a&&1===b.nodeType)return b.innerHTML;if("string"==typeof a&&!la.test(a)&&!$[(Y.exec(a)||["",""])[1].toLowerCase()]){a=n.htmlPrefilter(a);try{for(;d>c;c++)b=this[c]||{},1===b.nodeType&&(n.cleanData(_(b,!1)),b.innerHTML=a);b=0}catch(e){}}b&&this.empty().append(a)},null,a,arguments.length)},replaceWith:function(){var a=[];return ua(this,arguments,function(b){var c=this.parentNode;n.inArray(this,a)<0&&(n.cleanData(_(this)),c&&c.replaceChild(b,this))},a)}}),n.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(a,b){n.fn[a]=function(a){for(var c,d=[],e=n(a),f=e.length-1,h=0;f>=h;h++)c=h===f?this:this.clone(!0),n(e[h])[b](c),g.apply(d,c.get());return this.pushStack(d)}});var wa,xa={HTML:"block",BODY:"block"};function ya(a,b){var c=n(b.createElement(a)).appendTo(b.body),d=n.css(c[0],"display");return c.detach(),d}function za(a){var b=d,c=xa[a];return c||(c=ya(a,b),"none"!==c&&c||(wa=(wa||n("<iframe frameborder='0' width='0' height='0'/>")).appendTo(b.documentElement),b=wa[0].contentDocument,b.write(),b.close(),c=ya(a,b),wa.detach()),xa[a]=c),c}var Aa=/^margin/,Ba=new RegExp("^("+S+")(?!px)[a-z%]+$","i"),Ca=function(b){var c=b.ownerDocument.defaultView;return c&&c.opener||(c=a),c.getComputedStyle(b)},Da=function(a,b,c,d){var e,f,g={};for(f in b)g[f]=a.style[f],a.style[f]=b[f];e=c.apply(a,d||[]);for(f in b)a.style[f]=g[f];return e},Ea=d.documentElement;!function(){var b,c,e,f,g=d.createElement("div"),h=d.createElement("div");if(h.style){h.style.backgroundClip="content-box",h.cloneNode(!0).style.backgroundClip="",l.clearCloneStyle="content-box"===h.style.backgroundClip,g.style.cssText="border:0;width:8px;height:0;top:0;left:-9999px;padding:0;margin-top:1px;position:absolute",g.appendChild(h);function i(){h.style.cssText="-webkit-box-sizing:border-box;-moz-box-sizing:border-box;box-sizing:border-box;position:relative;display:block;margin:auto;border:1px;padding:1px;top:1%;width:50%",h.innerHTML="",Ea.appendChild(g);var d=a.getComputedStyle(h);b="1%"!==d.top,f="2px"===d.marginLeft,c="4px"===d.width,h.style.marginRight="50%",e="4px"===d.marginRight,Ea.removeChild(g)}n.extend(l,{pixelPosition:function(){return i(),b},boxSizingReliable:function(){return null==c&&i(),c},pixelMarginRight:function(){return null==c&&i(),e},reliableMarginLeft:function(){return null==c&&i(),f},reliableMarginRight:function(){var b,c=h.appendChild(d.createElement("div"));return c.style.cssText=h.style.cssText="-webkit-box-sizing:content-box;box-sizing:content-box;display:block;margin:0;border:0;padding:0",c.style.marginRight=c.style.width="0",h.style.width="1px",Ea.appendChild(g),b=!parseFloat(a.getComputedStyle(c).marginRight),Ea.removeChild(g),h.removeChild(c),b}})}}();function Fa(a,b,c){var d,e,f,g,h=a.style;return c=c||Ca(a),g=c?c.getPropertyValue(b)||c[b]:void 0,""!==g&&void 0!==g||n.contains(a.ownerDocument,a)||(g=n.style(a,b)),c&&!l.pixelMarginRight()&&Ba.test(g)&&Aa.test(b)&&(d=h.width,e=h.minWidth,f=h.maxWidth,h.minWidth=h.maxWidth=h.width=g,g=c.width,h.width=d,h.minWidth=e,h.maxWidth=f),void 0!==g?g+"":g}function Ga(a,b){return{get:function(){return a()?void delete this.get:(this.get=b).apply(this,arguments)}}}var Ha=/^(none|table(?!-c[ea]).+)/,Ia={position:"absolute",visibility:"hidden",display:"block"},Ja={letterSpacing:"0",fontWeight:"400"},Ka=["Webkit","O","Moz","ms"],La=d.createElement("div").style;function Ma(a){if(a in La)return a;var b=a[0].toUpperCase()+a.slice(1),c=Ka.length;while(c--)if(a=Ka[c]+b,a in La)return a}function Na(a,b,c){var d=T.exec(b);return d?Math.max(0,d[2]-(c||0))+(d[3]||"px"):b}function Oa(a,b,c,d,e){for(var f=c===(d?"border":"content")?4:"width"===b?1:0,g=0;4>f;f+=2)"margin"===c&&(g+=n.css(a,c+U[f],!0,e)),d?("content"===c&&(g-=n.css(a,"padding"+U[f],!0,e)),"margin"!==c&&(g-=n.css(a,"border"+U[f]+"Width",!0,e))):(g+=n.css(a,"padding"+U[f],!0,e),"padding"!==c&&(g+=n.css(a,"border"+U[f]+"Width",!0,e)));return g}function Pa(a,b,c){var d=!0,e="width"===b?a.offsetWidth:a.offsetHeight,f=Ca(a),g="border-box"===n.css(a,"boxSizing",!1,f);if(0>=e||null==e){if(e=Fa(a,b,f),(0>e||null==e)&&(e=a.style[b]),Ba.test(e))return e;d=g&&(l.boxSizingReliable()||e===a.style[b]),e=parseFloat(e)||0}return e+Oa(a,b,c||(g?"border":"content"),d,f)+"px"}function Qa(a,b){for(var c,d,e,f=[],g=0,h=a.length;h>g;g++)d=a[g],d.style&&(f[g]=N.get(d,"olddisplay"),c=d.style.display,b?(f[g]||"none"!==c||(d.style.display=""),""===d.style.display&&V(d)&&(f[g]=N.access(d,"olddisplay",za(d.nodeName)))):(e=V(d),"none"===c&&e||N.set(d,"olddisplay",e?c:n.css(d,"display"))));for(g=0;h>g;g++)d=a[g],d.style&&(b&&"none"!==d.style.display&&""!==d.style.display||(d.style.display=b?f[g]||"":"none"));return a}n.extend({cssHooks:{opacity:{get:function(a,b){if(b){var c=Fa(a,"opacity");return""===c?"1":c}}}},cssNumber:{animationIterationCount:!0,columnCount:!0,fillOpacity:!0,flexGrow:!0,flexShrink:!0,fontWeight:!0,lineHeight:!0,opacity:!0,order:!0,orphans:!0,widows:!0,zIndex:!0,zoom:!0},cssProps:{"float":"cssFloat"},style:function(a,b,c,d){if(a&&3!==a.nodeType&&8!==a.nodeType&&a.style){var e,f,g,h=n.camelCase(b),i=a.style;return b=n.cssProps[h]||(n.cssProps[h]=Ma(h)||h),g=n.cssHooks[b]||n.cssHooks[h],void 0===c?g&&"get"in g&&void 0!==(e=g.get(a,!1,d))?e:i[b]:(f=typeof c,"string"===f&&(e=T.exec(c))&&e[1]&&(c=W(a,b,e),f="number"),null!=c&&c===c&&("number"===f&&(c+=e&&e[3]||(n.cssNumber[h]?"":"px")),l.clearCloneStyle||""!==c||0!==b.indexOf("background")||(i[b]="inherit"),g&&"set"in g&&void 0===(c=g.set(a,c,d))||(i[b]=c)),void 0)}},css:function(a,b,c,d){var e,f,g,h=n.camelCase(b);return b=n.cssProps[h]||(n.cssProps[h]=Ma(h)||h),g=n.cssHooks[b]||n.cssHooks[h],g&&"get"in g&&(e=g.get(a,!0,c)),void 0===e&&(e=Fa(a,b,d)),"normal"===e&&b in Ja&&(e=Ja[b]),""===c||c?(f=parseFloat(e),c===!0||isFinite(f)?f||0:e):e}}),n.each(["height","width"],function(a,b){n.cssHooks[b]={get:function(a,c,d){return c?Ha.test(n.css(a,"display"))&&0===a.offsetWidth?Da(a,Ia,function(){return Pa(a,b,d)}):Pa(a,b,d):void 0},set:function(a,c,d){var e,f=d&&Ca(a),g=d&&Oa(a,b,d,"border-box"===n.css(a,"boxSizing",!1,f),f);return g&&(e=T.exec(c))&&"px"!==(e[3]||"px")&&(a.style[b]=c,c=n.css(a,b)),Na(a,c,g)}}}),n.cssHooks.marginLeft=Ga(l.reliableMarginLeft,function(a,b){return b?(parseFloat(Fa(a,"marginLeft"))||a.getBoundingClientRect().left-Da(a,{marginLeft:0},function(){return a.getBoundingClientRect().left}))+"px":void 0}),n.cssHooks.marginRight=Ga(l.reliableMarginRight,function(a,b){return b?Da(a,{display:"inline-block"},Fa,[a,"marginRight"]):void 0}),n.each({margin:"",padding:"",border:"Width"},function(a,b){n.cssHooks[a+b]={expand:function(c){for(var d=0,e={},f="string"==typeof c?c.split(" "):[c];4>d;d++)e[a+U[d]+b]=f[d]||f[d-2]||f[0];return e}},Aa.test(a)||(n.cssHooks[a+b].set=Na)}),n.fn.extend({css:function(a,b){return K(this,function(a,b,c){var d,e,f={},g=0;if(n.isArray(b)){for(d=Ca(a),e=b.length;e>g;g++)f[b[g]]=n.css(a,b[g],!1,d);return f}return void 0!==c?n.style(a,b,c):n.css(a,b)},a,b,arguments.length>1)},show:function(){return Qa(this,!0)},hide:function(){return Qa(this)},toggle:function(a){return"boolean"==typeof a?a?this.show():this.hide():this.each(function(){V(this)?n(this).show():n(this).hide()})}});function Ra(a,b,c,d,e){return new Ra.prototype.init(a,b,c,d,e)}n.Tween=Ra,Ra.prototype={constructor:Ra,init:function(a,b,c,d,e,f){this.elem=a,this.prop=c,this.easing=e||n.easing._default,this.options=b,this.start=this.now=this.cur(),this.end=d,this.unit=f||(n.cssNumber[c]?"":"px")},cur:function(){var a=Ra.propHooks[this.prop];return a&&a.get?a.get(this):Ra.propHooks._default.get(this)},run:function(a){var b,c=Ra.propHooks[this.prop];return this.options.duration?this.pos=b=n.easing[this.easing](a,this.options.duration*a,0,1,this.options.duration):this.pos=b=a,this.now=(this.end-this.start)*b+this.start,this.options.step&&this.options.step.call(this.elem,this.now,this),c&&c.set?c.set(this):Ra.propHooks._default.set(this),this}},Ra.prototype.init.prototype=Ra.prototype,Ra.propHooks={_default:{get:function(a){var b;return 1!==a.elem.nodeType||null!=a.elem[a.prop]&&null==a.elem.style[a.prop]?a.elem[a.prop]:(b=n.css(a.elem,a.prop,""),b&&"auto"!==b?b:0)},set:function(a){n.fx.step[a.prop]?n.fx.step[a.prop](a):1!==a.elem.nodeType||null==a.elem.style[n.cssProps[a.prop]]&&!n.cssHooks[a.prop]?a.elem[a.prop]=a.now:n.style(a.elem,a.prop,a.now+a.unit)}}},Ra.propHooks.scrollTop=Ra.propHooks.scrollLeft={set:function(a){a.elem.nodeType&&a.elem.parentNode&&(a.elem[a.prop]=a.now)}},n.easing={linear:function(a){return a},swing:function(a){return.5-Math.cos(a*Math.PI)/2},_default:"swing"},n.fx=Ra.prototype.init,n.fx.step={};var Sa,Ta,Ua=/^(?:toggle|show|hide)$/,Va=/queueHooks$/;function Wa(){return a.setTimeout(function(){Sa=void 0}),Sa=n.now()}function Xa(a,b){var c,d=0,e={height:a};for(b=b?1:0;4>d;d+=2-b)c=U[d],e["margin"+c]=e["padding"+c]=a;return b&&(e.opacity=e.width=a),e}function Ya(a,b,c){for(var d,e=(_a.tweeners[b]||[]).concat(_a.tweeners["*"]),f=0,g=e.length;g>f;f++)if(d=e[f].call(c,b,a))return d}function Za(a,b,c){var d,e,f,g,h,i,j,k,l=this,m={},o=a.style,p=a.nodeType&&V(a),q=N.get(a,"fxshow");c.queue||(h=n._queueHooks(a,"fx"),null==h.unqueued&&(h.unqueued=0,i=h.empty.fire,h.empty.fire=function(){h.unqueued||i()}),h.unqueued++,l.always(function(){l.always(function(){h.unqueued--,n.queue(a,"fx").length||h.empty.fire()})})),1===a.nodeType&&("height"in b||"width"in b)&&(c.overflow=[o.overflow,o.overflowX,o.overflowY],j=n.css(a,"display"),k="none"===j?N.get(a,"olddisplay")||za(a.nodeName):j,"inline"===k&&"none"===n.css(a,"float")&&(o.display="inline-block")),c.overflow&&(o.overflow="hidden",l.always(function(){o.overflow=c.overflow[0],o.overflowX=c.overflow[1],o.overflowY=c.overflow[2]}));for(d in b)if(e=b[d],Ua.exec(e)){if(delete b[d],f=f||"toggle"===e,e===(p?"hide":"show")){if("show"!==e||!q||void 0===q[d])continue;p=!0}m[d]=q&&q[d]||n.style(a,d)}else j=void 0;if(n.isEmptyObject(m))"inline"===("none"===j?za(a.nodeName):j)&&(o.display=j);else{q?"hidden"in q&&(p=q.hidden):q=N.access(a,"fxshow",{}),f&&(q.hidden=!p),p?n(a).show():l.done(function(){n(a).hide()}),l.done(function(){var b;N.remove(a,"fxshow");for(b in m)n.style(a,b,m[b])});for(d in m)g=Ya(p?q[d]:0,d,l),d in q||(q[d]=g.start,p&&(g.end=g.start,g.start="width"===d||"height"===d?1:0))}}function $a(a,b){var c,d,e,f,g;for(c in a)if(d=n.camelCase(c),e=b[d],f=a[c],n.isArray(f)&&(e=f[1],f=a[c]=f[0]),c!==d&&(a[d]=f,delete a[c]),g=n.cssHooks[d],g&&"expand"in g){f=g.expand(f),delete a[d];for(c in f)c in a||(a[c]=f[c],b[c]=e)}else b[d]=e}function _a(a,b,c){var d,e,f=0,g=_a.prefilters.length,h=n.Deferred().always(function(){delete i.elem}),i=function(){if(e)return!1;for(var b=Sa||Wa(),c=Math.max(0,j.startTime+j.duration-b),d=c/j.duration||0,f=1-d,g=0,i=j.tweens.length;i>g;g++)j.tweens[g].run(f);return h.notifyWith(a,[j,f,c]),1>f&&i?c:(h.resolveWith(a,[j]),!1)},j=h.promise({elem:a,props:n.extend({},b),opts:n.extend(!0,{specialEasing:{},easing:n.easing._default},c),originalProperties:b,originalOptions:c,startTime:Sa||Wa(),duration:c.duration,tweens:[],createTween:function(b,c){var d=n.Tween(a,j.opts,b,c,j.opts.specialEasing[b]||j.opts.easing);return j.tweens.push(d),d},stop:function(b){var c=0,d=b?j.tweens.length:0;if(e)return this;for(e=!0;d>c;c++)j.tweens[c].run(1);return b?(h.notifyWith(a,[j,1,0]),h.resolveWith(a,[j,b])):h.rejectWith(a,[j,b]),this}}),k=j.props;for($a(k,j.opts.specialEasing);g>f;f++)if(d=_a.prefilters[f].call(j,a,k,j.opts))return n.isFunction(d.stop)&&(n._queueHooks(j.elem,j.opts.queue).stop=n.proxy(d.stop,d)),d;return n.map(k,Ya,j),n.isFunction(j.opts.start)&&j.opts.start.call(a,j),n.fx.timer(n.extend(i,{elem:a,anim:j,queue:j.opts.queue})),j.progress(j.opts.progress).done(j.opts.done,j.opts.complete).fail(j.opts.fail).always(j.opts.always)}n.Animation=n.extend(_a,{tweeners:{"*":[function(a,b){var c=this.createTween(a,b);return W(c.elem,a,T.exec(b),c),c}]},tweener:function(a,b){n.isFunction(a)?(b=a,a=["*"]):a=a.match(G);for(var c,d=0,e=a.length;e>d;d++)c=a[d],_a.tweeners[c]=_a.tweeners[c]||[],_a.tweeners[c].unshift(b)},prefilters:[Za],prefilter:function(a,b){b?_a.prefilters.unshift(a):_a.prefilters.push(a)}}),n.speed=function(a,b,c){var d=a&&"object"==typeof a?n.extend({},a):{complete:c||!c&&b||n.isFunction(a)&&a,duration:a,easing:c&&b||b&&!n.isFunction(b)&&b};return d.duration=n.fx.off?0:"number"==typeof d.duration?d.duration:d.duration in n.fx.speeds?n.fx.speeds[d.duration]:n.fx.speeds._default,null!=d.queue&&d.queue!==!0||(d.queue="fx"),d.old=d.complete,d.complete=function(){n.isFunction(d.old)&&d.old.call(this),d.queue&&n.dequeue(this,d.queue)},d},n.fn.extend({fadeTo:function(a,b,c,d){return this.filter(V).css("opacity",0).show().end().animate({opacity:b},a,c,d)},animate:function(a,b,c,d){var e=n.isEmptyObject(a),f=n.speed(b,c,d),g=function(){var b=_a(this,n.extend({},a),f);(e||N.get(this,"finish"))&&b.stop(!0)};return g.finish=g,e||f.queue===!1?this.each(g):this.queue(f.queue,g)},stop:function(a,b,c){var d=function(a){var b=a.stop;delete a.stop,b(c)};return"string"!=typeof a&&(c=b,b=a,a=void 0),b&&a!==!1&&this.queue(a||"fx",[]),this.each(function(){var b=!0,e=null!=a&&a+"queueHooks",f=n.timers,g=N.get(this);if(e)g[e]&&g[e].stop&&d(g[e]);else for(e in g)g[e]&&g[e].stop&&Va.test(e)&&d(g[e]);for(e=f.length;e--;)f[e].elem!==this||null!=a&&f[e].queue!==a||(f[e].anim.stop(c),b=!1,f.splice(e,1));!b&&c||n.dequeue(this,a)})},finish:function(a){return a!==!1&&(a=a||"fx"),this.each(function(){var b,c=N.get(this),d=c[a+"queue"],e=c[a+"queueHooks"],f=n.timers,g=d?d.length:0;for(c.finish=!0,n.queue(this,a,[]),e&&e.stop&&e.stop.call(this,!0),b=f.length;b--;)f[b].elem===this&&f[b].queue===a&&(f[b].anim.stop(!0),f.splice(b,1));for(b=0;g>b;b++)d[b]&&d[b].finish&&d[b].finish.call(this);delete c.finish})}}),n.each(["toggle","show","hide"],function(a,b){var c=n.fn[b];n.fn[b]=function(a,d,e){return null==a||"boolean"==typeof a?c.apply(this,arguments):this.animate(Xa(b,!0),a,d,e)}}),n.each({slideDown:Xa("show"),slideUp:Xa("hide"),slideToggle:Xa("toggle"),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"},fadeToggle:{opacity:"toggle"}},function(a,b){n.fn[a]=function(a,c,d){return this.animate(b,a,c,d)}}),n.timers=[],n.fx.tick=function(){var a,b=0,c=n.timers;for(Sa=n.now();b<c.length;b++)a=c[b],a()||c[b]!==a||c.splice(b--,1);c.length||n.fx.stop(),Sa=void 0},n.fx.timer=function(a){n.timers.push(a),a()?n.fx.start():n.timers.pop()},n.fx.interval=13,n.fx.start=function(){Ta||(Ta=a.setInterval(n.fx.tick,n.fx.interval))},n.fx.stop=function(){a.clearInterval(Ta),Ta=null},n.fx.speeds={slow:600,fast:200,_default:400},n.fn.delay=function(b,c){return b=n.fx?n.fx.speeds[b]||b:b,c=c||"fx",this.queue(c,function(c,d){var e=a.setTimeout(c,b);d.stop=function(){a.clearTimeout(e)}})},function(){var a=d.createElement("input"),b=d.createElement("select"),c=b.appendChild(d.createElement("option"));a.type="checkbox",l.checkOn=""!==a.value,l.optSelected=c.selected,b.disabled=!0,l.optDisabled=!c.disabled,a=d.createElement("input"),a.value="t",a.type="radio",l.radioValue="t"===a.value}();var ab,bb=n.expr.attrHandle;n.fn.extend({attr:function(a,b){return K(this,n.attr,a,b,arguments.length>1)},removeAttr:function(a){return this.each(function(){n.removeAttr(this,a)})}}),n.extend({attr:function(a,b,c){var d,e,f=a.nodeType;if(3!==f&&8!==f&&2!==f)return"undefined"==typeof a.getAttribute?n.prop(a,b,c):(1===f&&n.isXMLDoc(a)||(b=b.toLowerCase(),e=n.attrHooks[b]||(n.expr.match.bool.test(b)?ab:void 0)),void 0!==c?null===c?void n.removeAttr(a,b):e&&"set"in e&&void 0!==(d=e.set(a,c,b))?d:(a.setAttribute(b,c+""),c):e&&"get"in e&&null!==(d=e.get(a,b))?d:(d=n.find.attr(a,b),null==d?void 0:d))},attrHooks:{type:{set:function(a,b){if(!l.radioValue&&"radio"===b&&n.nodeName(a,"input")){var c=a.value;return a.setAttribute("type",b),c&&(a.value=c),b}}}},removeAttr:function(a,b){var c,d,e=0,f=b&&b.match(G);if(f&&1===a.nodeType)while(c=f[e++])d=n.propFix[c]||c,n.expr.match.bool.test(c)&&(a[d]=!1),a.removeAttribute(c)}}),ab={set:function(a,b,c){return b===!1?n.removeAttr(a,c):a.setAttribute(c,c),c}},n.each(n.expr.match.bool.source.match(/\w+/g),function(a,b){var c=bb[b]||n.find.attr;bb[b]=function(a,b,d){var e,f;return d||(f=bb[b],bb[b]=e,e=null!=c(a,b,d)?b.toLowerCase():null,bb[b]=f),e}});var cb=/^(?:input|select|textarea|button)$/i,db=/^(?:a|area)$/i;n.fn.extend({prop:function(a,b){return K(this,n.prop,a,b,arguments.length>1)},removeProp:function(a){return this.each(function(){delete this[n.propFix[a]||a]})}}),n.extend({prop:function(a,b,c){var d,e,f=a.nodeType;if(3!==f&&8!==f&&2!==f)return 1===f&&n.isXMLDoc(a)||(b=n.propFix[b]||b,e=n.propHooks[b]), |
| | | void 0!==c?e&&"set"in e&&void 0!==(d=e.set(a,c,b))?d:a[b]=c:e&&"get"in e&&null!==(d=e.get(a,b))?d:a[b]},propHooks:{tabIndex:{get:function(a){var b=n.find.attr(a,"tabindex");return b?parseInt(b,10):cb.test(a.nodeName)||db.test(a.nodeName)&&a.href?0:-1}}},propFix:{"for":"htmlFor","class":"className"}}),l.optSelected||(n.propHooks.selected={get:function(a){var b=a.parentNode;return b&&b.parentNode&&b.parentNode.selectedIndex,null},set:function(a){var b=a.parentNode;b&&(b.selectedIndex,b.parentNode&&b.parentNode.selectedIndex)}}),n.each(["tabIndex","readOnly","maxLength","cellSpacing","cellPadding","rowSpan","colSpan","useMap","frameBorder","contentEditable"],function(){n.propFix[this.toLowerCase()]=this});var eb=/[\t\r\n\f]/g;function fb(a){return a.getAttribute&&a.getAttribute("class")||""}n.fn.extend({addClass:function(a){var b,c,d,e,f,g,h,i=0;if(n.isFunction(a))return this.each(function(b){n(this).addClass(a.call(this,b,fb(this)))});if("string"==typeof a&&a){b=a.match(G)||[];while(c=this[i++])if(e=fb(c),d=1===c.nodeType&&(" "+e+" ").replace(eb," ")){g=0;while(f=b[g++])d.indexOf(" "+f+" ")<0&&(d+=f+" ");h=n.trim(d),e!==h&&c.setAttribute("class",h)}}return this},removeClass:function(a){var b,c,d,e,f,g,h,i=0;if(n.isFunction(a))return this.each(function(b){n(this).removeClass(a.call(this,b,fb(this)))});if(!arguments.length)return this.attr("class","");if("string"==typeof a&&a){b=a.match(G)||[];while(c=this[i++])if(e=fb(c),d=1===c.nodeType&&(" "+e+" ").replace(eb," ")){g=0;while(f=b[g++])while(d.indexOf(" "+f+" ")>-1)d=d.replace(" "+f+" "," ");h=n.trim(d),e!==h&&c.setAttribute("class",h)}}return this},toggleClass:function(a,b){var c=typeof a;return"boolean"==typeof b&&"string"===c?b?this.addClass(a):this.removeClass(a):n.isFunction(a)?this.each(function(c){n(this).toggleClass(a.call(this,c,fb(this),b),b)}):this.each(function(){var b,d,e,f;if("string"===c){d=0,e=n(this),f=a.match(G)||[];while(b=f[d++])e.hasClass(b)?e.removeClass(b):e.addClass(b)}else void 0!==a&&"boolean"!==c||(b=fb(this),b&&N.set(this,"__className__",b),this.setAttribute&&this.setAttribute("class",b||a===!1?"":N.get(this,"__className__")||""))})},hasClass:function(a){var b,c,d=0;b=" "+a+" ";while(c=this[d++])if(1===c.nodeType&&(" "+fb(c)+" ").replace(eb," ").indexOf(b)>-1)return!0;return!1}});var gb=/\r/g,hb=/[\x20\t\r\n\f]+/g;n.fn.extend({val:function(a){var b,c,d,e=this[0];{if(arguments.length)return d=n.isFunction(a),this.each(function(c){var e;1===this.nodeType&&(e=d?a.call(this,c,n(this).val()):a,null==e?e="":"number"==typeof e?e+="":n.isArray(e)&&(e=n.map(e,function(a){return null==a?"":a+""})),b=n.valHooks[this.type]||n.valHooks[this.nodeName.toLowerCase()],b&&"set"in b&&void 0!==b.set(this,e,"value")||(this.value=e))});if(e)return b=n.valHooks[e.type]||n.valHooks[e.nodeName.toLowerCase()],b&&"get"in b&&void 0!==(c=b.get(e,"value"))?c:(c=e.value,"string"==typeof c?c.replace(gb,""):null==c?"":c)}}}),n.extend({valHooks:{option:{get:function(a){var b=n.find.attr(a,"value");return null!=b?b:n.trim(n.text(a)).replace(hb," ")}},select:{get:function(a){for(var b,c,d=a.options,e=a.selectedIndex,f="select-one"===a.type||0>e,g=f?null:[],h=f?e+1:d.length,i=0>e?h:f?e:0;h>i;i++)if(c=d[i],(c.selected||i===e)&&(l.optDisabled?!c.disabled:null===c.getAttribute("disabled"))&&(!c.parentNode.disabled||!n.nodeName(c.parentNode,"optgroup"))){if(b=n(c).val(),f)return b;g.push(b)}return g},set:function(a,b){var c,d,e=a.options,f=n.makeArray(b),g=e.length;while(g--)d=e[g],(d.selected=n.inArray(n.valHooks.option.get(d),f)>-1)&&(c=!0);return c||(a.selectedIndex=-1),f}}}}),n.each(["radio","checkbox"],function(){n.valHooks[this]={set:function(a,b){return n.isArray(b)?a.checked=n.inArray(n(a).val(),b)>-1:void 0}},l.checkOn||(n.valHooks[this].get=function(a){return null===a.getAttribute("value")?"on":a.value})});var ib=/^(?:focusinfocus|focusoutblur)$/;n.extend(n.event,{trigger:function(b,c,e,f){var g,h,i,j,l,m,o,p=[e||d],q=k.call(b,"type")?b.type:b,r=k.call(b,"namespace")?b.namespace.split("."):[];if(h=i=e=e||d,3!==e.nodeType&&8!==e.nodeType&&!ib.test(q+n.event.triggered)&&(q.indexOf(".")>-1&&(r=q.split("."),q=r.shift(),r.sort()),l=q.indexOf(":")<0&&"on"+q,b=b[n.expando]?b:new n.Event(q,"object"==typeof b&&b),b.isTrigger=f?2:3,b.namespace=r.join("."),b.rnamespace=b.namespace?new RegExp("(^|\\.)"+r.join("\\.(?:.*\\.|)")+"(\\.|$)"):null,b.result=void 0,b.target||(b.target=e),c=null==c?[b]:n.makeArray(c,[b]),o=n.event.special[q]||{},f||!o.trigger||o.trigger.apply(e,c)!==!1)){if(!f&&!o.noBubble&&!n.isWindow(e)){for(j=o.delegateType||q,ib.test(j+q)||(h=h.parentNode);h;h=h.parentNode)p.push(h),i=h;i===(e.ownerDocument||d)&&p.push(i.defaultView||i.parentWindow||a)}g=0;while((h=p[g++])&&!b.isPropagationStopped())b.type=g>1?j:o.bindType||q,m=(N.get(h,"events")||{})[b.type]&&N.get(h,"handle"),m&&m.apply(h,c),m=l&&h[l],m&&m.apply&&L(h)&&(b.result=m.apply(h,c),b.result===!1&&b.preventDefault());return b.type=q,f||b.isDefaultPrevented()||o._default&&o._default.apply(p.pop(),c)!==!1||!L(e)||l&&n.isFunction(e[q])&&!n.isWindow(e)&&(i=e[l],i&&(e[l]=null),n.event.triggered=q,e[q](),n.event.triggered=void 0,i&&(e[l]=i)),b.result}},simulate:function(a,b,c){var d=n.extend(new n.Event,c,{type:a,isSimulated:!0});n.event.trigger(d,null,b)}}),n.fn.extend({trigger:function(a,b){return this.each(function(){n.event.trigger(a,b,this)})},triggerHandler:function(a,b){var c=this[0];return c?n.event.trigger(a,b,c,!0):void 0}}),n.each("blur focus focusin focusout load resize scroll unload click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup error contextmenu".split(" "),function(a,b){n.fn[b]=function(a,c){return arguments.length>0?this.on(b,null,a,c):this.trigger(b)}}),n.fn.extend({hover:function(a,b){return this.mouseenter(a).mouseleave(b||a)}}),l.focusin="onfocusin"in a,l.focusin||n.each({focus:"focusin",blur:"focusout"},function(a,b){var c=function(a){n.event.simulate(b,a.target,n.event.fix(a))};n.event.special[b]={setup:function(){var d=this.ownerDocument||this,e=N.access(d,b);e||d.addEventListener(a,c,!0),N.access(d,b,(e||0)+1)},teardown:function(){var d=this.ownerDocument||this,e=N.access(d,b)-1;e?N.access(d,b,e):(d.removeEventListener(a,c,!0),N.remove(d,b))}}});var jb=a.location,kb=n.now(),lb=/\?/;n.parseJSON=function(a){return JSON.parse(a+"")},n.parseXML=function(b){var c;if(!b||"string"!=typeof b)return null;try{c=(new a.DOMParser).parseFromString(b,"text/xml")}catch(d){c=void 0}return c&&!c.getElementsByTagName("parsererror").length||n.error("Invalid XML: "+b),c};var mb=/#.*$/,nb=/([?&])_=[^&]*/,ob=/^(.*?):[ \t]*([^\r\n]*)$/gm,pb=/^(?:about|app|app-storage|.+-extension|file|res|widget):$/,qb=/^(?:GET|HEAD)$/,rb=/^\/\//,sb={},tb={},ub="*/".concat("*"),vb=d.createElement("a");vb.href=jb.href;function wb(a){return function(b,c){"string"!=typeof b&&(c=b,b="*");var d,e=0,f=b.toLowerCase().match(G)||[];if(n.isFunction(c))while(d=f[e++])"+"===d[0]?(d=d.slice(1)||"*",(a[d]=a[d]||[]).unshift(c)):(a[d]=a[d]||[]).push(c)}}function xb(a,b,c,d){var e={},f=a===tb;function g(h){var i;return e[h]=!0,n.each(a[h]||[],function(a,h){var j=h(b,c,d);return"string"!=typeof j||f||e[j]?f?!(i=j):void 0:(b.dataTypes.unshift(j),g(j),!1)}),i}return g(b.dataTypes[0])||!e["*"]&&g("*")}function yb(a,b){var c,d,e=n.ajaxSettings.flatOptions||{};for(c in b)void 0!==b[c]&&((e[c]?a:d||(d={}))[c]=b[c]);return d&&n.extend(!0,a,d),a}function zb(a,b,c){var d,e,f,g,h=a.contents,i=a.dataTypes;while("*"===i[0])i.shift(),void 0===d&&(d=a.mimeType||b.getResponseHeader("Content-Type"));if(d)for(e in h)if(h[e]&&h[e].test(d)){i.unshift(e);break}if(i[0]in c)f=i[0];else{for(e in c){if(!i[0]||a.converters[e+" "+i[0]]){f=e;break}g||(g=e)}f=f||g}return f?(f!==i[0]&&i.unshift(f),c[f]):void 0}function Ab(a,b,c,d){var e,f,g,h,i,j={},k=a.dataTypes.slice();if(k[1])for(g in a.converters)j[g.toLowerCase()]=a.converters[g];f=k.shift();while(f)if(a.responseFields[f]&&(c[a.responseFields[f]]=b),!i&&d&&a.dataFilter&&(b=a.dataFilter(b,a.dataType)),i=f,f=k.shift())if("*"===f)f=i;else if("*"!==i&&i!==f){if(g=j[i+" "+f]||j["* "+f],!g)for(e in j)if(h=e.split(" "),h[1]===f&&(g=j[i+" "+h[0]]||j["* "+h[0]])){g===!0?g=j[e]:j[e]!==!0&&(f=h[0],k.unshift(h[1]));break}if(g!==!0)if(g&&a["throws"])b=g(b);else try{b=g(b)}catch(l){return{state:"parsererror",error:g?l:"No conversion from "+i+" to "+f}}}return{state:"success",data:b}}n.extend({active:0,lastModified:{},etag:{},ajaxSettings:{url:jb.href,type:"GET",isLocal:pb.test(jb.protocol),global:!0,processData:!0,async:!0,contentType:"application/x-www-form-urlencoded; charset=UTF-8",accepts:{"*":ub,text:"text/plain",html:"text/html",xml:"application/xml, text/xml",json:"application/json, text/javascript"},contents:{xml:/\bxml\b/,html:/\bhtml/,json:/\bjson\b/},responseFields:{xml:"responseXML",text:"responseText",json:"responseJSON"},converters:{"* text":String,"text html":!0,"text json":n.parseJSON,"text xml":n.parseXML},flatOptions:{url:!0,context:!0}},ajaxSetup:function(a,b){return b?yb(yb(a,n.ajaxSettings),b):yb(n.ajaxSettings,a)},ajaxPrefilter:wb(sb),ajaxTransport:wb(tb),ajax:function(b,c){"object"==typeof b&&(c=b,b=void 0),c=c||{};var e,f,g,h,i,j,k,l,m=n.ajaxSetup({},c),o=m.context||m,p=m.context&&(o.nodeType||o.jquery)?n(o):n.event,q=n.Deferred(),r=n.Callbacks("once memory"),s=m.statusCode||{},t={},u={},v=0,w="canceled",x={readyState:0,getResponseHeader:function(a){var b;if(2===v){if(!h){h={};while(b=ob.exec(g))h[b[1].toLowerCase()]=b[2]}b=h[a.toLowerCase()]}return null==b?null:b},getAllResponseHeaders:function(){return 2===v?g:null},setRequestHeader:function(a,b){var c=a.toLowerCase();return v||(a=u[c]=u[c]||a,t[a]=b),this},overrideMimeType:function(a){return v||(m.mimeType=a),this},statusCode:function(a){var b;if(a)if(2>v)for(b in a)s[b]=[s[b],a[b]];else x.always(a[x.status]);return this},abort:function(a){var b=a||w;return e&&e.abort(b),z(0,b),this}};if(q.promise(x).complete=r.add,x.success=x.done,x.error=x.fail,m.url=((b||m.url||jb.href)+"").replace(mb,"").replace(rb,jb.protocol+"//"),m.type=c.method||c.type||m.method||m.type,m.dataTypes=n.trim(m.dataType||"*").toLowerCase().match(G)||[""],null==m.crossDomain){j=d.createElement("a");try{j.href=m.url,j.href=j.href,m.crossDomain=vb.protocol+"//"+vb.host!=j.protocol+"//"+j.host}catch(y){m.crossDomain=!0}}if(m.data&&m.processData&&"string"!=typeof m.data&&(m.data=n.param(m.data,m.traditional)),xb(sb,m,c,x),2===v)return x;k=n.event&&m.global,k&&0===n.active++&&n.event.trigger("ajaxStart"),m.type=m.type.toUpperCase(),m.hasContent=!qb.test(m.type),f=m.url,m.hasContent||(m.data&&(f=m.url+=(lb.test(f)?"&":"?")+m.data,delete m.data),m.cache===!1&&(m.url=nb.test(f)?f.replace(nb,"$1_="+kb++):f+(lb.test(f)?"&":"?")+"_="+kb++)),m.ifModified&&(n.lastModified[f]&&x.setRequestHeader("If-Modified-Since",n.lastModified[f]),n.etag[f]&&x.setRequestHeader("If-None-Match",n.etag[f])),(m.data&&m.hasContent&&m.contentType!==!1||c.contentType)&&x.setRequestHeader("Content-Type",m.contentType),x.setRequestHeader("Accept",m.dataTypes[0]&&m.accepts[m.dataTypes[0]]?m.accepts[m.dataTypes[0]]+("*"!==m.dataTypes[0]?", "+ub+"; q=0.01":""):m.accepts["*"]);for(l in m.headers)x.setRequestHeader(l,m.headers[l]);if(m.beforeSend&&(m.beforeSend.call(o,x,m)===!1||2===v))return x.abort();w="abort";for(l in{success:1,error:1,complete:1})x[l](m[l]);if(e=xb(tb,m,c,x)){if(x.readyState=1,k&&p.trigger("ajaxSend",[x,m]),2===v)return x;m.async&&m.timeout>0&&(i=a.setTimeout(function(){x.abort("timeout")},m.timeout));try{v=1,e.send(t,z)}catch(y){if(!(2>v))throw y;z(-1,y)}}else z(-1,"No Transport");function z(b,c,d,h){var j,l,t,u,w,y=c;2!==v&&(v=2,i&&a.clearTimeout(i),e=void 0,g=h||"",x.readyState=b>0?4:0,j=b>=200&&300>b||304===b,d&&(u=zb(m,x,d)),u=Ab(m,u,x,j),j?(m.ifModified&&(w=x.getResponseHeader("Last-Modified"),w&&(n.lastModified[f]=w),w=x.getResponseHeader("etag"),w&&(n.etag[f]=w)),204===b||"HEAD"===m.type?y="nocontent":304===b?y="notmodified":(y=u.state,l=u.data,t=u.error,j=!t)):(t=y,!b&&y||(y="error",0>b&&(b=0))),x.status=b,x.statusText=(c||y)+"",j?q.resolveWith(o,[l,y,x]):q.rejectWith(o,[x,y,t]),x.statusCode(s),s=void 0,k&&p.trigger(j?"ajaxSuccess":"ajaxError",[x,m,j?l:t]),r.fireWith(o,[x,y]),k&&(p.trigger("ajaxComplete",[x,m]),--n.active||n.event.trigger("ajaxStop")))}return x},getJSON:function(a,b,c){return n.get(a,b,c,"json")},getScript:function(a,b){return n.get(a,void 0,b,"script")}}),n.each(["get","post"],function(a,b){n[b]=function(a,c,d,e){return n.isFunction(c)&&(e=e||d,d=c,c=void 0),n.ajax(n.extend({url:a,type:b,dataType:e,data:c,success:d},n.isPlainObject(a)&&a))}}),n._evalUrl=function(a){return n.ajax({url:a,type:"GET",dataType:"script",async:!1,global:!1,"throws":!0})},n.fn.extend({wrapAll:function(a){var b;return n.isFunction(a)?this.each(function(b){n(this).wrapAll(a.call(this,b))}):(this[0]&&(b=n(a,this[0].ownerDocument).eq(0).clone(!0),this[0].parentNode&&b.insertBefore(this[0]),b.map(function(){var a=this;while(a.firstElementChild)a=a.firstElementChild;return a}).append(this)),this)},wrapInner:function(a){return n.isFunction(a)?this.each(function(b){n(this).wrapInner(a.call(this,b))}):this.each(function(){var b=n(this),c=b.contents();c.length?c.wrapAll(a):b.append(a)})},wrap:function(a){var b=n.isFunction(a);return this.each(function(c){n(this).wrapAll(b?a.call(this,c):a)})},unwrap:function(){return this.parent().each(function(){n.nodeName(this,"body")||n(this).replaceWith(this.childNodes)}).end()}}),n.expr.filters.hidden=function(a){return!n.expr.filters.visible(a)},n.expr.filters.visible=function(a){return a.offsetWidth>0||a.offsetHeight>0||a.getClientRects().length>0};var Bb=/%20/g,Cb=/\[\]$/,Db=/\r?\n/g,Eb=/^(?:submit|button|image|reset|file)$/i,Fb=/^(?:input|select|textarea|keygen)/i;function Gb(a,b,c,d){var e;if(n.isArray(b))n.each(b,function(b,e){c||Cb.test(a)?d(a,e):Gb(a+"["+("object"==typeof e&&null!=e?b:"")+"]",e,c,d)});else if(c||"object"!==n.type(b))d(a,b);else for(e in b)Gb(a+"["+e+"]",b[e],c,d)}n.param=function(a,b){var c,d=[],e=function(a,b){b=n.isFunction(b)?b():null==b?"":b,d[d.length]=encodeURIComponent(a)+"="+encodeURIComponent(b)};if(void 0===b&&(b=n.ajaxSettings&&n.ajaxSettings.traditional),n.isArray(a)||a.jquery&&!n.isPlainObject(a))n.each(a,function(){e(this.name,this.value)});else for(c in a)Gb(c,a[c],b,e);return d.join("&").replace(Bb,"+")},n.fn.extend({serialize:function(){return n.param(this.serializeArray())},serializeArray:function(){return this.map(function(){var a=n.prop(this,"elements");return a?n.makeArray(a):this}).filter(function(){var a=this.type;return this.name&&!n(this).is(":disabled")&&Fb.test(this.nodeName)&&!Eb.test(a)&&(this.checked||!X.test(a))}).map(function(a,b){var c=n(this).val();return null==c?null:n.isArray(c)?n.map(c,function(a){return{name:b.name,value:a.replace(Db,"\r\n")}}):{name:b.name,value:c.replace(Db,"\r\n")}}).get()}}),n.ajaxSettings.xhr=function(){try{return new a.XMLHttpRequest}catch(b){}};var Hb={0:200,1223:204},Ib=n.ajaxSettings.xhr();l.cors=!!Ib&&"withCredentials"in Ib,l.ajax=Ib=!!Ib,n.ajaxTransport(function(b){var c,d;return l.cors||Ib&&!b.crossDomain?{send:function(e,f){var g,h=b.xhr();if(h.open(b.type,b.url,b.async,b.username,b.password),b.xhrFields)for(g in b.xhrFields)h[g]=b.xhrFields[g];b.mimeType&&h.overrideMimeType&&h.overrideMimeType(b.mimeType),b.crossDomain||e["X-Requested-With"]||(e["X-Requested-With"]="XMLHttpRequest");for(g in e)h.setRequestHeader(g,e[g]);c=function(a){return function(){c&&(c=d=h.onload=h.onerror=h.onabort=h.onreadystatechange=null,"abort"===a?h.abort():"error"===a?"number"!=typeof h.status?f(0,"error"):f(h.status,h.statusText):f(Hb[h.status]||h.status,h.statusText,"text"!==(h.responseType||"text")||"string"!=typeof h.responseText?{binary:h.response}:{text:h.responseText},h.getAllResponseHeaders()))}},h.onload=c(),d=h.onerror=c("error"),void 0!==h.onabort?h.onabort=d:h.onreadystatechange=function(){4===h.readyState&&a.setTimeout(function(){c&&d()})},c=c("abort");try{h.send(b.hasContent&&b.data||null)}catch(i){if(c)throw i}},abort:function(){c&&c()}}:void 0}),n.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/\b(?:java|ecma)script\b/},converters:{"text script":function(a){return n.globalEval(a),a}}}),n.ajaxPrefilter("script",function(a){void 0===a.cache&&(a.cache=!1),a.crossDomain&&(a.type="GET")}),n.ajaxTransport("script",function(a){if(a.crossDomain){var b,c;return{send:function(e,f){b=n("<script>").prop({charset:a.scriptCharset,src:a.url}).on("load error",c=function(a){b.remove(),c=null,a&&f("error"===a.type?404:200,a.type)}),d.head.appendChild(b[0])},abort:function(){c&&c()}}}});var Jb=[],Kb=/(=)\?(?=&|$)|\?\?/;n.ajaxSetup({jsonp:"callback",jsonpCallback:function(){var a=Jb.pop()||n.expando+"_"+kb++;return this[a]=!0,a}}),n.ajaxPrefilter("json jsonp",function(b,c,d){var e,f,g,h=b.jsonp!==!1&&(Kb.test(b.url)?"url":"string"==typeof b.data&&0===(b.contentType||"").indexOf("application/x-www-form-urlencoded")&&Kb.test(b.data)&&"data");return h||"jsonp"===b.dataTypes[0]?(e=b.jsonpCallback=n.isFunction(b.jsonpCallback)?b.jsonpCallback():b.jsonpCallback,h?b[h]=b[h].replace(Kb,"$1"+e):b.jsonp!==!1&&(b.url+=(lb.test(b.url)?"&":"?")+b.jsonp+"="+e),b.converters["script json"]=function(){return g||n.error(e+" was not called"),g[0]},b.dataTypes[0]="json",f=a[e],a[e]=function(){g=arguments},d.always(function(){void 0===f?n(a).removeProp(e):a[e]=f,b[e]&&(b.jsonpCallback=c.jsonpCallback,Jb.push(e)),g&&n.isFunction(f)&&f(g[0]),g=f=void 0}),"script"):void 0}),n.parseHTML=function(a,b,c){if(!a||"string"!=typeof a)return null;"boolean"==typeof b&&(c=b,b=!1),b=b||d;var e=x.exec(a),f=!c&&[];return e?[b.createElement(e[1])]:(e=ca([a],b,f),f&&f.length&&n(f).remove(),n.merge([],e.childNodes))};var Lb=n.fn.load;n.fn.load=function(a,b,c){if("string"!=typeof a&&Lb)return Lb.apply(this,arguments);var d,e,f,g=this,h=a.indexOf(" ");return h>-1&&(d=n.trim(a.slice(h)),a=a.slice(0,h)),n.isFunction(b)?(c=b,b=void 0):b&&"object"==typeof b&&(e="POST"),g.length>0&&n.ajax({url:a,type:e||"GET",dataType:"html",data:b}).done(function(a){f=arguments,g.html(d?n("<div>").append(n.parseHTML(a)).find(d):a)}).always(c&&function(a,b){g.each(function(){c.apply(this,f||[a.responseText,b,a])})}),this},n.each(["ajaxStart","ajaxStop","ajaxComplete","ajaxError","ajaxSuccess","ajaxSend"],function(a,b){n.fn[b]=function(a){return this.on(b,a)}}),n.expr.filters.animated=function(a){return n.grep(n.timers,function(b){return a===b.elem}).length};function Mb(a){return n.isWindow(a)?a:9===a.nodeType&&a.defaultView}n.offset={setOffset:function(a,b,c){var d,e,f,g,h,i,j,k=n.css(a,"position"),l=n(a),m={};"static"===k&&(a.style.position="relative"),h=l.offset(),f=n.css(a,"top"),i=n.css(a,"left"),j=("absolute"===k||"fixed"===k)&&(f+i).indexOf("auto")>-1,j?(d=l.position(),g=d.top,e=d.left):(g=parseFloat(f)||0,e=parseFloat(i)||0),n.isFunction(b)&&(b=b.call(a,c,n.extend({},h))),null!=b.top&&(m.top=b.top-h.top+g),null!=b.left&&(m.left=b.left-h.left+e),"using"in b?b.using.call(a,m):l.css(m)}},n.fn.extend({offset:function(a){if(arguments.length)return void 0===a?this:this.each(function(b){n.offset.setOffset(this,a,b)});var b,c,d=this[0],e={top:0,left:0},f=d&&d.ownerDocument;if(f)return b=f.documentElement,n.contains(b,d)?(e=d.getBoundingClientRect(),c=Mb(f),{top:e.top+c.pageYOffset-b.clientTop,left:e.left+c.pageXOffset-b.clientLeft}):e},position:function(){if(this[0]){var a,b,c=this[0],d={top:0,left:0};return"fixed"===n.css(c,"position")?b=c.getBoundingClientRect():(a=this.offsetParent(),b=this.offset(),n.nodeName(a[0],"html")||(d=a.offset()),d.top+=n.css(a[0],"borderTopWidth",!0),d.left+=n.css(a[0],"borderLeftWidth",!0)),{top:b.top-d.top-n.css(c,"marginTop",!0),left:b.left-d.left-n.css(c,"marginLeft",!0)}}},offsetParent:function(){return this.map(function(){var a=this.offsetParent;while(a&&"static"===n.css(a,"position"))a=a.offsetParent;return a||Ea})}}),n.each({scrollLeft:"pageXOffset",scrollTop:"pageYOffset"},function(a,b){var c="pageYOffset"===b;n.fn[a]=function(d){return K(this,function(a,d,e){var f=Mb(a);return void 0===e?f?f[b]:a[d]:void(f?f.scrollTo(c?f.pageXOffset:e,c?e:f.pageYOffset):a[d]=e)},a,d,arguments.length)}}),n.each(["top","left"],function(a,b){n.cssHooks[b]=Ga(l.pixelPosition,function(a,c){return c?(c=Fa(a,b),Ba.test(c)?n(a).position()[b]+"px":c):void 0})}),n.each({Height:"height",Width:"width"},function(a,b){n.each({padding:"inner"+a,content:b,"":"outer"+a},function(c,d){n.fn[d]=function(d,e){var f=arguments.length&&(c||"boolean"!=typeof d),g=c||(d===!0||e===!0?"margin":"border");return K(this,function(b,c,d){var e;return n.isWindow(b)?b.document.documentElement["client"+a]:9===b.nodeType?(e=b.documentElement,Math.max(b.body["scroll"+a],e["scroll"+a],b.body["offset"+a],e["offset"+a],e["client"+a])):void 0===d?n.css(b,c,g):n.style(b,c,d,g)},b,f?d:void 0,f,null)}})}),n.fn.extend({bind:function(a,b,c){return this.on(a,null,b,c)},unbind:function(a,b){return this.off(a,null,b)},delegate:function(a,b,c,d){return this.on(b,a,c,d)},undelegate:function(a,b,c){return 1===arguments.length?this.off(a,"**"):this.off(b,a||"**",c)},size:function(){return this.length}}),n.fn.andSelf=n.fn.addBack,"function"==typeof define&&define.amd&&define("jquery",[],function(){return n});var Nb=a.jQuery,Ob=a.$;return n.noConflict=function(b){return a.$===n&&(a.$=Ob),b&&a.jQuery===n&&(a.jQuery=Nb),n},b||(a.jQuery=a.$=n),n}); |
New file |
| | |
| | | /* jquery.nicescroll |
| | | -- version 3.4.0 |
| | | -- copyright 2011-12-13 InuYaksa*2013 |
| | | -- licensed under the MIT |
| | | -- |
| | | -- http://areaaperta.com/nicescroll |
| | | -- https://github.com/inuyaksa/jquery.nicescroll |
| | | -- |
| | | */ |
| | | |
| | | ;(function (jQuery) { |
| | | // globals |
| | | var domfocus = false |
| | | var mousefocus = false |
| | | var zoomactive = false |
| | | var tabindexcounter = 5000 |
| | | var ascrailcounter = 2000 |
| | | var globalmaxzindex = 0 |
| | | |
| | | var $ = jQuery // sandbox |
| | | |
| | | // http://stackoverflow.com/questions/2161159/get-script-path |
| | | function getScriptPath() { |
| | | var scripts = document.getElementsByTagName('script') |
| | | var path = scripts[scripts.length - 1].src.split('?')[0] |
| | | return path.split('/').length > 0 ? path.split('/').slice(0, -1).join('/') + '/' : '' |
| | | } |
| | | var scriptpath = getScriptPath() |
| | | |
| | | // derived by Paul Irish https://gist.github.com/paulirish/1579671 - thanks for your code! |
| | | |
| | | if (!Array.prototype.forEach) { |
| | | // JS 1.6 polyfill |
| | | Array.prototype.forEach = function (fn, scope) { |
| | | for (var i = 0, len = this.length; i < len; ++i) { |
| | | fn.call(scope, this[i], i, this) |
| | | } |
| | | } |
| | | } |
| | | |
| | | var vendors = ['ms', 'moz', 'webkit', 'o'] |
| | | |
| | | var setAnimationFrame = window.requestAnimationFrame || false |
| | | var clearAnimationFrame = window.cancelAnimationFrame || false |
| | | |
| | | vendors.forEach(function (v) { |
| | | if (!setAnimationFrame) setAnimationFrame = window[v + 'RequestAnimationFrame'] |
| | | if (!clearAnimationFrame) |
| | | clearAnimationFrame = |
| | | window[v + 'CancelAnimationFrame'] || window[v + 'CancelRequestAnimationFrame'] |
| | | }) |
| | | |
| | | var clsMutationObserver = window.MutationObserver || window.WebKitMutationObserver || false |
| | | |
| | | var _globaloptions = { |
| | | zindex: 'auto', |
| | | cursoropacitymin: 0, |
| | | cursoropacitymax: 1, |
| | | cursorcolor: '#424242', |
| | | cursorwidth: '5px', |
| | | cursorborder: '1px solid #fff', |
| | | cursorborderradius: '5px', |
| | | scrollspeed: 60, |
| | | mousescrollstep: 8 * 3, |
| | | touchbehavior: false, |
| | | hwacceleration: true, |
| | | usetransition: true, |
| | | boxzoom: false, |
| | | dblclickzoom: true, |
| | | gesturezoom: true, |
| | | grabcursorenabled: true, |
| | | autohidemode: true, |
| | | background: '', |
| | | iframeautoresize: true, |
| | | cursorminheight: 32, |
| | | preservenativescrolling: true, |
| | | railoffset: false, |
| | | bouncescroll: true, |
| | | spacebarenabled: true, |
| | | railpadding: { top: 0, right: 0, left: 0, bottom: 0 }, |
| | | disableoutline: true, |
| | | horizrailenabled: true, |
| | | railalign: 'right', |
| | | railvalign: 'bottom', |
| | | enabletranslate3d: true, |
| | | enablemousewheel: true, |
| | | enablekeyboard: true, |
| | | smoothscroll: true, |
| | | sensitiverail: true, |
| | | enablemouselockapi: true, |
| | | // cursormaxheight:false, |
| | | cursorfixedheight: false, |
| | | directionlockdeadzone: 6, |
| | | hidecursordelay: 400, |
| | | nativeparentscrolling: true, |
| | | enablescrollonselection: true, |
| | | overflowx: true, |
| | | overflowy: true, |
| | | cursordragspeed: 0.3, |
| | | rtlmode: false, |
| | | cursordragontouch: false |
| | | } |
| | | |
| | | var browserdetected = false |
| | | |
| | | var getBrowserDetection = function () { |
| | | if (browserdetected) return browserdetected |
| | | |
| | | var domtest = document.createElement('DIV') |
| | | |
| | | var d = {} |
| | | |
| | | d.haspointerlock = |
| | | 'pointerLockElement' in document || |
| | | 'mozPointerLockElement' in document || |
| | | 'webkitPointerLockElement' in document |
| | | |
| | | d.isopera = 'opera' in window |
| | | d.isopera12 = d.isopera && 'getUserMedia' in navigator |
| | | |
| | | d.isie = 'all' in document && 'attachEvent' in domtest && !d.isopera |
| | | d.isieold = d.isie && !('msInterpolationMode' in domtest.style) // IE6 and older |
| | | d.isie7 = d.isie && !d.isieold && (!('documentMode' in document) || document.documentMode == 7) |
| | | d.isie8 = d.isie && 'documentMode' in document && document.documentMode == 8 |
| | | d.isie9 = d.isie && 'performance' in window && document.documentMode >= 9 |
| | | d.isie10 = d.isie && 'performance' in window && document.documentMode >= 10 |
| | | |
| | | d.isie9mobile = /iemobile.9/i.test(navigator.userAgent) //wp 7.1 mango |
| | | if (d.isie9mobile) d.isie9 = false |
| | | d.isie7mobile = !d.isie9mobile && d.isie7 && /iemobile/i.test(navigator.userAgent) //wp 7.0 |
| | | |
| | | d.ismozilla = 'MozAppearance' in domtest.style |
| | | |
| | | d.iswebkit = 'WebkitAppearance' in domtest.style |
| | | |
| | | d.ischrome = 'chrome' in window |
| | | d.ischrome22 = d.ischrome && d.haspointerlock |
| | | d.ischrome26 = d.ischrome && 'transition' in domtest.style // issue with transform detection (maintain prefix) |
| | | |
| | | d.cantouch = 'ontouchstart' in document.documentElement || 'ontouchstart' in window // detection for Chrome Touch Emulation |
| | | d.hasmstouch = window.navigator.msPointerEnabled || false // IE10+ pointer events |
| | | |
| | | d.ismac = /^mac$/i.test(navigator.platform) |
| | | |
| | | d.isios = d.cantouch && /iphone|ipad|ipod/i.test(navigator.platform) |
| | | d.isios4 = d.isios && !('seal' in Object) |
| | | |
| | | d.isandroid = /android/i.test(navigator.userAgent) |
| | | |
| | | d.trstyle = false |
| | | d.hastransform = false |
| | | d.hastranslate3d = false |
| | | d.transitionstyle = false |
| | | d.hastransition = false |
| | | d.transitionend = false |
| | | |
| | | var check = ['transform', 'msTransform', 'webkitTransform', 'MozTransform', 'OTransform'] |
| | | for (var a = 0; a < check.length; a++) { |
| | | if (typeof domtest.style[check[a]] != 'undefined') { |
| | | d.trstyle = check[a] |
| | | break |
| | | } |
| | | } |
| | | d.hastransform = d.trstyle != false |
| | | if (d.hastransform) { |
| | | domtest.style[d.trstyle] = 'translate3d(1px,2px,3px)' |
| | | d.hastranslate3d = /translate3d/.test(domtest.style[d.trstyle]) |
| | | } |
| | | |
| | | d.transitionstyle = false |
| | | d.prefixstyle = '' |
| | | d.transitionend = false |
| | | var check = [ |
| | | 'transition', |
| | | 'webkitTransition', |
| | | 'MozTransition', |
| | | 'OTransition', |
| | | 'OTransition', |
| | | 'msTransition', |
| | | 'KhtmlTransition' |
| | | ] |
| | | var prefix = ['', '-webkit-', '-moz-', '-o-', '-o', '-ms-', '-khtml-'] |
| | | var evs = [ |
| | | 'transitionend', |
| | | 'webkitTransitionEnd', |
| | | 'transitionend', |
| | | 'otransitionend', |
| | | 'oTransitionEnd', |
| | | 'msTransitionEnd', |
| | | 'KhtmlTransitionEnd' |
| | | ] |
| | | for (var a = 0; a < check.length; a++) { |
| | | if (check[a] in domtest.style) { |
| | | d.transitionstyle = check[a] |
| | | d.prefixstyle = prefix[a] |
| | | d.transitionend = evs[a] |
| | | break |
| | | } |
| | | } |
| | | if (d.ischrome26) { |
| | | // use always prefix |
| | | d.prefixstyle = prefix[1] |
| | | } |
| | | |
| | | d.hastransition = d.transitionstyle |
| | | |
| | | function detectCursorGrab() { |
| | | var lst = ['-moz-grab', '-webkit-grab', 'grab'] |
| | | if ((d.ischrome && !d.ischrome22) || d.isie) lst = [] // force setting for IE returns false positive and chrome cursor bug |
| | | for (var a = 0; a < lst.length; a++) { |
| | | var p = lst[a] |
| | | domtest.style['cursor'] = p |
| | | if (domtest.style['cursor'] == p) return p |
| | | } |
| | | return 'url(http://www.google.com/intl/en_ALL/mapfiles/openhand.cur),n-resize' // thank you google for custom cursor! |
| | | } |
| | | d.cursorgrabvalue = detectCursorGrab() |
| | | |
| | | d.hasmousecapture = 'setCapture' in domtest |
| | | |
| | | d.hasMutationObserver = clsMutationObserver !== false |
| | | |
| | | domtest = null //memory released |
| | | |
| | | browserdetected = d |
| | | |
| | | return d |
| | | } |
| | | |
| | | var NiceScrollClass = function (myopt, me) { |
| | | var self = this |
| | | |
| | | this.version = '3.4.0' |
| | | this.name = 'nicescroll' |
| | | |
| | | this.me = me |
| | | |
| | | this.opt = { |
| | | doc: $('body'), |
| | | win: false |
| | | } |
| | | |
| | | $.extend(this.opt, _globaloptions) |
| | | |
| | | // Options for internal use |
| | | this.opt.snapbackspeed = 80 |
| | | |
| | | if (myopt || false) { |
| | | for (var a in self.opt) { |
| | | if (typeof myopt[a] != 'undefined') self.opt[a] = myopt[a] |
| | | } |
| | | } |
| | | |
| | | this.doc = self.opt.doc |
| | | this.iddoc = this.doc && this.doc[0] ? this.doc[0].id || '' : '' |
| | | this.ispage = /BODY|HTML/.test(self.opt.win ? self.opt.win[0].nodeName : this.doc[0].nodeName) |
| | | this.haswrapper = self.opt.win !== false |
| | | this.win = self.opt.win || (this.ispage ? $(window) : this.doc) |
| | | this.docscroll = this.ispage && !this.haswrapper ? $(window) : this.win |
| | | this.body = $('body') |
| | | this.viewport = false |
| | | |
| | | this.isfixed = false |
| | | |
| | | this.iframe = false |
| | | this.isiframe = this.doc[0].nodeName == 'IFRAME' && this.win[0].nodeName == 'IFRAME' |
| | | |
| | | this.istextarea = this.win[0].nodeName == 'TEXTAREA' |
| | | |
| | | this.forcescreen = false //force to use screen position on events |
| | | |
| | | this.canshowonmouseevent = self.opt.autohidemode != 'scroll' |
| | | |
| | | // Events jump table |
| | | this.onmousedown = false |
| | | this.onmouseup = false |
| | | this.onmousemove = false |
| | | this.onmousewheel = false |
| | | this.onkeypress = false |
| | | this.ongesturezoom = false |
| | | this.onclick = false |
| | | |
| | | // Nicescroll custom events |
| | | this.onscrollstart = false |
| | | this.onscrollend = false |
| | | this.onscrollcancel = false |
| | | |
| | | this.onzoomin = false |
| | | this.onzoomout = false |
| | | |
| | | // Let's start! |
| | | this.view = false |
| | | this.page = false |
| | | |
| | | this.scroll = { x: 0, y: 0 } |
| | | this.scrollratio = { x: 0, y: 0 } |
| | | this.cursorheight = 20 |
| | | this.scrollvaluemax = 0 |
| | | |
| | | this.checkrtlmode = false |
| | | |
| | | this.scrollrunning = false |
| | | |
| | | this.scrollmom = false |
| | | |
| | | this.observer = false |
| | | this.observerremover = false // observer on parent for remove detection |
| | | |
| | | do { |
| | | this.id = 'ascrail' + ascrailcounter++ |
| | | } while (document.getElementById(this.id)) |
| | | |
| | | this.rail = false |
| | | this.cursor = false |
| | | this.cursorfreezed = false |
| | | this.selectiondrag = false |
| | | |
| | | this.zoom = false |
| | | this.zoomactive = false |
| | | |
| | | this.hasfocus = false |
| | | this.hasmousefocus = false |
| | | |
| | | this.visibility = true |
| | | this.locked = false |
| | | this.hidden = false // rails always hidden |
| | | this.cursoractive = true // user can interact with cursors |
| | | |
| | | this.overflowx = self.opt.overflowx |
| | | this.overflowy = self.opt.overflowy |
| | | |
| | | this.nativescrollingarea = false |
| | | this.checkarea = 0 |
| | | |
| | | this.events = [] // event list for unbind |
| | | |
| | | this.saved = {} |
| | | |
| | | this.delaylist = {} |
| | | this.synclist = {} |
| | | |
| | | this.lastdeltax = 0 |
| | | this.lastdeltay = 0 |
| | | |
| | | this.detected = getBrowserDetection() |
| | | |
| | | var cap = $.extend({}, this.detected) |
| | | |
| | | this.canhwscroll = cap.hastransform && self.opt.hwacceleration |
| | | this.ishwscroll = this.canhwscroll && self.haswrapper |
| | | |
| | | this.istouchcapable = false // desktop devices with touch screen support |
| | | |
| | | //## Check Chrome desktop with touch support |
| | | if (cap.cantouch && cap.ischrome && !cap.isios && !cap.isandroid) { |
| | | this.istouchcapable = true |
| | | cap.cantouch = false // parse normal desktop events |
| | | } |
| | | |
| | | //## Firefox 18 nightly build (desktop) false positive (or desktop with touch support) |
| | | if (cap.cantouch && cap.ismozilla && !cap.isios) { |
| | | this.istouchcapable = true |
| | | cap.cantouch = false // parse normal desktop events |
| | | } |
| | | |
| | | //## disable MouseLock API on user request |
| | | |
| | | if (!self.opt.enablemouselockapi) { |
| | | cap.hasmousecapture = false |
| | | cap.haspointerlock = false |
| | | } |
| | | |
| | | this.delayed = function (name, fn, tm, lazy) { |
| | | var dd = self.delaylist[name] |
| | | var nw = new Date().getTime() |
| | | if (!lazy && dd && dd.tt) return false |
| | | if (dd && dd.tt) clearTimeout(dd.tt) |
| | | if (dd && dd.last + tm > nw && !dd.tt) { |
| | | self.delaylist[name] = { |
| | | last: nw + tm, |
| | | tt: setTimeout(function () { |
| | | self.delaylist[name].tt = 0 |
| | | fn.call() |
| | | }, tm) |
| | | } |
| | | } else if (!dd || !dd.tt) { |
| | | self.delaylist[name] = { |
| | | last: nw, |
| | | tt: 0 |
| | | } |
| | | setTimeout(function () { |
| | | fn.call() |
| | | }, 0) |
| | | } |
| | | } |
| | | |
| | | this.debounced = function (name, fn, tm) { |
| | | var dd = self.delaylist[name] |
| | | var nw = new Date().getTime() |
| | | self.delaylist[name] = fn |
| | | if (!dd) { |
| | | setTimeout(function () { |
| | | var fn = self.delaylist[name] |
| | | self.delaylist[name] = false |
| | | fn.call() |
| | | }, tm) |
| | | } |
| | | } |
| | | |
| | | this.synched = function (name, fn) { |
| | | function requestSync() { |
| | | if (self.onsync) return |
| | | setAnimationFrame(function () { |
| | | self.onsync = false |
| | | for (name in self.synclist) { |
| | | var fn = self.synclist[name] |
| | | if (fn) fn.call(self) |
| | | self.synclist[name] = false |
| | | } |
| | | }) |
| | | self.onsync = true |
| | | } |
| | | |
| | | self.synclist[name] = fn |
| | | requestSync() |
| | | return name |
| | | } |
| | | |
| | | this.unsynched = function (name) { |
| | | if (self.synclist[name]) self.synclist[name] = false |
| | | } |
| | | |
| | | this.css = function (el, pars) { |
| | | // save & set |
| | | for (var n in pars) { |
| | | self.saved.css.push([el, n, el.css(n)]) |
| | | el.css(n, pars[n]) |
| | | } |
| | | } |
| | | |
| | | this.scrollTop = function (val) { |
| | | return typeof val == 'undefined' ? self.getScrollTop() : self.setScrollTop(val) |
| | | } |
| | | |
| | | this.scrollLeft = function (val) { |
| | | return typeof val == 'undefined' ? self.getScrollLeft() : self.setScrollLeft(val) |
| | | } |
| | | |
| | | // derived by by Dan Pupius www.pupius.net |
| | | BezierClass = function (st, ed, spd, p1, p2, p3, p4) { |
| | | this.st = st |
| | | this.ed = ed |
| | | this.spd = spd |
| | | |
| | | this.p1 = p1 || 0 |
| | | this.p2 = p2 || 1 |
| | | this.p3 = p3 || 0 |
| | | this.p4 = p4 || 1 |
| | | |
| | | this.ts = new Date().getTime() |
| | | this.df = this.ed - this.st |
| | | } |
| | | BezierClass.prototype = { |
| | | B2: function (t) { |
| | | return 3 * t * t * (1 - t) |
| | | }, |
| | | B3: function (t) { |
| | | return 3 * t * (1 - t) * (1 - t) |
| | | }, |
| | | B4: function (t) { |
| | | return (1 - t) * (1 - t) * (1 - t) |
| | | }, |
| | | getNow: function () { |
| | | var nw = new Date().getTime() |
| | | var pc = 1 - (nw - this.ts) / this.spd |
| | | var bz = this.B2(pc) + this.B3(pc) + this.B4(pc) |
| | | return pc < 0 ? this.ed : this.st + Math.round(this.df * bz) |
| | | }, |
| | | update: function (ed, spd) { |
| | | this.st = this.getNow() |
| | | this.ed = ed |
| | | this.spd = spd |
| | | this.ts = new Date().getTime() |
| | | this.df = this.ed - this.st |
| | | return this |
| | | } |
| | | } |
| | | |
| | | if (this.ishwscroll) { |
| | | // hw accelerated scroll |
| | | this.doc.translate = { x: 0, y: 0, tx: '0px', ty: '0px' } |
| | | |
| | | //this one can help to enable hw accel on ios6 http://indiegamr.com/ios6-html-hardware-acceleration-changes-and-how-to-fix-them/ |
| | | if (cap.hastranslate3d && cap.isios) this.doc.css('-webkit-backface-visibility', 'hidden') // prevent flickering http://stackoverflow.com/questions/3461441/ |
| | | |
| | | //derived from http://stackoverflow.com/questions/11236090/ |
| | | function getMatrixValues() { |
| | | var tr = self.doc.css(cap.trstyle) |
| | | if (tr && tr.substr(0, 6) == 'matrix') { |
| | | return tr |
| | | .replace(/^.*\((.*)\)$/g, '$1') |
| | | .replace(/px/g, '') |
| | | .split(/, +/) |
| | | } |
| | | return false |
| | | } |
| | | |
| | | this.getScrollTop = function (last) { |
| | | if (!last) { |
| | | var mtx = getMatrixValues() |
| | | if (mtx) return mtx.length == 16 ? -mtx[13] : -mtx[5] //matrix3d 16 on IE10 |
| | | if (self.timerscroll && self.timerscroll.bz) return self.timerscroll.bz.getNow() |
| | | } |
| | | return self.doc.translate.y |
| | | } |
| | | |
| | | this.getScrollLeft = function (last) { |
| | | if (!last) { |
| | | var mtx = getMatrixValues() |
| | | if (mtx) return mtx.length == 16 ? -mtx[12] : -mtx[4] //matrix3d 16 on IE10 |
| | | if (self.timerscroll && self.timerscroll.bh) return self.timerscroll.bh.getNow() |
| | | } |
| | | return self.doc.translate.x |
| | | } |
| | | |
| | | if (document.createEvent) { |
| | | this.notifyScrollEvent = function (el) { |
| | | var e = document.createEvent('UIEvents') |
| | | e.initUIEvent('scroll', false, true, window, 1) |
| | | el.dispatchEvent(e) |
| | | } |
| | | } else if (document.fireEvent) { |
| | | this.notifyScrollEvent = function (el) { |
| | | var e = document.createEventObject() |
| | | el.fireEvent('onscroll') |
| | | e.cancelBubble = true |
| | | } |
| | | } else { |
| | | this.notifyScrollEvent = function (el, add) {} //NOPE |
| | | } |
| | | |
| | | if (cap.hastranslate3d && self.opt.enabletranslate3d) { |
| | | this.setScrollTop = function (val, silent) { |
| | | self.doc.translate.y = val |
| | | self.doc.translate.ty = val * -1 + 'px' |
| | | self.doc.css( |
| | | cap.trstyle, |
| | | 'translate3d(' + self.doc.translate.tx + ',' + self.doc.translate.ty + ',0px)' |
| | | ) |
| | | if (!silent) self.notifyScrollEvent(self.win[0]) |
| | | } |
| | | this.setScrollLeft = function (val, silent) { |
| | | self.doc.translate.x = val |
| | | self.doc.translate.tx = val * -1 + 'px' |
| | | self.doc.css( |
| | | cap.trstyle, |
| | | 'translate3d(' + self.doc.translate.tx + ',' + self.doc.translate.ty + ',0px)' |
| | | ) |
| | | if (!silent) self.notifyScrollEvent(self.win[0]) |
| | | } |
| | | } else { |
| | | this.setScrollTop = function (val, silent) { |
| | | self.doc.translate.y = val |
| | | self.doc.translate.ty = val * -1 + 'px' |
| | | self.doc.css( |
| | | cap.trstyle, |
| | | 'translate(' + self.doc.translate.tx + ',' + self.doc.translate.ty + ')' |
| | | ) |
| | | if (!silent) self.notifyScrollEvent(self.win[0]) |
| | | } |
| | | this.setScrollLeft = function (val, silent) { |
| | | self.doc.translate.x = val |
| | | self.doc.translate.tx = val * -1 + 'px' |
| | | self.doc.css( |
| | | cap.trstyle, |
| | | 'translate(' + self.doc.translate.tx + ',' + self.doc.translate.ty + ')' |
| | | ) |
| | | if (!silent) self.notifyScrollEvent(self.win[0]) |
| | | } |
| | | } |
| | | } else { |
| | | // native scroll |
| | | this.getScrollTop = function () { |
| | | return self.docscroll.scrollTop() |
| | | } |
| | | this.setScrollTop = function (val) { |
| | | return self.docscroll.scrollTop(val) |
| | | } |
| | | this.getScrollLeft = function () { |
| | | return self.docscroll.scrollLeft() |
| | | } |
| | | this.setScrollLeft = function (val) { |
| | | return self.docscroll.scrollLeft(val) |
| | | } |
| | | } |
| | | |
| | | this.getTarget = function (e) { |
| | | if (!e) return false |
| | | if (e.target) return e.target |
| | | if (e.srcElement) return e.srcElement |
| | | return false |
| | | } |
| | | |
| | | this.hasParent = function (e, id) { |
| | | if (!e) return false |
| | | var el = e.target || e.srcElement || e || false |
| | | while (el && el.id != id) { |
| | | el = el.parentNode || false |
| | | } |
| | | return el !== false |
| | | } |
| | | |
| | | function getZIndex() { |
| | | var dom = self.win |
| | | if ('zIndex' in dom) return dom.zIndex() // use jQuery UI method when available |
| | | while (dom.length > 0) { |
| | | if (dom[0].nodeType == 9) return false |
| | | var zi = dom.css('zIndex') |
| | | if (!isNaN(zi) && zi != 0) return parseInt(zi) |
| | | dom = dom.parent() |
| | | } |
| | | return false |
| | | } |
| | | |
| | | //inspired by http://forum.jquery.com/topic/width-includes-border-width-when-set-to-thin-medium-thick-in-ie |
| | | var _convertBorderWidth = { thin: 1, medium: 3, thick: 5 } |
| | | function getWidthToPixel(dom, prop, chkheight) { |
| | | var wd = dom.css(prop) |
| | | var px = parseFloat(wd) |
| | | if (isNaN(px)) { |
| | | px = _convertBorderWidth[wd] || 0 |
| | | var brd = |
| | | px == 3 |
| | | ? chkheight |
| | | ? self.win.outerHeight() - self.win.innerHeight() |
| | | : self.win.outerWidth() - self.win.innerWidth() |
| | | : 1 //DON'T TRUST CSS |
| | | if (self.isie8 && px) px += 1 |
| | | return brd ? px : 0 |
| | | } |
| | | return px |
| | | } |
| | | |
| | | this.getOffset = function () { |
| | | if (self.isfixed) |
| | | return { top: parseFloat(self.win.css('top')), left: parseFloat(self.win.css('left')) } |
| | | if (!self.viewport) return self.win.offset() |
| | | var ww = self.win.offset() |
| | | var vp = self.viewport.offset() |
| | | return { |
| | | top: ww.top - vp.top + self.viewport.scrollTop(), |
| | | left: ww.left - vp.left + self.viewport.scrollLeft() |
| | | } |
| | | } |
| | | |
| | | this.updateScrollBar = function (len) { |
| | | if (self.ishwscroll) { |
| | | self.rail.css({ height: self.win.innerHeight() }) |
| | | if (self.railh) self.railh.css({ width: self.win.innerWidth() }) |
| | | } else { |
| | | var wpos = self.getOffset() |
| | | var pos = { top: wpos.top, left: wpos.left } |
| | | pos.top += getWidthToPixel(self.win, 'border-top-width', true) |
| | | var brd = (self.win.outerWidth() - self.win.innerWidth()) / 2 |
| | | pos.left += self.rail.align |
| | | ? self.win.outerWidth() - |
| | | getWidthToPixel(self.win, 'border-right-width') - |
| | | self.rail.width |
| | | : getWidthToPixel(self.win, 'border-left-width') |
| | | |
| | | var off = self.opt.railoffset |
| | | if (off) { |
| | | if (off.top) pos.top += off.top |
| | | if (self.rail.align && off.left) pos.left += off.left |
| | | } |
| | | |
| | | if (!self.locked) |
| | | self.rail.css({ |
| | | top: pos.top, |
| | | left: pos.left, |
| | | height: len ? len.h : self.win.innerHeight() |
| | | }) |
| | | |
| | | if (self.zoom) { |
| | | self.zoom.css({ |
| | | top: pos.top + 1, |
| | | left: self.rail.align == 1 ? pos.left - 20 : pos.left + self.rail.width + 4 |
| | | }) |
| | | } |
| | | |
| | | if (self.railh && !self.locked) { |
| | | var pos = { top: wpos.top, left: wpos.left } |
| | | var y = self.railh.align |
| | | ? pos.top + |
| | | getWidthToPixel(self.win, 'border-top-width', true) + |
| | | self.win.innerHeight() - |
| | | self.railh.height |
| | | : pos.top + getWidthToPixel(self.win, 'border-top-width', true) |
| | | var x = pos.left + getWidthToPixel(self.win, 'border-left-width') |
| | | self.railh.css({ top: y, left: x, width: self.railh.width }) |
| | | } |
| | | } |
| | | } |
| | | |
| | | this.doRailClick = function (e, dbl, hr) { |
| | | var fn, pg, cur, pos |
| | | |
| | | // if (self.rail.drag&&self.rail.drag.pt!=1) return; |
| | | if (self.locked) return |
| | | // if (self.rail.drag) return; |
| | | |
| | | // self.cancelScroll(); |
| | | |
| | | self.cancelEvent(e) |
| | | |
| | | if (dbl) { |
| | | fn = hr ? self.doScrollLeft : self.doScrollTop |
| | | cur = hr |
| | | ? (e.pageX - self.railh.offset().left - self.cursorwidth / 2) * self.scrollratio.x |
| | | : (e.pageY - self.rail.offset().top - self.cursorheight / 2) * self.scrollratio.y |
| | | fn(cur) |
| | | } else { |
| | | // console.log(e.pageY); |
| | | fn = hr ? self.doScrollLeftBy : self.doScrollBy |
| | | cur = hr ? self.scroll.x : self.scroll.y |
| | | pos = hr ? e.pageX - self.railh.offset().left : e.pageY - self.rail.offset().top |
| | | pg = hr ? self.view.w : self.view.h |
| | | cur >= pos ? fn(pg) : fn(-pg) |
| | | } |
| | | } |
| | | |
| | | self.hasanimationframe = setAnimationFrame |
| | | self.hascancelanimationframe = clearAnimationFrame |
| | | |
| | | if (!self.hasanimationframe) { |
| | | setAnimationFrame = function (fn) { |
| | | return setTimeout(fn, 15 - (Math.floor(+new Date() / 1000) % 16)) |
| | | } // 1000/60)}; |
| | | clearAnimationFrame = clearInterval |
| | | } else if (!self.hascancelanimationframe) |
| | | clearAnimationFrame = function () { |
| | | self.cancelAnimationFrame = true |
| | | } |
| | | |
| | | this.init = function () { |
| | | self.saved.css = [] |
| | | |
| | | if (cap.isie7mobile) return true // SORRY, DO NOT WORK! |
| | | |
| | | if (cap.hasmstouch) |
| | | self.css(self.ispage ? $('html') : self.win, { '-ms-touch-action': 'none' }) |
| | | |
| | | self.zindex = 'auto' |
| | | if (!self.ispage && self.opt.zindex == 'auto') { |
| | | self.zindex = getZIndex() || 'auto' |
| | | } else { |
| | | self.zindex = self.opt.zindex |
| | | } |
| | | |
| | | if (!self.ispage && self.zindex != 'auto') { |
| | | if (self.zindex > globalmaxzindex) globalmaxzindex = self.zindex |
| | | } |
| | | |
| | | if (self.isie && self.zindex == 0 && self.opt.zindex == 'auto') { |
| | | // fix IE auto == 0 |
| | | self.zindex = 'auto' |
| | | } |
| | | |
| | | /* |
| | | self.ispage = true; |
| | | self.haswrapper = true; |
| | | // self.win = $(window); |
| | | self.docscroll = $("body"); |
| | | // self.doc = $("body"); |
| | | */ |
| | | |
| | | if (!self.ispage || (!cap.cantouch && !cap.isieold && !cap.isie9mobile)) { |
| | | var cont = self.docscroll |
| | | if (self.ispage) cont = self.haswrapper ? self.win : self.doc |
| | | |
| | | if (!cap.isie9mobile) self.css(cont, { 'overflow-y': 'hidden' }) |
| | | |
| | | if (self.ispage && cap.isie7) { |
| | | if (self.doc[0].nodeName == 'BODY') |
| | | self.css($('html'), { 'overflow-y': 'hidden' }) //IE7 double scrollbar issue |
| | | else if (self.doc[0].nodeName == 'HTML') self.css($('body'), { 'overflow-y': 'hidden' }) //IE7 double scrollbar issue |
| | | } |
| | | |
| | | if (cap.isios && !self.ispage && !self.haswrapper) |
| | | self.css($('body'), { '-webkit-overflow-scrolling': 'touch' }) //force hw acceleration |
| | | |
| | | var cursor = $(document.createElement('div')) |
| | | cursor.css({ |
| | | position: 'relative', |
| | | top: 0, |
| | | float: 'right', |
| | | width: self.opt.cursorwidth, |
| | | height: '0px', |
| | | 'background-color': self.opt.cursorcolor, |
| | | border: self.opt.cursorborder, |
| | | 'background-clip': 'padding-box', |
| | | '-webkit-border-radius': self.opt.cursorborderradius, |
| | | '-moz-border-radius': self.opt.cursorborderradius, |
| | | 'border-radius': self.opt.cursorborderradius |
| | | }) |
| | | |
| | | cursor.hborder = parseFloat(cursor.outerHeight() - cursor.innerHeight()) |
| | | self.cursor = cursor |
| | | |
| | | var rail = $(document.createElement('div')) |
| | | rail.attr('id', self.id) |
| | | rail.addClass('nicescroll-rails') |
| | | |
| | | var v, |
| | | a, |
| | | kp = ['left', 'right'] //"top","bottom" |
| | | for (var n in kp) { |
| | | a = kp[n] |
| | | v = self.opt.railpadding[a] |
| | | v ? rail.css('padding-' + a, v + 'px') : (self.opt.railpadding[a] = 0) |
| | | } |
| | | |
| | | rail.append(cursor) |
| | | |
| | | rail.width = |
| | | Math.max(parseFloat(self.opt.cursorwidth), cursor.outerWidth()) + |
| | | self.opt.railpadding['left'] + |
| | | self.opt.railpadding['right'] |
| | | rail.css({ |
| | | width: rail.width + 'px', |
| | | zIndex: self.zindex, |
| | | background: self.opt.background, |
| | | cursor: 'default' |
| | | }) |
| | | |
| | | rail.visibility = true |
| | | rail.scrollable = true |
| | | |
| | | rail.align = self.opt.railalign == 'left' ? 0 : 1 |
| | | |
| | | self.rail = rail |
| | | |
| | | self.rail.drag = false |
| | | |
| | | var zoom = false |
| | | if (self.opt.boxzoom && !self.ispage && !cap.isieold) { |
| | | zoom = document.createElement('div') |
| | | self.bind(zoom, 'click', self.doZoom) |
| | | self.zoom = $(zoom) |
| | | self.zoom.css({ |
| | | cursor: 'pointer', |
| | | 'z-index': self.zindex, |
| | | backgroundImage: 'url(' + scriptpath + 'zoomico.png)', |
| | | height: 18, |
| | | width: 18, |
| | | backgroundPosition: '0px 0px' |
| | | }) |
| | | if (self.opt.dblclickzoom) self.bind(self.win, 'dblclick', self.doZoom) |
| | | if (cap.cantouch && self.opt.gesturezoom) { |
| | | self.ongesturezoom = function (e) { |
| | | if (e.scale > 1.5) self.doZoomIn(e) |
| | | if (e.scale < 0.8) self.doZoomOut(e) |
| | | return self.cancelEvent(e) |
| | | } |
| | | self.bind(self.win, 'gestureend', self.ongesturezoom) |
| | | } |
| | | } |
| | | |
| | | // init HORIZ |
| | | |
| | | self.railh = false |
| | | |
| | | if (self.opt.horizrailenabled) { |
| | | self.css(cont, { 'overflow-x': 'hidden' }) |
| | | |
| | | var cursor = $(document.createElement('div')) |
| | | cursor.css({ |
| | | position: 'relative', |
| | | top: 0, |
| | | height: self.opt.cursorwidth, |
| | | width: '0px', |
| | | 'background-color': self.opt.cursorcolor, |
| | | border: self.opt.cursorborder, |
| | | 'background-clip': 'padding-box', |
| | | '-webkit-border-radius': self.opt.cursorborderradius, |
| | | '-moz-border-radius': self.opt.cursorborderradius, |
| | | 'border-radius': self.opt.cursorborderradius |
| | | }) |
| | | |
| | | cursor.wborder = parseFloat(cursor.outerWidth() - cursor.innerWidth()) |
| | | self.cursorh = cursor |
| | | |
| | | var railh = $(document.createElement('div')) |
| | | railh.attr('id', self.id + '-hr') |
| | | railh.addClass('nicescroll-rails') |
| | | railh.height = Math.max(parseFloat(self.opt.cursorwidth), cursor.outerHeight()) |
| | | railh.css({ |
| | | height: railh.height + 'px', |
| | | zIndex: self.zindex, |
| | | background: self.opt.background |
| | | }) |
| | | |
| | | railh.append(cursor) |
| | | |
| | | railh.visibility = true |
| | | railh.scrollable = true |
| | | |
| | | railh.align = self.opt.railvalign == 'top' ? 0 : 1 |
| | | |
| | | self.railh = railh |
| | | |
| | | self.railh.drag = false |
| | | } |
| | | |
| | | // |
| | | |
| | | if (self.ispage) { |
| | | rail.css({ position: 'fixed', top: '0px', height: '100%' }) |
| | | rail.align ? rail.css({ right: '0px' }) : rail.css({ left: '0px' }) |
| | | self.body.append(rail) |
| | | if (self.railh) { |
| | | railh.css({ position: 'fixed', left: '0px', width: '100%' }) |
| | | railh.align ? railh.css({ bottom: '0px' }) : railh.css({ top: '0px' }) |
| | | self.body.append(railh) |
| | | } |
| | | } else { |
| | | if (self.ishwscroll) { |
| | | if (self.win.css('position') == 'static') self.css(self.win, { position: 'relative' }) |
| | | var bd = self.win[0].nodeName == 'HTML' ? self.body : self.win |
| | | if (self.zoom) { |
| | | self.zoom.css({ |
| | | position: 'absolute', |
| | | top: 1, |
| | | right: 0, |
| | | 'margin-right': rail.width + 4 |
| | | }) |
| | | bd.append(self.zoom) |
| | | } |
| | | rail.css({ position: 'absolute', top: 0 }) |
| | | rail.align ? rail.css({ right: 0 }) : rail.css({ left: 0 }) |
| | | bd.append(rail) |
| | | if (railh) { |
| | | railh.css({ position: 'absolute', left: 0, bottom: 0 }) |
| | | railh.align ? railh.css({ bottom: 0 }) : railh.css({ top: 0 }) |
| | | bd.append(railh) |
| | | } |
| | | } else { |
| | | self.isfixed = self.win.css('position') == 'fixed' |
| | | var rlpos = self.isfixed ? 'fixed' : 'absolute' |
| | | |
| | | if (!self.isfixed) self.viewport = self.getViewport(self.win[0]) |
| | | if (self.viewport) { |
| | | self.body = self.viewport |
| | | if (/relative|absolute/.test(self.viewport.css('position')) == false) |
| | | self.css(self.viewport, { position: 'relative' }) |
| | | } |
| | | |
| | | rail.css({ position: rlpos }) |
| | | if (self.zoom) self.zoom.css({ position: rlpos }) |
| | | self.updateScrollBar() |
| | | self.body.append(rail) |
| | | if (self.zoom) self.body.append(self.zoom) |
| | | if (self.railh) { |
| | | railh.css({ position: rlpos }) |
| | | self.body.append(railh) |
| | | } |
| | | } |
| | | |
| | | if (cap.isios) |
| | | self.css(self.win, { |
| | | '-webkit-tap-highlight-color': 'rgba(0,0,0,0)', |
| | | '-webkit-touch-callout': 'none' |
| | | }) // prevent grey layer on click |
| | | |
| | | if (cap.isie && self.opt.disableoutline) self.win.attr('hideFocus', 'true') // IE, prevent dotted rectangle on focused div |
| | | if (cap.iswebkit && self.opt.disableoutline) self.win.css({ outline: 'none' }) |
| | | } |
| | | |
| | | if (self.opt.autohidemode === false) { |
| | | self.autohidedom = false |
| | | self.rail.css({ opacity: self.opt.cursoropacitymax }) |
| | | if (self.railh) self.railh.css({ opacity: self.opt.cursoropacitymax }) |
| | | } else if (self.opt.autohidemode === true) { |
| | | self.autohidedom = $().add(self.rail) |
| | | if (cap.isie8) self.autohidedom = self.autohidedom.add(self.cursor) |
| | | if (self.railh) self.autohidedom = self.autohidedom.add(self.railh) |
| | | if (self.railh && cap.isie8) self.autohidedom = self.autohidedom.add(self.cursorh) |
| | | } else if (self.opt.autohidemode == 'scroll') { |
| | | self.autohidedom = $().add(self.rail) |
| | | if (self.railh) self.autohidedom = self.autohidedom.add(self.railh) |
| | | } else if (self.opt.autohidemode == 'cursor') { |
| | | self.autohidedom = $().add(self.cursor) |
| | | if (self.railh) self.autohidedom = self.autohidedom.add(self.cursorh) |
| | | } else if (self.opt.autohidemode == 'hidden') { |
| | | self.autohidedom = false |
| | | self.hide() |
| | | self.locked = false |
| | | } |
| | | |
| | | if (cap.isie9mobile) { |
| | | self.scrollmom = new ScrollMomentumClass2D(self) |
| | | |
| | | /* |
| | | var trace = function(msg) { |
| | | var db = $("#debug"); |
| | | if (isNaN(msg)&&(typeof msg != "string")) { |
| | | var x = []; |
| | | for(var a in msg) { |
| | | x.push(a+":"+msg[a]); |
| | | } |
| | | msg ="{"+x.join(",")+"}"; |
| | | } |
| | | if (db.children().length>0) { |
| | | db.children().eq(0).before("<div>"+msg+"</div>"); |
| | | } else { |
| | | db.append("<div>"+msg+"</div>"); |
| | | } |
| | | } |
| | | window.onerror = function(msg,url,ln) { |
| | | trace("ERR: "+msg+" at "+ln); |
| | | } |
| | | */ |
| | | |
| | | self.onmangotouch = function (e) { |
| | | var py = self.getScrollTop() |
| | | var px = self.getScrollLeft() |
| | | |
| | | if (py == self.scrollmom.lastscrolly && px == self.scrollmom.lastscrollx) return true |
| | | // $("#debug").html('DRAG:'+py); |
| | | |
| | | var dfy = py - self.mangotouch.sy |
| | | var dfx = px - self.mangotouch.sx |
| | | var df = Math.round(Math.sqrt(Math.pow(dfx, 2) + Math.pow(dfy, 2))) |
| | | if (df == 0) return |
| | | |
| | | var dry = dfy < 0 ? -1 : 1 |
| | | var drx = dfx < 0 ? -1 : 1 |
| | | |
| | | var tm = +new Date() |
| | | if (self.mangotouch.lazy) clearTimeout(self.mangotouch.lazy) |
| | | |
| | | if ( |
| | | tm - self.mangotouch.tm > 80 || |
| | | self.mangotouch.dry != dry || |
| | | self.mangotouch.drx != drx |
| | | ) { |
| | | // trace('RESET+'+(tm-self.mangotouch.tm)); |
| | | self.scrollmom.stop() |
| | | self.scrollmom.reset(px, py) |
| | | self.mangotouch.sy = py |
| | | self.mangotouch.ly = py |
| | | self.mangotouch.sx = px |
| | | self.mangotouch.lx = px |
| | | self.mangotouch.dry = dry |
| | | self.mangotouch.drx = drx |
| | | self.mangotouch.tm = tm |
| | | } else { |
| | | self.scrollmom.stop() |
| | | self.scrollmom.update(self.mangotouch.sx - dfx, self.mangotouch.sy - dfy) |
| | | var gap = tm - self.mangotouch.tm |
| | | self.mangotouch.tm = tm |
| | | |
| | | // trace('MOVE:'+df+" - "+gap); |
| | | |
| | | var ds = Math.max( |
| | | Math.abs(self.mangotouch.ly - py), |
| | | Math.abs(self.mangotouch.lx - px) |
| | | ) |
| | | self.mangotouch.ly = py |
| | | self.mangotouch.lx = px |
| | | |
| | | if (ds > 2) { |
| | | self.mangotouch.lazy = setTimeout(function () { |
| | | // trace('END:'+ds+'+'+gap); |
| | | self.mangotouch.lazy = false |
| | | self.mangotouch.dry = 0 |
| | | self.mangotouch.drx = 0 |
| | | self.mangotouch.tm = 0 |
| | | self.scrollmom.doMomentum(30) |
| | | }, 100) |
| | | } |
| | | } |
| | | } |
| | | |
| | | var top = self.getScrollTop() |
| | | var lef = self.getScrollLeft() |
| | | self.mangotouch = { |
| | | sy: top, |
| | | ly: top, |
| | | dry: 0, |
| | | sx: lef, |
| | | lx: lef, |
| | | drx: 0, |
| | | lazy: false, |
| | | tm: 0 |
| | | } |
| | | |
| | | self.bind(self.docscroll, 'scroll', self.onmangotouch) |
| | | } else { |
| | | if (cap.cantouch || self.istouchcapable || self.opt.touchbehavior || cap.hasmstouch) { |
| | | self.scrollmom = new ScrollMomentumClass2D(self) |
| | | |
| | | self.ontouchstart = function (e) { |
| | | if (e.pointerType && e.pointerType != 2) return false |
| | | |
| | | if (!self.locked) { |
| | | if (cap.hasmstouch) { |
| | | var tg = e.target ? e.target : false |
| | | while (tg) { |
| | | var nc = $(tg).getNiceScroll() |
| | | if (nc.length > 0 && nc[0].me == self.me) break |
| | | if (nc.length > 0) return false |
| | | if (tg.nodeName == 'DIV' && tg.id == self.id) break |
| | | tg = tg.parentNode ? tg.parentNode : false |
| | | } |
| | | } |
| | | |
| | | self.cancelScroll() |
| | | |
| | | var tg = self.getTarget(e) |
| | | |
| | | if (tg) { |
| | | var skp = /INPUT/i.test(tg.nodeName) && /range/i.test(tg.type) |
| | | if (skp) return self.stopPropagation(e) |
| | | } |
| | | |
| | | if (!('clientX' in e) && 'changedTouches' in e) { |
| | | e.clientX = e.changedTouches[0].clientX |
| | | e.clientY = e.changedTouches[0].clientY |
| | | } |
| | | |
| | | if (self.forcescreen) { |
| | | var le = e |
| | | var e = { original: e.original ? e.original : e } |
| | | e.clientX = le.screenX |
| | | e.clientY = le.screenY |
| | | } |
| | | |
| | | self.rail.drag = { |
| | | x: e.clientX, |
| | | y: e.clientY, |
| | | sx: self.scroll.x, |
| | | sy: self.scroll.y, |
| | | st: self.getScrollTop(), |
| | | sl: self.getScrollLeft(), |
| | | pt: 2, |
| | | dl: false |
| | | } |
| | | |
| | | if (self.ispage || !self.opt.directionlockdeadzone) { |
| | | self.rail.drag.dl = 'f' |
| | | } else { |
| | | var view = { |
| | | w: $(window).width(), |
| | | h: $(window).height() |
| | | } |
| | | |
| | | var page = { |
| | | w: Math.max(document.body.scrollWidth, document.documentElement.scrollWidth), |
| | | h: Math.max(document.body.scrollHeight, document.documentElement.scrollHeight) |
| | | } |
| | | |
| | | var maxh = Math.max(0, page.h - view.h) |
| | | var maxw = Math.max(0, page.w - view.w) |
| | | |
| | | if (!self.rail.scrollable && self.railh.scrollable) |
| | | self.rail.drag.ck = maxh > 0 ? 'v' : false |
| | | else if (self.rail.scrollable && !self.railh.scrollable) |
| | | self.rail.drag.ck = maxw > 0 ? 'h' : false |
| | | else self.rail.drag.ck = false |
| | | if (!self.rail.drag.ck) self.rail.drag.dl = 'f' |
| | | } |
| | | |
| | | if (self.opt.touchbehavior && self.isiframe && cap.isie) { |
| | | var wp = self.win.position() |
| | | self.rail.drag.x += wp.left |
| | | self.rail.drag.y += wp.top |
| | | } |
| | | |
| | | self.hasmoving = false |
| | | self.lastmouseup = false |
| | | self.scrollmom.reset(e.clientX, e.clientY) |
| | | if (!cap.cantouch && !this.istouchcapable && !cap.hasmstouch) { |
| | | var ip = tg ? /INPUT|SELECT|TEXTAREA/i.test(tg.nodeName) : false |
| | | if (!ip) { |
| | | if (!self.ispage && cap.hasmousecapture) tg.setCapture() |
| | | return self.cancelEvent(e) |
| | | } |
| | | if (/SUBMIT|CANCEL|BUTTON/i.test($(tg).attr('type'))) { |
| | | pc = { tg: tg, click: false } |
| | | self.preventclick = pc |
| | | } |
| | | } |
| | | } |
| | | } |
| | | |
| | | self.ontouchend = function (e) { |
| | | if (e.pointerType && e.pointerType != 2) return false |
| | | if (self.rail.drag && self.rail.drag.pt == 2) { |
| | | self.scrollmom.doMomentum() |
| | | self.rail.drag = false |
| | | if (self.hasmoving) { |
| | | self.hasmoving = false |
| | | self.lastmouseup = true |
| | | self.hideCursor() |
| | | if (cap.hasmousecapture) document.releaseCapture() |
| | | if (!cap.cantouch) return self.cancelEvent(e) |
| | | } |
| | | } |
| | | } |
| | | |
| | | var moveneedoffset = self.opt.touchbehavior && self.isiframe && !cap.hasmousecapture |
| | | |
| | | self.ontouchmove = function (e, byiframe) { |
| | | if (e.pointerType && e.pointerType != 2) return false |
| | | |
| | | if (self.rail.drag && self.rail.drag.pt == 2) { |
| | | if (cap.cantouch && typeof e.original == 'undefined') return true // prevent ios "ghost" events by clickable elements |
| | | |
| | | self.hasmoving = true |
| | | |
| | | if (self.preventclick && !self.preventclick.click) { |
| | | self.preventclick.click = self.preventclick.tg.onclick || false |
| | | self.preventclick.tg.onclick = self.onpreventclick |
| | | } |
| | | |
| | | var ev = $.extend({ original: e }, e) |
| | | e = ev |
| | | |
| | | if ('changedTouches' in e) { |
| | | e.clientX = e.changedTouches[0].clientX |
| | | e.clientY = e.changedTouches[0].clientY |
| | | } |
| | | |
| | | if (self.forcescreen) { |
| | | var le = e |
| | | var e = { original: e.original ? e.original : e } |
| | | e.clientX = le.screenX |
| | | e.clientY = le.screenY |
| | | } |
| | | |
| | | var ofx = (ofy = 0) |
| | | |
| | | if (moveneedoffset && !byiframe) { |
| | | var wp = self.win.position() |
| | | ofx = -wp.left |
| | | ofy = -wp.top |
| | | } |
| | | |
| | | var fy = e.clientY + ofy |
| | | var my = fy - self.rail.drag.y |
| | | var fx = e.clientX + ofx |
| | | var mx = fx - self.rail.drag.x |
| | | |
| | | var ny = self.rail.drag.st - my |
| | | |
| | | if (self.ishwscroll && self.opt.bouncescroll) { |
| | | if (ny < 0) { |
| | | ny = Math.round(ny / 2) |
| | | // fy = 0; |
| | | } else if (ny > self.page.maxh) { |
| | | ny = self.page.maxh + Math.round((ny - self.page.maxh) / 2) |
| | | // fy = 0; |
| | | } |
| | | } else { |
| | | if (ny < 0) { |
| | | ny = 0 |
| | | fy = 0 |
| | | } |
| | | if (ny > self.page.maxh) { |
| | | ny = self.page.maxh |
| | | fy = 0 |
| | | } |
| | | } |
| | | |
| | | if (self.railh && self.railh.scrollable) { |
| | | var nx = self.rail.drag.sl - mx |
| | | |
| | | if (self.ishwscroll && self.opt.bouncescroll) { |
| | | if (nx < 0) { |
| | | nx = Math.round(nx / 2) |
| | | // fx = 0; |
| | | } else if (nx > self.page.maxw) { |
| | | nx = self.page.maxw + Math.round((nx - self.page.maxw) / 2) |
| | | // fx = 0; |
| | | } |
| | | } else { |
| | | if (nx < 0) { |
| | | nx = 0 |
| | | fx = 0 |
| | | } |
| | | if (nx > self.page.maxw) { |
| | | nx = self.page.maxw |
| | | fx = 0 |
| | | } |
| | | } |
| | | } |
| | | |
| | | var grabbed = false |
| | | if (self.rail.drag.dl) { |
| | | grabbed = true |
| | | if (self.rail.drag.dl == 'v') nx = self.rail.drag.sl |
| | | else if (self.rail.drag.dl == 'h') ny = self.rail.drag.st |
| | | } else { |
| | | var ay = Math.abs(my) |
| | | var ax = Math.abs(mx) |
| | | var dz = self.opt.directionlockdeadzone |
| | | if (self.rail.drag.ck == 'v') { |
| | | if (ay > dz && ax <= ay * 0.3) { |
| | | self.rail.drag = false |
| | | return true |
| | | } else if (ax > dz) { |
| | | self.rail.drag.dl = 'f' |
| | | $('body').scrollTop($('body').scrollTop()) // stop iOS native scrolling (when active javascript has blocked) |
| | | } |
| | | } else if (self.rail.drag.ck == 'h') { |
| | | if (ax > dz && ay <= az * 0.3) { |
| | | self.rail.drag = false |
| | | return true |
| | | } else if (ay > dz) { |
| | | self.rail.drag.dl = 'f' |
| | | $('body').scrollLeft($('body').scrollLeft()) // stop iOS native scrolling (when active javascript has blocked) |
| | | } |
| | | } |
| | | } |
| | | |
| | | self.synched('touchmove', function () { |
| | | if (self.rail.drag && self.rail.drag.pt == 2) { |
| | | if (self.prepareTransition) self.prepareTransition(0) |
| | | if (self.rail.scrollable) self.setScrollTop(ny) |
| | | self.scrollmom.update(fx, fy) |
| | | if (self.railh && self.railh.scrollable) { |
| | | self.setScrollLeft(nx) |
| | | self.showCursor(ny, nx) |
| | | } else { |
| | | self.showCursor(ny) |
| | | } |
| | | if (cap.isie10) document.selection.clear() |
| | | } |
| | | }) |
| | | |
| | | if (cap.ischrome && self.istouchcapable) grabbed = false //chrome touch emulation doesn't like! |
| | | if (grabbed) return self.cancelEvent(e) |
| | | } |
| | | } |
| | | } |
| | | |
| | | self.onmousedown = function (e, hronly) { |
| | | if (self.rail.drag && self.rail.drag.pt != 1) return |
| | | if (self.locked) return self.cancelEvent(e) |
| | | self.cancelScroll() |
| | | self.rail.drag = { |
| | | x: e.clientX, |
| | | y: e.clientY, |
| | | sx: self.scroll.x, |
| | | sy: self.scroll.y, |
| | | pt: 1, |
| | | hr: !!hronly |
| | | } |
| | | var tg = self.getTarget(e) |
| | | if (!self.ispage && cap.hasmousecapture) tg.setCapture() |
| | | if (self.isiframe && !cap.hasmousecapture) { |
| | | self.saved['csspointerevents'] = self.doc.css('pointer-events') |
| | | self.css(self.doc, { 'pointer-events': 'none' }) |
| | | } |
| | | return self.cancelEvent(e) |
| | | } |
| | | |
| | | self.onmouseup = function (e) { |
| | | if (self.rail.drag) { |
| | | if (cap.hasmousecapture) document.releaseCapture() |
| | | if (self.isiframe && !cap.hasmousecapture) |
| | | self.doc.css('pointer-events', self.saved['csspointerevents']) |
| | | if (self.rail.drag.pt != 1) return |
| | | self.rail.drag = false |
| | | //if (!self.rail.active) self.hideCursor(); |
| | | return self.cancelEvent(e) |
| | | } |
| | | } |
| | | |
| | | self.onmousemove = function (e) { |
| | | if (self.rail.drag) { |
| | | if (self.rail.drag.pt != 1) return |
| | | |
| | | if (cap.ischrome && e.which == 0) return self.onmouseup(e) |
| | | |
| | | self.cursorfreezed = true |
| | | |
| | | if (self.rail.drag.hr) { |
| | | self.scroll.x = self.rail.drag.sx + (e.clientX - self.rail.drag.x) |
| | | if (self.scroll.x < 0) self.scroll.x = 0 |
| | | var mw = self.scrollvaluemaxw |
| | | if (self.scroll.x > mw) self.scroll.x = mw |
| | | } else { |
| | | self.scroll.y = self.rail.drag.sy + (e.clientY - self.rail.drag.y) |
| | | if (self.scroll.y < 0) self.scroll.y = 0 |
| | | var my = self.scrollvaluemax |
| | | if (self.scroll.y > my) self.scroll.y = my |
| | | } |
| | | |
| | | self.synched('mousemove', function () { |
| | | if (self.rail.drag && self.rail.drag.pt == 1) { |
| | | self.showCursor() |
| | | if (self.rail.drag.hr) |
| | | self.doScrollLeft( |
| | | Math.round(self.scroll.x * self.scrollratio.x), |
| | | self.opt.cursordragspeed |
| | | ) |
| | | else |
| | | self.doScrollTop( |
| | | Math.round(self.scroll.y * self.scrollratio.y), |
| | | self.opt.cursordragspeed |
| | | ) |
| | | } |
| | | }) |
| | | |
| | | return self.cancelEvent(e) |
| | | } |
| | | /* |
| | | else { |
| | | self.checkarea = true; |
| | | } |
| | | */ |
| | | } |
| | | |
| | | if (cap.cantouch || self.opt.touchbehavior) { |
| | | self.onpreventclick = function (e) { |
| | | if (self.preventclick) { |
| | | self.preventclick.tg.onclick = self.preventclick.click |
| | | self.preventclick = false |
| | | return self.cancelEvent(e) |
| | | } |
| | | } |
| | | |
| | | // self.onmousedown = self.ontouchstart; |
| | | // self.onmouseup = self.ontouchend; |
| | | // self.onmousemove = self.ontouchmove; |
| | | |
| | | self.bind(self.win, 'mousedown', self.ontouchstart) // control content dragging |
| | | |
| | | self.onclick = cap.isios |
| | | ? false |
| | | : function (e) { |
| | | if (self.lastmouseup) { |
| | | self.lastmouseup = false |
| | | return self.cancelEvent(e) |
| | | } else { |
| | | return true |
| | | } |
| | | } |
| | | |
| | | if (self.opt.grabcursorenabled && cap.cursorgrabvalue) { |
| | | self.css(self.ispage ? self.doc : self.win, { cursor: cap.cursorgrabvalue }) |
| | | self.css(self.rail, { cursor: cap.cursorgrabvalue }) |
| | | } |
| | | } else { |
| | | function checkSelectionScroll(e) { |
| | | if (!self.selectiondrag) return |
| | | |
| | | if (e) { |
| | | var ww = self.win.outerHeight() |
| | | var df = e.pageY - self.selectiondrag.top |
| | | if (df > 0 && df < ww) df = 0 |
| | | if (df >= ww) df -= ww |
| | | self.selectiondrag.df = df |
| | | } |
| | | if (self.selectiondrag.df == 0) return |
| | | |
| | | var rt = -Math.floor(self.selectiondrag.df / 6) * 2 |
| | | // self.doScrollTop(self.getScrollTop(true)+rt); |
| | | self.doScrollBy(rt) |
| | | |
| | | self.debounced( |
| | | 'doselectionscroll', |
| | | function () { |
| | | checkSelectionScroll() |
| | | }, |
| | | 50 |
| | | ) |
| | | } |
| | | |
| | | if ('getSelection' in document) { |
| | | // A grade - Major browsers |
| | | self.hasTextSelected = function () { |
| | | return document.getSelection().rangeCount > 0 |
| | | } |
| | | } else if ('selection' in document) { |
| | | //IE9- |
| | | self.hasTextSelected = function () { |
| | | return document.selection.type != 'None' |
| | | } |
| | | } else { |
| | | self.hasTextSelected = function () { |
| | | // no support |
| | | return false |
| | | } |
| | | } |
| | | |
| | | self.onselectionstart = function (e) { |
| | | if (self.ispage) return |
| | | self.selectiondrag = self.win.offset() |
| | | } |
| | | self.onselectionend = function (e) { |
| | | self.selectiondrag = false |
| | | } |
| | | self.onselectiondrag = function (e) { |
| | | if (!self.selectiondrag) return |
| | | if (self.hasTextSelected()) |
| | | self.debounced( |
| | | 'selectionscroll', |
| | | function () { |
| | | checkSelectionScroll(e) |
| | | }, |
| | | 250 |
| | | ) |
| | | } |
| | | } |
| | | |
| | | if (cap.hasmstouch) { |
| | | self.css(self.rail, { '-ms-touch-action': 'none' }) |
| | | self.css(self.cursor, { '-ms-touch-action': 'none' }) |
| | | |
| | | self.bind(self.win, 'MSPointerDown', self.ontouchstart) |
| | | self.bind(document, 'MSPointerUp', self.ontouchend) |
| | | self.bind(document, 'MSPointerMove', self.ontouchmove) |
| | | self.bind(self.cursor, 'MSGestureHold', function (e) { |
| | | e.preventDefault() |
| | | }) |
| | | self.bind(self.cursor, 'contextmenu', function (e) { |
| | | e.preventDefault() |
| | | }) |
| | | } |
| | | |
| | | if (this.istouchcapable) { |
| | | //desktop with screen touch enabled |
| | | self.bind(self.win, 'touchstart', self.ontouchstart) |
| | | self.bind(document, 'touchend', self.ontouchend) |
| | | self.bind(document, 'touchcancel', self.ontouchend) |
| | | self.bind(document, 'touchmove', self.ontouchmove) |
| | | } |
| | | |
| | | self.bind(self.cursor, 'mousedown', self.onmousedown) |
| | | self.bind(self.cursor, 'mouseup', self.onmouseup) |
| | | |
| | | if (self.railh) { |
| | | self.bind(self.cursorh, 'mousedown', function (e) { |
| | | self.onmousedown(e, true) |
| | | }) |
| | | self.bind(self.cursorh, 'mouseup', function (e) { |
| | | if (self.rail.drag && self.rail.drag.pt == 2) return |
| | | self.rail.drag = false |
| | | self.hasmoving = false |
| | | self.hideCursor() |
| | | if (cap.hasmousecapture) document.releaseCapture() |
| | | return self.cancelEvent(e) |
| | | }) |
| | | } |
| | | |
| | | if (self.opt.cursordragontouch || (!cap.cantouch && !self.opt.touchbehavior)) { |
| | | self.rail.css({ cursor: 'default' }) |
| | | self.railh && self.railh.css({ cursor: 'default' }) |
| | | |
| | | self.jqbind(self.rail, 'mouseenter', function () { |
| | | if (self.canshowonmouseevent) self.showCursor() |
| | | self.rail.active = true |
| | | }) |
| | | self.jqbind(self.rail, 'mouseleave', function () { |
| | | self.rail.active = false |
| | | if (!self.rail.drag) self.hideCursor() |
| | | }) |
| | | |
| | | if (self.opt.sensitiverail) { |
| | | self.bind(self.rail, 'click', function (e) { |
| | | self.doRailClick(e, false, false) |
| | | }) |
| | | self.bind(self.rail, 'dblclick', function (e) { |
| | | self.doRailClick(e, true, false) |
| | | }) |
| | | self.bind(self.cursor, 'click', function (e) { |
| | | self.cancelEvent(e) |
| | | }) |
| | | self.bind(self.cursor, 'dblclick', function (e) { |
| | | self.cancelEvent(e) |
| | | }) |
| | | } |
| | | |
| | | if (self.railh) { |
| | | self.jqbind(self.railh, 'mouseenter', function () { |
| | | if (self.canshowonmouseevent) self.showCursor() |
| | | self.rail.active = true |
| | | }) |
| | | self.jqbind(self.railh, 'mouseleave', function () { |
| | | self.rail.active = false |
| | | if (!self.rail.drag) self.hideCursor() |
| | | }) |
| | | |
| | | if (self.opt.sensitiverail) { |
| | | self.bind(self.railh, 'click', function (e) { |
| | | self.doRailClick(e, false, true) |
| | | }) |
| | | self.bind(self.railh, 'dblclick', function (e) { |
| | | self.doRailClick(e, true, true) |
| | | }) |
| | | self.bind(self.cursorh, 'click', function (e) { |
| | | self.cancelEvent(e) |
| | | }) |
| | | self.bind(self.cursorh, 'dblclick', function (e) { |
| | | self.cancelEvent(e) |
| | | }) |
| | | } |
| | | } |
| | | } |
| | | |
| | | if (!cap.cantouch && !self.opt.touchbehavior) { |
| | | self.bind(cap.hasmousecapture ? self.win : document, 'mouseup', self.onmouseup) |
| | | self.bind(document, 'mousemove', self.onmousemove) |
| | | if (self.onclick) self.bind(document, 'click', self.onclick) |
| | | |
| | | if (!self.ispage && self.opt.enablescrollonselection) { |
| | | self.bind(self.win[0], 'mousedown', self.onselectionstart) |
| | | self.bind(document, 'mouseup', self.onselectionend) |
| | | self.bind(self.cursor, 'mouseup', self.onselectionend) |
| | | if (self.cursorh) self.bind(self.cursorh, 'mouseup', self.onselectionend) |
| | | self.bind(document, 'mousemove', self.onselectiondrag) |
| | | } |
| | | |
| | | if (self.zoom) { |
| | | self.jqbind(self.zoom, 'mouseenter', function () { |
| | | if (self.canshowonmouseevent) self.showCursor() |
| | | self.rail.active = true |
| | | }) |
| | | self.jqbind(self.zoom, 'mouseleave', function () { |
| | | self.rail.active = false |
| | | if (!self.rail.drag) self.hideCursor() |
| | | }) |
| | | } |
| | | } else { |
| | | self.bind(cap.hasmousecapture ? self.win : document, 'mouseup', self.ontouchend) |
| | | self.bind(document, 'mousemove', self.ontouchmove) |
| | | if (self.onclick) self.bind(document, 'click', self.onclick) |
| | | |
| | | if (self.opt.cursordragontouch) { |
| | | self.bind(self.cursor, 'mousedown', self.onmousedown) |
| | | self.bind(self.cursor, 'mousemove', self.onmousemove) |
| | | self.cursorh && self.bind(self.cursorh, 'mousedown', self.onmousedown) |
| | | self.cursorh && self.bind(self.cursorh, 'mousemove', self.onmousemove) |
| | | } |
| | | } |
| | | |
| | | if (self.opt.enablemousewheel) { |
| | | if (!self.isiframe) |
| | | self.bind( |
| | | cap.isie && self.ispage ? document : self.docscroll, |
| | | 'mousewheel', |
| | | self.onmousewheel |
| | | ) |
| | | self.bind(self.rail, 'mousewheel', self.onmousewheel) |
| | | if (self.railh) self.bind(self.railh, 'mousewheel', self.onmousewheelhr) |
| | | } |
| | | |
| | | if (!self.ispage && !cap.cantouch && !/HTML|BODY/.test(self.win[0].nodeName)) { |
| | | if (!self.win.attr('tabindex')) self.win.attr({ tabindex: tabindexcounter++ }) |
| | | |
| | | self.jqbind(self.win, 'focus', function (e) { |
| | | domfocus = self.getTarget(e).id || true |
| | | self.hasfocus = true |
| | | if (self.canshowonmouseevent) self.noticeCursor() |
| | | }) |
| | | self.jqbind(self.win, 'blur', function (e) { |
| | | domfocus = false |
| | | self.hasfocus = false |
| | | }) |
| | | |
| | | self.jqbind(self.win, 'mouseenter', function (e) { |
| | | mousefocus = self.getTarget(e).id || true |
| | | self.hasmousefocus = true |
| | | if (self.canshowonmouseevent) self.noticeCursor() |
| | | }) |
| | | self.jqbind(self.win, 'mouseleave', function () { |
| | | mousefocus = false |
| | | self.hasmousefocus = false |
| | | }) |
| | | } |
| | | } // !ie9mobile |
| | | |
| | | //Thanks to http://www.quirksmode.org !! |
| | | self.onkeypress = function (e) { |
| | | if (self.locked && self.page.maxh == 0) return true |
| | | |
| | | e = e ? e : window.e |
| | | var tg = self.getTarget(e) |
| | | if (tg && /INPUT|TEXTAREA|SELECT|OPTION/.test(tg.nodeName)) { |
| | | var tp = tg.getAttribute('type') || tg.type || false |
| | | if (!tp || !/submit|button|cancel/i.tp) return true |
| | | } |
| | | |
| | | if ( |
| | | self.hasfocus || |
| | | (self.hasmousefocus && !domfocus) || |
| | | (self.ispage && !domfocus && !mousefocus) |
| | | ) { |
| | | var key = e.keyCode |
| | | |
| | | if (self.locked && key != 27) return self.cancelEvent(e) |
| | | |
| | | var ctrl = e.ctrlKey || false |
| | | var shift = e.shiftKey || false |
| | | |
| | | var ret = false |
| | | switch (key) { |
| | | case 38: |
| | | case 63233: //safari |
| | | self.doScrollBy(24 * 3) |
| | | ret = true |
| | | break |
| | | case 40: |
| | | case 63235: //safari |
| | | self.doScrollBy(-24 * 3) |
| | | ret = true |
| | | break |
| | | case 37: |
| | | case 63232: //safari |
| | | if (self.railh) { |
| | | ctrl ? self.doScrollLeft(0) : self.doScrollLeftBy(24 * 3) |
| | | ret = true |
| | | } |
| | | break |
| | | case 39: |
| | | case 63234: //safari |
| | | if (self.railh) { |
| | | ctrl ? self.doScrollLeft(self.page.maxw) : self.doScrollLeftBy(-24 * 3) |
| | | ret = true |
| | | } |
| | | break |
| | | case 33: |
| | | case 63276: // safari |
| | | self.doScrollBy(self.view.h) |
| | | ret = true |
| | | break |
| | | case 34: |
| | | case 63277: // safari |
| | | self.doScrollBy(-self.view.h) |
| | | ret = true |
| | | break |
| | | case 36: |
| | | case 63273: // safari |
| | | self.railh && ctrl ? self.doScrollPos(0, 0) : self.doScrollTo(0) |
| | | ret = true |
| | | break |
| | | case 35: |
| | | case 63275: // safari |
| | | self.railh && ctrl |
| | | ? self.doScrollPos(self.page.maxw, self.page.maxh) |
| | | : self.doScrollTo(self.page.maxh) |
| | | ret = true |
| | | break |
| | | case 32: |
| | | if (self.opt.spacebarenabled) { |
| | | shift ? self.doScrollBy(self.view.h) : self.doScrollBy(-self.view.h) |
| | | ret = true |
| | | } |
| | | break |
| | | case 27: // ESC |
| | | if (self.zoomactive) { |
| | | self.doZoom() |
| | | ret = true |
| | | } |
| | | break |
| | | } |
| | | if (ret) return self.cancelEvent(e) |
| | | } |
| | | } |
| | | |
| | | if (self.opt.enablekeyboard) |
| | | self.bind( |
| | | document, |
| | | cap.isopera && !cap.isopera12 ? 'keypress' : 'keydown', |
| | | self.onkeypress |
| | | ) |
| | | |
| | | self.bind(window, 'resize', self.lazyResize) |
| | | self.bind(window, 'orientationchange', self.lazyResize) |
| | | |
| | | self.bind(window, 'load', self.lazyResize) |
| | | |
| | | if (cap.ischrome && !self.ispage && !self.haswrapper) { |
| | | //chrome void scrollbar bug - it persists in version 26 |
| | | var tmp = self.win.attr('style') |
| | | var ww = parseFloat(self.win.css('width')) + 1 |
| | | self.win.css('width', ww) |
| | | self.synched('chromefix', function () { |
| | | self.win.attr('style', tmp) |
| | | }) |
| | | } |
| | | |
| | | // Trying a cross-browser implementation - good luck! |
| | | |
| | | self.onAttributeChange = function (e) { |
| | | self.lazyResize(250) |
| | | } |
| | | |
| | | if (!self.ispage && !self.haswrapper) { |
| | | // redesigned MutationObserver for Chrome18+/Firefox14+/iOS6+ with support for: remove div, add/remove content |
| | | if (clsMutationObserver !== false) { |
| | | self.observer = new clsMutationObserver(function (mutations) { |
| | | mutations.forEach(self.onAttributeChange) |
| | | }) |
| | | self.observer.observe(self.win[0], { |
| | | childList: true, |
| | | characterData: false, |
| | | attributes: true, |
| | | subtree: false |
| | | }) |
| | | |
| | | self.observerremover = new clsMutationObserver(function (mutations) { |
| | | mutations.forEach(function (mo) { |
| | | if (mo.removedNodes.length > 0) { |
| | | for (var dd in mo.removedNodes) { |
| | | if (mo.removedNodes[dd] == self.win[0]) return self.remove() |
| | | } |
| | | } |
| | | }) |
| | | }) |
| | | self.observerremover.observe(self.win[0].parentNode, { |
| | | childList: true, |
| | | characterData: false, |
| | | attributes: false, |
| | | subtree: false |
| | | }) |
| | | } else { |
| | | self.bind( |
| | | self.win, |
| | | cap.isie && !cap.isie9 ? 'propertychange' : 'DOMAttrModified', |
| | | self.onAttributeChange |
| | | ) |
| | | if (cap.isie9) self.win[0].attachEvent('onpropertychange', self.onAttributeChange) //IE9 DOMAttrModified bug |
| | | self.bind(self.win, 'DOMNodeRemoved', function (e) { |
| | | if (e.target == self.win[0]) self.remove() |
| | | }) |
| | | } |
| | | } |
| | | |
| | | // |
| | | |
| | | if (!self.ispage && self.opt.boxzoom) self.bind(window, 'resize', self.resizeZoom) |
| | | if (self.istextarea) self.bind(self.win, 'mouseup', self.lazyResize) |
| | | |
| | | self.checkrtlmode = true |
| | | self.lazyResize(30) |
| | | } |
| | | |
| | | if (this.doc[0].nodeName == 'IFRAME') { |
| | | function oniframeload(e) { |
| | | self.iframexd = false |
| | | try { |
| | | var doc = 'contentDocument' in this ? this.contentDocument : this.contentWindow.document |
| | | var a = doc.domain |
| | | } catch (e) { |
| | | self.iframexd = true |
| | | doc = false |
| | | } |
| | | |
| | | if (self.iframexd) { |
| | | if ('console' in window) console.log('NiceScroll error: policy restriced iframe') |
| | | return true //cross-domain - I can't manage this |
| | | } |
| | | |
| | | self.forcescreen = true |
| | | |
| | | if (self.isiframe) { |
| | | self.iframe = { |
| | | doc: $(doc), |
| | | html: self.doc.contents().find('html')[0], |
| | | body: self.doc.contents().find('body')[0] |
| | | } |
| | | self.getContentSize = function () { |
| | | return { |
| | | w: Math.max(self.iframe.html.scrollWidth, self.iframe.body.scrollWidth), |
| | | h: Math.max(self.iframe.html.scrollHeight, self.iframe.body.scrollHeight) |
| | | } |
| | | } |
| | | self.docscroll = $(self.iframe.body) //$(this.contentWindow); |
| | | } |
| | | |
| | | if (!cap.isios && self.opt.iframeautoresize && !self.isiframe) { |
| | | self.win.scrollTop(0) // reset position |
| | | self.doc.height('') //reset height to fix browser bug |
| | | var hh = Math.max( |
| | | doc.getElementsByTagName('html')[0].scrollHeight, |
| | | doc.body.scrollHeight |
| | | ) |
| | | self.doc.height(hh) |
| | | } |
| | | self.lazyResize(30) |
| | | |
| | | if (cap.isie7) self.css($(self.iframe.html), { 'overflow-y': 'hidden' }) |
| | | //self.css($(doc.body),{'overflow-y':'hidden'}); |
| | | self.css($(self.iframe.body), { 'overflow-y': 'hidden' }) |
| | | |
| | | if ('contentWindow' in this) { |
| | | self.bind(this.contentWindow, 'scroll', self.onscroll) //IE8 & minor |
| | | } else { |
| | | self.bind(doc, 'scroll', self.onscroll) |
| | | } |
| | | |
| | | if (self.opt.enablemousewheel) { |
| | | self.bind(doc, 'mousewheel', self.onmousewheel) |
| | | } |
| | | |
| | | if (self.opt.enablekeyboard) |
| | | self.bind(doc, cap.isopera ? 'keypress' : 'keydown', self.onkeypress) |
| | | |
| | | if (cap.cantouch || self.opt.touchbehavior) { |
| | | self.bind(doc, 'mousedown', self.onmousedown) |
| | | self.bind(doc, 'mousemove', function (e) { |
| | | self.onmousemove(e, true) |
| | | }) |
| | | if (self.opt.grabcursorenabled && cap.cursorgrabvalue) |
| | | self.css($(doc.body), { cursor: cap.cursorgrabvalue }) |
| | | } |
| | | |
| | | self.bind(doc, 'mouseup', self.onmouseup) |
| | | |
| | | if (self.zoom) { |
| | | if (self.opt.dblclickzoom) self.bind(doc, 'dblclick', self.doZoom) |
| | | if (self.ongesturezoom) self.bind(doc, 'gestureend', self.ongesturezoom) |
| | | } |
| | | } |
| | | |
| | | if (this.doc[0].readyState && this.doc[0].readyState == 'complete') { |
| | | setTimeout(function () { |
| | | oniframeload.call(self.doc[0], false) |
| | | }, 500) |
| | | } |
| | | self.bind(this.doc, 'load', oniframeload) |
| | | } |
| | | } |
| | | |
| | | this.showCursor = function (py, px) { |
| | | if (self.cursortimeout) { |
| | | clearTimeout(self.cursortimeout) |
| | | self.cursortimeout = 0 |
| | | } |
| | | if (!self.rail) return |
| | | if (self.autohidedom) { |
| | | self.autohidedom.stop().css({ opacity: self.opt.cursoropacitymax }) |
| | | self.cursoractive = true |
| | | } |
| | | |
| | | if (!self.rail.drag || self.rail.drag.pt != 1) { |
| | | if (typeof py != 'undefined' && py !== false) { |
| | | self.scroll.y = Math.round((py * 1) / self.scrollratio.y) |
| | | } |
| | | if (typeof px != 'undefined') { |
| | | self.scroll.x = Math.round((px * 1) / self.scrollratio.x) |
| | | } |
| | | } |
| | | |
| | | self.cursor.css({ height: self.cursorheight, top: self.scroll.y }) |
| | | if (self.cursorh) { |
| | | !self.rail.align && self.rail.visibility |
| | | ? self.cursorh.css({ width: self.cursorwidth, left: self.scroll.x + self.rail.width }) |
| | | : self.cursorh.css({ width: self.cursorwidth, left: self.scroll.x }) |
| | | self.cursoractive = true |
| | | } |
| | | |
| | | if (self.zoom) self.zoom.stop().css({ opacity: self.opt.cursoropacitymax }) |
| | | } |
| | | |
| | | this.hideCursor = function (tm) { |
| | | if (self.cursortimeout) return |
| | | if (!self.rail) return |
| | | if (!self.autohidedom) return |
| | | self.cursortimeout = setTimeout(function () { |
| | | if (!self.rail.active || !self.showonmouseevent) { |
| | | self.autohidedom.stop().animate({ opacity: self.opt.cursoropacitymin }) |
| | | if (self.zoom) self.zoom.stop().animate({ opacity: self.opt.cursoropacitymin }) |
| | | self.cursoractive = false |
| | | } |
| | | self.cursortimeout = 0 |
| | | }, tm || self.opt.hidecursordelay) |
| | | } |
| | | |
| | | this.noticeCursor = function (tm, py, px) { |
| | | self.showCursor(py, px) |
| | | if (!self.rail.active) self.hideCursor(tm) |
| | | } |
| | | |
| | | this.getContentSize = self.ispage |
| | | ? function () { |
| | | return { |
| | | w: Math.max(document.body.scrollWidth, document.documentElement.scrollWidth), |
| | | h: Math.max(document.body.scrollHeight, document.documentElement.scrollHeight) |
| | | } |
| | | } |
| | | : self.haswrapper |
| | | ? function () { |
| | | return { |
| | | w: |
| | | self.doc.outerWidth() + |
| | | parseInt(self.win.css('paddingLeft')) + |
| | | parseInt(self.win.css('paddingRight')), |
| | | h: |
| | | self.doc.outerHeight() + |
| | | parseInt(self.win.css('paddingTop')) + |
| | | parseInt(self.win.css('paddingBottom')) |
| | | } |
| | | } |
| | | : function () { |
| | | return { |
| | | w: self.docscroll[0].scrollWidth, |
| | | h: self.docscroll[0].scrollHeight |
| | | } |
| | | } |
| | | |
| | | this.onResize = function (e, page) { |
| | | if (!self.win) return false |
| | | |
| | | if (!self.haswrapper && !self.ispage) { |
| | | if (self.win.css('display') == 'none') { |
| | | if (self.visibility) self.hideRail().hideRailHr() |
| | | return false |
| | | } else { |
| | | if (!self.hidden && !self.visibility) self.showRail().showRailHr() |
| | | } |
| | | } |
| | | |
| | | var premaxh = self.page.maxh |
| | | var premaxw = self.page.maxw |
| | | |
| | | var preview = { h: self.view.h, w: self.view.w } |
| | | |
| | | self.view = { |
| | | w: self.ispage ? self.win.width() : parseInt(self.win[0].clientWidth), |
| | | h: self.ispage ? self.win.height() : parseInt(self.win[0].clientHeight) |
| | | } |
| | | |
| | | self.page = page ? page : self.getContentSize() |
| | | |
| | | self.page.maxh = Math.max(0, self.page.h - self.view.h) |
| | | self.page.maxw = Math.max(0, self.page.w - self.view.w) |
| | | |
| | | if (self.page.maxh == premaxh && self.page.maxw == premaxw && self.view.w == preview.w) { |
| | | // test position |
| | | if (!self.ispage) { |
| | | var pos = self.win.offset() |
| | | if (self.lastposition) { |
| | | var lst = self.lastposition |
| | | if (lst.top == pos.top && lst.left == pos.left) return self //nothing to do |
| | | } |
| | | self.lastposition = pos |
| | | } else { |
| | | return self //nothing to do |
| | | } |
| | | } |
| | | |
| | | if (self.page.maxh == 0) { |
| | | self.hideRail() |
| | | self.scrollvaluemax = 0 |
| | | self.scroll.y = 0 |
| | | self.scrollratio.y = 0 |
| | | self.cursorheight = 0 |
| | | self.setScrollTop(0) |
| | | self.rail.scrollable = false |
| | | } else { |
| | | self.rail.scrollable = true |
| | | } |
| | | |
| | | if (self.page.maxw == 0) { |
| | | self.hideRailHr() |
| | | self.scrollvaluemaxw = 0 |
| | | self.scroll.x = 0 |
| | | self.scrollratio.x = 0 |
| | | self.cursorwidth = 0 |
| | | self.setScrollLeft(0) |
| | | self.railh.scrollable = false |
| | | } else { |
| | | self.railh.scrollable = true |
| | | } |
| | | |
| | | self.locked = self.page.maxh == 0 && self.page.maxw == 0 |
| | | if (self.locked) { |
| | | if (!self.ispage) self.updateScrollBar(self.view) |
| | | return false |
| | | } |
| | | |
| | | if (!self.hidden && !self.visibility) { |
| | | self.showRail().showRailHr() |
| | | } else if (!self.hidden && !self.railh.visibility) self.showRailHr() |
| | | |
| | | if (self.istextarea && self.win.css('resize') && self.win.css('resize') != 'none') |
| | | self.view.h -= 20 |
| | | |
| | | self.cursorheight = Math.min( |
| | | self.view.h, |
| | | Math.round(self.view.h * (self.view.h / self.page.h)) |
| | | ) |
| | | self.cursorheight = self.opt.cursorfixedheight |
| | | ? self.opt.cursorfixedheight |
| | | : Math.max(self.opt.cursorminheight, self.cursorheight) |
| | | |
| | | self.cursorwidth = Math.min( |
| | | self.view.w, |
| | | Math.round(self.view.w * (self.view.w / self.page.w)) |
| | | ) |
| | | self.cursorwidth = self.opt.cursorfixedheight |
| | | ? self.opt.cursorfixedheight |
| | | : Math.max(self.opt.cursorminheight, self.cursorwidth) |
| | | |
| | | self.scrollvaluemax = self.view.h - self.cursorheight - self.cursor.hborder |
| | | |
| | | if (self.railh) { |
| | | self.railh.width = self.page.maxh > 0 ? self.view.w - self.rail.width : self.view.w |
| | | self.scrollvaluemaxw = self.railh.width - self.cursorwidth - self.cursorh.wborder |
| | | } |
| | | |
| | | if (self.checkrtlmode && self.railh) { |
| | | self.checkrtlmode = false |
| | | if (self.opt.rtlmode && self.scroll.x == 0) self.setScrollLeft(self.page.maxw) |
| | | } |
| | | |
| | | if (!self.ispage) self.updateScrollBar(self.view) |
| | | |
| | | self.scrollratio = { |
| | | x: self.page.maxw / self.scrollvaluemaxw, |
| | | y: self.page.maxh / self.scrollvaluemax |
| | | } |
| | | |
| | | var sy = self.getScrollTop() |
| | | if (sy > self.page.maxh) { |
| | | self.doScrollTop(self.page.maxh) |
| | | } else { |
| | | self.scroll.y = Math.round(self.getScrollTop() * (1 / self.scrollratio.y)) |
| | | self.scroll.x = Math.round(self.getScrollLeft() * (1 / self.scrollratio.x)) |
| | | if (self.cursoractive) self.noticeCursor() |
| | | } |
| | | |
| | | if (self.scroll.y && self.getScrollTop() == 0) |
| | | self.doScrollTo(Math.floor(self.scroll.y * self.scrollratio.y)) |
| | | |
| | | return self |
| | | } |
| | | |
| | | this.resize = self.onResize |
| | | |
| | | this.lazyResize = function (tm) { |
| | | // event debounce |
| | | tm = isNaN(tm) ? 30 : tm |
| | | self.delayed('resize', self.resize, tm) |
| | | return self |
| | | } |
| | | |
| | | // modified by MDN https://developer.mozilla.org/en-US/docs/DOM/Mozilla_event_reference/wheel |
| | | function _modernWheelEvent(dom, name, fn, bubble) { |
| | | self._bind( |
| | | dom, |
| | | name, |
| | | function (e) { |
| | | var e = e ? e : window.event |
| | | var event = { |
| | | original: e, |
| | | target: e.target || e.srcElement, |
| | | type: 'wheel', |
| | | deltaMode: e.type == 'MozMousePixelScroll' ? 0 : 1, |
| | | deltaX: 0, |
| | | deltaZ: 0, |
| | | preventDefault: function () { |
| | | e.preventDefault ? e.preventDefault() : (e.returnValue = false) |
| | | return false |
| | | }, |
| | | stopImmediatePropagation: function () { |
| | | e.stopImmediatePropagation ? e.stopImmediatePropagation() : (e.cancelBubble = true) |
| | | } |
| | | } |
| | | |
| | | if (name == 'mousewheel') { |
| | | event.deltaY = (-1 / 40) * e.wheelDelta |
| | | e.wheelDeltaX && (event.deltaX = (-1 / 40) * e.wheelDeltaX) |
| | | } else { |
| | | event.deltaY = e.detail |
| | | } |
| | | |
| | | return fn.call(dom, event) |
| | | }, |
| | | bubble |
| | | ) |
| | | } |
| | | |
| | | this._bind = function (el, name, fn, bubble) { |
| | | // primitive bind |
| | | self.events.push({ e: el, n: name, f: fn, b: bubble, q: false }) |
| | | if (el.addEventListener) { |
| | | el.addEventListener(name, fn, bubble || false) |
| | | } else if (el.attachEvent) { |
| | | el.attachEvent('on' + name, fn) |
| | | } else { |
| | | el['on' + name] = fn |
| | | } |
| | | } |
| | | |
| | | this.jqbind = function (dom, name, fn) { |
| | | // use jquery bind for non-native events (mouseenter/mouseleave) |
| | | self.events.push({ e: dom, n: name, f: fn, q: true }) |
| | | $(dom).bind(name, fn) |
| | | } |
| | | |
| | | this.bind = function (dom, name, fn, bubble) { |
| | | // touch-oriented & fixing jquery bind |
| | | var el = 'jquery' in dom ? dom[0] : dom |
| | | |
| | | if (name == 'mousewheel') { |
| | | if ('onwheel' in self.win) { |
| | | self._bind(el, 'wheel', fn, bubble || false) |
| | | } else { |
| | | var wname = typeof document.onmousewheel != 'undefined' ? 'mousewheel' : 'DOMMouseScroll' // older IE/Firefox |
| | | _modernWheelEvent(el, wname, fn, bubble || false) |
| | | if (wname == 'DOMMouseScroll') |
| | | _modernWheelEvent(el, 'MozMousePixelScroll', fn, bubble || false) // Firefox legacy |
| | | } |
| | | } else if (el.addEventListener) { |
| | | if (cap.cantouch && /mouseup|mousedown|mousemove/.test(name)) { |
| | | // touch device support |
| | | var tt = name == 'mousedown' ? 'touchstart' : name == 'mouseup' ? 'touchend' : 'touchmove' |
| | | self._bind( |
| | | el, |
| | | tt, |
| | | function (e) { |
| | | if (e.touches) { |
| | | if (e.touches.length < 2) { |
| | | var ev = e.touches.length ? e.touches[0] : e |
| | | ev.original = e |
| | | fn.call(this, ev) |
| | | } |
| | | } else if (e.changedTouches) { |
| | | var ev = e.changedTouches[0] |
| | | ev.original = e |
| | | fn.call(this, ev) |
| | | } //blackberry |
| | | }, |
| | | bubble || false |
| | | ) |
| | | } |
| | | self._bind(el, name, fn, bubble || false) |
| | | if (cap.cantouch && name == 'mouseup') self._bind(el, 'touchcancel', fn, bubble || false) |
| | | } else { |
| | | self._bind(el, name, function (e) { |
| | | e = e || window.event || false |
| | | if (e) { |
| | | if (e.srcElement) e.target = e.srcElement |
| | | } |
| | | if (!('pageY' in e)) { |
| | | e.pageX = e.clientX + document.documentElement.scrollLeft |
| | | e.pageY = e.clientY + document.documentElement.scrollTop |
| | | } |
| | | return fn.call(el, e) === false || bubble === false ? self.cancelEvent(e) : true |
| | | }) |
| | | } |
| | | } |
| | | |
| | | this._unbind = function (el, name, fn, bub) { |
| | | // primitive unbind |
| | | if (el.removeEventListener) { |
| | | el.removeEventListener(name, fn, bub) |
| | | } else if (el.detachEvent) { |
| | | el.detachEvent('on' + name, fn) |
| | | } else { |
| | | el['on' + name] = false |
| | | } |
| | | } |
| | | |
| | | this.unbindAll = function () { |
| | | for (var a = 0; a < self.events.length; a++) { |
| | | var r = self.events[a] |
| | | r.q ? r.e.unbind(r.n, r.f) : self._unbind(r.e, r.n, r.f, r.b) |
| | | } |
| | | } |
| | | |
| | | // Thanks to http://www.switchonthecode.com !! |
| | | this.cancelEvent = function (e) { |
| | | var e = e.original ? e.original : e ? e : window.event || false |
| | | if (!e) return false |
| | | if (e.preventDefault) e.preventDefault() |
| | | if (e.stopPropagation) e.stopPropagation() |
| | | if (e.preventManipulation) e.preventManipulation() //IE10 |
| | | e.cancelBubble = true |
| | | e.cancel = true |
| | | e.returnValue = false |
| | | return false |
| | | } |
| | | |
| | | this.stopPropagation = function (e) { |
| | | var e = e.original ? e.original : e ? e : window.event || false |
| | | if (!e) return false |
| | | if (e.stopPropagation) return e.stopPropagation() |
| | | if (e.cancelBubble) e.cancelBubble = true |
| | | return false |
| | | } |
| | | |
| | | this.showRail = function () { |
| | | if (self.page.maxh != 0 && (self.ispage || self.win.css('display') != 'none')) { |
| | | self.visibility = true |
| | | self.rail.visibility = true |
| | | self.rail.css('display', 'block') |
| | | } |
| | | return self |
| | | } |
| | | |
| | | this.showRailHr = function () { |
| | | if (!self.railh) return self |
| | | if (self.page.maxw != 0 && (self.ispage || self.win.css('display') != 'none')) { |
| | | self.railh.visibility = true |
| | | self.railh.css('display', 'block') |
| | | } |
| | | return self |
| | | } |
| | | |
| | | this.hideRail = function () { |
| | | self.visibility = false |
| | | self.rail.visibility = false |
| | | self.rail.css('display', 'none') |
| | | return self |
| | | } |
| | | |
| | | this.hideRailHr = function () { |
| | | if (!self.railh) return self |
| | | self.railh.visibility = false |
| | | self.railh.css('display', 'none') |
| | | return self |
| | | } |
| | | |
| | | this.show = function () { |
| | | self.hidden = false |
| | | self.locked = false |
| | | return self.showRail().showRailHr() |
| | | } |
| | | |
| | | this.hide = function () { |
| | | self.hidden = true |
| | | self.locked = true |
| | | return self.hideRail().hideRailHr() |
| | | } |
| | | |
| | | this.toggle = function () { |
| | | return self.hidden ? self.show() : self.hide() |
| | | } |
| | | |
| | | this.remove = function () { |
| | | self.stop() |
| | | if (self.cursortimeout) clearTimeout(self.cursortimeout) |
| | | self.doZoomOut() |
| | | self.unbindAll() |
| | | if (self.observer !== false) self.observer.disconnect() |
| | | if (self.observerremover !== false) self.observerremover.disconnect() |
| | | self.events = [] |
| | | if (self.cursor) { |
| | | self.cursor.remove() |
| | | self.cursor = null |
| | | } |
| | | if (self.cursorh) { |
| | | self.cursorh.remove() |
| | | self.cursorh = null |
| | | } |
| | | if (self.rail) { |
| | | self.rail.remove() |
| | | self.rail = null |
| | | } |
| | | if (self.railh) { |
| | | self.railh.remove() |
| | | self.railh = null |
| | | } |
| | | if (self.zoom) { |
| | | self.zoom.remove() |
| | | self.zoom = null |
| | | } |
| | | for (var a = 0; a < self.saved.css.length; a++) { |
| | | var d = self.saved.css[a] |
| | | d[0].css(d[1], typeof d[2] == 'undefined' ? '' : d[2]) |
| | | } |
| | | self.saved = false |
| | | self.me.data('__nicescroll', '') //erase all traces |
| | | self.me = null |
| | | self.doc = null |
| | | self.docscroll = null |
| | | self.win = null |
| | | return self |
| | | } |
| | | |
| | | this.scrollstart = function (fn) { |
| | | this.onscrollstart = fn |
| | | return self |
| | | } |
| | | this.scrollend = function (fn) { |
| | | this.onscrollend = fn |
| | | return self |
| | | } |
| | | this.scrollcancel = function (fn) { |
| | | this.onscrollcancel = fn |
| | | return self |
| | | } |
| | | |
| | | this.zoomin = function (fn) { |
| | | this.onzoomin = fn |
| | | return self |
| | | } |
| | | this.zoomout = function (fn) { |
| | | this.onzoomout = fn |
| | | return self |
| | | } |
| | | |
| | | this.isScrollable = function (e) { |
| | | var dom = e.target ? e.target : e |
| | | if (dom.nodeName == 'OPTION') return true |
| | | while (dom && dom.nodeType == 1 && !/BODY|HTML/.test(dom.nodeName)) { |
| | | var dd = $(dom) |
| | | var ov = dd.css('overflowY') || dd.css('overflowX') || dd.css('overflow') || '' |
| | | if (/scroll|auto/.test(ov)) return dom.clientHeight != dom.scrollHeight |
| | | dom = dom.parentNode ? dom.parentNode : false |
| | | } |
| | | return false |
| | | } |
| | | |
| | | this.getViewport = function (me) { |
| | | var dom = me && me.parentNode ? me.parentNode : false |
| | | while (dom && dom.nodeType == 1 && !/BODY|HTML/.test(dom.nodeName)) { |
| | | var dd = $(dom) |
| | | var ov = dd.css('overflowY') || dd.css('overflowX') || dd.css('overflow') || '' |
| | | if (/scroll|auto/.test(ov) && dom.clientHeight != dom.scrollHeight) return dd |
| | | if (dd.getNiceScroll().length > 0) return dd |
| | | dom = dom.parentNode ? dom.parentNode : false |
| | | } |
| | | return false |
| | | } |
| | | |
| | | function execScrollWheel(e, hr, chkscroll) { |
| | | var px, py |
| | | var rt = 1 |
| | | |
| | | if (e.deltaMode == 0) { |
| | | // PIXEL |
| | | px = -Math.floor(e.deltaX * (self.opt.mousescrollstep / (18 * 3))) |
| | | py = -Math.floor(e.deltaY * (self.opt.mousescrollstep / (18 * 3))) |
| | | } else if (e.deltaMode == 1) { |
| | | // LINE |
| | | px = -Math.floor(e.deltaX * self.opt.mousescrollstep) |
| | | py = -Math.floor(e.deltaY * self.opt.mousescrollstep) |
| | | } |
| | | |
| | | if (hr && px == 0 && py) { |
| | | // classic vertical-only mousewheel + browser with x/y support |
| | | px = py |
| | | py = 0 |
| | | } |
| | | |
| | | if (px) { |
| | | if (self.scrollmom) { |
| | | self.scrollmom.stop() |
| | | } |
| | | self.lastdeltax += px |
| | | self.debounced( |
| | | 'mousewheelx', |
| | | function () { |
| | | var dt = self.lastdeltax |
| | | self.lastdeltax = 0 |
| | | if (!self.rail.drag) { |
| | | self.doScrollLeftBy(dt) |
| | | } |
| | | }, |
| | | 120 |
| | | ) |
| | | } |
| | | if (py) { |
| | | if (self.opt.nativeparentscrolling && chkscroll && !self.ispage && !self.zoomactive) { |
| | | if (py < 0) { |
| | | if (self.getScrollTop() >= self.page.maxh) return true |
| | | } else { |
| | | if (self.getScrollTop() <= 0) return true |
| | | } |
| | | } |
| | | if (self.scrollmom) { |
| | | self.scrollmom.stop() |
| | | } |
| | | self.lastdeltay += py |
| | | self.debounced( |
| | | 'mousewheely', |
| | | function () { |
| | | var dt = self.lastdeltay |
| | | self.lastdeltay = 0 |
| | | if (!self.rail.drag) { |
| | | self.doScrollBy(dt) |
| | | } |
| | | }, |
| | | 120 |
| | | ) |
| | | } |
| | | |
| | | e.stopImmediatePropagation() |
| | | return e.preventDefault() |
| | | // return self.cancelEvent(e); |
| | | } |
| | | |
| | | this.onmousewheel = function (e) { |
| | | if (self.locked) return true |
| | | if (self.rail.drag) return self.cancelEvent(e) |
| | | |
| | | if (!self.rail.scrollable) { |
| | | if (self.railh && self.railh.scrollable) { |
| | | return self.onmousewheelhr(e) |
| | | } else { |
| | | return true |
| | | } |
| | | } |
| | | |
| | | var nw = +new Date() |
| | | var chk = false |
| | | if (self.opt.preservenativescrolling && self.checkarea + 600 < nw) { |
| | | // self.checkarea = false; |
| | | self.nativescrollingarea = self.isScrollable(e) |
| | | chk = true |
| | | } |
| | | self.checkarea = nw |
| | | if (self.nativescrollingarea) return true // this isn't my business |
| | | // if (self.locked) return self.cancelEvent(e); |
| | | var ret = execScrollWheel(e, false, chk) |
| | | if (ret) self.checkarea = 0 |
| | | return ret |
| | | } |
| | | |
| | | this.onmousewheelhr = function (e) { |
| | | if (self.locked || !self.railh.scrollable) return true |
| | | if (self.rail.drag) return self.cancelEvent(e) |
| | | |
| | | var nw = +new Date() |
| | | var chk = false |
| | | if (self.opt.preservenativescrolling && self.checkarea + 600 < nw) { |
| | | // self.checkarea = false; |
| | | self.nativescrollingarea = self.isScrollable(e) |
| | | chk = true |
| | | } |
| | | self.checkarea = nw |
| | | if (self.nativescrollingarea) return true // this isn't my business |
| | | if (self.locked) return self.cancelEvent(e) |
| | | |
| | | return execScrollWheel(e, true, chk) |
| | | } |
| | | |
| | | this.stop = function () { |
| | | self.cancelScroll() |
| | | if (self.scrollmon) self.scrollmon.stop() |
| | | self.cursorfreezed = false |
| | | self.scroll.y = Math.round(self.getScrollTop() * (1 / self.scrollratio.y)) |
| | | self.noticeCursor() |
| | | return self |
| | | } |
| | | |
| | | this.getTransitionSpeed = function (dif) { |
| | | var sp = Math.round(self.opt.scrollspeed * 10) |
| | | var ex = Math.min(sp, Math.round((dif / 20) * self.opt.scrollspeed)) |
| | | return ex > 20 ? ex : 0 |
| | | } |
| | | |
| | | if (!self.opt.smoothscroll) { |
| | | this.doScrollLeft = function (x, spd) { |
| | | //direct |
| | | var y = self.getScrollTop() |
| | | self.doScrollPos(x, y, spd) |
| | | } |
| | | this.doScrollTop = function (y, spd) { |
| | | //direct |
| | | var x = self.getScrollLeft() |
| | | self.doScrollPos(x, y, spd) |
| | | } |
| | | this.doScrollPos = function (x, y, spd) { |
| | | //direct |
| | | var nx = x > self.page.maxw ? self.page.maxw : x |
| | | if (nx < 0) nx = 0 |
| | | var ny = y > self.page.maxh ? self.page.maxh : y |
| | | if (ny < 0) ny = 0 |
| | | self.synched('scroll', function () { |
| | | self.setScrollTop(ny) |
| | | self.setScrollLeft(nx) |
| | | }) |
| | | } |
| | | this.cancelScroll = function () {} // direct |
| | | } else if (self.ishwscroll && cap.hastransition && self.opt.usetransition) { |
| | | this.prepareTransition = function (dif, istime) { |
| | | var ex = istime ? (dif > 20 ? dif : 0) : self.getTransitionSpeed(dif) |
| | | var trans = ex ? cap.prefixstyle + 'transform ' + ex + 'ms ease-out' : '' |
| | | if (!self.lasttransitionstyle || self.lasttransitionstyle != trans) { |
| | | self.lasttransitionstyle = trans |
| | | self.doc.css(cap.transitionstyle, trans) |
| | | } |
| | | return ex |
| | | } |
| | | |
| | | this.doScrollLeft = function (x, spd) { |
| | | //trans |
| | | var y = self.scrollrunning ? self.newscrolly : self.getScrollTop() |
| | | self.doScrollPos(x, y, spd) |
| | | } |
| | | |
| | | this.doScrollTop = function (y, spd) { |
| | | //trans |
| | | var x = self.scrollrunning ? self.newscrollx : self.getScrollLeft() |
| | | self.doScrollPos(x, y, spd) |
| | | } |
| | | |
| | | this.doScrollPos = function (x, y, spd) { |
| | | //trans |
| | | |
| | | var py = self.getScrollTop() |
| | | var px = self.getScrollLeft() |
| | | |
| | | if ((self.newscrolly - py) * (y - py) < 0 || (self.newscrollx - px) * (x - px) < 0) |
| | | self.cancelScroll() //inverted movement detection |
| | | |
| | | if (self.opt.bouncescroll == false) { |
| | | if (y < 0) y = 0 |
| | | else if (y > self.page.maxh) y = self.page.maxh |
| | | if (x < 0) x = 0 |
| | | else if (x > self.page.maxw) x = self.page.maxw |
| | | } |
| | | |
| | | if (self.scrollrunning && x == self.newscrollx && y == self.newscrolly) return false |
| | | |
| | | self.newscrolly = y |
| | | self.newscrollx = x |
| | | |
| | | self.newscrollspeed = spd || false |
| | | |
| | | if (self.timer) return false |
| | | |
| | | self.timer = setTimeout(function () { |
| | | var top = self.getScrollTop() |
| | | var lft = self.getScrollLeft() |
| | | |
| | | var dst = {} |
| | | dst.x = x - lft |
| | | dst.y = y - top |
| | | dst.px = lft |
| | | dst.py = top |
| | | |
| | | var dd = Math.round(Math.sqrt(Math.pow(dst.x, 2) + Math.pow(dst.y, 2))) |
| | | |
| | | // var df = (self.newscrollspeed) ? self.newscrollspeed : dd; |
| | | |
| | | var ms = |
| | | self.newscrollspeed && self.newscrollspeed > 1 |
| | | ? self.newscrollspeed |
| | | : self.getTransitionSpeed(dd) |
| | | if (self.newscrollspeed && self.newscrollspeed <= 1) ms *= self.newscrollspeed |
| | | |
| | | self.prepareTransition(ms, true) |
| | | |
| | | if (self.timerscroll && self.timerscroll.tm) clearInterval(self.timerscroll.tm) |
| | | |
| | | if (ms > 0) { |
| | | if (!self.scrollrunning && self.onscrollstart) { |
| | | var info = { |
| | | type: 'scrollstart', |
| | | current: { x: lft, y: top }, |
| | | request: { x: x, y: y }, |
| | | end: { x: self.newscrollx, y: self.newscrolly }, |
| | | speed: ms |
| | | } |
| | | self.onscrollstart.call(self, info) |
| | | } |
| | | |
| | | if (cap.transitionend) { |
| | | if (!self.scrollendtrapped) { |
| | | self.scrollendtrapped = true |
| | | self.bind(self.doc, cap.transitionend, self.onScrollEnd, false) //I have got to do something usefull!! |
| | | } |
| | | } else { |
| | | if (self.scrollendtrapped) clearTimeout(self.scrollendtrapped) |
| | | self.scrollendtrapped = setTimeout(self.onScrollEnd, ms) // simulate transitionend event |
| | | } |
| | | |
| | | var py = top |
| | | var px = lft |
| | | self.timerscroll = { |
| | | bz: new BezierClass(py, self.newscrolly, ms, 0, 0, 0.58, 1), |
| | | bh: new BezierClass(px, self.newscrollx, ms, 0, 0, 0.58, 1) |
| | | } |
| | | if (!self.cursorfreezed) |
| | | self.timerscroll.tm = setInterval(function () { |
| | | self.showCursor(self.getScrollTop(), self.getScrollLeft()) |
| | | }, 60) |
| | | } |
| | | |
| | | self.synched('doScroll-set', function () { |
| | | self.timer = 0 |
| | | if (self.scrollendtrapped) self.scrollrunning = true |
| | | self.setScrollTop(self.newscrolly) |
| | | self.setScrollLeft(self.newscrollx) |
| | | if (!self.scrollendtrapped) self.onScrollEnd() |
| | | }) |
| | | }, 50) |
| | | } |
| | | |
| | | this.cancelScroll = function () { |
| | | if (!self.scrollendtrapped) return true |
| | | var py = self.getScrollTop() |
| | | var px = self.getScrollLeft() |
| | | self.scrollrunning = false |
| | | if (!cap.transitionend) clearTimeout(cap.transitionend) |
| | | self.scrollendtrapped = false |
| | | self._unbind(self.doc, cap.transitionend, self.onScrollEnd) |
| | | self.prepareTransition(0) |
| | | self.setScrollTop(py) // fire event onscroll |
| | | if (self.railh) self.setScrollLeft(px) |
| | | if (self.timerscroll && self.timerscroll.tm) clearInterval(self.timerscroll.tm) |
| | | self.timerscroll = false |
| | | |
| | | self.cursorfreezed = false |
| | | |
| | | //self.noticeCursor(false,py,px); |
| | | self.showCursor(py, px) |
| | | return self |
| | | } |
| | | this.onScrollEnd = function () { |
| | | if (self.scrollendtrapped) self._unbind(self.doc, cap.transitionend, self.onScrollEnd) |
| | | self.scrollendtrapped = false |
| | | self.prepareTransition(0) |
| | | if (self.timerscroll && self.timerscroll.tm) clearInterval(self.timerscroll.tm) |
| | | self.timerscroll = false |
| | | var py = self.getScrollTop() |
| | | var px = self.getScrollLeft() |
| | | self.setScrollTop(py) // fire event onscroll |
| | | if (self.railh) self.setScrollLeft(px) // fire event onscroll left |
| | | |
| | | self.noticeCursor(false, py, px) |
| | | |
| | | self.cursorfreezed = false |
| | | |
| | | if (py < 0) py = 0 |
| | | else if (py > self.page.maxh) py = self.page.maxh |
| | | if (px < 0) px = 0 |
| | | else if (px > self.page.maxw) px = self.page.maxw |
| | | if (py != self.newscrolly || px != self.newscrollx) |
| | | return self.doScrollPos(px, py, self.opt.snapbackspeed) |
| | | |
| | | if (self.onscrollend && self.scrollrunning) { |
| | | var info = { |
| | | type: 'scrollend', |
| | | current: { x: px, y: py }, |
| | | end: { x: self.newscrollx, y: self.newscrolly } |
| | | } |
| | | self.onscrollend.call(self, info) |
| | | } |
| | | self.scrollrunning = false |
| | | } |
| | | } else { |
| | | this.doScrollLeft = function (x, spd) { |
| | | //no-trans |
| | | var y = self.scrollrunning ? self.newscrolly : self.getScrollTop() |
| | | self.doScrollPos(x, y, spd) |
| | | } |
| | | |
| | | this.doScrollTop = function (y, spd) { |
| | | //no-trans |
| | | var x = self.scrollrunning ? self.newscrollx : self.getScrollLeft() |
| | | self.doScrollPos(x, y, spd) |
| | | } |
| | | |
| | | this.doScrollPos = function (x, y, spd) { |
| | | //no-trans |
| | | var y = typeof y == 'undefined' || y === false ? self.getScrollTop(true) : y |
| | | |
| | | if (self.timer && self.newscrolly == y && self.newscrollx == x) return true |
| | | |
| | | if (self.timer) clearAnimationFrame(self.timer) |
| | | self.timer = 0 |
| | | |
| | | var py = self.getScrollTop() |
| | | var px = self.getScrollLeft() |
| | | |
| | | if ((self.newscrolly - py) * (y - py) < 0 || (self.newscrollx - px) * (x - px) < 0) |
| | | self.cancelScroll() //inverted movement detection |
| | | |
| | | self.newscrolly = y |
| | | self.newscrollx = x |
| | | |
| | | if (!self.bouncescroll || !self.rail.visibility) { |
| | | if (self.newscrolly < 0) { |
| | | self.newscrolly = 0 |
| | | } else if (self.newscrolly > self.page.maxh) { |
| | | self.newscrolly = self.page.maxh |
| | | } |
| | | } |
| | | if (!self.bouncescroll || !self.railh.visibility) { |
| | | if (self.newscrollx < 0) { |
| | | self.newscrollx = 0 |
| | | } else if (self.newscrollx > self.page.maxw) { |
| | | self.newscrollx = self.page.maxw |
| | | } |
| | | } |
| | | |
| | | self.dst = {} |
| | | self.dst.x = x - px |
| | | self.dst.y = y - py |
| | | self.dst.px = px |
| | | self.dst.py = py |
| | | |
| | | var dst = Math.round(Math.sqrt(Math.pow(self.dst.x, 2) + Math.pow(self.dst.y, 2))) |
| | | |
| | | self.dst.ax = self.dst.x / dst |
| | | self.dst.ay = self.dst.y / dst |
| | | |
| | | var pa = 0 |
| | | var pe = dst |
| | | |
| | | if (self.dst.x == 0) { |
| | | pa = py |
| | | pe = y |
| | | self.dst.ay = 1 |
| | | self.dst.py = 0 |
| | | } else if (self.dst.y == 0) { |
| | | pa = px |
| | | pe = x |
| | | self.dst.ax = 1 |
| | | self.dst.px = 0 |
| | | } |
| | | |
| | | var ms = self.getTransitionSpeed(dst) |
| | | if (spd && spd <= 1) ms *= spd |
| | | if (ms > 0) { |
| | | self.bzscroll = self.bzscroll |
| | | ? self.bzscroll.update(pe, ms) |
| | | : new BezierClass(pa, pe, ms, 0, 1, 0, 1) |
| | | } else { |
| | | self.bzscroll = false |
| | | } |
| | | |
| | | if (self.timer) return |
| | | |
| | | if ( |
| | | (py == self.page.maxh && y >= self.page.maxh) || |
| | | (px == self.page.maxw && x >= self.page.maxw) |
| | | ) |
| | | self.checkContentSize() |
| | | |
| | | var sync = 1 |
| | | |
| | | function scrolling() { |
| | | if (self.cancelAnimationFrame) return true |
| | | |
| | | self.scrollrunning = true |
| | | |
| | | sync = 1 - sync |
| | | if (sync) return (self.timer = setAnimationFrame(scrolling) || 1) |
| | | |
| | | var done = 0 |
| | | |
| | | var sc = (sy = self.getScrollTop()) |
| | | if (self.dst.ay) { |
| | | sc = self.bzscroll |
| | | ? self.dst.py + self.bzscroll.getNow() * self.dst.ay |
| | | : self.newscrolly |
| | | var dr = sc - sy |
| | | if ((dr < 0 && sc < self.newscrolly) || (dr > 0 && sc > self.newscrolly)) |
| | | sc = self.newscrolly |
| | | self.setScrollTop(sc) |
| | | if (sc == self.newscrolly) done = 1 |
| | | } else { |
| | | done = 1 |
| | | } |
| | | |
| | | var scx = (sx = self.getScrollLeft()) |
| | | if (self.dst.ax) { |
| | | scx = self.bzscroll |
| | | ? self.dst.px + self.bzscroll.getNow() * self.dst.ax |
| | | : self.newscrollx |
| | | var dr = scx - sx |
| | | if ((dr < 0 && scx < self.newscrollx) || (dr > 0 && scx > self.newscrollx)) |
| | | scx = self.newscrollx |
| | | self.setScrollLeft(scx) |
| | | if (scx == self.newscrollx) done += 1 |
| | | } else { |
| | | done += 1 |
| | | } |
| | | |
| | | if (done == 2) { |
| | | self.timer = 0 |
| | | self.cursorfreezed = false |
| | | self.bzscroll = false |
| | | self.scrollrunning = false |
| | | if (sc < 0) sc = 0 |
| | | else if (sc > self.page.maxh) sc = self.page.maxh |
| | | if (scx < 0) scx = 0 |
| | | else if (scx > self.page.maxw) scx = self.page.maxw |
| | | if (scx != self.newscrollx || sc != self.newscrolly) self.doScrollPos(scx, sc) |
| | | else { |
| | | if (self.onscrollend) { |
| | | var info = { |
| | | type: 'scrollend', |
| | | current: { x: sx, y: sy }, |
| | | end: { x: self.newscrollx, y: self.newscrolly } |
| | | } |
| | | self.onscrollend.call(self, info) |
| | | } |
| | | } |
| | | } else { |
| | | self.timer = setAnimationFrame(scrolling) || 1 |
| | | } |
| | | } |
| | | self.cancelAnimationFrame = false |
| | | self.timer = 1 |
| | | |
| | | if (self.onscrollstart && !self.scrollrunning) { |
| | | var info = { |
| | | type: 'scrollstart', |
| | | current: { x: px, y: py }, |
| | | request: { x: x, y: y }, |
| | | end: { x: self.newscrollx, y: self.newscrolly }, |
| | | speed: ms |
| | | } |
| | | self.onscrollstart.call(self, info) |
| | | } |
| | | |
| | | scrolling() |
| | | |
| | | if ((py == self.page.maxh && y >= py) || (px == self.page.maxw && x >= px)) |
| | | self.checkContentSize() |
| | | |
| | | self.noticeCursor() |
| | | } |
| | | |
| | | this.cancelScroll = function () { |
| | | if (self.timer) clearAnimationFrame(self.timer) |
| | | self.timer = 0 |
| | | self.bzscroll = false |
| | | self.scrollrunning = false |
| | | return self |
| | | } |
| | | } |
| | | |
| | | this.doScrollBy = function (stp, relative) { |
| | | var ny = 0 |
| | | if (relative) { |
| | | ny = Math.floor((self.scroll.y - stp) * self.scrollratio.y) |
| | | } else { |
| | | var sy = self.timer ? self.newscrolly : self.getScrollTop(true) |
| | | ny = sy - stp |
| | | } |
| | | if (self.bouncescroll) { |
| | | var haf = Math.round(self.view.h / 2) |
| | | if (ny < -haf) ny = -haf |
| | | else if (ny > self.page.maxh + haf) ny = self.page.maxh + haf |
| | | } |
| | | self.cursorfreezed = false |
| | | |
| | | py = self.getScrollTop(true) |
| | | if (ny < 0 && py <= 0) return self.noticeCursor() |
| | | else if (ny > self.page.maxh && py >= self.page.maxh) { |
| | | self.checkContentSize() |
| | | return self.noticeCursor() |
| | | } |
| | | |
| | | self.doScrollTop(ny) |
| | | } |
| | | |
| | | this.doScrollLeftBy = function (stp, relative) { |
| | | var nx = 0 |
| | | if (relative) { |
| | | nx = Math.floor((self.scroll.x - stp) * self.scrollratio.x) |
| | | } else { |
| | | var sx = self.timer ? self.newscrollx : self.getScrollLeft(true) |
| | | nx = sx - stp |
| | | } |
| | | if (self.bouncescroll) { |
| | | var haf = Math.round(self.view.w / 2) |
| | | if (nx < -haf) nx = -haf |
| | | else if (nx > self.page.maxw + haf) nx = self.page.maxw + haf |
| | | } |
| | | self.cursorfreezed = false |
| | | |
| | | px = self.getScrollLeft(true) |
| | | if (nx < 0 && px <= 0) return self.noticeCursor() |
| | | else if (nx > self.page.maxw && px >= self.page.maxw) return self.noticeCursor() |
| | | |
| | | self.doScrollLeft(nx) |
| | | } |
| | | |
| | | this.doScrollTo = function (pos, relative) { |
| | | var ny = relative ? Math.round(pos * self.scrollratio.y) : pos |
| | | if (ny < 0) ny = 0 |
| | | else if (ny > self.page.maxh) ny = self.page.maxh |
| | | self.cursorfreezed = false |
| | | self.doScrollTop(pos) |
| | | } |
| | | |
| | | this.checkContentSize = function () { |
| | | var pg = self.getContentSize() |
| | | if (pg.h != self.page.h || pg.w != self.page.w) self.resize(false, pg) |
| | | } |
| | | |
| | | self.onscroll = function (e) { |
| | | if (self.rail.drag) return |
| | | if (!self.cursorfreezed) { |
| | | self.synched('scroll', function () { |
| | | self.scroll.y = Math.round(self.getScrollTop() * (1 / self.scrollratio.y)) |
| | | if (self.railh) |
| | | self.scroll.x = Math.round(self.getScrollLeft() * (1 / self.scrollratio.x)) |
| | | self.noticeCursor() |
| | | }) |
| | | } |
| | | } |
| | | self.bind(self.docscroll, 'scroll', self.onscroll) |
| | | |
| | | this.doZoomIn = function (e) { |
| | | if (self.zoomactive) return |
| | | self.zoomactive = true |
| | | |
| | | self.zoomrestore = { |
| | | style: {} |
| | | } |
| | | var lst = [ |
| | | 'position', |
| | | 'top', |
| | | 'left', |
| | | 'zIndex', |
| | | 'backgroundColor', |
| | | 'marginTop', |
| | | 'marginBottom', |
| | | 'marginLeft', |
| | | 'marginRight' |
| | | ] |
| | | var win = self.win[0].style |
| | | for (var a in lst) { |
| | | var pp = lst[a] |
| | | self.zoomrestore.style[pp] = typeof win[pp] != 'undefined' ? win[pp] : '' |
| | | } |
| | | |
| | | self.zoomrestore.style.width = self.win.css('width') |
| | | self.zoomrestore.style.height = self.win.css('height') |
| | | |
| | | self.zoomrestore.padding = { |
| | | w: self.win.outerWidth() - self.win.width(), |
| | | h: self.win.outerHeight() - self.win.height() |
| | | } |
| | | |
| | | if (cap.isios4) { |
| | | self.zoomrestore.scrollTop = $(window).scrollTop() |
| | | $(window).scrollTop(0) |
| | | } |
| | | |
| | | self.win.css({ |
| | | position: cap.isios4 ? 'absolute' : 'fixed', |
| | | top: 0, |
| | | left: 0, |
| | | 'z-index': globalmaxzindex + 100, |
| | | margin: '0px' |
| | | }) |
| | | var bkg = self.win.css('backgroundColor') |
| | | if (bkg == '' || /transparent|rgba\(0, 0, 0, 0\)|rgba\(0,0,0,0\)/.test(bkg)) |
| | | self.win.css('backgroundColor', '#fff') |
| | | self.rail.css({ 'z-index': globalmaxzindex + 101 }) |
| | | self.zoom.css({ 'z-index': globalmaxzindex + 102 }) |
| | | self.zoom.css('backgroundPosition', '0px -18px') |
| | | self.resizeZoom() |
| | | |
| | | if (self.onzoomin) self.onzoomin.call(self) |
| | | |
| | | return self.cancelEvent(e) |
| | | } |
| | | |
| | | this.doZoomOut = function (e) { |
| | | if (!self.zoomactive) return |
| | | self.zoomactive = false |
| | | |
| | | self.win.css('margin', '') |
| | | self.win.css(self.zoomrestore.style) |
| | | |
| | | if (cap.isios4) { |
| | | $(window).scrollTop(self.zoomrestore.scrollTop) |
| | | } |
| | | |
| | | self.rail.css({ 'z-index': self.zindex }) |
| | | self.zoom.css({ 'z-index': self.zindex }) |
| | | self.zoomrestore = false |
| | | self.zoom.css('backgroundPosition', '0px 0px') |
| | | self.onResize() |
| | | |
| | | if (self.onzoomout) self.onzoomout.call(self) |
| | | |
| | | return self.cancelEvent(e) |
| | | } |
| | | |
| | | this.doZoom = function (e) { |
| | | return self.zoomactive ? self.doZoomOut(e) : self.doZoomIn(e) |
| | | } |
| | | |
| | | this.resizeZoom = function () { |
| | | if (!self.zoomactive) return |
| | | |
| | | var py = self.getScrollTop() //preserve scrolling position |
| | | self.win.css({ |
| | | width: $(window).width() - self.zoomrestore.padding.w + 'px', |
| | | height: $(window).height() - self.zoomrestore.padding.h + 'px' |
| | | }) |
| | | self.onResize() |
| | | |
| | | self.setScrollTop(Math.min(self.page.maxh, py)) |
| | | } |
| | | |
| | | this.init() |
| | | |
| | | $.nicescroll.push(this) |
| | | } |
| | | |
| | | // Inspired by the work of Kin Blas |
| | | // http://webpro.host.adobe.com/people/jblas/momentum/includes/jquery.momentum.0.7.js |
| | | |
| | | var ScrollMomentumClass2D = function (nc) { |
| | | var self = this |
| | | this.nc = nc |
| | | |
| | | this.lastx = 0 |
| | | this.lasty = 0 |
| | | this.speedx = 0 |
| | | this.speedy = 0 |
| | | this.lasttime = 0 |
| | | this.steptime = 0 |
| | | this.snapx = false |
| | | this.snapy = false |
| | | this.demulx = 0 |
| | | this.demuly = 0 |
| | | |
| | | this.lastscrollx = -1 |
| | | this.lastscrolly = -1 |
| | | |
| | | this.chkx = 0 |
| | | this.chky = 0 |
| | | |
| | | this.timer = 0 |
| | | |
| | | this.time = function () { |
| | | return +new Date() //beautifull hack |
| | | } |
| | | |
| | | this.reset = function (px, py) { |
| | | self.stop() |
| | | var now = self.time() |
| | | self.steptime = 0 |
| | | self.lasttime = now |
| | | self.speedx = 0 |
| | | self.speedy = 0 |
| | | self.lastx = px |
| | | self.lasty = py |
| | | self.lastscrollx = -1 |
| | | self.lastscrolly = -1 |
| | | } |
| | | |
| | | this.update = function (px, py) { |
| | | var now = self.time() |
| | | self.steptime = now - self.lasttime |
| | | self.lasttime = now |
| | | var dy = py - self.lasty |
| | | var dx = px - self.lastx |
| | | var sy = self.nc.getScrollTop() |
| | | var sx = self.nc.getScrollLeft() |
| | | var newy = sy + dy |
| | | var newx = sx + dx |
| | | self.snapx = newx < 0 || newx > self.nc.page.maxw |
| | | self.snapy = newy < 0 || newy > self.nc.page.maxh |
| | | self.speedx = dx |
| | | self.speedy = dy |
| | | self.lastx = px |
| | | self.lasty = py |
| | | } |
| | | |
| | | this.stop = function () { |
| | | self.nc.unsynched('domomentum2d') |
| | | if (self.timer) clearTimeout(self.timer) |
| | | self.timer = 0 |
| | | self.lastscrollx = -1 |
| | | self.lastscrolly = -1 |
| | | } |
| | | |
| | | this.doSnapy = function (nx, ny) { |
| | | var snap = false |
| | | |
| | | if (ny < 0) { |
| | | ny = 0 |
| | | snap = true |
| | | } else if (ny > self.nc.page.maxh) { |
| | | ny = self.nc.page.maxh |
| | | snap = true |
| | | } |
| | | |
| | | if (nx < 0) { |
| | | nx = 0 |
| | | snap = true |
| | | } else if (nx > self.nc.page.maxw) { |
| | | nx = self.nc.page.maxw |
| | | snap = true |
| | | } |
| | | |
| | | if (snap) self.nc.doScrollPos(nx, ny, self.nc.opt.snapbackspeed) |
| | | } |
| | | |
| | | this.doMomentum = function (gp) { |
| | | var t = self.time() |
| | | var l = gp ? t + gp : self.lasttime |
| | | |
| | | var sl = self.nc.getScrollLeft() |
| | | var st = self.nc.getScrollTop() |
| | | |
| | | var pageh = self.nc.page.maxh |
| | | var pagew = self.nc.page.maxw |
| | | |
| | | self.speedx = pagew > 0 ? Math.min(60, self.speedx) : 0 |
| | | self.speedy = pageh > 0 ? Math.min(60, self.speedy) : 0 |
| | | |
| | | var chk = l && t - l <= 50 |
| | | |
| | | if (st < 0 || st > pageh || sl < 0 || sl > pagew) chk = false |
| | | |
| | | var sy = self.speedy && chk ? self.speedy : false |
| | | var sx = self.speedx && chk ? self.speedx : false |
| | | |
| | | if (sy || sx) { |
| | | var tm = Math.max(16, self.steptime) //timeout granularity |
| | | |
| | | if (tm > 50) { |
| | | // do smooth |
| | | var xm = tm / 50 |
| | | self.speedx *= xm |
| | | self.speedy *= xm |
| | | tm = 50 |
| | | } |
| | | |
| | | self.demulxy = 0 |
| | | |
| | | self.lastscrollx = self.nc.getScrollLeft() |
| | | self.chkx = self.lastscrollx |
| | | self.lastscrolly = self.nc.getScrollTop() |
| | | self.chky = self.lastscrolly |
| | | |
| | | var nx = self.lastscrollx |
| | | var ny = self.lastscrolly |
| | | |
| | | var onscroll = function () { |
| | | var df = self.time() - t > 600 ? 0.04 : 0.02 |
| | | |
| | | if (self.speedx) { |
| | | nx = Math.floor(self.lastscrollx - self.speedx * (1 - self.demulxy)) |
| | | self.lastscrollx = nx |
| | | if (nx < 0 || nx > pagew) df = 0.1 |
| | | } |
| | | |
| | | if (self.speedy) { |
| | | ny = Math.floor(self.lastscrolly - self.speedy * (1 - self.demulxy)) |
| | | self.lastscrolly = ny |
| | | if (ny < 0 || ny > pageh) df = 0.1 |
| | | } |
| | | |
| | | self.demulxy = Math.min(1, self.demulxy + df) |
| | | |
| | | self.nc.synched('domomentum2d', function () { |
| | | if (self.speedx) { |
| | | var scx = self.nc.getScrollLeft() |
| | | if (scx != self.chkx) self.stop() |
| | | self.chkx = nx |
| | | self.nc.setScrollLeft(nx) |
| | | } |
| | | |
| | | if (self.speedy) { |
| | | var scy = self.nc.getScrollTop() |
| | | if (scy != self.chky) self.stop() |
| | | self.chky = ny |
| | | self.nc.setScrollTop(ny) |
| | | } |
| | | |
| | | if (!self.timer) { |
| | | self.nc.hideCursor() |
| | | self.doSnapy(nx, ny) |
| | | } |
| | | }) |
| | | |
| | | if (self.demulxy < 1) { |
| | | self.timer = setTimeout(onscroll, tm) |
| | | } else { |
| | | self.stop() |
| | | self.nc.hideCursor() |
| | | self.doSnapy(nx, ny) |
| | | } |
| | | } |
| | | |
| | | onscroll() |
| | | } else { |
| | | self.doSnapy(self.nc.getScrollLeft(), self.nc.getScrollTop()) |
| | | } |
| | | } |
| | | } |
| | | |
| | | // override jQuery scrollTop |
| | | |
| | | var _scrollTop = jQuery.fn.scrollTop // preserve original function |
| | | |
| | | jQuery.cssHooks['pageYOffset'] = { |
| | | get: function (elem, computed, extra) { |
| | | var nice = $.data(elem, '__nicescroll') || false |
| | | return nice && nice.ishwscroll ? nice.getScrollTop() : _scrollTop.call(elem) |
| | | }, |
| | | set: function (elem, value) { |
| | | var nice = $.data(elem, '__nicescroll') || false |
| | | nice && nice.ishwscroll ? nice.setScrollTop(parseInt(value)) : _scrollTop.call(elem, value) |
| | | return this |
| | | } |
| | | } |
| | | |
| | | /* |
| | | $.fx.step["scrollTop"] = function(fx){ |
| | | $.cssHooks["scrollTop"].set( fx.elem, fx.now + fx.unit ); |
| | | }; |
| | | */ |
| | | |
| | | jQuery.fn.scrollTop = function (value) { |
| | | if (typeof value == 'undefined') { |
| | | var nice = this[0] ? $.data(this[0], '__nicescroll') || false : false |
| | | return nice && nice.ishwscroll ? nice.getScrollTop() : _scrollTop.call(this) |
| | | } else { |
| | | return this.each(function () { |
| | | var nice = $.data(this, '__nicescroll') || false |
| | | nice && nice.ishwscroll |
| | | ? nice.setScrollTop(parseInt(value)) |
| | | : _scrollTop.call($(this), value) |
| | | }) |
| | | } |
| | | } |
| | | |
| | | // override jQuery scrollLeft |
| | | |
| | | var _scrollLeft = jQuery.fn.scrollLeft // preserve original function |
| | | |
| | | $.cssHooks.pageXOffset = { |
| | | get: function (elem, computed, extra) { |
| | | var nice = $.data(elem, '__nicescroll') || false |
| | | return nice && nice.ishwscroll ? nice.getScrollLeft() : _scrollLeft.call(elem) |
| | | }, |
| | | set: function (elem, value) { |
| | | var nice = $.data(elem, '__nicescroll') || false |
| | | nice && nice.ishwscroll ? nice.setScrollLeft(parseInt(value)) : _scrollLeft.call(elem, value) |
| | | return this |
| | | } |
| | | } |
| | | |
| | | /* |
| | | $.fx.step["scrollLeft"] = function(fx){ |
| | | $.cssHooks["scrollLeft"].set( fx.elem, fx.now + fx.unit ); |
| | | }; |
| | | */ |
| | | |
| | | jQuery.fn.scrollLeft = function (value) { |
| | | if (typeof value == 'undefined') { |
| | | var nice = this[0] ? $.data(this[0], '__nicescroll') || false : false |
| | | return nice && nice.ishwscroll ? nice.getScrollLeft() : _scrollLeft.call(this) |
| | | } else { |
| | | return this.each(function () { |
| | | var nice = $.data(this, '__nicescroll') || false |
| | | nice && nice.ishwscroll |
| | | ? nice.setScrollLeft(parseInt(value)) |
| | | : _scrollLeft.call($(this), value) |
| | | }) |
| | | } |
| | | } |
| | | |
| | | var NiceScrollArray = function (doms) { |
| | | var self = this |
| | | this.length = 0 |
| | | this.name = 'nicescrollarray' |
| | | |
| | | this.each = function (fn) { |
| | | for (var a = 0; a < self.length; a++) fn.call(self[a]) |
| | | return self |
| | | } |
| | | |
| | | this.push = function (nice) { |
| | | self[self.length] = nice |
| | | self.length++ |
| | | } |
| | | |
| | | this.eq = function (idx) { |
| | | return self[idx] |
| | | } |
| | | |
| | | if (doms) { |
| | | for (a = 0; a < doms.length; a++) { |
| | | var nice = $.data(doms[a], '__nicescroll') || false |
| | | if (nice) { |
| | | this[this.length] = nice |
| | | this.length++ |
| | | } |
| | | } |
| | | } |
| | | |
| | | return this |
| | | } |
| | | |
| | | function mplex(el, lst, fn) { |
| | | for (var a = 0; a < lst.length; a++) fn(el, lst[a]) |
| | | } |
| | | mplex( |
| | | NiceScrollArray.prototype, |
| | | ['show', 'hide', 'toggle', 'onResize', 'resize', 'remove', 'stop', 'doScrollPos'], |
| | | function (e, n) { |
| | | e[n] = function () { |
| | | var args = arguments |
| | | return this.each(function () { |
| | | this[n].apply(this, args) |
| | | }) |
| | | } |
| | | } |
| | | ) |
| | | |
| | | jQuery.fn.getNiceScroll = function (index) { |
| | | if (typeof index == 'undefined') { |
| | | return new NiceScrollArray(this) |
| | | } else { |
| | | var nice = $.data(this[index], '__nicescroll') || false |
| | | return nice |
| | | } |
| | | } |
| | | |
| | | jQuery.extend(jQuery.expr[':'], { |
| | | nicescroll: function (a) { |
| | | return $.data(a, '__nicescroll') ? true : false |
| | | } |
| | | }) |
| | | |
| | | $.fn.niceScroll = function (wrapper, opt) { |
| | | if (typeof opt == 'undefined') { |
| | | if (typeof wrapper == 'object' && !('jquery' in wrapper)) { |
| | | opt = wrapper |
| | | wrapper = false |
| | | } |
| | | } |
| | | var ret = new NiceScrollArray() |
| | | if (typeof opt == 'undefined') opt = {} |
| | | |
| | | if (wrapper || false) { |
| | | opt.doc = $(wrapper) |
| | | opt.win = $(this) |
| | | } |
| | | var docundef = !('doc' in opt) |
| | | if (!docundef && !('win' in opt)) opt.win = $(this) |
| | | |
| | | this.each(function () { |
| | | var nice = $(this).data('__nicescroll') || false |
| | | if (!nice) { |
| | | opt.doc = docundef ? $(this) : opt.doc |
| | | nice = new NiceScrollClass(opt, $(this)) |
| | | $(this).data('__nicescroll', nice) |
| | | } |
| | | ret.push(nice) |
| | | }) |
| | | return ret.length == 1 ? ret[0] : ret |
| | | } |
| | | |
| | | window.NiceScroll = { |
| | | getjQuery: function () { |
| | | return jQuery |
| | | } |
| | | } |
| | | |
| | | if (!$.nicescroll) { |
| | | $.nicescroll = new NiceScrollArray() |
| | | $.nicescroll.options = _globaloptions |
| | | } |
| | | })(jQuery) |
New file |
| | |
| | | /** |
| | | * @author mrdoob / http://mrdoob.com/ |
| | | * @author Mugen87 / https://github.com/Mugen87 |
| | | */ |
| | | |
| | | THREE.ColladaLoader = function (manager) { |
| | | |
| | | this.manager = (manager !== undefined) ? manager : THREE.DefaultLoadingManager; |
| | | |
| | | }; |
| | | |
| | | THREE.ColladaLoader.prototype = { |
| | | |
| | | constructor: THREE.ColladaLoader, |
| | | |
| | | crossOrigin: 'anonymous', |
| | | |
| | | load: function (url, onLoad, onProgress, onError) { |
| | | |
| | | var scope = this; |
| | | |
| | | var path = scope.path === undefined ? THREE.LoaderUtils.extractUrlBase(url) : scope.path; |
| | | |
| | | var loader = new THREE.FileLoader(scope.manager); |
| | | loader.load(url, function (text) { |
| | | |
| | | onLoad(scope.parse(text, path)); |
| | | |
| | | }, onProgress, onError); |
| | | |
| | | }, |
| | | |
| | | setPath: function (value) { |
| | | |
| | | this.path = value; |
| | | return this; |
| | | |
| | | }, |
| | | |
| | | options: { |
| | | |
| | | set convertUpAxis(value) { |
| | | |
| | | console.warn('THREE.ColladaLoader: options.convertUpAxis() has been removed. Up axis is converted automatically.'); |
| | | |
| | | } |
| | | |
| | | }, |
| | | |
| | | setCrossOrigin: function (value) { |
| | | |
| | | this.crossOrigin = value; |
| | | return this; |
| | | |
| | | }, |
| | | |
| | | parse: function (text, path) { |
| | | |
| | | function getElementsByTagName(xml, name) { |
| | | |
| | | // Non recursive xml.getElementsByTagName() ... |
| | | |
| | | var array = []; |
| | | var childNodes = xml.childNodes; |
| | | |
| | | for (var i = 0, l = childNodes.length; i < l; i++) { |
| | | |
| | | var child = childNodes[i]; |
| | | |
| | | if (child.nodeName === name) { |
| | | |
| | | array.push(child); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | return array; |
| | | |
| | | } |
| | | |
| | | function parseStrings(text) { |
| | | |
| | | if (text.length === 0) return []; |
| | | |
| | | var parts = text.trim().split(/\s+/); |
| | | var array = new Array(parts.length); |
| | | |
| | | for (var i = 0, l = parts.length; i < l; i++) { |
| | | |
| | | array[i] = parts[i]; |
| | | |
| | | } |
| | | |
| | | return array; |
| | | |
| | | } |
| | | |
| | | function parseFloats(text) { |
| | | |
| | | if (text.length === 0) return []; |
| | | |
| | | var parts = text.trim().split(/\s+/); |
| | | var array = new Array(parts.length); |
| | | |
| | | for (var i = 0, l = parts.length; i < l; i++) { |
| | | |
| | | array[i] = parseFloat(parts[i]); |
| | | |
| | | } |
| | | |
| | | return array; |
| | | |
| | | } |
| | | |
| | | function parseInts(text) { |
| | | |
| | | if (text.length === 0) return []; |
| | | |
| | | var parts = text.trim().split(/\s+/); |
| | | var array = new Array(parts.length); |
| | | |
| | | for (var i = 0, l = parts.length; i < l; i++) { |
| | | |
| | | array[i] = parseInt(parts[i]); |
| | | |
| | | } |
| | | |
| | | return array; |
| | | |
| | | } |
| | | |
| | | function parseId(text) { |
| | | |
| | | return text.substring(1); |
| | | |
| | | } |
| | | |
| | | function generateId() { |
| | | |
| | | return 'three_default_' + (count++); |
| | | |
| | | } |
| | | |
| | | function isEmpty(object) { |
| | | |
| | | return Object.keys(object).length === 0; |
| | | |
| | | } |
| | | |
| | | // asset |
| | | |
| | | function parseAsset(xml) { |
| | | |
| | | return { |
| | | unit: parseAssetUnit(getElementsByTagName(xml, 'unit')[0]), |
| | | upAxis: parseAssetUpAxis(getElementsByTagName(xml, 'up_axis')[0]) |
| | | }; |
| | | |
| | | } |
| | | |
| | | function parseAssetUnit(xml) { |
| | | |
| | | if ((xml !== undefined) && (xml.hasAttribute('meter') === true)) { |
| | | |
| | | return parseFloat(xml.getAttribute('meter')); |
| | | |
| | | } else { |
| | | |
| | | return 1; // default 1 meter |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | function parseAssetUpAxis(xml) { |
| | | |
| | | return xml !== undefined ? xml.textContent : 'Y_UP'; |
| | | |
| | | } |
| | | |
| | | // library |
| | | |
| | | function parseLibrary(xml, libraryName, nodeName, parser) { |
| | | |
| | | var library = getElementsByTagName(xml, libraryName)[0]; |
| | | |
| | | if (library !== undefined) { |
| | | |
| | | var elements = getElementsByTagName(library, nodeName); |
| | | |
| | | for (var i = 0; i < elements.length; i++) { |
| | | |
| | | parser(elements[i]); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | function buildLibrary(data, builder) { |
| | | |
| | | for (var name in data) { |
| | | |
| | | var object = data[name]; |
| | | object.build = builder(data[name]); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | // get |
| | | |
| | | function getBuild(data, builder) { |
| | | |
| | | if (data.build !== undefined) return data.build; |
| | | |
| | | data.build = builder(data); |
| | | |
| | | return data.build; |
| | | |
| | | } |
| | | |
| | | // animation |
| | | |
| | | function parseAnimation(xml) { |
| | | |
| | | var data = { |
| | | sources: {}, |
| | | samplers: {}, |
| | | channels: {} |
| | | }; |
| | | |
| | | for (var i = 0, l = xml.childNodes.length; i < l; i++) { |
| | | |
| | | var child = xml.childNodes[i]; |
| | | |
| | | if (child.nodeType !== 1) continue; |
| | | |
| | | var id; |
| | | |
| | | switch (child.nodeName) { |
| | | |
| | | case 'source': |
| | | id = child.getAttribute('id'); |
| | | data.sources[id] = parseSource(child); |
| | | break; |
| | | |
| | | case 'sampler': |
| | | id = child.getAttribute('id'); |
| | | data.samplers[id] = parseAnimationSampler(child); |
| | | break; |
| | | |
| | | case 'channel': |
| | | id = child.getAttribute('target'); |
| | | data.channels[id] = parseAnimationChannel(child); |
| | | break; |
| | | |
| | | default: |
| | | console.log(child); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | library.animations[xml.getAttribute('id')] = data; |
| | | |
| | | } |
| | | |
| | | function parseAnimationSampler(xml) { |
| | | |
| | | var data = { |
| | | inputs: {}, |
| | | }; |
| | | |
| | | for (var i = 0, l = xml.childNodes.length; i < l; i++) { |
| | | |
| | | var child = xml.childNodes[i]; |
| | | |
| | | if (child.nodeType !== 1) continue; |
| | | |
| | | switch (child.nodeName) { |
| | | |
| | | case 'input': |
| | | var id = parseId(child.getAttribute('source')); |
| | | var semantic = child.getAttribute('semantic'); |
| | | data.inputs[semantic] = id; |
| | | break; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | return data; |
| | | |
| | | } |
| | | |
| | | function parseAnimationChannel(xml) { |
| | | |
| | | var data = {}; |
| | | |
| | | var target = xml.getAttribute('target'); |
| | | |
| | | // parsing SID Addressing Syntax |
| | | |
| | | var parts = target.split('/'); |
| | | |
| | | var id = parts.shift(); |
| | | var sid = parts.shift(); |
| | | |
| | | // check selection syntax |
| | | |
| | | var arraySyntax = (sid.indexOf('(') !== -1); |
| | | var memberSyntax = (sid.indexOf('.') !== -1); |
| | | |
| | | if (memberSyntax) { |
| | | |
| | | // member selection access |
| | | |
| | | parts = sid.split('.'); |
| | | sid = parts.shift(); |
| | | data.member = parts.shift(); |
| | | |
| | | } else if (arraySyntax) { |
| | | |
| | | // array-access syntax. can be used to express fields in one-dimensional vectors or two-dimensional matrices. |
| | | |
| | | var indices = sid.split('('); |
| | | sid = indices.shift(); |
| | | |
| | | for (var i = 0; i < indices.length; i++) { |
| | | |
| | | indices[i] = parseInt(indices[i].replace(/\)/, '')); |
| | | |
| | | } |
| | | |
| | | data.indices = indices; |
| | | |
| | | } |
| | | |
| | | data.id = id; |
| | | data.sid = sid; |
| | | |
| | | data.arraySyntax = arraySyntax; |
| | | data.memberSyntax = memberSyntax; |
| | | |
| | | data.sampler = parseId(xml.getAttribute('source')); |
| | | |
| | | return data; |
| | | |
| | | } |
| | | |
| | | function buildAnimation(data) { |
| | | |
| | | var tracks = []; |
| | | |
| | | var channels = data.channels; |
| | | var samplers = data.samplers; |
| | | var sources = data.sources; |
| | | |
| | | for (var target in channels) { |
| | | |
| | | if (channels.hasOwnProperty(target)) { |
| | | |
| | | var channel = channels[target]; |
| | | var sampler = samplers[channel.sampler]; |
| | | |
| | | var inputId = sampler.inputs.INPUT; |
| | | var outputId = sampler.inputs.OUTPUT; |
| | | |
| | | var inputSource = sources[inputId]; |
| | | var outputSource = sources[outputId]; |
| | | |
| | | var animation = buildAnimationChannel(channel, inputSource, outputSource); |
| | | |
| | | createKeyframeTracks(animation, tracks); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | return tracks; |
| | | |
| | | } |
| | | |
| | | function getAnimation(id) { |
| | | |
| | | return getBuild(library.animations[id], buildAnimation); |
| | | |
| | | } |
| | | |
| | | function buildAnimationChannel(channel, inputSource, outputSource) { |
| | | |
| | | var node = library.nodes[channel.id]; |
| | | var object3D = getNode(node.id); |
| | | |
| | | var transform = node.transforms[channel.sid]; |
| | | var defaultMatrix = node.matrix.clone().transpose(); |
| | | |
| | | var time, stride; |
| | | var i, il, j, jl; |
| | | |
| | | var data = {}; |
| | | |
| | | // the collada spec allows the animation of data in various ways. |
| | | // depending on the transform type (matrix, translate, rotate, scale), we execute different logic |
| | | |
| | | switch (transform) { |
| | | |
| | | case 'matrix': |
| | | |
| | | for (i = 0, il = inputSource.array.length; i < il; i++) { |
| | | |
| | | time = inputSource.array[i]; |
| | | stride = i * outputSource.stride; |
| | | |
| | | if (data[time] === undefined) data[time] = {}; |
| | | |
| | | if (channel.arraySyntax === true) { |
| | | |
| | | var value = outputSource.array[stride]; |
| | | var index = channel.indices[0] + 4 * channel.indices[1]; |
| | | |
| | | data[time][index] = value; |
| | | |
| | | } else { |
| | | |
| | | for (j = 0, jl = outputSource.stride; j < jl; j++) { |
| | | |
| | | data[time][j] = outputSource.array[stride + j]; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | break; |
| | | |
| | | case 'translate': |
| | | console.warn('THREE.ColladaLoader: Animation transform type "%s" not yet implemented.', transform); |
| | | break; |
| | | |
| | | case 'rotate': |
| | | console.warn('THREE.ColladaLoader: Animation transform type "%s" not yet implemented.', transform); |
| | | break; |
| | | |
| | | case 'scale': |
| | | console.warn('THREE.ColladaLoader: Animation transform type "%s" not yet implemented.', transform); |
| | | break; |
| | | |
| | | } |
| | | |
| | | var keyframes = prepareAnimationData(data, defaultMatrix); |
| | | |
| | | var animation = { |
| | | name: object3D.uuid, |
| | | keyframes: keyframes |
| | | }; |
| | | |
| | | return animation; |
| | | |
| | | } |
| | | |
| | | function prepareAnimationData(data, defaultMatrix) { |
| | | |
| | | var keyframes = []; |
| | | |
| | | // transfer data into a sortable array |
| | | |
| | | for (var time in data) { |
| | | |
| | | keyframes.push({ time: parseFloat(time), value: data[time] }); |
| | | |
| | | } |
| | | |
| | | // ensure keyframes are sorted by time |
| | | |
| | | keyframes.sort(ascending); |
| | | |
| | | // now we clean up all animation data, so we can use them for keyframe tracks |
| | | |
| | | for (var i = 0; i < 16; i++) { |
| | | |
| | | transformAnimationData(keyframes, i, defaultMatrix.elements[i]); |
| | | |
| | | } |
| | | |
| | | return keyframes; |
| | | |
| | | // array sort function |
| | | |
| | | function ascending(a, b) { |
| | | |
| | | return a.time - b.time; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | var position = new THREE.Vector3(); |
| | | var scale = new THREE.Vector3(); |
| | | var quaternion = new THREE.Quaternion(); |
| | | |
| | | function createKeyframeTracks(animation, tracks) { |
| | | |
| | | var keyframes = animation.keyframes; |
| | | var name = animation.name; |
| | | |
| | | var times = []; |
| | | var positionData = []; |
| | | var quaternionData = []; |
| | | var scaleData = []; |
| | | |
| | | for (var i = 0, l = keyframes.length; i < l; i++) { |
| | | |
| | | var keyframe = keyframes[i]; |
| | | |
| | | var time = keyframe.time; |
| | | var value = keyframe.value; |
| | | |
| | | matrix.fromArray(value).transpose(); |
| | | matrix.decompose(position, quaternion, scale); |
| | | |
| | | times.push(time); |
| | | positionData.push(position.x, position.y, position.z); |
| | | quaternionData.push(quaternion.x, quaternion.y, quaternion.z, quaternion.w); |
| | | scaleData.push(scale.x, scale.y, scale.z); |
| | | |
| | | } |
| | | |
| | | if (positionData.length > 0) tracks.push(new THREE.VectorKeyframeTrack(name + '.position', times, positionData)); |
| | | if (quaternionData.length > 0) tracks.push(new THREE.QuaternionKeyframeTrack(name + '.quaternion', times, quaternionData)); |
| | | if (scaleData.length > 0) tracks.push(new THREE.VectorKeyframeTrack(name + '.scale', times, scaleData)); |
| | | |
| | | return tracks; |
| | | |
| | | } |
| | | |
| | | function transformAnimationData(keyframes, property, defaultValue) { |
| | | |
| | | var keyframe; |
| | | |
| | | var empty = true; |
| | | var i, l; |
| | | |
| | | // check, if values of a property are missing in our keyframes |
| | | |
| | | for (i = 0, l = keyframes.length; i < l; i++) { |
| | | |
| | | keyframe = keyframes[i]; |
| | | |
| | | if (keyframe.value[property] === undefined) { |
| | | |
| | | keyframe.value[property] = null; // mark as missing |
| | | |
| | | } else { |
| | | |
| | | empty = false; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | if (empty === true) { |
| | | |
| | | // no values at all, so we set a default value |
| | | |
| | | for (i = 0, l = keyframes.length; i < l; i++) { |
| | | |
| | | keyframe = keyframes[i]; |
| | | |
| | | keyframe.value[property] = defaultValue; |
| | | |
| | | } |
| | | |
| | | } else { |
| | | |
| | | // filling gaps |
| | | |
| | | createMissingKeyframes(keyframes, property); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | function createMissingKeyframes(keyframes, property) { |
| | | |
| | | var prev, next; |
| | | |
| | | for (var i = 0, l = keyframes.length; i < l; i++) { |
| | | |
| | | var keyframe = keyframes[i]; |
| | | |
| | | if (keyframe.value[property] === null) { |
| | | |
| | | prev = getPrev(keyframes, i, property); |
| | | next = getNext(keyframes, i, property); |
| | | |
| | | if (prev === null) { |
| | | |
| | | keyframe.value[property] = next.value[property]; |
| | | continue; |
| | | |
| | | } |
| | | |
| | | if (next === null) { |
| | | |
| | | keyframe.value[property] = prev.value[property]; |
| | | continue; |
| | | |
| | | } |
| | | |
| | | interpolate(keyframe, prev, next, property); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | function getPrev(keyframes, i, property) { |
| | | |
| | | while (i >= 0) { |
| | | |
| | | var keyframe = keyframes[i]; |
| | | |
| | | if (keyframe.value[property] !== null) return keyframe; |
| | | |
| | | i--; |
| | | |
| | | } |
| | | |
| | | return null; |
| | | |
| | | } |
| | | |
| | | function getNext(keyframes, i, property) { |
| | | |
| | | while (i < keyframes.length) { |
| | | |
| | | var keyframe = keyframes[i]; |
| | | |
| | | if (keyframe.value[property] !== null) return keyframe; |
| | | |
| | | i++; |
| | | |
| | | } |
| | | |
| | | return null; |
| | | |
| | | } |
| | | |
| | | function interpolate(key, prev, next, property) { |
| | | |
| | | if ((next.time - prev.time) === 0) { |
| | | |
| | | key.value[property] = prev.value[property]; |
| | | return; |
| | | |
| | | } |
| | | |
| | | key.value[property] = ((key.time - prev.time) * (next.value[property] - prev.value[property]) / (next.time - prev.time)) + prev.value[property]; |
| | | |
| | | } |
| | | |
| | | // animation clips |
| | | |
| | | function parseAnimationClip(xml) { |
| | | |
| | | var data = { |
| | | name: xml.getAttribute('id') || 'default', |
| | | start: parseFloat(xml.getAttribute('start') || 0), |
| | | end: parseFloat(xml.getAttribute('end') || 0), |
| | | animations: [] |
| | | }; |
| | | |
| | | for (var i = 0, l = xml.childNodes.length; i < l; i++) { |
| | | |
| | | var child = xml.childNodes[i]; |
| | | |
| | | if (child.nodeType !== 1) continue; |
| | | |
| | | switch (child.nodeName) { |
| | | |
| | | case 'instance_animation': |
| | | data.animations.push(parseId(child.getAttribute('url'))); |
| | | break; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | library.clips[xml.getAttribute('id')] = data; |
| | | |
| | | } |
| | | |
| | | function buildAnimationClip(data) { |
| | | |
| | | var tracks = []; |
| | | |
| | | var name = data.name; |
| | | var duration = (data.end - data.start) || -1; |
| | | var animations = data.animations; |
| | | |
| | | for (var i = 0, il = animations.length; i < il; i++) { |
| | | |
| | | var animationTracks = getAnimation(animations[i]); |
| | | |
| | | for (var j = 0, jl = animationTracks.length; j < jl; j++) { |
| | | |
| | | tracks.push(animationTracks[j]); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | return new THREE.AnimationClip(name, duration, tracks); |
| | | |
| | | } |
| | | |
| | | function getAnimationClip(id) { |
| | | |
| | | return getBuild(library.clips[id], buildAnimationClip); |
| | | |
| | | } |
| | | |
| | | // controller |
| | | |
| | | function parseController(xml) { |
| | | |
| | | var data = {}; |
| | | |
| | | for (var i = 0, l = xml.childNodes.length; i < l; i++) { |
| | | |
| | | var child = xml.childNodes[i]; |
| | | |
| | | if (child.nodeType !== 1) continue; |
| | | |
| | | switch (child.nodeName) { |
| | | |
| | | case 'skin': |
| | | // there is exactly one skin per controller |
| | | data.id = parseId(child.getAttribute('source')); |
| | | data.skin = parseSkin(child); |
| | | break; |
| | | |
| | | case 'morph': |
| | | data.id = parseId(child.getAttribute('source')); |
| | | console.warn('THREE.ColladaLoader: Morph target animation not supported yet.'); |
| | | break; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | library.controllers[xml.getAttribute('id')] = data; |
| | | |
| | | } |
| | | |
| | | function parseSkin(xml) { |
| | | |
| | | var data = { |
| | | sources: {} |
| | | }; |
| | | |
| | | for (var i = 0, l = xml.childNodes.length; i < l; i++) { |
| | | |
| | | var child = xml.childNodes[i]; |
| | | |
| | | if (child.nodeType !== 1) continue; |
| | | |
| | | switch (child.nodeName) { |
| | | |
| | | case 'bind_shape_matrix': |
| | | data.bindShapeMatrix = parseFloats(child.textContent); |
| | | break; |
| | | |
| | | case 'source': |
| | | var id = child.getAttribute('id'); |
| | | data.sources[id] = parseSource(child); |
| | | break; |
| | | |
| | | case 'joints': |
| | | data.joints = parseJoints(child); |
| | | break; |
| | | |
| | | case 'vertex_weights': |
| | | data.vertexWeights = parseVertexWeights(child); |
| | | break; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | return data; |
| | | |
| | | } |
| | | |
| | | function parseJoints(xml) { |
| | | |
| | | var data = { |
| | | inputs: {} |
| | | }; |
| | | |
| | | for (var i = 0, l = xml.childNodes.length; i < l; i++) { |
| | | |
| | | var child = xml.childNodes[i]; |
| | | |
| | | if (child.nodeType !== 1) continue; |
| | | |
| | | switch (child.nodeName) { |
| | | |
| | | case 'input': |
| | | var semantic = child.getAttribute('semantic'); |
| | | var id = parseId(child.getAttribute('source')); |
| | | data.inputs[semantic] = id; |
| | | break; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | return data; |
| | | |
| | | } |
| | | |
| | | function parseVertexWeights(xml) { |
| | | |
| | | var data = { |
| | | inputs: {} |
| | | }; |
| | | |
| | | for (var i = 0, l = xml.childNodes.length; i < l; i++) { |
| | | |
| | | var child = xml.childNodes[i]; |
| | | |
| | | if (child.nodeType !== 1) continue; |
| | | |
| | | switch (child.nodeName) { |
| | | |
| | | case 'input': |
| | | var semantic = child.getAttribute('semantic'); |
| | | var id = parseId(child.getAttribute('source')); |
| | | var offset = parseInt(child.getAttribute('offset')); |
| | | data.inputs[semantic] = { id: id, offset: offset }; |
| | | break; |
| | | |
| | | case 'vcount': |
| | | data.vcount = parseInts(child.textContent); |
| | | break; |
| | | |
| | | case 'v': |
| | | data.v = parseInts(child.textContent); |
| | | break; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | return data; |
| | | |
| | | } |
| | | |
| | | function buildController(data) { |
| | | |
| | | var build = { |
| | | id: data.id |
| | | }; |
| | | |
| | | var geometry = library.geometries[build.id]; |
| | | |
| | | if (data.skin !== undefined) { |
| | | |
| | | build.skin = buildSkin(data.skin); |
| | | |
| | | // we enhance the 'sources' property of the corresponding geometry with our skin data |
| | | |
| | | geometry.sources.skinIndices = build.skin.indices; |
| | | geometry.sources.skinWeights = build.skin.weights; |
| | | |
| | | } |
| | | |
| | | return build; |
| | | |
| | | } |
| | | |
| | | function buildSkin(data) { |
| | | |
| | | var BONE_LIMIT = 4; |
| | | |
| | | var build = { |
| | | joints: [], // this must be an array to preserve the joint order |
| | | indices: { |
| | | array: [], |
| | | stride: BONE_LIMIT |
| | | }, |
| | | weights: { |
| | | array: [], |
| | | stride: BONE_LIMIT |
| | | } |
| | | }; |
| | | |
| | | var sources = data.sources; |
| | | var vertexWeights = data.vertexWeights; |
| | | |
| | | var vcount = vertexWeights.vcount; |
| | | var v = vertexWeights.v; |
| | | var jointOffset = vertexWeights.inputs.JOINT.offset; |
| | | var weightOffset = vertexWeights.inputs.WEIGHT.offset; |
| | | |
| | | var jointSource = data.sources[data.joints.inputs.JOINT]; |
| | | var inverseSource = data.sources[data.joints.inputs.INV_BIND_MATRIX]; |
| | | |
| | | var weights = sources[vertexWeights.inputs.WEIGHT.id].array; |
| | | var stride = 0; |
| | | |
| | | var i, j, l; |
| | | |
| | | // procces skin data for each vertex |
| | | |
| | | for (i = 0, l = vcount.length; i < l; i++) { |
| | | |
| | | var jointCount = vcount[i]; // this is the amount of joints that affect a single vertex |
| | | var vertexSkinData = []; |
| | | |
| | | for (j = 0; j < jointCount; j++) { |
| | | |
| | | var skinIndex = v[stride + jointOffset]; |
| | | var weightId = v[stride + weightOffset]; |
| | | var skinWeight = weights[weightId]; |
| | | |
| | | vertexSkinData.push({ index: skinIndex, weight: skinWeight }); |
| | | |
| | | stride += 2; |
| | | |
| | | } |
| | | |
| | | // we sort the joints in descending order based on the weights. |
| | | // this ensures, we only procced the most important joints of the vertex |
| | | |
| | | vertexSkinData.sort(descending); |
| | | |
| | | // now we provide for each vertex a set of four index and weight values. |
| | | // the order of the skin data matches the order of vertices |
| | | |
| | | for (j = 0; j < BONE_LIMIT; j++) { |
| | | |
| | | var d = vertexSkinData[j]; |
| | | |
| | | if (d !== undefined) { |
| | | |
| | | build.indices.array.push(d.index); |
| | | build.weights.array.push(d.weight); |
| | | |
| | | } else { |
| | | |
| | | build.indices.array.push(0); |
| | | build.weights.array.push(0); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | // setup bind matrix |
| | | |
| | | if (data.bindShapeMatrix) { |
| | | |
| | | build.bindMatrix = new THREE.Matrix4().fromArray(data.bindShapeMatrix).transpose(); |
| | | |
| | | } else { |
| | | |
| | | build.bindMatrix = new THREE.Matrix4().identity(); |
| | | |
| | | } |
| | | |
| | | // process bones and inverse bind matrix data |
| | | |
| | | for (i = 0, l = jointSource.array.length; i < l; i++) { |
| | | |
| | | var name = jointSource.array[i]; |
| | | var boneInverse = new THREE.Matrix4().fromArray(inverseSource.array, i * inverseSource.stride).transpose(); |
| | | |
| | | build.joints.push({ name: name, boneInverse: boneInverse }); |
| | | |
| | | } |
| | | |
| | | return build; |
| | | |
| | | // array sort function |
| | | |
| | | function descending(a, b) { |
| | | |
| | | return b.weight - a.weight; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | function getController(id) { |
| | | |
| | | return getBuild(library.controllers[id], buildController); |
| | | |
| | | } |
| | | |
| | | // image |
| | | |
| | | function parseImage(xml) { |
| | | |
| | | var data = { |
| | | init_from: getElementsByTagName(xml, 'init_from')[0].textContent |
| | | }; |
| | | |
| | | library.images[xml.getAttribute('id')] = data; |
| | | |
| | | } |
| | | |
| | | function buildImage(data) { |
| | | |
| | | if (data.build !== undefined) return data.build; |
| | | |
| | | return data.init_from; |
| | | |
| | | } |
| | | |
| | | function getImage(id) { |
| | | |
| | | var data = library.images[id]; |
| | | |
| | | if (data !== undefined) { |
| | | |
| | | return getBuild(data, buildImage); |
| | | |
| | | } |
| | | |
| | | console.warn('THREE.ColladaLoader: Couldn\'t find image with ID:', id); |
| | | |
| | | return null; |
| | | |
| | | } |
| | | |
| | | // effect |
| | | |
| | | function parseEffect(xml) { |
| | | |
| | | var data = {}; |
| | | |
| | | for (var i = 0, l = xml.childNodes.length; i < l; i++) { |
| | | |
| | | var child = xml.childNodes[i]; |
| | | |
| | | if (child.nodeType !== 1) continue; |
| | | |
| | | switch (child.nodeName) { |
| | | |
| | | case 'profile_COMMON': |
| | | data.profile = parseEffectProfileCOMMON(child); |
| | | break; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | library.effects[xml.getAttribute('id')] = data; |
| | | |
| | | } |
| | | |
| | | function parseEffectProfileCOMMON(xml) { |
| | | |
| | | var data = { |
| | | surfaces: {}, |
| | | samplers: {} |
| | | }; |
| | | |
| | | for (var i = 0, l = xml.childNodes.length; i < l; i++) { |
| | | |
| | | var child = xml.childNodes[i]; |
| | | |
| | | if (child.nodeType !== 1) continue; |
| | | |
| | | switch (child.nodeName) { |
| | | |
| | | case 'newparam': |
| | | parseEffectNewparam(child, data); |
| | | break; |
| | | |
| | | case 'technique': |
| | | data.technique = parseEffectTechnique(child); |
| | | break; |
| | | |
| | | case 'extra': |
| | | data.extra = parseEffectExtra(child); |
| | | break; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | return data; |
| | | |
| | | } |
| | | |
| | | function parseEffectNewparam(xml, data) { |
| | | |
| | | var sid = xml.getAttribute('sid'); |
| | | |
| | | for (var i = 0, l = xml.childNodes.length; i < l; i++) { |
| | | |
| | | var child = xml.childNodes[i]; |
| | | |
| | | if (child.nodeType !== 1) continue; |
| | | |
| | | switch (child.nodeName) { |
| | | |
| | | case 'surface': |
| | | data.surfaces[sid] = parseEffectSurface(child); |
| | | break; |
| | | |
| | | case 'sampler2D': |
| | | data.samplers[sid] = parseEffectSampler(child); |
| | | break; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | function parseEffectSurface(xml) { |
| | | |
| | | var data = {}; |
| | | |
| | | for (var i = 0, l = xml.childNodes.length; i < l; i++) { |
| | | |
| | | var child = xml.childNodes[i]; |
| | | |
| | | if (child.nodeType !== 1) continue; |
| | | |
| | | switch (child.nodeName) { |
| | | |
| | | case 'init_from': |
| | | data.init_from = child.textContent; |
| | | break; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | return data; |
| | | |
| | | } |
| | | |
| | | function parseEffectSampler(xml) { |
| | | |
| | | var data = {}; |
| | | |
| | | for (var i = 0, l = xml.childNodes.length; i < l; i++) { |
| | | |
| | | var child = xml.childNodes[i]; |
| | | |
| | | if (child.nodeType !== 1) continue; |
| | | |
| | | switch (child.nodeName) { |
| | | |
| | | case 'source': |
| | | data.source = child.textContent; |
| | | break; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | return data; |
| | | |
| | | } |
| | | |
| | | function parseEffectTechnique(xml) { |
| | | |
| | | var data = {}; |
| | | |
| | | for (var i = 0, l = xml.childNodes.length; i < l; i++) { |
| | | |
| | | var child = xml.childNodes[i]; |
| | | |
| | | if (child.nodeType !== 1) continue; |
| | | |
| | | switch (child.nodeName) { |
| | | |
| | | case 'constant': |
| | | case 'lambert': |
| | | case 'blinn': |
| | | case 'phong': |
| | | data.type = child.nodeName; |
| | | data.parameters = parseEffectParameters(child); |
| | | break; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | return data; |
| | | |
| | | } |
| | | |
| | | function parseEffectParameters(xml) { |
| | | |
| | | var data = {}; |
| | | |
| | | for (var i = 0, l = xml.childNodes.length; i < l; i++) { |
| | | |
| | | var child = xml.childNodes[i]; |
| | | |
| | | if (child.nodeType !== 1) continue; |
| | | |
| | | switch (child.nodeName) { |
| | | |
| | | case 'emission': |
| | | case 'diffuse': |
| | | case 'specular': |
| | | case 'shininess': |
| | | case 'transparency': |
| | | data[child.nodeName] = parseEffectParameter(child); |
| | | break; |
| | | case 'transparent': |
| | | data[child.nodeName] = { |
| | | opaque: child.getAttribute('opaque'), |
| | | data: parseEffectParameter(child) |
| | | }; |
| | | break; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | return data; |
| | | |
| | | } |
| | | |
| | | function parseEffectParameter(xml) { |
| | | |
| | | var data = {}; |
| | | |
| | | for (var i = 0, l = xml.childNodes.length; i < l; i++) { |
| | | |
| | | var child = xml.childNodes[i]; |
| | | |
| | | if (child.nodeType !== 1) continue; |
| | | |
| | | switch (child.nodeName) { |
| | | |
| | | case 'color': |
| | | data[child.nodeName] = parseFloats(child.textContent); |
| | | break; |
| | | |
| | | case 'float': |
| | | data[child.nodeName] = parseFloat(child.textContent); |
| | | break; |
| | | |
| | | case 'texture': |
| | | data[child.nodeName] = { id: child.getAttribute('texture'), extra: parseEffectParameterTexture(child) }; |
| | | break; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | return data; |
| | | |
| | | } |
| | | |
| | | function parseEffectParameterTexture(xml) { |
| | | |
| | | var data = { |
| | | technique: {} |
| | | }; |
| | | |
| | | for (var i = 0, l = xml.childNodes.length; i < l; i++) { |
| | | |
| | | var child = xml.childNodes[i]; |
| | | |
| | | if (child.nodeType !== 1) continue; |
| | | |
| | | switch (child.nodeName) { |
| | | |
| | | case 'extra': |
| | | parseEffectParameterTextureExtra(child, data); |
| | | break; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | return data; |
| | | |
| | | } |
| | | |
| | | function parseEffectParameterTextureExtra(xml, data) { |
| | | |
| | | for (var i = 0, l = xml.childNodes.length; i < l; i++) { |
| | | |
| | | var child = xml.childNodes[i]; |
| | | |
| | | if (child.nodeType !== 1) continue; |
| | | |
| | | switch (child.nodeName) { |
| | | |
| | | case 'technique': |
| | | parseEffectParameterTextureExtraTechnique(child, data); |
| | | break; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | function parseEffectParameterTextureExtraTechnique(xml, data) { |
| | | |
| | | for (var i = 0, l = xml.childNodes.length; i < l; i++) { |
| | | |
| | | var child = xml.childNodes[i]; |
| | | |
| | | if (child.nodeType !== 1) continue; |
| | | |
| | | switch (child.nodeName) { |
| | | |
| | | case 'repeatU': |
| | | case 'repeatV': |
| | | case 'offsetU': |
| | | case 'offsetV': |
| | | data.technique[child.nodeName] = parseFloat(child.textContent); |
| | | break; |
| | | |
| | | case 'wrapU': |
| | | case 'wrapV': |
| | | |
| | | // some files have values for wrapU/wrapV which become NaN via parseInt |
| | | |
| | | if (child.textContent.toUpperCase() === 'TRUE') { |
| | | |
| | | data.technique[child.nodeName] = 1; |
| | | |
| | | } else if (child.textContent.toUpperCase() === 'FALSE') { |
| | | |
| | | data.technique[child.nodeName] = 0; |
| | | |
| | | } else { |
| | | |
| | | data.technique[child.nodeName] = parseInt(child.textContent); |
| | | |
| | | } |
| | | |
| | | break; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | function parseEffectExtra(xml) { |
| | | |
| | | var data = {}; |
| | | |
| | | for (var i = 0, l = xml.childNodes.length; i < l; i++) { |
| | | |
| | | var child = xml.childNodes[i]; |
| | | |
| | | if (child.nodeType !== 1) continue; |
| | | |
| | | switch (child.nodeName) { |
| | | |
| | | case 'technique': |
| | | data.technique = parseEffectExtraTechnique(child); |
| | | break; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | return data; |
| | | |
| | | } |
| | | |
| | | function parseEffectExtraTechnique(xml) { |
| | | |
| | | var data = {}; |
| | | |
| | | for (var i = 0, l = xml.childNodes.length; i < l; i++) { |
| | | |
| | | var child = xml.childNodes[i]; |
| | | |
| | | if (child.nodeType !== 1) continue; |
| | | |
| | | switch (child.nodeName) { |
| | | |
| | | case 'double_sided': |
| | | data[child.nodeName] = parseInt(child.textContent); |
| | | break; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | return data; |
| | | |
| | | } |
| | | |
| | | function buildEffect(data) { |
| | | |
| | | return data; |
| | | |
| | | } |
| | | |
| | | function getEffect(id) { |
| | | |
| | | return getBuild(library.effects[id], buildEffect); |
| | | |
| | | } |
| | | |
| | | // material |
| | | |
| | | function parseMaterial(xml) { |
| | | |
| | | var data = { |
| | | name: xml.getAttribute('name') |
| | | }; |
| | | |
| | | for (var i = 0, l = xml.childNodes.length; i < l; i++) { |
| | | |
| | | var child = xml.childNodes[i]; |
| | | |
| | | if (child.nodeType !== 1) continue; |
| | | |
| | | switch (child.nodeName) { |
| | | |
| | | case 'instance_effect': |
| | | data.url = parseId(child.getAttribute('url')); |
| | | break; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | library.materials[xml.getAttribute('id')] = data; |
| | | |
| | | } |
| | | |
| | | function getTextureLoader(image) { |
| | | |
| | | var loader; |
| | | |
| | | var extension = image.slice((image.lastIndexOf('.') - 1 >>> 0) + 2); // http://www.jstips.co/en/javascript/get-file-extension/ |
| | | extension = extension.toLowerCase(); |
| | | |
| | | switch (extension) { |
| | | |
| | | case 'tga': |
| | | loader = tgaLoader; |
| | | break; |
| | | |
| | | default: |
| | | loader = textureLoader; |
| | | |
| | | } |
| | | |
| | | return loader; |
| | | |
| | | } |
| | | |
| | | function buildMaterial(data) { |
| | | |
| | | var effect = getEffect(data.url); |
| | | var technique = effect.profile.technique; |
| | | var extra = effect.profile.extra; |
| | | |
| | | var material; |
| | | |
| | | switch (technique.type) { |
| | | |
| | | case 'phong': |
| | | case 'blinn': |
| | | material = new THREE.MeshPhongMaterial(); |
| | | break; |
| | | |
| | | case 'lambert': |
| | | material = new THREE.MeshLambertMaterial(); |
| | | break; |
| | | |
| | | default: |
| | | material = new THREE.MeshBasicMaterial(); |
| | | break; |
| | | |
| | | } |
| | | |
| | | material.name = data.name; |
| | | |
| | | function getTexture(textureObject) { |
| | | |
| | | var sampler = effect.profile.samplers[textureObject.id]; |
| | | var image = null; |
| | | |
| | | // get image |
| | | |
| | | if (sampler !== undefined) { |
| | | |
| | | var surface = effect.profile.surfaces[sampler.source]; |
| | | image = getImage(surface.init_from); |
| | | |
| | | } else { |
| | | |
| | | console.warn('THREE.ColladaLoader: Undefined sampler. Access image directly (see #12530).'); |
| | | image = getImage(textureObject.id); |
| | | |
| | | } |
| | | |
| | | // create texture if image is avaiable |
| | | |
| | | if (image !== null) { |
| | | |
| | | var loader = getTextureLoader(image); |
| | | |
| | | if (loader !== undefined) { |
| | | |
| | | var texture = loader.load(image); |
| | | |
| | | var extra = textureObject.extra; |
| | | |
| | | if (extra !== undefined && extra.technique !== undefined && isEmpty(extra.technique) === false) { |
| | | |
| | | var technique = extra.technique; |
| | | |
| | | texture.wrapS = technique.wrapU ? THREE.RepeatWrapping : THREE.ClampToEdgeWrapping; |
| | | texture.wrapT = technique.wrapV ? THREE.RepeatWrapping : THREE.ClampToEdgeWrapping; |
| | | |
| | | texture.offset.set(technique.offsetU || 0, technique.offsetV || 0); |
| | | texture.repeat.set(technique.repeatU || 1, technique.repeatV || 1); |
| | | |
| | | } else { |
| | | |
| | | texture.wrapS = THREE.RepeatWrapping; |
| | | texture.wrapT = THREE.RepeatWrapping; |
| | | |
| | | } |
| | | |
| | | return texture; |
| | | |
| | | } else { |
| | | |
| | | console.warn('THREE.ColladaLoader: Loader for texture %s not found.', image); |
| | | |
| | | return null; |
| | | |
| | | } |
| | | |
| | | } else { |
| | | |
| | | console.warn('THREE.ColladaLoader: Couldn\'t create texture with ID:', textureObject.id); |
| | | |
| | | return null; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | var parameters = technique.parameters; |
| | | |
| | | for (var key in parameters) { |
| | | |
| | | var parameter = parameters[key]; |
| | | |
| | | switch (key) { |
| | | |
| | | case 'diffuse': |
| | | if (parameter.color) material.color.fromArray(parameter.color); |
| | | if (parameter.texture) material.map = getTexture(parameter.texture); |
| | | break; |
| | | case 'specular': |
| | | if (parameter.color && material.specular) material.specular.fromArray(parameter.color); |
| | | if (parameter.texture) material.specularMap = getTexture(parameter.texture); |
| | | break; |
| | | case 'shininess': |
| | | if (parameter.float && material.shininess) material.shininess = parameter.float; |
| | | break; |
| | | case 'emission': |
| | | if (parameter.color && material.emissive) material.emissive.fromArray(parameter.color); |
| | | if (parameter.texture) material.emissiveMap = getTexture(parameter.texture); |
| | | break; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | // |
| | | |
| | | var transparent = parameters['transparent']; |
| | | var transparency = parameters['transparency']; |
| | | |
| | | // <transparency> does not exist but <transparent> |
| | | |
| | | if (transparency === undefined && transparent) { |
| | | |
| | | transparency = { |
| | | float: 1 |
| | | }; |
| | | |
| | | } |
| | | |
| | | // <transparent> does not exist but <transparency> |
| | | |
| | | if (transparent === undefined && transparency) { |
| | | |
| | | transparent = { |
| | | opaque: 'A_ONE', |
| | | data: { |
| | | color: [1, 1, 1, 1] |
| | | } |
| | | }; |
| | | |
| | | } |
| | | |
| | | if (transparent && transparency) { |
| | | |
| | | // handle case if a texture exists but no color |
| | | |
| | | if (transparent.data.texture) { |
| | | |
| | | // we do not set an alpha map (see #13792) |
| | | |
| | | material.transparent = true; |
| | | |
| | | } else { |
| | | |
| | | var color = transparent.data.color; |
| | | |
| | | switch (transparent.opaque) { |
| | | |
| | | case 'A_ONE': |
| | | material.opacity = color[3] * transparency.float; |
| | | break; |
| | | case 'RGB_ZERO': |
| | | material.opacity = 1 - (color[0] * transparency.float); |
| | | break; |
| | | case 'A_ZERO': |
| | | material.opacity = 1 - (color[3] * transparency.float); |
| | | break; |
| | | case 'RGB_ONE': |
| | | material.opacity = color[0] * transparency.float; |
| | | break; |
| | | default: |
| | | console.warn('THREE.ColladaLoader: Invalid opaque type "%s" of transparent tag.', transparent.opaque); |
| | | |
| | | } |
| | | |
| | | if (material.opacity < 1) material.transparent = true; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | // |
| | | |
| | | if (extra !== undefined && extra.technique !== undefined && extra.technique.double_sided === 1) { |
| | | |
| | | material.side = THREE.DoubleSide; |
| | | |
| | | } |
| | | |
| | | return material; |
| | | |
| | | } |
| | | |
| | | function getMaterial(id) { |
| | | |
| | | return getBuild(library.materials[id], buildMaterial); |
| | | |
| | | } |
| | | |
| | | // camera |
| | | |
| | | function parseCamera(xml) { |
| | | |
| | | var data = { |
| | | name: xml.getAttribute('name') |
| | | }; |
| | | |
| | | for (var i = 0, l = xml.childNodes.length; i < l; i++) { |
| | | |
| | | var child = xml.childNodes[i]; |
| | | |
| | | if (child.nodeType !== 1) continue; |
| | | |
| | | switch (child.nodeName) { |
| | | |
| | | case 'optics': |
| | | data.optics = parseCameraOptics(child); |
| | | break; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | library.cameras[xml.getAttribute('id')] = data; |
| | | |
| | | } |
| | | |
| | | function parseCameraOptics(xml) { |
| | | |
| | | for (var i = 0; i < xml.childNodes.length; i++) { |
| | | |
| | | var child = xml.childNodes[i]; |
| | | |
| | | switch (child.nodeName) { |
| | | |
| | | case 'technique_common': |
| | | return parseCameraTechnique(child); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | return {}; |
| | | |
| | | } |
| | | |
| | | function parseCameraTechnique(xml) { |
| | | |
| | | var data = {}; |
| | | |
| | | for (var i = 0; i < xml.childNodes.length; i++) { |
| | | |
| | | var child = xml.childNodes[i]; |
| | | |
| | | switch (child.nodeName) { |
| | | |
| | | case 'perspective': |
| | | case 'orthographic': |
| | | |
| | | data.technique = child.nodeName; |
| | | data.parameters = parseCameraParameters(child); |
| | | |
| | | break; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | return data; |
| | | |
| | | } |
| | | |
| | | function parseCameraParameters(xml) { |
| | | |
| | | var data = {}; |
| | | |
| | | for (var i = 0; i < xml.childNodes.length; i++) { |
| | | |
| | | var child = xml.childNodes[i]; |
| | | |
| | | switch (child.nodeName) { |
| | | |
| | | case 'xfov': |
| | | case 'yfov': |
| | | case 'xmag': |
| | | case 'ymag': |
| | | case 'znear': |
| | | case 'zfar': |
| | | case 'aspect_ratio': |
| | | data[child.nodeName] = parseFloat(child.textContent); |
| | | break; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | return data; |
| | | |
| | | } |
| | | |
| | | function buildCamera(data) { |
| | | |
| | | var camera; |
| | | |
| | | switch (data.optics.technique) { |
| | | |
| | | case 'perspective': |
| | | camera = new THREE.PerspectiveCamera( |
| | | data.optics.parameters.yfov, |
| | | data.optics.parameters.aspect_ratio, |
| | | data.optics.parameters.znear, |
| | | data.optics.parameters.zfar |
| | | ); |
| | | break; |
| | | |
| | | case 'orthographic': |
| | | var ymag = data.optics.parameters.ymag; |
| | | var xmag = data.optics.parameters.xmag; |
| | | var aspectRatio = data.optics.parameters.aspect_ratio; |
| | | |
| | | xmag = (xmag === undefined) ? (ymag * aspectRatio) : xmag; |
| | | ymag = (ymag === undefined) ? (xmag / aspectRatio) : ymag; |
| | | |
| | | xmag *= 0.5; |
| | | ymag *= 0.5; |
| | | |
| | | camera = new THREE.OrthographicCamera( |
| | | -xmag, xmag, ymag, -ymag, // left, right, top, bottom |
| | | data.optics.parameters.znear, |
| | | data.optics.parameters.zfar |
| | | ); |
| | | break; |
| | | |
| | | default: |
| | | camera = new THREE.PerspectiveCamera(); |
| | | break; |
| | | |
| | | } |
| | | |
| | | camera.name = data.name; |
| | | |
| | | return camera; |
| | | |
| | | } |
| | | |
| | | function getCamera(id) { |
| | | |
| | | var data = library.cameras[id]; |
| | | |
| | | if (data !== undefined) { |
| | | |
| | | return getBuild(data, buildCamera); |
| | | |
| | | } |
| | | |
| | | console.warn('THREE.ColladaLoader: Couldn\'t find camera with ID:', id); |
| | | |
| | | return null; |
| | | |
| | | } |
| | | |
| | | // light |
| | | |
| | | function parseLight(xml) { |
| | | |
| | | var data = {}; |
| | | |
| | | for (var i = 0, l = xml.childNodes.length; i < l; i++) { |
| | | |
| | | var child = xml.childNodes[i]; |
| | | |
| | | if (child.nodeType !== 1) continue; |
| | | |
| | | switch (child.nodeName) { |
| | | |
| | | case 'technique_common': |
| | | data = parseLightTechnique(child); |
| | | break; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | library.lights[xml.getAttribute('id')] = data; |
| | | |
| | | } |
| | | |
| | | function parseLightTechnique(xml) { |
| | | |
| | | var data = {}; |
| | | |
| | | for (var i = 0, l = xml.childNodes.length; i < l; i++) { |
| | | |
| | | var child = xml.childNodes[i]; |
| | | |
| | | if (child.nodeType !== 1) continue; |
| | | |
| | | switch (child.nodeName) { |
| | | |
| | | case 'directional': |
| | | case 'point': |
| | | case 'spot': |
| | | case 'ambient': |
| | | |
| | | data.technique = child.nodeName; |
| | | data.parameters = parseLightParameters(child); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | return data; |
| | | |
| | | } |
| | | |
| | | function parseLightParameters(xml) { |
| | | |
| | | var data = {}; |
| | | |
| | | for (var i = 0, l = xml.childNodes.length; i < l; i++) { |
| | | |
| | | var child = xml.childNodes[i]; |
| | | |
| | | if (child.nodeType !== 1) continue; |
| | | |
| | | switch (child.nodeName) { |
| | | |
| | | case 'color': |
| | | var array = parseFloats(child.textContent); |
| | | data.color = new THREE.Color().fromArray(array); |
| | | break; |
| | | |
| | | case 'falloff_angle': |
| | | data.falloffAngle = parseFloat(child.textContent); |
| | | break; |
| | | |
| | | case 'quadratic_attenuation': |
| | | var f = parseFloat(child.textContent); |
| | | data.distance = f ? Math.sqrt(1 / f) : 0; |
| | | break; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | return data; |
| | | |
| | | } |
| | | |
| | | function buildLight(data) { |
| | | |
| | | var light; |
| | | |
| | | switch (data.technique) { |
| | | |
| | | case 'directional': |
| | | light = new THREE.DirectionalLight(); |
| | | break; |
| | | |
| | | case 'point': |
| | | light = new THREE.PointLight(); |
| | | break; |
| | | |
| | | case 'spot': |
| | | light = new THREE.SpotLight(); |
| | | break; |
| | | |
| | | case 'ambient': |
| | | light = new THREE.AmbientLight(); |
| | | break; |
| | | |
| | | } |
| | | |
| | | if (data.parameters.color) light.color.copy(data.parameters.color); |
| | | if (data.parameters.distance) light.distance = data.parameters.distance; |
| | | |
| | | return light; |
| | | |
| | | } |
| | | |
| | | function getLight(id) { |
| | | |
| | | var data = library.lights[id]; |
| | | |
| | | if (data !== undefined) { |
| | | |
| | | return getBuild(data, buildLight); |
| | | |
| | | } |
| | | |
| | | console.warn('THREE.ColladaLoader: Couldn\'t find light with ID:', id); |
| | | |
| | | return null; |
| | | |
| | | } |
| | | |
| | | // geometry |
| | | |
| | | function parseGeometry(xml) { |
| | | |
| | | var data = { |
| | | name: xml.getAttribute('name'), |
| | | sources: {}, |
| | | vertices: {}, |
| | | primitives: [] |
| | | }; |
| | | |
| | | var mesh = getElementsByTagName(xml, 'mesh')[0]; |
| | | |
| | | // the following tags inside geometry are not supported yet (see https://github.com/mrdoob/three.js/pull/12606): convex_mesh, spline, brep |
| | | if (mesh === undefined) return; |
| | | |
| | | for (var i = 0; i < mesh.childNodes.length; i++) { |
| | | |
| | | var child = mesh.childNodes[i]; |
| | | |
| | | if (child.nodeType !== 1) continue; |
| | | |
| | | var id = child.getAttribute('id'); |
| | | |
| | | switch (child.nodeName) { |
| | | |
| | | case 'source': |
| | | data.sources[id] = parseSource(child); |
| | | break; |
| | | |
| | | case 'vertices': |
| | | // data.sources[ id ] = data.sources[ parseId( getElementsByTagName( child, 'input' )[ 0 ].getAttribute( 'source' ) ) ]; |
| | | data.vertices = parseGeometryVertices(child); |
| | | break; |
| | | |
| | | case 'polygons': |
| | | console.warn('THREE.ColladaLoader: Unsupported primitive type: ', child.nodeName); |
| | | break; |
| | | |
| | | case 'lines': |
| | | case 'linestrips': |
| | | case 'polylist': |
| | | case 'triangles': |
| | | data.primitives.push(parseGeometryPrimitive(child)); |
| | | break; |
| | | |
| | | default: |
| | | console.log(child); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | library.geometries[xml.getAttribute('id')] = data; |
| | | |
| | | } |
| | | |
| | | function parseSource(xml) { |
| | | |
| | | var data = { |
| | | array: [], |
| | | stride: 3 |
| | | }; |
| | | |
| | | for (var i = 0; i < xml.childNodes.length; i++) { |
| | | |
| | | var child = xml.childNodes[i]; |
| | | |
| | | if (child.nodeType !== 1) continue; |
| | | |
| | | switch (child.nodeName) { |
| | | |
| | | case 'float_array': |
| | | data.array = parseFloats(child.textContent); |
| | | break; |
| | | |
| | | case 'Name_array': |
| | | data.array = parseStrings(child.textContent); |
| | | break; |
| | | |
| | | case 'technique_common': |
| | | var accessor = getElementsByTagName(child, 'accessor')[0]; |
| | | |
| | | if (accessor !== undefined) { |
| | | |
| | | data.stride = parseInt(accessor.getAttribute('stride')); |
| | | |
| | | } |
| | | break; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | return data; |
| | | |
| | | } |
| | | |
| | | function parseGeometryVertices(xml) { |
| | | |
| | | var data = {}; |
| | | |
| | | for (var i = 0; i < xml.childNodes.length; i++) { |
| | | |
| | | var child = xml.childNodes[i]; |
| | | |
| | | if (child.nodeType !== 1) continue; |
| | | |
| | | data[child.getAttribute('semantic')] = parseId(child.getAttribute('source')); |
| | | |
| | | } |
| | | |
| | | return data; |
| | | |
| | | } |
| | | |
| | | function parseGeometryPrimitive(xml) { |
| | | |
| | | var primitive = { |
| | | type: xml.nodeName, |
| | | material: xml.getAttribute('material'), |
| | | count: parseInt(xml.getAttribute('count')), |
| | | inputs: {}, |
| | | stride: 0, |
| | | hasUV: false |
| | | }; |
| | | |
| | | for (var i = 0, l = xml.childNodes.length; i < l; i++) { |
| | | |
| | | var child = xml.childNodes[i]; |
| | | |
| | | if (child.nodeType !== 1) continue; |
| | | |
| | | switch (child.nodeName) { |
| | | |
| | | case 'input': |
| | | var id = parseId(child.getAttribute('source')); |
| | | var semantic = child.getAttribute('semantic'); |
| | | var offset = parseInt(child.getAttribute('offset')); |
| | | primitive.inputs[semantic] = { id: id, offset: offset }; |
| | | primitive.stride = Math.max(primitive.stride, offset + 1); |
| | | if (semantic === 'TEXCOORD') primitive.hasUV = true; |
| | | break; |
| | | |
| | | case 'vcount': |
| | | primitive.vcount = parseInts(child.textContent); |
| | | break; |
| | | |
| | | case 'p': |
| | | primitive.p = parseInts(child.textContent); |
| | | break; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | return primitive; |
| | | |
| | | } |
| | | |
| | | function groupPrimitives(primitives) { |
| | | |
| | | var build = {}; |
| | | |
| | | for (var i = 0; i < primitives.length; i++) { |
| | | |
| | | var primitive = primitives[i]; |
| | | |
| | | if (build[primitive.type] === undefined) build[primitive.type] = []; |
| | | |
| | | build[primitive.type].push(primitive); |
| | | |
| | | } |
| | | |
| | | return build; |
| | | |
| | | } |
| | | |
| | | function checkUVCoordinates(primitives) { |
| | | |
| | | var count = 0; |
| | | |
| | | for (var i = 0, l = primitives.length; i < l; i++) { |
| | | |
| | | var primitive = primitives[i]; |
| | | |
| | | if (primitive.hasUV === true) { |
| | | |
| | | count++; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | if (count > 0 && count < primitives.length) { |
| | | |
| | | primitives.uvsNeedsFix = true; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | function buildGeometry(data) { |
| | | |
| | | var build = {}; |
| | | |
| | | var sources = data.sources; |
| | | var vertices = data.vertices; |
| | | var primitives = data.primitives; |
| | | |
| | | if (primitives.length === 0) return {}; |
| | | |
| | | // our goal is to create one buffer geometry for a single type of primitives |
| | | // first, we group all primitives by their type |
| | | |
| | | var groupedPrimitives = groupPrimitives(primitives); |
| | | |
| | | for (var type in groupedPrimitives) { |
| | | |
| | | var primitiveType = groupedPrimitives[type]; |
| | | |
| | | // second, ensure consistent uv coordinates for each type of primitives (polylist,triangles or lines) |
| | | |
| | | checkUVCoordinates(primitiveType); |
| | | |
| | | // third, create a buffer geometry for each type of primitives |
| | | |
| | | build[type] = buildGeometryType(primitiveType, sources, vertices); |
| | | |
| | | } |
| | | |
| | | return build; |
| | | |
| | | } |
| | | |
| | | function buildGeometryType(primitives, sources, vertices) { |
| | | |
| | | var build = {}; |
| | | |
| | | var position = { array: [], stride: 0 }; |
| | | var normal = { array: [], stride: 0 }; |
| | | var uv = { array: [], stride: 0 }; |
| | | var color = { array: [], stride: 0 }; |
| | | |
| | | var skinIndex = { array: [], stride: 4 }; |
| | | var skinWeight = { array: [], stride: 4 }; |
| | | |
| | | var geometry = new THREE.BufferGeometry(); |
| | | |
| | | var materialKeys = []; |
| | | |
| | | var start = 0; |
| | | |
| | | for (var p = 0; p < primitives.length; p++) { |
| | | |
| | | var primitive = primitives[p]; |
| | | var inputs = primitive.inputs; |
| | | |
| | | // groups |
| | | |
| | | var count = 0; |
| | | |
| | | switch (primitive.type) { |
| | | |
| | | case 'lines': |
| | | case 'linestrips': |
| | | count = primitive.count * 2; |
| | | break; |
| | | |
| | | case 'triangles': |
| | | count = primitive.count * 3; |
| | | break; |
| | | |
| | | case 'polylist': |
| | | |
| | | for (var g = 0; g < primitive.count; g++) { |
| | | |
| | | var vc = primitive.vcount[g]; |
| | | |
| | | switch (vc) { |
| | | |
| | | case 3: |
| | | count += 3; // single triangle |
| | | break; |
| | | |
| | | case 4: |
| | | count += 6; // quad, subdivided into two triangles |
| | | break; |
| | | |
| | | default: |
| | | count += (vc - 2) * 3; // polylist with more than four vertices |
| | | break; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | break; |
| | | |
| | | default: |
| | | console.warn('THREE.ColladaLoader: Unknow primitive type:', primitive.type); |
| | | |
| | | } |
| | | |
| | | geometry.addGroup(start, count, p); |
| | | start += count; |
| | | |
| | | // material |
| | | |
| | | if (primitive.material) { |
| | | |
| | | materialKeys.push(primitive.material); |
| | | |
| | | } |
| | | |
| | | // geometry data |
| | | |
| | | for (var name in inputs) { |
| | | |
| | | var input = inputs[name]; |
| | | |
| | | switch (name) { |
| | | |
| | | case 'VERTEX': |
| | | for (var key in vertices) { |
| | | |
| | | var id = vertices[key]; |
| | | |
| | | switch (key) { |
| | | |
| | | case 'POSITION': |
| | | var prevLength = position.array.length; |
| | | buildGeometryData(primitive, sources[id], input.offset, position.array); |
| | | position.stride = sources[id].stride; |
| | | |
| | | if (sources.skinWeights && sources.skinIndices) { |
| | | |
| | | buildGeometryData(primitive, sources.skinIndices, input.offset, skinIndex.array); |
| | | buildGeometryData(primitive, sources.skinWeights, input.offset, skinWeight.array); |
| | | |
| | | } |
| | | |
| | | // see #3803 |
| | | |
| | | if (primitive.hasUV === false && primitives.uvsNeedsFix === true) { |
| | | |
| | | var count = (position.array.length - prevLength) / position.stride; |
| | | |
| | | for (var i = 0; i < count; i++) { |
| | | |
| | | // fill missing uv coordinates |
| | | |
| | | uv.array.push(0, 0); |
| | | |
| | | } |
| | | |
| | | } |
| | | break; |
| | | |
| | | case 'NORMAL': |
| | | buildGeometryData(primitive, sources[id], input.offset, normal.array); |
| | | normal.stride = sources[id].stride; |
| | | break; |
| | | |
| | | case 'COLOR': |
| | | buildGeometryData(primitive, sources[id], input.offset, color.array); |
| | | color.stride = sources[id].stride; |
| | | break; |
| | | |
| | | case 'TEXCOORD': |
| | | buildGeometryData(primitive, sources[id], input.offset, uv.array); |
| | | uv.stride = sources[id].stride; |
| | | break; |
| | | |
| | | default: |
| | | console.warn('THREE.ColladaLoader: Semantic "%s" not handled in geometry build process.', key); |
| | | |
| | | } |
| | | |
| | | } |
| | | break; |
| | | |
| | | case 'NORMAL': |
| | | buildGeometryData(primitive, sources[input.id], input.offset, normal.array); |
| | | normal.stride = sources[input.id].stride; |
| | | break; |
| | | |
| | | case 'COLOR': |
| | | buildGeometryData(primitive, sources[input.id], input.offset, color.array); |
| | | color.stride = sources[input.id].stride; |
| | | break; |
| | | |
| | | case 'TEXCOORD': |
| | | buildGeometryData(primitive, sources[input.id], input.offset, uv.array); |
| | | uv.stride = sources[input.id].stride; |
| | | break; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | // build geometry |
| | | |
| | | if (position.array.length > 0) geometry.addAttribute('position', new THREE.Float32BufferAttribute(position.array, position.stride)); |
| | | if (normal.array.length > 0) geometry.addAttribute('normal', new THREE.Float32BufferAttribute(normal.array, normal.stride)); |
| | | if (color.array.length > 0) geometry.addAttribute('color', new THREE.Float32BufferAttribute(color.array, color.stride)); |
| | | if (uv.array.length > 0) geometry.addAttribute('uv', new THREE.Float32BufferAttribute(uv.array, uv.stride)); |
| | | |
| | | if (skinIndex.array.length > 0) geometry.addAttribute('skinIndex', new THREE.Float32BufferAttribute(skinIndex.array, skinIndex.stride)); |
| | | if (skinWeight.array.length > 0) geometry.addAttribute('skinWeight', new THREE.Float32BufferAttribute(skinWeight.array, skinWeight.stride)); |
| | | |
| | | build.data = geometry; |
| | | build.type = primitives[0].type; |
| | | build.materialKeys = materialKeys; |
| | | |
| | | return build; |
| | | |
| | | } |
| | | |
| | | function buildGeometryData(primitive, source, offset, array) { |
| | | |
| | | var indices = primitive.p; |
| | | var stride = primitive.stride; |
| | | var vcount = primitive.vcount; |
| | | |
| | | function pushVector(i) { |
| | | |
| | | var index = indices[i + offset] * sourceStride; |
| | | var length = index + sourceStride; |
| | | |
| | | for (; index < length; index++) { |
| | | |
| | | array.push(sourceArray[index]); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | var sourceArray = source.array; |
| | | var sourceStride = source.stride; |
| | | |
| | | if (primitive.vcount !== undefined) { |
| | | |
| | | var index = 0; |
| | | |
| | | for (var i = 0, l = vcount.length; i < l; i++) { |
| | | |
| | | var count = vcount[i]; |
| | | |
| | | if (count === 4) { |
| | | |
| | | var a = index + stride * 0; |
| | | var b = index + stride * 1; |
| | | var c = index + stride * 2; |
| | | var d = index + stride * 3; |
| | | |
| | | pushVector(a); pushVector(b); pushVector(d); |
| | | pushVector(b); pushVector(c); pushVector(d); |
| | | |
| | | } else if (count === 3) { |
| | | |
| | | var a = index + stride * 0; |
| | | var b = index + stride * 1; |
| | | var c = index + stride * 2; |
| | | |
| | | pushVector(a); pushVector(b); pushVector(c); |
| | | |
| | | } else if (count > 4) { |
| | | |
| | | for (var k = 1, kl = (count - 2) ; k <= kl; k++) { |
| | | |
| | | var a = index + stride * 0; |
| | | var b = index + stride * k; |
| | | var c = index + stride * (k + 1); |
| | | |
| | | pushVector(a); pushVector(b); pushVector(c); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | index += stride * count; |
| | | |
| | | } |
| | | |
| | | } else { |
| | | |
| | | for (var i = 0, l = indices.length; i < l; i += stride) { |
| | | |
| | | pushVector(i); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | function getGeometry(id) { |
| | | |
| | | return getBuild(library.geometries[id], buildGeometry); |
| | | |
| | | } |
| | | |
| | | // kinematics |
| | | |
| | | function parseKinematicsModel(xml) { |
| | | |
| | | var data = { |
| | | name: xml.getAttribute('name') || '', |
| | | joints: {}, |
| | | links: [] |
| | | }; |
| | | |
| | | for (var i = 0; i < xml.childNodes.length; i++) { |
| | | |
| | | var child = xml.childNodes[i]; |
| | | |
| | | if (child.nodeType !== 1) continue; |
| | | |
| | | switch (child.nodeName) { |
| | | |
| | | case 'technique_common': |
| | | parseKinematicsTechniqueCommon(child, data); |
| | | break; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | library.kinematicsModels[xml.getAttribute('id')] = data; |
| | | |
| | | } |
| | | |
| | | function buildKinematicsModel(data) { |
| | | |
| | | if (data.build !== undefined) return data.build; |
| | | |
| | | return data; |
| | | |
| | | } |
| | | |
| | | function getKinematicsModel(id) { |
| | | |
| | | return getBuild(library.kinematicsModels[id], buildKinematicsModel); |
| | | |
| | | } |
| | | |
| | | function parseKinematicsTechniqueCommon(xml, data) { |
| | | |
| | | for (var i = 0; i < xml.childNodes.length; i++) { |
| | | |
| | | var child = xml.childNodes[i]; |
| | | |
| | | if (child.nodeType !== 1) continue; |
| | | |
| | | switch (child.nodeName) { |
| | | |
| | | case 'joint': |
| | | data.joints[child.getAttribute('sid')] = parseKinematicsJoint(child); |
| | | break; |
| | | |
| | | case 'link': |
| | | data.links.push(parseKinematicsLink(child)); |
| | | break; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | function parseKinematicsJoint(xml) { |
| | | |
| | | var data; |
| | | |
| | | for (var i = 0; i < xml.childNodes.length; i++) { |
| | | |
| | | var child = xml.childNodes[i]; |
| | | |
| | | if (child.nodeType !== 1) continue; |
| | | |
| | | switch (child.nodeName) { |
| | | |
| | | case 'prismatic': |
| | | case 'revolute': |
| | | data = parseKinematicsJointParameter(child); |
| | | break; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | return data; |
| | | |
| | | } |
| | | |
| | | function parseKinematicsJointParameter(xml, data) { |
| | | |
| | | var data = { |
| | | sid: xml.getAttribute('sid'), |
| | | name: xml.getAttribute('name') || '', |
| | | axis: new THREE.Vector3(), |
| | | limits: { |
| | | min: 0, |
| | | max: 0 |
| | | }, |
| | | type: xml.nodeName, |
| | | static: false, |
| | | zeroPosition: 0, |
| | | middlePosition: 0 |
| | | }; |
| | | |
| | | for (var i = 0; i < xml.childNodes.length; i++) { |
| | | |
| | | var child = xml.childNodes[i]; |
| | | |
| | | if (child.nodeType !== 1) continue; |
| | | |
| | | switch (child.nodeName) { |
| | | |
| | | case 'axis': |
| | | var array = parseFloats(child.textContent); |
| | | data.axis.fromArray(array); |
| | | break; |
| | | case 'limits': |
| | | var max = child.getElementsByTagName('max')[0]; |
| | | var min = child.getElementsByTagName('min')[0]; |
| | | |
| | | data.limits.max = parseFloat(max.textContent); |
| | | data.limits.min = parseFloat(min.textContent); |
| | | break; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | // if min is equal to or greater than max, consider the joint static |
| | | |
| | | if (data.limits.min >= data.limits.max) { |
| | | |
| | | data.static = true; |
| | | |
| | | } |
| | | |
| | | // calculate middle position |
| | | |
| | | data.middlePosition = (data.limits.min + data.limits.max) / 2.0; |
| | | |
| | | return data; |
| | | |
| | | } |
| | | |
| | | function parseKinematicsLink(xml) { |
| | | |
| | | var data = { |
| | | sid: xml.getAttribute('sid'), |
| | | name: xml.getAttribute('name') || '', |
| | | attachments: [], |
| | | transforms: [] |
| | | }; |
| | | |
| | | for (var i = 0; i < xml.childNodes.length; i++) { |
| | | |
| | | var child = xml.childNodes[i]; |
| | | |
| | | if (child.nodeType !== 1) continue; |
| | | |
| | | switch (child.nodeName) { |
| | | |
| | | case 'attachment_full': |
| | | data.attachments.push(parseKinematicsAttachment(child)); |
| | | break; |
| | | |
| | | case 'matrix': |
| | | case 'translate': |
| | | case 'rotate': |
| | | data.transforms.push(parseKinematicsTransform(child)); |
| | | break; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | return data; |
| | | |
| | | } |
| | | |
| | | function parseKinematicsAttachment(xml) { |
| | | |
| | | var data = { |
| | | joint: xml.getAttribute('joint').split('/').pop(), |
| | | transforms: [], |
| | | links: [] |
| | | }; |
| | | |
| | | for (var i = 0; i < xml.childNodes.length; i++) { |
| | | |
| | | var child = xml.childNodes[i]; |
| | | |
| | | if (child.nodeType !== 1) continue; |
| | | |
| | | switch (child.nodeName) { |
| | | |
| | | case 'link': |
| | | data.links.push(parseKinematicsLink(child)); |
| | | break; |
| | | |
| | | case 'matrix': |
| | | case 'translate': |
| | | case 'rotate': |
| | | data.transforms.push(parseKinematicsTransform(child)); |
| | | break; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | return data; |
| | | |
| | | } |
| | | |
| | | function parseKinematicsTransform(xml) { |
| | | |
| | | var data = { |
| | | type: xml.nodeName |
| | | }; |
| | | |
| | | var array = parseFloats(xml.textContent); |
| | | |
| | | switch (data.type) { |
| | | |
| | | case 'matrix': |
| | | data.obj = new THREE.Matrix4(); |
| | | data.obj.fromArray(array).transpose(); |
| | | break; |
| | | |
| | | case 'translate': |
| | | data.obj = new THREE.Vector3(); |
| | | data.obj.fromArray(array); |
| | | break; |
| | | |
| | | case 'rotate': |
| | | data.obj = new THREE.Vector3(); |
| | | data.obj.fromArray(array); |
| | | data.angle = THREE.Math.degToRad(array[3]); |
| | | break; |
| | | |
| | | } |
| | | |
| | | return data; |
| | | |
| | | } |
| | | |
| | | // physics |
| | | |
| | | function parsePhysicsModel(xml) { |
| | | |
| | | var data = { |
| | | name: xml.getAttribute('name') || '', |
| | | rigidBodies: {} |
| | | }; |
| | | |
| | | for (var i = 0; i < xml.childNodes.length; i++) { |
| | | |
| | | var child = xml.childNodes[i]; |
| | | |
| | | if (child.nodeType !== 1) continue; |
| | | |
| | | switch (child.nodeName) { |
| | | |
| | | case 'rigid_body': |
| | | data.rigidBodies[child.getAttribute('name')] = {}; |
| | | parsePhysicsRigidBody(child, data.rigidBodies[child.getAttribute('name')]); |
| | | break; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | library.physicsModels[xml.getAttribute('id')] = data; |
| | | |
| | | } |
| | | |
| | | function parsePhysicsRigidBody(xml, data) { |
| | | |
| | | for (var i = 0; i < xml.childNodes.length; i++) { |
| | | |
| | | var child = xml.childNodes[i]; |
| | | |
| | | if (child.nodeType !== 1) continue; |
| | | |
| | | switch (child.nodeName) { |
| | | |
| | | case 'technique_common': |
| | | parsePhysicsTechniqueCommon(child, data); |
| | | break; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | function parsePhysicsTechniqueCommon(xml, data) { |
| | | |
| | | for (var i = 0; i < xml.childNodes.length; i++) { |
| | | |
| | | var child = xml.childNodes[i]; |
| | | |
| | | if (child.nodeType !== 1) continue; |
| | | |
| | | switch (child.nodeName) { |
| | | |
| | | case 'inertia': |
| | | data.inertia = parseFloats(child.textContent); |
| | | break; |
| | | |
| | | case 'mass': |
| | | data.mass = parseFloats(child.textContent)[0]; |
| | | break; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | // scene |
| | | |
| | | function parseKinematicsScene(xml) { |
| | | |
| | | var data = { |
| | | bindJointAxis: [] |
| | | }; |
| | | |
| | | for (var i = 0; i < xml.childNodes.length; i++) { |
| | | |
| | | var child = xml.childNodes[i]; |
| | | |
| | | if (child.nodeType !== 1) continue; |
| | | |
| | | switch (child.nodeName) { |
| | | |
| | | case 'bind_joint_axis': |
| | | data.bindJointAxis.push(parseKinematicsBindJointAxis(child)); |
| | | break; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | library.kinematicsScenes[parseId(xml.getAttribute('url'))] = data; |
| | | |
| | | } |
| | | |
| | | function parseKinematicsBindJointAxis(xml) { |
| | | |
| | | var data = { |
| | | target: xml.getAttribute('target').split('/').pop() |
| | | }; |
| | | |
| | | for (var i = 0; i < xml.childNodes.length; i++) { |
| | | |
| | | var child = xml.childNodes[i]; |
| | | |
| | | if (child.nodeType !== 1) continue; |
| | | |
| | | switch (child.nodeName) { |
| | | |
| | | case 'axis': |
| | | var param = child.getElementsByTagName('param')[0]; |
| | | data.axis = param.textContent; |
| | | var tmpJointIndex = data.axis.split('inst_').pop().split('axis')[0]; |
| | | data.jointIndex = tmpJointIndex.substr(0, tmpJointIndex.length - 1); |
| | | break; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | return data; |
| | | |
| | | } |
| | | |
| | | function buildKinematicsScene(data) { |
| | | |
| | | if (data.build !== undefined) return data.build; |
| | | |
| | | return data; |
| | | |
| | | } |
| | | |
| | | function getKinematicsScene(id) { |
| | | |
| | | return getBuild(library.kinematicsScenes[id], buildKinematicsScene); |
| | | |
| | | } |
| | | |
| | | function setupKinematics() { |
| | | |
| | | var kinematicsModelId = Object.keys(library.kinematicsModels)[0]; |
| | | var kinematicsSceneId = Object.keys(library.kinematicsScenes)[0]; |
| | | var visualSceneId = Object.keys(library.visualScenes)[0]; |
| | | |
| | | if (kinematicsModelId === undefined || kinematicsSceneId === undefined) return; |
| | | |
| | | var kinematicsModel = getKinematicsModel(kinematicsModelId); |
| | | var kinematicsScene = getKinematicsScene(kinematicsSceneId); |
| | | var visualScene = getVisualScene(visualSceneId); |
| | | |
| | | var bindJointAxis = kinematicsScene.bindJointAxis; |
| | | var jointMap = {}; |
| | | |
| | | for (var i = 0, l = bindJointAxis.length; i < l; i++) { |
| | | |
| | | var axis = bindJointAxis[i]; |
| | | |
| | | // the result of the following query is an element of type 'translate', 'rotate','scale' or 'matrix' |
| | | |
| | | var targetElement = collada.querySelector('[sid="' + axis.target + '"]'); |
| | | |
| | | if (targetElement) { |
| | | |
| | | // get the parent of the transfrom element |
| | | |
| | | var parentVisualElement = targetElement.parentElement; |
| | | |
| | | // connect the joint of the kinematics model with the element in the visual scene |
| | | |
| | | connect(axis.jointIndex, parentVisualElement); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | function connect(jointIndex, visualElement) { |
| | | |
| | | var visualElementName = visualElement.getAttribute('name'); |
| | | var joint = kinematicsModel.joints[jointIndex]; |
| | | |
| | | visualScene.traverse(function (object) { |
| | | |
| | | if (object.name === visualElementName) { |
| | | |
| | | jointMap[jointIndex] = { |
| | | object: object, |
| | | transforms: buildTransformList(visualElement), |
| | | joint: joint, |
| | | position: joint.zeroPosition |
| | | }; |
| | | |
| | | } |
| | | |
| | | }); |
| | | |
| | | } |
| | | |
| | | var m0 = new THREE.Matrix4(); |
| | | |
| | | kinematics = { |
| | | |
| | | joints: kinematicsModel && kinematicsModel.joints, |
| | | |
| | | getJointValue: function (jointIndex) { |
| | | |
| | | var jointData = jointMap[jointIndex]; |
| | | |
| | | if (jointData) { |
| | | |
| | | return jointData.position; |
| | | |
| | | } else { |
| | | |
| | | console.warn('THREE.ColladaLoader: Joint ' + jointIndex + ' doesn\'t exist.'); |
| | | |
| | | } |
| | | |
| | | }, |
| | | |
| | | setJointValue: function (jointIndex, value) { |
| | | |
| | | var jointData = jointMap[jointIndex]; |
| | | |
| | | if (jointData) { |
| | | |
| | | var joint = jointData.joint; |
| | | |
| | | if (value > joint.limits.max || value < joint.limits.min) { |
| | | |
| | | console.warn('THREE.ColladaLoader: Joint ' + jointIndex + ' value ' + value + ' outside of limits (min: ' + joint.limits.min + ', max: ' + joint.limits.max + ').'); |
| | | |
| | | } else if (joint.static) { |
| | | |
| | | console.warn('THREE.ColladaLoader: Joint ' + jointIndex + ' is static.'); |
| | | |
| | | } else { |
| | | |
| | | var object = jointData.object; |
| | | var axis = joint.axis; |
| | | var transforms = jointData.transforms; |
| | | |
| | | matrix.identity(); |
| | | |
| | | // each update, we have to apply all transforms in the correct order |
| | | |
| | | for (var i = 0; i < transforms.length; i++) { |
| | | |
| | | var transform = transforms[i]; |
| | | |
| | | // if there is a connection of the transform node with a joint, apply the joint value |
| | | |
| | | if (transform.sid && transform.sid.indexOf(jointIndex) !== -1) { |
| | | |
| | | switch (joint.type) { |
| | | |
| | | case 'revolute': |
| | | matrix.multiply(m0.makeRotationAxis(axis, THREE.Math.degToRad(value))); |
| | | break; |
| | | |
| | | case 'prismatic': |
| | | matrix.multiply(m0.makeTranslation(axis.x * value, axis.y * value, axis.z * value)); |
| | | break; |
| | | |
| | | default: |
| | | console.warn('THREE.ColladaLoader: Unknown joint type: ' + joint.type); |
| | | break; |
| | | |
| | | } |
| | | |
| | | } else { |
| | | |
| | | switch (transform.type) { |
| | | |
| | | case 'matrix': |
| | | matrix.multiply(transform.obj); |
| | | break; |
| | | |
| | | case 'translate': |
| | | matrix.multiply(m0.makeTranslation(transform.obj.x, transform.obj.y, transform.obj.z)); |
| | | break; |
| | | |
| | | case 'scale': |
| | | matrix.scale(transform.obj); |
| | | break; |
| | | |
| | | case 'rotate': |
| | | matrix.multiply(m0.makeRotationAxis(transform.obj, transform.angle)); |
| | | break; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | object.matrix.copy(matrix); |
| | | object.matrix.decompose(object.position, object.quaternion, object.scale); |
| | | |
| | | jointMap[jointIndex].position = value; |
| | | |
| | | } |
| | | |
| | | } else { |
| | | |
| | | console.log('THREE.ColladaLoader: ' + jointIndex + ' does not exist.'); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | }; |
| | | |
| | | } |
| | | |
| | | function buildTransformList(node) { |
| | | |
| | | var transforms = []; |
| | | |
| | | var xml = collada.querySelector('[id="' + node.id + '"]'); |
| | | |
| | | for (var i = 0; i < xml.childNodes.length; i++) { |
| | | |
| | | var child = xml.childNodes[i]; |
| | | |
| | | if (child.nodeType !== 1) continue; |
| | | |
| | | switch (child.nodeName) { |
| | | |
| | | case 'matrix': |
| | | var array = parseFloats(child.textContent); |
| | | var matrix = new THREE.Matrix4().fromArray(array).transpose(); |
| | | transforms.push({ |
| | | sid: child.getAttribute('sid'), |
| | | type: child.nodeName, |
| | | obj: matrix |
| | | }); |
| | | break; |
| | | |
| | | case 'translate': |
| | | case 'scale': |
| | | var array = parseFloats(child.textContent); |
| | | var vector = new THREE.Vector3().fromArray(array); |
| | | transforms.push({ |
| | | sid: child.getAttribute('sid'), |
| | | type: child.nodeName, |
| | | obj: vector |
| | | }); |
| | | break; |
| | | |
| | | case 'rotate': |
| | | var array = parseFloats(child.textContent); |
| | | var vector = new THREE.Vector3().fromArray(array); |
| | | var angle = THREE.Math.degToRad(array[3]); |
| | | transforms.push({ |
| | | sid: child.getAttribute('sid'), |
| | | type: child.nodeName, |
| | | obj: vector, |
| | | angle: angle |
| | | }); |
| | | break; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | return transforms; |
| | | |
| | | } |
| | | |
| | | // nodes |
| | | |
| | | function prepareNodes(xml) { |
| | | |
| | | var elements = xml.getElementsByTagName('node'); |
| | | |
| | | // ensure all node elements have id attributes |
| | | |
| | | for (var i = 0; i < elements.length; i++) { |
| | | |
| | | var element = elements[i]; |
| | | |
| | | if (element.hasAttribute('id') === false) { |
| | | |
| | | element.setAttribute('id', generateId()); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | var matrix = new THREE.Matrix4(); |
| | | var vector = new THREE.Vector3(); |
| | | |
| | | function parseNode(xml) { |
| | | |
| | | var data = { |
| | | name: xml.getAttribute('name') || '', |
| | | type: xml.getAttribute('type'), |
| | | id: xml.getAttribute('id'), |
| | | sid: xml.getAttribute('sid'), |
| | | matrix: new THREE.Matrix4(), |
| | | nodes: [], |
| | | instanceCameras: [], |
| | | instanceControllers: [], |
| | | instanceLights: [], |
| | | instanceGeometries: [], |
| | | instanceNodes: [], |
| | | transforms: {} |
| | | }; |
| | | |
| | | for (var i = 0; i < xml.childNodes.length; i++) { |
| | | |
| | | var child = xml.childNodes[i]; |
| | | |
| | | if (child.nodeType !== 1) continue; |
| | | |
| | | switch (child.nodeName) { |
| | | |
| | | case 'node': |
| | | data.nodes.push(child.getAttribute('id')); |
| | | parseNode(child); |
| | | break; |
| | | |
| | | case 'instance_camera': |
| | | data.instanceCameras.push(parseId(child.getAttribute('url'))); |
| | | break; |
| | | |
| | | case 'instance_controller': |
| | | data.instanceControllers.push(parseNodeInstance(child)); |
| | | break; |
| | | |
| | | case 'instance_light': |
| | | data.instanceLights.push(parseId(child.getAttribute('url'))); |
| | | break; |
| | | |
| | | case 'instance_geometry': |
| | | data.instanceGeometries.push(parseNodeInstance(child)); |
| | | break; |
| | | |
| | | case 'instance_node': |
| | | data.instanceNodes.push(parseId(child.getAttribute('url'))); |
| | | break; |
| | | |
| | | case 'matrix': |
| | | var array = parseFloats(child.textContent); |
| | | data.matrix.multiply(matrix.fromArray(array).transpose()); |
| | | data.transforms[child.getAttribute('sid')] = child.nodeName; |
| | | break; |
| | | |
| | | case 'translate': |
| | | var array = parseFloats(child.textContent); |
| | | vector.fromArray(array); |
| | | data.matrix.multiply(matrix.makeTranslation(vector.x, vector.y, vector.z)); |
| | | data.transforms[child.getAttribute('sid')] = child.nodeName; |
| | | break; |
| | | |
| | | case 'rotate': |
| | | var array = parseFloats(child.textContent); |
| | | var angle = THREE.Math.degToRad(array[3]); |
| | | data.matrix.multiply(matrix.makeRotationAxis(vector.fromArray(array), angle)); |
| | | data.transforms[child.getAttribute('sid')] = child.nodeName; |
| | | break; |
| | | |
| | | case 'scale': |
| | | var array = parseFloats(child.textContent); |
| | | data.matrix.scale(vector.fromArray(array)); |
| | | data.transforms[child.getAttribute('sid')] = child.nodeName; |
| | | break; |
| | | |
| | | case 'extra': |
| | | break; |
| | | |
| | | default: |
| | | console.log(child); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | if (hasNode(data.id)) { |
| | | |
| | | console.warn('THREE.ColladaLoader: There is already a node with ID %s. Exclude current node from further processing.', data.id); |
| | | |
| | | } else { |
| | | |
| | | library.nodes[data.id] = data; |
| | | |
| | | } |
| | | |
| | | return data; |
| | | |
| | | } |
| | | |
| | | function parseNodeInstance(xml) { |
| | | |
| | | var data = { |
| | | id: parseId(xml.getAttribute('url')), |
| | | materials: {}, |
| | | skeletons: [] |
| | | }; |
| | | |
| | | for (var i = 0; i < xml.childNodes.length; i++) { |
| | | |
| | | var child = xml.childNodes[i]; |
| | | |
| | | switch (child.nodeName) { |
| | | |
| | | case 'bind_material': |
| | | var instances = child.getElementsByTagName('instance_material'); |
| | | |
| | | for (var j = 0; j < instances.length; j++) { |
| | | |
| | | var instance = instances[j]; |
| | | var symbol = instance.getAttribute('symbol'); |
| | | var target = instance.getAttribute('target'); |
| | | |
| | | data.materials[symbol] = parseId(target); |
| | | |
| | | } |
| | | |
| | | break; |
| | | |
| | | case 'skeleton': |
| | | data.skeletons.push(parseId(child.textContent)); |
| | | break; |
| | | |
| | | default: |
| | | break; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | return data; |
| | | |
| | | } |
| | | |
| | | function buildSkeleton(skeletons, joints) { |
| | | |
| | | var boneData = []; |
| | | var sortedBoneData = []; |
| | | |
| | | var i, j, data; |
| | | |
| | | // a skeleton can have multiple root bones. collada expresses this |
| | | // situtation with multiple "skeleton" tags per controller instance |
| | | |
| | | for (i = 0; i < skeletons.length; i++) { |
| | | |
| | | var skeleton = skeletons[i]; |
| | | |
| | | var root; |
| | | |
| | | if (hasNode(skeleton)) { |
| | | |
| | | root = getNode(skeleton); |
| | | buildBoneHierarchy(root, joints, boneData); |
| | | |
| | | } else if (hasVisualScene(skeleton)) { |
| | | |
| | | // handle case where the skeleton refers to the visual scene (#13335) |
| | | |
| | | var visualScene = library.visualScenes[skeleton]; |
| | | var children = visualScene.children; |
| | | |
| | | for (var j = 0; j < children.length; j++) { |
| | | |
| | | var child = children[j]; |
| | | |
| | | if (child.type === 'JOINT') { |
| | | |
| | | var root = getNode(child.id); |
| | | buildBoneHierarchy(root, joints, boneData); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | } else { |
| | | |
| | | console.error('THREE.ColladaLoader: Unable to find root bone of skeleton with ID:', skeleton); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | // sort bone data (the order is defined in the corresponding controller) |
| | | |
| | | for (i = 0; i < joints.length; i++) { |
| | | |
| | | for (j = 0; j < boneData.length; j++) { |
| | | |
| | | data = boneData[j]; |
| | | |
| | | if (data.bone.name === joints[i].name) { |
| | | |
| | | sortedBoneData[i] = data; |
| | | data.processed = true; |
| | | break; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | // add unprocessed bone data at the end of the list |
| | | |
| | | for (i = 0; i < boneData.length; i++) { |
| | | |
| | | data = boneData[i]; |
| | | |
| | | if (data.processed === false) { |
| | | |
| | | sortedBoneData.push(data); |
| | | data.processed = true; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | // setup arrays for skeleton creation |
| | | |
| | | var bones = []; |
| | | var boneInverses = []; |
| | | |
| | | for (i = 0; i < sortedBoneData.length; i++) { |
| | | |
| | | data = sortedBoneData[i]; |
| | | |
| | | bones.push(data.bone); |
| | | boneInverses.push(data.boneInverse); |
| | | |
| | | } |
| | | |
| | | return new THREE.Skeleton(bones, boneInverses); |
| | | |
| | | } |
| | | |
| | | function buildBoneHierarchy(root, joints, boneData) { |
| | | |
| | | // setup bone data from visual scene |
| | | |
| | | root.traverse(function (object) { |
| | | |
| | | if (object.isBone === true) { |
| | | |
| | | var boneInverse; |
| | | |
| | | // retrieve the boneInverse from the controller data |
| | | |
| | | for (var i = 0; i < joints.length; i++) { |
| | | |
| | | var joint = joints[i]; |
| | | |
| | | if (joint.name === object.name) { |
| | | |
| | | boneInverse = joint.boneInverse; |
| | | break; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | if (boneInverse === undefined) { |
| | | |
| | | // Unfortunately, there can be joints in the visual scene that are not part of the |
| | | // corresponding controller. In this case, we have to create a dummy boneInverse matrix |
| | | // for the respective bone. This bone won't affect any vertices, because there are no skin indices |
| | | // and weights defined for it. But we still have to add the bone to the sorted bone list in order to |
| | | // ensure a correct animation of the model. |
| | | |
| | | boneInverse = new THREE.Matrix4(); |
| | | |
| | | } |
| | | |
| | | boneData.push({ bone: object, boneInverse: boneInverse, processed: false }); |
| | | |
| | | } |
| | | |
| | | }); |
| | | |
| | | } |
| | | |
| | | function buildNode(data) { |
| | | |
| | | var objects = []; |
| | | |
| | | var matrix = data.matrix; |
| | | var nodes = data.nodes; |
| | | var type = data.type; |
| | | var instanceCameras = data.instanceCameras; |
| | | var instanceControllers = data.instanceControllers; |
| | | var instanceLights = data.instanceLights; |
| | | var instanceGeometries = data.instanceGeometries; |
| | | var instanceNodes = data.instanceNodes; |
| | | |
| | | // nodes |
| | | |
| | | for (var i = 0, l = nodes.length; i < l; i++) { |
| | | |
| | | objects.push(getNode(nodes[i])); |
| | | |
| | | } |
| | | |
| | | // instance cameras |
| | | |
| | | for (var i = 0, l = instanceCameras.length; i < l; i++) { |
| | | |
| | | var instanceCamera = getCamera(instanceCameras[i]); |
| | | |
| | | if (instanceCamera !== null) { |
| | | |
| | | objects.push(instanceCamera.clone()); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | // instance controllers |
| | | |
| | | for (var i = 0, l = instanceControllers.length; i < l; i++) { |
| | | |
| | | var instance = instanceControllers[i]; |
| | | var controller = getController(instance.id); |
| | | var geometries = getGeometry(controller.id); |
| | | var newObjects = buildObjects(geometries, instance.materials); |
| | | |
| | | var skeletons = instance.skeletons; |
| | | var joints = controller.skin.joints; |
| | | |
| | | var skeleton = buildSkeleton(skeletons, joints); |
| | | |
| | | for (var j = 0, jl = newObjects.length; j < jl; j++) { |
| | | |
| | | var object = newObjects[j]; |
| | | |
| | | if (object.isSkinnedMesh) { |
| | | |
| | | object.bind(skeleton, controller.skin.bindMatrix); |
| | | object.normalizeSkinWeights(); |
| | | |
| | | } |
| | | |
| | | objects.push(object); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | // instance lights |
| | | |
| | | for (var i = 0, l = instanceLights.length; i < l; i++) { |
| | | |
| | | var instanceLight = getLight(instanceLights[i]); |
| | | |
| | | if (instanceLight !== null) { |
| | | |
| | | objects.push(instanceLight.clone()); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | // instance geometries |
| | | |
| | | for (var i = 0, l = instanceGeometries.length; i < l; i++) { |
| | | |
| | | var instance = instanceGeometries[i]; |
| | | |
| | | // a single geometry instance in collada can lead to multiple object3Ds. |
| | | // this is the case when primitives are combined like triangles and lines |
| | | |
| | | var geometries = getGeometry(instance.id); |
| | | var newObjects = buildObjects(geometries, instance.materials); |
| | | |
| | | for (var j = 0, jl = newObjects.length; j < jl; j++) { |
| | | |
| | | objects.push(newObjects[j]); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | // instance nodes |
| | | |
| | | for (var i = 0, l = instanceNodes.length; i < l; i++) { |
| | | |
| | | objects.push(getNode(instanceNodes[i]).clone()); |
| | | |
| | | } |
| | | |
| | | var object; |
| | | |
| | | if (nodes.length === 0 && objects.length === 1) { |
| | | |
| | | object = objects[0]; |
| | | |
| | | } else { |
| | | |
| | | object = (type === 'JOINT') ? new THREE.Bone() : new THREE.Group(); |
| | | |
| | | for (var i = 0; i < objects.length; i++) { |
| | | |
| | | object.add(objects[i]); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | if (object.name === '') { |
| | | |
| | | object.name = (type === 'JOINT') ? data.sid : data.name; |
| | | |
| | | } |
| | | |
| | | object.matrix.copy(matrix); |
| | | object.matrix.decompose(object.position, object.quaternion, object.scale); |
| | | |
| | | return object; |
| | | |
| | | } |
| | | |
| | | var fallbackMaterial = new THREE.MeshBasicMaterial({ color: 0xff00ff }); |
| | | |
| | | function resolveMaterialBinding(keys, instanceMaterials) { |
| | | |
| | | var materials = []; |
| | | |
| | | for (var i = 0, l = keys.length; i < l; i++) { |
| | | |
| | | var id = instanceMaterials[keys[i]]; |
| | | |
| | | if (id === undefined) { |
| | | |
| | | console.warn('THREE.ColladaLoader: Material with key %s not found. Apply fallback material.', keys[i]); |
| | | materials.push(fallbackMaterial); |
| | | |
| | | } else { |
| | | |
| | | materials.push(getMaterial(id)); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | return materials; |
| | | |
| | | } |
| | | |
| | | function buildObjects(geometries, instanceMaterials) { |
| | | |
| | | var objects = []; |
| | | |
| | | for (var type in geometries) { |
| | | |
| | | var geometry = geometries[type]; |
| | | |
| | | var materials = resolveMaterialBinding(geometry.materialKeys, instanceMaterials); |
| | | |
| | | // handle case if no materials are defined |
| | | |
| | | if (materials.length === 0) { |
| | | |
| | | if (type === 'lines' || type === 'linestrips') { |
| | | |
| | | materials.push(new THREE.LineBasicMaterial()); |
| | | |
| | | } else { |
| | | |
| | | materials.push(new THREE.MeshPhongMaterial()); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | // regard skinning |
| | | |
| | | var skinning = (geometry.data.attributes.skinIndex !== undefined); |
| | | |
| | | if (skinning) { |
| | | |
| | | for (var i = 0, l = materials.length; i < l; i++) { |
| | | |
| | | materials[i].skinning = true; |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | // choose between a single or multi materials (material array) |
| | | |
| | | var material = (materials.length === 1) ? materials[0] : materials; |
| | | |
| | | // now create a specific 3D object |
| | | |
| | | var object; |
| | | |
| | | switch (type) { |
| | | |
| | | case 'lines': |
| | | object = new THREE.LineSegments(geometry.data, material); |
| | | break; |
| | | |
| | | case 'linestrips': |
| | | object = new THREE.Line(geometry.data, material); |
| | | break; |
| | | |
| | | case 'triangles': |
| | | case 'polylist': |
| | | if (skinning) { |
| | | |
| | | object = new THREE.SkinnedMesh(geometry.data, material); |
| | | |
| | | } else { |
| | | |
| | | object = new THREE.Mesh(geometry.data, material); |
| | | |
| | | } |
| | | break; |
| | | |
| | | } |
| | | |
| | | objects.push(object); |
| | | |
| | | } |
| | | |
| | | return objects; |
| | | |
| | | } |
| | | |
| | | function hasNode(id) { |
| | | |
| | | return library.nodes[id] !== undefined; |
| | | |
| | | } |
| | | |
| | | function getNode(id) { |
| | | |
| | | return getBuild(library.nodes[id], buildNode); |
| | | |
| | | } |
| | | |
| | | // visual scenes |
| | | |
| | | function parseVisualScene(xml) { |
| | | |
| | | var data = { |
| | | name: xml.getAttribute('name'), |
| | | children: [] |
| | | }; |
| | | |
| | | prepareNodes(xml); |
| | | |
| | | var elements = getElementsByTagName(xml, 'node'); |
| | | |
| | | for (var i = 0; i < elements.length; i++) { |
| | | |
| | | data.children.push(parseNode(elements[i])); |
| | | |
| | | } |
| | | |
| | | library.visualScenes[xml.getAttribute('id')] = data; |
| | | |
| | | } |
| | | |
| | | function buildVisualScene(data) { |
| | | |
| | | var group = new THREE.Group(); |
| | | group.name = data.name; |
| | | |
| | | var children = data.children; |
| | | |
| | | for (var i = 0; i < children.length; i++) { |
| | | |
| | | var child = children[i]; |
| | | |
| | | group.add(getNode(child.id)); |
| | | |
| | | } |
| | | |
| | | return group; |
| | | |
| | | } |
| | | |
| | | function hasVisualScene(id) { |
| | | |
| | | return library.visualScenes[id] !== undefined; |
| | | |
| | | } |
| | | |
| | | function getVisualScene(id) { |
| | | |
| | | return getBuild(library.visualScenes[id], buildVisualScene); |
| | | |
| | | } |
| | | |
| | | // scenes |
| | | |
| | | function parseScene(xml) { |
| | | |
| | | var instance = getElementsByTagName(xml, 'instance_visual_scene')[0]; |
| | | return getVisualScene(parseId(instance.getAttribute('url'))); |
| | | |
| | | } |
| | | |
| | | function setupAnimations() { |
| | | |
| | | var clips = library.clips; |
| | | |
| | | if (isEmpty(clips) === true) { |
| | | |
| | | if (isEmpty(library.animations) === false) { |
| | | |
| | | // if there are animations but no clips, we create a default clip for playback |
| | | |
| | | var tracks = []; |
| | | |
| | | for (var id in library.animations) { |
| | | |
| | | var animationTracks = getAnimation(id); |
| | | |
| | | for (var i = 0, l = animationTracks.length; i < l; i++) { |
| | | |
| | | tracks.push(animationTracks[i]); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | animations.push(new THREE.AnimationClip('default', -1, tracks)); |
| | | |
| | | } |
| | | |
| | | } else { |
| | | |
| | | for (var id in clips) { |
| | | |
| | | animations.push(getAnimationClip(id)); |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | } |
| | | |
| | | if (text.length === 0) { |
| | | |
| | | return { scene: new THREE.Scene() }; |
| | | |
| | | } |
| | | |
| | | var xml = new DOMParser().parseFromString(text, 'application/xml'); |
| | | |
| | | var collada = getElementsByTagName(xml, 'COLLADA')[0]; |
| | | |
| | | // metadata |
| | | |
| | | var version = collada.getAttribute('version'); |
| | | console.log('THREE.ColladaLoader: File version', version); |
| | | |
| | | var asset = parseAsset(getElementsByTagName(collada, 'asset')[0]); |
| | | var textureLoader = new THREE.TextureLoader(this.manager); |
| | | textureLoader.setPath(path).setCrossOrigin(this.crossOrigin); |
| | | |
| | | var tgaLoader; |
| | | |
| | | if (THREE.TGALoader) { |
| | | |
| | | tgaLoader = new THREE.TGALoader(this.manager); |
| | | tgaLoader.setPath(path); |
| | | |
| | | } |
| | | |
| | | // |
| | | |
| | | var animations = []; |
| | | var kinematics = {}; |
| | | var count = 0; |
| | | |
| | | // |
| | | |
| | | var library = { |
| | | animations: {}, |
| | | clips: {}, |
| | | controllers: {}, |
| | | images: {}, |
| | | effects: {}, |
| | | materials: {}, |
| | | cameras: {}, |
| | | lights: {}, |
| | | geometries: {}, |
| | | nodes: {}, |
| | | visualScenes: {}, |
| | | kinematicsModels: {}, |
| | | physicsModels: {}, |
| | | kinematicsScenes: {} |
| | | }; |
| | | |
| | | parseLibrary(collada, 'library_animations', 'animation', parseAnimation); |
| | | parseLibrary(collada, 'library_animation_clips', 'animation_clip', parseAnimationClip); |
| | | parseLibrary(collada, 'library_controllers', 'controller', parseController); |
| | | parseLibrary(collada, 'library_images', 'image', parseImage); |
| | | parseLibrary(collada, 'library_effects', 'effect', parseEffect); |
| | | parseLibrary(collada, 'library_materials', 'material', parseMaterial); |
| | | parseLibrary(collada, 'library_cameras', 'camera', parseCamera); |
| | | parseLibrary(collada, 'library_lights', 'light', parseLight); |
| | | parseLibrary(collada, 'library_geometries', 'geometry', parseGeometry); |
| | | parseLibrary(collada, 'library_nodes', 'node', parseNode); |
| | | parseLibrary(collada, 'library_visual_scenes', 'visual_scene', parseVisualScene); |
| | | parseLibrary(collada, 'library_kinematics_models', 'kinematics_model', parseKinematicsModel); |
| | | parseLibrary(collada, 'library_physics_models', 'physics_model', parsePhysicsModel); |
| | | parseLibrary(collada, 'scene', 'instance_kinematics_scene', parseKinematicsScene); |
| | | |
| | | buildLibrary(library.animations, buildAnimation); |
| | | buildLibrary(library.clips, buildAnimationClip); |
| | | buildLibrary(library.controllers, buildController); |
| | | buildLibrary(library.images, buildImage); |
| | | buildLibrary(library.effects, buildEffect); |
| | | buildLibrary(library.materials, buildMaterial); |
| | | buildLibrary(library.cameras, buildCamera); |
| | | buildLibrary(library.lights, buildLight); |
| | | buildLibrary(library.geometries, buildGeometry); |
| | | buildLibrary(library.visualScenes, buildVisualScene); |
| | | |
| | | setupAnimations(); |
| | | setupKinematics(); |
| | | |
| | | var scene = parseScene(getElementsByTagName(collada, 'scene')[0]); |
| | | |
| | | if (asset.upAxis === 'Z_UP') { |
| | | |
| | | scene.quaternion.setFromEuler(new THREE.Euler(-Math.PI / 2, 0, 0)); |
| | | |
| | | } |
| | | |
| | | scene.scale.multiplyScalar(asset.unit); |
| | | |
| | | return { |
| | | animations: animations, |
| | | kinematics: kinematics, |
| | | library: library, |
| | | scene: scene |
| | | }; |
| | | |
| | | } |
| | | |
| | | }; |
public/static/modelView/js/loaders/DDSLoader.js
public/static/modelView/js/loaders/FBXLoader.js
public/static/modelView/js/loaders/GLTFLoader.js
public/static/modelView/js/loaders/MTLLoader.js
public/static/modelView/js/loaders/OBJLoader.js
public/static/modelView/js/loaders/STLLoader.js
public/static/modelView/js/loaders/inflate.min.js
public/static/modelView/js/main.js
public/static/modelView/js/menu.js
public/static/modelView/js/screenfull.min.js
public/static/modelView/js/spectrum.js
public/static/modelView/js/three.js
public/static/modelView/js/three.min.js
public/static/modelView/js/userModel.js
public/static/modelView/js/userModelTextures.js
public/static/modelView/js/utils.js
src/App.vue
src/books/artAndDrama/assets/main.less
src/books/artAndDrama/view/components/chapter001.vue
src/books/artAndDrama/view/components/chapter002.vue
src/books/artAndDrama/view/components/chapter003.vue
src/books/artAndDrama/view/components/chapter004.vue
src/books/civilAviation/assets/images/0071-01.jpg
src/books/civilAviation/assets/images/0071-02.jpg
src/books/civilAviation/assets/images/0071-03.jpg
src/books/civilAviation/assets/images/0071-04.jpg
src/books/civilAviation/assets/images/0071-05.jpg
src/books/civilAviation/assets/images/0075-01.jpg
src/books/civilAviation/assets/images/0075-02.jpg
src/books/civilAviation/assets/images/0078-01.jpg
src/books/civilAviation/assets/images/0078-02.jpg
src/books/civilAviation/assets/images/0078-03.jpg
src/books/civilAviation/assets/images/0080-01.jpg
src/books/civilAviation/assets/images/0080-02.jpg
src/books/civilAviation/assets/images/0092-01.jpg
src/books/civilAviation/assets/images/0092-02.jpg
src/books/civilAviation/assets/images/0092-03.jpg
src/books/civilAviation/assets/images/0099-01.jpg
src/books/civilAviation/assets/images/0099-02.jpg
src/books/civilAviation/assets/images/0111-01.jpg
src/books/civilAviation/assets/images/0111-02.jpg
src/books/civilAviation/assets/images/0118-01.jpg
src/books/civilAviation/assets/images/0118-02.jpg
src/books/civilAviation/assets/images/0120-01.jpg
src/books/civilAviation/assets/images/0120-02.jpg
src/books/civilAviation/assets/images/0123-01.jpg
src/books/civilAviation/assets/images/0123-02.jpg
src/books/civilAviation/assets/images/0194-01.jpg
src/books/civilAviation/assets/images/0194-02.jpg
src/books/civilAviation/assets/images/0194-03.jpg
src/books/civilAviation/assets/images/0194-04.jpg
src/books/civilAviation/assets/images/fengdi.png
src/books/civilAviation/assets/main.less
src/books/civilAviation/view/components/chapter001.vue
src/books/civilAviation/view/components/chapter002.vue
src/books/civilAviation/view/components/chapter003.vue
src/books/civilAviation/view/components/chapter004.vue
src/books/civilAviation/view/components/chapter005.vue
src/books/civilAviation/view/components/index.vue
src/components/choice/choice.vue
src/components/pdfview/index.vue |