/*! jQuery UI - v1.12.1 - 2016-09-14
|
* http://jqueryui.com
|
* Includes: widget.js, position.js, data.js, disable-selection.js, effect.js, effects/effect-blind.js, effects/effect-bounce.js, effects/effect-clip.js, effects/effect-drop.js, effects/effect-explode.js, effects/effect-fade.js, effects/effect-fold.js, effects/effect-highlight.js, effects/effect-puff.js, effects/effect-pulsate.js, effects/effect-scale.js, effects/effect-shake.js, effects/effect-size.js, effects/effect-slide.js, effects/effect-transfer.js, focusable.js, form-reset-mixin.js, jquery-1-7.js, keycode.js, labels.js, scroll-parent.js, tabbable.js, unique-id.js, widgets/accordion.js, widgets/autocomplete.js, widgets/button.js, widgets/checkboxradio.js, widgets/controlgroup.js, widgets/datepicker.js, widgets/dialog.js, widgets/draggable.js, widgets/droppable.js, widgets/menu.js, widgets/mouse.js, widgets/progressbar.js, widgets/resizable.js, widgets/selectable.js, widgets/selectmenu.js, widgets/slider.js, widgets/sortable.js, widgets/spinner.js, widgets/tabs.js, widgets/tooltip.js
|
* Copyright jQuery Foundation and other contributors; Licensed MIT */
|
|
;(function (factory) {
|
if (typeof define === 'function' && define.amd) {
|
// AMD. Register as an anonymous module.
|
define(['jquery'], factory)
|
} else {
|
// Browser globals
|
factory(jQuery)
|
}
|
})(function ($) {
|
$.ui = $.ui || {}
|
|
var version = ($.ui.version = '1.12.1')
|
|
/*!
|
* jQuery UI Widget 1.12.1
|
* http://jqueryui.com
|
*
|
* Copyright jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*/
|
|
//>>label: Widget
|
//>>group: Core
|
//>>description: Provides a factory for creating stateful widgets with a common API.
|
//>>docs: http://api.jqueryui.com/jQuery.widget/
|
//>>demos: http://jqueryui.com/widget/
|
|
var widgetUuid = 0
|
var widgetSlice = Array.prototype.slice
|
|
$.cleanData = (function (orig) {
|
return function (elems) {
|
var events, elem, i
|
for (i = 0; (elem = elems[i]) != null; i++) {
|
try {
|
// Only trigger remove when necessary to save time
|
events = $._data(elem, 'events')
|
if (events && events.remove) {
|
$(elem).triggerHandler('remove')
|
}
|
|
// Http://bugs.jquery.com/ticket/8235
|
} catch (e) {}
|
}
|
orig(elems)
|
}
|
})($.cleanData)
|
|
$.widget = function (name, base, prototype) {
|
var existingConstructor, constructor, basePrototype
|
|
// ProxiedPrototype allows the provided prototype to remain unmodified
|
// so that it can be used as a mixin for multiple widgets (#8876)
|
var proxiedPrototype = {}
|
|
var namespace = name.split('.')[0]
|
name = name.split('.')[1]
|
var fullName = namespace + '-' + name
|
|
if (!prototype) {
|
prototype = base
|
base = $.Widget
|
}
|
|
if ($.isArray(prototype)) {
|
prototype = $.extend.apply(null, [{}].concat(prototype))
|
}
|
|
// Create selector for plugin
|
$.expr[':'][fullName.toLowerCase()] = function (elem) {
|
return !!$.data(elem, fullName)
|
}
|
|
$[namespace] = $[namespace] || {}
|
existingConstructor = $[namespace][name]
|
constructor = $[namespace][name] = function (options, element) {
|
// Allow instantiation without "new" keyword
|
if (!this._createWidget) {
|
return new constructor(options, element)
|
}
|
|
// Allow instantiation without initializing for simple inheritance
|
// must use "new" keyword (the code above always passes args)
|
if (arguments.length) {
|
this._createWidget(options, element)
|
}
|
}
|
|
// Extend with the existing constructor to carry over any static properties
|
$.extend(constructor, existingConstructor, {
|
version: prototype.version,
|
|
// Copy the object used to create the prototype in case we need to
|
// redefine the widget later
|
_proto: $.extend({}, prototype),
|
|
// Track widgets that inherit from this widget in case this widget is
|
// redefined after a widget inherits from it
|
_childConstructors: []
|
})
|
|
basePrototype = new base()
|
|
// We need to make the options hash a property directly on the new instance
|
// otherwise we'll modify the options hash on the prototype that we're
|
// inheriting from
|
basePrototype.options = $.widget.extend({}, basePrototype.options)
|
$.each(prototype, function (prop, value) {
|
if (!$.isFunction(value)) {
|
proxiedPrototype[prop] = value
|
return
|
}
|
proxiedPrototype[prop] = (function () {
|
function _super() {
|
return base.prototype[prop].apply(this, arguments)
|
}
|
|
function _superApply(args) {
|
return base.prototype[prop].apply(this, args)
|
}
|
|
return function () {
|
var __super = this._super
|
var __superApply = this._superApply
|
var returnValue
|
|
this._super = _super
|
this._superApply = _superApply
|
|
returnValue = value.apply(this, arguments)
|
|
this._super = __super
|
this._superApply = __superApply
|
|
return returnValue
|
}
|
})()
|
})
|
constructor.prototype = $.widget.extend(
|
basePrototype,
|
{
|
// TODO: remove support for widgetEventPrefix
|
// always use the name + a colon as the prefix, e.g., draggable:start
|
// don't prefix for widgets that aren't DOM-based
|
widgetEventPrefix: existingConstructor ? basePrototype.widgetEventPrefix || name : name
|
},
|
proxiedPrototype,
|
{
|
constructor: constructor,
|
namespace: namespace,
|
widgetName: name,
|
widgetFullName: fullName
|
}
|
)
|
|
// If this widget is being redefined then we need to find all widgets that
|
// are inheriting from it and redefine all of them so that they inherit from
|
// the new version of this widget. We're essentially trying to replace one
|
// level in the prototype chain.
|
if (existingConstructor) {
|
$.each(existingConstructor._childConstructors, function (i, child) {
|
var childPrototype = child.prototype
|
|
// Redefine the child widget using the same prototype that was
|
// originally used, but inherit from the new version of the base
|
$.widget(
|
childPrototype.namespace + '.' + childPrototype.widgetName,
|
constructor,
|
child._proto
|
)
|
})
|
|
// Remove the list of existing child constructors from the old constructor
|
// so the old child constructors can be garbage collected
|
delete existingConstructor._childConstructors
|
} else {
|
base._childConstructors.push(constructor)
|
}
|
|
$.widget.bridge(name, constructor)
|
|
return constructor
|
}
|
|
$.widget.extend = function (target) {
|
var input = widgetSlice.call(arguments, 1)
|
var inputIndex = 0
|
var inputLength = input.length
|
var key
|
var value
|
|
for (; inputIndex < inputLength; inputIndex++) {
|
for (key in input[inputIndex]) {
|
value = input[inputIndex][key]
|
if (input[inputIndex].hasOwnProperty(key) && value !== undefined) {
|
// Clone objects
|
if ($.isPlainObject(value)) {
|
target[key] = $.isPlainObject(target[key])
|
? $.widget.extend({}, target[key], value)
|
: // Don't extend strings, arrays, etc. with objects
|
$.widget.extend({}, value)
|
|
// Copy everything else by reference
|
} else {
|
target[key] = value
|
}
|
}
|
}
|
}
|
return target
|
}
|
|
$.widget.bridge = function (name, object) {
|
var fullName = object.prototype.widgetFullName || name
|
$.fn[name] = function (options) {
|
var isMethodCall = typeof options === 'string'
|
var args = widgetSlice.call(arguments, 1)
|
var returnValue = this
|
|
if (isMethodCall) {
|
// If this is an empty collection, we need to have the instance method
|
// return undefined instead of the jQuery instance
|
if (!this.length && options === 'instance') {
|
returnValue = undefined
|
} else {
|
this.each(function () {
|
var methodValue
|
var instance = $.data(this, fullName)
|
|
if (options === 'instance') {
|
returnValue = instance
|
return false
|
}
|
|
if (!instance) {
|
return $.error(
|
'cannot call methods on ' +
|
name +
|
' prior to initialization; ' +
|
"attempted to call method '" +
|
options +
|
"'"
|
)
|
}
|
|
if (!$.isFunction(instance[options]) || options.charAt(0) === '_') {
|
return $.error("no such method '" + options + "' for " + name + ' widget instance')
|
}
|
|
methodValue = instance[options].apply(instance, args)
|
|
if (methodValue !== instance && methodValue !== undefined) {
|
returnValue =
|
methodValue && methodValue.jquery
|
? returnValue.pushStack(methodValue.get())
|
: methodValue
|
return false
|
}
|
})
|
}
|
} else {
|
// Allow multiple hashes to be passed on init
|
if (args.length) {
|
options = $.widget.extend.apply(null, [options].concat(args))
|
}
|
|
this.each(function () {
|
var instance = $.data(this, fullName)
|
if (instance) {
|
instance.option(options || {})
|
if (instance._init) {
|
instance._init()
|
}
|
} else {
|
$.data(this, fullName, new object(options, this))
|
}
|
})
|
}
|
|
return returnValue
|
}
|
}
|
|
$.Widget = function (/* options, element */) {}
|
$.Widget._childConstructors = []
|
|
$.Widget.prototype = {
|
widgetName: 'widget',
|
widgetEventPrefix: '',
|
defaultElement: '<div>',
|
|
options: {
|
classes: {},
|
disabled: false,
|
|
// Callbacks
|
create: null
|
},
|
|
_createWidget: function (options, element) {
|
element = $(element || this.defaultElement || this)[0]
|
this.element = $(element)
|
this.uuid = widgetUuid++
|
this.eventNamespace = '.' + this.widgetName + this.uuid
|
|
this.bindings = $()
|
this.hoverable = $()
|
this.focusable = $()
|
this.classesElementLookup = {}
|
|
if (element !== this) {
|
$.data(element, this.widgetFullName, this)
|
this._on(true, this.element, {
|
remove: function (event) {
|
if (event.target === element) {
|
this.destroy()
|
}
|
}
|
})
|
this.document = $(
|
element.style
|
? // Element within the document
|
element.ownerDocument
|
: // Element is window or document
|
element.document || element
|
)
|
this.window = $(this.document[0].defaultView || this.document[0].parentWindow)
|
}
|
|
this.options = $.widget.extend({}, this.options, this._getCreateOptions(), options)
|
|
this._create()
|
|
if (this.options.disabled) {
|
this._setOptionDisabled(this.options.disabled)
|
}
|
|
this._trigger('create', null, this._getCreateEventData())
|
this._init()
|
},
|
|
_getCreateOptions: function () {
|
return {}
|
},
|
|
_getCreateEventData: $.noop,
|
|
_create: $.noop,
|
|
_init: $.noop,
|
|
destroy: function () {
|
var that = this
|
|
this._destroy()
|
$.each(this.classesElementLookup, function (key, value) {
|
that._removeClass(value, key)
|
})
|
|
// We can probably remove the unbind calls in 2.0
|
// all event bindings should go through this._on()
|
this.element.off(this.eventNamespace).removeData(this.widgetFullName)
|
this.widget().off(this.eventNamespace).removeAttr('aria-disabled')
|
|
// Clean up events and states
|
this.bindings.off(this.eventNamespace)
|
},
|
|
_destroy: $.noop,
|
|
widget: function () {
|
return this.element
|
},
|
|
option: function (key, value) {
|
var options = key
|
var parts
|
var curOption
|
var i
|
|
if (arguments.length === 0) {
|
// Don't return a reference to the internal hash
|
return $.widget.extend({}, this.options)
|
}
|
|
if (typeof key === 'string') {
|
// Handle nested keys, e.g., "foo.bar" => { foo: { bar: ___ } }
|
options = {}
|
parts = key.split('.')
|
key = parts.shift()
|
if (parts.length) {
|
curOption = options[key] = $.widget.extend({}, this.options[key])
|
for (i = 0; i < parts.length - 1; i++) {
|
curOption[parts[i]] = curOption[parts[i]] || {}
|
curOption = curOption[parts[i]]
|
}
|
key = parts.pop()
|
if (arguments.length === 1) {
|
return curOption[key] === undefined ? null : curOption[key]
|
}
|
curOption[key] = value
|
} else {
|
if (arguments.length === 1) {
|
return this.options[key] === undefined ? null : this.options[key]
|
}
|
options[key] = value
|
}
|
}
|
|
this._setOptions(options)
|
|
return this
|
},
|
|
_setOptions: function (options) {
|
var key
|
|
for (key in options) {
|
this._setOption(key, options[key])
|
}
|
|
return this
|
},
|
|
_setOption: function (key, value) {
|
if (key === 'classes') {
|
this._setOptionClasses(value)
|
}
|
|
this.options[key] = value
|
|
if (key === 'disabled') {
|
this._setOptionDisabled(value)
|
}
|
|
return this
|
},
|
|
_setOptionClasses: function (value) {
|
var classKey, elements, currentElements
|
|
for (classKey in value) {
|
currentElements = this.classesElementLookup[classKey]
|
if (
|
value[classKey] === this.options.classes[classKey] ||
|
!currentElements ||
|
!currentElements.length
|
) {
|
continue
|
}
|
|
// We are doing this to create a new jQuery object because the _removeClass() call
|
// on the next line is going to destroy the reference to the current elements being
|
// tracked. We need to save a copy of this collection so that we can add the new classes
|
// below.
|
elements = $(currentElements.get())
|
this._removeClass(currentElements, classKey)
|
|
// We don't use _addClass() here, because that uses this.options.classes
|
// for generating the string of classes. We want to use the value passed in from
|
// _setOption(), this is the new value of the classes option which was passed to
|
// _setOption(). We pass this value directly to _classes().
|
elements.addClass(
|
this._classes({
|
element: elements,
|
keys: classKey,
|
classes: value,
|
add: true
|
})
|
)
|
}
|
},
|
|
_setOptionDisabled: function (value) {
|
this._toggleClass(this.widget(), this.widgetFullName + '-disabled', null, !!value)
|
|
// If the widget is becoming disabled, then nothing is interactive
|
if (value) {
|
this._removeClass(this.hoverable, null, 'ui-state-hover')
|
this._removeClass(this.focusable, null, 'ui-state-focus')
|
}
|
},
|
|
enable: function () {
|
return this._setOptions({ disabled: false })
|
},
|
|
disable: function () {
|
return this._setOptions({ disabled: true })
|
},
|
|
_classes: function (options) {
|
var full = []
|
var that = this
|
|
options = $.extend(
|
{
|
element: this.element,
|
classes: this.options.classes || {}
|
},
|
options
|
)
|
|
function processClassString(classes, checkOption) {
|
var current, i
|
for (i = 0; i < classes.length; i++) {
|
current = that.classesElementLookup[classes[i]] || $()
|
if (options.add) {
|
current = $($.unique(current.get().concat(options.element.get())))
|
} else {
|
current = $(current.not(options.element).get())
|
}
|
that.classesElementLookup[classes[i]] = current
|
full.push(classes[i])
|
if (checkOption && options.classes[classes[i]]) {
|
full.push(options.classes[classes[i]])
|
}
|
}
|
}
|
|
this._on(options.element, {
|
remove: '_untrackClassesElement'
|
})
|
|
if (options.keys) {
|
processClassString(options.keys.match(/\S+/g) || [], true)
|
}
|
if (options.extra) {
|
processClassString(options.extra.match(/\S+/g) || [])
|
}
|
|
return full.join(' ')
|
},
|
|
_untrackClassesElement: function (event) {
|
var that = this
|
$.each(that.classesElementLookup, function (key, value) {
|
if ($.inArray(event.target, value) !== -1) {
|
that.classesElementLookup[key] = $(value.not(event.target).get())
|
}
|
})
|
},
|
|
_removeClass: function (element, keys, extra) {
|
return this._toggleClass(element, keys, extra, false)
|
},
|
|
_addClass: function (element, keys, extra) {
|
return this._toggleClass(element, keys, extra, true)
|
},
|
|
_toggleClass: function (element, keys, extra, add) {
|
add = typeof add === 'boolean' ? add : extra
|
var shift = typeof element === 'string' || element === null,
|
options = {
|
extra: shift ? keys : extra,
|
keys: shift ? element : keys,
|
element: shift ? this.element : element,
|
add: add
|
}
|
options.element.toggleClass(this._classes(options), add)
|
return this
|
},
|
|
_on: function (suppressDisabledCheck, element, handlers) {
|
var delegateElement
|
var instance = this
|
|
// No suppressDisabledCheck flag, shuffle arguments
|
if (typeof suppressDisabledCheck !== 'boolean') {
|
handlers = element
|
element = suppressDisabledCheck
|
suppressDisabledCheck = false
|
}
|
|
// No element argument, shuffle and use this.element
|
if (!handlers) {
|
handlers = element
|
element = this.element
|
delegateElement = this.widget()
|
} else {
|
element = delegateElement = $(element)
|
this.bindings = this.bindings.add(element)
|
}
|
|
$.each(handlers, function (event, handler) {
|
function handlerProxy() {
|
// Allow widgets to customize the disabled handling
|
// - disabled as an array instead of boolean
|
// - disabled class as method for disabling individual parts
|
if (
|
!suppressDisabledCheck &&
|
(instance.options.disabled === true || $(this).hasClass('ui-state-disabled'))
|
) {
|
return
|
}
|
return (typeof handler === 'string' ? instance[handler] : handler).apply(
|
instance,
|
arguments
|
)
|
}
|
|
// Copy the guid so direct unbinding works
|
if (typeof handler !== 'string') {
|
handlerProxy.guid = handler.guid = handler.guid || handlerProxy.guid || $.guid++
|
}
|
|
var match = event.match(/^([\w:-]*)\s*(.*)$/)
|
var eventName = match[1] + instance.eventNamespace
|
var selector = match[2]
|
|
if (selector) {
|
delegateElement.on(eventName, selector, handlerProxy)
|
} else {
|
element.on(eventName, handlerProxy)
|
}
|
})
|
},
|
|
_off: function (element, eventName) {
|
eventName = (eventName || '').split(' ').join(this.eventNamespace + ' ') + this.eventNamespace
|
element.off(eventName).off(eventName)
|
|
// Clear the stack to avoid memory leaks (#10056)
|
this.bindings = $(this.bindings.not(element).get())
|
this.focusable = $(this.focusable.not(element).get())
|
this.hoverable = $(this.hoverable.not(element).get())
|
},
|
|
_delay: function (handler, delay) {
|
function handlerProxy() {
|
return (typeof handler === 'string' ? instance[handler] : handler).apply(
|
instance,
|
arguments
|
)
|
}
|
var instance = this
|
return setTimeout(handlerProxy, delay || 0)
|
},
|
|
_hoverable: function (element) {
|
this.hoverable = this.hoverable.add(element)
|
this._on(element, {
|
mouseenter: function (event) {
|
this._addClass($(event.currentTarget), null, 'ui-state-hover')
|
},
|
mouseleave: function (event) {
|
this._removeClass($(event.currentTarget), null, 'ui-state-hover')
|
}
|
})
|
},
|
|
_focusable: function (element) {
|
this.focusable = this.focusable.add(element)
|
this._on(element, {
|
focusin: function (event) {
|
this._addClass($(event.currentTarget), null, 'ui-state-focus')
|
},
|
focusout: function (event) {
|
this._removeClass($(event.currentTarget), null, 'ui-state-focus')
|
}
|
})
|
},
|
|
_trigger: function (type, event, data) {
|
var prop, orig
|
var callback = this.options[type]
|
|
data = data || {}
|
event = $.Event(event)
|
event.type = (
|
type === this.widgetEventPrefix ? type : this.widgetEventPrefix + type
|
).toLowerCase()
|
|
// The original event may come from any element
|
// so we need to reset the target on the new event
|
event.target = this.element[0]
|
|
// Copy original event properties over to the new event
|
orig = event.originalEvent
|
if (orig) {
|
for (prop in orig) {
|
if (!(prop in event)) {
|
event[prop] = orig[prop]
|
}
|
}
|
}
|
|
this.element.trigger(event, data)
|
return !(
|
($.isFunction(callback) &&
|
callback.apply(this.element[0], [event].concat(data)) === false) ||
|
event.isDefaultPrevented()
|
)
|
}
|
}
|
|
$.each({ show: 'fadeIn', hide: 'fadeOut' }, function (method, defaultEffect) {
|
$.Widget.prototype['_' + method] = function (element, options, callback) {
|
if (typeof options === 'string') {
|
options = { effect: options }
|
}
|
|
var hasOptions
|
var effectName = !options
|
? method
|
: options === true || typeof options === 'number'
|
? defaultEffect
|
: options.effect || defaultEffect
|
|
options = options || {}
|
if (typeof options === 'number') {
|
options = { duration: options }
|
}
|
|
hasOptions = !$.isEmptyObject(options)
|
options.complete = callback
|
|
if (options.delay) {
|
element.delay(options.delay)
|
}
|
|
if (hasOptions && $.effects && $.effects.effect[effectName]) {
|
element[method](options)
|
} else if (effectName !== method && element[effectName]) {
|
element[effectName](options.duration, options.easing, callback)
|
} else {
|
element.queue(function (next) {
|
$(this)[method]()
|
if (callback) {
|
callback.call(element[0])
|
}
|
next()
|
})
|
}
|
}
|
})
|
|
var widget = $.widget
|
|
/*!
|
* jQuery UI Position 1.12.1
|
* http://jqueryui.com
|
*
|
* Copyright jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*
|
* http://api.jqueryui.com/position/
|
*/
|
|
//>>label: Position
|
//>>group: Core
|
//>>description: Positions elements relative to other elements.
|
//>>docs: http://api.jqueryui.com/position/
|
//>>demos: http://jqueryui.com/position/
|
|
;(function () {
|
var cachedScrollbarWidth,
|
max = Math.max,
|
abs = Math.abs,
|
rhorizontal = /left|center|right/,
|
rvertical = /top|center|bottom/,
|
roffset = /[\+\-]\d+(\.[\d]+)?%?/,
|
rposition = /^\w+/,
|
rpercent = /%$/,
|
_position = $.fn.position
|
|
function getOffsets(offsets, width, height) {
|
return [
|
parseFloat(offsets[0]) * (rpercent.test(offsets[0]) ? width / 100 : 1),
|
parseFloat(offsets[1]) * (rpercent.test(offsets[1]) ? height / 100 : 1)
|
]
|
}
|
|
function parseCss(element, property) {
|
return parseInt($.css(element, property), 10) || 0
|
}
|
|
function getDimensions(elem) {
|
var raw = elem[0]
|
if (raw.nodeType === 9) {
|
return {
|
width: elem.width(),
|
height: elem.height(),
|
offset: { top: 0, left: 0 }
|
}
|
}
|
if ($.isWindow(raw)) {
|
return {
|
width: elem.width(),
|
height: elem.height(),
|
offset: { top: elem.scrollTop(), left: elem.scrollLeft() }
|
}
|
}
|
if (raw.preventDefault) {
|
return {
|
width: 0,
|
height: 0,
|
offset: { top: raw.pageY, left: raw.pageX }
|
}
|
}
|
return {
|
width: elem.outerWidth(),
|
height: elem.outerHeight(),
|
offset: elem.offset()
|
}
|
}
|
|
$.position = {
|
scrollbarWidth: function () {
|
if (cachedScrollbarWidth !== undefined) {
|
return cachedScrollbarWidth
|
}
|
var w1,
|
w2,
|
div = $(
|
'<div ' +
|
"style='display:block;position:absolute;width:50px;height:50px;overflow:hidden;'>" +
|
"<div style='height:100px;width:auto;'></div></div>"
|
),
|
innerDiv = div.children()[0]
|
|
$('body').append(div)
|
w1 = innerDiv.offsetWidth
|
div.css('overflow', 'scroll')
|
|
w2 = innerDiv.offsetWidth
|
|
if (w1 === w2) {
|
w2 = div[0].clientWidth
|
}
|
|
div.remove()
|
|
return (cachedScrollbarWidth = w1 - w2)
|
},
|
getScrollInfo: function (within) {
|
var overflowX =
|
within.isWindow || within.isDocument ? '' : within.element.css('overflow-x'),
|
overflowY = within.isWindow || within.isDocument ? '' : within.element.css('overflow-y'),
|
hasOverflowX =
|
overflowX === 'scroll' ||
|
(overflowX === 'auto' && within.width < within.element[0].scrollWidth),
|
hasOverflowY =
|
overflowY === 'scroll' ||
|
(overflowY === 'auto' && within.height < within.element[0].scrollHeight)
|
return {
|
width: hasOverflowY ? $.position.scrollbarWidth() : 0,
|
height: hasOverflowX ? $.position.scrollbarWidth() : 0
|
}
|
},
|
getWithinInfo: function (element) {
|
var withinElement = $(element || window),
|
isWindow = $.isWindow(withinElement[0]),
|
isDocument = !!withinElement[0] && withinElement[0].nodeType === 9,
|
hasOffset = !isWindow && !isDocument
|
return {
|
element: withinElement,
|
isWindow: isWindow,
|
isDocument: isDocument,
|
offset: hasOffset ? $(element).offset() : { left: 0, top: 0 },
|
scrollLeft: withinElement.scrollLeft(),
|
scrollTop: withinElement.scrollTop(),
|
width: withinElement.outerWidth(),
|
height: withinElement.outerHeight()
|
}
|
}
|
}
|
|
$.fn.position = function (options) {
|
if (!options || !options.of) {
|
return _position.apply(this, arguments)
|
}
|
|
// Make a copy, we don't want to modify arguments
|
options = $.extend({}, options)
|
|
var atOffset,
|
targetWidth,
|
targetHeight,
|
targetOffset,
|
basePosition,
|
dimensions,
|
target = $(options.of),
|
within = $.position.getWithinInfo(options.within),
|
scrollInfo = $.position.getScrollInfo(within),
|
collision = (options.collision || 'flip').split(' '),
|
offsets = {}
|
|
dimensions = getDimensions(target)
|
if (target[0].preventDefault) {
|
// Force left top to allow flipping
|
options.at = 'left top'
|
}
|
targetWidth = dimensions.width
|
targetHeight = dimensions.height
|
targetOffset = dimensions.offset
|
|
// Clone to reuse original targetOffset later
|
basePosition = $.extend({}, targetOffset)
|
|
// Force my and at to have valid horizontal and vertical positions
|
// if a value is missing or invalid, it will be converted to center
|
$.each(['my', 'at'], function () {
|
var pos = (options[this] || '').split(' '),
|
horizontalOffset,
|
verticalOffset
|
|
if (pos.length === 1) {
|
pos = rhorizontal.test(pos[0])
|
? pos.concat(['center'])
|
: rvertical.test(pos[0])
|
? ['center'].concat(pos)
|
: ['center', 'center']
|
}
|
pos[0] = rhorizontal.test(pos[0]) ? pos[0] : 'center'
|
pos[1] = rvertical.test(pos[1]) ? pos[1] : 'center'
|
|
// Calculate offsets
|
horizontalOffset = roffset.exec(pos[0])
|
verticalOffset = roffset.exec(pos[1])
|
offsets[this] = [
|
horizontalOffset ? horizontalOffset[0] : 0,
|
verticalOffset ? verticalOffset[0] : 0
|
]
|
|
// Reduce to just the positions without the offsets
|
options[this] = [rposition.exec(pos[0])[0], rposition.exec(pos[1])[0]]
|
})
|
|
// Normalize collision option
|
if (collision.length === 1) {
|
collision[1] = collision[0]
|
}
|
|
if (options.at[0] === 'right') {
|
basePosition.left += targetWidth
|
} else if (options.at[0] === 'center') {
|
basePosition.left += targetWidth / 2
|
}
|
|
if (options.at[1] === 'bottom') {
|
basePosition.top += targetHeight
|
} else if (options.at[1] === 'center') {
|
basePosition.top += targetHeight / 2
|
}
|
|
atOffset = getOffsets(offsets.at, targetWidth, targetHeight)
|
basePosition.left += atOffset[0]
|
basePosition.top += atOffset[1]
|
|
return this.each(function () {
|
var collisionPosition,
|
using,
|
elem = $(this),
|
elemWidth = elem.outerWidth(),
|
elemHeight = elem.outerHeight(),
|
marginLeft = parseCss(this, 'marginLeft'),
|
marginTop = parseCss(this, 'marginTop'),
|
collisionWidth =
|
elemWidth + marginLeft + parseCss(this, 'marginRight') + scrollInfo.width,
|
collisionHeight =
|
elemHeight + marginTop + parseCss(this, 'marginBottom') + scrollInfo.height,
|
position = $.extend({}, basePosition),
|
myOffset = getOffsets(offsets.my, elem.outerWidth(), elem.outerHeight())
|
|
if (options.my[0] === 'right') {
|
position.left -= elemWidth
|
} else if (options.my[0] === 'center') {
|
position.left -= elemWidth / 2
|
}
|
|
if (options.my[1] === 'bottom') {
|
position.top -= elemHeight
|
} else if (options.my[1] === 'center') {
|
position.top -= elemHeight / 2
|
}
|
|
position.left += myOffset[0]
|
position.top += myOffset[1]
|
|
collisionPosition = {
|
marginLeft: marginLeft,
|
marginTop: marginTop
|
}
|
|
$.each(['left', 'top'], function (i, dir) {
|
if ($.ui.position[collision[i]]) {
|
$.ui.position[collision[i]][dir](position, {
|
targetWidth: targetWidth,
|
targetHeight: targetHeight,
|
elemWidth: elemWidth,
|
elemHeight: elemHeight,
|
collisionPosition: collisionPosition,
|
collisionWidth: collisionWidth,
|
collisionHeight: collisionHeight,
|
offset: [atOffset[0] + myOffset[0], atOffset[1] + myOffset[1]],
|
my: options.my,
|
at: options.at,
|
within: within,
|
elem: elem
|
})
|
}
|
})
|
|
if (options.using) {
|
// Adds feedback as second argument to using callback, if present
|
using = function (props) {
|
var left = targetOffset.left - position.left,
|
right = left + targetWidth - elemWidth,
|
top = targetOffset.top - position.top,
|
bottom = top + targetHeight - elemHeight,
|
feedback = {
|
target: {
|
element: target,
|
left: targetOffset.left,
|
top: targetOffset.top,
|
width: targetWidth,
|
height: targetHeight
|
},
|
element: {
|
element: elem,
|
left: position.left,
|
top: position.top,
|
width: elemWidth,
|
height: elemHeight
|
},
|
horizontal: right < 0 ? 'left' : left > 0 ? 'right' : 'center',
|
vertical: bottom < 0 ? 'top' : top > 0 ? 'bottom' : 'middle'
|
}
|
if (targetWidth < elemWidth && abs(left + right) < targetWidth) {
|
feedback.horizontal = 'center'
|
}
|
if (targetHeight < elemHeight && abs(top + bottom) < targetHeight) {
|
feedback.vertical = 'middle'
|
}
|
if (max(abs(left), abs(right)) > max(abs(top), abs(bottom))) {
|
feedback.important = 'horizontal'
|
} else {
|
feedback.important = 'vertical'
|
}
|
options.using.call(this, props, feedback)
|
}
|
}
|
|
elem.offset($.extend(position, { using: using }))
|
})
|
}
|
|
$.ui.position = {
|
fit: {
|
left: function (position, data) {
|
var within = data.within,
|
withinOffset = within.isWindow ? within.scrollLeft : within.offset.left,
|
outerWidth = within.width,
|
collisionPosLeft = position.left - data.collisionPosition.marginLeft,
|
overLeft = withinOffset - collisionPosLeft,
|
overRight = collisionPosLeft + data.collisionWidth - outerWidth - withinOffset,
|
newOverRight
|
|
// Element is wider than within
|
if (data.collisionWidth > outerWidth) {
|
// Element is initially over the left side of within
|
if (overLeft > 0 && overRight <= 0) {
|
newOverRight =
|
position.left + overLeft + data.collisionWidth - outerWidth - withinOffset
|
position.left += overLeft - newOverRight
|
|
// Element is initially over right side of within
|
} else if (overRight > 0 && overLeft <= 0) {
|
position.left = withinOffset
|
|
// Element is initially over both left and right sides of within
|
} else {
|
if (overLeft > overRight) {
|
position.left = withinOffset + outerWidth - data.collisionWidth
|
} else {
|
position.left = withinOffset
|
}
|
}
|
|
// Too far left -> align with left edge
|
} else if (overLeft > 0) {
|
position.left += overLeft
|
|
// Too far right -> align with right edge
|
} else if (overRight > 0) {
|
position.left -= overRight
|
|
// Adjust based on position and margin
|
} else {
|
position.left = max(position.left - collisionPosLeft, position.left)
|
}
|
},
|
top: function (position, data) {
|
var within = data.within,
|
withinOffset = within.isWindow ? within.scrollTop : within.offset.top,
|
outerHeight = data.within.height,
|
collisionPosTop = position.top - data.collisionPosition.marginTop,
|
overTop = withinOffset - collisionPosTop,
|
overBottom = collisionPosTop + data.collisionHeight - outerHeight - withinOffset,
|
newOverBottom
|
|
// Element is taller than within
|
if (data.collisionHeight > outerHeight) {
|
// Element is initially over the top of within
|
if (overTop > 0 && overBottom <= 0) {
|
newOverBottom =
|
position.top + overTop + data.collisionHeight - outerHeight - withinOffset
|
position.top += overTop - newOverBottom
|
|
// Element is initially over bottom of within
|
} else if (overBottom > 0 && overTop <= 0) {
|
position.top = withinOffset
|
|
// Element is initially over both top and bottom of within
|
} else {
|
if (overTop > overBottom) {
|
position.top = withinOffset + outerHeight - data.collisionHeight
|
} else {
|
position.top = withinOffset
|
}
|
}
|
|
// Too far up -> align with top
|
} else if (overTop > 0) {
|
position.top += overTop
|
|
// Too far down -> align with bottom edge
|
} else if (overBottom > 0) {
|
position.top -= overBottom
|
|
// Adjust based on position and margin
|
} else {
|
position.top = max(position.top - collisionPosTop, position.top)
|
}
|
}
|
},
|
flip: {
|
left: function (position, data) {
|
var within = data.within,
|
withinOffset = within.offset.left + within.scrollLeft,
|
outerWidth = within.width,
|
offsetLeft = within.isWindow ? within.scrollLeft : within.offset.left,
|
collisionPosLeft = position.left - data.collisionPosition.marginLeft,
|
overLeft = collisionPosLeft - offsetLeft,
|
overRight = collisionPosLeft + data.collisionWidth - outerWidth - offsetLeft,
|
myOffset =
|
data.my[0] === 'left' ? -data.elemWidth : data.my[0] === 'right' ? data.elemWidth : 0,
|
atOffset =
|
data.at[0] === 'left'
|
? data.targetWidth
|
: data.at[0] === 'right'
|
? -data.targetWidth
|
: 0,
|
offset = -2 * data.offset[0],
|
newOverRight,
|
newOverLeft
|
|
if (overLeft < 0) {
|
newOverRight =
|
position.left +
|
myOffset +
|
atOffset +
|
offset +
|
data.collisionWidth -
|
outerWidth -
|
withinOffset
|
if (newOverRight < 0 || newOverRight < abs(overLeft)) {
|
position.left += myOffset + atOffset + offset
|
}
|
} else if (overRight > 0) {
|
newOverLeft =
|
position.left -
|
data.collisionPosition.marginLeft +
|
myOffset +
|
atOffset +
|
offset -
|
offsetLeft
|
if (newOverLeft > 0 || abs(newOverLeft) < overRight) {
|
position.left += myOffset + atOffset + offset
|
}
|
}
|
},
|
top: function (position, data) {
|
var within = data.within,
|
withinOffset = within.offset.top + within.scrollTop,
|
outerHeight = within.height,
|
offsetTop = within.isWindow ? within.scrollTop : within.offset.top,
|
collisionPosTop = position.top - data.collisionPosition.marginTop,
|
overTop = collisionPosTop - offsetTop,
|
overBottom = collisionPosTop + data.collisionHeight - outerHeight - offsetTop,
|
top = data.my[1] === 'top',
|
myOffset = top ? -data.elemHeight : data.my[1] === 'bottom' ? data.elemHeight : 0,
|
atOffset =
|
data.at[1] === 'top'
|
? data.targetHeight
|
: data.at[1] === 'bottom'
|
? -data.targetHeight
|
: 0,
|
offset = -2 * data.offset[1],
|
newOverTop,
|
newOverBottom
|
if (overTop < 0) {
|
newOverBottom =
|
position.top +
|
myOffset +
|
atOffset +
|
offset +
|
data.collisionHeight -
|
outerHeight -
|
withinOffset
|
if (newOverBottom < 0 || newOverBottom < abs(overTop)) {
|
position.top += myOffset + atOffset + offset
|
}
|
} else if (overBottom > 0) {
|
newOverTop =
|
position.top -
|
data.collisionPosition.marginTop +
|
myOffset +
|
atOffset +
|
offset -
|
offsetTop
|
if (newOverTop > 0 || abs(newOverTop) < overBottom) {
|
position.top += myOffset + atOffset + offset
|
}
|
}
|
}
|
},
|
flipfit: {
|
left: function () {
|
$.ui.position.flip.left.apply(this, arguments)
|
$.ui.position.fit.left.apply(this, arguments)
|
},
|
top: function () {
|
$.ui.position.flip.top.apply(this, arguments)
|
$.ui.position.fit.top.apply(this, arguments)
|
}
|
}
|
}
|
})()
|
|
var position = $.ui.position
|
|
/*!
|
* jQuery UI :data 1.12.1
|
* http://jqueryui.com
|
*
|
* Copyright jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*/
|
|
//>>label: :data Selector
|
//>>group: Core
|
//>>description: Selects elements which have data stored under the specified key.
|
//>>docs: http://api.jqueryui.com/data-selector/
|
|
var data = $.extend($.expr[':'], {
|
data: $.expr.createPseudo
|
? $.expr.createPseudo(function (dataName) {
|
return function (elem) {
|
return !!$.data(elem, dataName)
|
}
|
})
|
: // Support: jQuery <1.8
|
function (elem, i, match) {
|
return !!$.data(elem, match[3])
|
}
|
})
|
|
/*!
|
* jQuery UI Disable Selection 1.12.1
|
* http://jqueryui.com
|
*
|
* Copyright jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*/
|
|
//>>label: disableSelection
|
//>>group: Core
|
//>>description: Disable selection of text content within the set of matched elements.
|
//>>docs: http://api.jqueryui.com/disableSelection/
|
|
// This file is deprecated
|
|
var disableSelection = $.fn.extend({
|
disableSelection: (function () {
|
var eventType = 'onselectstart' in document.createElement('div') ? 'selectstart' : 'mousedown'
|
|
return function () {
|
return this.on(eventType + '.ui-disableSelection', function (event) {
|
event.preventDefault()
|
})
|
}
|
})(),
|
|
enableSelection: function () {
|
return this.off('.ui-disableSelection')
|
}
|
})
|
|
/*!
|
* jQuery UI Effects 1.12.1
|
* http://jqueryui.com
|
*
|
* Copyright jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*/
|
|
//>>label: Effects Core
|
//>>group: Effects
|
// jscs:disable maximumLineLength
|
//>>description: Extends the internal jQuery effects. Includes morphing and easing. Required by all other effects.
|
// jscs:enable maximumLineLength
|
//>>docs: http://api.jqueryui.com/category/effects-core/
|
//>>demos: http://jqueryui.com/effect/
|
|
var dataSpace = 'ui-effects-',
|
dataSpaceStyle = 'ui-effects-style',
|
dataSpaceAnimated = 'ui-effects-animated',
|
// Create a local jQuery because jQuery Color relies on it and the
|
// global may not exist with AMD and a custom build (#10199)
|
jQuery = $
|
|
$.effects = {
|
effect: {}
|
}
|
|
/*!
|
* jQuery Color Animations v2.1.2
|
* https://github.com/jquery/jquery-color
|
*
|
* Copyright 2014 jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*
|
* Date: Wed Jan 16 08:47:09 2013 -0600
|
*/
|
;(function (jQuery, undefined) {
|
var stepHooks =
|
'backgroundColor borderBottomColor borderLeftColor borderRightColor ' +
|
'borderTopColor color columnRuleColor outlineColor textDecorationColor textEmphasisColor',
|
// Plusequals test for += 100 -= 100
|
rplusequals = /^([\-+])=\s*(\d+\.?\d*)/,
|
// A set of RE's that can match strings and generate color tuples.
|
stringParsers = [
|
{
|
re: /rgba?\(\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d{1,3})\s*(?:,\s*(\d?(?:\.\d+)?)\s*)?\)/,
|
parse: function (execResult) {
|
return [execResult[1], execResult[2], execResult[3], execResult[4]]
|
}
|
},
|
{
|
re: /rgba?\(\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*(?:,\s*(\d?(?:\.\d+)?)\s*)?\)/,
|
parse: function (execResult) {
|
return [execResult[1] * 2.55, execResult[2] * 2.55, execResult[3] * 2.55, execResult[4]]
|
}
|
},
|
{
|
// This regex ignores A-F because it's compared against an already lowercased string
|
re: /#([a-f0-9]{2})([a-f0-9]{2})([a-f0-9]{2})/,
|
parse: function (execResult) {
|
return [
|
parseInt(execResult[1], 16),
|
parseInt(execResult[2], 16),
|
parseInt(execResult[3], 16)
|
]
|
}
|
},
|
{
|
// This regex ignores A-F because it's compared against an already lowercased string
|
re: /#([a-f0-9])([a-f0-9])([a-f0-9])/,
|
parse: function (execResult) {
|
return [
|
parseInt(execResult[1] + execResult[1], 16),
|
parseInt(execResult[2] + execResult[2], 16),
|
parseInt(execResult[3] + execResult[3], 16)
|
]
|
}
|
},
|
{
|
re: /hsla?\(\s*(\d+(?:\.\d+)?)\s*,\s*(\d+(?:\.\d+)?)\%\s*,\s*(\d+(?:\.\d+)?)\%\s*(?:,\s*(\d?(?:\.\d+)?)\s*)?\)/,
|
space: 'hsla',
|
parse: function (execResult) {
|
return [execResult[1], execResult[2] / 100, execResult[3] / 100, execResult[4]]
|
}
|
}
|
],
|
// JQuery.Color( )
|
color = (jQuery.Color = function (color, green, blue, alpha) {
|
return new jQuery.Color.fn.parse(color, green, blue, alpha)
|
}),
|
spaces = {
|
rgba: {
|
props: {
|
red: {
|
idx: 0,
|
type: 'byte'
|
},
|
green: {
|
idx: 1,
|
type: 'byte'
|
},
|
blue: {
|
idx: 2,
|
type: 'byte'
|
}
|
}
|
},
|
|
hsla: {
|
props: {
|
hue: {
|
idx: 0,
|
type: 'degrees'
|
},
|
saturation: {
|
idx: 1,
|
type: 'percent'
|
},
|
lightness: {
|
idx: 2,
|
type: 'percent'
|
}
|
}
|
}
|
},
|
propTypes = {
|
byte: {
|
floor: true,
|
max: 255
|
},
|
percent: {
|
max: 1
|
},
|
degrees: {
|
mod: 360,
|
floor: true
|
}
|
},
|
support = (color.support = {}),
|
// Element for support tests
|
supportElem = jQuery('<p>')[0],
|
// Colors = jQuery.Color.names
|
colors,
|
// Local aliases of functions called often
|
each = jQuery.each
|
|
// Determine rgba support immediately
|
supportElem.style.cssText = 'background-color:rgba(1,1,1,.5)'
|
support.rgba = supportElem.style.backgroundColor.indexOf('rgba') > -1
|
|
// Define cache name and alpha properties
|
// for rgba and hsla spaces
|
each(spaces, function (spaceName, space) {
|
space.cache = '_' + spaceName
|
space.props.alpha = {
|
idx: 3,
|
type: 'percent',
|
def: 1
|
}
|
})
|
|
function clamp(value, prop, allowEmpty) {
|
var type = propTypes[prop.type] || {}
|
|
if (value == null) {
|
return allowEmpty || !prop.def ? null : prop.def
|
}
|
|
// ~~ is an short way of doing floor for positive numbers
|
value = type.floor ? ~~value : parseFloat(value)
|
|
// IE will pass in empty strings as value for alpha,
|
// which will hit this case
|
if (isNaN(value)) {
|
return prop.def
|
}
|
|
if (type.mod) {
|
// We add mod before modding to make sure that negatives values
|
// get converted properly: -10 -> 350
|
return (value + type.mod) % type.mod
|
}
|
|
// For now all property types without mod have min and max
|
return 0 > value ? 0 : type.max < value ? type.max : value
|
}
|
|
function stringParse(string) {
|
var inst = color(),
|
rgba = (inst._rgba = [])
|
|
string = string.toLowerCase()
|
|
each(stringParsers, function (i, parser) {
|
var parsed,
|
match = parser.re.exec(string),
|
values = match && parser.parse(match),
|
spaceName = parser.space || 'rgba'
|
|
if (values) {
|
parsed = inst[spaceName](values)
|
|
// If this was an rgba parse the assignment might happen twice
|
// oh well....
|
inst[spaces[spaceName].cache] = parsed[spaces[spaceName].cache]
|
rgba = inst._rgba = parsed._rgba
|
|
// Exit each( stringParsers ) here because we matched
|
return false
|
}
|
})
|
|
// Found a stringParser that handled it
|
if (rgba.length) {
|
// If this came from a parsed string, force "transparent" when alpha is 0
|
// chrome, (and maybe others) return "transparent" as rgba(0,0,0,0)
|
if (rgba.join() === '0,0,0,0') {
|
jQuery.extend(rgba, colors.transparent)
|
}
|
return inst
|
}
|
|
// Named colors
|
return colors[string]
|
}
|
|
color.fn = jQuery.extend(color.prototype, {
|
parse: function (red, green, blue, alpha) {
|
if (red === undefined) {
|
this._rgba = [null, null, null, null]
|
return this
|
}
|
if (red.jquery || red.nodeType) {
|
red = jQuery(red).css(green)
|
green = undefined
|
}
|
|
var inst = this,
|
type = jQuery.type(red),
|
rgba = (this._rgba = [])
|
|
// More than 1 argument specified - assume ( red, green, blue, alpha )
|
if (green !== undefined) {
|
red = [red, green, blue, alpha]
|
type = 'array'
|
}
|
|
if (type === 'string') {
|
return this.parse(stringParse(red) || colors._default)
|
}
|
|
if (type === 'array') {
|
each(spaces.rgba.props, function (key, prop) {
|
rgba[prop.idx] = clamp(red[prop.idx], prop)
|
})
|
return this
|
}
|
|
if (type === 'object') {
|
if (red instanceof color) {
|
each(spaces, function (spaceName, space) {
|
if (red[space.cache]) {
|
inst[space.cache] = red[space.cache].slice()
|
}
|
})
|
} else {
|
each(spaces, function (spaceName, space) {
|
var cache = space.cache
|
each(space.props, function (key, prop) {
|
// If the cache doesn't exist, and we know how to convert
|
if (!inst[cache] && space.to) {
|
// If the value was null, we don't need to copy it
|
// if the key was alpha, we don't need to copy it either
|
if (key === 'alpha' || red[key] == null) {
|
return
|
}
|
inst[cache] = space.to(inst._rgba)
|
}
|
|
// This is the only case where we allow nulls for ALL properties.
|
// call clamp with alwaysAllowEmpty
|
inst[cache][prop.idx] = clamp(red[key], prop, true)
|
})
|
|
// Everything defined but alpha?
|
if (inst[cache] && jQuery.inArray(null, inst[cache].slice(0, 3)) < 0) {
|
// Use the default of 1
|
inst[cache][3] = 1
|
if (space.from) {
|
inst._rgba = space.from(inst[cache])
|
}
|
}
|
})
|
}
|
return this
|
}
|
},
|
is: function (compare) {
|
var is = color(compare),
|
same = true,
|
inst = this
|
|
each(spaces, function (_, space) {
|
var localCache,
|
isCache = is[space.cache]
|
if (isCache) {
|
localCache = inst[space.cache] || (space.to && space.to(inst._rgba)) || []
|
each(space.props, function (_, prop) {
|
if (isCache[prop.idx] != null) {
|
same = isCache[prop.idx] === localCache[prop.idx]
|
return same
|
}
|
})
|
}
|
return same
|
})
|
return same
|
},
|
_space: function () {
|
var used = [],
|
inst = this
|
each(spaces, function (spaceName, space) {
|
if (inst[space.cache]) {
|
used.push(spaceName)
|
}
|
})
|
return used.pop()
|
},
|
transition: function (other, distance) {
|
var end = color(other),
|
spaceName = end._space(),
|
space = spaces[spaceName],
|
startColor = this.alpha() === 0 ? color('transparent') : this,
|
start = startColor[space.cache] || space.to(startColor._rgba),
|
result = start.slice()
|
|
end = end[space.cache]
|
each(space.props, function (key, prop) {
|
var index = prop.idx,
|
startValue = start[index],
|
endValue = end[index],
|
type = propTypes[prop.type] || {}
|
|
// If null, don't override start value
|
if (endValue === null) {
|
return
|
}
|
|
// If null - use end
|
if (startValue === null) {
|
result[index] = endValue
|
} else {
|
if (type.mod) {
|
if (endValue - startValue > type.mod / 2) {
|
startValue += type.mod
|
} else if (startValue - endValue > type.mod / 2) {
|
startValue -= type.mod
|
}
|
}
|
result[index] = clamp((endValue - startValue) * distance + startValue, prop)
|
}
|
})
|
return this[spaceName](result)
|
},
|
blend: function (opaque) {
|
// If we are already opaque - return ourself
|
if (this._rgba[3] === 1) {
|
return this
|
}
|
|
var rgb = this._rgba.slice(),
|
a = rgb.pop(),
|
blend = color(opaque)._rgba
|
|
return color(
|
jQuery.map(rgb, function (v, i) {
|
return (1 - a) * blend[i] + a * v
|
})
|
)
|
},
|
toRgbaString: function () {
|
var prefix = 'rgba(',
|
rgba = jQuery.map(this._rgba, function (v, i) {
|
return v == null ? (i > 2 ? 1 : 0) : v
|
})
|
|
if (rgba[3] === 1) {
|
rgba.pop()
|
prefix = 'rgb('
|
}
|
|
return prefix + rgba.join() + ')'
|
},
|
toHslaString: function () {
|
var prefix = 'hsla(',
|
hsla = jQuery.map(this.hsla(), function (v, i) {
|
if (v == null) {
|
v = i > 2 ? 1 : 0
|
}
|
|
// Catch 1 and 2
|
if (i && i < 3) {
|
v = Math.round(v * 100) + '%'
|
}
|
return v
|
})
|
|
if (hsla[3] === 1) {
|
hsla.pop()
|
prefix = 'hsl('
|
}
|
return prefix + hsla.join() + ')'
|
},
|
toHexString: function (includeAlpha) {
|
var rgba = this._rgba.slice(),
|
alpha = rgba.pop()
|
|
if (includeAlpha) {
|
rgba.push(~~(alpha * 255))
|
}
|
|
return (
|
'#' +
|
jQuery
|
.map(rgba, function (v) {
|
// Default to 0 when nulls exist
|
v = (v || 0).toString(16)
|
return v.length === 1 ? '0' + v : v
|
})
|
.join('')
|
)
|
},
|
toString: function () {
|
return this._rgba[3] === 0 ? 'transparent' : this.toRgbaString()
|
}
|
})
|
color.fn.parse.prototype = color.fn
|
|
// Hsla conversions adapted from:
|
// https://code.google.com/p/maashaack/source/browse/packages/graphics/trunk/src/graphics/colors/HUE2RGB.as?r=5021
|
|
function hue2rgb(p, q, h) {
|
h = (h + 1) % 1
|
if (h * 6 < 1) {
|
return p + (q - p) * h * 6
|
}
|
if (h * 2 < 1) {
|
return q
|
}
|
if (h * 3 < 2) {
|
return p + (q - p) * (2 / 3 - h) * 6
|
}
|
return p
|
}
|
|
spaces.hsla.to = function (rgba) {
|
if (rgba[0] == null || rgba[1] == null || rgba[2] == null) {
|
return [null, null, null, rgba[3]]
|
}
|
var r = rgba[0] / 255,
|
g = rgba[1] / 255,
|
b = rgba[2] / 255,
|
a = rgba[3],
|
max = Math.max(r, g, b),
|
min = Math.min(r, g, b),
|
diff = max - min,
|
add = max + min,
|
l = add * 0.5,
|
h,
|
s
|
|
if (min === max) {
|
h = 0
|
} else if (r === max) {
|
h = (60 * (g - b)) / diff + 360
|
} else if (g === max) {
|
h = (60 * (b - r)) / diff + 120
|
} else {
|
h = (60 * (r - g)) / diff + 240
|
}
|
|
// Chroma (diff) == 0 means greyscale which, by definition, saturation = 0%
|
// otherwise, saturation is based on the ratio of chroma (diff) to lightness (add)
|
if (diff === 0) {
|
s = 0
|
} else if (l <= 0.5) {
|
s = diff / add
|
} else {
|
s = diff / (2 - add)
|
}
|
return [Math.round(h) % 360, s, l, a == null ? 1 : a]
|
}
|
|
spaces.hsla.from = function (hsla) {
|
if (hsla[0] == null || hsla[1] == null || hsla[2] == null) {
|
return [null, null, null, hsla[3]]
|
}
|
var h = hsla[0] / 360,
|
s = hsla[1],
|
l = hsla[2],
|
a = hsla[3],
|
q = l <= 0.5 ? l * (1 + s) : l + s - l * s,
|
p = 2 * l - q
|
|
return [
|
Math.round(hue2rgb(p, q, h + 1 / 3) * 255),
|
Math.round(hue2rgb(p, q, h) * 255),
|
Math.round(hue2rgb(p, q, h - 1 / 3) * 255),
|
a
|
]
|
}
|
|
each(spaces, function (spaceName, space) {
|
var props = space.props,
|
cache = space.cache,
|
to = space.to,
|
from = space.from
|
|
// Makes rgba() and hsla()
|
color.fn[spaceName] = function (value) {
|
// Generate a cache for this space if it doesn't exist
|
if (to && !this[cache]) {
|
this[cache] = to(this._rgba)
|
}
|
if (value === undefined) {
|
return this[cache].slice()
|
}
|
|
var ret,
|
type = jQuery.type(value),
|
arr = type === 'array' || type === 'object' ? value : arguments,
|
local = this[cache].slice()
|
|
each(props, function (key, prop) {
|
var val = arr[type === 'object' ? key : prop.idx]
|
if (val == null) {
|
val = local[prop.idx]
|
}
|
local[prop.idx] = clamp(val, prop)
|
})
|
|
if (from) {
|
ret = color(from(local))
|
ret[cache] = local
|
return ret
|
} else {
|
return color(local)
|
}
|
}
|
|
// Makes red() green() blue() alpha() hue() saturation() lightness()
|
each(props, function (key, prop) {
|
// Alpha is included in more than one space
|
if (color.fn[key]) {
|
return
|
}
|
color.fn[key] = function (value) {
|
var vtype = jQuery.type(value),
|
fn = key === 'alpha' ? (this._hsla ? 'hsla' : 'rgba') : spaceName,
|
local = this[fn](),
|
cur = local[prop.idx],
|
match
|
|
if (vtype === 'undefined') {
|
return cur
|
}
|
|
if (vtype === 'function') {
|
value = value.call(this, cur)
|
vtype = jQuery.type(value)
|
}
|
if (value == null && prop.empty) {
|
return this
|
}
|
if (vtype === 'string') {
|
match = rplusequals.exec(value)
|
if (match) {
|
value = cur + parseFloat(match[2]) * (match[1] === '+' ? 1 : -1)
|
}
|
}
|
local[prop.idx] = value
|
return this[fn](local)
|
}
|
})
|
})
|
|
// Add cssHook and .fx.step function for each named hook.
|
// accept a space separated string of properties
|
color.hook = function (hook) {
|
var hooks = hook.split(' ')
|
each(hooks, function (i, hook) {
|
jQuery.cssHooks[hook] = {
|
set: function (elem, value) {
|
var parsed,
|
curElem,
|
backgroundColor = ''
|
|
if (
|
value !== 'transparent' &&
|
(jQuery.type(value) !== 'string' || (parsed = stringParse(value)))
|
) {
|
value = color(parsed || value)
|
if (!support.rgba && value._rgba[3] !== 1) {
|
curElem = hook === 'backgroundColor' ? elem.parentNode : elem
|
while (
|
(backgroundColor === '' || backgroundColor === 'transparent') &&
|
curElem &&
|
curElem.style
|
) {
|
try {
|
backgroundColor = jQuery.css(curElem, 'backgroundColor')
|
curElem = curElem.parentNode
|
} catch (e) {}
|
}
|
|
value = value.blend(
|
backgroundColor && backgroundColor !== 'transparent'
|
? backgroundColor
|
: '_default'
|
)
|
}
|
|
value = value.toRgbaString()
|
}
|
try {
|
elem.style[hook] = value
|
} catch (e) {
|
// Wrapped to prevent IE from throwing errors on "invalid" values like
|
// 'auto' or 'inherit'
|
}
|
}
|
}
|
jQuery.fx.step[hook] = function (fx) {
|
if (!fx.colorInit) {
|
fx.start = color(fx.elem, hook)
|
fx.end = color(fx.end)
|
fx.colorInit = true
|
}
|
jQuery.cssHooks[hook].set(fx.elem, fx.start.transition(fx.end, fx.pos))
|
}
|
})
|
}
|
|
color.hook(stepHooks)
|
|
jQuery.cssHooks.borderColor = {
|
expand: function (value) {
|
var expanded = {}
|
|
each(['Top', 'Right', 'Bottom', 'Left'], function (i, part) {
|
expanded['border' + part + 'Color'] = value
|
})
|
return expanded
|
}
|
}
|
|
// Basic color names only.
|
// Usage of any of the other color names requires adding yourself or including
|
// jquery.color.svg-names.js.
|
colors = jQuery.Color.names = {
|
// 4.1. Basic color keywords
|
aqua: '#00ffff',
|
black: '#000000',
|
blue: '#0000ff',
|
fuchsia: '#ff00ff',
|
gray: '#808080',
|
green: '#008000',
|
lime: '#00ff00',
|
maroon: '#800000',
|
navy: '#000080',
|
olive: '#808000',
|
purple: '#800080',
|
red: '#ff0000',
|
silver: '#c0c0c0',
|
teal: '#008080',
|
white: '#ffffff',
|
yellow: '#ffff00',
|
|
// 4.2.3. "transparent" color keyword
|
transparent: [null, null, null, 0],
|
|
_default: '#ffffff'
|
}
|
})(jQuery)
|
|
/******************************************************************************/
|
/****************************** CLASS ANIMATIONS ******************************/
|
/******************************************************************************/
|
;(function () {
|
var classAnimationActions = ['add', 'remove', 'toggle'],
|
shorthandStyles = {
|
border: 1,
|
borderBottom: 1,
|
borderColor: 1,
|
borderLeft: 1,
|
borderRight: 1,
|
borderTop: 1,
|
borderWidth: 1,
|
margin: 1,
|
padding: 1
|
}
|
|
$.each(
|
['borderLeftStyle', 'borderRightStyle', 'borderBottomStyle', 'borderTopStyle'],
|
function (_, prop) {
|
$.fx.step[prop] = function (fx) {
|
if ((fx.end !== 'none' && !fx.setAttr) || (fx.pos === 1 && !fx.setAttr)) {
|
jQuery.style(fx.elem, prop, fx.end)
|
fx.setAttr = true
|
}
|
}
|
}
|
)
|
|
function getElementStyles(elem) {
|
var key,
|
len,
|
style = elem.ownerDocument.defaultView
|
? elem.ownerDocument.defaultView.getComputedStyle(elem, null)
|
: elem.currentStyle,
|
styles = {}
|
|
if (style && style.length && style[0] && style[style[0]]) {
|
len = style.length
|
while (len--) {
|
key = style[len]
|
if (typeof style[key] === 'string') {
|
styles[$.camelCase(key)] = style[key]
|
}
|
}
|
|
// Support: Opera, IE <9
|
} else {
|
for (key in style) {
|
if (typeof style[key] === 'string') {
|
styles[key] = style[key]
|
}
|
}
|
}
|
|
return styles
|
}
|
|
function styleDifference(oldStyle, newStyle) {
|
var diff = {},
|
name,
|
value
|
|
for (name in newStyle) {
|
value = newStyle[name]
|
if (oldStyle[name] !== value) {
|
if (!shorthandStyles[name]) {
|
if ($.fx.step[name] || !isNaN(parseFloat(value))) {
|
diff[name] = value
|
}
|
}
|
}
|
}
|
|
return diff
|
}
|
|
// Support: jQuery <1.8
|
if (!$.fn.addBack) {
|
$.fn.addBack = function (selector) {
|
return this.add(selector == null ? this.prevObject : this.prevObject.filter(selector))
|
}
|
}
|
|
$.effects.animateClass = function (value, duration, easing, callback) {
|
var o = $.speed(duration, easing, callback)
|
|
return this.queue(function () {
|
var animated = $(this),
|
baseClass = animated.attr('class') || '',
|
applyClassChange,
|
allAnimations = o.children ? animated.find('*').addBack() : animated
|
|
// Map the animated objects to store the original styles.
|
allAnimations = allAnimations.map(function () {
|
var el = $(this)
|
return {
|
el: el,
|
start: getElementStyles(this)
|
}
|
})
|
|
// Apply class change
|
applyClassChange = function () {
|
$.each(classAnimationActions, function (i, action) {
|
if (value[action]) {
|
animated[action + 'Class'](value[action])
|
}
|
})
|
}
|
applyClassChange()
|
|
// Map all animated objects again - calculate new styles and diff
|
allAnimations = allAnimations.map(function () {
|
this.end = getElementStyles(this.el[0])
|
this.diff = styleDifference(this.start, this.end)
|
return this
|
})
|
|
// Apply original class
|
animated.attr('class', baseClass)
|
|
// Map all animated objects again - this time collecting a promise
|
allAnimations = allAnimations.map(function () {
|
var styleInfo = this,
|
dfd = $.Deferred(),
|
opts = $.extend({}, o, {
|
queue: false,
|
complete: function () {
|
dfd.resolve(styleInfo)
|
}
|
})
|
|
this.el.animate(this.diff, opts)
|
return dfd.promise()
|
})
|
|
// Once all animations have completed:
|
$.when.apply($, allAnimations.get()).done(function () {
|
// Set the final class
|
applyClassChange()
|
|
// For each animated element,
|
// clear all css properties that were animated
|
$.each(arguments, function () {
|
var el = this.el
|
$.each(this.diff, function (key) {
|
el.css(key, '')
|
})
|
})
|
|
// This is guarnteed to be there if you use jQuery.speed()
|
// it also handles dequeuing the next anim...
|
o.complete.call(animated[0])
|
})
|
})
|
}
|
|
$.fn.extend({
|
addClass: (function (orig) {
|
return function (classNames, speed, easing, callback) {
|
return speed
|
? $.effects.animateClass.call(this, { add: classNames }, speed, easing, callback)
|
: orig.apply(this, arguments)
|
}
|
})($.fn.addClass),
|
|
removeClass: (function (orig) {
|
return function (classNames, speed, easing, callback) {
|
return arguments.length > 1
|
? $.effects.animateClass.call(this, { remove: classNames }, speed, easing, callback)
|
: orig.apply(this, arguments)
|
}
|
})($.fn.removeClass),
|
|
toggleClass: (function (orig) {
|
return function (classNames, force, speed, easing, callback) {
|
if (typeof force === 'boolean' || force === undefined) {
|
if (!speed) {
|
// Without speed parameter
|
return orig.apply(this, arguments)
|
} else {
|
return $.effects.animateClass.call(
|
this,
|
force ? { add: classNames } : { remove: classNames },
|
speed,
|
easing,
|
callback
|
)
|
}
|
} else {
|
// Without force parameter
|
return $.effects.animateClass.call(this, { toggle: classNames }, force, speed, easing)
|
}
|
}
|
})($.fn.toggleClass),
|
|
switchClass: function (remove, add, speed, easing, callback) {
|
return $.effects.animateClass.call(
|
this,
|
{
|
add: add,
|
remove: remove
|
},
|
speed,
|
easing,
|
callback
|
)
|
}
|
})
|
})()
|
|
/******************************************************************************/
|
/*********************************** EFFECTS **********************************/
|
/******************************************************************************/
|
|
;(function () {
|
if ($.expr && $.expr.filters && $.expr.filters.animated) {
|
$.expr.filters.animated = (function (orig) {
|
return function (elem) {
|
return !!$(elem).data(dataSpaceAnimated) || orig(elem)
|
}
|
})($.expr.filters.animated)
|
}
|
|
if ($.uiBackCompat !== false) {
|
$.extend($.effects, {
|
// Saves a set of properties in a data storage
|
save: function (element, set) {
|
var i = 0,
|
length = set.length
|
for (; i < length; i++) {
|
if (set[i] !== null) {
|
element.data(dataSpace + set[i], element[0].style[set[i]])
|
}
|
}
|
},
|
|
// Restores a set of previously saved properties from a data storage
|
restore: function (element, set) {
|
var val,
|
i = 0,
|
length = set.length
|
for (; i < length; i++) {
|
if (set[i] !== null) {
|
val = element.data(dataSpace + set[i])
|
element.css(set[i], val)
|
}
|
}
|
},
|
|
setMode: function (el, mode) {
|
if (mode === 'toggle') {
|
mode = el.is(':hidden') ? 'show' : 'hide'
|
}
|
return mode
|
},
|
|
// Wraps the element around a wrapper that copies position properties
|
createWrapper: function (element) {
|
// If the element is already wrapped, return it
|
if (element.parent().is('.ui-effects-wrapper')) {
|
return element.parent()
|
}
|
|
// Wrap the element
|
var props = {
|
width: element.outerWidth(true),
|
height: element.outerHeight(true),
|
float: element.css('float')
|
},
|
wrapper = $('<div></div>').addClass('ui-effects-wrapper').css({
|
fontSize: '100%',
|
background: 'transparent',
|
border: 'none',
|
margin: 0,
|
padding: 0
|
}),
|
// Store the size in case width/height are defined in % - Fixes #5245
|
size = {
|
width: element.width(),
|
height: element.height()
|
},
|
active = document.activeElement
|
|
// Support: Firefox
|
// Firefox incorrectly exposes anonymous content
|
// https://bugzilla.mozilla.org/show_bug.cgi?id=561664
|
try {
|
active.id
|
} catch (e) {
|
active = document.body
|
}
|
|
element.wrap(wrapper)
|
|
// Fixes #7595 - Elements lose focus when wrapped.
|
if (element[0] === active || $.contains(element[0], active)) {
|
$(active).trigger('focus')
|
}
|
|
// Hotfix for jQuery 1.4 since some change in wrap() seems to actually
|
// lose the reference to the wrapped element
|
wrapper = element.parent()
|
|
// Transfer positioning properties to the wrapper
|
if (element.css('position') === 'static') {
|
wrapper.css({ position: 'relative' })
|
element.css({ position: 'relative' })
|
} else {
|
$.extend(props, {
|
position: element.css('position'),
|
zIndex: element.css('z-index')
|
})
|
$.each(['top', 'left', 'bottom', 'right'], function (i, pos) {
|
props[pos] = element.css(pos)
|
if (isNaN(parseInt(props[pos], 10))) {
|
props[pos] = 'auto'
|
}
|
})
|
element.css({
|
position: 'relative',
|
top: 0,
|
left: 0,
|
right: 'auto',
|
bottom: 'auto'
|
})
|
}
|
element.css(size)
|
|
return wrapper.css(props).show()
|
},
|
|
removeWrapper: function (element) {
|
var active = document.activeElement
|
|
if (element.parent().is('.ui-effects-wrapper')) {
|
element.parent().replaceWith(element)
|
|
// Fixes #7595 - Elements lose focus when wrapped.
|
if (element[0] === active || $.contains(element[0], active)) {
|
$(active).trigger('focus')
|
}
|
}
|
|
return element
|
}
|
})
|
}
|
|
$.extend($.effects, {
|
version: '1.12.1',
|
|
define: function (name, mode, effect) {
|
if (!effect) {
|
effect = mode
|
mode = 'effect'
|
}
|
|
$.effects.effect[name] = effect
|
$.effects.effect[name].mode = mode
|
|
return effect
|
},
|
|
scaledDimensions: function (element, percent, direction) {
|
if (percent === 0) {
|
return {
|
height: 0,
|
width: 0,
|
outerHeight: 0,
|
outerWidth: 0
|
}
|
}
|
|
var x = direction !== 'horizontal' ? (percent || 100) / 100 : 1,
|
y = direction !== 'vertical' ? (percent || 100) / 100 : 1
|
|
return {
|
height: element.height() * y,
|
width: element.width() * x,
|
outerHeight: element.outerHeight() * y,
|
outerWidth: element.outerWidth() * x
|
}
|
},
|
|
clipToBox: function (animation) {
|
return {
|
width: animation.clip.right - animation.clip.left,
|
height: animation.clip.bottom - animation.clip.top,
|
left: animation.clip.left,
|
top: animation.clip.top
|
}
|
},
|
|
// Injects recently queued functions to be first in line (after "inprogress")
|
unshift: function (element, queueLength, count) {
|
var queue = element.queue()
|
|
if (queueLength > 1) {
|
queue.splice.apply(queue, [1, 0].concat(queue.splice(queueLength, count)))
|
}
|
element.dequeue()
|
},
|
|
saveStyle: function (element) {
|
element.data(dataSpaceStyle, element[0].style.cssText)
|
},
|
|
restoreStyle: function (element) {
|
element[0].style.cssText = element.data(dataSpaceStyle) || ''
|
element.removeData(dataSpaceStyle)
|
},
|
|
mode: function (element, mode) {
|
var hidden = element.is(':hidden')
|
|
if (mode === 'toggle') {
|
mode = hidden ? 'show' : 'hide'
|
}
|
if (hidden ? mode === 'hide' : mode === 'show') {
|
mode = 'none'
|
}
|
return mode
|
},
|
|
// Translates a [top,left] array into a baseline value
|
getBaseline: function (origin, original) {
|
var y, x
|
|
switch (origin[0]) {
|
case 'top':
|
y = 0
|
break
|
case 'middle':
|
y = 0.5
|
break
|
case 'bottom':
|
y = 1
|
break
|
default:
|
y = origin[0] / original.height
|
}
|
|
switch (origin[1]) {
|
case 'left':
|
x = 0
|
break
|
case 'center':
|
x = 0.5
|
break
|
case 'right':
|
x = 1
|
break
|
default:
|
x = origin[1] / original.width
|
}
|
|
return {
|
x: x,
|
y: y
|
}
|
},
|
|
// Creates a placeholder element so that the original element can be made absolute
|
createPlaceholder: function (element) {
|
var placeholder,
|
cssPosition = element.css('position'),
|
position = element.position()
|
|
// Lock in margins first to account for form elements, which
|
// will change margin if you explicitly set height
|
// see: http://jsfiddle.net/JZSMt/3/ https://bugs.webkit.org/show_bug.cgi?id=107380
|
// Support: Safari
|
element
|
.css({
|
marginTop: element.css('marginTop'),
|
marginBottom: element.css('marginBottom'),
|
marginLeft: element.css('marginLeft'),
|
marginRight: element.css('marginRight')
|
})
|
.outerWidth(element.outerWidth())
|
.outerHeight(element.outerHeight())
|
|
if (/^(static|relative)/.test(cssPosition)) {
|
cssPosition = 'absolute'
|
|
placeholder = $('<' + element[0].nodeName + '>')
|
.insertAfter(element)
|
.css({
|
// Convert inline to inline block to account for inline elements
|
// that turn to inline block based on content (like img)
|
display: /^(inline|ruby)/.test(element.css('display')) ? 'inline-block' : 'block',
|
visibility: 'hidden',
|
|
// Margins need to be set to account for margin collapse
|
marginTop: element.css('marginTop'),
|
marginBottom: element.css('marginBottom'),
|
marginLeft: element.css('marginLeft'),
|
marginRight: element.css('marginRight'),
|
float: element.css('float')
|
})
|
.outerWidth(element.outerWidth())
|
.outerHeight(element.outerHeight())
|
.addClass('ui-effects-placeholder')
|
|
element.data(dataSpace + 'placeholder', placeholder)
|
}
|
|
element.css({
|
position: cssPosition,
|
left: position.left,
|
top: position.top
|
})
|
|
return placeholder
|
},
|
|
removePlaceholder: function (element) {
|
var dataKey = dataSpace + 'placeholder',
|
placeholder = element.data(dataKey)
|
|
if (placeholder) {
|
placeholder.remove()
|
element.removeData(dataKey)
|
}
|
},
|
|
// Removes a placeholder if it exists and restores
|
// properties that were modified during placeholder creation
|
cleanUp: function (element) {
|
$.effects.restoreStyle(element)
|
$.effects.removePlaceholder(element)
|
},
|
|
setTransition: function (element, list, factor, value) {
|
value = value || {}
|
$.each(list, function (i, x) {
|
var unit = element.cssUnit(x)
|
if (unit[0] > 0) {
|
value[x] = unit[0] * factor + unit[1]
|
}
|
})
|
return value
|
}
|
})
|
|
// Return an effect options object for the given parameters:
|
function _normalizeArguments(effect, options, speed, callback) {
|
// Allow passing all options as the first parameter
|
if ($.isPlainObject(effect)) {
|
options = effect
|
effect = effect.effect
|
}
|
|
// Convert to an object
|
effect = { effect: effect }
|
|
// Catch (effect, null, ...)
|
if (options == null) {
|
options = {}
|
}
|
|
// Catch (effect, callback)
|
if ($.isFunction(options)) {
|
callback = options
|
speed = null
|
options = {}
|
}
|
|
// Catch (effect, speed, ?)
|
if (typeof options === 'number' || $.fx.speeds[options]) {
|
callback = speed
|
speed = options
|
options = {}
|
}
|
|
// Catch (effect, options, callback)
|
if ($.isFunction(speed)) {
|
callback = speed
|
speed = null
|
}
|
|
// Add options to effect
|
if (options) {
|
$.extend(effect, options)
|
}
|
|
speed = speed || options.duration
|
effect.duration = $.fx.off
|
? 0
|
: typeof speed === 'number'
|
? speed
|
: speed in $.fx.speeds
|
? $.fx.speeds[speed]
|
: $.fx.speeds._default
|
|
effect.complete = callback || options.complete
|
|
return effect
|
}
|
|
function standardAnimationOption(option) {
|
// Valid standard speeds (nothing, number, named speed)
|
if (!option || typeof option === 'number' || $.fx.speeds[option]) {
|
return true
|
}
|
|
// Invalid strings - treat as "normal" speed
|
if (typeof option === 'string' && !$.effects.effect[option]) {
|
return true
|
}
|
|
// Complete callback
|
if ($.isFunction(option)) {
|
return true
|
}
|
|
// Options hash (but not naming an effect)
|
if (typeof option === 'object' && !option.effect) {
|
return true
|
}
|
|
// Didn't match any standard API
|
return false
|
}
|
|
$.fn.extend({
|
effect: function (/* effect, options, speed, callback */) {
|
var args = _normalizeArguments.apply(this, arguments),
|
effectMethod = $.effects.effect[args.effect],
|
defaultMode = effectMethod.mode,
|
queue = args.queue,
|
queueName = queue || 'fx',
|
complete = args.complete,
|
mode = args.mode,
|
modes = [],
|
prefilter = function (next) {
|
var el = $(this),
|
normalizedMode = $.effects.mode(el, mode) || defaultMode
|
|
// Sentinel for duck-punching the :animated psuedo-selector
|
el.data(dataSpaceAnimated, true)
|
|
// Save effect mode for later use,
|
// we can't just call $.effects.mode again later,
|
// as the .show() below destroys the initial state
|
modes.push(normalizedMode)
|
|
// See $.uiBackCompat inside of run() for removal of defaultMode in 1.13
|
if (
|
defaultMode &&
|
(normalizedMode === 'show' ||
|
(normalizedMode === defaultMode && normalizedMode === 'hide'))
|
) {
|
el.show()
|
}
|
|
if (!defaultMode || normalizedMode !== 'none') {
|
$.effects.saveStyle(el)
|
}
|
|
if ($.isFunction(next)) {
|
next()
|
}
|
}
|
|
if ($.fx.off || !effectMethod) {
|
// Delegate to the original method (e.g., .show()) if possible
|
if (mode) {
|
return this[mode](args.duration, complete)
|
} else {
|
return this.each(function () {
|
if (complete) {
|
complete.call(this)
|
}
|
})
|
}
|
}
|
|
function run(next) {
|
var elem = $(this)
|
|
function cleanup() {
|
elem.removeData(dataSpaceAnimated)
|
|
$.effects.cleanUp(elem)
|
|
if (args.mode === 'hide') {
|
elem.hide()
|
}
|
|
done()
|
}
|
|
function done() {
|
if ($.isFunction(complete)) {
|
complete.call(elem[0])
|
}
|
|
if ($.isFunction(next)) {
|
next()
|
}
|
}
|
|
// Override mode option on a per element basis,
|
// as toggle can be either show or hide depending on element state
|
args.mode = modes.shift()
|
|
if ($.uiBackCompat !== false && !defaultMode) {
|
if (elem.is(':hidden') ? mode === 'hide' : mode === 'show') {
|
// Call the core method to track "olddisplay" properly
|
elem[mode]()
|
done()
|
} else {
|
effectMethod.call(elem[0], args, done)
|
}
|
} else {
|
if (args.mode === 'none') {
|
// Call the core method to track "olddisplay" properly
|
elem[mode]()
|
done()
|
} else {
|
effectMethod.call(elem[0], args, cleanup)
|
}
|
}
|
}
|
|
// Run prefilter on all elements first to ensure that
|
// any showing or hiding happens before placeholder creation,
|
// which ensures that any layout changes are correctly captured.
|
return queue === false
|
? this.each(prefilter).each(run)
|
: this.queue(queueName, prefilter).queue(queueName, run)
|
},
|
|
show: (function (orig) {
|
return function (option) {
|
if (standardAnimationOption(option)) {
|
return orig.apply(this, arguments)
|
} else {
|
var args = _normalizeArguments.apply(this, arguments)
|
args.mode = 'show'
|
return this.effect.call(this, args)
|
}
|
}
|
})($.fn.show),
|
|
hide: (function (orig) {
|
return function (option) {
|
if (standardAnimationOption(option)) {
|
return orig.apply(this, arguments)
|
} else {
|
var args = _normalizeArguments.apply(this, arguments)
|
args.mode = 'hide'
|
return this.effect.call(this, args)
|
}
|
}
|
})($.fn.hide),
|
|
toggle: (function (orig) {
|
return function (option) {
|
if (standardAnimationOption(option) || typeof option === 'boolean') {
|
return orig.apply(this, arguments)
|
} else {
|
var args = _normalizeArguments.apply(this, arguments)
|
args.mode = 'toggle'
|
return this.effect.call(this, args)
|
}
|
}
|
})($.fn.toggle),
|
|
cssUnit: function (key) {
|
var style = this.css(key),
|
val = []
|
|
$.each(['em', 'px', '%', 'pt'], function (i, unit) {
|
if (style.indexOf(unit) > 0) {
|
val = [parseFloat(style), unit]
|
}
|
})
|
return val
|
},
|
|
cssClip: function (clipObj) {
|
if (clipObj) {
|
return this.css(
|
'clip',
|
'rect(' +
|
clipObj.top +
|
'px ' +
|
clipObj.right +
|
'px ' +
|
clipObj.bottom +
|
'px ' +
|
clipObj.left +
|
'px)'
|
)
|
}
|
return parseClip(this.css('clip'), this)
|
},
|
|
transfer: function (options, done) {
|
var element = $(this),
|
target = $(options.to),
|
targetFixed = target.css('position') === 'fixed',
|
body = $('body'),
|
fixTop = targetFixed ? body.scrollTop() : 0,
|
fixLeft = targetFixed ? body.scrollLeft() : 0,
|
endPosition = target.offset(),
|
animation = {
|
top: endPosition.top - fixTop,
|
left: endPosition.left - fixLeft,
|
height: target.innerHeight(),
|
width: target.innerWidth()
|
},
|
startPosition = element.offset(),
|
transfer = $("<div class='ui-effects-transfer'></div>")
|
.appendTo('body')
|
.addClass(options.className)
|
.css({
|
top: startPosition.top - fixTop,
|
left: startPosition.left - fixLeft,
|
height: element.innerHeight(),
|
width: element.innerWidth(),
|
position: targetFixed ? 'fixed' : 'absolute'
|
})
|
.animate(animation, options.duration, options.easing, function () {
|
transfer.remove()
|
if ($.isFunction(done)) {
|
done()
|
}
|
})
|
}
|
})
|
|
function parseClip(str, element) {
|
var outerWidth = element.outerWidth(),
|
outerHeight = element.outerHeight(),
|
clipRegex =
|
/^rect\((-?\d*\.?\d*px|-?\d+%|auto),?\s*(-?\d*\.?\d*px|-?\d+%|auto),?\s*(-?\d*\.?\d*px|-?\d+%|auto),?\s*(-?\d*\.?\d*px|-?\d+%|auto)\)$/,
|
values = clipRegex.exec(str) || ['', 0, outerWidth, outerHeight, 0]
|
|
return {
|
top: parseFloat(values[1]) || 0,
|
right: values[2] === 'auto' ? outerWidth : parseFloat(values[2]),
|
bottom: values[3] === 'auto' ? outerHeight : parseFloat(values[3]),
|
left: parseFloat(values[4]) || 0
|
}
|
}
|
|
$.fx.step.clip = function (fx) {
|
if (!fx.clipInit) {
|
fx.start = $(fx.elem).cssClip()
|
if (typeof fx.end === 'string') {
|
fx.end = parseClip(fx.end, fx.elem)
|
}
|
fx.clipInit = true
|
}
|
|
$(fx.elem).cssClip({
|
top: fx.pos * (fx.end.top - fx.start.top) + fx.start.top,
|
right: fx.pos * (fx.end.right - fx.start.right) + fx.start.right,
|
bottom: fx.pos * (fx.end.bottom - fx.start.bottom) + fx.start.bottom,
|
left: fx.pos * (fx.end.left - fx.start.left) + fx.start.left
|
})
|
}
|
})()
|
|
/******************************************************************************/
|
/*********************************** EASING ***********************************/
|
/******************************************************************************/
|
|
;(function () {
|
// Based on easing equations from Robert Penner (http://www.robertpenner.com/easing)
|
|
var baseEasings = {}
|
|
$.each(['Quad', 'Cubic', 'Quart', 'Quint', 'Expo'], function (i, name) {
|
baseEasings[name] = function (p) {
|
return Math.pow(p, i + 2)
|
}
|
})
|
|
$.extend(baseEasings, {
|
Sine: function (p) {
|
return 1 - Math.cos((p * Math.PI) / 2)
|
},
|
Circ: function (p) {
|
return 1 - Math.sqrt(1 - p * p)
|
},
|
Elastic: function (p) {
|
return p === 0 || p === 1
|
? p
|
: -Math.pow(2, 8 * (p - 1)) * Math.sin((((p - 1) * 80 - 7.5) * Math.PI) / 15)
|
},
|
Back: function (p) {
|
return p * p * (3 * p - 2)
|
},
|
Bounce: function (p) {
|
var pow2,
|
bounce = 4
|
|
while (p < ((pow2 = Math.pow(2, --bounce)) - 1) / 11) {}
|
return 1 / Math.pow(4, 3 - bounce) - 7.5625 * Math.pow((pow2 * 3 - 2) / 22 - p, 2)
|
}
|
})
|
|
$.each(baseEasings, function (name, easeIn) {
|
$.easing['easeIn' + name] = easeIn
|
$.easing['easeOut' + name] = function (p) {
|
return 1 - easeIn(1 - p)
|
}
|
$.easing['easeInOut' + name] = function (p) {
|
return p < 0.5 ? easeIn(p * 2) / 2 : 1 - easeIn(p * -2 + 2) / 2
|
}
|
})
|
})()
|
|
var effect = $.effects
|
|
/*!
|
* jQuery UI Effects Blind 1.12.1
|
* http://jqueryui.com
|
*
|
* Copyright jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*/
|
|
//>>label: Blind Effect
|
//>>group: Effects
|
//>>description: Blinds the element.
|
//>>docs: http://api.jqueryui.com/blind-effect/
|
//>>demos: http://jqueryui.com/effect/
|
|
var effectsEffectBlind = $.effects.define('blind', 'hide', function (options, done) {
|
var map = {
|
up: ['bottom', 'top'],
|
vertical: ['bottom', 'top'],
|
down: ['top', 'bottom'],
|
left: ['right', 'left'],
|
horizontal: ['right', 'left'],
|
right: ['left', 'right']
|
},
|
element = $(this),
|
direction = options.direction || 'up',
|
start = element.cssClip(),
|
animate = { clip: $.extend({}, start) },
|
placeholder = $.effects.createPlaceholder(element)
|
|
animate.clip[map[direction][0]] = animate.clip[map[direction][1]]
|
|
if (options.mode === 'show') {
|
element.cssClip(animate.clip)
|
if (placeholder) {
|
placeholder.css($.effects.clipToBox(animate))
|
}
|
|
animate.clip = start
|
}
|
|
if (placeholder) {
|
placeholder.animate($.effects.clipToBox(animate), options.duration, options.easing)
|
}
|
|
element.animate(animate, {
|
queue: false,
|
duration: options.duration,
|
easing: options.easing,
|
complete: done
|
})
|
})
|
|
/*!
|
* jQuery UI Effects Bounce 1.12.1
|
* http://jqueryui.com
|
*
|
* Copyright jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*/
|
|
//>>label: Bounce Effect
|
//>>group: Effects
|
//>>description: Bounces an element horizontally or vertically n times.
|
//>>docs: http://api.jqueryui.com/bounce-effect/
|
//>>demos: http://jqueryui.com/effect/
|
|
var effectsEffectBounce = $.effects.define('bounce', function (options, done) {
|
var upAnim,
|
downAnim,
|
refValue,
|
element = $(this),
|
// Defaults:
|
mode = options.mode,
|
hide = mode === 'hide',
|
show = mode === 'show',
|
direction = options.direction || 'up',
|
distance = options.distance,
|
times = options.times || 5,
|
// Number of internal animations
|
anims = times * 2 + (show || hide ? 1 : 0),
|
speed = options.duration / anims,
|
easing = options.easing,
|
// Utility:
|
ref = direction === 'up' || direction === 'down' ? 'top' : 'left',
|
motion = direction === 'up' || direction === 'left',
|
i = 0,
|
queuelen = element.queue().length
|
|
$.effects.createPlaceholder(element)
|
|
refValue = element.css(ref)
|
|
// Default distance for the BIGGEST bounce is the outer Distance / 3
|
if (!distance) {
|
distance = element[ref === 'top' ? 'outerHeight' : 'outerWidth']() / 3
|
}
|
|
if (show) {
|
downAnim = { opacity: 1 }
|
downAnim[ref] = refValue
|
|
// If we are showing, force opacity 0 and set the initial position
|
// then do the "first" animation
|
element
|
.css('opacity', 0)
|
.css(ref, motion ? -distance * 2 : distance * 2)
|
.animate(downAnim, speed, easing)
|
}
|
|
// Start at the smallest distance if we are hiding
|
if (hide) {
|
distance = distance / Math.pow(2, times - 1)
|
}
|
|
downAnim = {}
|
downAnim[ref] = refValue
|
|
// Bounces up/down/left/right then back to 0 -- times * 2 animations happen here
|
for (; i < times; i++) {
|
upAnim = {}
|
upAnim[ref] = (motion ? '-=' : '+=') + distance
|
|
element.animate(upAnim, speed, easing).animate(downAnim, speed, easing)
|
|
distance = hide ? distance * 2 : distance / 2
|
}
|
|
// Last Bounce when Hiding
|
if (hide) {
|
upAnim = { opacity: 0 }
|
upAnim[ref] = (motion ? '-=' : '+=') + distance
|
|
element.animate(upAnim, speed, easing)
|
}
|
|
element.queue(done)
|
|
$.effects.unshift(element, queuelen, anims + 1)
|
})
|
|
/*!
|
* jQuery UI Effects Clip 1.12.1
|
* http://jqueryui.com
|
*
|
* Copyright jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*/
|
|
//>>label: Clip Effect
|
//>>group: Effects
|
//>>description: Clips the element on and off like an old TV.
|
//>>docs: http://api.jqueryui.com/clip-effect/
|
//>>demos: http://jqueryui.com/effect/
|
|
var effectsEffectClip = $.effects.define('clip', 'hide', function (options, done) {
|
var start,
|
animate = {},
|
element = $(this),
|
direction = options.direction || 'vertical',
|
both = direction === 'both',
|
horizontal = both || direction === 'horizontal',
|
vertical = both || direction === 'vertical'
|
|
start = element.cssClip()
|
animate.clip = {
|
top: vertical ? (start.bottom - start.top) / 2 : start.top,
|
right: horizontal ? (start.right - start.left) / 2 : start.right,
|
bottom: vertical ? (start.bottom - start.top) / 2 : start.bottom,
|
left: horizontal ? (start.right - start.left) / 2 : start.left
|
}
|
|
$.effects.createPlaceholder(element)
|
|
if (options.mode === 'show') {
|
element.cssClip(animate.clip)
|
animate.clip = start
|
}
|
|
element.animate(animate, {
|
queue: false,
|
duration: options.duration,
|
easing: options.easing,
|
complete: done
|
})
|
})
|
|
/*!
|
* jQuery UI Effects Drop 1.12.1
|
* http://jqueryui.com
|
*
|
* Copyright jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*/
|
|
//>>label: Drop Effect
|
//>>group: Effects
|
//>>description: Moves an element in one direction and hides it at the same time.
|
//>>docs: http://api.jqueryui.com/drop-effect/
|
//>>demos: http://jqueryui.com/effect/
|
|
var effectsEffectDrop = $.effects.define('drop', 'hide', function (options, done) {
|
var distance,
|
element = $(this),
|
mode = options.mode,
|
show = mode === 'show',
|
direction = options.direction || 'left',
|
ref = direction === 'up' || direction === 'down' ? 'top' : 'left',
|
motion = direction === 'up' || direction === 'left' ? '-=' : '+=',
|
oppositeMotion = motion === '+=' ? '-=' : '+=',
|
animation = {
|
opacity: 0
|
}
|
|
$.effects.createPlaceholder(element)
|
|
distance = options.distance || element[ref === 'top' ? 'outerHeight' : 'outerWidth'](true) / 2
|
|
animation[ref] = motion + distance
|
|
if (show) {
|
element.css(animation)
|
|
animation[ref] = oppositeMotion + distance
|
animation.opacity = 1
|
}
|
|
// Animate
|
element.animate(animation, {
|
queue: false,
|
duration: options.duration,
|
easing: options.easing,
|
complete: done
|
})
|
})
|
|
/*!
|
* jQuery UI Effects Explode 1.12.1
|
* http://jqueryui.com
|
*
|
* Copyright jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*/
|
|
//>>label: Explode Effect
|
//>>group: Effects
|
// jscs:disable maximumLineLength
|
//>>description: Explodes an element in all directions into n pieces. Implodes an element to its original wholeness.
|
// jscs:enable maximumLineLength
|
//>>docs: http://api.jqueryui.com/explode-effect/
|
//>>demos: http://jqueryui.com/effect/
|
|
var effectsEffectExplode = $.effects.define('explode', 'hide', function (options, done) {
|
var i,
|
j,
|
left,
|
top,
|
mx,
|
my,
|
rows = options.pieces ? Math.round(Math.sqrt(options.pieces)) : 3,
|
cells = rows,
|
element = $(this),
|
mode = options.mode,
|
show = mode === 'show',
|
// Show and then visibility:hidden the element before calculating offset
|
offset = element.show().css('visibility', 'hidden').offset(),
|
// Width and height of a piece
|
width = Math.ceil(element.outerWidth() / cells),
|
height = Math.ceil(element.outerHeight() / rows),
|
pieces = []
|
|
// Children animate complete:
|
function childComplete() {
|
pieces.push(this)
|
if (pieces.length === rows * cells) {
|
animComplete()
|
}
|
}
|
|
// Clone the element for each row and cell.
|
for (i = 0; i < rows; i++) {
|
// ===>
|
top = offset.top + i * height
|
my = i - (rows - 1) / 2
|
|
for (j = 0; j < cells; j++) {
|
// |||
|
left = offset.left + j * width
|
mx = j - (cells - 1) / 2
|
|
// Create a clone of the now hidden main element that will be absolute positioned
|
// within a wrapper div off the -left and -top equal to size of our pieces
|
element
|
.clone()
|
.appendTo('body')
|
.wrap('<div></div>')
|
.css({
|
position: 'absolute',
|
visibility: 'visible',
|
left: -j * width,
|
top: -i * height
|
})
|
|
// Select the wrapper - make it overflow: hidden and absolute positioned based on
|
// where the original was located +left and +top equal to the size of pieces
|
.parent()
|
.addClass('ui-effects-explode')
|
.css({
|
position: 'absolute',
|
overflow: 'hidden',
|
width: width,
|
height: height,
|
left: left + (show ? mx * width : 0),
|
top: top + (show ? my * height : 0),
|
opacity: show ? 0 : 1
|
})
|
.animate(
|
{
|
left: left + (show ? 0 : mx * width),
|
top: top + (show ? 0 : my * height),
|
opacity: show ? 1 : 0
|
},
|
options.duration || 500,
|
options.easing,
|
childComplete
|
)
|
}
|
}
|
|
function animComplete() {
|
element.css({
|
visibility: 'visible'
|
})
|
$(pieces).remove()
|
done()
|
}
|
})
|
|
/*!
|
* jQuery UI Effects Fade 1.12.1
|
* http://jqueryui.com
|
*
|
* Copyright jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*/
|
|
//>>label: Fade Effect
|
//>>group: Effects
|
//>>description: Fades the element.
|
//>>docs: http://api.jqueryui.com/fade-effect/
|
//>>demos: http://jqueryui.com/effect/
|
|
var effectsEffectFade = $.effects.define('fade', 'toggle', function (options, done) {
|
var show = options.mode === 'show'
|
|
$(this)
|
.css('opacity', show ? 0 : 1)
|
.animate(
|
{
|
opacity: show ? 1 : 0
|
},
|
{
|
queue: false,
|
duration: options.duration,
|
easing: options.easing,
|
complete: done
|
}
|
)
|
})
|
|
/*!
|
* jQuery UI Effects Fold 1.12.1
|
* http://jqueryui.com
|
*
|
* Copyright jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*/
|
|
//>>label: Fold Effect
|
//>>group: Effects
|
//>>description: Folds an element first horizontally and then vertically.
|
//>>docs: http://api.jqueryui.com/fold-effect/
|
//>>demos: http://jqueryui.com/effect/
|
|
var effectsEffectFold = $.effects.define('fold', 'hide', function (options, done) {
|
// Create element
|
var element = $(this),
|
mode = options.mode,
|
show = mode === 'show',
|
hide = mode === 'hide',
|
size = options.size || 15,
|
percent = /([0-9]+)%/.exec(size),
|
horizFirst = !!options.horizFirst,
|
ref = horizFirst ? ['right', 'bottom'] : ['bottom', 'right'],
|
duration = options.duration / 2,
|
placeholder = $.effects.createPlaceholder(element),
|
start = element.cssClip(),
|
animation1 = { clip: $.extend({}, start) },
|
animation2 = { clip: $.extend({}, start) },
|
distance = [start[ref[0]], start[ref[1]]],
|
queuelen = element.queue().length
|
|
if (percent) {
|
size = (parseInt(percent[1], 10) / 100) * distance[hide ? 0 : 1]
|
}
|
animation1.clip[ref[0]] = size
|
animation2.clip[ref[0]] = size
|
animation2.clip[ref[1]] = 0
|
|
if (show) {
|
element.cssClip(animation2.clip)
|
if (placeholder) {
|
placeholder.css($.effects.clipToBox(animation2))
|
}
|
|
animation2.clip = start
|
}
|
|
// Animate
|
element
|
.queue(function (next) {
|
if (placeholder) {
|
placeholder
|
.animate($.effects.clipToBox(animation1), duration, options.easing)
|
.animate($.effects.clipToBox(animation2), duration, options.easing)
|
}
|
|
next()
|
})
|
.animate(animation1, duration, options.easing)
|
.animate(animation2, duration, options.easing)
|
.queue(done)
|
|
$.effects.unshift(element, queuelen, 4)
|
})
|
|
/*!
|
* jQuery UI Effects Highlight 1.12.1
|
* http://jqueryui.com
|
*
|
* Copyright jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*/
|
|
//>>label: Highlight Effect
|
//>>group: Effects
|
//>>description: Highlights the background of an element in a defined color for a custom duration.
|
//>>docs: http://api.jqueryui.com/highlight-effect/
|
//>>demos: http://jqueryui.com/effect/
|
|
var effectsEffectHighlight = $.effects.define('highlight', 'show', function (options, done) {
|
var element = $(this),
|
animation = {
|
backgroundColor: element.css('backgroundColor')
|
}
|
|
if (options.mode === 'hide') {
|
animation.opacity = 0
|
}
|
|
$.effects.saveStyle(element)
|
|
element
|
.css({
|
backgroundImage: 'none',
|
backgroundColor: options.color || '#ffff99'
|
})
|
.animate(animation, {
|
queue: false,
|
duration: options.duration,
|
easing: options.easing,
|
complete: done
|
})
|
})
|
|
/*!
|
* jQuery UI Effects Size 1.12.1
|
* http://jqueryui.com
|
*
|
* Copyright jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*/
|
|
//>>label: Size Effect
|
//>>group: Effects
|
//>>description: Resize an element to a specified width and height.
|
//>>docs: http://api.jqueryui.com/size-effect/
|
//>>demos: http://jqueryui.com/effect/
|
|
var effectsEffectSize = $.effects.define('size', function (options, done) {
|
// Create element
|
var baseline,
|
factor,
|
temp,
|
element = $(this),
|
// Copy for children
|
cProps = ['fontSize'],
|
vProps = ['borderTopWidth', 'borderBottomWidth', 'paddingTop', 'paddingBottom'],
|
hProps = ['borderLeftWidth', 'borderRightWidth', 'paddingLeft', 'paddingRight'],
|
// Set options
|
mode = options.mode,
|
restore = mode !== 'effect',
|
scale = options.scale || 'both',
|
origin = options.origin || ['middle', 'center'],
|
position = element.css('position'),
|
pos = element.position(),
|
original = $.effects.scaledDimensions(element),
|
from = options.from || original,
|
to = options.to || $.effects.scaledDimensions(element, 0)
|
|
$.effects.createPlaceholder(element)
|
|
if (mode === 'show') {
|
temp = from
|
from = to
|
to = temp
|
}
|
|
// Set scaling factor
|
factor = {
|
from: {
|
y: from.height / original.height,
|
x: from.width / original.width
|
},
|
to: {
|
y: to.height / original.height,
|
x: to.width / original.width
|
}
|
}
|
|
// Scale the css box
|
if (scale === 'box' || scale === 'both') {
|
// Vertical props scaling
|
if (factor.from.y !== factor.to.y) {
|
from = $.effects.setTransition(element, vProps, factor.from.y, from)
|
to = $.effects.setTransition(element, vProps, factor.to.y, to)
|
}
|
|
// Horizontal props scaling
|
if (factor.from.x !== factor.to.x) {
|
from = $.effects.setTransition(element, hProps, factor.from.x, from)
|
to = $.effects.setTransition(element, hProps, factor.to.x, to)
|
}
|
}
|
|
// Scale the content
|
if (scale === 'content' || scale === 'both') {
|
// Vertical props scaling
|
if (factor.from.y !== factor.to.y) {
|
from = $.effects.setTransition(element, cProps, factor.from.y, from)
|
to = $.effects.setTransition(element, cProps, factor.to.y, to)
|
}
|
}
|
|
// Adjust the position properties based on the provided origin points
|
if (origin) {
|
baseline = $.effects.getBaseline(origin, original)
|
from.top = (original.outerHeight - from.outerHeight) * baseline.y + pos.top
|
from.left = (original.outerWidth - from.outerWidth) * baseline.x + pos.left
|
to.top = (original.outerHeight - to.outerHeight) * baseline.y + pos.top
|
to.left = (original.outerWidth - to.outerWidth) * baseline.x + pos.left
|
}
|
element.css(from)
|
|
// Animate the children if desired
|
if (scale === 'content' || scale === 'both') {
|
vProps = vProps.concat(['marginTop', 'marginBottom']).concat(cProps)
|
hProps = hProps.concat(['marginLeft', 'marginRight'])
|
|
// Only animate children with width attributes specified
|
// TODO: is this right? should we include anything with css width specified as well
|
element.find('*[width]').each(function () {
|
var child = $(this),
|
childOriginal = $.effects.scaledDimensions(child),
|
childFrom = {
|
height: childOriginal.height * factor.from.y,
|
width: childOriginal.width * factor.from.x,
|
outerHeight: childOriginal.outerHeight * factor.from.y,
|
outerWidth: childOriginal.outerWidth * factor.from.x
|
},
|
childTo = {
|
height: childOriginal.height * factor.to.y,
|
width: childOriginal.width * factor.to.x,
|
outerHeight: childOriginal.height * factor.to.y,
|
outerWidth: childOriginal.width * factor.to.x
|
}
|
|
// Vertical props scaling
|
if (factor.from.y !== factor.to.y) {
|
childFrom = $.effects.setTransition(child, vProps, factor.from.y, childFrom)
|
childTo = $.effects.setTransition(child, vProps, factor.to.y, childTo)
|
}
|
|
// Horizontal props scaling
|
if (factor.from.x !== factor.to.x) {
|
childFrom = $.effects.setTransition(child, hProps, factor.from.x, childFrom)
|
childTo = $.effects.setTransition(child, hProps, factor.to.x, childTo)
|
}
|
|
if (restore) {
|
$.effects.saveStyle(child)
|
}
|
|
// Animate children
|
child.css(childFrom)
|
child.animate(childTo, options.duration, options.easing, function () {
|
// Restore children
|
if (restore) {
|
$.effects.restoreStyle(child)
|
}
|
})
|
})
|
}
|
|
// Animate
|
element.animate(to, {
|
queue: false,
|
duration: options.duration,
|
easing: options.easing,
|
complete: function () {
|
var offset = element.offset()
|
|
if (to.opacity === 0) {
|
element.css('opacity', from.opacity)
|
}
|
|
if (!restore) {
|
element.css('position', position === 'static' ? 'relative' : position).offset(offset)
|
|
// Need to save style here so that automatic style restoration
|
// doesn't restore to the original styles from before the animation.
|
$.effects.saveStyle(element)
|
}
|
|
done()
|
}
|
})
|
})
|
|
/*!
|
* jQuery UI Effects Scale 1.12.1
|
* http://jqueryui.com
|
*
|
* Copyright jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*/
|
|
//>>label: Scale Effect
|
//>>group: Effects
|
//>>description: Grows or shrinks an element and its content.
|
//>>docs: http://api.jqueryui.com/scale-effect/
|
//>>demos: http://jqueryui.com/effect/
|
|
var effectsEffectScale = $.effects.define('scale', function (options, done) {
|
// Create element
|
var el = $(this),
|
mode = options.mode,
|
percent =
|
parseInt(options.percent, 10) ||
|
(parseInt(options.percent, 10) === 0 ? 0 : mode !== 'effect' ? 0 : 100),
|
newOptions = $.extend(
|
true,
|
{
|
from: $.effects.scaledDimensions(el),
|
to: $.effects.scaledDimensions(el, percent, options.direction || 'both'),
|
origin: options.origin || ['middle', 'center']
|
},
|
options
|
)
|
|
// Fade option to support puff
|
if (options.fade) {
|
newOptions.from.opacity = 1
|
newOptions.to.opacity = 0
|
}
|
|
$.effects.effect.size.call(this, newOptions, done)
|
})
|
|
/*!
|
* jQuery UI Effects Puff 1.12.1
|
* http://jqueryui.com
|
*
|
* Copyright jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*/
|
|
//>>label: Puff Effect
|
//>>group: Effects
|
//>>description: Creates a puff effect by scaling the element up and hiding it at the same time.
|
//>>docs: http://api.jqueryui.com/puff-effect/
|
//>>demos: http://jqueryui.com/effect/
|
|
var effectsEffectPuff = $.effects.define('puff', 'hide', function (options, done) {
|
var newOptions = $.extend(true, {}, options, {
|
fade: true,
|
percent: parseInt(options.percent, 10) || 150
|
})
|
|
$.effects.effect.scale.call(this, newOptions, done)
|
})
|
|
/*!
|
* jQuery UI Effects Pulsate 1.12.1
|
* http://jqueryui.com
|
*
|
* Copyright jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*/
|
|
//>>label: Pulsate Effect
|
//>>group: Effects
|
//>>description: Pulsates an element n times by changing the opacity to zero and back.
|
//>>docs: http://api.jqueryui.com/pulsate-effect/
|
//>>demos: http://jqueryui.com/effect/
|
|
var effectsEffectPulsate = $.effects.define('pulsate', 'show', function (options, done) {
|
var element = $(this),
|
mode = options.mode,
|
show = mode === 'show',
|
hide = mode === 'hide',
|
showhide = show || hide,
|
// Showing or hiding leaves off the "last" animation
|
anims = (options.times || 5) * 2 + (showhide ? 1 : 0),
|
duration = options.duration / anims,
|
animateTo = 0,
|
i = 1,
|
queuelen = element.queue().length
|
|
if (show || !element.is(':visible')) {
|
element.css('opacity', 0).show()
|
animateTo = 1
|
}
|
|
// Anims - 1 opacity "toggles"
|
for (; i < anims; i++) {
|
element.animate({ opacity: animateTo }, duration, options.easing)
|
animateTo = 1 - animateTo
|
}
|
|
element.animate({ opacity: animateTo }, duration, options.easing)
|
|
element.queue(done)
|
|
$.effects.unshift(element, queuelen, anims + 1)
|
})
|
|
/*!
|
* jQuery UI Effects Shake 1.12.1
|
* http://jqueryui.com
|
*
|
* Copyright jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*/
|
|
//>>label: Shake Effect
|
//>>group: Effects
|
//>>description: Shakes an element horizontally or vertically n times.
|
//>>docs: http://api.jqueryui.com/shake-effect/
|
//>>demos: http://jqueryui.com/effect/
|
|
var effectsEffectShake = $.effects.define('shake', function (options, done) {
|
var i = 1,
|
element = $(this),
|
direction = options.direction || 'left',
|
distance = options.distance || 20,
|
times = options.times || 3,
|
anims = times * 2 + 1,
|
speed = Math.round(options.duration / anims),
|
ref = direction === 'up' || direction === 'down' ? 'top' : 'left',
|
positiveMotion = direction === 'up' || direction === 'left',
|
animation = {},
|
animation1 = {},
|
animation2 = {},
|
queuelen = element.queue().length
|
|
$.effects.createPlaceholder(element)
|
|
// Animation
|
animation[ref] = (positiveMotion ? '-=' : '+=') + distance
|
animation1[ref] = (positiveMotion ? '+=' : '-=') + distance * 2
|
animation2[ref] = (positiveMotion ? '-=' : '+=') + distance * 2
|
|
// Animate
|
element.animate(animation, speed, options.easing)
|
|
// Shakes
|
for (; i < times; i++) {
|
element.animate(animation1, speed, options.easing).animate(animation2, speed, options.easing)
|
}
|
|
element
|
.animate(animation1, speed, options.easing)
|
.animate(animation, speed / 2, options.easing)
|
.queue(done)
|
|
$.effects.unshift(element, queuelen, anims + 1)
|
})
|
|
/*!
|
* jQuery UI Effects Slide 1.12.1
|
* http://jqueryui.com
|
*
|
* Copyright jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*/
|
|
//>>label: Slide Effect
|
//>>group: Effects
|
//>>description: Slides an element in and out of the viewport.
|
//>>docs: http://api.jqueryui.com/slide-effect/
|
//>>demos: http://jqueryui.com/effect/
|
|
var effectsEffectSlide = $.effects.define('slide', 'show', function (options, done) {
|
var startClip,
|
startRef,
|
element = $(this),
|
map = {
|
up: ['bottom', 'top'],
|
down: ['top', 'bottom'],
|
left: ['right', 'left'],
|
right: ['left', 'right']
|
},
|
mode = options.mode,
|
direction = options.direction || 'left',
|
ref = direction === 'up' || direction === 'down' ? 'top' : 'left',
|
positiveMotion = direction === 'up' || direction === 'left',
|
distance = options.distance || element[ref === 'top' ? 'outerHeight' : 'outerWidth'](true),
|
animation = {}
|
|
$.effects.createPlaceholder(element)
|
|
startClip = element.cssClip()
|
startRef = element.position()[ref]
|
|
// Define hide animation
|
animation[ref] = (positiveMotion ? -1 : 1) * distance + startRef
|
animation.clip = element.cssClip()
|
animation.clip[map[direction][1]] = animation.clip[map[direction][0]]
|
|
// Reverse the animation if we're showing
|
if (mode === 'show') {
|
element.cssClip(animation.clip)
|
element.css(ref, animation[ref])
|
animation.clip = startClip
|
animation[ref] = startRef
|
}
|
|
// Actually animate
|
element.animate(animation, {
|
queue: false,
|
duration: options.duration,
|
easing: options.easing,
|
complete: done
|
})
|
})
|
|
/*!
|
* jQuery UI Effects Transfer 1.12.1
|
* http://jqueryui.com
|
*
|
* Copyright jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*/
|
|
//>>label: Transfer Effect
|
//>>group: Effects
|
//>>description: Displays a transfer effect from one element to another.
|
//>>docs: http://api.jqueryui.com/transfer-effect/
|
//>>demos: http://jqueryui.com/effect/
|
|
var effect
|
if ($.uiBackCompat !== false) {
|
effect = $.effects.define('transfer', function (options, done) {
|
$(this).transfer(options, done)
|
})
|
}
|
var effectsEffectTransfer = effect
|
|
/*!
|
* jQuery UI Focusable 1.12.1
|
* http://jqueryui.com
|
*
|
* Copyright jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*/
|
|
//>>label: :focusable Selector
|
//>>group: Core
|
//>>description: Selects elements which can be focused.
|
//>>docs: http://api.jqueryui.com/focusable-selector/
|
|
// Selectors
|
$.ui.focusable = function (element, hasTabindex) {
|
var map,
|
mapName,
|
img,
|
focusableIfVisible,
|
fieldset,
|
nodeName = element.nodeName.toLowerCase()
|
|
if ('area' === nodeName) {
|
map = element.parentNode
|
mapName = map.name
|
if (!element.href || !mapName || map.nodeName.toLowerCase() !== 'map') {
|
return false
|
}
|
img = $("img[usemap='#" + mapName + "']")
|
return img.length > 0 && img.is(':visible')
|
}
|
|
if (/^(input|select|textarea|button|object)$/.test(nodeName)) {
|
focusableIfVisible = !element.disabled
|
|
if (focusableIfVisible) {
|
// Form controls within a disabled fieldset are disabled.
|
// However, controls within the fieldset's legend do not get disabled.
|
// Since controls generally aren't placed inside legends, we skip
|
// this portion of the check.
|
fieldset = $(element).closest('fieldset')[0]
|
if (fieldset) {
|
focusableIfVisible = !fieldset.disabled
|
}
|
}
|
} else if ('a' === nodeName) {
|
focusableIfVisible = element.href || hasTabindex
|
} else {
|
focusableIfVisible = hasTabindex
|
}
|
|
return focusableIfVisible && $(element).is(':visible') && visible($(element))
|
}
|
|
// Support: IE 8 only
|
// IE 8 doesn't resolve inherit to visible/hidden for computed values
|
function visible(element) {
|
var visibility = element.css('visibility')
|
while (visibility === 'inherit') {
|
element = element.parent()
|
visibility = element.css('visibility')
|
}
|
return visibility !== 'hidden'
|
}
|
|
$.extend($.expr[':'], {
|
focusable: function (element) {
|
return $.ui.focusable(element, $.attr(element, 'tabindex') != null)
|
}
|
})
|
|
var focusable = $.ui.focusable
|
|
// Support: IE8 Only
|
// IE8 does not support the form attribute and when it is supplied. It overwrites the form prop
|
// with a string, so we need to find the proper form.
|
var form = ($.fn.form = function () {
|
return typeof this[0].form === 'string' ? this.closest('form') : $(this[0].form)
|
})
|
|
/*!
|
* jQuery UI Form Reset Mixin 1.12.1
|
* http://jqueryui.com
|
*
|
* Copyright jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*/
|
|
//>>label: Form Reset Mixin
|
//>>group: Core
|
//>>description: Refresh input widgets when their form is reset
|
//>>docs: http://api.jqueryui.com/form-reset-mixin/
|
|
var formResetMixin = ($.ui.formResetMixin = {
|
_formResetHandler: function () {
|
var form = $(this)
|
|
// Wait for the form reset to actually happen before refreshing
|
setTimeout(function () {
|
var instances = form.data('ui-form-reset-instances')
|
$.each(instances, function () {
|
this.refresh()
|
})
|
})
|
},
|
|
_bindFormResetHandler: function () {
|
this.form = this.element.form()
|
if (!this.form.length) {
|
return
|
}
|
|
var instances = this.form.data('ui-form-reset-instances') || []
|
if (!instances.length) {
|
// We don't use _on() here because we use a single event handler per form
|
this.form.on('reset.ui-form-reset', this._formResetHandler)
|
}
|
instances.push(this)
|
this.form.data('ui-form-reset-instances', instances)
|
},
|
|
_unbindFormResetHandler: function () {
|
if (!this.form.length) {
|
return
|
}
|
|
var instances = this.form.data('ui-form-reset-instances')
|
instances.splice($.inArray(this, instances), 1)
|
if (instances.length) {
|
this.form.data('ui-form-reset-instances', instances)
|
} else {
|
this.form.removeData('ui-form-reset-instances').off('reset.ui-form-reset')
|
}
|
}
|
})
|
|
/*!
|
* jQuery UI Support for jQuery core 1.7.x 1.12.1
|
* http://jqueryui.com
|
*
|
* Copyright jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*
|
*/
|
|
//>>label: jQuery 1.7 Support
|
//>>group: Core
|
//>>description: Support version 1.7.x of jQuery core
|
|
// Support: jQuery 1.7 only
|
// Not a great way to check versions, but since we only support 1.7+ and only
|
// need to detect <1.8, this is a simple check that should suffice. Checking
|
// for "1.7." would be a bit safer, but the version string is 1.7, not 1.7.0
|
// and we'll never reach 1.70.0 (if we do, we certainly won't be supporting
|
// 1.7 anymore). See #11197 for why we're not using feature detection.
|
if ($.fn.jquery.substring(0, 3) === '1.7') {
|
// Setters for .innerWidth(), .innerHeight(), .outerWidth(), .outerHeight()
|
// Unlike jQuery Core 1.8+, these only support numeric values to set the
|
// dimensions in pixels
|
$.each(['Width', 'Height'], function (i, name) {
|
var side = name === 'Width' ? ['Left', 'Right'] : ['Top', 'Bottom'],
|
type = name.toLowerCase(),
|
orig = {
|
innerWidth: $.fn.innerWidth,
|
innerHeight: $.fn.innerHeight,
|
outerWidth: $.fn.outerWidth,
|
outerHeight: $.fn.outerHeight
|
}
|
|
function reduce(elem, size, border, margin) {
|
$.each(side, function () {
|
size -= parseFloat($.css(elem, 'padding' + this)) || 0
|
if (border) {
|
size -= parseFloat($.css(elem, 'border' + this + 'Width')) || 0
|
}
|
if (margin) {
|
size -= parseFloat($.css(elem, 'margin' + this)) || 0
|
}
|
})
|
return size
|
}
|
|
$.fn['inner' + name] = function (size) {
|
if (size === undefined) {
|
return orig['inner' + name].call(this)
|
}
|
|
return this.each(function () {
|
$(this).css(type, reduce(this, size) + 'px')
|
})
|
}
|
|
$.fn['outer' + name] = function (size, margin) {
|
if (typeof size !== 'number') {
|
return orig['outer' + name].call(this, size)
|
}
|
|
return this.each(function () {
|
$(this).css(type, reduce(this, size, true, margin) + 'px')
|
})
|
}
|
})
|
|
$.fn.addBack = function (selector) {
|
return this.add(selector == null ? this.prevObject : this.prevObject.filter(selector))
|
}
|
}
|
|
/*!
|
* jQuery UI Keycode 1.12.1
|
* http://jqueryui.com
|
*
|
* Copyright jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*/
|
|
//>>label: Keycode
|
//>>group: Core
|
//>>description: Provide keycodes as keynames
|
//>>docs: http://api.jqueryui.com/jQuery.ui.keyCode/
|
|
var keycode = ($.ui.keyCode = {
|
BACKSPACE: 8,
|
COMMA: 188,
|
DELETE: 46,
|
DOWN: 40,
|
END: 35,
|
ENTER: 13,
|
ESCAPE: 27,
|
HOME: 36,
|
LEFT: 37,
|
PAGE_DOWN: 34,
|
PAGE_UP: 33,
|
PERIOD: 190,
|
RIGHT: 39,
|
SPACE: 32,
|
TAB: 9,
|
UP: 38
|
})
|
|
// Internal use only
|
var escapeSelector = ($.ui.escapeSelector = (function () {
|
var selectorEscape = /([!"#$%&'()*+,./:;<=>?@[\]^`{|}~])/g
|
return function (selector) {
|
return selector.replace(selectorEscape, '\\$1')
|
}
|
})())
|
|
/*!
|
* jQuery UI Labels 1.12.1
|
* http://jqueryui.com
|
*
|
* Copyright jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*/
|
|
//>>label: labels
|
//>>group: Core
|
//>>description: Find all the labels associated with a given input
|
//>>docs: http://api.jqueryui.com/labels/
|
|
var labels = ($.fn.labels = function () {
|
var ancestor, selector, id, labels, ancestors
|
|
// Check control.labels first
|
if (this[0].labels && this[0].labels.length) {
|
return this.pushStack(this[0].labels)
|
}
|
|
// Support: IE <= 11, FF <= 37, Android <= 2.3 only
|
// Above browsers do not support control.labels. Everything below is to support them
|
// as well as document fragments. control.labels does not work on document fragments
|
labels = this.eq(0).parents('label')
|
|
// Look for the label based on the id
|
id = this.attr('id')
|
if (id) {
|
// We don't search against the document in case the element
|
// is disconnected from the DOM
|
ancestor = this.eq(0).parents().last()
|
|
// Get a full set of top level ancestors
|
ancestors = ancestor.add(ancestor.length ? ancestor.siblings() : this.siblings())
|
|
// Create a selector for the label based on the id
|
selector = "label[for='" + $.ui.escapeSelector(id) + "']"
|
|
labels = labels.add(ancestors.find(selector).addBack(selector))
|
}
|
|
// Return whatever we have found for labels
|
return this.pushStack(labels)
|
})
|
|
/*!
|
* jQuery UI Scroll Parent 1.12.1
|
* http://jqueryui.com
|
*
|
* Copyright jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*/
|
|
//>>label: scrollParent
|
//>>group: Core
|
//>>description: Get the closest ancestor element that is scrollable.
|
//>>docs: http://api.jqueryui.com/scrollParent/
|
|
var scrollParent = ($.fn.scrollParent = function (includeHidden) {
|
var position = this.css('position'),
|
excludeStaticParent = position === 'absolute',
|
overflowRegex = includeHidden ? /(auto|scroll|hidden)/ : /(auto|scroll)/,
|
scrollParent = this.parents()
|
.filter(function () {
|
var parent = $(this)
|
if (excludeStaticParent && parent.css('position') === 'static') {
|
return false
|
}
|
return overflowRegex.test(
|
parent.css('overflow') + parent.css('overflow-y') + parent.css('overflow-x')
|
)
|
})
|
.eq(0)
|
|
return position === 'fixed' || !scrollParent.length
|
? $(this[0].ownerDocument || document)
|
: scrollParent
|
})
|
|
/*!
|
* jQuery UI Tabbable 1.12.1
|
* http://jqueryui.com
|
*
|
* Copyright jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*/
|
|
//>>label: :tabbable Selector
|
//>>group: Core
|
//>>description: Selects elements which can be tabbed to.
|
//>>docs: http://api.jqueryui.com/tabbable-selector/
|
|
var tabbable = $.extend($.expr[':'], {
|
tabbable: function (element) {
|
var tabIndex = $.attr(element, 'tabindex'),
|
hasTabindex = tabIndex != null
|
return (!hasTabindex || tabIndex >= 0) && $.ui.focusable(element, hasTabindex)
|
}
|
})
|
|
/*!
|
* jQuery UI Unique ID 1.12.1
|
* http://jqueryui.com
|
*
|
* Copyright jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*/
|
|
//>>label: uniqueId
|
//>>group: Core
|
//>>description: Functions to generate and remove uniqueId's
|
//>>docs: http://api.jqueryui.com/uniqueId/
|
|
var uniqueId = $.fn.extend({
|
uniqueId: (function () {
|
var uuid = 0
|
|
return function () {
|
return this.each(function () {
|
if (!this.id) {
|
this.id = 'ui-id-' + ++uuid
|
}
|
})
|
}
|
})(),
|
|
removeUniqueId: function () {
|
return this.each(function () {
|
if (/^ui-id-\d+$/.test(this.id)) {
|
$(this).removeAttr('id')
|
}
|
})
|
}
|
})
|
|
/*!
|
* jQuery UI Accordion 1.12.1
|
* http://jqueryui.com
|
*
|
* Copyright jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*/
|
|
//>>label: Accordion
|
//>>group: Widgets
|
// jscs:disable maximumLineLength
|
//>>description: Displays collapsible content panels for presenting information in a limited amount of space.
|
// jscs:enable maximumLineLength
|
//>>docs: http://api.jqueryui.com/accordion/
|
//>>demos: http://jqueryui.com/accordion/
|
//>>css.structure: ../../themes/base/core.css
|
//>>css.structure: ../../themes/base/accordion.css
|
//>>css.theme: ../../themes/base/theme.css
|
|
var widgetsAccordion = $.widget('ui.accordion', {
|
version: '1.12.1',
|
options: {
|
active: 0,
|
animate: {},
|
classes: {
|
'ui-accordion-header': 'ui-corner-top',
|
'ui-accordion-header-collapsed': 'ui-corner-all',
|
'ui-accordion-content': 'ui-corner-bottom'
|
},
|
collapsible: false,
|
event: 'click',
|
header: '> li > :first-child, > :not(li):even',
|
heightStyle: 'auto',
|
icons: {
|
activeHeader: 'ui-icon-triangle-1-s',
|
header: 'ui-icon-triangle-1-e'
|
},
|
|
// Callbacks
|
activate: null,
|
beforeActivate: null
|
},
|
|
hideProps: {
|
borderTopWidth: 'hide',
|
borderBottomWidth: 'hide',
|
paddingTop: 'hide',
|
paddingBottom: 'hide',
|
height: 'hide'
|
},
|
|
showProps: {
|
borderTopWidth: 'show',
|
borderBottomWidth: 'show',
|
paddingTop: 'show',
|
paddingBottom: 'show',
|
height: 'show'
|
},
|
|
_create: function () {
|
var options = this.options
|
|
this.prevShow = this.prevHide = $()
|
this._addClass('ui-accordion', 'ui-widget ui-helper-reset')
|
this.element.attr('role', 'tablist')
|
|
// Don't allow collapsible: false and active: false / null
|
if (!options.collapsible && (options.active === false || options.active == null)) {
|
options.active = 0
|
}
|
|
this._processPanels()
|
|
// handle negative values
|
if (options.active < 0) {
|
options.active += this.headers.length
|
}
|
this._refresh()
|
},
|
|
_getCreateEventData: function () {
|
return {
|
header: this.active,
|
panel: !this.active.length ? $() : this.active.next()
|
}
|
},
|
|
_createIcons: function () {
|
var icon,
|
children,
|
icons = this.options.icons
|
|
if (icons) {
|
icon = $('<span>')
|
this._addClass(icon, 'ui-accordion-header-icon', 'ui-icon ' + icons.header)
|
icon.prependTo(this.headers)
|
children = this.active.children('.ui-accordion-header-icon')
|
this._removeClass(children, icons.header)
|
._addClass(children, null, icons.activeHeader)
|
._addClass(this.headers, 'ui-accordion-icons')
|
}
|
},
|
|
_destroyIcons: function () {
|
this._removeClass(this.headers, 'ui-accordion-icons')
|
this.headers.children('.ui-accordion-header-icon').remove()
|
},
|
|
_destroy: function () {
|
var contents
|
|
// Clean up main element
|
this.element.removeAttr('role')
|
|
// Clean up headers
|
this.headers
|
.removeAttr('role aria-expanded aria-selected aria-controls tabIndex')
|
.removeUniqueId()
|
|
this._destroyIcons()
|
|
// Clean up content panels
|
contents = this.headers
|
.next()
|
.css('display', '')
|
.removeAttr('role aria-hidden aria-labelledby')
|
.removeUniqueId()
|
|
if (this.options.heightStyle !== 'content') {
|
contents.css('height', '')
|
}
|
},
|
|
_setOption: function (key, value) {
|
if (key === 'active') {
|
// _activate() will handle invalid values and update this.options
|
this._activate(value)
|
return
|
}
|
|
if (key === 'event') {
|
if (this.options.event) {
|
this._off(this.headers, this.options.event)
|
}
|
this._setupEvents(value)
|
}
|
|
this._super(key, value)
|
|
// Setting collapsible: false while collapsed; open first panel
|
if (key === 'collapsible' && !value && this.options.active === false) {
|
this._activate(0)
|
}
|
|
if (key === 'icons') {
|
this._destroyIcons()
|
if (value) {
|
this._createIcons()
|
}
|
}
|
},
|
|
_setOptionDisabled: function (value) {
|
this._super(value)
|
|
this.element.attr('aria-disabled', value)
|
|
// Support: IE8 Only
|
// #5332 / #6059 - opacity doesn't cascade to positioned elements in IE
|
// so we need to add the disabled class to the headers and panels
|
this._toggleClass(null, 'ui-state-disabled', !!value)
|
this._toggleClass(this.headers.add(this.headers.next()), null, 'ui-state-disabled', !!value)
|
},
|
|
_keydown: function (event) {
|
if (event.altKey || event.ctrlKey) {
|
return
|
}
|
|
var keyCode = $.ui.keyCode,
|
length = this.headers.length,
|
currentIndex = this.headers.index(event.target),
|
toFocus = false
|
|
switch (event.keyCode) {
|
case keyCode.RIGHT:
|
case keyCode.DOWN:
|
toFocus = this.headers[(currentIndex + 1) % length]
|
break
|
case keyCode.LEFT:
|
case keyCode.UP:
|
toFocus = this.headers[(currentIndex - 1 + length) % length]
|
break
|
case keyCode.SPACE:
|
case keyCode.ENTER:
|
this._eventHandler(event)
|
break
|
case keyCode.HOME:
|
toFocus = this.headers[0]
|
break
|
case keyCode.END:
|
toFocus = this.headers[length - 1]
|
break
|
}
|
|
if (toFocus) {
|
$(event.target).attr('tabIndex', -1)
|
$(toFocus).attr('tabIndex', 0)
|
$(toFocus).trigger('focus')
|
event.preventDefault()
|
}
|
},
|
|
_panelKeyDown: function (event) {
|
if (event.keyCode === $.ui.keyCode.UP && event.ctrlKey) {
|
$(event.currentTarget).prev().trigger('focus')
|
}
|
},
|
|
refresh: function () {
|
var options = this.options
|
this._processPanels()
|
|
// Was collapsed or no panel
|
if ((options.active === false && options.collapsible === true) || !this.headers.length) {
|
options.active = false
|
this.active = $()
|
|
// active false only when collapsible is true
|
} else if (options.active === false) {
|
this._activate(0)
|
|
// was active, but active panel is gone
|
} else if (this.active.length && !$.contains(this.element[0], this.active[0])) {
|
// all remaining panel are disabled
|
if (this.headers.length === this.headers.find('.ui-state-disabled').length) {
|
options.active = false
|
this.active = $()
|
|
// activate previous panel
|
} else {
|
this._activate(Math.max(0, options.active - 1))
|
}
|
|
// was active, active panel still exists
|
} else {
|
// make sure active index is correct
|
options.active = this.headers.index(this.active)
|
}
|
|
this._destroyIcons()
|
|
this._refresh()
|
},
|
|
_processPanels: function () {
|
var prevHeaders = this.headers,
|
prevPanels = this.panels
|
|
this.headers = this.element.find(this.options.header)
|
this._addClass(
|
this.headers,
|
'ui-accordion-header ui-accordion-header-collapsed',
|
'ui-state-default'
|
)
|
|
this.panels = this.headers.next().filter(':not(.ui-accordion-content-active)').hide()
|
this._addClass(this.panels, 'ui-accordion-content', 'ui-helper-reset ui-widget-content')
|
|
// Avoid memory leaks (#10056)
|
if (prevPanels) {
|
this._off(prevHeaders.not(this.headers))
|
this._off(prevPanels.not(this.panels))
|
}
|
},
|
|
_refresh: function () {
|
var maxHeight,
|
options = this.options,
|
heightStyle = options.heightStyle,
|
parent = this.element.parent()
|
|
this.active = this._findActive(options.active)
|
this._addClass(this.active, 'ui-accordion-header-active', 'ui-state-active')._removeClass(
|
this.active,
|
'ui-accordion-header-collapsed'
|
)
|
this._addClass(this.active.next(), 'ui-accordion-content-active')
|
this.active.next().show()
|
|
this.headers
|
.attr('role', 'tab')
|
.each(function () {
|
var header = $(this),
|
headerId = header.uniqueId().attr('id'),
|
panel = header.next(),
|
panelId = panel.uniqueId().attr('id')
|
header.attr('aria-controls', panelId)
|
panel.attr('aria-labelledby', headerId)
|
})
|
.next()
|
.attr('role', 'tabpanel')
|
|
this.headers
|
.not(this.active)
|
.attr({
|
'aria-selected': 'false',
|
'aria-expanded': 'false',
|
tabIndex: -1
|
})
|
.next()
|
.attr({
|
'aria-hidden': 'true'
|
})
|
.hide()
|
|
// Make sure at least one header is in the tab order
|
if (!this.active.length) {
|
this.headers.eq(0).attr('tabIndex', 0)
|
} else {
|
this.active
|
.attr({
|
'aria-selected': 'true',
|
'aria-expanded': 'true',
|
tabIndex: 0
|
})
|
.next()
|
.attr({
|
'aria-hidden': 'false'
|
})
|
}
|
|
this._createIcons()
|
|
this._setupEvents(options.event)
|
|
if (heightStyle === 'fill') {
|
maxHeight = parent.height()
|
this.element.siblings(':visible').each(function () {
|
var elem = $(this),
|
position = elem.css('position')
|
|
if (position === 'absolute' || position === 'fixed') {
|
return
|
}
|
maxHeight -= elem.outerHeight(true)
|
})
|
|
this.headers.each(function () {
|
maxHeight -= $(this).outerHeight(true)
|
})
|
|
this.headers
|
.next()
|
.each(function () {
|
$(this).height(Math.max(0, maxHeight - $(this).innerHeight() + $(this).height()))
|
})
|
.css('overflow', 'auto')
|
} else if (heightStyle === 'auto') {
|
maxHeight = 0
|
this.headers
|
.next()
|
.each(function () {
|
var isVisible = $(this).is(':visible')
|
if (!isVisible) {
|
$(this).show()
|
}
|
maxHeight = Math.max(maxHeight, $(this).css('height', '').height())
|
if (!isVisible) {
|
$(this).hide()
|
}
|
})
|
.height(maxHeight)
|
}
|
},
|
|
_activate: function (index) {
|
var active = this._findActive(index)[0]
|
|
// Trying to activate the already active panel
|
if (active === this.active[0]) {
|
return
|
}
|
|
// Trying to collapse, simulate a click on the currently active header
|
active = active || this.active[0]
|
|
this._eventHandler({
|
target: active,
|
currentTarget: active,
|
preventDefault: $.noop
|
})
|
},
|
|
_findActive: function (selector) {
|
return typeof selector === 'number' ? this.headers.eq(selector) : $()
|
},
|
|
_setupEvents: function (event) {
|
var events = {
|
keydown: '_keydown'
|
}
|
if (event) {
|
$.each(event.split(' '), function (index, eventName) {
|
events[eventName] = '_eventHandler'
|
})
|
}
|
|
this._off(this.headers.add(this.headers.next()))
|
this._on(this.headers, events)
|
this._on(this.headers.next(), { keydown: '_panelKeyDown' })
|
this._hoverable(this.headers)
|
this._focusable(this.headers)
|
},
|
|
_eventHandler: function (event) {
|
var activeChildren,
|
clickedChildren,
|
options = this.options,
|
active = this.active,
|
clicked = $(event.currentTarget),
|
clickedIsActive = clicked[0] === active[0],
|
collapsing = clickedIsActive && options.collapsible,
|
toShow = collapsing ? $() : clicked.next(),
|
toHide = active.next(),
|
eventData = {
|
oldHeader: active,
|
oldPanel: toHide,
|
newHeader: collapsing ? $() : clicked,
|
newPanel: toShow
|
}
|
|
event.preventDefault()
|
|
if (
|
// click on active header, but not collapsible
|
(clickedIsActive && !options.collapsible) ||
|
// allow canceling activation
|
this._trigger('beforeActivate', event, eventData) === false
|
) {
|
return
|
}
|
|
options.active = collapsing ? false : this.headers.index(clicked)
|
|
// When the call to ._toggle() comes after the class changes
|
// it causes a very odd bug in IE 8 (see #6720)
|
this.active = clickedIsActive ? $() : clicked
|
this._toggle(eventData)
|
|
// Switch classes
|
// corner classes on the previously active header stay after the animation
|
this._removeClass(active, 'ui-accordion-header-active', 'ui-state-active')
|
if (options.icons) {
|
activeChildren = active.children('.ui-accordion-header-icon')
|
this._removeClass(activeChildren, null, options.icons.activeHeader)._addClass(
|
activeChildren,
|
null,
|
options.icons.header
|
)
|
}
|
|
if (!clickedIsActive) {
|
this._removeClass(clicked, 'ui-accordion-header-collapsed')._addClass(
|
clicked,
|
'ui-accordion-header-active',
|
'ui-state-active'
|
)
|
if (options.icons) {
|
clickedChildren = clicked.children('.ui-accordion-header-icon')
|
this._removeClass(clickedChildren, null, options.icons.header)._addClass(
|
clickedChildren,
|
null,
|
options.icons.activeHeader
|
)
|
}
|
|
this._addClass(clicked.next(), 'ui-accordion-content-active')
|
}
|
},
|
|
_toggle: function (data) {
|
var toShow = data.newPanel,
|
toHide = this.prevShow.length ? this.prevShow : data.oldPanel
|
|
// Handle activating a panel during the animation for another activation
|
this.prevShow.add(this.prevHide).stop(true, true)
|
this.prevShow = toShow
|
this.prevHide = toHide
|
|
if (this.options.animate) {
|
this._animate(toShow, toHide, data)
|
} else {
|
toHide.hide()
|
toShow.show()
|
this._toggleComplete(data)
|
}
|
|
toHide.attr({
|
'aria-hidden': 'true'
|
})
|
toHide.prev().attr({
|
'aria-selected': 'false',
|
'aria-expanded': 'false'
|
})
|
|
// if we're switching panels, remove the old header from the tab order
|
// if we're opening from collapsed state, remove the previous header from the tab order
|
// if we're collapsing, then keep the collapsing header in the tab order
|
if (toShow.length && toHide.length) {
|
toHide.prev().attr({
|
tabIndex: -1,
|
'aria-expanded': 'false'
|
})
|
} else if (toShow.length) {
|
this.headers
|
.filter(function () {
|
return parseInt($(this).attr('tabIndex'), 10) === 0
|
})
|
.attr('tabIndex', -1)
|
}
|
|
toShow.attr('aria-hidden', 'false').prev().attr({
|
'aria-selected': 'true',
|
'aria-expanded': 'true',
|
tabIndex: 0
|
})
|
},
|
|
_animate: function (toShow, toHide, data) {
|
var total,
|
easing,
|
duration,
|
that = this,
|
adjust = 0,
|
boxSizing = toShow.css('box-sizing'),
|
down = toShow.length && (!toHide.length || toShow.index() < toHide.index()),
|
animate = this.options.animate || {},
|
options = (down && animate.down) || animate,
|
complete = function () {
|
that._toggleComplete(data)
|
}
|
|
if (typeof options === 'number') {
|
duration = options
|
}
|
if (typeof options === 'string') {
|
easing = options
|
}
|
|
// fall back from options to animation in case of partial down settings
|
easing = easing || options.easing || animate.easing
|
duration = duration || options.duration || animate.duration
|
|
if (!toHide.length) {
|
return toShow.animate(this.showProps, duration, easing, complete)
|
}
|
if (!toShow.length) {
|
return toHide.animate(this.hideProps, duration, easing, complete)
|
}
|
|
total = toShow.show().outerHeight()
|
toHide.animate(this.hideProps, {
|
duration: duration,
|
easing: easing,
|
step: function (now, fx) {
|
fx.now = Math.round(now)
|
}
|
})
|
toShow.hide().animate(this.showProps, {
|
duration: duration,
|
easing: easing,
|
complete: complete,
|
step: function (now, fx) {
|
fx.now = Math.round(now)
|
if (fx.prop !== 'height') {
|
if (boxSizing === 'content-box') {
|
adjust += fx.now
|
}
|
} else if (that.options.heightStyle !== 'content') {
|
fx.now = Math.round(total - toHide.outerHeight() - adjust)
|
adjust = 0
|
}
|
}
|
})
|
},
|
|
_toggleComplete: function (data) {
|
var toHide = data.oldPanel,
|
prev = toHide.prev()
|
|
this._removeClass(toHide, 'ui-accordion-content-active')
|
this._removeClass(prev, 'ui-accordion-header-active')._addClass(
|
prev,
|
'ui-accordion-header-collapsed'
|
)
|
|
// Work around for rendering bug in IE (#5421)
|
if (toHide.length) {
|
toHide.parent()[0].className = toHide.parent()[0].className
|
}
|
this._trigger('activate', null, data)
|
}
|
})
|
|
var safeActiveElement = ($.ui.safeActiveElement = function (document) {
|
var activeElement
|
|
// Support: IE 9 only
|
// IE9 throws an "Unspecified error" accessing document.activeElement from an <iframe>
|
try {
|
activeElement = document.activeElement
|
} catch (error) {
|
activeElement = document.body
|
}
|
|
// Support: IE 9 - 11 only
|
// IE may return null instead of an element
|
// Interestingly, this only seems to occur when NOT in an iframe
|
if (!activeElement) {
|
activeElement = document.body
|
}
|
|
// Support: IE 11 only
|
// IE11 returns a seemingly empty object in some cases when accessing
|
// document.activeElement from an <iframe>
|
if (!activeElement.nodeName) {
|
activeElement = document.body
|
}
|
|
return activeElement
|
})
|
|
/*!
|
* jQuery UI Menu 1.12.1
|
* http://jqueryui.com
|
*
|
* Copyright jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*/
|
|
//>>label: Menu
|
//>>group: Widgets
|
//>>description: Creates nestable menus.
|
//>>docs: http://api.jqueryui.com/menu/
|
//>>demos: http://jqueryui.com/menu/
|
//>>css.structure: ../../themes/base/core.css
|
//>>css.structure: ../../themes/base/menu.css
|
//>>css.theme: ../../themes/base/theme.css
|
|
var widgetsMenu = $.widget('ui.menu', {
|
version: '1.12.1',
|
defaultElement: '<ul>',
|
delay: 300,
|
options: {
|
icons: {
|
submenu: 'ui-icon-caret-1-e'
|
},
|
items: '> *',
|
menus: 'ul',
|
position: {
|
my: 'left top',
|
at: 'right top'
|
},
|
role: 'menu',
|
|
// Callbacks
|
blur: null,
|
focus: null,
|
select: null
|
},
|
|
_create: function () {
|
this.activeMenu = this.element
|
|
// Flag used to prevent firing of the click handler
|
// as the event bubbles up through nested menus
|
this.mouseHandled = false
|
this.element.uniqueId().attr({
|
role: this.options.role,
|
tabIndex: 0
|
})
|
|
this._addClass('ui-menu', 'ui-widget ui-widget-content')
|
this._on({
|
// Prevent focus from sticking to links inside menu after clicking
|
// them (focus should always stay on UL during navigation).
|
'mousedown .ui-menu-item': function (event) {
|
event.preventDefault()
|
},
|
'click .ui-menu-item': function (event) {
|
var target = $(event.target)
|
var active = $($.ui.safeActiveElement(this.document[0]))
|
if (!this.mouseHandled && target.not('.ui-state-disabled').length) {
|
this.select(event)
|
|
// Only set the mouseHandled flag if the event will bubble, see #9469.
|
if (!event.isPropagationStopped()) {
|
this.mouseHandled = true
|
}
|
|
// Open submenu on click
|
if (target.has('.ui-menu').length) {
|
this.expand(event)
|
} else if (!this.element.is(':focus') && active.closest('.ui-menu').length) {
|
// Redirect focus to the menu
|
this.element.trigger('focus', [true])
|
|
// If the active item is on the top level, let it stay active.
|
// Otherwise, blur the active item since it is no longer visible.
|
if (this.active && this.active.parents('.ui-menu').length === 1) {
|
clearTimeout(this.timer)
|
}
|
}
|
}
|
},
|
'mouseenter .ui-menu-item': function (event) {
|
// Ignore mouse events while typeahead is active, see #10458.
|
// Prevents focusing the wrong item when typeahead causes a scroll while the mouse
|
// is over an item in the menu
|
if (this.previousFilter) {
|
return
|
}
|
|
var actualTarget = $(event.target).closest('.ui-menu-item'),
|
target = $(event.currentTarget)
|
|
// Ignore bubbled events on parent items, see #11641
|
if (actualTarget[0] !== target[0]) {
|
return
|
}
|
|
// Remove ui-state-active class from siblings of the newly focused menu item
|
// to avoid a jump caused by adjacent elements both having a class with a border
|
this._removeClass(target.siblings().children('.ui-state-active'), null, 'ui-state-active')
|
this.focus(event, target)
|
},
|
mouseleave: 'collapseAll',
|
'mouseleave .ui-menu': 'collapseAll',
|
focus: function (event, keepActiveItem) {
|
// If there's already an active item, keep it active
|
// If not, activate the first item
|
var item = this.active || this.element.find(this.options.items).eq(0)
|
|
if (!keepActiveItem) {
|
this.focus(event, item)
|
}
|
},
|
blur: function (event) {
|
this._delay(function () {
|
var notContained = !$.contains(
|
this.element[0],
|
$.ui.safeActiveElement(this.document[0])
|
)
|
if (notContained) {
|
this.collapseAll(event)
|
}
|
})
|
},
|
keydown: '_keydown'
|
})
|
|
this.refresh()
|
|
// Clicks outside of a menu collapse any open menus
|
this._on(this.document, {
|
click: function (event) {
|
if (this._closeOnDocumentClick(event)) {
|
this.collapseAll(event)
|
}
|
|
// Reset the mouseHandled flag
|
this.mouseHandled = false
|
}
|
})
|
},
|
|
_destroy: function () {
|
var items = this.element.find('.ui-menu-item').removeAttr('role aria-disabled'),
|
submenus = items
|
.children('.ui-menu-item-wrapper')
|
.removeUniqueId()
|
.removeAttr('tabIndex role aria-haspopup')
|
|
// Destroy (sub)menus
|
this.element
|
.removeAttr('aria-activedescendant')
|
.find('.ui-menu')
|
.addBack()
|
.removeAttr('role aria-labelledby aria-expanded aria-hidden aria-disabled ' + 'tabIndex')
|
.removeUniqueId()
|
.show()
|
|
submenus.children().each(function () {
|
var elem = $(this)
|
if (elem.data('ui-menu-submenu-caret')) {
|
elem.remove()
|
}
|
})
|
},
|
|
_keydown: function (event) {
|
var match,
|
prev,
|
character,
|
skip,
|
preventDefault = true
|
|
switch (event.keyCode) {
|
case $.ui.keyCode.PAGE_UP:
|
this.previousPage(event)
|
break
|
case $.ui.keyCode.PAGE_DOWN:
|
this.nextPage(event)
|
break
|
case $.ui.keyCode.HOME:
|
this._move('first', 'first', event)
|
break
|
case $.ui.keyCode.END:
|
this._move('last', 'last', event)
|
break
|
case $.ui.keyCode.UP:
|
this.previous(event)
|
break
|
case $.ui.keyCode.DOWN:
|
this.next(event)
|
break
|
case $.ui.keyCode.LEFT:
|
this.collapse(event)
|
break
|
case $.ui.keyCode.RIGHT:
|
if (this.active && !this.active.is('.ui-state-disabled')) {
|
this.expand(event)
|
}
|
break
|
case $.ui.keyCode.ENTER:
|
case $.ui.keyCode.SPACE:
|
this._activate(event)
|
break
|
case $.ui.keyCode.ESCAPE:
|
this.collapse(event)
|
break
|
default:
|
preventDefault = false
|
prev = this.previousFilter || ''
|
skip = false
|
|
// Support number pad values
|
character =
|
event.keyCode >= 96 && event.keyCode <= 105
|
? (event.keyCode - 96).toString()
|
: String.fromCharCode(event.keyCode)
|
|
clearTimeout(this.filterTimer)
|
|
if (character === prev) {
|
skip = true
|
} else {
|
character = prev + character
|
}
|
|
match = this._filterMenuItems(character)
|
match =
|
skip && match.index(this.active.next()) !== -1
|
? this.active.nextAll('.ui-menu-item')
|
: match
|
|
// If no matches on the current filter, reset to the last character pressed
|
// to move down the menu to the first item that starts with that character
|
if (!match.length) {
|
character = String.fromCharCode(event.keyCode)
|
match = this._filterMenuItems(character)
|
}
|
|
if (match.length) {
|
this.focus(event, match)
|
this.previousFilter = character
|
this.filterTimer = this._delay(function () {
|
delete this.previousFilter
|
}, 1000)
|
} else {
|
delete this.previousFilter
|
}
|
}
|
|
if (preventDefault) {
|
event.preventDefault()
|
}
|
},
|
|
_activate: function (event) {
|
if (this.active && !this.active.is('.ui-state-disabled')) {
|
if (this.active.children("[aria-haspopup='true']").length) {
|
this.expand(event)
|
} else {
|
this.select(event)
|
}
|
}
|
},
|
|
refresh: function () {
|
var menus,
|
items,
|
newSubmenus,
|
newItems,
|
newWrappers,
|
that = this,
|
icon = this.options.icons.submenu,
|
submenus = this.element.find(this.options.menus)
|
|
this._toggleClass('ui-menu-icons', null, !!this.element.find('.ui-icon').length)
|
|
// Initialize nested menus
|
newSubmenus = submenus
|
.filter(':not(.ui-menu)')
|
.hide()
|
.attr({
|
role: this.options.role,
|
'aria-hidden': 'true',
|
'aria-expanded': 'false'
|
})
|
.each(function () {
|
var menu = $(this),
|
item = menu.prev(),
|
submenuCaret = $('<span>').data('ui-menu-submenu-caret', true)
|
|
that._addClass(submenuCaret, 'ui-menu-icon', 'ui-icon ' + icon)
|
item.attr('aria-haspopup', 'true').prepend(submenuCaret)
|
menu.attr('aria-labelledby', item.attr('id'))
|
})
|
|
this._addClass(newSubmenus, 'ui-menu', 'ui-widget ui-widget-content ui-front')
|
|
menus = submenus.add(this.element)
|
items = menus.find(this.options.items)
|
|
// Initialize menu-items containing spaces and/or dashes only as dividers
|
items.not('.ui-menu-item').each(function () {
|
var item = $(this)
|
if (that._isDivider(item)) {
|
that._addClass(item, 'ui-menu-divider', 'ui-widget-content')
|
}
|
})
|
|
// Don't refresh list items that are already adapted
|
newItems = items.not('.ui-menu-item, .ui-menu-divider')
|
newWrappers = newItems.children().not('.ui-menu').uniqueId().attr({
|
tabIndex: -1,
|
role: this._itemRole()
|
})
|
this._addClass(newItems, 'ui-menu-item')._addClass(newWrappers, 'ui-menu-item-wrapper')
|
|
// Add aria-disabled attribute to any disabled menu item
|
items.filter('.ui-state-disabled').attr('aria-disabled', 'true')
|
|
// If the active item has been removed, blur the menu
|
if (this.active && !$.contains(this.element[0], this.active[0])) {
|
this.blur()
|
}
|
},
|
|
_itemRole: function () {
|
return {
|
menu: 'menuitem',
|
listbox: 'option'
|
}[this.options.role]
|
},
|
|
_setOption: function (key, value) {
|
if (key === 'icons') {
|
var icons = this.element.find('.ui-menu-icon')
|
this._removeClass(icons, null, this.options.icons.submenu)._addClass(
|
icons,
|
null,
|
value.submenu
|
)
|
}
|
this._super(key, value)
|
},
|
|
_setOptionDisabled: function (value) {
|
this._super(value)
|
|
this.element.attr('aria-disabled', String(value))
|
this._toggleClass(null, 'ui-state-disabled', !!value)
|
},
|
|
focus: function (event, item) {
|
var nested, focused, activeParent
|
this.blur(event, event && event.type === 'focus')
|
|
this._scrollIntoView(item)
|
|
this.active = item.first()
|
|
focused = this.active.children('.ui-menu-item-wrapper')
|
this._addClass(focused, null, 'ui-state-active')
|
|
// Only update aria-activedescendant if there's a role
|
// otherwise we assume focus is managed elsewhere
|
if (this.options.role) {
|
this.element.attr('aria-activedescendant', focused.attr('id'))
|
}
|
|
// Highlight active parent menu item, if any
|
activeParent = this.active.parent().closest('.ui-menu-item').children('.ui-menu-item-wrapper')
|
this._addClass(activeParent, null, 'ui-state-active')
|
|
if (event && event.type === 'keydown') {
|
this._close()
|
} else {
|
this.timer = this._delay(function () {
|
this._close()
|
}, this.delay)
|
}
|
|
nested = item.children('.ui-menu')
|
if (nested.length && event && /^mouse/.test(event.type)) {
|
this._startOpening(nested)
|
}
|
this.activeMenu = item.parent()
|
|
this._trigger('focus', event, { item: item })
|
},
|
|
_scrollIntoView: function (item) {
|
var borderTop, paddingTop, offset, scroll, elementHeight, itemHeight
|
if (this._hasScroll()) {
|
borderTop = parseFloat($.css(this.activeMenu[0], 'borderTopWidth')) || 0
|
paddingTop = parseFloat($.css(this.activeMenu[0], 'paddingTop')) || 0
|
offset = item.offset().top - this.activeMenu.offset().top - borderTop - paddingTop
|
scroll = this.activeMenu.scrollTop()
|
elementHeight = this.activeMenu.height()
|
itemHeight = item.outerHeight()
|
|
if (offset < 0) {
|
this.activeMenu.scrollTop(scroll + offset)
|
} else if (offset + itemHeight > elementHeight) {
|
this.activeMenu.scrollTop(scroll + offset - elementHeight + itemHeight)
|
}
|
}
|
},
|
|
blur: function (event, fromFocus) {
|
if (!fromFocus) {
|
clearTimeout(this.timer)
|
}
|
|
if (!this.active) {
|
return
|
}
|
|
this._removeClass(this.active.children('.ui-menu-item-wrapper'), null, 'ui-state-active')
|
|
this._trigger('blur', event, { item: this.active })
|
this.active = null
|
},
|
|
_startOpening: function (submenu) {
|
clearTimeout(this.timer)
|
|
// Don't open if already open fixes a Firefox bug that caused a .5 pixel
|
// shift in the submenu position when mousing over the caret icon
|
if (submenu.attr('aria-hidden') !== 'true') {
|
return
|
}
|
|
this.timer = this._delay(function () {
|
this._close()
|
this._open(submenu)
|
}, this.delay)
|
},
|
|
_open: function (submenu) {
|
var position = $.extend(
|
{
|
of: this.active
|
},
|
this.options.position
|
)
|
|
clearTimeout(this.timer)
|
this.element
|
.find('.ui-menu')
|
.not(submenu.parents('.ui-menu'))
|
.hide()
|
.attr('aria-hidden', 'true')
|
|
submenu.show().removeAttr('aria-hidden').attr('aria-expanded', 'true').position(position)
|
},
|
|
collapseAll: function (event, all) {
|
clearTimeout(this.timer)
|
this.timer = this._delay(function () {
|
// If we were passed an event, look for the submenu that contains the event
|
var currentMenu = all
|
? this.element
|
: $(event && event.target).closest(this.element.find('.ui-menu'))
|
|
// If we found no valid submenu ancestor, use the main menu to close all
|
// sub menus anyway
|
if (!currentMenu.length) {
|
currentMenu = this.element
|
}
|
|
this._close(currentMenu)
|
|
this.blur(event)
|
|
// Work around active item staying active after menu is blurred
|
this._removeClass(currentMenu.find('.ui-state-active'), null, 'ui-state-active')
|
|
this.activeMenu = currentMenu
|
}, this.delay)
|
},
|
|
// With no arguments, closes the currently active menu - if nothing is active
|
// it closes all menus. If passed an argument, it will search for menus BELOW
|
_close: function (startMenu) {
|
if (!startMenu) {
|
startMenu = this.active ? this.active.parent() : this.element
|
}
|
|
startMenu.find('.ui-menu').hide().attr('aria-hidden', 'true').attr('aria-expanded', 'false')
|
},
|
|
_closeOnDocumentClick: function (event) {
|
return !$(event.target).closest('.ui-menu').length
|
},
|
|
_isDivider: function (item) {
|
// Match hyphen, em dash, en dash
|
return !/[^\-\u2014\u2013\s]/.test(item.text())
|
},
|
|
collapse: function (event) {
|
var newItem = this.active && this.active.parent().closest('.ui-menu-item', this.element)
|
if (newItem && newItem.length) {
|
this._close()
|
this.focus(event, newItem)
|
}
|
},
|
|
expand: function (event) {
|
var newItem =
|
this.active && this.active.children('.ui-menu ').find(this.options.items).first()
|
|
if (newItem && newItem.length) {
|
this._open(newItem.parent())
|
|
// Delay so Firefox will not hide activedescendant change in expanding submenu from AT
|
this._delay(function () {
|
this.focus(event, newItem)
|
})
|
}
|
},
|
|
next: function (event) {
|
this._move('next', 'first', event)
|
},
|
|
previous: function (event) {
|
this._move('prev', 'last', event)
|
},
|
|
isFirstItem: function () {
|
return this.active && !this.active.prevAll('.ui-menu-item').length
|
},
|
|
isLastItem: function () {
|
return this.active && !this.active.nextAll('.ui-menu-item').length
|
},
|
|
_move: function (direction, filter, event) {
|
var next
|
if (this.active) {
|
if (direction === 'first' || direction === 'last') {
|
next = this.active[direction === 'first' ? 'prevAll' : 'nextAll']('.ui-menu-item').eq(-1)
|
} else {
|
next = this.active[direction + 'All']('.ui-menu-item').eq(0)
|
}
|
}
|
if (!next || !next.length || !this.active) {
|
next = this.activeMenu.find(this.options.items)[filter]()
|
}
|
|
this.focus(event, next)
|
},
|
|
nextPage: function (event) {
|
var item, base, height
|
|
if (!this.active) {
|
this.next(event)
|
return
|
}
|
if (this.isLastItem()) {
|
return
|
}
|
if (this._hasScroll()) {
|
base = this.active.offset().top
|
height = this.element.height()
|
this.active.nextAll('.ui-menu-item').each(function () {
|
item = $(this)
|
return item.offset().top - base - height < 0
|
})
|
|
this.focus(event, item)
|
} else {
|
this.focus(
|
event,
|
this.activeMenu.find(this.options.items)[!this.active ? 'first' : 'last']()
|
)
|
}
|
},
|
|
previousPage: function (event) {
|
var item, base, height
|
if (!this.active) {
|
this.next(event)
|
return
|
}
|
if (this.isFirstItem()) {
|
return
|
}
|
if (this._hasScroll()) {
|
base = this.active.offset().top
|
height = this.element.height()
|
this.active.prevAll('.ui-menu-item').each(function () {
|
item = $(this)
|
return item.offset().top - base + height > 0
|
})
|
|
this.focus(event, item)
|
} else {
|
this.focus(event, this.activeMenu.find(this.options.items).first())
|
}
|
},
|
|
_hasScroll: function () {
|
return this.element.outerHeight() < this.element.prop('scrollHeight')
|
},
|
|
select: function (event) {
|
// TODO: It should never be possible to not have an active item at this
|
// point, but the tests don't trigger mouseenter before click.
|
this.active = this.active || $(event.target).closest('.ui-menu-item')
|
var ui = { item: this.active }
|
if (!this.active.has('.ui-menu').length) {
|
this.collapseAll(event, true)
|
}
|
this._trigger('select', event, ui)
|
},
|
|
_filterMenuItems: function (character) {
|
var escapedCharacter = character.replace(/[\-\[\]{}()*+?.,\\\^$|#\s]/g, '\\$&'),
|
regex = new RegExp('^' + escapedCharacter, 'i')
|
|
return (
|
this.activeMenu
|
.find(this.options.items)
|
|
// Only match on items, not dividers or other content (#10571)
|
.filter('.ui-menu-item')
|
.filter(function () {
|
return regex.test($.trim($(this).children('.ui-menu-item-wrapper').text()))
|
})
|
)
|
}
|
})
|
|
/*!
|
* jQuery UI Autocomplete 1.12.1
|
* http://jqueryui.com
|
*
|
* Copyright jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*/
|
|
//>>label: Autocomplete
|
//>>group: Widgets
|
//>>description: Lists suggested words as the user is typing.
|
//>>docs: http://api.jqueryui.com/autocomplete/
|
//>>demos: http://jqueryui.com/autocomplete/
|
//>>css.structure: ../../themes/base/core.css
|
//>>css.structure: ../../themes/base/autocomplete.css
|
//>>css.theme: ../../themes/base/theme.css
|
|
$.widget('ui.autocomplete', {
|
version: '1.12.1',
|
defaultElement: '<input>',
|
options: {
|
appendTo: null,
|
autoFocus: false,
|
delay: 300,
|
minLength: 1,
|
position: {
|
my: 'left top',
|
at: 'left bottom',
|
collision: 'none'
|
},
|
source: null,
|
|
// Callbacks
|
change: null,
|
close: null,
|
focus: null,
|
open: null,
|
response: null,
|
search: null,
|
select: null
|
},
|
|
requestIndex: 0,
|
pending: 0,
|
|
_create: function () {
|
// Some browsers only repeat keydown events, not keypress events,
|
// so we use the suppressKeyPress flag to determine if we've already
|
// handled the keydown event. #7269
|
// Unfortunately the code for & in keypress is the same as the up arrow,
|
// so we use the suppressKeyPressRepeat flag to avoid handling keypress
|
// events when we know the keydown event was used to modify the
|
// search term. #7799
|
var suppressKeyPress,
|
suppressKeyPressRepeat,
|
suppressInput,
|
nodeName = this.element[0].nodeName.toLowerCase(),
|
isTextarea = nodeName === 'textarea',
|
isInput = nodeName === 'input'
|
|
// Textareas are always multi-line
|
// Inputs are always single-line, even if inside a contentEditable element
|
// IE also treats inputs as contentEditable
|
// All other element types are determined by whether or not they're contentEditable
|
this.isMultiLine = isTextarea || (!isInput && this._isContentEditable(this.element))
|
|
this.valueMethod = this.element[isTextarea || isInput ? 'val' : 'text']
|
this.isNewMenu = true
|
|
this._addClass('ui-autocomplete-input')
|
this.element.attr('autocomplete', 'off')
|
|
this._on(this.element, {
|
keydown: function (event) {
|
if (this.element.prop('readOnly')) {
|
suppressKeyPress = true
|
suppressInput = true
|
suppressKeyPressRepeat = true
|
return
|
}
|
|
suppressKeyPress = false
|
suppressInput = false
|
suppressKeyPressRepeat = false
|
var keyCode = $.ui.keyCode
|
switch (event.keyCode) {
|
case keyCode.PAGE_UP:
|
suppressKeyPress = true
|
this._move('previousPage', event)
|
break
|
case keyCode.PAGE_DOWN:
|
suppressKeyPress = true
|
this._move('nextPage', event)
|
break
|
case keyCode.UP:
|
suppressKeyPress = true
|
this._keyEvent('previous', event)
|
break
|
case keyCode.DOWN:
|
suppressKeyPress = true
|
this._keyEvent('next', event)
|
break
|
case keyCode.ENTER:
|
// when menu is open and has focus
|
if (this.menu.active) {
|
// #6055 - Opera still allows the keypress to occur
|
// which causes forms to submit
|
suppressKeyPress = true
|
event.preventDefault()
|
this.menu.select(event)
|
}
|
break
|
case keyCode.TAB:
|
if (this.menu.active) {
|
this.menu.select(event)
|
}
|
break
|
case keyCode.ESCAPE:
|
if (this.menu.element.is(':visible')) {
|
if (!this.isMultiLine) {
|
this._value(this.term)
|
}
|
this.close(event)
|
|
// Different browsers have different default behavior for escape
|
// Single press can mean undo or clear
|
// Double press in IE means clear the whole form
|
event.preventDefault()
|
}
|
break
|
default:
|
suppressKeyPressRepeat = true
|
|
// search timeout should be triggered before the input value is changed
|
this._searchTimeout(event)
|
break
|
}
|
},
|
keypress: function (event) {
|
if (suppressKeyPress) {
|
suppressKeyPress = false
|
if (!this.isMultiLine || this.menu.element.is(':visible')) {
|
event.preventDefault()
|
}
|
return
|
}
|
if (suppressKeyPressRepeat) {
|
return
|
}
|
|
// Replicate some key handlers to allow them to repeat in Firefox and Opera
|
var keyCode = $.ui.keyCode
|
switch (event.keyCode) {
|
case keyCode.PAGE_UP:
|
this._move('previousPage', event)
|
break
|
case keyCode.PAGE_DOWN:
|
this._move('nextPage', event)
|
break
|
case keyCode.UP:
|
this._keyEvent('previous', event)
|
break
|
case keyCode.DOWN:
|
this._keyEvent('next', event)
|
break
|
}
|
},
|
input: function (event) {
|
if (suppressInput) {
|
suppressInput = false
|
event.preventDefault()
|
return
|
}
|
this._searchTimeout(event)
|
},
|
focus: function () {
|
this.selectedItem = null
|
this.previous = this._value()
|
},
|
blur: function (event) {
|
if (this.cancelBlur) {
|
delete this.cancelBlur
|
return
|
}
|
|
clearTimeout(this.searching)
|
this.close(event)
|
this._change(event)
|
}
|
})
|
|
this._initSource()
|
this.menu = $('<ul>')
|
.appendTo(this._appendTo())
|
.menu({
|
// disable ARIA support, the live region takes care of that
|
role: null
|
})
|
.hide()
|
.menu('instance')
|
|
this._addClass(this.menu.element, 'ui-autocomplete', 'ui-front')
|
this._on(this.menu.element, {
|
mousedown: function (event) {
|
// prevent moving focus out of the text field
|
event.preventDefault()
|
|
// IE doesn't prevent moving focus even with event.preventDefault()
|
// so we set a flag to know when we should ignore the blur event
|
this.cancelBlur = true
|
this._delay(function () {
|
delete this.cancelBlur
|
|
// Support: IE 8 only
|
// Right clicking a menu item or selecting text from the menu items will
|
// result in focus moving out of the input. However, we've already received
|
// and ignored the blur event because of the cancelBlur flag set above. So
|
// we restore focus to ensure that the menu closes properly based on the user's
|
// next actions.
|
if (this.element[0] !== $.ui.safeActiveElement(this.document[0])) {
|
this.element.trigger('focus')
|
}
|
})
|
},
|
menufocus: function (event, ui) {
|
var label, item
|
|
// support: Firefox
|
// Prevent accidental activation of menu items in Firefox (#7024 #9118)
|
if (this.isNewMenu) {
|
this.isNewMenu = false
|
if (event.originalEvent && /^mouse/.test(event.originalEvent.type)) {
|
this.menu.blur()
|
|
this.document.one('mousemove', function () {
|
$(event.target).trigger(event.originalEvent)
|
})
|
|
return
|
}
|
}
|
|
item = ui.item.data('ui-autocomplete-item')
|
if (false !== this._trigger('focus', event, { item: item })) {
|
// use value to match what will end up in the input, if it was a key event
|
if (event.originalEvent && /^key/.test(event.originalEvent.type)) {
|
this._value(item.value)
|
}
|
}
|
|
// Announce the value in the liveRegion
|
label = ui.item.attr('aria-label') || item.value
|
if (label && $.trim(label).length) {
|
this.liveRegion.children().hide()
|
$('<div>').text(label).appendTo(this.liveRegion)
|
}
|
},
|
menuselect: function (event, ui) {
|
var item = ui.item.data('ui-autocomplete-item'),
|
previous = this.previous
|
|
// Only trigger when focus was lost (click on menu)
|
if (this.element[0] !== $.ui.safeActiveElement(this.document[0])) {
|
this.element.trigger('focus')
|
this.previous = previous
|
|
// #6109 - IE triggers two focus events and the second
|
// is asynchronous, so we need to reset the previous
|
// term synchronously and asynchronously :-(
|
this._delay(function () {
|
this.previous = previous
|
this.selectedItem = item
|
})
|
}
|
|
if (false !== this._trigger('select', event, { item: item })) {
|
this._value(item.value)
|
}
|
|
// reset the term after the select event
|
// this allows custom select handling to work properly
|
this.term = this._value()
|
|
this.close(event)
|
this.selectedItem = item
|
}
|
})
|
|
this.liveRegion = $('<div>', {
|
role: 'status',
|
'aria-live': 'assertive',
|
'aria-relevant': 'additions'
|
}).appendTo(this.document[0].body)
|
|
this._addClass(this.liveRegion, null, 'ui-helper-hidden-accessible')
|
|
// Turning off autocomplete prevents the browser from remembering the
|
// value when navigating through history, so we re-enable autocomplete
|
// if the page is unloaded before the widget is destroyed. #7790
|
this._on(this.window, {
|
beforeunload: function () {
|
this.element.removeAttr('autocomplete')
|
}
|
})
|
},
|
|
_destroy: function () {
|
clearTimeout(this.searching)
|
this.element.removeAttr('autocomplete')
|
this.menu.element.remove()
|
this.liveRegion.remove()
|
},
|
|
_setOption: function (key, value) {
|
this._super(key, value)
|
if (key === 'source') {
|
this._initSource()
|
}
|
if (key === 'appendTo') {
|
this.menu.element.appendTo(this._appendTo())
|
}
|
if (key === 'disabled' && value && this.xhr) {
|
this.xhr.abort()
|
}
|
},
|
|
_isEventTargetInWidget: function (event) {
|
var menuElement = this.menu.element[0]
|
|
return (
|
event.target === this.element[0] ||
|
event.target === menuElement ||
|
$.contains(menuElement, event.target)
|
)
|
},
|
|
_closeOnClickOutside: function (event) {
|
if (!this._isEventTargetInWidget(event)) {
|
this.close()
|
}
|
},
|
|
_appendTo: function () {
|
var element = this.options.appendTo
|
|
if (element) {
|
element =
|
element.jquery || element.nodeType ? $(element) : this.document.find(element).eq(0)
|
}
|
|
if (!element || !element[0]) {
|
element = this.element.closest('.ui-front, dialog')
|
}
|
|
if (!element.length) {
|
element = this.document[0].body
|
}
|
|
return element
|
},
|
|
_initSource: function () {
|
var array,
|
url,
|
that = this
|
if ($.isArray(this.options.source)) {
|
array = this.options.source
|
this.source = function (request, response) {
|
response($.ui.autocomplete.filter(array, request.term))
|
}
|
} else if (typeof this.options.source === 'string') {
|
url = this.options.source
|
this.source = function (request, response) {
|
if (that.xhr) {
|
that.xhr.abort()
|
}
|
that.xhr = $.ajax({
|
url: url,
|
data: request,
|
dataType: 'json',
|
success: function (data) {
|
response(data)
|
},
|
error: function () {
|
response([])
|
}
|
})
|
}
|
} else {
|
this.source = this.options.source
|
}
|
},
|
|
_searchTimeout: function (event) {
|
clearTimeout(this.searching)
|
this.searching = this._delay(function () {
|
// Search if the value has changed, or if the user retypes the same value (see #7434)
|
var equalValues = this.term === this._value(),
|
menuVisible = this.menu.element.is(':visible'),
|
modifierKey = event.altKey || event.ctrlKey || event.metaKey || event.shiftKey
|
|
if (!equalValues || (equalValues && !menuVisible && !modifierKey)) {
|
this.selectedItem = null
|
this.search(null, event)
|
}
|
}, this.options.delay)
|
},
|
|
search: function (value, event) {
|
value = value != null ? value : this._value()
|
|
// Always save the actual value, not the one passed as an argument
|
this.term = this._value()
|
|
if (value.length < this.options.minLength) {
|
return this.close(event)
|
}
|
|
if (this._trigger('search', event) === false) {
|
return
|
}
|
|
return this._search(value)
|
},
|
|
_search: function (value) {
|
this.pending++
|
this._addClass('ui-autocomplete-loading')
|
this.cancelSearch = false
|
|
this.source({ term: value }, this._response())
|
},
|
|
_response: function () {
|
var index = ++this.requestIndex
|
|
return $.proxy(function (content) {
|
if (index === this.requestIndex) {
|
this.__response(content)
|
}
|
|
this.pending--
|
if (!this.pending) {
|
this._removeClass('ui-autocomplete-loading')
|
}
|
}, this)
|
},
|
|
__response: function (content) {
|
if (content) {
|
content = this._normalize(content)
|
}
|
this._trigger('response', null, { content: content })
|
if (!this.options.disabled && content && content.length && !this.cancelSearch) {
|
this._suggest(content)
|
this._trigger('open')
|
} else {
|
// use ._close() instead of .close() so we don't cancel future searches
|
this._close()
|
}
|
},
|
|
close: function (event) {
|
this.cancelSearch = true
|
this._close(event)
|
},
|
|
_close: function (event) {
|
// Remove the handler that closes the menu on outside clicks
|
this._off(this.document, 'mousedown')
|
|
if (this.menu.element.is(':visible')) {
|
this.menu.element.hide()
|
this.menu.blur()
|
this.isNewMenu = true
|
this._trigger('close', event)
|
}
|
},
|
|
_change: function (event) {
|
if (this.previous !== this._value()) {
|
this._trigger('change', event, { item: this.selectedItem })
|
}
|
},
|
|
_normalize: function (items) {
|
// assume all items have the right format when the first item is complete
|
if (items.length && items[0].label && items[0].value) {
|
return items
|
}
|
return $.map(items, function (item) {
|
if (typeof item === 'string') {
|
return {
|
label: item,
|
value: item
|
}
|
}
|
return $.extend({}, item, {
|
label: item.label || item.value,
|
value: item.value || item.label
|
})
|
})
|
},
|
|
_suggest: function (items) {
|
var ul = this.menu.element.empty()
|
this._renderMenu(ul, items)
|
this.isNewMenu = true
|
this.menu.refresh()
|
|
// Size and position menu
|
ul.show()
|
this._resizeMenu()
|
ul.position(
|
$.extend(
|
{
|
of: this.element
|
},
|
this.options.position
|
)
|
)
|
|
if (this.options.autoFocus) {
|
this.menu.next()
|
}
|
|
// Listen for interactions outside of the widget (#6642)
|
this._on(this.document, {
|
mousedown: '_closeOnClickOutside'
|
})
|
},
|
|
_resizeMenu: function () {
|
var ul = this.menu.element
|
ul.outerWidth(
|
Math.max(
|
// Firefox wraps long text (possibly a rounding bug)
|
// so we add 1px to avoid the wrapping (#7513)
|
ul.width('').outerWidth() + 1,
|
this.element.outerWidth()
|
)
|
)
|
},
|
|
_renderMenu: function (ul, items) {
|
var that = this
|
$.each(items, function (index, item) {
|
that._renderItemData(ul, item)
|
})
|
},
|
|
_renderItemData: function (ul, item) {
|
return this._renderItem(ul, item).data('ui-autocomplete-item', item)
|
},
|
|
_renderItem: function (ul, item) {
|
return $('<li>').append($('<div>').text(item.label)).appendTo(ul)
|
},
|
|
_move: function (direction, event) {
|
if (!this.menu.element.is(':visible')) {
|
this.search(null, event)
|
return
|
}
|
if (
|
(this.menu.isFirstItem() && /^previous/.test(direction)) ||
|
(this.menu.isLastItem() && /^next/.test(direction))
|
) {
|
if (!this.isMultiLine) {
|
this._value(this.term)
|
}
|
|
this.menu.blur()
|
return
|
}
|
this.menu[direction](event)
|
},
|
|
widget: function () {
|
return this.menu.element
|
},
|
|
_value: function () {
|
return this.valueMethod.apply(this.element, arguments)
|
},
|
|
_keyEvent: function (keyEvent, event) {
|
if (!this.isMultiLine || this.menu.element.is(':visible')) {
|
this._move(keyEvent, event)
|
|
// Prevents moving cursor to beginning/end of the text field in some browsers
|
event.preventDefault()
|
}
|
},
|
|
// Support: Chrome <=50
|
// We should be able to just use this.element.prop( "isContentEditable" )
|
// but hidden elements always report false in Chrome.
|
// https://code.google.com/p/chromium/issues/detail?id=313082
|
_isContentEditable: function (element) {
|
if (!element.length) {
|
return false
|
}
|
|
var editable = element.prop('contentEditable')
|
|
if (editable === 'inherit') {
|
return this._isContentEditable(element.parent())
|
}
|
|
return editable === 'true'
|
}
|
})
|
|
$.extend($.ui.autocomplete, {
|
escapeRegex: function (value) {
|
return value.replace(/[\-\[\]{}()*+?.,\\\^$|#\s]/g, '\\$&')
|
},
|
filter: function (array, term) {
|
var matcher = new RegExp($.ui.autocomplete.escapeRegex(term), 'i')
|
return $.grep(array, function (value) {
|
return matcher.test(value.label || value.value || value)
|
})
|
}
|
})
|
|
// Live region extension, adding a `messages` option
|
// NOTE: This is an experimental API. We are still investigating
|
// a full solution for string manipulation and internationalization.
|
$.widget('ui.autocomplete', $.ui.autocomplete, {
|
options: {
|
messages: {
|
noResults: 'No search results.',
|
results: function (amount) {
|
return (
|
amount +
|
(amount > 1 ? ' results are' : ' result is') +
|
' available, use up and down arrow keys to navigate.'
|
)
|
}
|
}
|
},
|
|
__response: function (content) {
|
var message
|
this._superApply(arguments)
|
if (this.options.disabled || this.cancelSearch) {
|
return
|
}
|
if (content && content.length) {
|
message = this.options.messages.results(content.length)
|
} else {
|
message = this.options.messages.noResults
|
}
|
this.liveRegion.children().hide()
|
$('<div>').text(message).appendTo(this.liveRegion)
|
}
|
})
|
|
var widgetsAutocomplete = $.ui.autocomplete
|
|
/*!
|
* jQuery UI Controlgroup 1.12.1
|
* http://jqueryui.com
|
*
|
* Copyright jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*/
|
|
//>>label: Controlgroup
|
//>>group: Widgets
|
//>>description: Visually groups form control widgets
|
//>>docs: http://api.jqueryui.com/controlgroup/
|
//>>demos: http://jqueryui.com/controlgroup/
|
//>>css.structure: ../../themes/base/core.css
|
//>>css.structure: ../../themes/base/controlgroup.css
|
//>>css.theme: ../../themes/base/theme.css
|
|
var controlgroupCornerRegex = /ui-corner-([a-z]){2,6}/g
|
|
var widgetsControlgroup = $.widget('ui.controlgroup', {
|
version: '1.12.1',
|
defaultElement: '<div>',
|
options: {
|
direction: 'horizontal',
|
disabled: null,
|
onlyVisible: true,
|
items: {
|
button: 'input[type=button], input[type=submit], input[type=reset], button, a',
|
controlgroupLabel: '.ui-controlgroup-label',
|
checkboxradio: "input[type='checkbox'], input[type='radio']",
|
selectmenu: 'select',
|
spinner: '.ui-spinner-input'
|
}
|
},
|
|
_create: function () {
|
this._enhance()
|
},
|
|
// To support the enhanced option in jQuery Mobile, we isolate DOM manipulation
|
_enhance: function () {
|
this.element.attr('role', 'toolbar')
|
this.refresh()
|
},
|
|
_destroy: function () {
|
this._callChildMethod('destroy')
|
this.childWidgets.removeData('ui-controlgroup-data')
|
this.element.removeAttr('role')
|
if (this.options.items.controlgroupLabel) {
|
this.element
|
.find(this.options.items.controlgroupLabel)
|
.find('.ui-controlgroup-label-contents')
|
.contents()
|
.unwrap()
|
}
|
},
|
|
_initWidgets: function () {
|
var that = this,
|
childWidgets = []
|
|
// First we iterate over each of the items options
|
$.each(this.options.items, function (widget, selector) {
|
var labels
|
var options = {}
|
|
// Make sure the widget has a selector set
|
if (!selector) {
|
return
|
}
|
|
if (widget === 'controlgroupLabel') {
|
labels = that.element.find(selector)
|
labels.each(function () {
|
var element = $(this)
|
|
if (element.children('.ui-controlgroup-label-contents').length) {
|
return
|
}
|
element.contents().wrapAll("<span class='ui-controlgroup-label-contents'></span>")
|
})
|
that._addClass(labels, null, 'ui-widget ui-widget-content ui-state-default')
|
childWidgets = childWidgets.concat(labels.get())
|
return
|
}
|
|
// Make sure the widget actually exists
|
if (!$.fn[widget]) {
|
return
|
}
|
|
// We assume everything is in the middle to start because we can't determine
|
// first / last elements until all enhancments are done.
|
if (that['_' + widget + 'Options']) {
|
options = that['_' + widget + 'Options']('middle')
|
} else {
|
options = { classes: {} }
|
}
|
|
// Find instances of this widget inside controlgroup and init them
|
that.element.find(selector).each(function () {
|
var element = $(this)
|
var instance = element[widget]('instance')
|
|
// We need to clone the default options for this type of widget to avoid
|
// polluting the variable options which has a wider scope than a single widget.
|
var instanceOptions = $.widget.extend({}, options)
|
|
// If the button is the child of a spinner ignore it
|
// TODO: Find a more generic solution
|
if (widget === 'button' && element.parent('.ui-spinner').length) {
|
return
|
}
|
|
// Create the widget if it doesn't exist
|
if (!instance) {
|
instance = element[widget]()[widget]('instance')
|
}
|
if (instance) {
|
instanceOptions.classes = that._resolveClassesValues(instanceOptions.classes, instance)
|
}
|
element[widget](instanceOptions)
|
|
// Store an instance of the controlgroup to be able to reference
|
// from the outermost element for changing options and refresh
|
var widgetElement = element[widget]('widget')
|
$.data(
|
widgetElement[0],
|
'ui-controlgroup-data',
|
instance ? instance : element[widget]('instance')
|
)
|
|
childWidgets.push(widgetElement[0])
|
})
|
})
|
|
this.childWidgets = $($.unique(childWidgets))
|
this._addClass(this.childWidgets, 'ui-controlgroup-item')
|
},
|
|
_callChildMethod: function (method) {
|
this.childWidgets.each(function () {
|
var element = $(this),
|
data = element.data('ui-controlgroup-data')
|
if (data && data[method]) {
|
data[method]()
|
}
|
})
|
},
|
|
_updateCornerClass: function (element, position) {
|
var remove = 'ui-corner-top ui-corner-bottom ui-corner-left ui-corner-right ui-corner-all'
|
var add = this._buildSimpleOptions(position, 'label').classes.label
|
|
this._removeClass(element, null, remove)
|
this._addClass(element, null, add)
|
},
|
|
_buildSimpleOptions: function (position, key) {
|
var direction = this.options.direction === 'vertical'
|
var result = {
|
classes: {}
|
}
|
result.classes[key] = {
|
middle: '',
|
first: 'ui-corner-' + (direction ? 'top' : 'left'),
|
last: 'ui-corner-' + (direction ? 'bottom' : 'right'),
|
only: 'ui-corner-all'
|
}[position]
|
|
return result
|
},
|
|
_spinnerOptions: function (position) {
|
var options = this._buildSimpleOptions(position, 'ui-spinner')
|
|
options.classes['ui-spinner-up'] = ''
|
options.classes['ui-spinner-down'] = ''
|
|
return options
|
},
|
|
_buttonOptions: function (position) {
|
return this._buildSimpleOptions(position, 'ui-button')
|
},
|
|
_checkboxradioOptions: function (position) {
|
return this._buildSimpleOptions(position, 'ui-checkboxradio-label')
|
},
|
|
_selectmenuOptions: function (position) {
|
var direction = this.options.direction === 'vertical'
|
return {
|
width: direction ? 'auto' : false,
|
classes: {
|
middle: {
|
'ui-selectmenu-button-open': '',
|
'ui-selectmenu-button-closed': ''
|
},
|
first: {
|
'ui-selectmenu-button-open': 'ui-corner-' + (direction ? 'top' : 'tl'),
|
'ui-selectmenu-button-closed': 'ui-corner-' + (direction ? 'top' : 'left')
|
},
|
last: {
|
'ui-selectmenu-button-open': direction ? '' : 'ui-corner-tr',
|
'ui-selectmenu-button-closed': 'ui-corner-' + (direction ? 'bottom' : 'right')
|
},
|
only: {
|
'ui-selectmenu-button-open': 'ui-corner-top',
|
'ui-selectmenu-button-closed': 'ui-corner-all'
|
}
|
}[position]
|
}
|
},
|
|
_resolveClassesValues: function (classes, instance) {
|
var result = {}
|
$.each(classes, function (key) {
|
var current = instance.options.classes[key] || ''
|
current = $.trim(current.replace(controlgroupCornerRegex, ''))
|
result[key] = (current + ' ' + classes[key]).replace(/\s+/g, ' ')
|
})
|
return result
|
},
|
|
_setOption: function (key, value) {
|
if (key === 'direction') {
|
this._removeClass('ui-controlgroup-' + this.options.direction)
|
}
|
|
this._super(key, value)
|
if (key === 'disabled') {
|
this._callChildMethod(value ? 'disable' : 'enable')
|
return
|
}
|
|
this.refresh()
|
},
|
|
refresh: function () {
|
var children,
|
that = this
|
|
this._addClass('ui-controlgroup ui-controlgroup-' + this.options.direction)
|
|
if (this.options.direction === 'horizontal') {
|
this._addClass(null, 'ui-helper-clearfix')
|
}
|
this._initWidgets()
|
|
children = this.childWidgets
|
|
// We filter here because we need to track all childWidgets not just the visible ones
|
if (this.options.onlyVisible) {
|
children = children.filter(':visible')
|
}
|
|
if (children.length) {
|
// We do this last because we need to make sure all enhancment is done
|
// before determining first and last
|
$.each(['first', 'last'], function (index, value) {
|
var instance = children[value]().data('ui-controlgroup-data')
|
|
if (instance && that['_' + instance.widgetName + 'Options']) {
|
var options = that['_' + instance.widgetName + 'Options'](
|
children.length === 1 ? 'only' : value
|
)
|
options.classes = that._resolveClassesValues(options.classes, instance)
|
instance.element[instance.widgetName](options)
|
} else {
|
that._updateCornerClass(children[value](), value)
|
}
|
})
|
|
// Finally call the refresh method on each of the child widgets.
|
this._callChildMethod('refresh')
|
}
|
}
|
})
|
|
/*!
|
* jQuery UI Checkboxradio 1.12.1
|
* http://jqueryui.com
|
*
|
* Copyright jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*/
|
|
//>>label: Checkboxradio
|
//>>group: Widgets
|
//>>description: Enhances a form with multiple themeable checkboxes or radio buttons.
|
//>>docs: http://api.jqueryui.com/checkboxradio/
|
//>>demos: http://jqueryui.com/checkboxradio/
|
//>>css.structure: ../../themes/base/core.css
|
//>>css.structure: ../../themes/base/button.css
|
//>>css.structure: ../../themes/base/checkboxradio.css
|
//>>css.theme: ../../themes/base/theme.css
|
|
$.widget('ui.checkboxradio', [
|
$.ui.formResetMixin,
|
{
|
version: '1.12.1',
|
options: {
|
disabled: null,
|
label: null,
|
icon: true,
|
classes: {
|
'ui-checkboxradio-label': 'ui-corner-all',
|
'ui-checkboxradio-icon': 'ui-corner-all'
|
}
|
},
|
|
_getCreateOptions: function () {
|
var disabled, labels
|
var that = this
|
var options = this._super() || {}
|
|
// We read the type here, because it makes more sense to throw a element type error first,
|
// rather then the error for lack of a label. Often if its the wrong type, it
|
// won't have a label (e.g. calling on a div, btn, etc)
|
this._readType()
|
|
labels = this.element.labels()
|
|
// If there are multiple labels, use the last one
|
this.label = $(labels[labels.length - 1])
|
if (!this.label.length) {
|
$.error('No label found for checkboxradio widget')
|
}
|
|
this.originalLabel = ''
|
|
// We need to get the label text but this may also need to make sure it does not contain the
|
// input itself.
|
this.label
|
.contents()
|
.not(this.element[0])
|
.each(function () {
|
// The label contents could be text, html, or a mix. We concat each element to get a
|
// string representation of the label, without the input as part of it.
|
that.originalLabel += this.nodeType === 3 ? $(this).text() : this.outerHTML
|
})
|
|
// Set the label option if we found label text
|
if (this.originalLabel) {
|
options.label = this.originalLabel
|
}
|
|
disabled = this.element[0].disabled
|
if (disabled != null) {
|
options.disabled = disabled
|
}
|
return options
|
},
|
|
_create: function () {
|
var checked = this.element[0].checked
|
|
this._bindFormResetHandler()
|
|
if (this.options.disabled == null) {
|
this.options.disabled = this.element[0].disabled
|
}
|
|
this._setOption('disabled', this.options.disabled)
|
this._addClass('ui-checkboxradio', 'ui-helper-hidden-accessible')
|
this._addClass(this.label, 'ui-checkboxradio-label', 'ui-button ui-widget')
|
|
if (this.type === 'radio') {
|
this._addClass(this.label, 'ui-checkboxradio-radio-label')
|
}
|
|
if (this.options.label && this.options.label !== this.originalLabel) {
|
this._updateLabel()
|
} else if (this.originalLabel) {
|
this.options.label = this.originalLabel
|
}
|
|
this._enhance()
|
|
if (checked) {
|
this._addClass(this.label, 'ui-checkboxradio-checked', 'ui-state-active')
|
if (this.icon) {
|
this._addClass(this.icon, null, 'ui-state-hover')
|
}
|
}
|
|
this._on({
|
change: '_toggleClasses',
|
focus: function () {
|
this._addClass(this.label, null, 'ui-state-focus ui-visual-focus')
|
},
|
blur: function () {
|
this._removeClass(this.label, null, 'ui-state-focus ui-visual-focus')
|
}
|
})
|
},
|
|
_readType: function () {
|
var nodeName = this.element[0].nodeName.toLowerCase()
|
this.type = this.element[0].type
|
if (nodeName !== 'input' || !/radio|checkbox/.test(this.type)) {
|
$.error(
|
"Can't create checkboxradio on element.nodeName=" +
|
nodeName +
|
' and element.type=' +
|
this.type
|
)
|
}
|
},
|
|
// Support jQuery Mobile enhanced option
|
_enhance: function () {
|
this._updateIcon(this.element[0].checked)
|
},
|
|
widget: function () {
|
return this.label
|
},
|
|
_getRadioGroup: function () {
|
var group
|
var name = this.element[0].name
|
var nameSelector = "input[name='" + $.ui.escapeSelector(name) + "']"
|
|
if (!name) {
|
return $([])
|
}
|
|
if (this.form.length) {
|
group = $(this.form[0].elements).filter(nameSelector)
|
} else {
|
// Not inside a form, check all inputs that also are not inside a form
|
group = $(nameSelector).filter(function () {
|
return $(this).form().length === 0
|
})
|
}
|
|
return group.not(this.element)
|
},
|
|
_toggleClasses: function () {
|
var checked = this.element[0].checked
|
this._toggleClass(this.label, 'ui-checkboxradio-checked', 'ui-state-active', checked)
|
|
if (this.options.icon && this.type === 'checkbox') {
|
this._toggleClass(
|
this.icon,
|
null,
|
'ui-icon-check ui-state-checked',
|
checked
|
)._toggleClass(this.icon, null, 'ui-icon-blank', !checked)
|
}
|
|
if (this.type === 'radio') {
|
this._getRadioGroup().each(function () {
|
var instance = $(this).checkboxradio('instance')
|
|
if (instance) {
|
instance._removeClass(instance.label, 'ui-checkboxradio-checked', 'ui-state-active')
|
}
|
})
|
}
|
},
|
|
_destroy: function () {
|
this._unbindFormResetHandler()
|
|
if (this.icon) {
|
this.icon.remove()
|
this.iconSpace.remove()
|
}
|
},
|
|
_setOption: function (key, value) {
|
// We don't allow the value to be set to nothing
|
if (key === 'label' && !value) {
|
return
|
}
|
|
this._super(key, value)
|
|
if (key === 'disabled') {
|
this._toggleClass(this.label, null, 'ui-state-disabled', value)
|
this.element[0].disabled = value
|
|
// Don't refresh when setting disabled
|
return
|
}
|
this.refresh()
|
},
|
|
_updateIcon: function (checked) {
|
var toAdd = 'ui-icon ui-icon-background '
|
|
if (this.options.icon) {
|
if (!this.icon) {
|
this.icon = $('<span>')
|
this.iconSpace = $('<span> </span>')
|
this._addClass(this.iconSpace, 'ui-checkboxradio-icon-space')
|
}
|
|
if (this.type === 'checkbox') {
|
toAdd += checked ? 'ui-icon-check ui-state-checked' : 'ui-icon-blank'
|
this._removeClass(this.icon, null, checked ? 'ui-icon-blank' : 'ui-icon-check')
|
} else {
|
toAdd += 'ui-icon-blank'
|
}
|
this._addClass(this.icon, 'ui-checkboxradio-icon', toAdd)
|
if (!checked) {
|
this._removeClass(this.icon, null, 'ui-icon-check ui-state-checked')
|
}
|
this.icon.prependTo(this.label).after(this.iconSpace)
|
} else if (this.icon !== undefined) {
|
this.icon.remove()
|
this.iconSpace.remove()
|
delete this.icon
|
}
|
},
|
|
_updateLabel: function () {
|
// Remove the contents of the label ( minus the icon, icon space, and input )
|
var contents = this.label.contents().not(this.element[0])
|
if (this.icon) {
|
contents = contents.not(this.icon[0])
|
}
|
if (this.iconSpace) {
|
contents = contents.not(this.iconSpace[0])
|
}
|
contents.remove()
|
|
this.label.append(this.options.label)
|
},
|
|
refresh: function () {
|
var checked = this.element[0].checked,
|
isDisabled = this.element[0].disabled
|
|
this._updateIcon(checked)
|
this._toggleClass(this.label, 'ui-checkboxradio-checked', 'ui-state-active', checked)
|
if (this.options.label !== null) {
|
this._updateLabel()
|
}
|
|
if (isDisabled !== this.options.disabled) {
|
this._setOptions({ disabled: isDisabled })
|
}
|
}
|
}
|
])
|
|
var widgetsCheckboxradio = $.ui.checkboxradio
|
|
/*!
|
* jQuery UI Button 1.12.1
|
* http://jqueryui.com
|
*
|
* Copyright jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*/
|
|
//>>label: Button
|
//>>group: Widgets
|
//>>description: Enhances a form with themeable buttons.
|
//>>docs: http://api.jqueryui.com/button/
|
//>>demos: http://jqueryui.com/button/
|
//>>css.structure: ../../themes/base/core.css
|
//>>css.structure: ../../themes/base/button.css
|
//>>css.theme: ../../themes/base/theme.css
|
|
$.widget('ui.button', {
|
version: '1.12.1',
|
defaultElement: '<button>',
|
options: {
|
classes: {
|
'ui-button': 'ui-corner-all'
|
},
|
disabled: null,
|
icon: null,
|
iconPosition: 'beginning',
|
label: null,
|
showLabel: true
|
},
|
|
_getCreateOptions: function () {
|
var disabled,
|
// This is to support cases like in jQuery Mobile where the base widget does have
|
// an implementation of _getCreateOptions
|
options = this._super() || {}
|
|
this.isInput = this.element.is('input')
|
|
disabled = this.element[0].disabled
|
if (disabled != null) {
|
options.disabled = disabled
|
}
|
|
this.originalLabel = this.isInput ? this.element.val() : this.element.html()
|
if (this.originalLabel) {
|
options.label = this.originalLabel
|
}
|
|
return options
|
},
|
|
_create: function () {
|
if (!this.option.showLabel & !this.options.icon) {
|
this.options.showLabel = true
|
}
|
|
// We have to check the option again here even though we did in _getCreateOptions,
|
// because null may have been passed on init which would override what was set in
|
// _getCreateOptions
|
if (this.options.disabled == null) {
|
this.options.disabled = this.element[0].disabled || false
|
}
|
|
this.hasTitle = !!this.element.attr('title')
|
|
// Check to see if the label needs to be set or if its already correct
|
if (this.options.label && this.options.label !== this.originalLabel) {
|
if (this.isInput) {
|
this.element.val(this.options.label)
|
} else {
|
this.element.html(this.options.label)
|
}
|
}
|
this._addClass('ui-button', 'ui-widget')
|
this._setOption('disabled', this.options.disabled)
|
this._enhance()
|
|
if (this.element.is('a')) {
|
this._on({
|
keyup: function (event) {
|
if (event.keyCode === $.ui.keyCode.SPACE) {
|
event.preventDefault()
|
|
// Support: PhantomJS <= 1.9, IE 8 Only
|
// If a native click is available use it so we actually cause navigation
|
// otherwise just trigger a click event
|
if (this.element[0].click) {
|
this.element[0].click()
|
} else {
|
this.element.trigger('click')
|
}
|
}
|
}
|
})
|
}
|
},
|
|
_enhance: function () {
|
if (!this.element.is('button')) {
|
this.element.attr('role', 'button')
|
}
|
|
if (this.options.icon) {
|
this._updateIcon('icon', this.options.icon)
|
this._updateTooltip()
|
}
|
},
|
|
_updateTooltip: function () {
|
this.title = this.element.attr('title')
|
|
if (!this.options.showLabel && !this.title) {
|
this.element.attr('title', this.options.label)
|
}
|
},
|
|
_updateIcon: function (option, value) {
|
var icon = option !== 'iconPosition',
|
position = icon ? this.options.iconPosition : value,
|
displayBlock = position === 'top' || position === 'bottom'
|
|
// Create icon
|
if (!this.icon) {
|
this.icon = $('<span>')
|
|
this._addClass(this.icon, 'ui-button-icon', 'ui-icon')
|
|
if (!this.options.showLabel) {
|
this._addClass('ui-button-icon-only')
|
}
|
} else if (icon) {
|
// If we are updating the icon remove the old icon class
|
this._removeClass(this.icon, null, this.options.icon)
|
}
|
|
// If we are updating the icon add the new icon class
|
if (icon) {
|
this._addClass(this.icon, null, value)
|
}
|
|
this._attachIcon(position)
|
|
// If the icon is on top or bottom we need to add the ui-widget-icon-block class and remove
|
// the iconSpace if there is one.
|
if (displayBlock) {
|
this._addClass(this.icon, null, 'ui-widget-icon-block')
|
if (this.iconSpace) {
|
this.iconSpace.remove()
|
}
|
} else {
|
// Position is beginning or end so remove the ui-widget-icon-block class and add the
|
// space if it does not exist
|
if (!this.iconSpace) {
|
this.iconSpace = $('<span> </span>')
|
this._addClass(this.iconSpace, 'ui-button-icon-space')
|
}
|
this._removeClass(this.icon, null, 'ui-wiget-icon-block')
|
this._attachIconSpace(position)
|
}
|
},
|
|
_destroy: function () {
|
this.element.removeAttr('role')
|
|
if (this.icon) {
|
this.icon.remove()
|
}
|
if (this.iconSpace) {
|
this.iconSpace.remove()
|
}
|
if (!this.hasTitle) {
|
this.element.removeAttr('title')
|
}
|
},
|
|
_attachIconSpace: function (iconPosition) {
|
this.icon[/^(?:end|bottom)/.test(iconPosition) ? 'before' : 'after'](this.iconSpace)
|
},
|
|
_attachIcon: function (iconPosition) {
|
this.element[/^(?:end|bottom)/.test(iconPosition) ? 'append' : 'prepend'](this.icon)
|
},
|
|
_setOptions: function (options) {
|
var newShowLabel =
|
options.showLabel === undefined ? this.options.showLabel : options.showLabel,
|
newIcon = options.icon === undefined ? this.options.icon : options.icon
|
|
if (!newShowLabel && !newIcon) {
|
options.showLabel = true
|
}
|
this._super(options)
|
},
|
|
_setOption: function (key, value) {
|
if (key === 'icon') {
|
if (value) {
|
this._updateIcon(key, value)
|
} else if (this.icon) {
|
this.icon.remove()
|
if (this.iconSpace) {
|
this.iconSpace.remove()
|
}
|
}
|
}
|
|
if (key === 'iconPosition') {
|
this._updateIcon(key, value)
|
}
|
|
// Make sure we can't end up with a button that has neither text nor icon
|
if (key === 'showLabel') {
|
this._toggleClass('ui-button-icon-only', null, !value)
|
this._updateTooltip()
|
}
|
|
if (key === 'label') {
|
if (this.isInput) {
|
this.element.val(value)
|
} else {
|
// If there is an icon, append it, else nothing then append the value
|
// this avoids removal of the icon when setting label text
|
this.element.html(value)
|
if (this.icon) {
|
this._attachIcon(this.options.iconPosition)
|
this._attachIconSpace(this.options.iconPosition)
|
}
|
}
|
}
|
|
this._super(key, value)
|
|
if (key === 'disabled') {
|
this._toggleClass(null, 'ui-state-disabled', value)
|
this.element[0].disabled = value
|
if (value) {
|
this.element.blur()
|
}
|
}
|
},
|
|
refresh: function () {
|
// Make sure to only check disabled if its an element that supports this otherwise
|
// check for the disabled class to determine state
|
var isDisabled = this.element.is('input, button')
|
? this.element[0].disabled
|
: this.element.hasClass('ui-button-disabled')
|
|
if (isDisabled !== this.options.disabled) {
|
this._setOptions({ disabled: isDisabled })
|
}
|
|
this._updateTooltip()
|
}
|
})
|
|
// DEPRECATED
|
if ($.uiBackCompat !== false) {
|
// Text and Icons options
|
$.widget('ui.button', $.ui.button, {
|
options: {
|
text: true,
|
icons: {
|
primary: null,
|
secondary: null
|
}
|
},
|
|
_create: function () {
|
if (this.options.showLabel && !this.options.text) {
|
this.options.showLabel = this.options.text
|
}
|
if (!this.options.showLabel && this.options.text) {
|
this.options.text = this.options.showLabel
|
}
|
if (!this.options.icon && (this.options.icons.primary || this.options.icons.secondary)) {
|
if (this.options.icons.primary) {
|
this.options.icon = this.options.icons.primary
|
} else {
|
this.options.icon = this.options.icons.secondary
|
this.options.iconPosition = 'end'
|
}
|
} else if (this.options.icon) {
|
this.options.icons.primary = this.options.icon
|
}
|
this._super()
|
},
|
|
_setOption: function (key, value) {
|
if (key === 'text') {
|
this._super('showLabel', value)
|
return
|
}
|
if (key === 'showLabel') {
|
this.options.text = value
|
}
|
if (key === 'icon') {
|
this.options.icons.primary = value
|
}
|
if (key === 'icons') {
|
if (value.primary) {
|
this._super('icon', value.primary)
|
this._super('iconPosition', 'beginning')
|
} else if (value.secondary) {
|
this._super('icon', value.secondary)
|
this._super('iconPosition', 'end')
|
}
|
}
|
this._superApply(arguments)
|
}
|
})
|
|
$.fn.button = (function (orig) {
|
return function () {
|
if (
|
!this.length ||
|
(this.length && this[0].tagName !== 'INPUT') ||
|
(this.length &&
|
this[0].tagName === 'INPUT' &&
|
this.attr('type') !== 'checkbox' &&
|
this.attr('type') !== 'radio')
|
) {
|
return orig.apply(this, arguments)
|
}
|
if (!$.ui.checkboxradio) {
|
$.error('Checkboxradio widget missing')
|
}
|
if (arguments.length === 0) {
|
return this.checkboxradio({
|
icon: false
|
})
|
}
|
return this.checkboxradio.apply(this, arguments)
|
}
|
})($.fn.button)
|
|
$.fn.buttonset = function () {
|
if (!$.ui.controlgroup) {
|
$.error('Controlgroup widget missing')
|
}
|
if (arguments[0] === 'option' && arguments[1] === 'items' && arguments[2]) {
|
return this.controlgroup.apply(this, [arguments[0], 'items.button', arguments[2]])
|
}
|
if (arguments[0] === 'option' && arguments[1] === 'items') {
|
return this.controlgroup.apply(this, [arguments[0], 'items.button'])
|
}
|
if (typeof arguments[0] === 'object' && arguments[0].items) {
|
arguments[0].items = {
|
button: arguments[0].items
|
}
|
}
|
return this.controlgroup.apply(this, arguments)
|
}
|
}
|
|
var widgetsButton = $.ui.button
|
|
// jscs:disable maximumLineLength
|
/* jscs:disable requireCamelCaseOrUpperCaseIdentifiers */
|
/*!
|
* jQuery UI Datepicker 1.12.1
|
* http://jqueryui.com
|
*
|
* Copyright jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*/
|
|
//>>label: Datepicker
|
//>>group: Widgets
|
//>>description: Displays a calendar from an input or inline for selecting dates.
|
//>>docs: http://api.jqueryui.com/datepicker/
|
//>>demos: http://jqueryui.com/datepicker/
|
//>>css.structure: ../../themes/base/core.css
|
//>>css.structure: ../../themes/base/datepicker.css
|
//>>css.theme: ../../themes/base/theme.css
|
|
$.extend($.ui, { datepicker: { version: '1.12.1' } })
|
|
var datepicker_instActive
|
|
function datepicker_getZindex(elem) {
|
var position, value
|
while (elem.length && elem[0] !== document) {
|
// Ignore z-index if position is set to a value where z-index is ignored by the browser
|
// This makes behavior of this function consistent across browsers
|
// WebKit always returns auto if the element is positioned
|
position = elem.css('position')
|
if (position === 'absolute' || position === 'relative' || position === 'fixed') {
|
// IE returns 0 when zIndex is not specified
|
// other browsers return a string
|
// we ignore the case of nested elements with an explicit value of 0
|
// <div style="z-index: -10;"><div style="z-index: 0;"></div></div>
|
value = parseInt(elem.css('zIndex'), 10)
|
if (!isNaN(value) && value !== 0) {
|
return value
|
}
|
}
|
elem = elem.parent()
|
}
|
|
return 0
|
}
|
/* Date picker manager.
|
Use the singleton instance of this class, $.datepicker, to interact with the date picker.
|
Settings for (groups of) date pickers are maintained in an instance object,
|
allowing multiple different settings on the same page. */
|
|
function Datepicker() {
|
this._curInst = null // The current instance in use
|
this._keyEvent = false // If the last event was a key event
|
this._disabledInputs = [] // List of date picker inputs that have been disabled
|
this._datepickerShowing = false // True if the popup picker is showing , false if not
|
this._inDialog = false // True if showing within a "dialog", false if not
|
this._mainDivId = 'ui-datepicker-div' // The ID of the main datepicker division
|
this._inlineClass = 'ui-datepicker-inline' // The name of the inline marker class
|
this._appendClass = 'ui-datepicker-append' // The name of the append marker class
|
this._triggerClass = 'ui-datepicker-trigger' // The name of the trigger marker class
|
this._dialogClass = 'ui-datepicker-dialog' // The name of the dialog marker class
|
this._disableClass = 'ui-datepicker-disabled' // The name of the disabled covering marker class
|
this._unselectableClass = 'ui-datepicker-unselectable' // The name of the unselectable cell marker class
|
this._currentClass = 'ui-datepicker-current-day' // The name of the current day marker class
|
this._dayOverClass = 'ui-datepicker-days-cell-over' // The name of the day hover marker class
|
this.regional = [] // Available regional settings, indexed by language code
|
this.regional[''] = {
|
// Default regional settings
|
closeText: 'Done', // Display text for close link
|
prevText: 'Prev', // Display text for previous month link
|
nextText: 'Next', // Display text for next month link
|
currentText: 'Today', // Display text for current month link
|
monthNames: [
|
'January',
|
'February',
|
'March',
|
'April',
|
'May',
|
'June',
|
'July',
|
'August',
|
'September',
|
'October',
|
'November',
|
'December'
|
], // Names of months for drop-down and formatting
|
monthNamesShort: [
|
'Jan',
|
'Feb',
|
'Mar',
|
'Apr',
|
'May',
|
'Jun',
|
'Jul',
|
'Aug',
|
'Sep',
|
'Oct',
|
'Nov',
|
'Dec'
|
], // For formatting
|
dayNames: ['Sunday', 'Monday', 'Tuesday', 'Wednesday', 'Thursday', 'Friday', 'Saturday'], // For formatting
|
dayNamesShort: ['Sun', 'Mon', 'Tue', 'Wed', 'Thu', 'Fri', 'Sat'], // For formatting
|
dayNamesMin: ['Su', 'Mo', 'Tu', 'We', 'Th', 'Fr', 'Sa'], // Column headings for days starting at Sunday
|
weekHeader: 'Wk', // Column header for week of the year
|
dateFormat: 'mm/dd/yy', // See format options on parseDate
|
firstDay: 0, // The first day of the week, Sun = 0, Mon = 1, ...
|
isRTL: false, // True if right-to-left language, false if left-to-right
|
showMonthAfterYear: false, // True if the year select precedes month, false for month then year
|
yearSuffix: '' // Additional text to append to the year in the month headers
|
}
|
this._defaults = {
|
// Global defaults for all the date picker instances
|
showOn: 'focus', // "focus" for popup on focus,
|
// "button" for trigger button, or "both" for either
|
showAnim: 'fadeIn', // Name of jQuery animation for popup
|
showOptions: {}, // Options for enhanced animations
|
defaultDate: null, // Used when field is blank: actual date,
|
// +/-number for offset from today, null for today
|
appendText: '', // Display text following the input box, e.g. showing the format
|
buttonText: '...', // Text for trigger button
|
buttonImage: '', // URL for trigger button image
|
buttonImageOnly: false, // True if the image appears alone, false if it appears on a button
|
hideIfNoPrevNext: false, // True to hide next/previous month links
|
// if not applicable, false to just disable them
|
navigationAsDateFormat: false, // True if date formatting applied to prev/today/next links
|
gotoCurrent: false, // True if today link goes back to current selection instead
|
changeMonth: false, // True if month can be selected directly, false if only prev/next
|
changeYear: false, // True if year can be selected directly, false if only prev/next
|
yearRange: 'c-10:c+10', // Range of years to display in drop-down,
|
// either relative to today's year (-nn:+nn), relative to currently displayed year
|
// (c-nn:c+nn), absolute (nnnn:nnnn), or a combination of the above (nnnn:-n)
|
showOtherMonths: false, // True to show dates in other months, false to leave blank
|
selectOtherMonths: false, // True to allow selection of dates in other months, false for unselectable
|
showWeek: false, // True to show week of the year, false to not show it
|
calculateWeek: this.iso8601Week, // How to calculate the week of the year,
|
// takes a Date and returns the number of the week for it
|
shortYearCutoff: '+10', // Short year values < this are in the current century,
|
// > this are in the previous century,
|
// string value starting with "+" for current year + value
|
minDate: null, // The earliest selectable date, or null for no limit
|
maxDate: null, // The latest selectable date, or null for no limit
|
duration: 'fast', // Duration of display/closure
|
beforeShowDay: null, // Function that takes a date and returns an array with
|
// [0] = true if selectable, false if not, [1] = custom CSS class name(s) or "",
|
// [2] = cell title (optional), e.g. $.datepicker.noWeekends
|
beforeShow: null, // Function that takes an input field and
|
// returns a set of custom settings for the date picker
|
onSelect: null, // Define a callback function when a date is selected
|
onChangeMonthYear: null, // Define a callback function when the month or year is changed
|
onClose: null, // Define a callback function when the datepicker is closed
|
numberOfMonths: 1, // Number of months to show at a time
|
showCurrentAtPos: 0, // The position in multipe months at which to show the current month (starting at 0)
|
stepMonths: 1, // Number of months to step back/forward
|
stepBigMonths: 12, // Number of months to step back/forward for the big links
|
altField: '', // Selector for an alternate field to store selected dates into
|
altFormat: '', // The date format to use for the alternate field
|
constrainInput: true, // The input is constrained by the current date format
|
showButtonPanel: false, // True to show button panel, false to not show it
|
autoSize: false, // True to size the input for the date format, false to leave as is
|
disabled: false // The initial disabled state
|
}
|
$.extend(this._defaults, this.regional[''])
|
this.regional.en = $.extend(true, {}, this.regional[''])
|
this.regional['en-US'] = $.extend(true, {}, this.regional.en)
|
this.dpDiv = datepicker_bindHover(
|
$(
|
"<div id='" +
|
this._mainDivId +
|
"' class='ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all'></div>"
|
)
|
)
|
}
|
|
$.extend(Datepicker.prototype, {
|
/* Class name added to elements to indicate already configured with a date picker. */
|
markerClassName: 'hasDatepicker',
|
|
//Keep track of the maximum number of rows displayed (see #7043)
|
maxRows: 4,
|
|
// TODO rename to "widget" when switching to widget factory
|
_widgetDatepicker: function () {
|
return this.dpDiv
|
},
|
|
/* Override the default settings for all instances of the date picker.
|
* @param settings object - the new settings to use as defaults (anonymous object)
|
* @return the manager object
|
*/
|
setDefaults: function (settings) {
|
datepicker_extendRemove(this._defaults, settings || {})
|
return this
|
},
|
|
/* Attach the date picker to a jQuery selection.
|
* @param target element - the target input field or division or span
|
* @param settings object - the new settings to use for this date picker instance (anonymous)
|
*/
|
_attachDatepicker: function (target, settings) {
|
var nodeName, inline, inst
|
nodeName = target.nodeName.toLowerCase()
|
inline = nodeName === 'div' || nodeName === 'span'
|
if (!target.id) {
|
this.uuid += 1
|
target.id = 'dp' + this.uuid
|
}
|
inst = this._newInst($(target), inline)
|
inst.settings = $.extend({}, settings || {})
|
if (nodeName === 'input') {
|
this._connectDatepicker(target, inst)
|
} else if (inline) {
|
this._inlineDatepicker(target, inst)
|
}
|
},
|
|
/* Create a new instance object. */
|
_newInst: function (target, inline) {
|
var id = target[0].id.replace(/([^A-Za-z0-9_\-])/g, '\\\\$1') // escape jQuery meta chars
|
return {
|
id: id,
|
input: target, // associated target
|
selectedDay: 0,
|
selectedMonth: 0,
|
selectedYear: 0, // current selection
|
drawMonth: 0,
|
drawYear: 0, // month being drawn
|
inline: inline, // is datepicker inline or not
|
dpDiv: !inline
|
? this.dpDiv // presentation div
|
: datepicker_bindHover(
|
$(
|
"<div class='" +
|
this._inlineClass +
|
" ui-datepicker ui-widget ui-widget-content ui-helper-clearfix ui-corner-all'></div>"
|
)
|
)
|
}
|
},
|
|
/* Attach the date picker to an input field. */
|
_connectDatepicker: function (target, inst) {
|
var input = $(target)
|
inst.append = $([])
|
inst.trigger = $([])
|
if (input.hasClass(this.markerClassName)) {
|
return
|
}
|
this._attachments(input, inst)
|
input
|
.addClass(this.markerClassName)
|
.on('keydown', this._doKeyDown)
|
.on('keypress', this._doKeyPress)
|
.on('keyup', this._doKeyUp)
|
this._autoSize(inst)
|
$.data(target, 'datepicker', inst)
|
|
//If disabled option is true, disable the datepicker once it has been attached to the input (see ticket #5665)
|
if (inst.settings.disabled) {
|
this._disableDatepicker(target)
|
}
|
},
|
|
/* Make attachments based on settings. */
|
_attachments: function (input, inst) {
|
var showOn,
|
buttonText,
|
buttonImage,
|
appendText = this._get(inst, 'appendText'),
|
isRTL = this._get(inst, 'isRTL')
|
|
if (inst.append) {
|
inst.append.remove()
|
}
|
if (appendText) {
|
inst.append = $("<span class='" + this._appendClass + "'>" + appendText + '</span>')
|
input[isRTL ? 'before' : 'after'](inst.append)
|
}
|
|
input.off('focus', this._showDatepicker)
|
|
if (inst.trigger) {
|
inst.trigger.remove()
|
}
|
|
showOn = this._get(inst, 'showOn')
|
if (showOn === 'focus' || showOn === 'both') {
|
// pop-up date picker when in the marked field
|
input.on('focus', this._showDatepicker)
|
}
|
if (showOn === 'button' || showOn === 'both') {
|
// pop-up date picker when button clicked
|
buttonText = this._get(inst, 'buttonText')
|
buttonImage = this._get(inst, 'buttonImage')
|
inst.trigger = $(
|
this._get(inst, 'buttonImageOnly')
|
? $('<img/>')
|
.addClass(this._triggerClass)
|
.attr({ src: buttonImage, alt: buttonText, title: buttonText })
|
: $("<button type='button'></button>")
|
.addClass(this._triggerClass)
|
.html(
|
!buttonImage
|
? buttonText
|
: $('<img/>').attr({ src: buttonImage, alt: buttonText, title: buttonText })
|
)
|
)
|
input[isRTL ? 'before' : 'after'](inst.trigger)
|
inst.trigger.on('click', function () {
|
if ($.datepicker._datepickerShowing && $.datepicker._lastInput === input[0]) {
|
$.datepicker._hideDatepicker()
|
} else if ($.datepicker._datepickerShowing && $.datepicker._lastInput !== input[0]) {
|
$.datepicker._hideDatepicker()
|
$.datepicker._showDatepicker(input[0])
|
} else {
|
$.datepicker._showDatepicker(input[0])
|
}
|
return false
|
})
|
}
|
},
|
|
/* Apply the maximum length for the date format. */
|
_autoSize: function (inst) {
|
if (this._get(inst, 'autoSize') && !inst.inline) {
|
var findMax,
|
max,
|
maxI,
|
i,
|
date = new Date(2009, 12 - 1, 20), // Ensure double digits
|
dateFormat = this._get(inst, 'dateFormat')
|
|
if (dateFormat.match(/[DM]/)) {
|
findMax = function (names) {
|
max = 0
|
maxI = 0
|
for (i = 0; i < names.length; i++) {
|
if (names[i].length > max) {
|
max = names[i].length
|
maxI = i
|
}
|
}
|
return maxI
|
}
|
date.setMonth(
|
findMax(this._get(inst, dateFormat.match(/MM/) ? 'monthNames' : 'monthNamesShort'))
|
)
|
date.setDate(
|
findMax(this._get(inst, dateFormat.match(/DD/) ? 'dayNames' : 'dayNamesShort')) +
|
20 -
|
date.getDay()
|
)
|
}
|
inst.input.attr('size', this._formatDate(inst, date).length)
|
}
|
},
|
|
/* Attach an inline date picker to a div. */
|
_inlineDatepicker: function (target, inst) {
|
var divSpan = $(target)
|
if (divSpan.hasClass(this.markerClassName)) {
|
return
|
}
|
divSpan.addClass(this.markerClassName).append(inst.dpDiv)
|
$.data(target, 'datepicker', inst)
|
this._setDate(inst, this._getDefaultDate(inst), true)
|
this._updateDatepicker(inst)
|
this._updateAlternate(inst)
|
|
//If disabled option is true, disable the datepicker before showing it (see ticket #5665)
|
if (inst.settings.disabled) {
|
this._disableDatepicker(target)
|
}
|
|
// Set display:block in place of inst.dpDiv.show() which won't work on disconnected elements
|
// http://bugs.jqueryui.com/ticket/7552 - A Datepicker created on a detached div has zero height
|
inst.dpDiv.css('display', 'block')
|
},
|
|
/* Pop-up the date picker in a "dialog" box.
|
* @param input element - ignored
|
* @param date string or Date - the initial date to display
|
* @param onSelect function - the function to call when a date is selected
|
* @param settings object - update the dialog date picker instance's settings (anonymous object)
|
* @param pos int[2] - coordinates for the dialog's position within the screen or
|
* event - with x/y coordinates or
|
* leave empty for default (screen centre)
|
* @return the manager object
|
*/
|
_dialogDatepicker: function (input, date, onSelect, settings, pos) {
|
var id,
|
browserWidth,
|
browserHeight,
|
scrollX,
|
scrollY,
|
inst = this._dialogInst // internal instance
|
|
if (!inst) {
|
this.uuid += 1
|
id = 'dp' + this.uuid
|
this._dialogInput = $(
|
"<input type='text' id='" +
|
id +
|
"' style='position: absolute; top: -100px; width: 0px;'/>"
|
)
|
this._dialogInput.on('keydown', this._doKeyDown)
|
$('body').append(this._dialogInput)
|
inst = this._dialogInst = this._newInst(this._dialogInput, false)
|
inst.settings = {}
|
$.data(this._dialogInput[0], 'datepicker', inst)
|
}
|
datepicker_extendRemove(inst.settings, settings || {})
|
date = date && date.constructor === Date ? this._formatDate(inst, date) : date
|
this._dialogInput.val(date)
|
|
this._pos = pos ? (pos.length ? pos : [pos.pageX, pos.pageY]) : null
|
if (!this._pos) {
|
browserWidth = document.documentElement.clientWidth
|
browserHeight = document.documentElement.clientHeight
|
scrollX = document.documentElement.scrollLeft || document.body.scrollLeft
|
scrollY = document.documentElement.scrollTop || document.body.scrollTop
|
this._pos =
|
// should use actual width/height below
|
[browserWidth / 2 - 100 + scrollX, browserHeight / 2 - 150 + scrollY]
|
}
|
|
// Move input on screen for focus, but hidden behind dialog
|
this._dialogInput.css('left', this._pos[0] + 20 + 'px').css('top', this._pos[1] + 'px')
|
inst.settings.onSelect = onSelect
|
this._inDialog = true
|
this.dpDiv.addClass(this._dialogClass)
|
this._showDatepicker(this._dialogInput[0])
|
if ($.blockUI) {
|
$.blockUI(this.dpDiv)
|
}
|
$.data(this._dialogInput[0], 'datepicker', inst)
|
return this
|
},
|
|
/* Detach a datepicker from its control.
|
* @param target element - the target input field or division or span
|
*/
|
_destroyDatepicker: function (target) {
|
var nodeName,
|
$target = $(target),
|
inst = $.data(target, 'datepicker')
|
|
if (!$target.hasClass(this.markerClassName)) {
|
return
|
}
|
|
nodeName = target.nodeName.toLowerCase()
|
$.removeData(target, 'datepicker')
|
if (nodeName === 'input') {
|
inst.append.remove()
|
inst.trigger.remove()
|
$target
|
.removeClass(this.markerClassName)
|
.off('focus', this._showDatepicker)
|
.off('keydown', this._doKeyDown)
|
.off('keypress', this._doKeyPress)
|
.off('keyup', this._doKeyUp)
|
} else if (nodeName === 'div' || nodeName === 'span') {
|
$target.removeClass(this.markerClassName).empty()
|
}
|
|
if (datepicker_instActive === inst) {
|
datepicker_instActive = null
|
}
|
},
|
|
/* Enable the date picker to a jQuery selection.
|
* @param target element - the target input field or division or span
|
*/
|
_enableDatepicker: function (target) {
|
var nodeName,
|
inline,
|
$target = $(target),
|
inst = $.data(target, 'datepicker')
|
|
if (!$target.hasClass(this.markerClassName)) {
|
return
|
}
|
|
nodeName = target.nodeName.toLowerCase()
|
if (nodeName === 'input') {
|
target.disabled = false
|
inst.trigger
|
.filter('button')
|
.each(function () {
|
this.disabled = false
|
})
|
.end()
|
.filter('img')
|
.css({ opacity: '1.0', cursor: '' })
|
} else if (nodeName === 'div' || nodeName === 'span') {
|
inline = $target.children('.' + this._inlineClass)
|
inline.children().removeClass('ui-state-disabled')
|
inline.find('select.ui-datepicker-month, select.ui-datepicker-year').prop('disabled', false)
|
}
|
this._disabledInputs = $.map(this._disabledInputs, function (value) {
|
return value === target ? null : value
|
}) // delete entry
|
},
|
|
/* Disable the date picker to a jQuery selection.
|
* @param target element - the target input field or division or span
|
*/
|
_disableDatepicker: function (target) {
|
var nodeName,
|
inline,
|
$target = $(target),
|
inst = $.data(target, 'datepicker')
|
|
if (!$target.hasClass(this.markerClassName)) {
|
return
|
}
|
|
nodeName = target.nodeName.toLowerCase()
|
if (nodeName === 'input') {
|
target.disabled = true
|
inst.trigger
|
.filter('button')
|
.each(function () {
|
this.disabled = true
|
})
|
.end()
|
.filter('img')
|
.css({ opacity: '0.5', cursor: 'default' })
|
} else if (nodeName === 'div' || nodeName === 'span') {
|
inline = $target.children('.' + this._inlineClass)
|
inline.children().addClass('ui-state-disabled')
|
inline.find('select.ui-datepicker-month, select.ui-datepicker-year').prop('disabled', true)
|
}
|
this._disabledInputs = $.map(this._disabledInputs, function (value) {
|
return value === target ? null : value
|
}) // delete entry
|
this._disabledInputs[this._disabledInputs.length] = target
|
},
|
|
/* Is the first field in a jQuery collection disabled as a datepicker?
|
* @param target element - the target input field or division or span
|
* @return boolean - true if disabled, false if enabled
|
*/
|
_isDisabledDatepicker: function (target) {
|
if (!target) {
|
return false
|
}
|
for (var i = 0; i < this._disabledInputs.length; i++) {
|
if (this._disabledInputs[i] === target) {
|
return true
|
}
|
}
|
return false
|
},
|
|
/* Retrieve the instance data for the target control.
|
* @param target element - the target input field or division or span
|
* @return object - the associated instance data
|
* @throws error if a jQuery problem getting data
|
*/
|
_getInst: function (target) {
|
try {
|
return $.data(target, 'datepicker')
|
} catch (err) {
|
throw 'Missing instance data for this datepicker'
|
}
|
},
|
|
/* Update or retrieve the settings for a date picker attached to an input field or division.
|
* @param target element - the target input field or division or span
|
* @param name object - the new settings to update or
|
* string - the name of the setting to change or retrieve,
|
* when retrieving also "all" for all instance settings or
|
* "defaults" for all global defaults
|
* @param value any - the new value for the setting
|
* (omit if above is an object or to retrieve a value)
|
*/
|
_optionDatepicker: function (target, name, value) {
|
var settings,
|
date,
|
minDate,
|
maxDate,
|
inst = this._getInst(target)
|
|
if (arguments.length === 2 && typeof name === 'string') {
|
return name === 'defaults'
|
? $.extend({}, $.datepicker._defaults)
|
: inst
|
? name === 'all'
|
? $.extend({}, inst.settings)
|
: this._get(inst, name)
|
: null
|
}
|
|
settings = name || {}
|
if (typeof name === 'string') {
|
settings = {}
|
settings[name] = value
|
}
|
|
if (inst) {
|
if (this._curInst === inst) {
|
this._hideDatepicker()
|
}
|
|
date = this._getDateDatepicker(target, true)
|
minDate = this._getMinMaxDate(inst, 'min')
|
maxDate = this._getMinMaxDate(inst, 'max')
|
datepicker_extendRemove(inst.settings, settings)
|
|
// reformat the old minDate/maxDate values if dateFormat changes and a new minDate/maxDate isn't provided
|
if (
|
minDate !== null &&
|
settings.dateFormat !== undefined &&
|
settings.minDate === undefined
|
) {
|
inst.settings.minDate = this._formatDate(inst, minDate)
|
}
|
if (
|
maxDate !== null &&
|
settings.dateFormat !== undefined &&
|
settings.maxDate === undefined
|
) {
|
inst.settings.maxDate = this._formatDate(inst, maxDate)
|
}
|
if ('disabled' in settings) {
|
if (settings.disabled) {
|
this._disableDatepicker(target)
|
} else {
|
this._enableDatepicker(target)
|
}
|
}
|
this._attachments($(target), inst)
|
this._autoSize(inst)
|
this._setDate(inst, date)
|
this._updateAlternate(inst)
|
this._updateDatepicker(inst)
|
}
|
},
|
|
// Change method deprecated
|
_changeDatepicker: function (target, name, value) {
|
this._optionDatepicker(target, name, value)
|
},
|
|
/* Redraw the date picker attached to an input field or division.
|
* @param target element - the target input field or division or span
|
*/
|
_refreshDatepicker: function (target) {
|
var inst = this._getInst(target)
|
if (inst) {
|
this._updateDatepicker(inst)
|
}
|
},
|
|
/* Set the dates for a jQuery selection.
|
* @param target element - the target input field or division or span
|
* @param date Date - the new date
|
*/
|
_setDateDatepicker: function (target, date) {
|
var inst = this._getInst(target)
|
if (inst) {
|
this._setDate(inst, date)
|
this._updateDatepicker(inst)
|
this._updateAlternate(inst)
|
}
|
},
|
|
/* Get the date(s) for the first entry in a jQuery selection.
|
* @param target element - the target input field or division or span
|
* @param noDefault boolean - true if no default date is to be used
|
* @return Date - the current date
|
*/
|
_getDateDatepicker: function (target, noDefault) {
|
var inst = this._getInst(target)
|
if (inst && !inst.inline) {
|
this._setDateFromField(inst, noDefault)
|
}
|
return inst ? this._getDate(inst) : null
|
},
|
|
/* Handle keystrokes. */
|
_doKeyDown: function (event) {
|
var onSelect,
|
dateStr,
|
sel,
|
inst = $.datepicker._getInst(event.target),
|
handled = true,
|
isRTL = inst.dpDiv.is('.ui-datepicker-rtl')
|
|
inst._keyEvent = true
|
if ($.datepicker._datepickerShowing) {
|
switch (event.keyCode) {
|
case 9:
|
$.datepicker._hideDatepicker()
|
handled = false
|
break // hide on tab out
|
case 13:
|
sel = $(
|
'td.' + $.datepicker._dayOverClass + ':not(.' + $.datepicker._currentClass + ')',
|
inst.dpDiv
|
)
|
if (sel[0]) {
|
$.datepicker._selectDay(event.target, inst.selectedMonth, inst.selectedYear, sel[0])
|
}
|
|
onSelect = $.datepicker._get(inst, 'onSelect')
|
if (onSelect) {
|
dateStr = $.datepicker._formatDate(inst)
|
|
// Trigger custom callback
|
onSelect.apply(inst.input ? inst.input[0] : null, [dateStr, inst])
|
} else {
|
$.datepicker._hideDatepicker()
|
}
|
|
return false // don't submit the form
|
case 27:
|
$.datepicker._hideDatepicker()
|
break // hide on escape
|
case 33:
|
$.datepicker._adjustDate(
|
event.target,
|
event.ctrlKey
|
? -$.datepicker._get(inst, 'stepBigMonths')
|
: -$.datepicker._get(inst, 'stepMonths'),
|
'M'
|
)
|
break // previous month/year on page up/+ ctrl
|
case 34:
|
$.datepicker._adjustDate(
|
event.target,
|
event.ctrlKey
|
? +$.datepicker._get(inst, 'stepBigMonths')
|
: +$.datepicker._get(inst, 'stepMonths'),
|
'M'
|
)
|
break // next month/year on page down/+ ctrl
|
case 35:
|
if (event.ctrlKey || event.metaKey) {
|
$.datepicker._clearDate(event.target)
|
}
|
handled = event.ctrlKey || event.metaKey
|
break // clear on ctrl or command +end
|
case 36:
|
if (event.ctrlKey || event.metaKey) {
|
$.datepicker._gotoToday(event.target)
|
}
|
handled = event.ctrlKey || event.metaKey
|
break // current on ctrl or command +home
|
case 37:
|
if (event.ctrlKey || event.metaKey) {
|
$.datepicker._adjustDate(event.target, isRTL ? +1 : -1, 'D')
|
}
|
handled = event.ctrlKey || event.metaKey
|
|
// -1 day on ctrl or command +left
|
if (event.originalEvent.altKey) {
|
$.datepicker._adjustDate(
|
event.target,
|
event.ctrlKey
|
? -$.datepicker._get(inst, 'stepBigMonths')
|
: -$.datepicker._get(inst, 'stepMonths'),
|
'M'
|
)
|
}
|
|
// next month/year on alt +left on Mac
|
break
|
case 38:
|
if (event.ctrlKey || event.metaKey) {
|
$.datepicker._adjustDate(event.target, -7, 'D')
|
}
|
handled = event.ctrlKey || event.metaKey
|
break // -1 week on ctrl or command +up
|
case 39:
|
if (event.ctrlKey || event.metaKey) {
|
$.datepicker._adjustDate(event.target, isRTL ? -1 : +1, 'D')
|
}
|
handled = event.ctrlKey || event.metaKey
|
|
// +1 day on ctrl or command +right
|
if (event.originalEvent.altKey) {
|
$.datepicker._adjustDate(
|
event.target,
|
event.ctrlKey
|
? +$.datepicker._get(inst, 'stepBigMonths')
|
: +$.datepicker._get(inst, 'stepMonths'),
|
'M'
|
)
|
}
|
|
// next month/year on alt +right
|
break
|
case 40:
|
if (event.ctrlKey || event.metaKey) {
|
$.datepicker._adjustDate(event.target, +7, 'D')
|
}
|
handled = event.ctrlKey || event.metaKey
|
break // +1 week on ctrl or command +down
|
default:
|
handled = false
|
}
|
} else if (event.keyCode === 36 && event.ctrlKey) {
|
// display the date picker on ctrl+home
|
$.datepicker._showDatepicker(this)
|
} else {
|
handled = false
|
}
|
|
if (handled) {
|
event.preventDefault()
|
event.stopPropagation()
|
}
|
},
|
|
/* Filter entered characters - based on date format. */
|
_doKeyPress: function (event) {
|
var chars,
|
chr,
|
inst = $.datepicker._getInst(event.target)
|
|
if ($.datepicker._get(inst, 'constrainInput')) {
|
chars = $.datepicker._possibleChars($.datepicker._get(inst, 'dateFormat'))
|
chr = String.fromCharCode(event.charCode == null ? event.keyCode : event.charCode)
|
return event.ctrlKey || event.metaKey || chr < ' ' || !chars || chars.indexOf(chr) > -1
|
}
|
},
|
|
/* Synchronise manual entry and field/alternate field. */
|
_doKeyUp: function (event) {
|
var date,
|
inst = $.datepicker._getInst(event.target)
|
|
if (inst.input.val() !== inst.lastVal) {
|
try {
|
date = $.datepicker.parseDate(
|
$.datepicker._get(inst, 'dateFormat'),
|
inst.input ? inst.input.val() : null,
|
$.datepicker._getFormatConfig(inst)
|
)
|
|
if (date) {
|
// only if valid
|
$.datepicker._setDateFromField(inst)
|
$.datepicker._updateAlternate(inst)
|
$.datepicker._updateDatepicker(inst)
|
}
|
} catch (err) {}
|
}
|
return true
|
},
|
|
/* Pop-up the date picker for a given input field.
|
* If false returned from beforeShow event handler do not show.
|
* @param input element - the input field attached to the date picker or
|
* event - if triggered by focus
|
*/
|
_showDatepicker: function (input) {
|
input = input.target || input
|
if (input.nodeName.toLowerCase() !== 'input') {
|
// find from button/image trigger
|
input = $('input', input.parentNode)[0]
|
}
|
|
if ($.datepicker._isDisabledDatepicker(input) || $.datepicker._lastInput === input) {
|
// already here
|
return
|
}
|
|
var inst, beforeShow, beforeShowSettings, isFixed, offset, showAnim, duration
|
|
inst = $.datepicker._getInst(input)
|
if ($.datepicker._curInst && $.datepicker._curInst !== inst) {
|
$.datepicker._curInst.dpDiv.stop(true, true)
|
if (inst && $.datepicker._datepickerShowing) {
|
$.datepicker._hideDatepicker($.datepicker._curInst.input[0])
|
}
|
}
|
|
beforeShow = $.datepicker._get(inst, 'beforeShow')
|
beforeShowSettings = beforeShow ? beforeShow.apply(input, [input, inst]) : {}
|
if (beforeShowSettings === false) {
|
return
|
}
|
datepicker_extendRemove(inst.settings, beforeShowSettings)
|
|
inst.lastVal = null
|
$.datepicker._lastInput = input
|
$.datepicker._setDateFromField(inst)
|
|
if ($.datepicker._inDialog) {
|
// hide cursor
|
input.value = ''
|
}
|
if (!$.datepicker._pos) {
|
// position below input
|
$.datepicker._pos = $.datepicker._findPos(input)
|
$.datepicker._pos[1] += input.offsetHeight // add the height
|
}
|
|
isFixed = false
|
$(input)
|
.parents()
|
.each(function () {
|
isFixed |= $(this).css('position') === 'fixed'
|
return !isFixed
|
})
|
|
offset = { left: $.datepicker._pos[0], top: $.datepicker._pos[1] }
|
$.datepicker._pos = null
|
|
//to avoid flashes on Firefox
|
inst.dpDiv.empty()
|
|
// determine sizing offscreen
|
inst.dpDiv.css({ position: 'absolute', display: 'block', top: '-1000px' })
|
$.datepicker._updateDatepicker(inst)
|
|
// fix width for dynamic number of date pickers
|
// and adjust position before showing
|
offset = $.datepicker._checkOffset(inst, offset, isFixed)
|
inst.dpDiv.css({
|
position: $.datepicker._inDialog && $.blockUI ? 'static' : isFixed ? 'fixed' : 'absolute',
|
display: 'none',
|
left: offset.left + 'px',
|
top: offset.top + 'px'
|
})
|
|
if (!inst.inline) {
|
showAnim = $.datepicker._get(inst, 'showAnim')
|
duration = $.datepicker._get(inst, 'duration')
|
inst.dpDiv.css('z-index', datepicker_getZindex($(input)) + 1)
|
$.datepicker._datepickerShowing = true
|
|
if ($.effects && $.effects.effect[showAnim]) {
|
inst.dpDiv.show(showAnim, $.datepicker._get(inst, 'showOptions'), duration)
|
} else {
|
inst.dpDiv[showAnim || 'show'](showAnim ? duration : null)
|
}
|
|
if ($.datepicker._shouldFocusInput(inst)) {
|
inst.input.trigger('focus')
|
}
|
|
$.datepicker._curInst = inst
|
}
|
},
|
|
/* Generate the date picker content. */
|
_updateDatepicker: function (inst) {
|
this.maxRows = 4 //Reset the max number of rows being displayed (see #7043)
|
datepicker_instActive = inst // for delegate hover events
|
inst.dpDiv.empty().append(this._generateHTML(inst))
|
this._attachHandlers(inst)
|
|
var origyearshtml,
|
numMonths = this._getNumberOfMonths(inst),
|
cols = numMonths[1],
|
width = 17,
|
activeCell = inst.dpDiv.find('.' + this._dayOverClass + ' a')
|
|
if (activeCell.length > 0) {
|
datepicker_handleMouseover.apply(activeCell.get(0))
|
}
|
|
inst.dpDiv
|
.removeClass('ui-datepicker-multi-2 ui-datepicker-multi-3 ui-datepicker-multi-4')
|
.width('')
|
if (cols > 1) {
|
inst.dpDiv.addClass('ui-datepicker-multi-' + cols).css('width', width * cols + 'em')
|
}
|
inst.dpDiv[(numMonths[0] !== 1 || numMonths[1] !== 1 ? 'add' : 'remove') + 'Class'](
|
'ui-datepicker-multi'
|
)
|
inst.dpDiv[(this._get(inst, 'isRTL') ? 'add' : 'remove') + 'Class']('ui-datepicker-rtl')
|
|
if (
|
inst === $.datepicker._curInst &&
|
$.datepicker._datepickerShowing &&
|
$.datepicker._shouldFocusInput(inst)
|
) {
|
inst.input.trigger('focus')
|
}
|
|
// Deffered render of the years select (to avoid flashes on Firefox)
|
if (inst.yearshtml) {
|
origyearshtml = inst.yearshtml
|
setTimeout(function () {
|
//assure that inst.yearshtml didn't change.
|
if (origyearshtml === inst.yearshtml && inst.yearshtml) {
|
inst.dpDiv.find('select.ui-datepicker-year:first').replaceWith(inst.yearshtml)
|
}
|
origyearshtml = inst.yearshtml = null
|
}, 0)
|
}
|
},
|
|
// #6694 - don't focus the input if it's already focused
|
// this breaks the change event in IE
|
// Support: IE and jQuery <1.9
|
_shouldFocusInput: function (inst) {
|
return (
|
inst.input &&
|
inst.input.is(':visible') &&
|
!inst.input.is(':disabled') &&
|
!inst.input.is(':focus')
|
)
|
},
|
|
/* Check positioning to remain on screen. */
|
_checkOffset: function (inst, offset, isFixed) {
|
var dpWidth = inst.dpDiv.outerWidth(),
|
dpHeight = inst.dpDiv.outerHeight(),
|
inputWidth = inst.input ? inst.input.outerWidth() : 0,
|
inputHeight = inst.input ? inst.input.outerHeight() : 0,
|
viewWidth = document.documentElement.clientWidth + (isFixed ? 0 : $(document).scrollLeft()),
|
viewHeight = document.documentElement.clientHeight + (isFixed ? 0 : $(document).scrollTop())
|
|
offset.left -= this._get(inst, 'isRTL') ? dpWidth - inputWidth : 0
|
offset.left -=
|
isFixed && offset.left === inst.input.offset().left ? $(document).scrollLeft() : 0
|
offset.top -=
|
isFixed && offset.top === inst.input.offset().top + inputHeight
|
? $(document).scrollTop()
|
: 0
|
|
// Now check if datepicker is showing outside window viewport - move to a better place if so.
|
offset.left -= Math.min(
|
offset.left,
|
offset.left + dpWidth > viewWidth && viewWidth > dpWidth
|
? Math.abs(offset.left + dpWidth - viewWidth)
|
: 0
|
)
|
offset.top -= Math.min(
|
offset.top,
|
offset.top + dpHeight > viewHeight && viewHeight > dpHeight
|
? Math.abs(dpHeight + inputHeight)
|
: 0
|
)
|
|
return offset
|
},
|
|
/* Find an object's position on the screen. */
|
_findPos: function (obj) {
|
var position,
|
inst = this._getInst(obj),
|
isRTL = this._get(inst, 'isRTL')
|
|
while (obj && (obj.type === 'hidden' || obj.nodeType !== 1 || $.expr.filters.hidden(obj))) {
|
obj = obj[isRTL ? 'previousSibling' : 'nextSibling']
|
}
|
|
position = $(obj).offset()
|
return [position.left, position.top]
|
},
|
|
/* Hide the date picker from view.
|
* @param input element - the input field attached to the date picker
|
*/
|
_hideDatepicker: function (input) {
|
var showAnim,
|
duration,
|
postProcess,
|
onClose,
|
inst = this._curInst
|
|
if (!inst || (input && inst !== $.data(input, 'datepicker'))) {
|
return
|
}
|
|
if (this._datepickerShowing) {
|
showAnim = this._get(inst, 'showAnim')
|
duration = this._get(inst, 'duration')
|
postProcess = function () {
|
$.datepicker._tidyDialog(inst)
|
}
|
|
// DEPRECATED: after BC for 1.8.x $.effects[ showAnim ] is not needed
|
if ($.effects && ($.effects.effect[showAnim] || $.effects[showAnim])) {
|
inst.dpDiv.hide(showAnim, $.datepicker._get(inst, 'showOptions'), duration, postProcess)
|
} else {
|
inst.dpDiv[
|
showAnim === 'slideDown' ? 'slideUp' : showAnim === 'fadeIn' ? 'fadeOut' : 'hide'
|
](showAnim ? duration : null, postProcess)
|
}
|
|
if (!showAnim) {
|
postProcess()
|
}
|
this._datepickerShowing = false
|
|
onClose = this._get(inst, 'onClose')
|
if (onClose) {
|
onClose.apply(inst.input ? inst.input[0] : null, [
|
inst.input ? inst.input.val() : '',
|
inst
|
])
|
}
|
|
this._lastInput = null
|
if (this._inDialog) {
|
this._dialogInput.css({ position: 'absolute', left: '0', top: '-100px' })
|
if ($.blockUI) {
|
$.unblockUI()
|
$('body').append(this.dpDiv)
|
}
|
}
|
this._inDialog = false
|
}
|
},
|
|
/* Tidy up after a dialog display. */
|
_tidyDialog: function (inst) {
|
inst.dpDiv.removeClass(this._dialogClass).off('.ui-datepicker-calendar')
|
},
|
|
/* Close date picker if clicked elsewhere. */
|
_checkExternalClick: function (event) {
|
if (!$.datepicker._curInst) {
|
return
|
}
|
|
var $target = $(event.target),
|
inst = $.datepicker._getInst($target[0])
|
|
if (
|
($target[0].id !== $.datepicker._mainDivId &&
|
$target.parents('#' + $.datepicker._mainDivId).length === 0 &&
|
!$target.hasClass($.datepicker.markerClassName) &&
|
!$target.closest('.' + $.datepicker._triggerClass).length &&
|
$.datepicker._datepickerShowing &&
|
!($.datepicker._inDialog && $.blockUI)) ||
|
($target.hasClass($.datepicker.markerClassName) && $.datepicker._curInst !== inst)
|
) {
|
$.datepicker._hideDatepicker()
|
}
|
},
|
|
/* Adjust one of the date sub-fields. */
|
_adjustDate: function (id, offset, period) {
|
var target = $(id),
|
inst = this._getInst(target[0])
|
|
if (this._isDisabledDatepicker(target[0])) {
|
return
|
}
|
this._adjustInstDate(
|
inst,
|
offset + (period === 'M' ? this._get(inst, 'showCurrentAtPos') : 0), // undo positioning
|
period
|
)
|
this._updateDatepicker(inst)
|
},
|
|
/* Action for current link. */
|
_gotoToday: function (id) {
|
var date,
|
target = $(id),
|
inst = this._getInst(target[0])
|
|
if (this._get(inst, 'gotoCurrent') && inst.currentDay) {
|
inst.selectedDay = inst.currentDay
|
inst.drawMonth = inst.selectedMonth = inst.currentMonth
|
inst.drawYear = inst.selectedYear = inst.currentYear
|
} else {
|
date = new Date()
|
inst.selectedDay = date.getDate()
|
inst.drawMonth = inst.selectedMonth = date.getMonth()
|
inst.drawYear = inst.selectedYear = date.getFullYear()
|
}
|
this._notifyChange(inst)
|
this._adjustDate(target)
|
},
|
|
/* Action for selecting a new month/year. */
|
_selectMonthYear: function (id, select, period) {
|
var target = $(id),
|
inst = this._getInst(target[0])
|
|
inst['selected' + (period === 'M' ? 'Month' : 'Year')] = inst[
|
'draw' + (period === 'M' ? 'Month' : 'Year')
|
] = parseInt(select.options[select.selectedIndex].value, 10)
|
|
this._notifyChange(inst)
|
this._adjustDate(target)
|
},
|
|
/* Action for selecting a day. */
|
_selectDay: function (id, month, year, td) {
|
var inst,
|
target = $(id)
|
|
if ($(td).hasClass(this._unselectableClass) || this._isDisabledDatepicker(target[0])) {
|
return
|
}
|
|
inst = this._getInst(target[0])
|
inst.selectedDay = inst.currentDay = $('a', td).html()
|
inst.selectedMonth = inst.currentMonth = month
|
inst.selectedYear = inst.currentYear = year
|
this._selectDate(
|
id,
|
this._formatDate(inst, inst.currentDay, inst.currentMonth, inst.currentYear)
|
)
|
},
|
|
/* Erase the input field and hide the date picker. */
|
_clearDate: function (id) {
|
var target = $(id)
|
this._selectDate(target, '')
|
},
|
|
/* Update the input field with the selected date. */
|
_selectDate: function (id, dateStr) {
|
var onSelect,
|
target = $(id),
|
inst = this._getInst(target[0])
|
|
dateStr = dateStr != null ? dateStr : this._formatDate(inst)
|
if (inst.input) {
|
inst.input.val(dateStr)
|
}
|
this._updateAlternate(inst)
|
|
onSelect = this._get(inst, 'onSelect')
|
if (onSelect) {
|
onSelect.apply(inst.input ? inst.input[0] : null, [dateStr, inst]) // trigger custom callback
|
} else if (inst.input) {
|
inst.input.trigger('change') // fire the change event
|
}
|
|
if (inst.inline) {
|
this._updateDatepicker(inst)
|
} else {
|
this._hideDatepicker()
|
this._lastInput = inst.input[0]
|
if (typeof inst.input[0] !== 'object') {
|
inst.input.trigger('focus') // restore focus
|
}
|
this._lastInput = null
|
}
|
},
|
|
/* Update any alternate field to synchronise with the main field. */
|
_updateAlternate: function (inst) {
|
var altFormat,
|
date,
|
dateStr,
|
altField = this._get(inst, 'altField')
|
|
if (altField) {
|
// update alternate field too
|
altFormat = this._get(inst, 'altFormat') || this._get(inst, 'dateFormat')
|
date = this._getDate(inst)
|
dateStr = this.formatDate(altFormat, date, this._getFormatConfig(inst))
|
$(altField).val(dateStr)
|
}
|
},
|
|
/* Set as beforeShowDay function to prevent selection of weekends.
|
* @param date Date - the date to customise
|
* @return [boolean, string] - is this date selectable?, what is its CSS class?
|
*/
|
noWeekends: function (date) {
|
var day = date.getDay()
|
return [day > 0 && day < 6, '']
|
},
|
|
/* Set as calculateWeek to determine the week of the year based on the ISO 8601 definition.
|
* @param date Date - the date to get the week for
|
* @return number - the number of the week within the year that contains this date
|
*/
|
iso8601Week: function (date) {
|
var time,
|
checkDate = new Date(date.getTime())
|
|
// Find Thursday of this week starting on Monday
|
checkDate.setDate(checkDate.getDate() + 4 - (checkDate.getDay() || 7))
|
|
time = checkDate.getTime()
|
checkDate.setMonth(0) // Compare with Jan 1
|
checkDate.setDate(1)
|
return Math.floor(Math.round((time - checkDate) / 86400000) / 7) + 1
|
},
|
|
/* Parse a string value into a date object.
|
* See formatDate below for the possible formats.
|
*
|
* @param format string - the expected format of the date
|
* @param value string - the date in the above format
|
* @param settings Object - attributes include:
|
* shortYearCutoff number - the cutoff year for determining the century (optional)
|
* dayNamesShort string[7] - abbreviated names of the days from Sunday (optional)
|
* dayNames string[7] - names of the days from Sunday (optional)
|
* monthNamesShort string[12] - abbreviated names of the months (optional)
|
* monthNames string[12] - names of the months (optional)
|
* @return Date - the extracted date value or null if value is blank
|
*/
|
parseDate: function (format, value, settings) {
|
if (format == null || value == null) {
|
throw 'Invalid arguments'
|
}
|
|
value = typeof value === 'object' ? value.toString() : value + ''
|
if (value === '') {
|
return null
|
}
|
|
var iFormat,
|
dim,
|
extra,
|
iValue = 0,
|
shortYearCutoffTemp =
|
(settings ? settings.shortYearCutoff : null) || this._defaults.shortYearCutoff,
|
shortYearCutoff =
|
typeof shortYearCutoffTemp !== 'string'
|
? shortYearCutoffTemp
|
: (new Date().getFullYear() % 100) + parseInt(shortYearCutoffTemp, 10),
|
dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort,
|
dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames,
|
monthNamesShort =
|
(settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort,
|
monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames,
|
year = -1,
|
month = -1,
|
day = -1,
|
doy = -1,
|
literal = false,
|
date,
|
// Check whether a format character is doubled
|
lookAhead = function (match) {
|
var matches = iFormat + 1 < format.length && format.charAt(iFormat + 1) === match
|
if (matches) {
|
iFormat++
|
}
|
return matches
|
},
|
// Extract a number from the string value
|
getNumber = function (match) {
|
var isDoubled = lookAhead(match),
|
size =
|
match === '@'
|
? 14
|
: match === '!'
|
? 20
|
: match === 'y' && isDoubled
|
? 4
|
: match === 'o'
|
? 3
|
: 2,
|
minSize = match === 'y' ? size : 1,
|
digits = new RegExp('^\\d{' + minSize + ',' + size + '}'),
|
num = value.substring(iValue).match(digits)
|
if (!num) {
|
throw 'Missing number at position ' + iValue
|
}
|
iValue += num[0].length
|
return parseInt(num[0], 10)
|
},
|
// Extract a name from the string value and convert to an index
|
getName = function (match, shortNames, longNames) {
|
var index = -1,
|
names = $.map(lookAhead(match) ? longNames : shortNames, function (v, k) {
|
return [[k, v]]
|
}).sort(function (a, b) {
|
return -(a[1].length - b[1].length)
|
})
|
|
$.each(names, function (i, pair) {
|
var name = pair[1]
|
if (value.substr(iValue, name.length).toLowerCase() === name.toLowerCase()) {
|
index = pair[0]
|
iValue += name.length
|
return false
|
}
|
})
|
if (index !== -1) {
|
return index + 1
|
} else {
|
throw 'Unknown name at position ' + iValue
|
}
|
},
|
// Confirm that a literal character matches the string value
|
checkLiteral = function () {
|
if (value.charAt(iValue) !== format.charAt(iFormat)) {
|
throw 'Unexpected literal at position ' + iValue
|
}
|
iValue++
|
}
|
|
for (iFormat = 0; iFormat < format.length; iFormat++) {
|
if (literal) {
|
if (format.charAt(iFormat) === "'" && !lookAhead("'")) {
|
literal = false
|
} else {
|
checkLiteral()
|
}
|
} else {
|
switch (format.charAt(iFormat)) {
|
case 'd':
|
day = getNumber('d')
|
break
|
case 'D':
|
getName('D', dayNamesShort, dayNames)
|
break
|
case 'o':
|
doy = getNumber('o')
|
break
|
case 'm':
|
month = getNumber('m')
|
break
|
case 'M':
|
month = getName('M', monthNamesShort, monthNames)
|
break
|
case 'y':
|
year = getNumber('y')
|
break
|
case '@':
|
date = new Date(getNumber('@'))
|
year = date.getFullYear()
|
month = date.getMonth() + 1
|
day = date.getDate()
|
break
|
case '!':
|
date = new Date((getNumber('!') - this._ticksTo1970) / 10000)
|
year = date.getFullYear()
|
month = date.getMonth() + 1
|
day = date.getDate()
|
break
|
case "'":
|
if (lookAhead("'")) {
|
checkLiteral()
|
} else {
|
literal = true
|
}
|
break
|
default:
|
checkLiteral()
|
}
|
}
|
}
|
|
if (iValue < value.length) {
|
extra = value.substr(iValue)
|
if (!/^\s+/.test(extra)) {
|
throw 'Extra/unparsed characters found in date: ' + extra
|
}
|
}
|
|
if (year === -1) {
|
year = new Date().getFullYear()
|
} else if (year < 100) {
|
year +=
|
new Date().getFullYear() -
|
(new Date().getFullYear() % 100) +
|
(year <= shortYearCutoff ? 0 : -100)
|
}
|
|
if (doy > -1) {
|
month = 1
|
day = doy
|
do {
|
dim = this._getDaysInMonth(year, month - 1)
|
if (day <= dim) {
|
break
|
}
|
month++
|
day -= dim
|
} while (true)
|
}
|
|
date = this._daylightSavingAdjust(new Date(year, month - 1, day))
|
if (date.getFullYear() !== year || date.getMonth() + 1 !== month || date.getDate() !== day) {
|
throw 'Invalid date' // E.g. 31/02/00
|
}
|
return date
|
},
|
|
/* Standard date formats. */
|
ATOM: 'yy-mm-dd', // RFC 3339 (ISO 8601)
|
COOKIE: 'D, dd M yy',
|
ISO_8601: 'yy-mm-dd',
|
RFC_822: 'D, d M y',
|
RFC_850: 'DD, dd-M-y',
|
RFC_1036: 'D, d M y',
|
RFC_1123: 'D, d M yy',
|
RFC_2822: 'D, d M yy',
|
RSS: 'D, d M y', // RFC 822
|
TICKS: '!',
|
TIMESTAMP: '@',
|
W3C: 'yy-mm-dd', // ISO 8601
|
|
_ticksTo1970:
|
((1970 - 1) * 365 + Math.floor(1970 / 4) - Math.floor(1970 / 100) + Math.floor(1970 / 400)) *
|
24 *
|
60 *
|
60 *
|
10000000,
|
|
/* Format a date object into a string value.
|
* The format can be combinations of the following:
|
* d - day of month (no leading zero)
|
* dd - day of month (two digit)
|
* o - day of year (no leading zeros)
|
* oo - day of year (three digit)
|
* D - day name short
|
* DD - day name long
|
* m - month of year (no leading zero)
|
* mm - month of year (two digit)
|
* M - month name short
|
* MM - month name long
|
* y - year (two digit)
|
* yy - year (four digit)
|
* @ - Unix timestamp (ms since 01/01/1970)
|
* ! - Windows ticks (100ns since 01/01/0001)
|
* "..." - literal text
|
* '' - single quote
|
*
|
* @param format string - the desired format of the date
|
* @param date Date - the date value to format
|
* @param settings Object - attributes include:
|
* dayNamesShort string[7] - abbreviated names of the days from Sunday (optional)
|
* dayNames string[7] - names of the days from Sunday (optional)
|
* monthNamesShort string[12] - abbreviated names of the months (optional)
|
* monthNames string[12] - names of the months (optional)
|
* @return string - the date in the above format
|
*/
|
formatDate: function (format, date, settings) {
|
if (!date) {
|
return ''
|
}
|
|
var iFormat,
|
dayNamesShort = (settings ? settings.dayNamesShort : null) || this._defaults.dayNamesShort,
|
dayNames = (settings ? settings.dayNames : null) || this._defaults.dayNames,
|
monthNamesShort =
|
(settings ? settings.monthNamesShort : null) || this._defaults.monthNamesShort,
|
monthNames = (settings ? settings.monthNames : null) || this._defaults.monthNames,
|
// Check whether a format character is doubled
|
lookAhead = function (match) {
|
var matches = iFormat + 1 < format.length && format.charAt(iFormat + 1) === match
|
if (matches) {
|
iFormat++
|
}
|
return matches
|
},
|
// Format a number, with leading zero if necessary
|
formatNumber = function (match, value, len) {
|
var num = '' + value
|
if (lookAhead(match)) {
|
while (num.length < len) {
|
num = '0' + num
|
}
|
}
|
return num
|
},
|
// Format a name, short or long as requested
|
formatName = function (match, value, shortNames, longNames) {
|
return lookAhead(match) ? longNames[value] : shortNames[value]
|
},
|
output = '',
|
literal = false
|
|
if (date) {
|
for (iFormat = 0; iFormat < format.length; iFormat++) {
|
if (literal) {
|
if (format.charAt(iFormat) === "'" && !lookAhead("'")) {
|
literal = false
|
} else {
|
output += format.charAt(iFormat)
|
}
|
} else {
|
switch (format.charAt(iFormat)) {
|
case 'd':
|
output += formatNumber('d', date.getDate(), 2)
|
break
|
case 'D':
|
output += formatName('D', date.getDay(), dayNamesShort, dayNames)
|
break
|
case 'o':
|
output += formatNumber(
|
'o',
|
Math.round(
|
(new Date(date.getFullYear(), date.getMonth(), date.getDate()).getTime() -
|
new Date(date.getFullYear(), 0, 0).getTime()) /
|
86400000
|
),
|
3
|
)
|
break
|
case 'm':
|
output += formatNumber('m', date.getMonth() + 1, 2)
|
break
|
case 'M':
|
output += formatName('M', date.getMonth(), monthNamesShort, monthNames)
|
break
|
case 'y':
|
output += lookAhead('y')
|
? date.getFullYear()
|
: (date.getFullYear() % 100 < 10 ? '0' : '') + (date.getFullYear() % 100)
|
break
|
case '@':
|
output += date.getTime()
|
break
|
case '!':
|
output += date.getTime() * 10000 + this._ticksTo1970
|
break
|
case "'":
|
if (lookAhead("'")) {
|
output += "'"
|
} else {
|
literal = true
|
}
|
break
|
default:
|
output += format.charAt(iFormat)
|
}
|
}
|
}
|
}
|
return output
|
},
|
|
/* Extract all possible characters from the date format. */
|
_possibleChars: function (format) {
|
var iFormat,
|
chars = '',
|
literal = false,
|
// Check whether a format character is doubled
|
lookAhead = function (match) {
|
var matches = iFormat + 1 < format.length && format.charAt(iFormat + 1) === match
|
if (matches) {
|
iFormat++
|
}
|
return matches
|
}
|
|
for (iFormat = 0; iFormat < format.length; iFormat++) {
|
if (literal) {
|
if (format.charAt(iFormat) === "'" && !lookAhead("'")) {
|
literal = false
|
} else {
|
chars += format.charAt(iFormat)
|
}
|
} else {
|
switch (format.charAt(iFormat)) {
|
case 'd':
|
case 'm':
|
case 'y':
|
case '@':
|
chars += '0123456789'
|
break
|
case 'D':
|
case 'M':
|
return null // Accept anything
|
case "'":
|
if (lookAhead("'")) {
|
chars += "'"
|
} else {
|
literal = true
|
}
|
break
|
default:
|
chars += format.charAt(iFormat)
|
}
|
}
|
}
|
return chars
|
},
|
|
/* Get a setting value, defaulting if necessary. */
|
_get: function (inst, name) {
|
return inst.settings[name] !== undefined ? inst.settings[name] : this._defaults[name]
|
},
|
|
/* Parse existing date and initialise date picker. */
|
_setDateFromField: function (inst, noDefault) {
|
if (inst.input.val() === inst.lastVal) {
|
return
|
}
|
|
var dateFormat = this._get(inst, 'dateFormat'),
|
dates = (inst.lastVal = inst.input ? inst.input.val() : null),
|
defaultDate = this._getDefaultDate(inst),
|
date = defaultDate,
|
settings = this._getFormatConfig(inst)
|
|
try {
|
date = this.parseDate(dateFormat, dates, settings) || defaultDate
|
} catch (event) {
|
dates = noDefault ? '' : dates
|
}
|
inst.selectedDay = date.getDate()
|
inst.drawMonth = inst.selectedMonth = date.getMonth()
|
inst.drawYear = inst.selectedYear = date.getFullYear()
|
inst.currentDay = dates ? date.getDate() : 0
|
inst.currentMonth = dates ? date.getMonth() : 0
|
inst.currentYear = dates ? date.getFullYear() : 0
|
this._adjustInstDate(inst)
|
},
|
|
/* Retrieve the default date shown on opening. */
|
_getDefaultDate: function (inst) {
|
return this._restrictMinMax(
|
inst,
|
this._determineDate(inst, this._get(inst, 'defaultDate'), new Date())
|
)
|
},
|
|
/* A date may be specified as an exact value or a relative one. */
|
_determineDate: function (inst, date, defaultDate) {
|
var offsetNumeric = function (offset) {
|
var date = new Date()
|
date.setDate(date.getDate() + offset)
|
return date
|
},
|
offsetString = function (offset) {
|
try {
|
return $.datepicker.parseDate(
|
$.datepicker._get(inst, 'dateFormat'),
|
offset,
|
$.datepicker._getFormatConfig(inst)
|
)
|
} catch (e) {
|
// Ignore
|
}
|
|
var date =
|
(offset.toLowerCase().match(/^c/) ? $.datepicker._getDate(inst) : null) || new Date(),
|
year = date.getFullYear(),
|
month = date.getMonth(),
|
day = date.getDate(),
|
pattern = /([+\-]?[0-9]+)\s*(d|D|w|W|m|M|y|Y)?/g,
|
matches = pattern.exec(offset)
|
|
while (matches) {
|
switch (matches[2] || 'd') {
|
case 'd':
|
case 'D':
|
day += parseInt(matches[1], 10)
|
break
|
case 'w':
|
case 'W':
|
day += parseInt(matches[1], 10) * 7
|
break
|
case 'm':
|
case 'M':
|
month += parseInt(matches[1], 10)
|
day = Math.min(day, $.datepicker._getDaysInMonth(year, month))
|
break
|
case 'y':
|
case 'Y':
|
year += parseInt(matches[1], 10)
|
day = Math.min(day, $.datepicker._getDaysInMonth(year, month))
|
break
|
}
|
matches = pattern.exec(offset)
|
}
|
return new Date(year, month, day)
|
},
|
newDate =
|
date == null || date === ''
|
? defaultDate
|
: typeof date === 'string'
|
? offsetString(date)
|
: typeof date === 'number'
|
? isNaN(date)
|
? defaultDate
|
: offsetNumeric(date)
|
: new Date(date.getTime())
|
|
newDate = newDate && newDate.toString() === 'Invalid Date' ? defaultDate : newDate
|
if (newDate) {
|
newDate.setHours(0)
|
newDate.setMinutes(0)
|
newDate.setSeconds(0)
|
newDate.setMilliseconds(0)
|
}
|
return this._daylightSavingAdjust(newDate)
|
},
|
|
/* Handle switch to/from daylight saving.
|
* Hours may be non-zero on daylight saving cut-over:
|
* > 12 when midnight changeover, but then cannot generate
|
* midnight datetime, so jump to 1AM, otherwise reset.
|
* @param date (Date) the date to check
|
* @return (Date) the corrected date
|
*/
|
_daylightSavingAdjust: function (date) {
|
if (!date) {
|
return null
|
}
|
date.setHours(date.getHours() > 12 ? date.getHours() + 2 : 0)
|
return date
|
},
|
|
/* Set the date(s) directly. */
|
_setDate: function (inst, date, noChange) {
|
var clear = !date,
|
origMonth = inst.selectedMonth,
|
origYear = inst.selectedYear,
|
newDate = this._restrictMinMax(inst, this._determineDate(inst, date, new Date()))
|
|
inst.selectedDay = inst.currentDay = newDate.getDate()
|
inst.drawMonth = inst.selectedMonth = inst.currentMonth = newDate.getMonth()
|
inst.drawYear = inst.selectedYear = inst.currentYear = newDate.getFullYear()
|
if ((origMonth !== inst.selectedMonth || origYear !== inst.selectedYear) && !noChange) {
|
this._notifyChange(inst)
|
}
|
this._adjustInstDate(inst)
|
if (inst.input) {
|
inst.input.val(clear ? '' : this._formatDate(inst))
|
}
|
},
|
|
/* Retrieve the date(s) directly. */
|
_getDate: function (inst) {
|
var startDate =
|
!inst.currentYear || (inst.input && inst.input.val() === '')
|
? null
|
: this._daylightSavingAdjust(
|
new Date(inst.currentYear, inst.currentMonth, inst.currentDay)
|
)
|
return startDate
|
},
|
|
/* Attach the onxxx handlers. These are declared statically so
|
* they work with static code transformers like Caja.
|
*/
|
_attachHandlers: function (inst) {
|
var stepMonths = this._get(inst, 'stepMonths'),
|
id = '#' + inst.id.replace(/\\\\/g, '\\')
|
inst.dpDiv.find('[data-handler]').map(function () {
|
var handler = {
|
prev: function () {
|
$.datepicker._adjustDate(id, -stepMonths, 'M')
|
},
|
next: function () {
|
$.datepicker._adjustDate(id, +stepMonths, 'M')
|
},
|
hide: function () {
|
$.datepicker._hideDatepicker()
|
},
|
today: function () {
|
$.datepicker._gotoToday(id)
|
},
|
selectDay: function () {
|
$.datepicker._selectDay(
|
id,
|
+this.getAttribute('data-month'),
|
+this.getAttribute('data-year'),
|
this
|
)
|
return false
|
},
|
selectMonth: function () {
|
$.datepicker._selectMonthYear(id, this, 'M')
|
return false
|
},
|
selectYear: function () {
|
$.datepicker._selectMonthYear(id, this, 'Y')
|
return false
|
}
|
}
|
$(this).on(this.getAttribute('data-event'), handler[this.getAttribute('data-handler')])
|
})
|
},
|
|
/* Generate the HTML for the current state of the date picker. */
|
_generateHTML: function (inst) {
|
var maxDraw,
|
prevText,
|
prev,
|
nextText,
|
next,
|
currentText,
|
gotoDate,
|
controls,
|
buttonPanel,
|
firstDay,
|
showWeek,
|
dayNames,
|
dayNamesMin,
|
monthNames,
|
monthNamesShort,
|
beforeShowDay,
|
showOtherMonths,
|
selectOtherMonths,
|
defaultDate,
|
html,
|
dow,
|
row,
|
group,
|
col,
|
selectedDate,
|
cornerClass,
|
calender,
|
thead,
|
day,
|
daysInMonth,
|
leadDays,
|
curRows,
|
numRows,
|
printDate,
|
dRow,
|
tbody,
|
daySettings,
|
otherMonth,
|
unselectable,
|
tempDate = new Date(),
|
today = this._daylightSavingAdjust(
|
new Date(tempDate.getFullYear(), tempDate.getMonth(), tempDate.getDate())
|
), // clear time
|
isRTL = this._get(inst, 'isRTL'),
|
showButtonPanel = this._get(inst, 'showButtonPanel'),
|
hideIfNoPrevNext = this._get(inst, 'hideIfNoPrevNext'),
|
navigationAsDateFormat = this._get(inst, 'navigationAsDateFormat'),
|
numMonths = this._getNumberOfMonths(inst),
|
showCurrentAtPos = this._get(inst, 'showCurrentAtPos'),
|
stepMonths = this._get(inst, 'stepMonths'),
|
isMultiMonth = numMonths[0] !== 1 || numMonths[1] !== 1,
|
currentDate = this._daylightSavingAdjust(
|
!inst.currentDay
|
? new Date(9999, 9, 9)
|
: new Date(inst.currentYear, inst.currentMonth, inst.currentDay)
|
),
|
minDate = this._getMinMaxDate(inst, 'min'),
|
maxDate = this._getMinMaxDate(inst, 'max'),
|
drawMonth = inst.drawMonth - showCurrentAtPos,
|
drawYear = inst.drawYear
|
|
if (drawMonth < 0) {
|
drawMonth += 12
|
drawYear--
|
}
|
if (maxDate) {
|
maxDraw = this._daylightSavingAdjust(
|
new Date(
|
maxDate.getFullYear(),
|
maxDate.getMonth() - numMonths[0] * numMonths[1] + 1,
|
maxDate.getDate()
|
)
|
)
|
maxDraw = minDate && maxDraw < minDate ? minDate : maxDraw
|
while (this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1)) > maxDraw) {
|
drawMonth--
|
if (drawMonth < 0) {
|
drawMonth = 11
|
drawYear--
|
}
|
}
|
}
|
inst.drawMonth = drawMonth
|
inst.drawYear = drawYear
|
|
prevText = this._get(inst, 'prevText')
|
prevText = !navigationAsDateFormat
|
? prevText
|
: this.formatDate(
|
prevText,
|
this._daylightSavingAdjust(new Date(drawYear, drawMonth - stepMonths, 1)),
|
this._getFormatConfig(inst)
|
)
|
|
prev = this._canAdjustMonth(inst, -1, drawYear, drawMonth)
|
? "<a class='ui-datepicker-prev ui-corner-all' data-handler='prev' data-event='click'" +
|
" title='" +
|
prevText +
|
"'><span class='ui-icon ui-icon-circle-triangle-" +
|
(isRTL ? 'e' : 'w') +
|
"'>" +
|
prevText +
|
'</span></a>'
|
: hideIfNoPrevNext
|
? ''
|
: "<a class='ui-datepicker-prev ui-corner-all ui-state-disabled' title='" +
|
prevText +
|
"'><span class='ui-icon ui-icon-circle-triangle-" +
|
(isRTL ? 'e' : 'w') +
|
"'>" +
|
prevText +
|
'</span></a>'
|
|
nextText = this._get(inst, 'nextText')
|
nextText = !navigationAsDateFormat
|
? nextText
|
: this.formatDate(
|
nextText,
|
this._daylightSavingAdjust(new Date(drawYear, drawMonth + stepMonths, 1)),
|
this._getFormatConfig(inst)
|
)
|
|
next = this._canAdjustMonth(inst, +1, drawYear, drawMonth)
|
? "<a class='ui-datepicker-next ui-corner-all' data-handler='next' data-event='click'" +
|
" title='" +
|
nextText +
|
"'><span class='ui-icon ui-icon-circle-triangle-" +
|
(isRTL ? 'w' : 'e') +
|
"'>" +
|
nextText +
|
'</span></a>'
|
: hideIfNoPrevNext
|
? ''
|
: "<a class='ui-datepicker-next ui-corner-all ui-state-disabled' title='" +
|
nextText +
|
"'><span class='ui-icon ui-icon-circle-triangle-" +
|
(isRTL ? 'w' : 'e') +
|
"'>" +
|
nextText +
|
'</span></a>'
|
|
currentText = this._get(inst, 'currentText')
|
gotoDate = this._get(inst, 'gotoCurrent') && inst.currentDay ? currentDate : today
|
currentText = !navigationAsDateFormat
|
? currentText
|
: this.formatDate(currentText, gotoDate, this._getFormatConfig(inst))
|
|
controls = !inst.inline
|
? "<button type='button' class='ui-datepicker-close ui-state-default ui-priority-primary ui-corner-all' data-handler='hide' data-event='click'>" +
|
this._get(inst, 'closeText') +
|
'</button>'
|
: ''
|
|
buttonPanel = showButtonPanel
|
? "<div class='ui-datepicker-buttonpane ui-widget-content'>" +
|
(isRTL ? controls : '') +
|
(this._isInRange(inst, gotoDate)
|
? "<button type='button' class='ui-datepicker-current ui-state-default ui-priority-secondary ui-corner-all' data-handler='today' data-event='click'" +
|
'>' +
|
currentText +
|
'</button>'
|
: '') +
|
(isRTL ? '' : controls) +
|
'</div>'
|
: ''
|
|
firstDay = parseInt(this._get(inst, 'firstDay'), 10)
|
firstDay = isNaN(firstDay) ? 0 : firstDay
|
|
showWeek = this._get(inst, 'showWeek')
|
dayNames = this._get(inst, 'dayNames')
|
dayNamesMin = this._get(inst, 'dayNamesMin')
|
monthNames = this._get(inst, 'monthNames')
|
monthNamesShort = this._get(inst, 'monthNamesShort')
|
beforeShowDay = this._get(inst, 'beforeShowDay')
|
showOtherMonths = this._get(inst, 'showOtherMonths')
|
selectOtherMonths = this._get(inst, 'selectOtherMonths')
|
defaultDate = this._getDefaultDate(inst)
|
html = ''
|
|
for (row = 0; row < numMonths[0]; row++) {
|
group = ''
|
this.maxRows = 4
|
for (col = 0; col < numMonths[1]; col++) {
|
selectedDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, inst.selectedDay))
|
cornerClass = ' ui-corner-all'
|
calender = ''
|
if (isMultiMonth) {
|
calender += "<div class='ui-datepicker-group"
|
if (numMonths[1] > 1) {
|
switch (col) {
|
case 0:
|
calender += ' ui-datepicker-group-first'
|
cornerClass = ' ui-corner-' + (isRTL ? 'right' : 'left')
|
break
|
case numMonths[1] - 1:
|
calender += ' ui-datepicker-group-last'
|
cornerClass = ' ui-corner-' + (isRTL ? 'left' : 'right')
|
break
|
default:
|
calender += ' ui-datepicker-group-middle'
|
cornerClass = ''
|
break
|
}
|
}
|
calender += "'>"
|
}
|
calender +=
|
"<div class='ui-datepicker-header ui-widget-header ui-helper-clearfix" +
|
cornerClass +
|
"'>" +
|
(/all|left/.test(cornerClass) && row === 0 ? (isRTL ? next : prev) : '') +
|
(/all|right/.test(cornerClass) && row === 0 ? (isRTL ? prev : next) : '') +
|
this._generateMonthYearHeader(
|
inst,
|
drawMonth,
|
drawYear,
|
minDate,
|
maxDate,
|
row > 0 || col > 0,
|
monthNames,
|
monthNamesShort
|
) + // draw month headers
|
"</div><table class='ui-datepicker-calendar'><thead>" +
|
'<tr>'
|
thead = showWeek
|
? "<th class='ui-datepicker-week-col'>" + this._get(inst, 'weekHeader') + '</th>'
|
: ''
|
for (dow = 0; dow < 7; dow++) {
|
// days of the week
|
day = (dow + firstDay) % 7
|
thead +=
|
"<th scope='col'" +
|
((dow + firstDay + 6) % 7 >= 5 ? " class='ui-datepicker-week-end'" : '') +
|
'>' +
|
"<span title='" +
|
dayNames[day] +
|
"'>" +
|
dayNamesMin[day] +
|
'</span></th>'
|
}
|
calender += thead + '</tr></thead><tbody>'
|
daysInMonth = this._getDaysInMonth(drawYear, drawMonth)
|
if (drawYear === inst.selectedYear && drawMonth === inst.selectedMonth) {
|
inst.selectedDay = Math.min(inst.selectedDay, daysInMonth)
|
}
|
leadDays = (this._getFirstDayOfMonth(drawYear, drawMonth) - firstDay + 7) % 7
|
curRows = Math.ceil((leadDays + daysInMonth) / 7) // calculate the number of rows to generate
|
numRows = isMultiMonth ? (this.maxRows > curRows ? this.maxRows : curRows) : curRows //If multiple months, use the higher number of rows (see #7043)
|
this.maxRows = numRows
|
printDate = this._daylightSavingAdjust(new Date(drawYear, drawMonth, 1 - leadDays))
|
for (dRow = 0; dRow < numRows; dRow++) {
|
// create date picker rows
|
calender += '<tr>'
|
tbody = !showWeek
|
? ''
|
: "<td class='ui-datepicker-week-col'>" +
|
this._get(inst, 'calculateWeek')(printDate) +
|
'</td>'
|
for (dow = 0; dow < 7; dow++) {
|
// create date picker days
|
daySettings = beforeShowDay
|
? beforeShowDay.apply(inst.input ? inst.input[0] : null, [printDate])
|
: [true, '']
|
otherMonth = printDate.getMonth() !== drawMonth
|
unselectable =
|
(otherMonth && !selectOtherMonths) ||
|
!daySettings[0] ||
|
(minDate && printDate < minDate) ||
|
(maxDate && printDate > maxDate)
|
tbody +=
|
"<td class='" +
|
((dow + firstDay + 6) % 7 >= 5 ? ' ui-datepicker-week-end' : '') + // highlight weekends
|
(otherMonth ? ' ui-datepicker-other-month' : '') + // highlight days from other months
|
((printDate.getTime() === selectedDate.getTime() &&
|
drawMonth === inst.selectedMonth &&
|
inst._keyEvent) || // user pressed key
|
(defaultDate.getTime() === printDate.getTime() &&
|
defaultDate.getTime() === selectedDate.getTime())
|
? // or defaultDate is current printedDate and defaultDate is selectedDate
|
' ' + this._dayOverClass
|
: '') + // highlight selected day
|
(unselectable ? ' ' + this._unselectableClass + ' ui-state-disabled' : '') + // highlight unselectable days
|
(otherMonth && !showOtherMonths
|
? ''
|
: ' ' +
|
daySettings[1] + // highlight custom dates
|
(printDate.getTime() === currentDate.getTime()
|
? ' ' + this._currentClass
|
: '') + // highlight selected day
|
(printDate.getTime() === today.getTime() ? ' ui-datepicker-today' : '')) +
|
"'" + // highlight today (if different)
|
((!otherMonth || showOtherMonths) && daySettings[2]
|
? " title='" + daySettings[2].replace(/'/g, ''') + "'"
|
: '') + // cell title
|
(unselectable
|
? ''
|
: " data-handler='selectDay' data-event='click' data-month='" +
|
printDate.getMonth() +
|
"' data-year='" +
|
printDate.getFullYear() +
|
"'") +
|
'>' + // actions
|
(otherMonth && !showOtherMonths
|
? ' ' // display for other months
|
: unselectable
|
? "<span class='ui-state-default'>" + printDate.getDate() + '</span>'
|
: "<a class='ui-state-default" +
|
(printDate.getTime() === today.getTime() ? ' ui-state-highlight' : '') +
|
(printDate.getTime() === currentDate.getTime() ? ' ui-state-active' : '') + // highlight selected day
|
(otherMonth ? ' ui-priority-secondary' : '') + // distinguish dates from other months
|
"' href='#'>" +
|
printDate.getDate() +
|
'</a>') +
|
'</td>' // display selectable date
|
printDate.setDate(printDate.getDate() + 1)
|
printDate = this._daylightSavingAdjust(printDate)
|
}
|
calender += tbody + '</tr>'
|
}
|
drawMonth++
|
if (drawMonth > 11) {
|
drawMonth = 0
|
drawYear++
|
}
|
calender +=
|
'</tbody></table>' +
|
(isMultiMonth
|
? '</div>' +
|
(numMonths[0] > 0 && col === numMonths[1] - 1
|
? "<div class='ui-datepicker-row-break'></div>"
|
: '')
|
: '')
|
group += calender
|
}
|
html += group
|
}
|
html += buttonPanel
|
inst._keyEvent = false
|
return html
|
},
|
|
/* Generate the month and year header. */
|
_generateMonthYearHeader: function (
|
inst,
|
drawMonth,
|
drawYear,
|
minDate,
|
maxDate,
|
secondary,
|
monthNames,
|
monthNamesShort
|
) {
|
var inMinYear,
|
inMaxYear,
|
month,
|
years,
|
thisYear,
|
determineYear,
|
year,
|
endYear,
|
changeMonth = this._get(inst, 'changeMonth'),
|
changeYear = this._get(inst, 'changeYear'),
|
showMonthAfterYear = this._get(inst, 'showMonthAfterYear'),
|
html = "<div class='ui-datepicker-title'>",
|
monthHtml = ''
|
|
// Month selection
|
if (secondary || !changeMonth) {
|
monthHtml += "<span class='ui-datepicker-month'>" + monthNames[drawMonth] + '</span>'
|
} else {
|
inMinYear = minDate && minDate.getFullYear() === drawYear
|
inMaxYear = maxDate && maxDate.getFullYear() === drawYear
|
monthHtml +=
|
"<select class='ui-datepicker-month' data-handler='selectMonth' data-event='change'>"
|
for (month = 0; month < 12; month++) {
|
if (
|
(!inMinYear || month >= minDate.getMonth()) &&
|
(!inMaxYear || month <= maxDate.getMonth())
|
) {
|
monthHtml +=
|
"<option value='" +
|
month +
|
"'" +
|
(month === drawMonth ? " selected='selected'" : '') +
|
'>' +
|
monthNamesShort[month] +
|
'</option>'
|
}
|
}
|
monthHtml += '</select>'
|
}
|
|
if (!showMonthAfterYear) {
|
html += monthHtml + (secondary || !(changeMonth && changeYear) ? ' ' : '')
|
}
|
|
// Year selection
|
if (!inst.yearshtml) {
|
inst.yearshtml = ''
|
if (secondary || !changeYear) {
|
html += "<span class='ui-datepicker-year'>" + drawYear + '</span>'
|
} else {
|
// determine range of years to display
|
years = this._get(inst, 'yearRange').split(':')
|
thisYear = new Date().getFullYear()
|
determineYear = function (value) {
|
var year = value.match(/c[+\-].*/)
|
? drawYear + parseInt(value.substring(1), 10)
|
: value.match(/[+\-].*/)
|
? thisYear + parseInt(value, 10)
|
: parseInt(value, 10)
|
return isNaN(year) ? thisYear : year
|
}
|
year = determineYear(years[0])
|
endYear = Math.max(year, determineYear(years[1] || ''))
|
year = minDate ? Math.max(year, minDate.getFullYear()) : year
|
endYear = maxDate ? Math.min(endYear, maxDate.getFullYear()) : endYear
|
inst.yearshtml +=
|
"<select class='ui-datepicker-year' data-handler='selectYear' data-event='change'>"
|
for (; year <= endYear; year++) {
|
inst.yearshtml +=
|
"<option value='" +
|
year +
|
"'" +
|
(year === drawYear ? " selected='selected'" : '') +
|
'>' +
|
year +
|
'</option>'
|
}
|
inst.yearshtml += '</select>'
|
|
html += inst.yearshtml
|
inst.yearshtml = null
|
}
|
}
|
|
html += this._get(inst, 'yearSuffix')
|
if (showMonthAfterYear) {
|
html += (secondary || !(changeMonth && changeYear) ? ' ' : '') + monthHtml
|
}
|
html += '</div>' // Close datepicker_header
|
return html
|
},
|
|
/* Adjust one of the date sub-fields. */
|
_adjustInstDate: function (inst, offset, period) {
|
var year = inst.selectedYear + (period === 'Y' ? offset : 0),
|
month = inst.selectedMonth + (period === 'M' ? offset : 0),
|
day =
|
Math.min(inst.selectedDay, this._getDaysInMonth(year, month)) +
|
(period === 'D' ? offset : 0),
|
date = this._restrictMinMax(inst, this._daylightSavingAdjust(new Date(year, month, day)))
|
|
inst.selectedDay = date.getDate()
|
inst.drawMonth = inst.selectedMonth = date.getMonth()
|
inst.drawYear = inst.selectedYear = date.getFullYear()
|
if (period === 'M' || period === 'Y') {
|
this._notifyChange(inst)
|
}
|
},
|
|
/* Ensure a date is within any min/max bounds. */
|
_restrictMinMax: function (inst, date) {
|
var minDate = this._getMinMaxDate(inst, 'min'),
|
maxDate = this._getMinMaxDate(inst, 'max'),
|
newDate = minDate && date < minDate ? minDate : date
|
return maxDate && newDate > maxDate ? maxDate : newDate
|
},
|
|
/* Notify change of month/year. */
|
_notifyChange: function (inst) {
|
var onChange = this._get(inst, 'onChangeMonthYear')
|
if (onChange) {
|
onChange.apply(inst.input ? inst.input[0] : null, [
|
inst.selectedYear,
|
inst.selectedMonth + 1,
|
inst
|
])
|
}
|
},
|
|
/* Determine the number of months to show. */
|
_getNumberOfMonths: function (inst) {
|
var numMonths = this._get(inst, 'numberOfMonths')
|
return numMonths == null ? [1, 1] : typeof numMonths === 'number' ? [1, numMonths] : numMonths
|
},
|
|
/* Determine the current maximum date - ensure no time components are set. */
|
_getMinMaxDate: function (inst, minMax) {
|
return this._determineDate(inst, this._get(inst, minMax + 'Date'), null)
|
},
|
|
/* Find the number of days in a given month. */
|
_getDaysInMonth: function (year, month) {
|
return 32 - this._daylightSavingAdjust(new Date(year, month, 32)).getDate()
|
},
|
|
/* Find the day of the week of the first of a month. */
|
_getFirstDayOfMonth: function (year, month) {
|
return new Date(year, month, 1).getDay()
|
},
|
|
/* Determines if we should allow a "next/prev" month display change. */
|
_canAdjustMonth: function (inst, offset, curYear, curMonth) {
|
var numMonths = this._getNumberOfMonths(inst),
|
date = this._daylightSavingAdjust(
|
new Date(curYear, curMonth + (offset < 0 ? offset : numMonths[0] * numMonths[1]), 1)
|
)
|
|
if (offset < 0) {
|
date.setDate(this._getDaysInMonth(date.getFullYear(), date.getMonth()))
|
}
|
return this._isInRange(inst, date)
|
},
|
|
/* Is the given date in the accepted range? */
|
_isInRange: function (inst, date) {
|
var yearSplit,
|
currentYear,
|
minDate = this._getMinMaxDate(inst, 'min'),
|
maxDate = this._getMinMaxDate(inst, 'max'),
|
minYear = null,
|
maxYear = null,
|
years = this._get(inst, 'yearRange')
|
if (years) {
|
yearSplit = years.split(':')
|
currentYear = new Date().getFullYear()
|
minYear = parseInt(yearSplit[0], 10)
|
maxYear = parseInt(yearSplit[1], 10)
|
if (yearSplit[0].match(/[+\-].*/)) {
|
minYear += currentYear
|
}
|
if (yearSplit[1].match(/[+\-].*/)) {
|
maxYear += currentYear
|
}
|
}
|
|
return (
|
(!minDate || date.getTime() >= minDate.getTime()) &&
|
(!maxDate || date.getTime() <= maxDate.getTime()) &&
|
(!minYear || date.getFullYear() >= minYear) &&
|
(!maxYear || date.getFullYear() <= maxYear)
|
)
|
},
|
|
/* Provide the configuration settings for formatting/parsing. */
|
_getFormatConfig: function (inst) {
|
var shortYearCutoff = this._get(inst, 'shortYearCutoff')
|
shortYearCutoff =
|
typeof shortYearCutoff !== 'string'
|
? shortYearCutoff
|
: (new Date().getFullYear() % 100) + parseInt(shortYearCutoff, 10)
|
return {
|
shortYearCutoff: shortYearCutoff,
|
dayNamesShort: this._get(inst, 'dayNamesShort'),
|
dayNames: this._get(inst, 'dayNames'),
|
monthNamesShort: this._get(inst, 'monthNamesShort'),
|
monthNames: this._get(inst, 'monthNames')
|
}
|
},
|
|
/* Format the given date for display. */
|
_formatDate: function (inst, day, month, year) {
|
if (!day) {
|
inst.currentDay = inst.selectedDay
|
inst.currentMonth = inst.selectedMonth
|
inst.currentYear = inst.selectedYear
|
}
|
var date = day
|
? typeof day === 'object'
|
? day
|
: this._daylightSavingAdjust(new Date(year, month, day))
|
: this._daylightSavingAdjust(new Date(inst.currentYear, inst.currentMonth, inst.currentDay))
|
return this.formatDate(this._get(inst, 'dateFormat'), date, this._getFormatConfig(inst))
|
}
|
})
|
|
/*
|
* Bind hover events for datepicker elements.
|
* Done via delegate so the binding only occurs once in the lifetime of the parent div.
|
* Global datepicker_instActive, set by _updateDatepicker allows the handlers to find their way back to the active picker.
|
*/
|
function datepicker_bindHover(dpDiv) {
|
var selector = 'button, .ui-datepicker-prev, .ui-datepicker-next, .ui-datepicker-calendar td a'
|
return dpDiv
|
.on('mouseout', selector, function () {
|
$(this).removeClass('ui-state-hover')
|
if (this.className.indexOf('ui-datepicker-prev') !== -1) {
|
$(this).removeClass('ui-datepicker-prev-hover')
|
}
|
if (this.className.indexOf('ui-datepicker-next') !== -1) {
|
$(this).removeClass('ui-datepicker-next-hover')
|
}
|
})
|
.on('mouseover', selector, datepicker_handleMouseover)
|
}
|
|
function datepicker_handleMouseover() {
|
if (
|
!$.datepicker._isDisabledDatepicker(
|
datepicker_instActive.inline
|
? datepicker_instActive.dpDiv.parent()[0]
|
: datepicker_instActive.input[0]
|
)
|
) {
|
$(this).parents('.ui-datepicker-calendar').find('a').removeClass('ui-state-hover')
|
$(this).addClass('ui-state-hover')
|
if (this.className.indexOf('ui-datepicker-prev') !== -1) {
|
$(this).addClass('ui-datepicker-prev-hover')
|
}
|
if (this.className.indexOf('ui-datepicker-next') !== -1) {
|
$(this).addClass('ui-datepicker-next-hover')
|
}
|
}
|
}
|
|
/* jQuery extend now ignores nulls! */
|
function datepicker_extendRemove(target, props) {
|
$.extend(target, props)
|
for (var name in props) {
|
if (props[name] == null) {
|
target[name] = props[name]
|
}
|
}
|
return target
|
}
|
|
/* Invoke the datepicker functionality.
|
@param options string - a command, optionally followed by additional parameters or
|
Object - settings for attaching new datepicker functionality
|
@return jQuery object */
|
$.fn.datepicker = function (options) {
|
/* Verify an empty collection wasn't passed - Fixes #6976 */
|
if (!this.length) {
|
return this
|
}
|
|
/* Initialise the date picker. */
|
if (!$.datepicker.initialized) {
|
$(document).on('mousedown', $.datepicker._checkExternalClick)
|
$.datepicker.initialized = true
|
}
|
|
/* Append datepicker main container to body if not exist. */
|
if ($('#' + $.datepicker._mainDivId).length === 0) {
|
$('body').append($.datepicker.dpDiv)
|
}
|
|
var otherArgs = Array.prototype.slice.call(arguments, 1)
|
if (
|
typeof options === 'string' &&
|
(options === 'isDisabled' || options === 'getDate' || options === 'widget')
|
) {
|
return $.datepicker['_' + options + 'Datepicker'].apply(
|
$.datepicker,
|
[this[0]].concat(otherArgs)
|
)
|
}
|
if (options === 'option' && arguments.length === 2 && typeof arguments[1] === 'string') {
|
return $.datepicker['_' + options + 'Datepicker'].apply(
|
$.datepicker,
|
[this[0]].concat(otherArgs)
|
)
|
}
|
return this.each(function () {
|
typeof options === 'string'
|
? $.datepicker['_' + options + 'Datepicker'].apply($.datepicker, [this].concat(otherArgs))
|
: $.datepicker._attachDatepicker(this, options)
|
})
|
}
|
|
$.datepicker = new Datepicker() // singleton instance
|
$.datepicker.initialized = false
|
$.datepicker.uuid = new Date().getTime()
|
$.datepicker.version = '1.12.1'
|
|
var widgetsDatepicker = $.datepicker
|
|
// This file is deprecated
|
var ie = ($.ui.ie = !!/msie [\w.]+/.exec(navigator.userAgent.toLowerCase()))
|
|
/*!
|
* jQuery UI Mouse 1.12.1
|
* http://jqueryui.com
|
*
|
* Copyright jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*/
|
|
//>>label: Mouse
|
//>>group: Widgets
|
//>>description: Abstracts mouse-based interactions to assist in creating certain widgets.
|
//>>docs: http://api.jqueryui.com/mouse/
|
|
var mouseHandled = false
|
$(document).on('mouseup', function () {
|
mouseHandled = false
|
})
|
|
var widgetsMouse = $.widget('ui.mouse', {
|
version: '1.12.1',
|
options: {
|
cancel: 'input, textarea, button, select, option',
|
distance: 1,
|
delay: 0
|
},
|
_mouseInit: function () {
|
var that = this
|
|
this.element
|
.on('mousedown.' + this.widgetName, function (event) {
|
return that._mouseDown(event)
|
})
|
.on('click.' + this.widgetName, function (event) {
|
if (true === $.data(event.target, that.widgetName + '.preventClickEvent')) {
|
$.removeData(event.target, that.widgetName + '.preventClickEvent')
|
event.stopImmediatePropagation()
|
return false
|
}
|
})
|
|
this.started = false
|
},
|
|
// TODO: make sure destroying one instance of mouse doesn't mess with
|
// other instances of mouse
|
_mouseDestroy: function () {
|
this.element.off('.' + this.widgetName)
|
if (this._mouseMoveDelegate) {
|
this.document
|
.off('mousemove.' + this.widgetName, this._mouseMoveDelegate)
|
.off('mouseup.' + this.widgetName, this._mouseUpDelegate)
|
}
|
},
|
|
_mouseDown: function (event) {
|
// don't let more than one widget handle mouseStart
|
if (mouseHandled) {
|
return
|
}
|
|
this._mouseMoved = false
|
|
// We may have missed mouseup (out of window)
|
this._mouseStarted && this._mouseUp(event)
|
|
this._mouseDownEvent = event
|
|
var that = this,
|
btnIsLeft = event.which === 1,
|
// event.target.nodeName works around a bug in IE 8 with
|
// disabled inputs (#7620)
|
elIsCancel =
|
typeof this.options.cancel === 'string' && event.target.nodeName
|
? $(event.target).closest(this.options.cancel).length
|
: false
|
if (!btnIsLeft || elIsCancel || !this._mouseCapture(event)) {
|
return true
|
}
|
|
this.mouseDelayMet = !this.options.delay
|
if (!this.mouseDelayMet) {
|
this._mouseDelayTimer = setTimeout(function () {
|
that.mouseDelayMet = true
|
}, this.options.delay)
|
}
|
|
if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
|
this._mouseStarted = this._mouseStart(event) !== false
|
if (!this._mouseStarted) {
|
event.preventDefault()
|
return true
|
}
|
}
|
|
// Click event may never have fired (Gecko & Opera)
|
if (true === $.data(event.target, this.widgetName + '.preventClickEvent')) {
|
$.removeData(event.target, this.widgetName + '.preventClickEvent')
|
}
|
|
// These delegates are required to keep context
|
this._mouseMoveDelegate = function (event) {
|
return that._mouseMove(event)
|
}
|
this._mouseUpDelegate = function (event) {
|
return that._mouseUp(event)
|
}
|
|
this.document
|
.on('mousemove.' + this.widgetName, this._mouseMoveDelegate)
|
.on('mouseup.' + this.widgetName, this._mouseUpDelegate)
|
|
event.preventDefault()
|
|
mouseHandled = true
|
return true
|
},
|
|
_mouseMove: function (event) {
|
// Only check for mouseups outside the document if you've moved inside the document
|
// at least once. This prevents the firing of mouseup in the case of IE<9, which will
|
// fire a mousemove event if content is placed under the cursor. See #7778
|
// Support: IE <9
|
if (this._mouseMoved) {
|
// IE mouseup check - mouseup happened when mouse was out of window
|
if ($.ui.ie && (!document.documentMode || document.documentMode < 9) && !event.button) {
|
return this._mouseUp(event)
|
|
// Iframe mouseup check - mouseup occurred in another document
|
} else if (!event.which) {
|
// Support: Safari <=8 - 9
|
// Safari sets which to 0 if you press any of the following keys
|
// during a drag (#14461)
|
if (
|
event.originalEvent.altKey ||
|
event.originalEvent.ctrlKey ||
|
event.originalEvent.metaKey ||
|
event.originalEvent.shiftKey
|
) {
|
this.ignoreMissingWhich = true
|
} else if (!this.ignoreMissingWhich) {
|
return this._mouseUp(event)
|
}
|
}
|
}
|
|
if (event.which || event.button) {
|
this._mouseMoved = true
|
}
|
|
if (this._mouseStarted) {
|
this._mouseDrag(event)
|
return event.preventDefault()
|
}
|
|
if (this._mouseDistanceMet(event) && this._mouseDelayMet(event)) {
|
this._mouseStarted = this._mouseStart(this._mouseDownEvent, event) !== false
|
this._mouseStarted ? this._mouseDrag(event) : this._mouseUp(event)
|
}
|
|
return !this._mouseStarted
|
},
|
|
_mouseUp: function (event) {
|
this.document
|
.off('mousemove.' + this.widgetName, this._mouseMoveDelegate)
|
.off('mouseup.' + this.widgetName, this._mouseUpDelegate)
|
|
if (this._mouseStarted) {
|
this._mouseStarted = false
|
|
if (event.target === this._mouseDownEvent.target) {
|
$.data(event.target, this.widgetName + '.preventClickEvent', true)
|
}
|
|
this._mouseStop(event)
|
}
|
|
if (this._mouseDelayTimer) {
|
clearTimeout(this._mouseDelayTimer)
|
delete this._mouseDelayTimer
|
}
|
|
this.ignoreMissingWhich = false
|
mouseHandled = false
|
event.preventDefault()
|
},
|
|
_mouseDistanceMet: function (event) {
|
return (
|
Math.max(
|
Math.abs(this._mouseDownEvent.pageX - event.pageX),
|
Math.abs(this._mouseDownEvent.pageY - event.pageY)
|
) >= this.options.distance
|
)
|
},
|
|
_mouseDelayMet: function (/* event */) {
|
return this.mouseDelayMet
|
},
|
|
// These are placeholder methods, to be overriden by extending plugin
|
_mouseStart: function (/* event */) {},
|
_mouseDrag: function (/* event */) {},
|
_mouseStop: function (/* event */) {},
|
_mouseCapture: function (/* event */) {
|
return true
|
}
|
})
|
|
// $.ui.plugin is deprecated. Use $.widget() extensions instead.
|
var plugin = ($.ui.plugin = {
|
add: function (module, option, set) {
|
var i,
|
proto = $.ui[module].prototype
|
for (i in set) {
|
proto.plugins[i] = proto.plugins[i] || []
|
proto.plugins[i].push([option, set[i]])
|
}
|
},
|
call: function (instance, name, args, allowDisconnected) {
|
var i,
|
set = instance.plugins[name]
|
|
if (!set) {
|
return
|
}
|
|
if (
|
!allowDisconnected &&
|
(!instance.element[0].parentNode || instance.element[0].parentNode.nodeType === 11)
|
) {
|
return
|
}
|
|
for (i = 0; i < set.length; i++) {
|
if (instance.options[set[i][0]]) {
|
set[i][1].apply(instance.element, args)
|
}
|
}
|
}
|
})
|
|
var safeBlur = ($.ui.safeBlur = function (element) {
|
// Support: IE9 - 10 only
|
// If the <body> is blurred, IE will switch windows, see #9420
|
if (element && element.nodeName.toLowerCase() !== 'body') {
|
$(element).trigger('blur')
|
}
|
})
|
|
/*!
|
* jQuery UI Draggable 1.12.1
|
* http://jqueryui.com
|
*
|
* Copyright jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*/
|
|
//>>label: Draggable
|
//>>group: Interactions
|
//>>description: Enables dragging functionality for any element.
|
//>>docs: http://api.jqueryui.com/draggable/
|
//>>demos: http://jqueryui.com/draggable/
|
//>>css.structure: ../../themes/base/draggable.css
|
|
$.widget('ui.draggable', $.ui.mouse, {
|
version: '1.12.1',
|
widgetEventPrefix: 'drag',
|
options: {
|
addClasses: true,
|
appendTo: 'parent',
|
axis: false,
|
connectToSortable: false,
|
containment: false,
|
cursor: 'auto',
|
cursorAt: false,
|
grid: false,
|
handle: false,
|
helper: 'original',
|
iframeFix: false,
|
opacity: false,
|
refreshPositions: false,
|
revert: false,
|
revertDuration: 500,
|
scope: 'default',
|
scroll: true,
|
scrollSensitivity: 20,
|
scrollSpeed: 20,
|
snap: false,
|
snapMode: 'both',
|
snapTolerance: 20,
|
stack: false,
|
zIndex: false,
|
|
// Callbacks
|
drag: null,
|
start: null,
|
stop: null
|
},
|
_create: function () {
|
if (this.options.helper === 'original') {
|
this._setPositionRelative()
|
}
|
if (this.options.addClasses) {
|
this._addClass('ui-draggable')
|
}
|
this._setHandleClassName()
|
|
this._mouseInit()
|
},
|
|
_setOption: function (key, value) {
|
this._super(key, value)
|
if (key === 'handle') {
|
this._removeHandleClassName()
|
this._setHandleClassName()
|
}
|
},
|
|
_destroy: function () {
|
if ((this.helper || this.element).is('.ui-draggable-dragging')) {
|
this.destroyOnClear = true
|
return
|
}
|
this._removeHandleClassName()
|
this._mouseDestroy()
|
},
|
|
_mouseCapture: function (event) {
|
var o = this.options
|
|
// Among others, prevent a drag on a resizable-handle
|
if (this.helper || o.disabled || $(event.target).closest('.ui-resizable-handle').length > 0) {
|
return false
|
}
|
|
//Quit if we're not on a valid handle
|
this.handle = this._getHandle(event)
|
if (!this.handle) {
|
return false
|
}
|
|
this._blurActiveElement(event)
|
|
this._blockFrames(o.iframeFix === true ? 'iframe' : o.iframeFix)
|
|
return true
|
},
|
|
_blockFrames: function (selector) {
|
this.iframeBlocks = this.document.find(selector).map(function () {
|
var iframe = $(this)
|
|
return $('<div>')
|
.css('position', 'absolute')
|
.appendTo(iframe.parent())
|
.outerWidth(iframe.outerWidth())
|
.outerHeight(iframe.outerHeight())
|
.offset(iframe.offset())[0]
|
})
|
},
|
|
_unblockFrames: function () {
|
if (this.iframeBlocks) {
|
this.iframeBlocks.remove()
|
delete this.iframeBlocks
|
}
|
},
|
|
_blurActiveElement: function (event) {
|
var activeElement = $.ui.safeActiveElement(this.document[0]),
|
target = $(event.target)
|
|
// Don't blur if the event occurred on an element that is within
|
// the currently focused element
|
// See #10527, #12472
|
if (target.closest(activeElement).length) {
|
return
|
}
|
|
// Blur any element that currently has focus, see #4261
|
$.ui.safeBlur(activeElement)
|
},
|
|
_mouseStart: function (event) {
|
var o = this.options
|
|
//Create and append the visible helper
|
this.helper = this._createHelper(event)
|
|
this._addClass(this.helper, 'ui-draggable-dragging')
|
|
//Cache the helper size
|
this._cacheHelperProportions()
|
|
//If ddmanager is used for droppables, set the global draggable
|
if ($.ui.ddmanager) {
|
$.ui.ddmanager.current = this
|
}
|
|
/*
|
* - Position generation -
|
* This block generates everything position related - it's the core of draggables.
|
*/
|
|
//Cache the margins of the original element
|
this._cacheMargins()
|
|
//Store the helper's css position
|
this.cssPosition = this.helper.css('position')
|
this.scrollParent = this.helper.scrollParent(true)
|
this.offsetParent = this.helper.offsetParent()
|
this.hasFixedAncestor =
|
this.helper.parents().filter(function () {
|
return $(this).css('position') === 'fixed'
|
}).length > 0
|
|
//The element's absolute position on the page minus margins
|
this.positionAbs = this.element.offset()
|
this._refreshOffsets(event)
|
|
//Generate the original position
|
this.originalPosition = this.position = this._generatePosition(event, false)
|
this.originalPageX = event.pageX
|
this.originalPageY = event.pageY
|
|
//Adjust the mouse offset relative to the helper if "cursorAt" is supplied
|
o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt)
|
|
//Set a containment if given in the options
|
this._setContainment()
|
|
//Trigger event + callbacks
|
if (this._trigger('start', event) === false) {
|
this._clear()
|
return false
|
}
|
|
//Recache the helper size
|
this._cacheHelperProportions()
|
|
//Prepare the droppable offsets
|
if ($.ui.ddmanager && !o.dropBehaviour) {
|
$.ui.ddmanager.prepareOffsets(this, event)
|
}
|
|
// Execute the drag once - this causes the helper not to be visible before getting its
|
// correct position
|
this._mouseDrag(event, true)
|
|
// If the ddmanager is used for droppables, inform the manager that dragging has started
|
// (see #5003)
|
if ($.ui.ddmanager) {
|
$.ui.ddmanager.dragStart(this, event)
|
}
|
|
return true
|
},
|
|
_refreshOffsets: function (event) {
|
this.offset = {
|
top: this.positionAbs.top - this.margins.top,
|
left: this.positionAbs.left - this.margins.left,
|
scroll: false,
|
parent: this._getParentOffset(),
|
relative: this._getRelativeOffset()
|
}
|
|
this.offset.click = {
|
left: event.pageX - this.offset.left,
|
top: event.pageY - this.offset.top
|
}
|
},
|
|
_mouseDrag: function (event, noPropagation) {
|
// reset any necessary cached properties (see #5009)
|
if (this.hasFixedAncestor) {
|
this.offset.parent = this._getParentOffset()
|
}
|
|
//Compute the helpers position
|
this.position = this._generatePosition(event, true)
|
this.positionAbs = this._convertPositionTo('absolute')
|
|
//Call plugins and callbacks and use the resulting position if something is returned
|
if (!noPropagation) {
|
var ui = this._uiHash()
|
if (this._trigger('drag', event, ui) === false) {
|
this._mouseUp(new $.Event('mouseup', event))
|
return false
|
}
|
this.position = ui.position
|
}
|
|
this.helper[0].style.left = this.position.left + 'px'
|
this.helper[0].style.top = this.position.top + 'px'
|
|
if ($.ui.ddmanager) {
|
$.ui.ddmanager.drag(this, event)
|
}
|
|
return false
|
},
|
|
_mouseStop: function (event) {
|
//If we are using droppables, inform the manager about the drop
|
var that = this,
|
dropped = false
|
if ($.ui.ddmanager && !this.options.dropBehaviour) {
|
dropped = $.ui.ddmanager.drop(this, event)
|
}
|
|
//if a drop comes from outside (a sortable)
|
if (this.dropped) {
|
dropped = this.dropped
|
this.dropped = false
|
}
|
|
if (
|
(this.options.revert === 'invalid' && !dropped) ||
|
(this.options.revert === 'valid' && dropped) ||
|
this.options.revert === true ||
|
($.isFunction(this.options.revert) && this.options.revert.call(this.element, dropped))
|
) {
|
$(this.helper).animate(
|
this.originalPosition,
|
parseInt(this.options.revertDuration, 10),
|
function () {
|
if (that._trigger('stop', event) !== false) {
|
that._clear()
|
}
|
}
|
)
|
} else {
|
if (this._trigger('stop', event) !== false) {
|
this._clear()
|
}
|
}
|
|
return false
|
},
|
|
_mouseUp: function (event) {
|
this._unblockFrames()
|
|
// If the ddmanager is used for droppables, inform the manager that dragging has stopped
|
// (see #5003)
|
if ($.ui.ddmanager) {
|
$.ui.ddmanager.dragStop(this, event)
|
}
|
|
// Only need to focus if the event occurred on the draggable itself, see #10527
|
if (this.handleElement.is(event.target)) {
|
// The interaction is over; whether or not the click resulted in a drag,
|
// focus the element
|
this.element.trigger('focus')
|
}
|
|
return $.ui.mouse.prototype._mouseUp.call(this, event)
|
},
|
|
cancel: function () {
|
if (this.helper.is('.ui-draggable-dragging')) {
|
this._mouseUp(new $.Event('mouseup', { target: this.element[0] }))
|
} else {
|
this._clear()
|
}
|
|
return this
|
},
|
|
_getHandle: function (event) {
|
return this.options.handle
|
? !!$(event.target).closest(this.element.find(this.options.handle)).length
|
: true
|
},
|
|
_setHandleClassName: function () {
|
this.handleElement = this.options.handle
|
? this.element.find(this.options.handle)
|
: this.element
|
this._addClass(this.handleElement, 'ui-draggable-handle')
|
},
|
|
_removeHandleClassName: function () {
|
this._removeClass(this.handleElement, 'ui-draggable-handle')
|
},
|
|
_createHelper: function (event) {
|
var o = this.options,
|
helperIsFunction = $.isFunction(o.helper),
|
helper = helperIsFunction
|
? $(o.helper.apply(this.element[0], [event]))
|
: o.helper === 'clone'
|
? this.element.clone().removeAttr('id')
|
: this.element
|
|
if (!helper.parents('body').length) {
|
helper.appendTo(o.appendTo === 'parent' ? this.element[0].parentNode : o.appendTo)
|
}
|
|
// Http://bugs.jqueryui.com/ticket/9446
|
// a helper function can return the original element
|
// which wouldn't have been set to relative in _create
|
if (helperIsFunction && helper[0] === this.element[0]) {
|
this._setPositionRelative()
|
}
|
|
if (helper[0] !== this.element[0] && !/(fixed|absolute)/.test(helper.css('position'))) {
|
helper.css('position', 'absolute')
|
}
|
|
return helper
|
},
|
|
_setPositionRelative: function () {
|
if (!/^(?:r|a|f)/.test(this.element.css('position'))) {
|
this.element[0].style.position = 'relative'
|
}
|
},
|
|
_adjustOffsetFromHelper: function (obj) {
|
if (typeof obj === 'string') {
|
obj = obj.split(' ')
|
}
|
if ($.isArray(obj)) {
|
obj = { left: +obj[0], top: +obj[1] || 0 }
|
}
|
if ('left' in obj) {
|
this.offset.click.left = obj.left + this.margins.left
|
}
|
if ('right' in obj) {
|
this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left
|
}
|
if ('top' in obj) {
|
this.offset.click.top = obj.top + this.margins.top
|
}
|
if ('bottom' in obj) {
|
this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top
|
}
|
},
|
|
_isRootNode: function (element) {
|
return /(html|body)/i.test(element.tagName) || element === this.document[0]
|
},
|
|
_getParentOffset: function () {
|
//Get the offsetParent and cache its position
|
var po = this.offsetParent.offset(),
|
document = this.document[0]
|
|
// This is a special case where we need to modify a offset calculated on start, since the
|
// following happened:
|
// 1. The position of the helper is absolute, so it's position is calculated based on the
|
// next positioned parent
|
// 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't
|
// the document, which means that the scroll is included in the initial calculation of the
|
// offset of the parent, and never recalculated upon drag
|
if (
|
this.cssPosition === 'absolute' &&
|
this.scrollParent[0] !== document &&
|
$.contains(this.scrollParent[0], this.offsetParent[0])
|
) {
|
po.left += this.scrollParent.scrollLeft()
|
po.top += this.scrollParent.scrollTop()
|
}
|
|
if (this._isRootNode(this.offsetParent[0])) {
|
po = { top: 0, left: 0 }
|
}
|
|
return {
|
top: po.top + (parseInt(this.offsetParent.css('borderTopWidth'), 10) || 0),
|
left: po.left + (parseInt(this.offsetParent.css('borderLeftWidth'), 10) || 0)
|
}
|
},
|
|
_getRelativeOffset: function () {
|
if (this.cssPosition !== 'relative') {
|
return { top: 0, left: 0 }
|
}
|
|
var p = this.element.position(),
|
scrollIsRootNode = this._isRootNode(this.scrollParent[0])
|
|
return {
|
top:
|
p.top -
|
(parseInt(this.helper.css('top'), 10) || 0) +
|
(!scrollIsRootNode ? this.scrollParent.scrollTop() : 0),
|
left:
|
p.left -
|
(parseInt(this.helper.css('left'), 10) || 0) +
|
(!scrollIsRootNode ? this.scrollParent.scrollLeft() : 0)
|
}
|
},
|
|
_cacheMargins: function () {
|
this.margins = {
|
left: parseInt(this.element.css('marginLeft'), 10) || 0,
|
top: parseInt(this.element.css('marginTop'), 10) || 0,
|
right: parseInt(this.element.css('marginRight'), 10) || 0,
|
bottom: parseInt(this.element.css('marginBottom'), 10) || 0
|
}
|
},
|
|
_cacheHelperProportions: function () {
|
this.helperProportions = {
|
width: this.helper.outerWidth(),
|
height: this.helper.outerHeight()
|
}
|
},
|
|
_setContainment: function () {
|
var isUserScrollable,
|
c,
|
ce,
|
o = this.options,
|
document = this.document[0]
|
|
this.relativeContainer = null
|
|
if (!o.containment) {
|
this.containment = null
|
return
|
}
|
|
if (o.containment === 'window') {
|
this.containment = [
|
$(window).scrollLeft() - this.offset.relative.left - this.offset.parent.left,
|
$(window).scrollTop() - this.offset.relative.top - this.offset.parent.top,
|
$(window).scrollLeft() +
|
$(window).width() -
|
this.helperProportions.width -
|
this.margins.left,
|
$(window).scrollTop() +
|
($(window).height() || document.body.parentNode.scrollHeight) -
|
this.helperProportions.height -
|
this.margins.top
|
]
|
return
|
}
|
|
if (o.containment === 'document') {
|
this.containment = [
|
0,
|
0,
|
$(document).width() - this.helperProportions.width - this.margins.left,
|
($(document).height() || document.body.parentNode.scrollHeight) -
|
this.helperProportions.height -
|
this.margins.top
|
]
|
return
|
}
|
|
if (o.containment.constructor === Array) {
|
this.containment = o.containment
|
return
|
}
|
|
if (o.containment === 'parent') {
|
o.containment = this.helper[0].parentNode
|
}
|
|
c = $(o.containment)
|
ce = c[0]
|
|
if (!ce) {
|
return
|
}
|
|
isUserScrollable = /(scroll|auto)/.test(c.css('overflow'))
|
|
this.containment = [
|
(parseInt(c.css('borderLeftWidth'), 10) || 0) + (parseInt(c.css('paddingLeft'), 10) || 0),
|
(parseInt(c.css('borderTopWidth'), 10) || 0) + (parseInt(c.css('paddingTop'), 10) || 0),
|
(isUserScrollable ? Math.max(ce.scrollWidth, ce.offsetWidth) : ce.offsetWidth) -
|
(parseInt(c.css('borderRightWidth'), 10) || 0) -
|
(parseInt(c.css('paddingRight'), 10) || 0) -
|
this.helperProportions.width -
|
this.margins.left -
|
this.margins.right,
|
(isUserScrollable ? Math.max(ce.scrollHeight, ce.offsetHeight) : ce.offsetHeight) -
|
(parseInt(c.css('borderBottomWidth'), 10) || 0) -
|
(parseInt(c.css('paddingBottom'), 10) || 0) -
|
this.helperProportions.height -
|
this.margins.top -
|
this.margins.bottom
|
]
|
this.relativeContainer = c
|
},
|
|
_convertPositionTo: function (d, pos) {
|
if (!pos) {
|
pos = this.position
|
}
|
|
var mod = d === 'absolute' ? 1 : -1,
|
scrollIsRootNode = this._isRootNode(this.scrollParent[0])
|
|
return {
|
top:
|
// The absolute mouse position
|
pos.top +
|
// Only for relative positioned nodes: Relative offset from element to offset parent
|
this.offset.relative.top * mod +
|
// The offsetParent's offset without borders (offset + border)
|
this.offset.parent.top * mod -
|
(this.cssPosition === 'fixed'
|
? -this.offset.scroll.top
|
: scrollIsRootNode
|
? 0
|
: this.offset.scroll.top) *
|
mod,
|
left:
|
// The absolute mouse position
|
pos.left +
|
// Only for relative positioned nodes: Relative offset from element to offset parent
|
this.offset.relative.left * mod +
|
// The offsetParent's offset without borders (offset + border)
|
this.offset.parent.left * mod -
|
(this.cssPosition === 'fixed'
|
? -this.offset.scroll.left
|
: scrollIsRootNode
|
? 0
|
: this.offset.scroll.left) *
|
mod
|
}
|
},
|
|
_generatePosition: function (event, constrainPosition) {
|
var containment,
|
co,
|
top,
|
left,
|
o = this.options,
|
scrollIsRootNode = this._isRootNode(this.scrollParent[0]),
|
pageX = event.pageX,
|
pageY = event.pageY
|
|
// Cache the scroll
|
if (!scrollIsRootNode || !this.offset.scroll) {
|
this.offset.scroll = {
|
top: this.scrollParent.scrollTop(),
|
left: this.scrollParent.scrollLeft()
|
}
|
}
|
|
/*
|
* - Position constraining -
|
* Constrain the position to a mix of grid, containment.
|
*/
|
|
// If we are not dragging yet, we won't check for options
|
if (constrainPosition) {
|
if (this.containment) {
|
if (this.relativeContainer) {
|
co = this.relativeContainer.offset()
|
containment = [
|
this.containment[0] + co.left,
|
this.containment[1] + co.top,
|
this.containment[2] + co.left,
|
this.containment[3] + co.top
|
]
|
} else {
|
containment = this.containment
|
}
|
|
if (event.pageX - this.offset.click.left < containment[0]) {
|
pageX = containment[0] + this.offset.click.left
|
}
|
if (event.pageY - this.offset.click.top < containment[1]) {
|
pageY = containment[1] + this.offset.click.top
|
}
|
if (event.pageX - this.offset.click.left > containment[2]) {
|
pageX = containment[2] + this.offset.click.left
|
}
|
if (event.pageY - this.offset.click.top > containment[3]) {
|
pageY = containment[3] + this.offset.click.top
|
}
|
}
|
|
if (o.grid) {
|
//Check for grid elements set to 0 to prevent divide by 0 error causing invalid
|
// argument errors in IE (see ticket #6950)
|
top = o.grid[1]
|
? this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1]
|
: this.originalPageY
|
pageY = containment
|
? top - this.offset.click.top >= containment[1] ||
|
top - this.offset.click.top > containment[3]
|
? top
|
: top - this.offset.click.top >= containment[1]
|
? top - o.grid[1]
|
: top + o.grid[1]
|
: top
|
|
left = o.grid[0]
|
? this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0]
|
: this.originalPageX
|
pageX = containment
|
? left - this.offset.click.left >= containment[0] ||
|
left - this.offset.click.left > containment[2]
|
? left
|
: left - this.offset.click.left >= containment[0]
|
? left - o.grid[0]
|
: left + o.grid[0]
|
: left
|
}
|
|
if (o.axis === 'y') {
|
pageX = this.originalPageX
|
}
|
|
if (o.axis === 'x') {
|
pageY = this.originalPageY
|
}
|
}
|
|
return {
|
top:
|
// The absolute mouse position
|
pageY -
|
// Click offset (relative to the element)
|
this.offset.click.top -
|
// Only for relative positioned nodes: Relative offset from element to offset parent
|
this.offset.relative.top -
|
// The offsetParent's offset without borders (offset + border)
|
this.offset.parent.top +
|
(this.cssPosition === 'fixed'
|
? -this.offset.scroll.top
|
: scrollIsRootNode
|
? 0
|
: this.offset.scroll.top),
|
left:
|
// The absolute mouse position
|
pageX -
|
// Click offset (relative to the element)
|
this.offset.click.left -
|
// Only for relative positioned nodes: Relative offset from element to offset parent
|
this.offset.relative.left -
|
// The offsetParent's offset without borders (offset + border)
|
this.offset.parent.left +
|
(this.cssPosition === 'fixed'
|
? -this.offset.scroll.left
|
: scrollIsRootNode
|
? 0
|
: this.offset.scroll.left)
|
}
|
},
|
|
_clear: function () {
|
this._removeClass(this.helper, 'ui-draggable-dragging')
|
if (this.helper[0] !== this.element[0] && !this.cancelHelperRemoval) {
|
this.helper.remove()
|
}
|
this.helper = null
|
this.cancelHelperRemoval = false
|
if (this.destroyOnClear) {
|
this.destroy()
|
}
|
},
|
|
// From now on bulk stuff - mainly helpers
|
|
_trigger: function (type, event, ui) {
|
ui = ui || this._uiHash()
|
$.ui.plugin.call(this, type, [event, ui, this], true)
|
|
// Absolute position and offset (see #6884 ) have to be recalculated after plugins
|
if (/^(drag|start|stop)/.test(type)) {
|
this.positionAbs = this._convertPositionTo('absolute')
|
ui.offset = this.positionAbs
|
}
|
return $.Widget.prototype._trigger.call(this, type, event, ui)
|
},
|
|
plugins: {},
|
|
_uiHash: function () {
|
return {
|
helper: this.helper,
|
position: this.position,
|
originalPosition: this.originalPosition,
|
offset: this.positionAbs
|
}
|
}
|
})
|
|
$.ui.plugin.add('draggable', 'connectToSortable', {
|
start: function (event, ui, draggable) {
|
var uiSortable = $.extend({}, ui, {
|
item: draggable.element
|
})
|
|
draggable.sortables = []
|
$(draggable.options.connectToSortable).each(function () {
|
var sortable = $(this).sortable('instance')
|
|
if (sortable && !sortable.options.disabled) {
|
draggable.sortables.push(sortable)
|
|
// RefreshPositions is called at drag start to refresh the containerCache
|
// which is used in drag. This ensures it's initialized and synchronized
|
// with any changes that might have happened on the page since initialization.
|
sortable.refreshPositions()
|
sortable._trigger('activate', event, uiSortable)
|
}
|
})
|
},
|
stop: function (event, ui, draggable) {
|
var uiSortable = $.extend({}, ui, {
|
item: draggable.element
|
})
|
|
draggable.cancelHelperRemoval = false
|
|
$.each(draggable.sortables, function () {
|
var sortable = this
|
|
if (sortable.isOver) {
|
sortable.isOver = 0
|
|
// Allow this sortable to handle removing the helper
|
draggable.cancelHelperRemoval = true
|
sortable.cancelHelperRemoval = false
|
|
// Use _storedCSS To restore properties in the sortable,
|
// as this also handles revert (#9675) since the draggable
|
// may have modified them in unexpected ways (#8809)
|
sortable._storedCSS = {
|
position: sortable.placeholder.css('position'),
|
top: sortable.placeholder.css('top'),
|
left: sortable.placeholder.css('left')
|
}
|
|
sortable._mouseStop(event)
|
|
// Once drag has ended, the sortable should return to using
|
// its original helper, not the shared helper from draggable
|
sortable.options.helper = sortable.options._helper
|
} else {
|
// Prevent this Sortable from removing the helper.
|
// However, don't set the draggable to remove the helper
|
// either as another connected Sortable may yet handle the removal.
|
sortable.cancelHelperRemoval = true
|
|
sortable._trigger('deactivate', event, uiSortable)
|
}
|
})
|
},
|
drag: function (event, ui, draggable) {
|
$.each(draggable.sortables, function () {
|
var innermostIntersecting = false,
|
sortable = this
|
|
// Copy over variables that sortable's _intersectsWith uses
|
sortable.positionAbs = draggable.positionAbs
|
sortable.helperProportions = draggable.helperProportions
|
sortable.offset.click = draggable.offset.click
|
|
if (sortable._intersectsWith(sortable.containerCache)) {
|
innermostIntersecting = true
|
|
$.each(draggable.sortables, function () {
|
// Copy over variables that sortable's _intersectsWith uses
|
this.positionAbs = draggable.positionAbs
|
this.helperProportions = draggable.helperProportions
|
this.offset.click = draggable.offset.click
|
|
if (
|
this !== sortable &&
|
this._intersectsWith(this.containerCache) &&
|
$.contains(sortable.element[0], this.element[0])
|
) {
|
innermostIntersecting = false
|
}
|
|
return innermostIntersecting
|
})
|
}
|
|
if (innermostIntersecting) {
|
// If it intersects, we use a little isOver variable and set it once,
|
// so that the move-in stuff gets fired only once.
|
if (!sortable.isOver) {
|
sortable.isOver = 1
|
|
// Store draggable's parent in case we need to reappend to it later.
|
draggable._parent = ui.helper.parent()
|
|
sortable.currentItem = ui.helper
|
.appendTo(sortable.element)
|
.data('ui-sortable-item', true)
|
|
// Store helper option to later restore it
|
sortable.options._helper = sortable.options.helper
|
|
sortable.options.helper = function () {
|
return ui.helper[0]
|
}
|
|
// Fire the start events of the sortable with our passed browser event,
|
// and our own helper (so it doesn't create a new one)
|
event.target = sortable.currentItem[0]
|
sortable._mouseCapture(event, true)
|
sortable._mouseStart(event, true, true)
|
|
// Because the browser event is way off the new appended portlet,
|
// modify necessary variables to reflect the changes
|
sortable.offset.click.top = draggable.offset.click.top
|
sortable.offset.click.left = draggable.offset.click.left
|
sortable.offset.parent.left -=
|
draggable.offset.parent.left - sortable.offset.parent.left
|
sortable.offset.parent.top -= draggable.offset.parent.top - sortable.offset.parent.top
|
|
draggable._trigger('toSortable', event)
|
|
// Inform draggable that the helper is in a valid drop zone,
|
// used solely in the revert option to handle "valid/invalid".
|
draggable.dropped = sortable.element
|
|
// Need to refreshPositions of all sortables in the case that
|
// adding to one sortable changes the location of the other sortables (#9675)
|
$.each(draggable.sortables, function () {
|
this.refreshPositions()
|
})
|
|
// Hack so receive/update callbacks work (mostly)
|
draggable.currentItem = draggable.element
|
sortable.fromOutside = draggable
|
}
|
|
if (sortable.currentItem) {
|
sortable._mouseDrag(event)
|
|
// Copy the sortable's position because the draggable's can potentially reflect
|
// a relative position, while sortable is always absolute, which the dragged
|
// element has now become. (#8809)
|
ui.position = sortable.position
|
}
|
} else {
|
// If it doesn't intersect with the sortable, and it intersected before,
|
// we fake the drag stop of the sortable, but make sure it doesn't remove
|
// the helper by using cancelHelperRemoval.
|
if (sortable.isOver) {
|
sortable.isOver = 0
|
sortable.cancelHelperRemoval = true
|
|
// Calling sortable's mouseStop would trigger a revert,
|
// so revert must be temporarily false until after mouseStop is called.
|
sortable.options._revert = sortable.options.revert
|
sortable.options.revert = false
|
|
sortable._trigger('out', event, sortable._uiHash(sortable))
|
sortable._mouseStop(event, true)
|
|
// Restore sortable behaviors that were modfied
|
// when the draggable entered the sortable area (#9481)
|
sortable.options.revert = sortable.options._revert
|
sortable.options.helper = sortable.options._helper
|
|
if (sortable.placeholder) {
|
sortable.placeholder.remove()
|
}
|
|
// Restore and recalculate the draggable's offset considering the sortable
|
// may have modified them in unexpected ways. (#8809, #10669)
|
ui.helper.appendTo(draggable._parent)
|
draggable._refreshOffsets(event)
|
ui.position = draggable._generatePosition(event, true)
|
|
draggable._trigger('fromSortable', event)
|
|
// Inform draggable that the helper is no longer in a valid drop zone
|
draggable.dropped = false
|
|
// Need to refreshPositions of all sortables just in case removing
|
// from one sortable changes the location of other sortables (#9675)
|
$.each(draggable.sortables, function () {
|
this.refreshPositions()
|
})
|
}
|
}
|
})
|
}
|
})
|
|
$.ui.plugin.add('draggable', 'cursor', {
|
start: function (event, ui, instance) {
|
var t = $('body'),
|
o = instance.options
|
|
if (t.css('cursor')) {
|
o._cursor = t.css('cursor')
|
}
|
t.css('cursor', o.cursor)
|
},
|
stop: function (event, ui, instance) {
|
var o = instance.options
|
if (o._cursor) {
|
$('body').css('cursor', o._cursor)
|
}
|
}
|
})
|
|
$.ui.plugin.add('draggable', 'opacity', {
|
start: function (event, ui, instance) {
|
var t = $(ui.helper),
|
o = instance.options
|
if (t.css('opacity')) {
|
o._opacity = t.css('opacity')
|
}
|
t.css('opacity', o.opacity)
|
},
|
stop: function (event, ui, instance) {
|
var o = instance.options
|
if (o._opacity) {
|
$(ui.helper).css('opacity', o._opacity)
|
}
|
}
|
})
|
|
$.ui.plugin.add('draggable', 'scroll', {
|
start: function (event, ui, i) {
|
if (!i.scrollParentNotHidden) {
|
i.scrollParentNotHidden = i.helper.scrollParent(false)
|
}
|
|
if (
|
i.scrollParentNotHidden[0] !== i.document[0] &&
|
i.scrollParentNotHidden[0].tagName !== 'HTML'
|
) {
|
i.overflowOffset = i.scrollParentNotHidden.offset()
|
}
|
},
|
drag: function (event, ui, i) {
|
var o = i.options,
|
scrolled = false,
|
scrollParent = i.scrollParentNotHidden[0],
|
document = i.document[0]
|
|
if (scrollParent !== document && scrollParent.tagName !== 'HTML') {
|
if (!o.axis || o.axis !== 'x') {
|
if (
|
i.overflowOffset.top + scrollParent.offsetHeight - event.pageY <
|
o.scrollSensitivity
|
) {
|
scrollParent.scrollTop = scrolled = scrollParent.scrollTop + o.scrollSpeed
|
} else if (event.pageY - i.overflowOffset.top < o.scrollSensitivity) {
|
scrollParent.scrollTop = scrolled = scrollParent.scrollTop - o.scrollSpeed
|
}
|
}
|
|
if (!o.axis || o.axis !== 'y') {
|
if (
|
i.overflowOffset.left + scrollParent.offsetWidth - event.pageX <
|
o.scrollSensitivity
|
) {
|
scrollParent.scrollLeft = scrolled = scrollParent.scrollLeft + o.scrollSpeed
|
} else if (event.pageX - i.overflowOffset.left < o.scrollSensitivity) {
|
scrollParent.scrollLeft = scrolled = scrollParent.scrollLeft - o.scrollSpeed
|
}
|
}
|
} else {
|
if (!o.axis || o.axis !== 'x') {
|
if (event.pageY - $(document).scrollTop() < o.scrollSensitivity) {
|
scrolled = $(document).scrollTop($(document).scrollTop() - o.scrollSpeed)
|
} else if (
|
$(window).height() - (event.pageY - $(document).scrollTop()) <
|
o.scrollSensitivity
|
) {
|
scrolled = $(document).scrollTop($(document).scrollTop() + o.scrollSpeed)
|
}
|
}
|
|
if (!o.axis || o.axis !== 'y') {
|
if (event.pageX - $(document).scrollLeft() < o.scrollSensitivity) {
|
scrolled = $(document).scrollLeft($(document).scrollLeft() - o.scrollSpeed)
|
} else if (
|
$(window).width() - (event.pageX - $(document).scrollLeft()) <
|
o.scrollSensitivity
|
) {
|
scrolled = $(document).scrollLeft($(document).scrollLeft() + o.scrollSpeed)
|
}
|
}
|
}
|
|
if (scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) {
|
$.ui.ddmanager.prepareOffsets(i, event)
|
}
|
}
|
})
|
|
$.ui.plugin.add('draggable', 'snap', {
|
start: function (event, ui, i) {
|
var o = i.options
|
|
i.snapElements = []
|
|
$(o.snap.constructor !== String ? o.snap.items || ':data(ui-draggable)' : o.snap).each(
|
function () {
|
var $t = $(this),
|
$o = $t.offset()
|
if (this !== i.element[0]) {
|
i.snapElements.push({
|
item: this,
|
width: $t.outerWidth(),
|
height: $t.outerHeight(),
|
top: $o.top,
|
left: $o.left
|
})
|
}
|
}
|
)
|
},
|
drag: function (event, ui, inst) {
|
var ts,
|
bs,
|
ls,
|
rs,
|
l,
|
r,
|
t,
|
b,
|
i,
|
first,
|
o = inst.options,
|
d = o.snapTolerance,
|
x1 = ui.offset.left,
|
x2 = x1 + inst.helperProportions.width,
|
y1 = ui.offset.top,
|
y2 = y1 + inst.helperProportions.height
|
|
for (i = inst.snapElements.length - 1; i >= 0; i--) {
|
l = inst.snapElements[i].left - inst.margins.left
|
r = l + inst.snapElements[i].width
|
t = inst.snapElements[i].top - inst.margins.top
|
b = t + inst.snapElements[i].height
|
|
if (
|
x2 < l - d ||
|
x1 > r + d ||
|
y2 < t - d ||
|
y1 > b + d ||
|
!$.contains(inst.snapElements[i].item.ownerDocument, inst.snapElements[i].item)
|
) {
|
if (inst.snapElements[i].snapping) {
|
inst.options.snap.release &&
|
inst.options.snap.release.call(
|
inst.element,
|
event,
|
$.extend(inst._uiHash(), { snapItem: inst.snapElements[i].item })
|
)
|
}
|
inst.snapElements[i].snapping = false
|
continue
|
}
|
|
if (o.snapMode !== 'inner') {
|
ts = Math.abs(t - y2) <= d
|
bs = Math.abs(b - y1) <= d
|
ls = Math.abs(l - x2) <= d
|
rs = Math.abs(r - x1) <= d
|
if (ts) {
|
ui.position.top = inst._convertPositionTo('relative', {
|
top: t - inst.helperProportions.height,
|
left: 0
|
}).top
|
}
|
if (bs) {
|
ui.position.top = inst._convertPositionTo('relative', {
|
top: b,
|
left: 0
|
}).top
|
}
|
if (ls) {
|
ui.position.left = inst._convertPositionTo('relative', {
|
top: 0,
|
left: l - inst.helperProportions.width
|
}).left
|
}
|
if (rs) {
|
ui.position.left = inst._convertPositionTo('relative', {
|
top: 0,
|
left: r
|
}).left
|
}
|
}
|
|
first = ts || bs || ls || rs
|
|
if (o.snapMode !== 'outer') {
|
ts = Math.abs(t - y1) <= d
|
bs = Math.abs(b - y2) <= d
|
ls = Math.abs(l - x1) <= d
|
rs = Math.abs(r - x2) <= d
|
if (ts) {
|
ui.position.top = inst._convertPositionTo('relative', {
|
top: t,
|
left: 0
|
}).top
|
}
|
if (bs) {
|
ui.position.top = inst._convertPositionTo('relative', {
|
top: b - inst.helperProportions.height,
|
left: 0
|
}).top
|
}
|
if (ls) {
|
ui.position.left = inst._convertPositionTo('relative', {
|
top: 0,
|
left: l
|
}).left
|
}
|
if (rs) {
|
ui.position.left = inst._convertPositionTo('relative', {
|
top: 0,
|
left: r - inst.helperProportions.width
|
}).left
|
}
|
}
|
|
if (!inst.snapElements[i].snapping && (ts || bs || ls || rs || first)) {
|
inst.options.snap.snap &&
|
inst.options.snap.snap.call(
|
inst.element,
|
event,
|
$.extend(inst._uiHash(), {
|
snapItem: inst.snapElements[i].item
|
})
|
)
|
}
|
inst.snapElements[i].snapping = ts || bs || ls || rs || first
|
}
|
}
|
})
|
|
$.ui.plugin.add('draggable', 'stack', {
|
start: function (event, ui, instance) {
|
var min,
|
o = instance.options,
|
group = $.makeArray($(o.stack)).sort(function (a, b) {
|
return (parseInt($(a).css('zIndex'), 10) || 0) - (parseInt($(b).css('zIndex'), 10) || 0)
|
})
|
|
if (!group.length) {
|
return
|
}
|
|
min = parseInt($(group[0]).css('zIndex'), 10) || 0
|
$(group).each(function (i) {
|
$(this).css('zIndex', min + i)
|
})
|
this.css('zIndex', min + group.length)
|
}
|
})
|
|
$.ui.plugin.add('draggable', 'zIndex', {
|
start: function (event, ui, instance) {
|
var t = $(ui.helper),
|
o = instance.options
|
|
if (t.css('zIndex')) {
|
o._zIndex = t.css('zIndex')
|
}
|
t.css('zIndex', o.zIndex)
|
},
|
stop: function (event, ui, instance) {
|
var o = instance.options
|
|
if (o._zIndex) {
|
$(ui.helper).css('zIndex', o._zIndex)
|
}
|
}
|
})
|
|
var widgetsDraggable = $.ui.draggable
|
|
/*!
|
* jQuery UI Resizable 1.12.1
|
* http://jqueryui.com
|
*
|
* Copyright jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*/
|
|
//>>label: Resizable
|
//>>group: Interactions
|
//>>description: Enables resize functionality for any element.
|
//>>docs: http://api.jqueryui.com/resizable/
|
//>>demos: http://jqueryui.com/resizable/
|
//>>css.structure: ../../themes/base/core.css
|
//>>css.structure: ../../themes/base/resizable.css
|
//>>css.theme: ../../themes/base/theme.css
|
|
$.widget('ui.resizable', $.ui.mouse, {
|
version: '1.12.1',
|
widgetEventPrefix: 'resize',
|
options: {
|
alsoResize: false,
|
animate: false,
|
animateDuration: 'slow',
|
animateEasing: 'swing',
|
aspectRatio: false,
|
autoHide: false,
|
classes: {
|
'ui-resizable-se': 'ui-icon ui-icon-gripsmall-diagonal-se'
|
},
|
containment: false,
|
ghost: false,
|
grid: false,
|
handles: 'e,s,se',
|
helper: false,
|
maxHeight: null,
|
maxWidth: null,
|
minHeight: 10,
|
minWidth: 10,
|
|
// See #7960
|
zIndex: 90,
|
|
// Callbacks
|
resize: null,
|
start: null,
|
stop: null
|
},
|
|
_num: function (value) {
|
return parseFloat(value) || 0
|
},
|
|
_isNumber: function (value) {
|
return !isNaN(parseFloat(value))
|
},
|
|
_hasScroll: function (el, a) {
|
if ($(el).css('overflow') === 'hidden') {
|
return false
|
}
|
|
var scroll = a && a === 'left' ? 'scrollLeft' : 'scrollTop',
|
has = false
|
|
if (el[scroll] > 0) {
|
return true
|
}
|
|
// TODO: determine which cases actually cause this to happen
|
// if the element doesn't have the scroll set, see if it's possible to
|
// set the scroll
|
el[scroll] = 1
|
has = el[scroll] > 0
|
el[scroll] = 0
|
return has
|
},
|
|
_create: function () {
|
var margins,
|
o = this.options,
|
that = this
|
this._addClass('ui-resizable')
|
|
$.extend(this, {
|
_aspectRatio: !!o.aspectRatio,
|
aspectRatio: o.aspectRatio,
|
originalElement: this.element,
|
_proportionallyResizeElements: [],
|
_helper: o.helper || o.ghost || o.animate ? o.helper || 'ui-resizable-helper' : null
|
})
|
|
// Wrap the element if it cannot hold child nodes
|
if (this.element[0].nodeName.match(/^(canvas|textarea|input|select|button|img)$/i)) {
|
this.element.wrap(
|
$("<div class='ui-wrapper' style='overflow: hidden;'></div>").css({
|
position: this.element.css('position'),
|
width: this.element.outerWidth(),
|
height: this.element.outerHeight(),
|
top: this.element.css('top'),
|
left: this.element.css('left')
|
})
|
)
|
|
this.element = this.element
|
.parent()
|
.data('ui-resizable', this.element.resizable('instance'))
|
|
this.elementIsWrapper = true
|
|
margins = {
|
marginTop: this.originalElement.css('marginTop'),
|
marginRight: this.originalElement.css('marginRight'),
|
marginBottom: this.originalElement.css('marginBottom'),
|
marginLeft: this.originalElement.css('marginLeft')
|
}
|
|
this.element.css(margins)
|
this.originalElement.css('margin', 0)
|
|
// support: Safari
|
// Prevent Safari textarea resize
|
this.originalResizeStyle = this.originalElement.css('resize')
|
this.originalElement.css('resize', 'none')
|
|
this._proportionallyResizeElements.push(
|
this.originalElement.css({
|
position: 'static',
|
zoom: 1,
|
display: 'block'
|
})
|
)
|
|
// Support: IE9
|
// avoid IE jump (hard set the margin)
|
this.originalElement.css(margins)
|
|
this._proportionallyResize()
|
}
|
|
this._setupHandles()
|
|
if (o.autoHide) {
|
$(this.element)
|
.on('mouseenter', function () {
|
if (o.disabled) {
|
return
|
}
|
that._removeClass('ui-resizable-autohide')
|
that._handles.show()
|
})
|
.on('mouseleave', function () {
|
if (o.disabled) {
|
return
|
}
|
if (!that.resizing) {
|
that._addClass('ui-resizable-autohide')
|
that._handles.hide()
|
}
|
})
|
}
|
|
this._mouseInit()
|
},
|
|
_destroy: function () {
|
this._mouseDestroy()
|
|
var wrapper,
|
_destroy = function (exp) {
|
$(exp)
|
.removeData('resizable')
|
.removeData('ui-resizable')
|
.off('.resizable')
|
.find('.ui-resizable-handle')
|
.remove()
|
}
|
|
// TODO: Unwrap at same DOM position
|
if (this.elementIsWrapper) {
|
_destroy(this.element)
|
wrapper = this.element
|
this.originalElement
|
.css({
|
position: wrapper.css('position'),
|
width: wrapper.outerWidth(),
|
height: wrapper.outerHeight(),
|
top: wrapper.css('top'),
|
left: wrapper.css('left')
|
})
|
.insertAfter(wrapper)
|
wrapper.remove()
|
}
|
|
this.originalElement.css('resize', this.originalResizeStyle)
|
_destroy(this.originalElement)
|
|
return this
|
},
|
|
_setOption: function (key, value) {
|
this._super(key, value)
|
|
switch (key) {
|
case 'handles':
|
this._removeHandles()
|
this._setupHandles()
|
break
|
default:
|
break
|
}
|
},
|
|
_setupHandles: function () {
|
var o = this.options,
|
handle,
|
i,
|
n,
|
hname,
|
axis,
|
that = this
|
this.handles =
|
o.handles ||
|
(!$('.ui-resizable-handle', this.element).length
|
? 'e,s,se'
|
: {
|
n: '.ui-resizable-n',
|
e: '.ui-resizable-e',
|
s: '.ui-resizable-s',
|
w: '.ui-resizable-w',
|
se: '.ui-resizable-se',
|
sw: '.ui-resizable-sw',
|
ne: '.ui-resizable-ne',
|
nw: '.ui-resizable-nw'
|
})
|
|
this._handles = $()
|
if (this.handles.constructor === String) {
|
if (this.handles === 'all') {
|
this.handles = 'n,e,s,w,se,sw,ne,nw'
|
}
|
|
n = this.handles.split(',')
|
this.handles = {}
|
|
for (i = 0; i < n.length; i++) {
|
handle = $.trim(n[i])
|
hname = 'ui-resizable-' + handle
|
axis = $('<div>')
|
this._addClass(axis, 'ui-resizable-handle ' + hname)
|
|
axis.css({ zIndex: o.zIndex })
|
|
this.handles[handle] = '.ui-resizable-' + handle
|
this.element.append(axis)
|
}
|
}
|
|
this._renderAxis = function (target) {
|
var i, axis, padPos, padWrapper
|
|
target = target || this.element
|
|
for (i in this.handles) {
|
if (this.handles[i].constructor === String) {
|
this.handles[i] = this.element.children(this.handles[i]).first().show()
|
} else if (this.handles[i].jquery || this.handles[i].nodeType) {
|
this.handles[i] = $(this.handles[i])
|
this._on(this.handles[i], { mousedown: that._mouseDown })
|
}
|
|
if (
|
this.elementIsWrapper &&
|
this.originalElement[0].nodeName.match(/^(textarea|input|select|button)$/i)
|
) {
|
axis = $(this.handles[i], this.element)
|
|
padWrapper = /sw|ne|nw|se|n|s/.test(i) ? axis.outerHeight() : axis.outerWidth()
|
|
padPos = [
|
'padding',
|
/ne|nw|n/.test(i)
|
? 'Top'
|
: /se|sw|s/.test(i)
|
? 'Bottom'
|
: /^e$/.test(i)
|
? 'Right'
|
: 'Left'
|
].join('')
|
|
target.css(padPos, padWrapper)
|
|
this._proportionallyResize()
|
}
|
|
this._handles = this._handles.add(this.handles[i])
|
}
|
}
|
|
// TODO: make renderAxis a prototype function
|
this._renderAxis(this.element)
|
|
this._handles = this._handles.add(this.element.find('.ui-resizable-handle'))
|
this._handles.disableSelection()
|
|
this._handles.on('mouseover', function () {
|
if (!that.resizing) {
|
if (this.className) {
|
axis = this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i)
|
}
|
that.axis = axis && axis[1] ? axis[1] : 'se'
|
}
|
})
|
|
if (o.autoHide) {
|
this._handles.hide()
|
this._addClass('ui-resizable-autohide')
|
}
|
},
|
|
_removeHandles: function () {
|
this._handles.remove()
|
},
|
|
_mouseCapture: function (event) {
|
var i,
|
handle,
|
capture = false
|
|
for (i in this.handles) {
|
handle = $(this.handles[i])[0]
|
if (handle === event.target || $.contains(handle, event.target)) {
|
capture = true
|
}
|
}
|
|
return !this.options.disabled && capture
|
},
|
|
_mouseStart: function (event) {
|
var curleft,
|
curtop,
|
cursor,
|
o = this.options,
|
el = this.element
|
|
this.resizing = true
|
|
this._renderProxy()
|
|
curleft = this._num(this.helper.css('left'))
|
curtop = this._num(this.helper.css('top'))
|
|
if (o.containment) {
|
curleft += $(o.containment).scrollLeft() || 0
|
curtop += $(o.containment).scrollTop() || 0
|
}
|
|
this.offset = this.helper.offset()
|
this.position = { left: curleft, top: curtop }
|
|
this.size = this._helper
|
? {
|
width: this.helper.width(),
|
height: this.helper.height()
|
}
|
: {
|
width: el.width(),
|
height: el.height()
|
}
|
|
this.originalSize = this._helper
|
? {
|
width: el.outerWidth(),
|
height: el.outerHeight()
|
}
|
: {
|
width: el.width(),
|
height: el.height()
|
}
|
|
this.sizeDiff = {
|
width: el.outerWidth() - el.width(),
|
height: el.outerHeight() - el.height()
|
}
|
|
this.originalPosition = { left: curleft, top: curtop }
|
this.originalMousePosition = { left: event.pageX, top: event.pageY }
|
|
this.aspectRatio =
|
typeof o.aspectRatio === 'number'
|
? o.aspectRatio
|
: this.originalSize.width / this.originalSize.height || 1
|
|
cursor = $('.ui-resizable-' + this.axis).css('cursor')
|
$('body').css('cursor', cursor === 'auto' ? this.axis + '-resize' : cursor)
|
|
this._addClass('ui-resizable-resizing')
|
this._propagate('start', event)
|
return true
|
},
|
|
_mouseDrag: function (event) {
|
var data,
|
props,
|
smp = this.originalMousePosition,
|
a = this.axis,
|
dx = event.pageX - smp.left || 0,
|
dy = event.pageY - smp.top || 0,
|
trigger = this._change[a]
|
|
this._updatePrevProperties()
|
|
if (!trigger) {
|
return false
|
}
|
|
data = trigger.apply(this, [event, dx, dy])
|
|
this._updateVirtualBoundaries(event.shiftKey)
|
if (this._aspectRatio || event.shiftKey) {
|
data = this._updateRatio(data, event)
|
}
|
|
data = this._respectSize(data, event)
|
|
this._updateCache(data)
|
|
this._propagate('resize', event)
|
|
props = this._applyChanges()
|
|
if (!this._helper && this._proportionallyResizeElements.length) {
|
this._proportionallyResize()
|
}
|
|
if (!$.isEmptyObject(props)) {
|
this._updatePrevProperties()
|
this._trigger('resize', event, this.ui())
|
this._applyChanges()
|
}
|
|
return false
|
},
|
|
_mouseStop: function (event) {
|
this.resizing = false
|
var pr,
|
ista,
|
soffseth,
|
soffsetw,
|
s,
|
left,
|
top,
|
o = this.options,
|
that = this
|
|
if (this._helper) {
|
pr = this._proportionallyResizeElements
|
ista = pr.length && /textarea/i.test(pr[0].nodeName)
|
soffseth = ista && this._hasScroll(pr[0], 'left') ? 0 : that.sizeDiff.height
|
soffsetw = ista ? 0 : that.sizeDiff.width
|
|
s = {
|
width: that.helper.width() - soffsetw,
|
height: that.helper.height() - soffseth
|
}
|
left =
|
parseFloat(that.element.css('left')) +
|
(that.position.left - that.originalPosition.left) || null
|
top =
|
parseFloat(that.element.css('top')) + (that.position.top - that.originalPosition.top) ||
|
null
|
|
if (!o.animate) {
|
this.element.css($.extend(s, { top: top, left: left }))
|
}
|
|
that.helper.height(that.size.height)
|
that.helper.width(that.size.width)
|
|
if (this._helper && !o.animate) {
|
this._proportionallyResize()
|
}
|
}
|
|
$('body').css('cursor', 'auto')
|
|
this._removeClass('ui-resizable-resizing')
|
|
this._propagate('stop', event)
|
|
if (this._helper) {
|
this.helper.remove()
|
}
|
|
return false
|
},
|
|
_updatePrevProperties: function () {
|
this.prevPosition = {
|
top: this.position.top,
|
left: this.position.left
|
}
|
this.prevSize = {
|
width: this.size.width,
|
height: this.size.height
|
}
|
},
|
|
_applyChanges: function () {
|
var props = {}
|
|
if (this.position.top !== this.prevPosition.top) {
|
props.top = this.position.top + 'px'
|
}
|
if (this.position.left !== this.prevPosition.left) {
|
props.left = this.position.left + 'px'
|
}
|
if (this.size.width !== this.prevSize.width) {
|
props.width = this.size.width + 'px'
|
}
|
if (this.size.height !== this.prevSize.height) {
|
props.height = this.size.height + 'px'
|
}
|
|
this.helper.css(props)
|
|
return props
|
},
|
|
_updateVirtualBoundaries: function (forceAspectRatio) {
|
var pMinWidth,
|
pMaxWidth,
|
pMinHeight,
|
pMaxHeight,
|
b,
|
o = this.options
|
|
b = {
|
minWidth: this._isNumber(o.minWidth) ? o.minWidth : 0,
|
maxWidth: this._isNumber(o.maxWidth) ? o.maxWidth : Infinity,
|
minHeight: this._isNumber(o.minHeight) ? o.minHeight : 0,
|
maxHeight: this._isNumber(o.maxHeight) ? o.maxHeight : Infinity
|
}
|
|
if (this._aspectRatio || forceAspectRatio) {
|
pMinWidth = b.minHeight * this.aspectRatio
|
pMinHeight = b.minWidth / this.aspectRatio
|
pMaxWidth = b.maxHeight * this.aspectRatio
|
pMaxHeight = b.maxWidth / this.aspectRatio
|
|
if (pMinWidth > b.minWidth) {
|
b.minWidth = pMinWidth
|
}
|
if (pMinHeight > b.minHeight) {
|
b.minHeight = pMinHeight
|
}
|
if (pMaxWidth < b.maxWidth) {
|
b.maxWidth = pMaxWidth
|
}
|
if (pMaxHeight < b.maxHeight) {
|
b.maxHeight = pMaxHeight
|
}
|
}
|
this._vBoundaries = b
|
},
|
|
_updateCache: function (data) {
|
this.offset = this.helper.offset()
|
if (this._isNumber(data.left)) {
|
this.position.left = data.left
|
}
|
if (this._isNumber(data.top)) {
|
this.position.top = data.top
|
}
|
if (this._isNumber(data.height)) {
|
this.size.height = data.height
|
}
|
if (this._isNumber(data.width)) {
|
this.size.width = data.width
|
}
|
},
|
|
_updateRatio: function (data) {
|
var cpos = this.position,
|
csize = this.size,
|
a = this.axis
|
|
if (this._isNumber(data.height)) {
|
data.width = data.height * this.aspectRatio
|
} else if (this._isNumber(data.width)) {
|
data.height = data.width / this.aspectRatio
|
}
|
|
if (a === 'sw') {
|
data.left = cpos.left + (csize.width - data.width)
|
data.top = null
|
}
|
if (a === 'nw') {
|
data.top = cpos.top + (csize.height - data.height)
|
data.left = cpos.left + (csize.width - data.width)
|
}
|
|
return data
|
},
|
|
_respectSize: function (data) {
|
var o = this._vBoundaries,
|
a = this.axis,
|
ismaxw = this._isNumber(data.width) && o.maxWidth && o.maxWidth < data.width,
|
ismaxh = this._isNumber(data.height) && o.maxHeight && o.maxHeight < data.height,
|
isminw = this._isNumber(data.width) && o.minWidth && o.minWidth > data.width,
|
isminh = this._isNumber(data.height) && o.minHeight && o.minHeight > data.height,
|
dw = this.originalPosition.left + this.originalSize.width,
|
dh = this.originalPosition.top + this.originalSize.height,
|
cw = /sw|nw|w/.test(a),
|
ch = /nw|ne|n/.test(a)
|
if (isminw) {
|
data.width = o.minWidth
|
}
|
if (isminh) {
|
data.height = o.minHeight
|
}
|
if (ismaxw) {
|
data.width = o.maxWidth
|
}
|
if (ismaxh) {
|
data.height = o.maxHeight
|
}
|
|
if (isminw && cw) {
|
data.left = dw - o.minWidth
|
}
|
if (ismaxw && cw) {
|
data.left = dw - o.maxWidth
|
}
|
if (isminh && ch) {
|
data.top = dh - o.minHeight
|
}
|
if (ismaxh && ch) {
|
data.top = dh - o.maxHeight
|
}
|
|
// Fixing jump error on top/left - bug #2330
|
if (!data.width && !data.height && !data.left && data.top) {
|
data.top = null
|
} else if (!data.width && !data.height && !data.top && data.left) {
|
data.left = null
|
}
|
|
return data
|
},
|
|
_getPaddingPlusBorderDimensions: function (element) {
|
var i = 0,
|
widths = [],
|
borders = [
|
element.css('borderTopWidth'),
|
element.css('borderRightWidth'),
|
element.css('borderBottomWidth'),
|
element.css('borderLeftWidth')
|
],
|
paddings = [
|
element.css('paddingTop'),
|
element.css('paddingRight'),
|
element.css('paddingBottom'),
|
element.css('paddingLeft')
|
]
|
|
for (; i < 4; i++) {
|
widths[i] = parseFloat(borders[i]) || 0
|
widths[i] += parseFloat(paddings[i]) || 0
|
}
|
|
return {
|
height: widths[0] + widths[2],
|
width: widths[1] + widths[3]
|
}
|
},
|
|
_proportionallyResize: function () {
|
if (!this._proportionallyResizeElements.length) {
|
return
|
}
|
|
var prel,
|
i = 0,
|
element = this.helper || this.element
|
|
for (; i < this._proportionallyResizeElements.length; i++) {
|
prel = this._proportionallyResizeElements[i]
|
|
// TODO: Seems like a bug to cache this.outerDimensions
|
// considering that we are in a loop.
|
if (!this.outerDimensions) {
|
this.outerDimensions = this._getPaddingPlusBorderDimensions(prel)
|
}
|
|
prel.css({
|
height: element.height() - this.outerDimensions.height || 0,
|
width: element.width() - this.outerDimensions.width || 0
|
})
|
}
|
},
|
|
_renderProxy: function () {
|
var el = this.element,
|
o = this.options
|
this.elementOffset = el.offset()
|
|
if (this._helper) {
|
this.helper = this.helper || $("<div style='overflow:hidden;'></div>")
|
|
this._addClass(this.helper, this._helper)
|
this.helper.css({
|
width: this.element.outerWidth(),
|
height: this.element.outerHeight(),
|
position: 'absolute',
|
left: this.elementOffset.left + 'px',
|
top: this.elementOffset.top + 'px',
|
zIndex: ++o.zIndex //TODO: Don't modify option
|
})
|
|
this.helper.appendTo('body').disableSelection()
|
} else {
|
this.helper = this.element
|
}
|
},
|
|
_change: {
|
e: function (event, dx) {
|
return { width: this.originalSize.width + dx }
|
},
|
w: function (event, dx) {
|
var cs = this.originalSize,
|
sp = this.originalPosition
|
return { left: sp.left + dx, width: cs.width - dx }
|
},
|
n: function (event, dx, dy) {
|
var cs = this.originalSize,
|
sp = this.originalPosition
|
return { top: sp.top + dy, height: cs.height - dy }
|
},
|
s: function (event, dx, dy) {
|
return { height: this.originalSize.height + dy }
|
},
|
se: function (event, dx, dy) {
|
return $.extend(
|
this._change.s.apply(this, arguments),
|
this._change.e.apply(this, [event, dx, dy])
|
)
|
},
|
sw: function (event, dx, dy) {
|
return $.extend(
|
this._change.s.apply(this, arguments),
|
this._change.w.apply(this, [event, dx, dy])
|
)
|
},
|
ne: function (event, dx, dy) {
|
return $.extend(
|
this._change.n.apply(this, arguments),
|
this._change.e.apply(this, [event, dx, dy])
|
)
|
},
|
nw: function (event, dx, dy) {
|
return $.extend(
|
this._change.n.apply(this, arguments),
|
this._change.w.apply(this, [event, dx, dy])
|
)
|
}
|
},
|
|
_propagate: function (n, event) {
|
$.ui.plugin.call(this, n, [event, this.ui()])
|
n !== 'resize' && this._trigger(n, event, this.ui())
|
},
|
|
plugins: {},
|
|
ui: function () {
|
return {
|
originalElement: this.originalElement,
|
element: this.element,
|
helper: this.helper,
|
position: this.position,
|
size: this.size,
|
originalSize: this.originalSize,
|
originalPosition: this.originalPosition
|
}
|
}
|
})
|
|
/*
|
* Resizable Extensions
|
*/
|
|
$.ui.plugin.add('resizable', 'animate', {
|
stop: function (event) {
|
var that = $(this).resizable('instance'),
|
o = that.options,
|
pr = that._proportionallyResizeElements,
|
ista = pr.length && /textarea/i.test(pr[0].nodeName),
|
soffseth = ista && that._hasScroll(pr[0], 'left') ? 0 : that.sizeDiff.height,
|
soffsetw = ista ? 0 : that.sizeDiff.width,
|
style = {
|
width: that.size.width - soffsetw,
|
height: that.size.height - soffseth
|
},
|
left =
|
parseFloat(that.element.css('left')) +
|
(that.position.left - that.originalPosition.left) || null,
|
top =
|
parseFloat(that.element.css('top')) + (that.position.top - that.originalPosition.top) ||
|
null
|
|
that.element.animate($.extend(style, top && left ? { top: top, left: left } : {}), {
|
duration: o.animateDuration,
|
easing: o.animateEasing,
|
step: function () {
|
var data = {
|
width: parseFloat(that.element.css('width')),
|
height: parseFloat(that.element.css('height')),
|
top: parseFloat(that.element.css('top')),
|
left: parseFloat(that.element.css('left'))
|
}
|
|
if (pr && pr.length) {
|
$(pr[0]).css({ width: data.width, height: data.height })
|
}
|
|
// Propagating resize, and updating values for each animation step
|
that._updateCache(data)
|
that._propagate('resize', event)
|
}
|
})
|
}
|
})
|
|
$.ui.plugin.add('resizable', 'containment', {
|
start: function () {
|
var element,
|
p,
|
co,
|
ch,
|
cw,
|
width,
|
height,
|
that = $(this).resizable('instance'),
|
o = that.options,
|
el = that.element,
|
oc = o.containment,
|
ce = oc instanceof $ ? oc.get(0) : /parent/.test(oc) ? el.parent().get(0) : oc
|
|
if (!ce) {
|
return
|
}
|
|
that.containerElement = $(ce)
|
|
if (/document/.test(oc) || oc === document) {
|
that.containerOffset = {
|
left: 0,
|
top: 0
|
}
|
that.containerPosition = {
|
left: 0,
|
top: 0
|
}
|
|
that.parentData = {
|
element: $(document),
|
left: 0,
|
top: 0,
|
width: $(document).width(),
|
height: $(document).height() || document.body.parentNode.scrollHeight
|
}
|
} else {
|
element = $(ce)
|
p = []
|
$(['Top', 'Right', 'Left', 'Bottom']).each(function (i, name) {
|
p[i] = that._num(element.css('padding' + name))
|
})
|
|
that.containerOffset = element.offset()
|
that.containerPosition = element.position()
|
that.containerSize = {
|
height: element.innerHeight() - p[3],
|
width: element.innerWidth() - p[1]
|
}
|
|
co = that.containerOffset
|
ch = that.containerSize.height
|
cw = that.containerSize.width
|
width = that._hasScroll(ce, 'left') ? ce.scrollWidth : cw
|
height = that._hasScroll(ce) ? ce.scrollHeight : ch
|
|
that.parentData = {
|
element: ce,
|
left: co.left,
|
top: co.top,
|
width: width,
|
height: height
|
}
|
}
|
},
|
|
resize: function (event) {
|
var woset,
|
hoset,
|
isParent,
|
isOffsetRelative,
|
that = $(this).resizable('instance'),
|
o = that.options,
|
co = that.containerOffset,
|
cp = that.position,
|
pRatio = that._aspectRatio || event.shiftKey,
|
cop = {
|
top: 0,
|
left: 0
|
},
|
ce = that.containerElement,
|
continueResize = true
|
|
if (ce[0] !== document && /static/.test(ce.css('position'))) {
|
cop = co
|
}
|
|
if (cp.left < (that._helper ? co.left : 0)) {
|
that.size.width =
|
that.size.width +
|
(that._helper ? that.position.left - co.left : that.position.left - cop.left)
|
|
if (pRatio) {
|
that.size.height = that.size.width / that.aspectRatio
|
continueResize = false
|
}
|
that.position.left = o.helper ? co.left : 0
|
}
|
|
if (cp.top < (that._helper ? co.top : 0)) {
|
that.size.height =
|
that.size.height + (that._helper ? that.position.top - co.top : that.position.top)
|
|
if (pRatio) {
|
that.size.width = that.size.height * that.aspectRatio
|
continueResize = false
|
}
|
that.position.top = that._helper ? co.top : 0
|
}
|
|
isParent = that.containerElement.get(0) === that.element.parent().get(0)
|
isOffsetRelative = /relative|absolute/.test(that.containerElement.css('position'))
|
|
if (isParent && isOffsetRelative) {
|
that.offset.left = that.parentData.left + that.position.left
|
that.offset.top = that.parentData.top + that.position.top
|
} else {
|
that.offset.left = that.element.offset().left
|
that.offset.top = that.element.offset().top
|
}
|
|
woset = Math.abs(
|
that.sizeDiff.width +
|
(that._helper ? that.offset.left - cop.left : that.offset.left - co.left)
|
)
|
|
hoset = Math.abs(
|
that.sizeDiff.height + (that._helper ? that.offset.top - cop.top : that.offset.top - co.top)
|
)
|
|
if (woset + that.size.width >= that.parentData.width) {
|
that.size.width = that.parentData.width - woset
|
if (pRatio) {
|
that.size.height = that.size.width / that.aspectRatio
|
continueResize = false
|
}
|
}
|
|
if (hoset + that.size.height >= that.parentData.height) {
|
that.size.height = that.parentData.height - hoset
|
if (pRatio) {
|
that.size.width = that.size.height * that.aspectRatio
|
continueResize = false
|
}
|
}
|
|
if (!continueResize) {
|
that.position.left = that.prevPosition.left
|
that.position.top = that.prevPosition.top
|
that.size.width = that.prevSize.width
|
that.size.height = that.prevSize.height
|
}
|
},
|
|
stop: function () {
|
var that = $(this).resizable('instance'),
|
o = that.options,
|
co = that.containerOffset,
|
cop = that.containerPosition,
|
ce = that.containerElement,
|
helper = $(that.helper),
|
ho = helper.offset(),
|
w = helper.outerWidth() - that.sizeDiff.width,
|
h = helper.outerHeight() - that.sizeDiff.height
|
|
if (that._helper && !o.animate && /relative/.test(ce.css('position'))) {
|
$(this).css({
|
left: ho.left - cop.left - co.left,
|
width: w,
|
height: h
|
})
|
}
|
|
if (that._helper && !o.animate && /static/.test(ce.css('position'))) {
|
$(this).css({
|
left: ho.left - cop.left - co.left,
|
width: w,
|
height: h
|
})
|
}
|
}
|
})
|
|
$.ui.plugin.add('resizable', 'alsoResize', {
|
start: function () {
|
var that = $(this).resizable('instance'),
|
o = that.options
|
|
$(o.alsoResize).each(function () {
|
var el = $(this)
|
el.data('ui-resizable-alsoresize', {
|
width: parseFloat(el.width()),
|
height: parseFloat(el.height()),
|
left: parseFloat(el.css('left')),
|
top: parseFloat(el.css('top'))
|
})
|
})
|
},
|
|
resize: function (event, ui) {
|
var that = $(this).resizable('instance'),
|
o = that.options,
|
os = that.originalSize,
|
op = that.originalPosition,
|
delta = {
|
height: that.size.height - os.height || 0,
|
width: that.size.width - os.width || 0,
|
top: that.position.top - op.top || 0,
|
left: that.position.left - op.left || 0
|
}
|
|
$(o.alsoResize).each(function () {
|
var el = $(this),
|
start = $(this).data('ui-resizable-alsoresize'),
|
style = {},
|
css = el.parents(ui.originalElement[0]).length
|
? ['width', 'height']
|
: ['width', 'height', 'top', 'left']
|
|
$.each(css, function (i, prop) {
|
var sum = (start[prop] || 0) + (delta[prop] || 0)
|
if (sum && sum >= 0) {
|
style[prop] = sum || null
|
}
|
})
|
|
el.css(style)
|
})
|
},
|
|
stop: function () {
|
$(this).removeData('ui-resizable-alsoresize')
|
}
|
})
|
|
$.ui.plugin.add('resizable', 'ghost', {
|
start: function () {
|
var that = $(this).resizable('instance'),
|
cs = that.size
|
|
that.ghost = that.originalElement.clone()
|
that.ghost.css({
|
opacity: 0.25,
|
display: 'block',
|
position: 'relative',
|
height: cs.height,
|
width: cs.width,
|
margin: 0,
|
left: 0,
|
top: 0
|
})
|
|
that._addClass(that.ghost, 'ui-resizable-ghost')
|
|
// DEPRECATED
|
// TODO: remove after 1.12
|
if ($.uiBackCompat !== false && typeof that.options.ghost === 'string') {
|
// Ghost option
|
that.ghost.addClass(this.options.ghost)
|
}
|
|
that.ghost.appendTo(that.helper)
|
},
|
|
resize: function () {
|
var that = $(this).resizable('instance')
|
if (that.ghost) {
|
that.ghost.css({
|
position: 'relative',
|
height: that.size.height,
|
width: that.size.width
|
})
|
}
|
},
|
|
stop: function () {
|
var that = $(this).resizable('instance')
|
if (that.ghost && that.helper) {
|
that.helper.get(0).removeChild(that.ghost.get(0))
|
}
|
}
|
})
|
|
$.ui.plugin.add('resizable', 'grid', {
|
resize: function () {
|
var outerDimensions,
|
that = $(this).resizable('instance'),
|
o = that.options,
|
cs = that.size,
|
os = that.originalSize,
|
op = that.originalPosition,
|
a = that.axis,
|
grid = typeof o.grid === 'number' ? [o.grid, o.grid] : o.grid,
|
gridX = grid[0] || 1,
|
gridY = grid[1] || 1,
|
ox = Math.round((cs.width - os.width) / gridX) * gridX,
|
oy = Math.round((cs.height - os.height) / gridY) * gridY,
|
newWidth = os.width + ox,
|
newHeight = os.height + oy,
|
isMaxWidth = o.maxWidth && o.maxWidth < newWidth,
|
isMaxHeight = o.maxHeight && o.maxHeight < newHeight,
|
isMinWidth = o.minWidth && o.minWidth > newWidth,
|
isMinHeight = o.minHeight && o.minHeight > newHeight
|
|
o.grid = grid
|
|
if (isMinWidth) {
|
newWidth += gridX
|
}
|
if (isMinHeight) {
|
newHeight += gridY
|
}
|
if (isMaxWidth) {
|
newWidth -= gridX
|
}
|
if (isMaxHeight) {
|
newHeight -= gridY
|
}
|
|
if (/^(se|s|e)$/.test(a)) {
|
that.size.width = newWidth
|
that.size.height = newHeight
|
} else if (/^(ne)$/.test(a)) {
|
that.size.width = newWidth
|
that.size.height = newHeight
|
that.position.top = op.top - oy
|
} else if (/^(sw)$/.test(a)) {
|
that.size.width = newWidth
|
that.size.height = newHeight
|
that.position.left = op.left - ox
|
} else {
|
if (newHeight - gridY <= 0 || newWidth - gridX <= 0) {
|
outerDimensions = that._getPaddingPlusBorderDimensions(this)
|
}
|
|
if (newHeight - gridY > 0) {
|
that.size.height = newHeight
|
that.position.top = op.top - oy
|
} else {
|
newHeight = gridY - outerDimensions.height
|
that.size.height = newHeight
|
that.position.top = op.top + os.height - newHeight
|
}
|
if (newWidth - gridX > 0) {
|
that.size.width = newWidth
|
that.position.left = op.left - ox
|
} else {
|
newWidth = gridX - outerDimensions.width
|
that.size.width = newWidth
|
that.position.left = op.left + os.width - newWidth
|
}
|
}
|
}
|
})
|
|
var widgetsResizable = $.ui.resizable
|
|
/*!
|
* jQuery UI Dialog 1.12.1
|
* http://jqueryui.com
|
*
|
* Copyright jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*/
|
|
//>>label: Dialog
|
//>>group: Widgets
|
//>>description: Displays customizable dialog windows.
|
//>>docs: http://api.jqueryui.com/dialog/
|
//>>demos: http://jqueryui.com/dialog/
|
//>>css.structure: ../../themes/base/core.css
|
//>>css.structure: ../../themes/base/dialog.css
|
//>>css.theme: ../../themes/base/theme.css
|
|
$.widget('ui.dialog', {
|
version: '1.12.1',
|
options: {
|
appendTo: 'body',
|
autoOpen: true,
|
buttons: [],
|
classes: {
|
'ui-dialog': 'ui-corner-all',
|
'ui-dialog-titlebar': 'ui-corner-all'
|
},
|
closeOnEscape: true,
|
closeText: 'Close',
|
draggable: true,
|
hide: null,
|
height: 'auto',
|
maxHeight: null,
|
maxWidth: null,
|
minHeight: 150,
|
minWidth: 150,
|
modal: false,
|
position: {
|
my: 'center',
|
at: 'center',
|
of: window,
|
collision: 'fit',
|
|
// Ensure the titlebar is always visible
|
using: function (pos) {
|
var topOffset = $(this).css(pos).offset().top
|
if (topOffset < 0) {
|
$(this).css('top', pos.top - topOffset)
|
}
|
}
|
},
|
resizable: true,
|
show: null,
|
title: null,
|
width: 300,
|
|
// Callbacks
|
beforeClose: null,
|
close: null,
|
drag: null,
|
dragStart: null,
|
dragStop: null,
|
focus: null,
|
open: null,
|
resize: null,
|
resizeStart: null,
|
resizeStop: null
|
},
|
|
sizeRelatedOptions: {
|
buttons: true,
|
height: true,
|
maxHeight: true,
|
maxWidth: true,
|
minHeight: true,
|
minWidth: true,
|
width: true
|
},
|
|
resizableRelatedOptions: {
|
maxHeight: true,
|
maxWidth: true,
|
minHeight: true,
|
minWidth: true
|
},
|
|
_create: function () {
|
this.originalCss = {
|
display: this.element[0].style.display,
|
width: this.element[0].style.width,
|
minHeight: this.element[0].style.minHeight,
|
maxHeight: this.element[0].style.maxHeight,
|
height: this.element[0].style.height
|
}
|
this.originalPosition = {
|
parent: this.element.parent(),
|
index: this.element.parent().children().index(this.element)
|
}
|
this.originalTitle = this.element.attr('title')
|
if (this.options.title == null && this.originalTitle != null) {
|
this.options.title = this.originalTitle
|
}
|
|
// Dialogs can't be disabled
|
if (this.options.disabled) {
|
this.options.disabled = false
|
}
|
|
this._createWrapper()
|
|
this.element.show().removeAttr('title').appendTo(this.uiDialog)
|
|
this._addClass('ui-dialog-content', 'ui-widget-content')
|
|
this._createTitlebar()
|
this._createButtonPane()
|
|
if (this.options.draggable && $.fn.draggable) {
|
this._makeDraggable()
|
}
|
if (this.options.resizable && $.fn.resizable) {
|
this._makeResizable()
|
}
|
|
this._isOpen = false
|
|
this._trackFocus()
|
},
|
|
_init: function () {
|
if (this.options.autoOpen) {
|
this.open()
|
}
|
},
|
|
_appendTo: function () {
|
var element = this.options.appendTo
|
if (element && (element.jquery || element.nodeType)) {
|
return $(element)
|
}
|
return this.document.find(element || 'body').eq(0)
|
},
|
|
_destroy: function () {
|
var next,
|
originalPosition = this.originalPosition
|
|
this._untrackInstance()
|
this._destroyOverlay()
|
|
this.element
|
.removeUniqueId()
|
.css(this.originalCss)
|
|
// Without detaching first, the following becomes really slow
|
.detach()
|
|
this.uiDialog.remove()
|
|
if (this.originalTitle) {
|
this.element.attr('title', this.originalTitle)
|
}
|
|
next = originalPosition.parent.children().eq(originalPosition.index)
|
|
// Don't try to place the dialog next to itself (#8613)
|
if (next.length && next[0] !== this.element[0]) {
|
next.before(this.element)
|
} else {
|
originalPosition.parent.append(this.element)
|
}
|
},
|
|
widget: function () {
|
return this.uiDialog
|
},
|
|
disable: $.noop,
|
enable: $.noop,
|
|
close: function (event) {
|
var that = this
|
|
if (!this._isOpen || this._trigger('beforeClose', event) === false) {
|
return
|
}
|
|
this._isOpen = false
|
this._focusedElement = null
|
this._destroyOverlay()
|
this._untrackInstance()
|
|
if (!this.opener.filter(':focusable').trigger('focus').length) {
|
// Hiding a focused element doesn't trigger blur in WebKit
|
// so in case we have nothing to focus on, explicitly blur the active element
|
// https://bugs.webkit.org/show_bug.cgi?id=47182
|
$.ui.safeBlur($.ui.safeActiveElement(this.document[0]))
|
}
|
|
this._hide(this.uiDialog, this.options.hide, function () {
|
that._trigger('close', event)
|
})
|
},
|
|
isOpen: function () {
|
return this._isOpen
|
},
|
|
moveToTop: function () {
|
this._moveToTop()
|
},
|
|
_moveToTop: function (event, silent) {
|
var moved = false,
|
zIndices = this.uiDialog
|
.siblings('.ui-front:visible')
|
.map(function () {
|
return +$(this).css('z-index')
|
})
|
.get(),
|
zIndexMax = Math.max.apply(null, zIndices)
|
|
if (zIndexMax >= +this.uiDialog.css('z-index')) {
|
this.uiDialog.css('z-index', zIndexMax + 1)
|
moved = true
|
}
|
|
if (moved && !silent) {
|
this._trigger('focus', event)
|
}
|
return moved
|
},
|
|
open: function () {
|
var that = this
|
if (this._isOpen) {
|
if (this._moveToTop()) {
|
this._focusTabbable()
|
}
|
return
|
}
|
|
this._isOpen = true
|
this.opener = $($.ui.safeActiveElement(this.document[0]))
|
|
this._size()
|
this._position()
|
this._createOverlay()
|
this._moveToTop(null, true)
|
|
// Ensure the overlay is moved to the top with the dialog, but only when
|
// opening. The overlay shouldn't move after the dialog is open so that
|
// modeless dialogs opened after the modal dialog stack properly.
|
if (this.overlay) {
|
this.overlay.css('z-index', this.uiDialog.css('z-index') - 1)
|
}
|
|
this._show(this.uiDialog, this.options.show, function () {
|
that._focusTabbable()
|
that._trigger('focus')
|
})
|
|
// Track the dialog immediately upon openening in case a focus event
|
// somehow occurs outside of the dialog before an element inside the
|
// dialog is focused (#10152)
|
this._makeFocusTarget()
|
|
this._trigger('open')
|
},
|
|
_focusTabbable: function () {
|
// Set focus to the first match:
|
// 1. An element that was focused previously
|
// 2. First element inside the dialog matching [autofocus]
|
// 3. Tabbable element inside the content element
|
// 4. Tabbable element inside the buttonpane
|
// 5. The close button
|
// 6. The dialog itself
|
var hasFocus = this._focusedElement
|
if (!hasFocus) {
|
hasFocus = this.element.find('[autofocus]')
|
}
|
if (!hasFocus.length) {
|
hasFocus = this.element.find(':tabbable')
|
}
|
if (!hasFocus.length) {
|
hasFocus = this.uiDialogButtonPane.find(':tabbable')
|
}
|
if (!hasFocus.length) {
|
hasFocus = this.uiDialogTitlebarClose.filter(':tabbable')
|
}
|
if (!hasFocus.length) {
|
hasFocus = this.uiDialog
|
}
|
hasFocus.eq(0).trigger('focus')
|
},
|
|
_keepFocus: function (event) {
|
function checkFocus() {
|
var activeElement = $.ui.safeActiveElement(this.document[0]),
|
isActive =
|
this.uiDialog[0] === activeElement || $.contains(this.uiDialog[0], activeElement)
|
if (!isActive) {
|
this._focusTabbable()
|
}
|
}
|
event.preventDefault()
|
checkFocus.call(this)
|
|
// support: IE
|
// IE <= 8 doesn't prevent moving focus even with event.preventDefault()
|
// so we check again later
|
this._delay(checkFocus)
|
},
|
|
_createWrapper: function () {
|
this.uiDialog = $('<div>')
|
.hide()
|
.attr({
|
// Setting tabIndex makes the div focusable
|
tabIndex: -1,
|
role: 'dialog'
|
})
|
.appendTo(this._appendTo())
|
|
this._addClass(this.uiDialog, 'ui-dialog', 'ui-widget ui-widget-content ui-front')
|
this._on(this.uiDialog, {
|
keydown: function (event) {
|
if (
|
this.options.closeOnEscape &&
|
!event.isDefaultPrevented() &&
|
event.keyCode &&
|
event.keyCode === $.ui.keyCode.ESCAPE
|
) {
|
event.preventDefault()
|
this.close(event)
|
return
|
}
|
|
// Prevent tabbing out of dialogs
|
if (event.keyCode !== $.ui.keyCode.TAB || event.isDefaultPrevented()) {
|
return
|
}
|
var tabbables = this.uiDialog.find(':tabbable'),
|
first = tabbables.filter(':first'),
|
last = tabbables.filter(':last')
|
|
if ((event.target === last[0] || event.target === this.uiDialog[0]) && !event.shiftKey) {
|
this._delay(function () {
|
first.trigger('focus')
|
})
|
event.preventDefault()
|
} else if (
|
(event.target === first[0] || event.target === this.uiDialog[0]) &&
|
event.shiftKey
|
) {
|
this._delay(function () {
|
last.trigger('focus')
|
})
|
event.preventDefault()
|
}
|
},
|
mousedown: function (event) {
|
if (this._moveToTop(event)) {
|
this._focusTabbable()
|
}
|
}
|
})
|
|
// We assume that any existing aria-describedby attribute means
|
// that the dialog content is marked up properly
|
// otherwise we brute force the content as the description
|
if (!this.element.find('[aria-describedby]').length) {
|
this.uiDialog.attr({
|
'aria-describedby': this.element.uniqueId().attr('id')
|
})
|
}
|
},
|
|
_createTitlebar: function () {
|
var uiDialogTitle
|
|
this.uiDialogTitlebar = $('<div>')
|
this._addClass(
|
this.uiDialogTitlebar,
|
'ui-dialog-titlebar',
|
'ui-widget-header ui-helper-clearfix'
|
)
|
this._on(this.uiDialogTitlebar, {
|
mousedown: function (event) {
|
// Don't prevent click on close button (#8838)
|
// Focusing a dialog that is partially scrolled out of view
|
// causes the browser to scroll it into view, preventing the click event
|
if (!$(event.target).closest('.ui-dialog-titlebar-close')) {
|
// Dialog isn't getting focus when dragging (#8063)
|
this.uiDialog.trigger('focus')
|
}
|
}
|
})
|
|
// Support: IE
|
// Use type="button" to prevent enter keypresses in textboxes from closing the
|
// dialog in IE (#9312)
|
this.uiDialogTitlebarClose = $("<button type='button'></button>")
|
.button({
|
label: $('<a>').text(this.options.closeText).html(),
|
icon: 'ui-icon-closethick',
|
showLabel: false
|
})
|
.appendTo(this.uiDialogTitlebar)
|
|
this._addClass(this.uiDialogTitlebarClose, 'ui-dialog-titlebar-close')
|
this._on(this.uiDialogTitlebarClose, {
|
click: function (event) {
|
event.preventDefault()
|
this.close(event)
|
}
|
})
|
|
uiDialogTitle = $('<span>').uniqueId().prependTo(this.uiDialogTitlebar)
|
this._addClass(uiDialogTitle, 'ui-dialog-title')
|
this._title(uiDialogTitle)
|
|
this.uiDialogTitlebar.prependTo(this.uiDialog)
|
|
this.uiDialog.attr({
|
'aria-labelledby': uiDialogTitle.attr('id')
|
})
|
},
|
|
_title: function (title) {
|
if (this.options.title) {
|
title.text(this.options.title)
|
} else {
|
title.html(' ')
|
}
|
},
|
|
_createButtonPane: function () {
|
this.uiDialogButtonPane = $('<div>')
|
this._addClass(
|
this.uiDialogButtonPane,
|
'ui-dialog-buttonpane',
|
'ui-widget-content ui-helper-clearfix'
|
)
|
|
this.uiButtonSet = $('<div>').appendTo(this.uiDialogButtonPane)
|
this._addClass(this.uiButtonSet, 'ui-dialog-buttonset')
|
|
this._createButtons()
|
},
|
|
_createButtons: function () {
|
var that = this,
|
buttons = this.options.buttons
|
|
// If we already have a button pane, remove it
|
this.uiDialogButtonPane.remove()
|
this.uiButtonSet.empty()
|
|
if ($.isEmptyObject(buttons) || ($.isArray(buttons) && !buttons.length)) {
|
this._removeClass(this.uiDialog, 'ui-dialog-buttons')
|
return
|
}
|
|
$.each(buttons, function (name, props) {
|
var click, buttonOptions
|
props = $.isFunction(props) ? { click: props, text: name } : props
|
|
// Default to a non-submitting button
|
props = $.extend({ type: 'button' }, props)
|
|
// Change the context for the click callback to be the main element
|
click = props.click
|
buttonOptions = {
|
icon: props.icon,
|
iconPosition: props.iconPosition,
|
showLabel: props.showLabel,
|
|
// Deprecated options
|
icons: props.icons,
|
text: props.text
|
}
|
|
delete props.click
|
delete props.icon
|
delete props.iconPosition
|
delete props.showLabel
|
|
// Deprecated options
|
delete props.icons
|
if (typeof props.text === 'boolean') {
|
delete props.text
|
}
|
|
$('<button></button>', props)
|
.button(buttonOptions)
|
.appendTo(that.uiButtonSet)
|
.on('click', function () {
|
click.apply(that.element[0], arguments)
|
})
|
})
|
this._addClass(this.uiDialog, 'ui-dialog-buttons')
|
this.uiDialogButtonPane.appendTo(this.uiDialog)
|
},
|
|
_makeDraggable: function () {
|
var that = this,
|
options = this.options
|
|
function filteredUi(ui) {
|
return {
|
position: ui.position,
|
offset: ui.offset
|
}
|
}
|
|
this.uiDialog.draggable({
|
cancel: '.ui-dialog-content, .ui-dialog-titlebar-close',
|
handle: '.ui-dialog-titlebar',
|
containment: 'document',
|
start: function (event, ui) {
|
that._addClass($(this), 'ui-dialog-dragging')
|
that._blockFrames()
|
that._trigger('dragStart', event, filteredUi(ui))
|
},
|
drag: function (event, ui) {
|
that._trigger('drag', event, filteredUi(ui))
|
},
|
stop: function (event, ui) {
|
var left = ui.offset.left - that.document.scrollLeft(),
|
top = ui.offset.top - that.document.scrollTop()
|
|
options.position = {
|
my: 'left top',
|
at: 'left' + (left >= 0 ? '+' : '') + left + ' ' + 'top' + (top >= 0 ? '+' : '') + top,
|
of: that.window
|
}
|
that._removeClass($(this), 'ui-dialog-dragging')
|
that._unblockFrames()
|
that._trigger('dragStop', event, filteredUi(ui))
|
}
|
})
|
},
|
|
_makeResizable: function () {
|
var that = this,
|
options = this.options,
|
handles = options.resizable,
|
// .ui-resizable has position: relative defined in the stylesheet
|
// but dialogs have to use absolute or fixed positioning
|
position = this.uiDialog.css('position'),
|
resizeHandles = typeof handles === 'string' ? handles : 'n,e,s,w,se,sw,ne,nw'
|
|
function filteredUi(ui) {
|
return {
|
originalPosition: ui.originalPosition,
|
originalSize: ui.originalSize,
|
position: ui.position,
|
size: ui.size
|
}
|
}
|
|
this.uiDialog
|
.resizable({
|
cancel: '.ui-dialog-content',
|
containment: 'document',
|
alsoResize: this.element,
|
maxWidth: options.maxWidth,
|
maxHeight: options.maxHeight,
|
minWidth: options.minWidth,
|
minHeight: this._minHeight(),
|
handles: resizeHandles,
|
start: function (event, ui) {
|
that._addClass($(this), 'ui-dialog-resizing')
|
that._blockFrames()
|
that._trigger('resizeStart', event, filteredUi(ui))
|
},
|
resize: function (event, ui) {
|
that._trigger('resize', event, filteredUi(ui))
|
},
|
stop: function (event, ui) {
|
var offset = that.uiDialog.offset(),
|
left = offset.left - that.document.scrollLeft(),
|
top = offset.top - that.document.scrollTop()
|
|
options.height = that.uiDialog.height()
|
options.width = that.uiDialog.width()
|
options.position = {
|
my: 'left top',
|
at:
|
'left' + (left >= 0 ? '+' : '') + left + ' ' + 'top' + (top >= 0 ? '+' : '') + top,
|
of: that.window
|
}
|
that._removeClass($(this), 'ui-dialog-resizing')
|
that._unblockFrames()
|
that._trigger('resizeStop', event, filteredUi(ui))
|
}
|
})
|
.css('position', position)
|
},
|
|
_trackFocus: function () {
|
this._on(this.widget(), {
|
focusin: function (event) {
|
this._makeFocusTarget()
|
this._focusedElement = $(event.target)
|
}
|
})
|
},
|
|
_makeFocusTarget: function () {
|
this._untrackInstance()
|
this._trackingInstances().unshift(this)
|
},
|
|
_untrackInstance: function () {
|
var instances = this._trackingInstances(),
|
exists = $.inArray(this, instances)
|
if (exists !== -1) {
|
instances.splice(exists, 1)
|
}
|
},
|
|
_trackingInstances: function () {
|
var instances = this.document.data('ui-dialog-instances')
|
if (!instances) {
|
instances = []
|
this.document.data('ui-dialog-instances', instances)
|
}
|
return instances
|
},
|
|
_minHeight: function () {
|
var options = this.options
|
|
return options.height === 'auto'
|
? options.minHeight
|
: Math.min(options.minHeight, options.height)
|
},
|
|
_position: function () {
|
// Need to show the dialog to get the actual offset in the position plugin
|
var isVisible = this.uiDialog.is(':visible')
|
if (!isVisible) {
|
this.uiDialog.show()
|
}
|
this.uiDialog.position(this.options.position)
|
if (!isVisible) {
|
this.uiDialog.hide()
|
}
|
},
|
|
_setOptions: function (options) {
|
var that = this,
|
resize = false,
|
resizableOptions = {}
|
|
$.each(options, function (key, value) {
|
that._setOption(key, value)
|
|
if (key in that.sizeRelatedOptions) {
|
resize = true
|
}
|
if (key in that.resizableRelatedOptions) {
|
resizableOptions[key] = value
|
}
|
})
|
|
if (resize) {
|
this._size()
|
this._position()
|
}
|
if (this.uiDialog.is(':data(ui-resizable)')) {
|
this.uiDialog.resizable('option', resizableOptions)
|
}
|
},
|
|
_setOption: function (key, value) {
|
var isDraggable,
|
isResizable,
|
uiDialog = this.uiDialog
|
|
if (key === 'disabled') {
|
return
|
}
|
|
this._super(key, value)
|
|
if (key === 'appendTo') {
|
this.uiDialog.appendTo(this._appendTo())
|
}
|
|
if (key === 'buttons') {
|
this._createButtons()
|
}
|
|
if (key === 'closeText') {
|
this.uiDialogTitlebarClose.button({
|
// Ensure that we always pass a string
|
label: $('<a>')
|
.text('' + this.options.closeText)
|
.html()
|
})
|
}
|
|
if (key === 'draggable') {
|
isDraggable = uiDialog.is(':data(ui-draggable)')
|
if (isDraggable && !value) {
|
uiDialog.draggable('destroy')
|
}
|
|
if (!isDraggable && value) {
|
this._makeDraggable()
|
}
|
}
|
|
if (key === 'position') {
|
this._position()
|
}
|
|
if (key === 'resizable') {
|
// currently resizable, becoming non-resizable
|
isResizable = uiDialog.is(':data(ui-resizable)')
|
if (isResizable && !value) {
|
uiDialog.resizable('destroy')
|
}
|
|
// Currently resizable, changing handles
|
if (isResizable && typeof value === 'string') {
|
uiDialog.resizable('option', 'handles', value)
|
}
|
|
// Currently non-resizable, becoming resizable
|
if (!isResizable && value !== false) {
|
this._makeResizable()
|
}
|
}
|
|
if (key === 'title') {
|
this._title(this.uiDialogTitlebar.find('.ui-dialog-title'))
|
}
|
},
|
|
_size: function () {
|
// If the user has resized the dialog, the .ui-dialog and .ui-dialog-content
|
// divs will both have width and height set, so we need to reset them
|
var nonContentHeight,
|
minContentHeight,
|
maxContentHeight,
|
options = this.options
|
|
// Reset content sizing
|
this.element.show().css({
|
width: 'auto',
|
minHeight: 0,
|
maxHeight: 'none',
|
height: 0
|
})
|
|
if (options.minWidth > options.width) {
|
options.width = options.minWidth
|
}
|
|
// Reset wrapper sizing
|
// determine the height of all the non-content elements
|
nonContentHeight = this.uiDialog
|
.css({
|
height: 'auto',
|
width: options.width
|
})
|
.outerHeight()
|
minContentHeight = Math.max(0, options.minHeight - nonContentHeight)
|
maxContentHeight =
|
typeof options.maxHeight === 'number'
|
? Math.max(0, options.maxHeight - nonContentHeight)
|
: 'none'
|
|
if (options.height === 'auto') {
|
this.element.css({
|
minHeight: minContentHeight,
|
maxHeight: maxContentHeight,
|
height: 'auto'
|
})
|
} else {
|
this.element.height(Math.max(0, options.height - nonContentHeight))
|
}
|
|
if (this.uiDialog.is(':data(ui-resizable)')) {
|
this.uiDialog.resizable('option', 'minHeight', this._minHeight())
|
}
|
},
|
|
_blockFrames: function () {
|
this.iframeBlocks = this.document.find('iframe').map(function () {
|
var iframe = $(this)
|
|
return $('<div>')
|
.css({
|
position: 'absolute',
|
width: iframe.outerWidth(),
|
height: iframe.outerHeight()
|
})
|
.appendTo(iframe.parent())
|
.offset(iframe.offset())[0]
|
})
|
},
|
|
_unblockFrames: function () {
|
if (this.iframeBlocks) {
|
this.iframeBlocks.remove()
|
delete this.iframeBlocks
|
}
|
},
|
|
_allowInteraction: function (event) {
|
if ($(event.target).closest('.ui-dialog').length) {
|
return true
|
}
|
|
// TODO: Remove hack when datepicker implements
|
// the .ui-front logic (#8989)
|
return !!$(event.target).closest('.ui-datepicker').length
|
},
|
|
_createOverlay: function () {
|
if (!this.options.modal) {
|
return
|
}
|
|
// We use a delay in case the overlay is created from an
|
// event that we're going to be cancelling (#2804)
|
var isOpening = true
|
this._delay(function () {
|
isOpening = false
|
})
|
|
if (!this.document.data('ui-dialog-overlays')) {
|
// Prevent use of anchors and inputs
|
// Using _on() for an event handler shared across many instances is
|
// safe because the dialogs stack and must be closed in reverse order
|
this._on(this.document, {
|
focusin: function (event) {
|
if (isOpening) {
|
return
|
}
|
|
if (!this._allowInteraction(event)) {
|
event.preventDefault()
|
this._trackingInstances()[0]._focusTabbable()
|
}
|
}
|
})
|
}
|
|
this.overlay = $('<div>').appendTo(this._appendTo())
|
|
this._addClass(this.overlay, null, 'ui-widget-overlay ui-front')
|
this._on(this.overlay, {
|
mousedown: '_keepFocus'
|
})
|
this.document.data('ui-dialog-overlays', (this.document.data('ui-dialog-overlays') || 0) + 1)
|
},
|
|
_destroyOverlay: function () {
|
if (!this.options.modal) {
|
return
|
}
|
|
if (this.overlay) {
|
var overlays = this.document.data('ui-dialog-overlays') - 1
|
|
if (!overlays) {
|
this._off(this.document, 'focusin')
|
this.document.removeData('ui-dialog-overlays')
|
} else {
|
this.document.data('ui-dialog-overlays', overlays)
|
}
|
|
this.overlay.remove()
|
this.overlay = null
|
}
|
}
|
})
|
|
// DEPRECATED
|
// TODO: switch return back to widget declaration at top of file when this is removed
|
if ($.uiBackCompat !== false) {
|
// Backcompat for dialogClass option
|
$.widget('ui.dialog', $.ui.dialog, {
|
options: {
|
dialogClass: ''
|
},
|
_createWrapper: function () {
|
this._super()
|
this.uiDialog.addClass(this.options.dialogClass)
|
},
|
_setOption: function (key, value) {
|
if (key === 'dialogClass') {
|
this.uiDialog.removeClass(this.options.dialogClass).addClass(value)
|
}
|
this._superApply(arguments)
|
}
|
})
|
}
|
|
var widgetsDialog = $.ui.dialog
|
|
/*!
|
* jQuery UI Droppable 1.12.1
|
* http://jqueryui.com
|
*
|
* Copyright jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*/
|
|
//>>label: Droppable
|
//>>group: Interactions
|
//>>description: Enables drop targets for draggable elements.
|
//>>docs: http://api.jqueryui.com/droppable/
|
//>>demos: http://jqueryui.com/droppable/
|
|
$.widget('ui.droppable', {
|
version: '1.12.1',
|
widgetEventPrefix: 'drop',
|
options: {
|
accept: '*',
|
addClasses: true,
|
greedy: false,
|
scope: 'default',
|
tolerance: 'intersect',
|
|
// Callbacks
|
activate: null,
|
deactivate: null,
|
drop: null,
|
out: null,
|
over: null
|
},
|
_create: function () {
|
var proportions,
|
o = this.options,
|
accept = o.accept
|
|
this.isover = false
|
this.isout = true
|
|
this.accept = $.isFunction(accept)
|
? accept
|
: function (d) {
|
return d.is(accept)
|
}
|
|
this.proportions = function (/* valueToWrite */) {
|
if (arguments.length) {
|
// Store the droppable's proportions
|
proportions = arguments[0]
|
} else {
|
// Retrieve or derive the droppable's proportions
|
return proportions
|
? proportions
|
: (proportions = {
|
width: this.element[0].offsetWidth,
|
height: this.element[0].offsetHeight
|
})
|
}
|
}
|
|
this._addToManager(o.scope)
|
|
o.addClasses && this._addClass('ui-droppable')
|
},
|
|
_addToManager: function (scope) {
|
// Add the reference and positions to the manager
|
$.ui.ddmanager.droppables[scope] = $.ui.ddmanager.droppables[scope] || []
|
$.ui.ddmanager.droppables[scope].push(this)
|
},
|
|
_splice: function (drop) {
|
var i = 0
|
for (; i < drop.length; i++) {
|
if (drop[i] === this) {
|
drop.splice(i, 1)
|
}
|
}
|
},
|
|
_destroy: function () {
|
var drop = $.ui.ddmanager.droppables[this.options.scope]
|
|
this._splice(drop)
|
},
|
|
_setOption: function (key, value) {
|
if (key === 'accept') {
|
this.accept = $.isFunction(value)
|
? value
|
: function (d) {
|
return d.is(value)
|
}
|
} else if (key === 'scope') {
|
var drop = $.ui.ddmanager.droppables[this.options.scope]
|
|
this._splice(drop)
|
this._addToManager(value)
|
}
|
|
this._super(key, value)
|
},
|
|
_activate: function (event) {
|
var draggable = $.ui.ddmanager.current
|
|
this._addActiveClass()
|
if (draggable) {
|
this._trigger('activate', event, this.ui(draggable))
|
}
|
},
|
|
_deactivate: function (event) {
|
var draggable = $.ui.ddmanager.current
|
|
this._removeActiveClass()
|
if (draggable) {
|
this._trigger('deactivate', event, this.ui(draggable))
|
}
|
},
|
|
_over: function (event) {
|
var draggable = $.ui.ddmanager.current
|
|
// Bail if draggable and droppable are same element
|
if (!draggable || (draggable.currentItem || draggable.element)[0] === this.element[0]) {
|
return
|
}
|
|
if (this.accept.call(this.element[0], draggable.currentItem || draggable.element)) {
|
this._addHoverClass()
|
this._trigger('over', event, this.ui(draggable))
|
}
|
},
|
|
_out: function (event) {
|
var draggable = $.ui.ddmanager.current
|
|
// Bail if draggable and droppable are same element
|
if (!draggable || (draggable.currentItem || draggable.element)[0] === this.element[0]) {
|
return
|
}
|
|
if (this.accept.call(this.element[0], draggable.currentItem || draggable.element)) {
|
this._removeHoverClass()
|
this._trigger('out', event, this.ui(draggable))
|
}
|
},
|
|
_drop: function (event, custom) {
|
var draggable = custom || $.ui.ddmanager.current,
|
childrenIntersection = false
|
|
// Bail if draggable and droppable are same element
|
if (!draggable || (draggable.currentItem || draggable.element)[0] === this.element[0]) {
|
return false
|
}
|
|
this.element
|
.find(':data(ui-droppable)')
|
.not('.ui-draggable-dragging')
|
.each(function () {
|
var inst = $(this).droppable('instance')
|
if (
|
inst.options.greedy &&
|
!inst.options.disabled &&
|
inst.options.scope === draggable.options.scope &&
|
inst.accept.call(inst.element[0], draggable.currentItem || draggable.element) &&
|
intersect(
|
draggable,
|
$.extend(inst, { offset: inst.element.offset() }),
|
inst.options.tolerance,
|
event
|
)
|
) {
|
childrenIntersection = true
|
return false
|
}
|
})
|
if (childrenIntersection) {
|
return false
|
}
|
|
if (this.accept.call(this.element[0], draggable.currentItem || draggable.element)) {
|
this._removeActiveClass()
|
this._removeHoverClass()
|
|
this._trigger('drop', event, this.ui(draggable))
|
return this.element
|
}
|
|
return false
|
},
|
|
ui: function (c) {
|
return {
|
draggable: c.currentItem || c.element,
|
helper: c.helper,
|
position: c.position,
|
offset: c.positionAbs
|
}
|
},
|
|
// Extension points just to make backcompat sane and avoid duplicating logic
|
// TODO: Remove in 1.13 along with call to it below
|
_addHoverClass: function () {
|
this._addClass('ui-droppable-hover')
|
},
|
|
_removeHoverClass: function () {
|
this._removeClass('ui-droppable-hover')
|
},
|
|
_addActiveClass: function () {
|
this._addClass('ui-droppable-active')
|
},
|
|
_removeActiveClass: function () {
|
this._removeClass('ui-droppable-active')
|
}
|
})
|
|
var intersect = ($.ui.intersect = (function () {
|
function isOverAxis(x, reference, size) {
|
return x >= reference && x < reference + size
|
}
|
|
return function (draggable, droppable, toleranceMode, event) {
|
if (!droppable.offset) {
|
return false
|
}
|
|
var x1 = (draggable.positionAbs || draggable.position.absolute).left + draggable.margins.left,
|
y1 = (draggable.positionAbs || draggable.position.absolute).top + draggable.margins.top,
|
x2 = x1 + draggable.helperProportions.width,
|
y2 = y1 + draggable.helperProportions.height,
|
l = droppable.offset.left,
|
t = droppable.offset.top,
|
r = l + droppable.proportions().width,
|
b = t + droppable.proportions().height
|
|
switch (toleranceMode) {
|
case 'fit':
|
return l <= x1 && x2 <= r && t <= y1 && y2 <= b
|
case 'intersect':
|
return (
|
l < x1 + draggable.helperProportions.width / 2 && // Right Half
|
x2 - draggable.helperProportions.width / 2 < r && // Left Half
|
t < y1 + draggable.helperProportions.height / 2 && // Bottom Half
|
y2 - draggable.helperProportions.height / 2 < b
|
) // Top Half
|
case 'pointer':
|
return (
|
isOverAxis(event.pageY, t, droppable.proportions().height) &&
|
isOverAxis(event.pageX, l, droppable.proportions().width)
|
)
|
case 'touch':
|
return (
|
((y1 >= t && y1 <= b) || // Top edge touching
|
(y2 >= t && y2 <= b) || // Bottom edge touching
|
(y1 < t && y2 > b)) && // Surrounded vertically
|
((x1 >= l && x1 <= r) || // Left edge touching
|
(x2 >= l && x2 <= r) || // Right edge touching
|
(x1 < l && x2 > r)) // Surrounded horizontally
|
)
|
default:
|
return false
|
}
|
}
|
})())
|
|
/*
|
This manager tracks offsets of draggables and droppables
|
*/
|
$.ui.ddmanager = {
|
current: null,
|
droppables: { default: [] },
|
prepareOffsets: function (t, event) {
|
var i,
|
j,
|
m = $.ui.ddmanager.droppables[t.options.scope] || [],
|
type = event ? event.type : null, // workaround for #2317
|
list = (t.currentItem || t.element).find(':data(ui-droppable)').addBack()
|
|
droppablesLoop: for (i = 0; i < m.length; i++) {
|
// No disabled and non-accepted
|
if (
|
m[i].options.disabled ||
|
(t && !m[i].accept.call(m[i].element[0], t.currentItem || t.element))
|
) {
|
continue
|
}
|
|
// Filter out elements in the current dragged item
|
for (j = 0; j < list.length; j++) {
|
if (list[j] === m[i].element[0]) {
|
m[i].proportions().height = 0
|
continue droppablesLoop
|
}
|
}
|
|
m[i].visible = m[i].element.css('display') !== 'none'
|
if (!m[i].visible) {
|
continue
|
}
|
|
// Activate the droppable if used directly from draggables
|
if (type === 'mousedown') {
|
m[i]._activate.call(m[i], event)
|
}
|
|
m[i].offset = m[i].element.offset()
|
m[i].proportions({
|
width: m[i].element[0].offsetWidth,
|
height: m[i].element[0].offsetHeight
|
})
|
}
|
},
|
drop: function (draggable, event) {
|
var dropped = false
|
|
// Create a copy of the droppables in case the list changes during the drop (#9116)
|
$.each(($.ui.ddmanager.droppables[draggable.options.scope] || []).slice(), function () {
|
if (!this.options) {
|
return
|
}
|
if (
|
!this.options.disabled &&
|
this.visible &&
|
intersect(draggable, this, this.options.tolerance, event)
|
) {
|
dropped = this._drop.call(this, event) || dropped
|
}
|
|
if (
|
!this.options.disabled &&
|
this.visible &&
|
this.accept.call(this.element[0], draggable.currentItem || draggable.element)
|
) {
|
this.isout = true
|
this.isover = false
|
this._deactivate.call(this, event)
|
}
|
})
|
return dropped
|
},
|
dragStart: function (draggable, event) {
|
// Listen for scrolling so that if the dragging causes scrolling the position of the
|
// droppables can be recalculated (see #5003)
|
draggable.element.parentsUntil('body').on('scroll.droppable', function () {
|
if (!draggable.options.refreshPositions) {
|
$.ui.ddmanager.prepareOffsets(draggable, event)
|
}
|
})
|
},
|
drag: function (draggable, event) {
|
// If you have a highly dynamic page, you might try this option. It renders positions
|
// every time you move the mouse.
|
if (draggable.options.refreshPositions) {
|
$.ui.ddmanager.prepareOffsets(draggable, event)
|
}
|
|
// Run through all droppables and check their positions based on specific tolerance options
|
$.each($.ui.ddmanager.droppables[draggable.options.scope] || [], function () {
|
if (this.options.disabled || this.greedyChild || !this.visible) {
|
return
|
}
|
|
var parentInstance,
|
scope,
|
parent,
|
intersects = intersect(draggable, this, this.options.tolerance, event),
|
c = !intersects && this.isover ? 'isout' : intersects && !this.isover ? 'isover' : null
|
if (!c) {
|
return
|
}
|
|
if (this.options.greedy) {
|
// find droppable parents with same scope
|
scope = this.options.scope
|
parent = this.element.parents(':data(ui-droppable)').filter(function () {
|
return $(this).droppable('instance').options.scope === scope
|
})
|
|
if (parent.length) {
|
parentInstance = $(parent[0]).droppable('instance')
|
parentInstance.greedyChild = c === 'isover'
|
}
|
}
|
|
// We just moved into a greedy child
|
if (parentInstance && c === 'isover') {
|
parentInstance.isover = false
|
parentInstance.isout = true
|
parentInstance._out.call(parentInstance, event)
|
}
|
|
this[c] = true
|
this[c === 'isout' ? 'isover' : 'isout'] = false
|
this[c === 'isover' ? '_over' : '_out'].call(this, event)
|
|
// We just moved out of a greedy child
|
if (parentInstance && c === 'isout') {
|
parentInstance.isout = false
|
parentInstance.isover = true
|
parentInstance._over.call(parentInstance, event)
|
}
|
})
|
},
|
dragStop: function (draggable, event) {
|
draggable.element.parentsUntil('body').off('scroll.droppable')
|
|
// Call prepareOffsets one final time since IE does not fire return scroll events when
|
// overflow was caused by drag (see #5003)
|
if (!draggable.options.refreshPositions) {
|
$.ui.ddmanager.prepareOffsets(draggable, event)
|
}
|
}
|
}
|
|
// DEPRECATED
|
// TODO: switch return back to widget declaration at top of file when this is removed
|
if ($.uiBackCompat !== false) {
|
// Backcompat for activeClass and hoverClass options
|
$.widget('ui.droppable', $.ui.droppable, {
|
options: {
|
hoverClass: false,
|
activeClass: false
|
},
|
_addActiveClass: function () {
|
this._super()
|
if (this.options.activeClass) {
|
this.element.addClass(this.options.activeClass)
|
}
|
},
|
_removeActiveClass: function () {
|
this._super()
|
if (this.options.activeClass) {
|
this.element.removeClass(this.options.activeClass)
|
}
|
},
|
_addHoverClass: function () {
|
this._super()
|
if (this.options.hoverClass) {
|
this.element.addClass(this.options.hoverClass)
|
}
|
},
|
_removeHoverClass: function () {
|
this._super()
|
if (this.options.hoverClass) {
|
this.element.removeClass(this.options.hoverClass)
|
}
|
}
|
})
|
}
|
|
var widgetsDroppable = $.ui.droppable
|
|
/*!
|
* jQuery UI Progressbar 1.12.1
|
* http://jqueryui.com
|
*
|
* Copyright jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*/
|
|
//>>label: Progressbar
|
//>>group: Widgets
|
// jscs:disable maximumLineLength
|
//>>description: Displays a status indicator for loading state, standard percentage, and other progress indicators.
|
// jscs:enable maximumLineLength
|
//>>docs: http://api.jqueryui.com/progressbar/
|
//>>demos: http://jqueryui.com/progressbar/
|
//>>css.structure: ../../themes/base/core.css
|
//>>css.structure: ../../themes/base/progressbar.css
|
//>>css.theme: ../../themes/base/theme.css
|
|
var widgetsProgressbar = $.widget('ui.progressbar', {
|
version: '1.12.1',
|
options: {
|
classes: {
|
'ui-progressbar': 'ui-corner-all',
|
'ui-progressbar-value': 'ui-corner-left',
|
'ui-progressbar-complete': 'ui-corner-right'
|
},
|
max: 100,
|
value: 0,
|
|
change: null,
|
complete: null
|
},
|
|
min: 0,
|
|
_create: function () {
|
// Constrain initial value
|
this.oldValue = this.options.value = this._constrainedValue()
|
|
this.element.attr({
|
// Only set static values; aria-valuenow and aria-valuemax are
|
// set inside _refreshValue()
|
role: 'progressbar',
|
'aria-valuemin': this.min
|
})
|
this._addClass('ui-progressbar', 'ui-widget ui-widget-content')
|
|
this.valueDiv = $('<div>').appendTo(this.element)
|
this._addClass(this.valueDiv, 'ui-progressbar-value', 'ui-widget-header')
|
this._refreshValue()
|
},
|
|
_destroy: function () {
|
this.element.removeAttr('role aria-valuemin aria-valuemax aria-valuenow')
|
|
this.valueDiv.remove()
|
},
|
|
value: function (newValue) {
|
if (newValue === undefined) {
|
return this.options.value
|
}
|
|
this.options.value = this._constrainedValue(newValue)
|
this._refreshValue()
|
},
|
|
_constrainedValue: function (newValue) {
|
if (newValue === undefined) {
|
newValue = this.options.value
|
}
|
|
this.indeterminate = newValue === false
|
|
// Sanitize value
|
if (typeof newValue !== 'number') {
|
newValue = 0
|
}
|
|
return this.indeterminate ? false : Math.min(this.options.max, Math.max(this.min, newValue))
|
},
|
|
_setOptions: function (options) {
|
// Ensure "value" option is set after other values (like max)
|
var value = options.value
|
delete options.value
|
|
this._super(options)
|
|
this.options.value = this._constrainedValue(value)
|
this._refreshValue()
|
},
|
|
_setOption: function (key, value) {
|
if (key === 'max') {
|
// Don't allow a max less than min
|
value = Math.max(this.min, value)
|
}
|
this._super(key, value)
|
},
|
|
_setOptionDisabled: function (value) {
|
this._super(value)
|
|
this.element.attr('aria-disabled', value)
|
this._toggleClass(null, 'ui-state-disabled', !!value)
|
},
|
|
_percentage: function () {
|
return this.indeterminate
|
? 100
|
: (100 * (this.options.value - this.min)) / (this.options.max - this.min)
|
},
|
|
_refreshValue: function () {
|
var value = this.options.value,
|
percentage = this._percentage()
|
|
this.valueDiv
|
.toggle(this.indeterminate || value > this.min)
|
.width(percentage.toFixed(0) + '%')
|
|
this._toggleClass(
|
this.valueDiv,
|
'ui-progressbar-complete',
|
null,
|
value === this.options.max
|
)._toggleClass('ui-progressbar-indeterminate', null, this.indeterminate)
|
|
if (this.indeterminate) {
|
this.element.removeAttr('aria-valuenow')
|
if (!this.overlayDiv) {
|
this.overlayDiv = $('<div>').appendTo(this.valueDiv)
|
this._addClass(this.overlayDiv, 'ui-progressbar-overlay')
|
}
|
} else {
|
this.element.attr({
|
'aria-valuemax': this.options.max,
|
'aria-valuenow': value
|
})
|
if (this.overlayDiv) {
|
this.overlayDiv.remove()
|
this.overlayDiv = null
|
}
|
}
|
|
if (this.oldValue !== value) {
|
this.oldValue = value
|
this._trigger('change')
|
}
|
if (value === this.options.max) {
|
this._trigger('complete')
|
}
|
}
|
})
|
|
/*!
|
* jQuery UI Selectable 1.12.1
|
* http://jqueryui.com
|
*
|
* Copyright jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*/
|
|
//>>label: Selectable
|
//>>group: Interactions
|
//>>description: Allows groups of elements to be selected with the mouse.
|
//>>docs: http://api.jqueryui.com/selectable/
|
//>>demos: http://jqueryui.com/selectable/
|
//>>css.structure: ../../themes/base/selectable.css
|
|
var widgetsSelectable = $.widget('ui.selectable', $.ui.mouse, {
|
version: '1.12.1',
|
options: {
|
appendTo: 'body',
|
autoRefresh: true,
|
distance: 0,
|
filter: '*',
|
tolerance: 'touch',
|
|
// Callbacks
|
selected: null,
|
selecting: null,
|
start: null,
|
stop: null,
|
unselected: null,
|
unselecting: null
|
},
|
_create: function () {
|
var that = this
|
|
this._addClass('ui-selectable')
|
|
this.dragged = false
|
|
// Cache selectee children based on filter
|
this.refresh = function () {
|
that.elementPos = $(that.element[0]).offset()
|
that.selectees = $(that.options.filter, that.element[0])
|
that._addClass(that.selectees, 'ui-selectee')
|
that.selectees.each(function () {
|
var $this = $(this),
|
selecteeOffset = $this.offset(),
|
pos = {
|
left: selecteeOffset.left - that.elementPos.left,
|
top: selecteeOffset.top - that.elementPos.top
|
}
|
$.data(this, 'selectable-item', {
|
element: this,
|
$element: $this,
|
left: pos.left,
|
top: pos.top,
|
right: pos.left + $this.outerWidth(),
|
bottom: pos.top + $this.outerHeight(),
|
startselected: false,
|
selected: $this.hasClass('ui-selected'),
|
selecting: $this.hasClass('ui-selecting'),
|
unselecting: $this.hasClass('ui-unselecting')
|
})
|
})
|
}
|
this.refresh()
|
|
this._mouseInit()
|
|
this.helper = $('<div>')
|
this._addClass(this.helper, 'ui-selectable-helper')
|
},
|
|
_destroy: function () {
|
this.selectees.removeData('selectable-item')
|
this._mouseDestroy()
|
},
|
|
_mouseStart: function (event) {
|
var that = this,
|
options = this.options
|
|
this.opos = [event.pageX, event.pageY]
|
this.elementPos = $(this.element[0]).offset()
|
|
if (this.options.disabled) {
|
return
|
}
|
|
this.selectees = $(options.filter, this.element[0])
|
|
this._trigger('start', event)
|
|
$(options.appendTo).append(this.helper)
|
|
// position helper (lasso)
|
this.helper.css({
|
left: event.pageX,
|
top: event.pageY,
|
width: 0,
|
height: 0
|
})
|
|
if (options.autoRefresh) {
|
this.refresh()
|
}
|
|
this.selectees.filter('.ui-selected').each(function () {
|
var selectee = $.data(this, 'selectable-item')
|
selectee.startselected = true
|
if (!event.metaKey && !event.ctrlKey) {
|
that._removeClass(selectee.$element, 'ui-selected')
|
selectee.selected = false
|
that._addClass(selectee.$element, 'ui-unselecting')
|
selectee.unselecting = true
|
|
// selectable UNSELECTING callback
|
that._trigger('unselecting', event, {
|
unselecting: selectee.element
|
})
|
}
|
})
|
|
$(event.target)
|
.parents()
|
.addBack()
|
.each(function () {
|
var doSelect,
|
selectee = $.data(this, 'selectable-item')
|
if (selectee) {
|
doSelect =
|
(!event.metaKey && !event.ctrlKey) || !selectee.$element.hasClass('ui-selected')
|
that
|
._removeClass(selectee.$element, doSelect ? 'ui-unselecting' : 'ui-selected')
|
._addClass(selectee.$element, doSelect ? 'ui-selecting' : 'ui-unselecting')
|
selectee.unselecting = !doSelect
|
selectee.selecting = doSelect
|
selectee.selected = doSelect
|
|
// selectable (UN)SELECTING callback
|
if (doSelect) {
|
that._trigger('selecting', event, {
|
selecting: selectee.element
|
})
|
} else {
|
that._trigger('unselecting', event, {
|
unselecting: selectee.element
|
})
|
}
|
return false
|
}
|
})
|
},
|
|
_mouseDrag: function (event) {
|
this.dragged = true
|
|
if (this.options.disabled) {
|
return
|
}
|
|
var tmp,
|
that = this,
|
options = this.options,
|
x1 = this.opos[0],
|
y1 = this.opos[1],
|
x2 = event.pageX,
|
y2 = event.pageY
|
|
if (x1 > x2) {
|
tmp = x2
|
x2 = x1
|
x1 = tmp
|
}
|
if (y1 > y2) {
|
tmp = y2
|
y2 = y1
|
y1 = tmp
|
}
|
this.helper.css({ left: x1, top: y1, width: x2 - x1, height: y2 - y1 })
|
|
this.selectees.each(function () {
|
var selectee = $.data(this, 'selectable-item'),
|
hit = false,
|
offset = {}
|
|
//prevent helper from being selected if appendTo: selectable
|
if (!selectee || selectee.element === that.element[0]) {
|
return
|
}
|
|
offset.left = selectee.left + that.elementPos.left
|
offset.right = selectee.right + that.elementPos.left
|
offset.top = selectee.top + that.elementPos.top
|
offset.bottom = selectee.bottom + that.elementPos.top
|
|
if (options.tolerance === 'touch') {
|
hit = !(offset.left > x2 || offset.right < x1 || offset.top > y2 || offset.bottom < y1)
|
} else if (options.tolerance === 'fit') {
|
hit = offset.left > x1 && offset.right < x2 && offset.top > y1 && offset.bottom < y2
|
}
|
|
if (hit) {
|
// SELECT
|
if (selectee.selected) {
|
that._removeClass(selectee.$element, 'ui-selected')
|
selectee.selected = false
|
}
|
if (selectee.unselecting) {
|
that._removeClass(selectee.$element, 'ui-unselecting')
|
selectee.unselecting = false
|
}
|
if (!selectee.selecting) {
|
that._addClass(selectee.$element, 'ui-selecting')
|
selectee.selecting = true
|
|
// selectable SELECTING callback
|
that._trigger('selecting', event, {
|
selecting: selectee.element
|
})
|
}
|
} else {
|
// UNSELECT
|
if (selectee.selecting) {
|
if ((event.metaKey || event.ctrlKey) && selectee.startselected) {
|
that._removeClass(selectee.$element, 'ui-selecting')
|
selectee.selecting = false
|
that._addClass(selectee.$element, 'ui-selected')
|
selectee.selected = true
|
} else {
|
that._removeClass(selectee.$element, 'ui-selecting')
|
selectee.selecting = false
|
if (selectee.startselected) {
|
that._addClass(selectee.$element, 'ui-unselecting')
|
selectee.unselecting = true
|
}
|
|
// selectable UNSELECTING callback
|
that._trigger('unselecting', event, {
|
unselecting: selectee.element
|
})
|
}
|
}
|
if (selectee.selected) {
|
if (!event.metaKey && !event.ctrlKey && !selectee.startselected) {
|
that._removeClass(selectee.$element, 'ui-selected')
|
selectee.selected = false
|
|
that._addClass(selectee.$element, 'ui-unselecting')
|
selectee.unselecting = true
|
|
// selectable UNSELECTING callback
|
that._trigger('unselecting', event, {
|
unselecting: selectee.element
|
})
|
}
|
}
|
}
|
})
|
|
return false
|
},
|
|
_mouseStop: function (event) {
|
var that = this
|
|
this.dragged = false
|
|
$('.ui-unselecting', this.element[0]).each(function () {
|
var selectee = $.data(this, 'selectable-item')
|
that._removeClass(selectee.$element, 'ui-unselecting')
|
selectee.unselecting = false
|
selectee.startselected = false
|
that._trigger('unselected', event, {
|
unselected: selectee.element
|
})
|
})
|
$('.ui-selecting', this.element[0]).each(function () {
|
var selectee = $.data(this, 'selectable-item')
|
that
|
._removeClass(selectee.$element, 'ui-selecting')
|
._addClass(selectee.$element, 'ui-selected')
|
selectee.selecting = false
|
selectee.selected = true
|
selectee.startselected = true
|
that._trigger('selected', event, {
|
selected: selectee.element
|
})
|
})
|
this._trigger('stop', event)
|
|
this.helper.remove()
|
|
return false
|
}
|
})
|
|
/*!
|
* jQuery UI Selectmenu 1.12.1
|
* http://jqueryui.com
|
*
|
* Copyright jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*/
|
|
//>>label: Selectmenu
|
//>>group: Widgets
|
// jscs:disable maximumLineLength
|
//>>description: Duplicates and extends the functionality of a native HTML select element, allowing it to be customizable in behavior and appearance far beyond the limitations of a native select.
|
// jscs:enable maximumLineLength
|
//>>docs: http://api.jqueryui.com/selectmenu/
|
//>>demos: http://jqueryui.com/selectmenu/
|
//>>css.structure: ../../themes/base/core.css
|
//>>css.structure: ../../themes/base/selectmenu.css, ../../themes/base/button.css
|
//>>css.theme: ../../themes/base/theme.css
|
|
var widgetsSelectmenu = $.widget('ui.selectmenu', [
|
$.ui.formResetMixin,
|
{
|
version: '1.12.1',
|
defaultElement: '<select>',
|
options: {
|
appendTo: null,
|
classes: {
|
'ui-selectmenu-button-open': 'ui-corner-top',
|
'ui-selectmenu-button-closed': 'ui-corner-all'
|
},
|
disabled: null,
|
icons: {
|
button: 'ui-icon-triangle-1-s'
|
},
|
position: {
|
my: 'left top',
|
at: 'left bottom',
|
collision: 'none'
|
},
|
width: false,
|
|
// Callbacks
|
change: null,
|
close: null,
|
focus: null,
|
open: null,
|
select: null
|
},
|
|
_create: function () {
|
var selectmenuId = this.element.uniqueId().attr('id')
|
this.ids = {
|
element: selectmenuId,
|
button: selectmenuId + '-button',
|
menu: selectmenuId + '-menu'
|
}
|
|
this._drawButton()
|
this._drawMenu()
|
this._bindFormResetHandler()
|
|
this._rendered = false
|
this.menuItems = $()
|
},
|
|
_drawButton: function () {
|
var icon,
|
that = this,
|
item = this._parseOption(
|
this.element.find('option:selected'),
|
this.element[0].selectedIndex
|
)
|
|
// Associate existing label with the new button
|
this.labels = this.element.labels().attr('for', this.ids.button)
|
this._on(this.labels, {
|
click: function (event) {
|
this.button.focus()
|
event.preventDefault()
|
}
|
})
|
|
// Hide original select element
|
this.element.hide()
|
|
// Create button
|
this.button = $('<span>', {
|
tabindex: this.options.disabled ? -1 : 0,
|
id: this.ids.button,
|
role: 'combobox',
|
'aria-expanded': 'false',
|
'aria-autocomplete': 'list',
|
'aria-owns': this.ids.menu,
|
'aria-haspopup': 'true',
|
title: this.element.attr('title')
|
}).insertAfter(this.element)
|
|
this._addClass(
|
this.button,
|
'ui-selectmenu-button ui-selectmenu-button-closed',
|
'ui-button ui-widget'
|
)
|
|
icon = $('<span>').appendTo(this.button)
|
this._addClass(icon, 'ui-selectmenu-icon', 'ui-icon ' + this.options.icons.button)
|
this.buttonItem = this._renderButtonItem(item).appendTo(this.button)
|
|
if (this.options.width !== false) {
|
this._resizeButton()
|
}
|
|
this._on(this.button, this._buttonEvents)
|
this.button.one('focusin', function () {
|
// Delay rendering the menu items until the button receives focus.
|
// The menu may have already been rendered via a programmatic open.
|
if (!that._rendered) {
|
that._refreshMenu()
|
}
|
})
|
},
|
|
_drawMenu: function () {
|
var that = this
|
|
// Create menu
|
this.menu = $('<ul>', {
|
'aria-hidden': 'true',
|
'aria-labelledby': this.ids.button,
|
id: this.ids.menu
|
})
|
|
// Wrap menu
|
this.menuWrap = $('<div>').append(this.menu)
|
this._addClass(this.menuWrap, 'ui-selectmenu-menu', 'ui-front')
|
this.menuWrap.appendTo(this._appendTo())
|
|
// Initialize menu widget
|
this.menuInstance = this.menu
|
.menu({
|
classes: {
|
'ui-menu': 'ui-corner-bottom'
|
},
|
role: 'listbox',
|
select: function (event, ui) {
|
event.preventDefault()
|
|
// Support: IE8
|
// If the item was selected via a click, the text selection
|
// will be destroyed in IE
|
that._setSelection()
|
|
that._select(ui.item.data('ui-selectmenu-item'), event)
|
},
|
focus: function (event, ui) {
|
var item = ui.item.data('ui-selectmenu-item')
|
|
// Prevent inital focus from firing and check if its a newly focused item
|
if (that.focusIndex != null && item.index !== that.focusIndex) {
|
that._trigger('focus', event, { item: item })
|
if (!that.isOpen) {
|
that._select(item, event)
|
}
|
}
|
that.focusIndex = item.index
|
|
that.button.attr('aria-activedescendant', that.menuItems.eq(item.index).attr('id'))
|
}
|
})
|
.menu('instance')
|
|
// Don't close the menu on mouseleave
|
this.menuInstance._off(this.menu, 'mouseleave')
|
|
// Cancel the menu's collapseAll on document click
|
this.menuInstance._closeOnDocumentClick = function () {
|
return false
|
}
|
|
// Selects often contain empty items, but never contain dividers
|
this.menuInstance._isDivider = function () {
|
return false
|
}
|
},
|
|
refresh: function () {
|
this._refreshMenu()
|
this.buttonItem.replaceWith(
|
(this.buttonItem = this._renderButtonItem(
|
// Fall back to an empty object in case there are no options
|
this._getSelectedItem().data('ui-selectmenu-item') || {}
|
))
|
)
|
if (this.options.width === null) {
|
this._resizeButton()
|
}
|
},
|
|
_refreshMenu: function () {
|
var item,
|
options = this.element.find('option')
|
|
this.menu.empty()
|
|
this._parseOptions(options)
|
this._renderMenu(this.menu, this.items)
|
|
this.menuInstance.refresh()
|
this.menuItems = this.menu
|
.find('li')
|
.not('.ui-selectmenu-optgroup')
|
.find('.ui-menu-item-wrapper')
|
|
this._rendered = true
|
|
if (!options.length) {
|
return
|
}
|
|
item = this._getSelectedItem()
|
|
// Update the menu to have the correct item focused
|
this.menuInstance.focus(null, item)
|
this._setAria(item.data('ui-selectmenu-item'))
|
|
// Set disabled state
|
this._setOption('disabled', this.element.prop('disabled'))
|
},
|
|
open: function (event) {
|
if (this.options.disabled) {
|
return
|
}
|
|
// If this is the first time the menu is being opened, render the items
|
if (!this._rendered) {
|
this._refreshMenu()
|
} else {
|
// Menu clears focus on close, reset focus to selected item
|
this._removeClass(this.menu.find('.ui-state-active'), null, 'ui-state-active')
|
this.menuInstance.focus(null, this._getSelectedItem())
|
}
|
|
// If there are no options, don't open the menu
|
if (!this.menuItems.length) {
|
return
|
}
|
|
this.isOpen = true
|
this._toggleAttr()
|
this._resizeMenu()
|
this._position()
|
|
this._on(this.document, this._documentClick)
|
|
this._trigger('open', event)
|
},
|
|
_position: function () {
|
this.menuWrap.position($.extend({ of: this.button }, this.options.position))
|
},
|
|
close: function (event) {
|
if (!this.isOpen) {
|
return
|
}
|
|
this.isOpen = false
|
this._toggleAttr()
|
|
this.range = null
|
this._off(this.document)
|
|
this._trigger('close', event)
|
},
|
|
widget: function () {
|
return this.button
|
},
|
|
menuWidget: function () {
|
return this.menu
|
},
|
|
_renderButtonItem: function (item) {
|
var buttonItem = $('<span>')
|
|
this._setText(buttonItem, item.label)
|
this._addClass(buttonItem, 'ui-selectmenu-text')
|
|
return buttonItem
|
},
|
|
_renderMenu: function (ul, items) {
|
var that = this,
|
currentOptgroup = ''
|
|
$.each(items, function (index, item) {
|
var li
|
|
if (item.optgroup !== currentOptgroup) {
|
li = $('<li>', {
|
text: item.optgroup
|
})
|
that._addClass(
|
li,
|
'ui-selectmenu-optgroup',
|
'ui-menu-divider' +
|
(item.element.parent('optgroup').prop('disabled') ? ' ui-state-disabled' : '')
|
)
|
|
li.appendTo(ul)
|
|
currentOptgroup = item.optgroup
|
}
|
|
that._renderItemData(ul, item)
|
})
|
},
|
|
_renderItemData: function (ul, item) {
|
return this._renderItem(ul, item).data('ui-selectmenu-item', item)
|
},
|
|
_renderItem: function (ul, item) {
|
var li = $('<li>'),
|
wrapper = $('<div>', {
|
title: item.element.attr('title')
|
})
|
|
if (item.disabled) {
|
this._addClass(li, null, 'ui-state-disabled')
|
}
|
this._setText(wrapper, item.label)
|
|
return li.append(wrapper).appendTo(ul)
|
},
|
|
_setText: function (element, value) {
|
if (value) {
|
element.text(value)
|
} else {
|
element.html(' ')
|
}
|
},
|
|
_move: function (direction, event) {
|
var item,
|
next,
|
filter = '.ui-menu-item'
|
|
if (this.isOpen) {
|
item = this.menuItems.eq(this.focusIndex).parent('li')
|
} else {
|
item = this.menuItems.eq(this.element[0].selectedIndex).parent('li')
|
filter += ':not(.ui-state-disabled)'
|
}
|
|
if (direction === 'first' || direction === 'last') {
|
next = item[direction === 'first' ? 'prevAll' : 'nextAll'](filter).eq(-1)
|
} else {
|
next = item[direction + 'All'](filter).eq(0)
|
}
|
|
if (next.length) {
|
this.menuInstance.focus(event, next)
|
}
|
},
|
|
_getSelectedItem: function () {
|
return this.menuItems.eq(this.element[0].selectedIndex).parent('li')
|
},
|
|
_toggle: function (event) {
|
this[this.isOpen ? 'close' : 'open'](event)
|
},
|
|
_setSelection: function () {
|
var selection
|
|
if (!this.range) {
|
return
|
}
|
|
if (window.getSelection) {
|
selection = window.getSelection()
|
selection.removeAllRanges()
|
selection.addRange(this.range)
|
|
// Support: IE8
|
} else {
|
this.range.select()
|
}
|
|
// Support: IE
|
// Setting the text selection kills the button focus in IE, but
|
// restoring the focus doesn't kill the selection.
|
this.button.focus()
|
},
|
|
_documentClick: {
|
mousedown: function (event) {
|
if (!this.isOpen) {
|
return
|
}
|
|
if (
|
!$(event.target).closest(
|
'.ui-selectmenu-menu, #' + $.ui.escapeSelector(this.ids.button)
|
).length
|
) {
|
this.close(event)
|
}
|
}
|
},
|
|
_buttonEvents: {
|
// Prevent text selection from being reset when interacting with the selectmenu (#10144)
|
mousedown: function () {
|
var selection
|
|
if (window.getSelection) {
|
selection = window.getSelection()
|
if (selection.rangeCount) {
|
this.range = selection.getRangeAt(0)
|
}
|
|
// Support: IE8
|
} else {
|
this.range = document.selection.createRange()
|
}
|
},
|
|
click: function (event) {
|
this._setSelection()
|
this._toggle(event)
|
},
|
|
keydown: function (event) {
|
var preventDefault = true
|
switch (event.keyCode) {
|
case $.ui.keyCode.TAB:
|
case $.ui.keyCode.ESCAPE:
|
this.close(event)
|
preventDefault = false
|
break
|
case $.ui.keyCode.ENTER:
|
if (this.isOpen) {
|
this._selectFocusedItem(event)
|
}
|
break
|
case $.ui.keyCode.UP:
|
if (event.altKey) {
|
this._toggle(event)
|
} else {
|
this._move('prev', event)
|
}
|
break
|
case $.ui.keyCode.DOWN:
|
if (event.altKey) {
|
this._toggle(event)
|
} else {
|
this._move('next', event)
|
}
|
break
|
case $.ui.keyCode.SPACE:
|
if (this.isOpen) {
|
this._selectFocusedItem(event)
|
} else {
|
this._toggle(event)
|
}
|
break
|
case $.ui.keyCode.LEFT:
|
this._move('prev', event)
|
break
|
case $.ui.keyCode.RIGHT:
|
this._move('next', event)
|
break
|
case $.ui.keyCode.HOME:
|
case $.ui.keyCode.PAGE_UP:
|
this._move('first', event)
|
break
|
case $.ui.keyCode.END:
|
case $.ui.keyCode.PAGE_DOWN:
|
this._move('last', event)
|
break
|
default:
|
this.menu.trigger(event)
|
preventDefault = false
|
}
|
|
if (preventDefault) {
|
event.preventDefault()
|
}
|
}
|
},
|
|
_selectFocusedItem: function (event) {
|
var item = this.menuItems.eq(this.focusIndex).parent('li')
|
if (!item.hasClass('ui-state-disabled')) {
|
this._select(item.data('ui-selectmenu-item'), event)
|
}
|
},
|
|
_select: function (item, event) {
|
var oldIndex = this.element[0].selectedIndex
|
|
// Change native select element
|
this.element[0].selectedIndex = item.index
|
this.buttonItem.replaceWith((this.buttonItem = this._renderButtonItem(item)))
|
this._setAria(item)
|
this._trigger('select', event, { item: item })
|
|
if (item.index !== oldIndex) {
|
this._trigger('change', event, { item: item })
|
}
|
|
this.close(event)
|
},
|
|
_setAria: function (item) {
|
var id = this.menuItems.eq(item.index).attr('id')
|
|
this.button.attr({
|
'aria-labelledby': id,
|
'aria-activedescendant': id
|
})
|
this.menu.attr('aria-activedescendant', id)
|
},
|
|
_setOption: function (key, value) {
|
if (key === 'icons') {
|
var icon = this.button.find('span.ui-icon')
|
this._removeClass(icon, null, this.options.icons.button)._addClass(
|
icon,
|
null,
|
value.button
|
)
|
}
|
|
this._super(key, value)
|
|
if (key === 'appendTo') {
|
this.menuWrap.appendTo(this._appendTo())
|
}
|
|
if (key === 'width') {
|
this._resizeButton()
|
}
|
},
|
|
_setOptionDisabled: function (value) {
|
this._super(value)
|
|
this.menuInstance.option('disabled', value)
|
this.button.attr('aria-disabled', value)
|
this._toggleClass(this.button, null, 'ui-state-disabled', value)
|
|
this.element.prop('disabled', value)
|
if (value) {
|
this.button.attr('tabindex', -1)
|
this.close()
|
} else {
|
this.button.attr('tabindex', 0)
|
}
|
},
|
|
_appendTo: function () {
|
var element = this.options.appendTo
|
|
if (element) {
|
element =
|
element.jquery || element.nodeType ? $(element) : this.document.find(element).eq(0)
|
}
|
|
if (!element || !element[0]) {
|
element = this.element.closest('.ui-front, dialog')
|
}
|
|
if (!element.length) {
|
element = this.document[0].body
|
}
|
|
return element
|
},
|
|
_toggleAttr: function () {
|
this.button.attr('aria-expanded', this.isOpen)
|
|
// We can't use two _toggleClass() calls here, because we need to make sure
|
// we always remove classes first and add them second, otherwise if both classes have the
|
// same theme class, it will be removed after we add it.
|
this._removeClass(this.button, 'ui-selectmenu-button-' + (this.isOpen ? 'closed' : 'open'))
|
._addClass(this.button, 'ui-selectmenu-button-' + (this.isOpen ? 'open' : 'closed'))
|
._toggleClass(this.menuWrap, 'ui-selectmenu-open', null, this.isOpen)
|
|
this.menu.attr('aria-hidden', !this.isOpen)
|
},
|
|
_resizeButton: function () {
|
var width = this.options.width
|
|
// For `width: false`, just remove inline style and stop
|
if (width === false) {
|
this.button.css('width', '')
|
return
|
}
|
|
// For `width: null`, match the width of the original element
|
if (width === null) {
|
width = this.element.show().outerWidth()
|
this.element.hide()
|
}
|
|
this.button.outerWidth(width)
|
},
|
|
_resizeMenu: function () {
|
this.menu.outerWidth(
|
Math.max(
|
this.button.outerWidth(),
|
|
// Support: IE10
|
// IE10 wraps long text (possibly a rounding bug)
|
// so we add 1px to avoid the wrapping
|
this.menu.width('').outerWidth() + 1
|
)
|
)
|
},
|
|
_getCreateOptions: function () {
|
var options = this._super()
|
|
options.disabled = this.element.prop('disabled')
|
|
return options
|
},
|
|
_parseOptions: function (options) {
|
var that = this,
|
data = []
|
options.each(function (index, item) {
|
data.push(that._parseOption($(item), index))
|
})
|
this.items = data
|
},
|
|
_parseOption: function (option, index) {
|
var optgroup = option.parent('optgroup')
|
|
return {
|
element: option,
|
index: index,
|
value: option.val(),
|
label: option.text(),
|
optgroup: optgroup.attr('label') || '',
|
disabled: optgroup.prop('disabled') || option.prop('disabled')
|
}
|
},
|
|
_destroy: function () {
|
this._unbindFormResetHandler()
|
this.menuWrap.remove()
|
this.button.remove()
|
this.element.show()
|
this.element.removeUniqueId()
|
this.labels.attr('for', this.ids.element)
|
}
|
}
|
])
|
|
/*!
|
* jQuery UI Slider 1.12.1
|
* http://jqueryui.com
|
*
|
* Copyright jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*/
|
|
//>>label: Slider
|
//>>group: Widgets
|
//>>description: Displays a flexible slider with ranges and accessibility via keyboard.
|
//>>docs: http://api.jqueryui.com/slider/
|
//>>demos: http://jqueryui.com/slider/
|
//>>css.structure: ../../themes/base/core.css
|
//>>css.structure: ../../themes/base/slider.css
|
//>>css.theme: ../../themes/base/theme.css
|
|
var widgetsSlider = $.widget('ui.slider', $.ui.mouse, {
|
version: '1.12.1',
|
widgetEventPrefix: 'slide',
|
|
options: {
|
animate: false,
|
classes: {
|
'ui-slider': 'ui-corner-all',
|
'ui-slider-handle': 'ui-corner-all',
|
|
// Note: ui-widget-header isn't the most fittingly semantic framework class for this
|
// element, but worked best visually with a variety of themes
|
'ui-slider-range': 'ui-corner-all ui-widget-header'
|
},
|
distance: 0,
|
max: 100,
|
min: 0,
|
orientation: 'horizontal',
|
range: false,
|
step: 1,
|
value: 0,
|
values: null,
|
|
// Callbacks
|
change: null,
|
slide: null,
|
start: null,
|
stop: null
|
},
|
|
// Number of pages in a slider
|
// (how many times can you page up/down to go through the whole range)
|
numPages: 5,
|
|
_create: function () {
|
this._keySliding = false
|
this._mouseSliding = false
|
this._animateOff = true
|
this._handleIndex = null
|
this._detectOrientation()
|
this._mouseInit()
|
this._calculateNewMax()
|
|
this._addClass('ui-slider ui-slider-' + this.orientation, 'ui-widget ui-widget-content')
|
|
this._refresh()
|
|
this._animateOff = false
|
},
|
|
_refresh: function () {
|
this._createRange()
|
this._createHandles()
|
this._setupEvents()
|
this._refreshValue()
|
},
|
|
_createHandles: function () {
|
var i,
|
handleCount,
|
options = this.options,
|
existingHandles = this.element.find('.ui-slider-handle'),
|
handle = "<span tabindex='0'></span>",
|
handles = []
|
|
handleCount = (options.values && options.values.length) || 1
|
|
if (existingHandles.length > handleCount) {
|
existingHandles.slice(handleCount).remove()
|
existingHandles = existingHandles.slice(0, handleCount)
|
}
|
|
for (i = existingHandles.length; i < handleCount; i++) {
|
handles.push(handle)
|
}
|
|
this.handles = existingHandles.add($(handles.join('')).appendTo(this.element))
|
|
this._addClass(this.handles, 'ui-slider-handle', 'ui-state-default')
|
|
this.handle = this.handles.eq(0)
|
|
this.handles.each(function (i) {
|
$(this).data('ui-slider-handle-index', i).attr('tabIndex', 0)
|
})
|
},
|
|
_createRange: function () {
|
var options = this.options
|
|
if (options.range) {
|
if (options.range === true) {
|
if (!options.values) {
|
options.values = [this._valueMin(), this._valueMin()]
|
} else if (options.values.length && options.values.length !== 2) {
|
options.values = [options.values[0], options.values[0]]
|
} else if ($.isArray(options.values)) {
|
options.values = options.values.slice(0)
|
}
|
}
|
|
if (!this.range || !this.range.length) {
|
this.range = $('<div>').appendTo(this.element)
|
|
this._addClass(this.range, 'ui-slider-range')
|
} else {
|
this._removeClass(this.range, 'ui-slider-range-min ui-slider-range-max')
|
|
// Handle range switching from true to min/max
|
this.range.css({
|
left: '',
|
bottom: ''
|
})
|
}
|
if (options.range === 'min' || options.range === 'max') {
|
this._addClass(this.range, 'ui-slider-range-' + options.range)
|
}
|
} else {
|
if (this.range) {
|
this.range.remove()
|
}
|
this.range = null
|
}
|
},
|
|
_setupEvents: function () {
|
this._off(this.handles)
|
this._on(this.handles, this._handleEvents)
|
this._hoverable(this.handles)
|
this._focusable(this.handles)
|
},
|
|
_destroy: function () {
|
this.handles.remove()
|
if (this.range) {
|
this.range.remove()
|
}
|
|
this._mouseDestroy()
|
},
|
|
_mouseCapture: function (event) {
|
var position,
|
normValue,
|
distance,
|
closestHandle,
|
index,
|
allowed,
|
offset,
|
mouseOverHandle,
|
that = this,
|
o = this.options
|
|
if (o.disabled) {
|
return false
|
}
|
|
this.elementSize = {
|
width: this.element.outerWidth(),
|
height: this.element.outerHeight()
|
}
|
this.elementOffset = this.element.offset()
|
|
position = { x: event.pageX, y: event.pageY }
|
normValue = this._normValueFromMouse(position)
|
distance = this._valueMax() - this._valueMin() + 1
|
this.handles.each(function (i) {
|
var thisDistance = Math.abs(normValue - that.values(i))
|
if (
|
distance > thisDistance ||
|
(distance === thisDistance && (i === that._lastChangedValue || that.values(i) === o.min))
|
) {
|
distance = thisDistance
|
closestHandle = $(this)
|
index = i
|
}
|
})
|
|
allowed = this._start(event, index)
|
if (allowed === false) {
|
return false
|
}
|
this._mouseSliding = true
|
|
this._handleIndex = index
|
|
this._addClass(closestHandle, null, 'ui-state-active')
|
closestHandle.trigger('focus')
|
|
offset = closestHandle.offset()
|
mouseOverHandle = !$(event.target).parents().addBack().is('.ui-slider-handle')
|
this._clickOffset = mouseOverHandle
|
? { left: 0, top: 0 }
|
: {
|
left: event.pageX - offset.left - closestHandle.width() / 2,
|
top:
|
event.pageY -
|
offset.top -
|
closestHandle.height() / 2 -
|
(parseInt(closestHandle.css('borderTopWidth'), 10) || 0) -
|
(parseInt(closestHandle.css('borderBottomWidth'), 10) || 0) +
|
(parseInt(closestHandle.css('marginTop'), 10) || 0)
|
}
|
|
if (!this.handles.hasClass('ui-state-hover')) {
|
this._slide(event, index, normValue)
|
}
|
this._animateOff = true
|
return true
|
},
|
|
_mouseStart: function () {
|
return true
|
},
|
|
_mouseDrag: function (event) {
|
var position = { x: event.pageX, y: event.pageY },
|
normValue = this._normValueFromMouse(position)
|
|
this._slide(event, this._handleIndex, normValue)
|
|
return false
|
},
|
|
_mouseStop: function (event) {
|
this._removeClass(this.handles, null, 'ui-state-active')
|
this._mouseSliding = false
|
|
this._stop(event, this._handleIndex)
|
this._change(event, this._handleIndex)
|
|
this._handleIndex = null
|
this._clickOffset = null
|
this._animateOff = false
|
|
return false
|
},
|
|
_detectOrientation: function () {
|
this.orientation = this.options.orientation === 'vertical' ? 'vertical' : 'horizontal'
|
},
|
|
_normValueFromMouse: function (position) {
|
var pixelTotal, pixelMouse, percentMouse, valueTotal, valueMouse
|
|
if (this.orientation === 'horizontal') {
|
pixelTotal = this.elementSize.width
|
pixelMouse =
|
position.x - this.elementOffset.left - (this._clickOffset ? this._clickOffset.left : 0)
|
} else {
|
pixelTotal = this.elementSize.height
|
pixelMouse =
|
position.y - this.elementOffset.top - (this._clickOffset ? this._clickOffset.top : 0)
|
}
|
|
percentMouse = pixelMouse / pixelTotal
|
if (percentMouse > 1) {
|
percentMouse = 1
|
}
|
if (percentMouse < 0) {
|
percentMouse = 0
|
}
|
if (this.orientation === 'vertical') {
|
percentMouse = 1 - percentMouse
|
}
|
|
valueTotal = this._valueMax() - this._valueMin()
|
valueMouse = this._valueMin() + percentMouse * valueTotal
|
|
return this._trimAlignValue(valueMouse)
|
},
|
|
_uiHash: function (index, value, values) {
|
var uiHash = {
|
handle: this.handles[index],
|
handleIndex: index,
|
value: value !== undefined ? value : this.value()
|
}
|
|
if (this._hasMultipleValues()) {
|
uiHash.value = value !== undefined ? value : this.values(index)
|
uiHash.values = values || this.values()
|
}
|
|
return uiHash
|
},
|
|
_hasMultipleValues: function () {
|
return this.options.values && this.options.values.length
|
},
|
|
_start: function (event, index) {
|
return this._trigger('start', event, this._uiHash(index))
|
},
|
|
_slide: function (event, index, newVal) {
|
var allowed,
|
otherVal,
|
currentValue = this.value(),
|
newValues = this.values()
|
|
if (this._hasMultipleValues()) {
|
otherVal = this.values(index ? 0 : 1)
|
currentValue = this.values(index)
|
|
if (this.options.values.length === 2 && this.options.range === true) {
|
newVal = index === 0 ? Math.min(otherVal, newVal) : Math.max(otherVal, newVal)
|
}
|
|
newValues[index] = newVal
|
}
|
|
if (newVal === currentValue) {
|
return
|
}
|
|
allowed = this._trigger('slide', event, this._uiHash(index, newVal, newValues))
|
|
// A slide can be canceled by returning false from the slide callback
|
if (allowed === false) {
|
return
|
}
|
|
if (this._hasMultipleValues()) {
|
this.values(index, newVal)
|
} else {
|
this.value(newVal)
|
}
|
},
|
|
_stop: function (event, index) {
|
this._trigger('stop', event, this._uiHash(index))
|
},
|
|
_change: function (event, index) {
|
if (!this._keySliding && !this._mouseSliding) {
|
//store the last changed value index for reference when handles overlap
|
this._lastChangedValue = index
|
this._trigger('change', event, this._uiHash(index))
|
}
|
},
|
|
value: function (newValue) {
|
if (arguments.length) {
|
this.options.value = this._trimAlignValue(newValue)
|
this._refreshValue()
|
this._change(null, 0)
|
return
|
}
|
|
return this._value()
|
},
|
|
values: function (index, newValue) {
|
var vals, newValues, i
|
|
if (arguments.length > 1) {
|
this.options.values[index] = this._trimAlignValue(newValue)
|
this._refreshValue()
|
this._change(null, index)
|
return
|
}
|
|
if (arguments.length) {
|
if ($.isArray(arguments[0])) {
|
vals = this.options.values
|
newValues = arguments[0]
|
for (i = 0; i < vals.length; i += 1) {
|
vals[i] = this._trimAlignValue(newValues[i])
|
this._change(null, i)
|
}
|
this._refreshValue()
|
} else {
|
if (this._hasMultipleValues()) {
|
return this._values(index)
|
} else {
|
return this.value()
|
}
|
}
|
} else {
|
return this._values()
|
}
|
},
|
|
_setOption: function (key, value) {
|
var i,
|
valsLength = 0
|
|
if (key === 'range' && this.options.range === true) {
|
if (value === 'min') {
|
this.options.value = this._values(0)
|
this.options.values = null
|
} else if (value === 'max') {
|
this.options.value = this._values(this.options.values.length - 1)
|
this.options.values = null
|
}
|
}
|
|
if ($.isArray(this.options.values)) {
|
valsLength = this.options.values.length
|
}
|
|
this._super(key, value)
|
|
switch (key) {
|
case 'orientation':
|
this._detectOrientation()
|
this._removeClass('ui-slider-horizontal ui-slider-vertical')._addClass(
|
'ui-slider-' + this.orientation
|
)
|
this._refreshValue()
|
if (this.options.range) {
|
this._refreshRange(value)
|
}
|
|
// Reset positioning from previous orientation
|
this.handles.css(value === 'horizontal' ? 'bottom' : 'left', '')
|
break
|
case 'value':
|
this._animateOff = true
|
this._refreshValue()
|
this._change(null, 0)
|
this._animateOff = false
|
break
|
case 'values':
|
this._animateOff = true
|
this._refreshValue()
|
|
// Start from the last handle to prevent unreachable handles (#9046)
|
for (i = valsLength - 1; i >= 0; i--) {
|
this._change(null, i)
|
}
|
this._animateOff = false
|
break
|
case 'step':
|
case 'min':
|
case 'max':
|
this._animateOff = true
|
this._calculateNewMax()
|
this._refreshValue()
|
this._animateOff = false
|
break
|
case 'range':
|
this._animateOff = true
|
this._refresh()
|
this._animateOff = false
|
break
|
}
|
},
|
|
_setOptionDisabled: function (value) {
|
this._super(value)
|
|
this._toggleClass(null, 'ui-state-disabled', !!value)
|
},
|
|
//internal value getter
|
// _value() returns value trimmed by min and max, aligned by step
|
_value: function () {
|
var val = this.options.value
|
val = this._trimAlignValue(val)
|
|
return val
|
},
|
|
//internal values getter
|
// _values() returns array of values trimmed by min and max, aligned by step
|
// _values( index ) returns single value trimmed by min and max, aligned by step
|
_values: function (index) {
|
var val, vals, i
|
|
if (arguments.length) {
|
val = this.options.values[index]
|
val = this._trimAlignValue(val)
|
|
return val
|
} else if (this._hasMultipleValues()) {
|
// .slice() creates a copy of the array
|
// this copy gets trimmed by min and max and then returned
|
vals = this.options.values.slice()
|
for (i = 0; i < vals.length; i += 1) {
|
vals[i] = this._trimAlignValue(vals[i])
|
}
|
|
return vals
|
} else {
|
return []
|
}
|
},
|
|
// Returns the step-aligned value that val is closest to, between (inclusive) min and max
|
_trimAlignValue: function (val) {
|
if (val <= this._valueMin()) {
|
return this._valueMin()
|
}
|
if (val >= this._valueMax()) {
|
return this._valueMax()
|
}
|
var step = this.options.step > 0 ? this.options.step : 1,
|
valModStep = (val - this._valueMin()) % step,
|
alignValue = val - valModStep
|
|
if (Math.abs(valModStep) * 2 >= step) {
|
alignValue += valModStep > 0 ? step : -step
|
}
|
|
// Since JavaScript has problems with large floats, round
|
// the final value to 5 digits after the decimal point (see #4124)
|
return parseFloat(alignValue.toFixed(5))
|
},
|
|
_calculateNewMax: function () {
|
var max = this.options.max,
|
min = this._valueMin(),
|
step = this.options.step,
|
aboveMin = Math.round((max - min) / step) * step
|
max = aboveMin + min
|
if (max > this.options.max) {
|
//If max is not divisible by step, rounding off may increase its value
|
max -= step
|
}
|
this.max = parseFloat(max.toFixed(this._precision()))
|
},
|
|
_precision: function () {
|
var precision = this._precisionOf(this.options.step)
|
if (this.options.min !== null) {
|
precision = Math.max(precision, this._precisionOf(this.options.min))
|
}
|
return precision
|
},
|
|
_precisionOf: function (num) {
|
var str = num.toString(),
|
decimal = str.indexOf('.')
|
return decimal === -1 ? 0 : str.length - decimal - 1
|
},
|
|
_valueMin: function () {
|
return this.options.min
|
},
|
|
_valueMax: function () {
|
return this.max
|
},
|
|
_refreshRange: function (orientation) {
|
if (orientation === 'vertical') {
|
this.range.css({ width: '', left: '' })
|
}
|
if (orientation === 'horizontal') {
|
this.range.css({ height: '', bottom: '' })
|
}
|
},
|
|
_refreshValue: function () {
|
var lastValPercent,
|
valPercent,
|
value,
|
valueMin,
|
valueMax,
|
oRange = this.options.range,
|
o = this.options,
|
that = this,
|
animate = !this._animateOff ? o.animate : false,
|
_set = {}
|
|
if (this._hasMultipleValues()) {
|
this.handles.each(function (i) {
|
valPercent =
|
((that.values(i) - that._valueMin()) / (that._valueMax() - that._valueMin())) * 100
|
_set[that.orientation === 'horizontal' ? 'left' : 'bottom'] = valPercent + '%'
|
$(this).stop(1, 1)[animate ? 'animate' : 'css'](_set, o.animate)
|
if (that.options.range === true) {
|
if (that.orientation === 'horizontal') {
|
if (i === 0) {
|
that.range.stop(1, 1)[animate ? 'animate' : 'css'](
|
{
|
left: valPercent + '%'
|
},
|
o.animate
|
)
|
}
|
if (i === 1) {
|
that.range[animate ? 'animate' : 'css'](
|
{
|
width: valPercent - lastValPercent + '%'
|
},
|
{
|
queue: false,
|
duration: o.animate
|
}
|
)
|
}
|
} else {
|
if (i === 0) {
|
that.range.stop(1, 1)[animate ? 'animate' : 'css'](
|
{
|
bottom: valPercent + '%'
|
},
|
o.animate
|
)
|
}
|
if (i === 1) {
|
that.range[animate ? 'animate' : 'css'](
|
{
|
height: valPercent - lastValPercent + '%'
|
},
|
{
|
queue: false,
|
duration: o.animate
|
}
|
)
|
}
|
}
|
}
|
lastValPercent = valPercent
|
})
|
} else {
|
value = this.value()
|
valueMin = this._valueMin()
|
valueMax = this._valueMax()
|
valPercent = valueMax !== valueMin ? ((value - valueMin) / (valueMax - valueMin)) * 100 : 0
|
_set[this.orientation === 'horizontal' ? 'left' : 'bottom'] = valPercent + '%'
|
this.handle.stop(1, 1)[animate ? 'animate' : 'css'](_set, o.animate)
|
|
if (oRange === 'min' && this.orientation === 'horizontal') {
|
this.range.stop(1, 1)[animate ? 'animate' : 'css'](
|
{
|
width: valPercent + '%'
|
},
|
o.animate
|
)
|
}
|
if (oRange === 'max' && this.orientation === 'horizontal') {
|
this.range.stop(1, 1)[animate ? 'animate' : 'css'](
|
{
|
width: 100 - valPercent + '%'
|
},
|
o.animate
|
)
|
}
|
if (oRange === 'min' && this.orientation === 'vertical') {
|
this.range.stop(1, 1)[animate ? 'animate' : 'css'](
|
{
|
height: valPercent + '%'
|
},
|
o.animate
|
)
|
}
|
if (oRange === 'max' && this.orientation === 'vertical') {
|
this.range.stop(1, 1)[animate ? 'animate' : 'css'](
|
{
|
height: 100 - valPercent + '%'
|
},
|
o.animate
|
)
|
}
|
}
|
},
|
|
_handleEvents: {
|
keydown: function (event) {
|
var allowed,
|
curVal,
|
newVal,
|
step,
|
index = $(event.target).data('ui-slider-handle-index')
|
|
switch (event.keyCode) {
|
case $.ui.keyCode.HOME:
|
case $.ui.keyCode.END:
|
case $.ui.keyCode.PAGE_UP:
|
case $.ui.keyCode.PAGE_DOWN:
|
case $.ui.keyCode.UP:
|
case $.ui.keyCode.RIGHT:
|
case $.ui.keyCode.DOWN:
|
case $.ui.keyCode.LEFT:
|
event.preventDefault()
|
if (!this._keySliding) {
|
this._keySliding = true
|
this._addClass($(event.target), null, 'ui-state-active')
|
allowed = this._start(event, index)
|
if (allowed === false) {
|
return
|
}
|
}
|
break
|
}
|
|
step = this.options.step
|
if (this._hasMultipleValues()) {
|
curVal = newVal = this.values(index)
|
} else {
|
curVal = newVal = this.value()
|
}
|
|
switch (event.keyCode) {
|
case $.ui.keyCode.HOME:
|
newVal = this._valueMin()
|
break
|
case $.ui.keyCode.END:
|
newVal = this._valueMax()
|
break
|
case $.ui.keyCode.PAGE_UP:
|
newVal = this._trimAlignValue(
|
curVal + (this._valueMax() - this._valueMin()) / this.numPages
|
)
|
break
|
case $.ui.keyCode.PAGE_DOWN:
|
newVal = this._trimAlignValue(
|
curVal - (this._valueMax() - this._valueMin()) / this.numPages
|
)
|
break
|
case $.ui.keyCode.UP:
|
case $.ui.keyCode.RIGHT:
|
if (curVal === this._valueMax()) {
|
return
|
}
|
newVal = this._trimAlignValue(curVal + step)
|
break
|
case $.ui.keyCode.DOWN:
|
case $.ui.keyCode.LEFT:
|
if (curVal === this._valueMin()) {
|
return
|
}
|
newVal = this._trimAlignValue(curVal - step)
|
break
|
}
|
|
this._slide(event, index, newVal)
|
},
|
keyup: function (event) {
|
var index = $(event.target).data('ui-slider-handle-index')
|
|
if (this._keySliding) {
|
this._keySliding = false
|
this._stop(event, index)
|
this._change(event, index)
|
this._removeClass($(event.target), null, 'ui-state-active')
|
}
|
}
|
}
|
})
|
|
/*!
|
* jQuery UI Sortable 1.12.1
|
* http://jqueryui.com
|
*
|
* Copyright jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*/
|
|
//>>label: Sortable
|
//>>group: Interactions
|
//>>description: Enables items in a list to be sorted using the mouse.
|
//>>docs: http://api.jqueryui.com/sortable/
|
//>>demos: http://jqueryui.com/sortable/
|
//>>css.structure: ../../themes/base/sortable.css
|
|
var widgetsSortable = $.widget('ui.sortable', $.ui.mouse, {
|
version: '1.12.1',
|
widgetEventPrefix: 'sort',
|
ready: false,
|
options: {
|
appendTo: 'parent',
|
axis: false,
|
connectWith: false,
|
containment: false,
|
cursor: 'auto',
|
cursorAt: false,
|
dropOnEmpty: true,
|
forcePlaceholderSize: false,
|
forceHelperSize: false,
|
grid: false,
|
handle: false,
|
helper: 'original',
|
items: '> *',
|
opacity: false,
|
placeholder: false,
|
revert: false,
|
scroll: true,
|
scrollSensitivity: 20,
|
scrollSpeed: 20,
|
scope: 'default',
|
tolerance: 'intersect',
|
zIndex: 1000,
|
|
// Callbacks
|
activate: null,
|
beforeStop: null,
|
change: null,
|
deactivate: null,
|
out: null,
|
over: null,
|
receive: null,
|
remove: null,
|
sort: null,
|
start: null,
|
stop: null,
|
update: null
|
},
|
|
_isOverAxis: function (x, reference, size) {
|
return x >= reference && x < reference + size
|
},
|
|
_isFloating: function (item) {
|
return /left|right/.test(item.css('float')) || /inline|table-cell/.test(item.css('display'))
|
},
|
|
_create: function () {
|
this.containerCache = {}
|
this._addClass('ui-sortable')
|
|
//Get the items
|
this.refresh()
|
|
//Let's determine the parent's offset
|
this.offset = this.element.offset()
|
|
//Initialize mouse events for interaction
|
this._mouseInit()
|
|
this._setHandleClassName()
|
|
//We're ready to go
|
this.ready = true
|
},
|
|
_setOption: function (key, value) {
|
this._super(key, value)
|
|
if (key === 'handle') {
|
this._setHandleClassName()
|
}
|
},
|
|
_setHandleClassName: function () {
|
var that = this
|
this._removeClass(this.element.find('.ui-sortable-handle'), 'ui-sortable-handle')
|
$.each(this.items, function () {
|
that._addClass(
|
this.instance.options.handle ? this.item.find(this.instance.options.handle) : this.item,
|
'ui-sortable-handle'
|
)
|
})
|
},
|
|
_destroy: function () {
|
this._mouseDestroy()
|
|
for (var i = this.items.length - 1; i >= 0; i--) {
|
this.items[i].item.removeData(this.widgetName + '-item')
|
}
|
|
return this
|
},
|
|
_mouseCapture: function (event, overrideHandle) {
|
var currentItem = null,
|
validHandle = false,
|
that = this
|
|
if (this.reverting) {
|
return false
|
}
|
|
if (this.options.disabled || this.options.type === 'static') {
|
return false
|
}
|
|
//We have to refresh the items data once first
|
this._refreshItems(event)
|
|
//Find out if the clicked node (or one of its parents) is a actual item in this.items
|
$(event.target)
|
.parents()
|
.each(function () {
|
if ($.data(this, that.widgetName + '-item') === that) {
|
currentItem = $(this)
|
return false
|
}
|
})
|
if ($.data(event.target, that.widgetName + '-item') === that) {
|
currentItem = $(event.target)
|
}
|
|
if (!currentItem) {
|
return false
|
}
|
if (this.options.handle && !overrideHandle) {
|
$(this.options.handle, currentItem)
|
.find('*')
|
.addBack()
|
.each(function () {
|
if (this === event.target) {
|
validHandle = true
|
}
|
})
|
if (!validHandle) {
|
return false
|
}
|
}
|
|
this.currentItem = currentItem
|
this._removeCurrentsFromItems()
|
return true
|
},
|
|
_mouseStart: function (event, overrideHandle, noActivation) {
|
var i,
|
body,
|
o = this.options
|
|
this.currentContainer = this
|
|
//We only need to call refreshPositions, because the refreshItems call has been moved to
|
// mouseCapture
|
this.refreshPositions()
|
|
//Create and append the visible helper
|
this.helper = this._createHelper(event)
|
|
//Cache the helper size
|
this._cacheHelperProportions()
|
|
/*
|
* - Position generation -
|
* This block generates everything position related - it's the core of draggables.
|
*/
|
|
//Cache the margins of the original element
|
this._cacheMargins()
|
|
//Get the next scrolling parent
|
this.scrollParent = this.helper.scrollParent()
|
|
//The element's absolute position on the page minus margins
|
this.offset = this.currentItem.offset()
|
this.offset = {
|
top: this.offset.top - this.margins.top,
|
left: this.offset.left - this.margins.left
|
}
|
|
$.extend(this.offset, {
|
click: {
|
//Where the click happened, relative to the element
|
left: event.pageX - this.offset.left,
|
top: event.pageY - this.offset.top
|
},
|
parent: this._getParentOffset(),
|
|
// This is a relative to absolute position minus the actual position calculation -
|
// only used for relative positioned helper
|
relative: this._getRelativeOffset()
|
})
|
|
// Only after we got the offset, we can change the helper's position to absolute
|
// TODO: Still need to figure out a way to make relative sorting possible
|
this.helper.css('position', 'absolute')
|
this.cssPosition = this.helper.css('position')
|
|
//Generate the original position
|
this.originalPosition = this._generatePosition(event)
|
this.originalPageX = event.pageX
|
this.originalPageY = event.pageY
|
|
//Adjust the mouse offset relative to the helper if "cursorAt" is supplied
|
o.cursorAt && this._adjustOffsetFromHelper(o.cursorAt)
|
|
//Cache the former DOM position
|
this.domPosition = {
|
prev: this.currentItem.prev()[0],
|
parent: this.currentItem.parent()[0]
|
}
|
|
// If the helper is not the original, hide the original so it's not playing any role during
|
// the drag, won't cause anything bad this way
|
if (this.helper[0] !== this.currentItem[0]) {
|
this.currentItem.hide()
|
}
|
|
//Create the placeholder
|
this._createPlaceholder()
|
|
//Set a containment if given in the options
|
if (o.containment) {
|
this._setContainment()
|
}
|
|
if (o.cursor && o.cursor !== 'auto') {
|
// cursor option
|
body = this.document.find('body')
|
|
// Support: IE
|
this.storedCursor = body.css('cursor')
|
body.css('cursor', o.cursor)
|
|
this.storedStylesheet = $(
|
'<style>*{ cursor: ' + o.cursor + ' !important; }</style>'
|
).appendTo(body)
|
}
|
|
if (o.opacity) {
|
// opacity option
|
if (this.helper.css('opacity')) {
|
this._storedOpacity = this.helper.css('opacity')
|
}
|
this.helper.css('opacity', o.opacity)
|
}
|
|
if (o.zIndex) {
|
// zIndex option
|
if (this.helper.css('zIndex')) {
|
this._storedZIndex = this.helper.css('zIndex')
|
}
|
this.helper.css('zIndex', o.zIndex)
|
}
|
|
//Prepare scrolling
|
if (this.scrollParent[0] !== this.document[0] && this.scrollParent[0].tagName !== 'HTML') {
|
this.overflowOffset = this.scrollParent.offset()
|
}
|
|
//Call callbacks
|
this._trigger('start', event, this._uiHash())
|
|
//Recache the helper size
|
if (!this._preserveHelperProportions) {
|
this._cacheHelperProportions()
|
}
|
|
//Post "activate" events to possible containers
|
if (!noActivation) {
|
for (i = this.containers.length - 1; i >= 0; i--) {
|
this.containers[i]._trigger('activate', event, this._uiHash(this))
|
}
|
}
|
|
//Prepare possible droppables
|
if ($.ui.ddmanager) {
|
$.ui.ddmanager.current = this
|
}
|
|
if ($.ui.ddmanager && !o.dropBehaviour) {
|
$.ui.ddmanager.prepareOffsets(this, event)
|
}
|
|
this.dragging = true
|
|
this._addClass(this.helper, 'ui-sortable-helper')
|
|
// Execute the drag once - this causes the helper not to be visiblebefore getting its
|
// correct position
|
this._mouseDrag(event)
|
return true
|
},
|
|
_mouseDrag: function (event) {
|
var i,
|
item,
|
itemElement,
|
intersection,
|
o = this.options,
|
scrolled = false
|
|
//Compute the helpers position
|
this.position = this._generatePosition(event)
|
this.positionAbs = this._convertPositionTo('absolute')
|
|
if (!this.lastPositionAbs) {
|
this.lastPositionAbs = this.positionAbs
|
}
|
|
//Do scrolling
|
if (this.options.scroll) {
|
if (this.scrollParent[0] !== this.document[0] && this.scrollParent[0].tagName !== 'HTML') {
|
if (
|
this.overflowOffset.top + this.scrollParent[0].offsetHeight - event.pageY <
|
o.scrollSensitivity
|
) {
|
this.scrollParent[0].scrollTop = scrolled =
|
this.scrollParent[0].scrollTop + o.scrollSpeed
|
} else if (event.pageY - this.overflowOffset.top < o.scrollSensitivity) {
|
this.scrollParent[0].scrollTop = scrolled =
|
this.scrollParent[0].scrollTop - o.scrollSpeed
|
}
|
|
if (
|
this.overflowOffset.left + this.scrollParent[0].offsetWidth - event.pageX <
|
o.scrollSensitivity
|
) {
|
this.scrollParent[0].scrollLeft = scrolled =
|
this.scrollParent[0].scrollLeft + o.scrollSpeed
|
} else if (event.pageX - this.overflowOffset.left < o.scrollSensitivity) {
|
this.scrollParent[0].scrollLeft = scrolled =
|
this.scrollParent[0].scrollLeft - o.scrollSpeed
|
}
|
} else {
|
if (event.pageY - this.document.scrollTop() < o.scrollSensitivity) {
|
scrolled = this.document.scrollTop(this.document.scrollTop() - o.scrollSpeed)
|
} else if (
|
this.window.height() - (event.pageY - this.document.scrollTop()) <
|
o.scrollSensitivity
|
) {
|
scrolled = this.document.scrollTop(this.document.scrollTop() + o.scrollSpeed)
|
}
|
|
if (event.pageX - this.document.scrollLeft() < o.scrollSensitivity) {
|
scrolled = this.document.scrollLeft(this.document.scrollLeft() - o.scrollSpeed)
|
} else if (
|
this.window.width() - (event.pageX - this.document.scrollLeft()) <
|
o.scrollSensitivity
|
) {
|
scrolled = this.document.scrollLeft(this.document.scrollLeft() + o.scrollSpeed)
|
}
|
}
|
|
if (scrolled !== false && $.ui.ddmanager && !o.dropBehaviour) {
|
$.ui.ddmanager.prepareOffsets(this, event)
|
}
|
}
|
|
//Regenerate the absolute position used for position checks
|
this.positionAbs = this._convertPositionTo('absolute')
|
|
//Set the helper position
|
if (!this.options.axis || this.options.axis !== 'y') {
|
this.helper[0].style.left = this.position.left + 'px'
|
}
|
if (!this.options.axis || this.options.axis !== 'x') {
|
this.helper[0].style.top = this.position.top + 'px'
|
}
|
|
//Rearrange
|
for (i = this.items.length - 1; i >= 0; i--) {
|
//Cache variables and intersection, continue if no intersection
|
item = this.items[i]
|
itemElement = item.item[0]
|
intersection = this._intersectsWithPointer(item)
|
if (!intersection) {
|
continue
|
}
|
|
// Only put the placeholder inside the current Container, skip all
|
// items from other containers. This works because when moving
|
// an item from one container to another the
|
// currentContainer is switched before the placeholder is moved.
|
//
|
// Without this, moving items in "sub-sortables" can cause
|
// the placeholder to jitter between the outer and inner container.
|
if (item.instance !== this.currentContainer) {
|
continue
|
}
|
|
// Cannot intersect with itself
|
// no useless actions that have been done before
|
// no action if the item moved is the parent of the item checked
|
if (
|
itemElement !== this.currentItem[0] &&
|
this.placeholder[intersection === 1 ? 'next' : 'prev']()[0] !== itemElement &&
|
!$.contains(this.placeholder[0], itemElement) &&
|
(this.options.type === 'semi-dynamic' ? !$.contains(this.element[0], itemElement) : true)
|
) {
|
this.direction = intersection === 1 ? 'down' : 'up'
|
|
if (this.options.tolerance === 'pointer' || this._intersectsWithSides(item)) {
|
this._rearrange(event, item)
|
} else {
|
break
|
}
|
|
this._trigger('change', event, this._uiHash())
|
break
|
}
|
}
|
|
//Post events to containers
|
this._contactContainers(event)
|
|
//Interconnect with droppables
|
if ($.ui.ddmanager) {
|
$.ui.ddmanager.drag(this, event)
|
}
|
|
//Call callbacks
|
this._trigger('sort', event, this._uiHash())
|
|
this.lastPositionAbs = this.positionAbs
|
return false
|
},
|
|
_mouseStop: function (event, noPropagation) {
|
if (!event) {
|
return
|
}
|
|
//If we are using droppables, inform the manager about the drop
|
if ($.ui.ddmanager && !this.options.dropBehaviour) {
|
$.ui.ddmanager.drop(this, event)
|
}
|
|
if (this.options.revert) {
|
var that = this,
|
cur = this.placeholder.offset(),
|
axis = this.options.axis,
|
animation = {}
|
|
if (!axis || axis === 'x') {
|
animation.left =
|
cur.left -
|
this.offset.parent.left -
|
this.margins.left +
|
(this.offsetParent[0] === this.document[0].body ? 0 : this.offsetParent[0].scrollLeft)
|
}
|
if (!axis || axis === 'y') {
|
animation.top =
|
cur.top -
|
this.offset.parent.top -
|
this.margins.top +
|
(this.offsetParent[0] === this.document[0].body ? 0 : this.offsetParent[0].scrollTop)
|
}
|
this.reverting = true
|
$(this.helper).animate(animation, parseInt(this.options.revert, 10) || 500, function () {
|
that._clear(event)
|
})
|
} else {
|
this._clear(event, noPropagation)
|
}
|
|
return false
|
},
|
|
cancel: function () {
|
if (this.dragging) {
|
this._mouseUp(new $.Event('mouseup', { target: null }))
|
|
if (this.options.helper === 'original') {
|
this.currentItem.css(this._storedCSS)
|
this._removeClass(this.currentItem, 'ui-sortable-helper')
|
} else {
|
this.currentItem.show()
|
}
|
|
//Post deactivating events to containers
|
for (var i = this.containers.length - 1; i >= 0; i--) {
|
this.containers[i]._trigger('deactivate', null, this._uiHash(this))
|
if (this.containers[i].containerCache.over) {
|
this.containers[i]._trigger('out', null, this._uiHash(this))
|
this.containers[i].containerCache.over = 0
|
}
|
}
|
}
|
|
if (this.placeholder) {
|
//$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately,
|
// it unbinds ALL events from the original node!
|
if (this.placeholder[0].parentNode) {
|
this.placeholder[0].parentNode.removeChild(this.placeholder[0])
|
}
|
if (this.options.helper !== 'original' && this.helper && this.helper[0].parentNode) {
|
this.helper.remove()
|
}
|
|
$.extend(this, {
|
helper: null,
|
dragging: false,
|
reverting: false,
|
_noFinalSort: null
|
})
|
|
if (this.domPosition.prev) {
|
$(this.domPosition.prev).after(this.currentItem)
|
} else {
|
$(this.domPosition.parent).prepend(this.currentItem)
|
}
|
}
|
|
return this
|
},
|
|
serialize: function (o) {
|
var items = this._getItemsAsjQuery(o && o.connected),
|
str = []
|
o = o || {}
|
|
$(items).each(function () {
|
var res = ($(o.item || this).attr(o.attribute || 'id') || '').match(
|
o.expression || /(.+)[\-=_](.+)/
|
)
|
if (res) {
|
str.push((o.key || res[1] + '[]') + '=' + (o.key && o.expression ? res[1] : res[2]))
|
}
|
})
|
|
if (!str.length && o.key) {
|
str.push(o.key + '=')
|
}
|
|
return str.join('&')
|
},
|
|
toArray: function (o) {
|
var items = this._getItemsAsjQuery(o && o.connected),
|
ret = []
|
|
o = o || {}
|
|
items.each(function () {
|
ret.push($(o.item || this).attr(o.attribute || 'id') || '')
|
})
|
return ret
|
},
|
|
/* Be careful with the following core functions */
|
_intersectsWith: function (item) {
|
var x1 = this.positionAbs.left,
|
x2 = x1 + this.helperProportions.width,
|
y1 = this.positionAbs.top,
|
y2 = y1 + this.helperProportions.height,
|
l = item.left,
|
r = l + item.width,
|
t = item.top,
|
b = t + item.height,
|
dyClick = this.offset.click.top,
|
dxClick = this.offset.click.left,
|
isOverElementHeight = this.options.axis === 'x' || (y1 + dyClick > t && y1 + dyClick < b),
|
isOverElementWidth = this.options.axis === 'y' || (x1 + dxClick > l && x1 + dxClick < r),
|
isOverElement = isOverElementHeight && isOverElementWidth
|
|
if (
|
this.options.tolerance === 'pointer' ||
|
this.options.forcePointerForContainers ||
|
(this.options.tolerance !== 'pointer' &&
|
this.helperProportions[this.floating ? 'width' : 'height'] >
|
item[this.floating ? 'width' : 'height'])
|
) {
|
return isOverElement
|
} else {
|
return (
|
l < x1 + this.helperProportions.width / 2 && // Right Half
|
x2 - this.helperProportions.width / 2 < r && // Left Half
|
t < y1 + this.helperProportions.height / 2 && // Bottom Half
|
y2 - this.helperProportions.height / 2 < b
|
) // Top Half
|
}
|
},
|
|
_intersectsWithPointer: function (item) {
|
var verticalDirection,
|
horizontalDirection,
|
isOverElementHeight =
|
this.options.axis === 'x' ||
|
this._isOverAxis(this.positionAbs.top + this.offset.click.top, item.top, item.height),
|
isOverElementWidth =
|
this.options.axis === 'y' ||
|
this._isOverAxis(this.positionAbs.left + this.offset.click.left, item.left, item.width),
|
isOverElement = isOverElementHeight && isOverElementWidth
|
|
if (!isOverElement) {
|
return false
|
}
|
|
verticalDirection = this._getDragVerticalDirection()
|
horizontalDirection = this._getDragHorizontalDirection()
|
|
return this.floating
|
? horizontalDirection === 'right' || verticalDirection === 'down'
|
? 2
|
: 1
|
: verticalDirection && (verticalDirection === 'down' ? 2 : 1)
|
},
|
|
_intersectsWithSides: function (item) {
|
var isOverBottomHalf = this._isOverAxis(
|
this.positionAbs.top + this.offset.click.top,
|
item.top + item.height / 2,
|
item.height
|
),
|
isOverRightHalf = this._isOverAxis(
|
this.positionAbs.left + this.offset.click.left,
|
item.left + item.width / 2,
|
item.width
|
),
|
verticalDirection = this._getDragVerticalDirection(),
|
horizontalDirection = this._getDragHorizontalDirection()
|
|
if (this.floating && horizontalDirection) {
|
return (
|
(horizontalDirection === 'right' && isOverRightHalf) ||
|
(horizontalDirection === 'left' && !isOverRightHalf)
|
)
|
} else {
|
return (
|
verticalDirection &&
|
((verticalDirection === 'down' && isOverBottomHalf) ||
|
(verticalDirection === 'up' && !isOverBottomHalf))
|
)
|
}
|
},
|
|
_getDragVerticalDirection: function () {
|
var delta = this.positionAbs.top - this.lastPositionAbs.top
|
return delta !== 0 && (delta > 0 ? 'down' : 'up')
|
},
|
|
_getDragHorizontalDirection: function () {
|
var delta = this.positionAbs.left - this.lastPositionAbs.left
|
return delta !== 0 && (delta > 0 ? 'right' : 'left')
|
},
|
|
refresh: function (event) {
|
this._refreshItems(event)
|
this._setHandleClassName()
|
this.refreshPositions()
|
return this
|
},
|
|
_connectWith: function () {
|
var options = this.options
|
return options.connectWith.constructor === String
|
? [options.connectWith]
|
: options.connectWith
|
},
|
|
_getItemsAsjQuery: function (connected) {
|
var i,
|
j,
|
cur,
|
inst,
|
items = [],
|
queries = [],
|
connectWith = this._connectWith()
|
|
if (connectWith && connected) {
|
for (i = connectWith.length - 1; i >= 0; i--) {
|
cur = $(connectWith[i], this.document[0])
|
for (j = cur.length - 1; j >= 0; j--) {
|
inst = $.data(cur[j], this.widgetFullName)
|
if (inst && inst !== this && !inst.options.disabled) {
|
queries.push([
|
$.isFunction(inst.options.items)
|
? inst.options.items.call(inst.element)
|
: $(inst.options.items, inst.element)
|
.not('.ui-sortable-helper')
|
.not('.ui-sortable-placeholder'),
|
inst
|
])
|
}
|
}
|
}
|
}
|
|
queries.push([
|
$.isFunction(this.options.items)
|
? this.options.items.call(this.element, null, {
|
options: this.options,
|
item: this.currentItem
|
})
|
: $(this.options.items, this.element)
|
.not('.ui-sortable-helper')
|
.not('.ui-sortable-placeholder'),
|
this
|
])
|
|
function addItems() {
|
items.push(this)
|
}
|
for (i = queries.length - 1; i >= 0; i--) {
|
queries[i][0].each(addItems)
|
}
|
|
return $(items)
|
},
|
|
_removeCurrentsFromItems: function () {
|
var list = this.currentItem.find(':data(' + this.widgetName + '-item)')
|
|
this.items = $.grep(this.items, function (item) {
|
for (var j = 0; j < list.length; j++) {
|
if (list[j] === item.item[0]) {
|
return false
|
}
|
}
|
return true
|
})
|
},
|
|
_refreshItems: function (event) {
|
this.items = []
|
this.containers = [this]
|
|
var i,
|
j,
|
cur,
|
inst,
|
targetData,
|
_queries,
|
item,
|
queriesLength,
|
items = this.items,
|
queries = [
|
[
|
$.isFunction(this.options.items)
|
? this.options.items.call(this.element[0], event, { item: this.currentItem })
|
: $(this.options.items, this.element),
|
this
|
]
|
],
|
connectWith = this._connectWith()
|
|
//Shouldn't be run the first time through due to massive slow-down
|
if (connectWith && this.ready) {
|
for (i = connectWith.length - 1; i >= 0; i--) {
|
cur = $(connectWith[i], this.document[0])
|
for (j = cur.length - 1; j >= 0; j--) {
|
inst = $.data(cur[j], this.widgetFullName)
|
if (inst && inst !== this && !inst.options.disabled) {
|
queries.push([
|
$.isFunction(inst.options.items)
|
? inst.options.items.call(inst.element[0], event, { item: this.currentItem })
|
: $(inst.options.items, inst.element),
|
inst
|
])
|
this.containers.push(inst)
|
}
|
}
|
}
|
}
|
|
for (i = queries.length - 1; i >= 0; i--) {
|
targetData = queries[i][1]
|
_queries = queries[i][0]
|
|
for (j = 0, queriesLength = _queries.length; j < queriesLength; j++) {
|
item = $(_queries[j])
|
|
// Data for target checking (mouse manager)
|
item.data(this.widgetName + '-item', targetData)
|
|
items.push({
|
item: item,
|
instance: targetData,
|
width: 0,
|
height: 0,
|
left: 0,
|
top: 0
|
})
|
}
|
}
|
},
|
|
refreshPositions: function (fast) {
|
// Determine whether items are being displayed horizontally
|
this.floating = this.items.length
|
? this.options.axis === 'x' || this._isFloating(this.items[0].item)
|
: false
|
|
//This has to be redone because due to the item being moved out/into the offsetParent,
|
// the offsetParent's position will change
|
if (this.offsetParent && this.helper) {
|
this.offset.parent = this._getParentOffset()
|
}
|
|
var i, item, t, p
|
|
for (i = this.items.length - 1; i >= 0; i--) {
|
item = this.items[i]
|
|
//We ignore calculating positions of all connected containers when we're not over them
|
if (
|
item.instance !== this.currentContainer &&
|
this.currentContainer &&
|
item.item[0] !== this.currentItem[0]
|
) {
|
continue
|
}
|
|
t = this.options.toleranceElement ? $(this.options.toleranceElement, item.item) : item.item
|
|
if (!fast) {
|
item.width = t.outerWidth()
|
item.height = t.outerHeight()
|
}
|
|
p = t.offset()
|
item.left = p.left
|
item.top = p.top
|
}
|
|
if (this.options.custom && this.options.custom.refreshContainers) {
|
this.options.custom.refreshContainers.call(this)
|
} else {
|
for (i = this.containers.length - 1; i >= 0; i--) {
|
p = this.containers[i].element.offset()
|
this.containers[i].containerCache.left = p.left
|
this.containers[i].containerCache.top = p.top
|
this.containers[i].containerCache.width = this.containers[i].element.outerWidth()
|
this.containers[i].containerCache.height = this.containers[i].element.outerHeight()
|
}
|
}
|
|
return this
|
},
|
|
_createPlaceholder: function (that) {
|
that = that || this
|
var className,
|
o = that.options
|
|
if (!o.placeholder || o.placeholder.constructor === String) {
|
className = o.placeholder
|
o.placeholder = {
|
element: function () {
|
var nodeName = that.currentItem[0].nodeName.toLowerCase(),
|
element = $('<' + nodeName + '>', that.document[0])
|
|
that
|
._addClass(
|
element,
|
'ui-sortable-placeholder',
|
className || that.currentItem[0].className
|
)
|
._removeClass(element, 'ui-sortable-helper')
|
|
if (nodeName === 'tbody') {
|
that._createTrPlaceholder(
|
that.currentItem.find('tr').eq(0),
|
$('<tr>', that.document[0]).appendTo(element)
|
)
|
} else if (nodeName === 'tr') {
|
that._createTrPlaceholder(that.currentItem, element)
|
} else if (nodeName === 'img') {
|
element.attr('src', that.currentItem.attr('src'))
|
}
|
|
if (!className) {
|
element.css('visibility', 'hidden')
|
}
|
|
return element
|
},
|
update: function (container, p) {
|
// 1. If a className is set as 'placeholder option, we don't force sizes -
|
// the class is responsible for that
|
// 2. The option 'forcePlaceholderSize can be enabled to force it even if a
|
// class name is specified
|
if (className && !o.forcePlaceholderSize) {
|
return
|
}
|
|
//If the element doesn't have a actual height by itself (without styles coming
|
// from a stylesheet), it receives the inline height from the dragged item
|
if (!p.height()) {
|
p.height(
|
that.currentItem.innerHeight() -
|
parseInt(that.currentItem.css('paddingTop') || 0, 10) -
|
parseInt(that.currentItem.css('paddingBottom') || 0, 10)
|
)
|
}
|
if (!p.width()) {
|
p.width(
|
that.currentItem.innerWidth() -
|
parseInt(that.currentItem.css('paddingLeft') || 0, 10) -
|
parseInt(that.currentItem.css('paddingRight') || 0, 10)
|
)
|
}
|
}
|
}
|
}
|
|
//Create the placeholder
|
that.placeholder = $(o.placeholder.element.call(that.element, that.currentItem))
|
|
//Append it after the actual current item
|
that.currentItem.after(that.placeholder)
|
|
//Update the size of the placeholder (TODO: Logic to fuzzy, see line 316/317)
|
o.placeholder.update(that, that.placeholder)
|
},
|
|
_createTrPlaceholder: function (sourceTr, targetTr) {
|
var that = this
|
|
sourceTr.children().each(function () {
|
$('<td> </td>', that.document[0])
|
.attr('colspan', $(this).attr('colspan') || 1)
|
.appendTo(targetTr)
|
})
|
},
|
|
_contactContainers: function (event) {
|
var i,
|
j,
|
dist,
|
itemWithLeastDistance,
|
posProperty,
|
sizeProperty,
|
cur,
|
nearBottom,
|
floating,
|
axis,
|
innermostContainer = null,
|
innermostIndex = null
|
|
// Get innermost container that intersects with item
|
for (i = this.containers.length - 1; i >= 0; i--) {
|
// Never consider a container that's located within the item itself
|
if ($.contains(this.currentItem[0], this.containers[i].element[0])) {
|
continue
|
}
|
|
if (this._intersectsWith(this.containers[i].containerCache)) {
|
// If we've already found a container and it's more "inner" than this, then continue
|
if (
|
innermostContainer &&
|
$.contains(this.containers[i].element[0], innermostContainer.element[0])
|
) {
|
continue
|
}
|
|
innermostContainer = this.containers[i]
|
innermostIndex = i
|
} else {
|
// container doesn't intersect. trigger "out" event if necessary
|
if (this.containers[i].containerCache.over) {
|
this.containers[i]._trigger('out', event, this._uiHash(this))
|
this.containers[i].containerCache.over = 0
|
}
|
}
|
}
|
|
// If no intersecting containers found, return
|
if (!innermostContainer) {
|
return
|
}
|
|
// Move the item into the container if it's not there already
|
if (this.containers.length === 1) {
|
if (!this.containers[innermostIndex].containerCache.over) {
|
this.containers[innermostIndex]._trigger('over', event, this._uiHash(this))
|
this.containers[innermostIndex].containerCache.over = 1
|
}
|
} else {
|
// When entering a new container, we will find the item with the least distance and
|
// append our item near it
|
dist = 10000
|
itemWithLeastDistance = null
|
floating = innermostContainer.floating || this._isFloating(this.currentItem)
|
posProperty = floating ? 'left' : 'top'
|
sizeProperty = floating ? 'width' : 'height'
|
axis = floating ? 'pageX' : 'pageY'
|
|
for (j = this.items.length - 1; j >= 0; j--) {
|
if (!$.contains(this.containers[innermostIndex].element[0], this.items[j].item[0])) {
|
continue
|
}
|
if (this.items[j].item[0] === this.currentItem[0]) {
|
continue
|
}
|
|
cur = this.items[j].item.offset()[posProperty]
|
nearBottom = false
|
if (event[axis] - cur > this.items[j][sizeProperty] / 2) {
|
nearBottom = true
|
}
|
|
if (Math.abs(event[axis] - cur) < dist) {
|
dist = Math.abs(event[axis] - cur)
|
itemWithLeastDistance = this.items[j]
|
this.direction = nearBottom ? 'up' : 'down'
|
}
|
}
|
|
//Check if dropOnEmpty is enabled
|
if (!itemWithLeastDistance && !this.options.dropOnEmpty) {
|
return
|
}
|
|
if (this.currentContainer === this.containers[innermostIndex]) {
|
if (!this.currentContainer.containerCache.over) {
|
this.containers[innermostIndex]._trigger('over', event, this._uiHash())
|
this.currentContainer.containerCache.over = 1
|
}
|
return
|
}
|
|
itemWithLeastDistance
|
? this._rearrange(event, itemWithLeastDistance, null, true)
|
: this._rearrange(event, null, this.containers[innermostIndex].element, true)
|
this._trigger('change', event, this._uiHash())
|
this.containers[innermostIndex]._trigger('change', event, this._uiHash(this))
|
this.currentContainer = this.containers[innermostIndex]
|
|
//Update the placeholder
|
this.options.placeholder.update(this.currentContainer, this.placeholder)
|
|
this.containers[innermostIndex]._trigger('over', event, this._uiHash(this))
|
this.containers[innermostIndex].containerCache.over = 1
|
}
|
},
|
|
_createHelper: function (event) {
|
var o = this.options,
|
helper = $.isFunction(o.helper)
|
? $(o.helper.apply(this.element[0], [event, this.currentItem]))
|
: o.helper === 'clone'
|
? this.currentItem.clone()
|
: this.currentItem
|
|
//Add the helper to the DOM if that didn't happen already
|
if (!helper.parents('body').length) {
|
$(o.appendTo !== 'parent' ? o.appendTo : this.currentItem[0].parentNode)[0].appendChild(
|
helper[0]
|
)
|
}
|
|
if (helper[0] === this.currentItem[0]) {
|
this._storedCSS = {
|
width: this.currentItem[0].style.width,
|
height: this.currentItem[0].style.height,
|
position: this.currentItem.css('position'),
|
top: this.currentItem.css('top'),
|
left: this.currentItem.css('left')
|
}
|
}
|
|
if (!helper[0].style.width || o.forceHelperSize) {
|
helper.width(this.currentItem.width())
|
}
|
if (!helper[0].style.height || o.forceHelperSize) {
|
helper.height(this.currentItem.height())
|
}
|
|
return helper
|
},
|
|
_adjustOffsetFromHelper: function (obj) {
|
if (typeof obj === 'string') {
|
obj = obj.split(' ')
|
}
|
if ($.isArray(obj)) {
|
obj = { left: +obj[0], top: +obj[1] || 0 }
|
}
|
if ('left' in obj) {
|
this.offset.click.left = obj.left + this.margins.left
|
}
|
if ('right' in obj) {
|
this.offset.click.left = this.helperProportions.width - obj.right + this.margins.left
|
}
|
if ('top' in obj) {
|
this.offset.click.top = obj.top + this.margins.top
|
}
|
if ('bottom' in obj) {
|
this.offset.click.top = this.helperProportions.height - obj.bottom + this.margins.top
|
}
|
},
|
|
_getParentOffset: function () {
|
//Get the offsetParent and cache its position
|
this.offsetParent = this.helper.offsetParent()
|
var po = this.offsetParent.offset()
|
|
// This is a special case where we need to modify a offset calculated on start, since the
|
// following happened:
|
// 1. The position of the helper is absolute, so it's position is calculated based on the
|
// next positioned parent
|
// 2. The actual offset parent is a child of the scroll parent, and the scroll parent isn't
|
// the document, which means that the scroll is included in the initial calculation of the
|
// offset of the parent, and never recalculated upon drag
|
if (
|
this.cssPosition === 'absolute' &&
|
this.scrollParent[0] !== this.document[0] &&
|
$.contains(this.scrollParent[0], this.offsetParent[0])
|
) {
|
po.left += this.scrollParent.scrollLeft()
|
po.top += this.scrollParent.scrollTop()
|
}
|
|
// This needs to be actually done for all browsers, since pageX/pageY includes this
|
// information with an ugly IE fix
|
if (
|
this.offsetParent[0] === this.document[0].body ||
|
(this.offsetParent[0].tagName &&
|
this.offsetParent[0].tagName.toLowerCase() === 'html' &&
|
$.ui.ie)
|
) {
|
po = { top: 0, left: 0 }
|
}
|
|
return {
|
top: po.top + (parseInt(this.offsetParent.css('borderTopWidth'), 10) || 0),
|
left: po.left + (parseInt(this.offsetParent.css('borderLeftWidth'), 10) || 0)
|
}
|
},
|
|
_getRelativeOffset: function () {
|
if (this.cssPosition === 'relative') {
|
var p = this.currentItem.position()
|
return {
|
top: p.top - (parseInt(this.helper.css('top'), 10) || 0) + this.scrollParent.scrollTop(),
|
left:
|
p.left - (parseInt(this.helper.css('left'), 10) || 0) + this.scrollParent.scrollLeft()
|
}
|
} else {
|
return { top: 0, left: 0 }
|
}
|
},
|
|
_cacheMargins: function () {
|
this.margins = {
|
left: parseInt(this.currentItem.css('marginLeft'), 10) || 0,
|
top: parseInt(this.currentItem.css('marginTop'), 10) || 0
|
}
|
},
|
|
_cacheHelperProportions: function () {
|
this.helperProportions = {
|
width: this.helper.outerWidth(),
|
height: this.helper.outerHeight()
|
}
|
},
|
|
_setContainment: function () {
|
var ce,
|
co,
|
over,
|
o = this.options
|
if (o.containment === 'parent') {
|
o.containment = this.helper[0].parentNode
|
}
|
if (o.containment === 'document' || o.containment === 'window') {
|
this.containment = [
|
0 - this.offset.relative.left - this.offset.parent.left,
|
0 - this.offset.relative.top - this.offset.parent.top,
|
o.containment === 'document'
|
? this.document.width()
|
: this.window.width() - this.helperProportions.width - this.margins.left,
|
(o.containment === 'document'
|
? this.document.height() || document.body.parentNode.scrollHeight
|
: this.window.height() || this.document[0].body.parentNode.scrollHeight) -
|
this.helperProportions.height -
|
this.margins.top
|
]
|
}
|
|
if (!/^(document|window|parent)$/.test(o.containment)) {
|
ce = $(o.containment)[0]
|
co = $(o.containment).offset()
|
over = $(ce).css('overflow') !== 'hidden'
|
|
this.containment = [
|
co.left +
|
(parseInt($(ce).css('borderLeftWidth'), 10) || 0) +
|
(parseInt($(ce).css('paddingLeft'), 10) || 0) -
|
this.margins.left,
|
co.top +
|
(parseInt($(ce).css('borderTopWidth'), 10) || 0) +
|
(parseInt($(ce).css('paddingTop'), 10) || 0) -
|
this.margins.top,
|
co.left +
|
(over ? Math.max(ce.scrollWidth, ce.offsetWidth) : ce.offsetWidth) -
|
(parseInt($(ce).css('borderLeftWidth'), 10) || 0) -
|
(parseInt($(ce).css('paddingRight'), 10) || 0) -
|
this.helperProportions.width -
|
this.margins.left,
|
co.top +
|
(over ? Math.max(ce.scrollHeight, ce.offsetHeight) : ce.offsetHeight) -
|
(parseInt($(ce).css('borderTopWidth'), 10) || 0) -
|
(parseInt($(ce).css('paddingBottom'), 10) || 0) -
|
this.helperProportions.height -
|
this.margins.top
|
]
|
}
|
},
|
|
_convertPositionTo: function (d, pos) {
|
if (!pos) {
|
pos = this.position
|
}
|
var mod = d === 'absolute' ? 1 : -1,
|
scroll =
|
this.cssPosition === 'absolute' &&
|
!(
|
this.scrollParent[0] !== this.document[0] &&
|
$.contains(this.scrollParent[0], this.offsetParent[0])
|
)
|
? this.offsetParent
|
: this.scrollParent,
|
scrollIsRootNode = /(html|body)/i.test(scroll[0].tagName)
|
|
return {
|
top:
|
// The absolute mouse position
|
pos.top +
|
// Only for relative positioned nodes: Relative offset from element to offset parent
|
this.offset.relative.top * mod +
|
// The offsetParent's offset without borders (offset + border)
|
this.offset.parent.top * mod -
|
(this.cssPosition === 'fixed'
|
? -this.scrollParent.scrollTop()
|
: scrollIsRootNode
|
? 0
|
: scroll.scrollTop()) *
|
mod,
|
left:
|
// The absolute mouse position
|
pos.left +
|
// Only for relative positioned nodes: Relative offset from element to offset parent
|
this.offset.relative.left * mod +
|
// The offsetParent's offset without borders (offset + border)
|
this.offset.parent.left * mod -
|
(this.cssPosition === 'fixed'
|
? -this.scrollParent.scrollLeft()
|
: scrollIsRootNode
|
? 0
|
: scroll.scrollLeft()) *
|
mod
|
}
|
},
|
|
_generatePosition: function (event) {
|
var top,
|
left,
|
o = this.options,
|
pageX = event.pageX,
|
pageY = event.pageY,
|
scroll =
|
this.cssPosition === 'absolute' &&
|
!(
|
this.scrollParent[0] !== this.document[0] &&
|
$.contains(this.scrollParent[0], this.offsetParent[0])
|
)
|
? this.offsetParent
|
: this.scrollParent,
|
scrollIsRootNode = /(html|body)/i.test(scroll[0].tagName)
|
|
// This is another very weird special case that only happens for relative elements:
|
// 1. If the css position is relative
|
// 2. and the scroll parent is the document or similar to the offset parent
|
// we have to refresh the relative offset during the scroll so there are no jumps
|
if (
|
this.cssPosition === 'relative' &&
|
!(
|
this.scrollParent[0] !== this.document[0] && this.scrollParent[0] !== this.offsetParent[0]
|
)
|
) {
|
this.offset.relative = this._getRelativeOffset()
|
}
|
|
/*
|
* - Position constraining -
|
* Constrain the position to a mix of grid, containment.
|
*/
|
|
if (this.originalPosition) {
|
//If we are not dragging yet, we won't check for options
|
|
if (this.containment) {
|
if (event.pageX - this.offset.click.left < this.containment[0]) {
|
pageX = this.containment[0] + this.offset.click.left
|
}
|
if (event.pageY - this.offset.click.top < this.containment[1]) {
|
pageY = this.containment[1] + this.offset.click.top
|
}
|
if (event.pageX - this.offset.click.left > this.containment[2]) {
|
pageX = this.containment[2] + this.offset.click.left
|
}
|
if (event.pageY - this.offset.click.top > this.containment[3]) {
|
pageY = this.containment[3] + this.offset.click.top
|
}
|
}
|
|
if (o.grid) {
|
top =
|
this.originalPageY + Math.round((pageY - this.originalPageY) / o.grid[1]) * o.grid[1]
|
pageY = this.containment
|
? top - this.offset.click.top >= this.containment[1] &&
|
top - this.offset.click.top <= this.containment[3]
|
? top
|
: top - this.offset.click.top >= this.containment[1]
|
? top - o.grid[1]
|
: top + o.grid[1]
|
: top
|
|
left =
|
this.originalPageX + Math.round((pageX - this.originalPageX) / o.grid[0]) * o.grid[0]
|
pageX = this.containment
|
? left - this.offset.click.left >= this.containment[0] &&
|
left - this.offset.click.left <= this.containment[2]
|
? left
|
: left - this.offset.click.left >= this.containment[0]
|
? left - o.grid[0]
|
: left + o.grid[0]
|
: left
|
}
|
}
|
|
return {
|
top:
|
// The absolute mouse position
|
pageY -
|
// Click offset (relative to the element)
|
this.offset.click.top -
|
// Only for relative positioned nodes: Relative offset from element to offset parent
|
this.offset.relative.top -
|
// The offsetParent's offset without borders (offset + border)
|
this.offset.parent.top +
|
(this.cssPosition === 'fixed'
|
? -this.scrollParent.scrollTop()
|
: scrollIsRootNode
|
? 0
|
: scroll.scrollTop()),
|
left:
|
// The absolute mouse position
|
pageX -
|
// Click offset (relative to the element)
|
this.offset.click.left -
|
// Only for relative positioned nodes: Relative offset from element to offset parent
|
this.offset.relative.left -
|
// The offsetParent's offset without borders (offset + border)
|
this.offset.parent.left +
|
(this.cssPosition === 'fixed'
|
? -this.scrollParent.scrollLeft()
|
: scrollIsRootNode
|
? 0
|
: scroll.scrollLeft())
|
}
|
},
|
|
_rearrange: function (event, i, a, hardRefresh) {
|
a
|
? a[0].appendChild(this.placeholder[0])
|
: i.item[0].parentNode.insertBefore(
|
this.placeholder[0],
|
this.direction === 'down' ? i.item[0] : i.item[0].nextSibling
|
)
|
|
//Various things done here to improve the performance:
|
// 1. we create a setTimeout, that calls refreshPositions
|
// 2. on the instance, we have a counter variable, that get's higher after every append
|
// 3. on the local scope, we copy the counter variable, and check in the timeout,
|
// if it's still the same
|
// 4. this lets only the last addition to the timeout stack through
|
this.counter = this.counter ? ++this.counter : 1
|
var counter = this.counter
|
|
this._delay(function () {
|
if (counter === this.counter) {
|
//Precompute after each DOM insertion, NOT on mousemove
|
this.refreshPositions(!hardRefresh)
|
}
|
})
|
},
|
|
_clear: function (event, noPropagation) {
|
this.reverting = false
|
|
// We delay all events that have to be triggered to after the point where the placeholder
|
// has been removed and everything else normalized again
|
var i,
|
delayedTriggers = []
|
|
// We first have to update the dom position of the actual currentItem
|
// Note: don't do it if the current item is already removed (by a user), or it gets
|
// reappended (see #4088)
|
if (!this._noFinalSort && this.currentItem.parent().length) {
|
this.placeholder.before(this.currentItem)
|
}
|
this._noFinalSort = null
|
|
if (this.helper[0] === this.currentItem[0]) {
|
for (i in this._storedCSS) {
|
if (this._storedCSS[i] === 'auto' || this._storedCSS[i] === 'static') {
|
this._storedCSS[i] = ''
|
}
|
}
|
this.currentItem.css(this._storedCSS)
|
this._removeClass(this.currentItem, 'ui-sortable-helper')
|
} else {
|
this.currentItem.show()
|
}
|
|
if (this.fromOutside && !noPropagation) {
|
delayedTriggers.push(function (event) {
|
this._trigger('receive', event, this._uiHash(this.fromOutside))
|
})
|
}
|
if (
|
(this.fromOutside ||
|
this.domPosition.prev !== this.currentItem.prev().not('.ui-sortable-helper')[0] ||
|
this.domPosition.parent !== this.currentItem.parent()[0]) &&
|
!noPropagation
|
) {
|
// Trigger update callback if the DOM position has changed
|
delayedTriggers.push(function (event) {
|
this._trigger('update', event, this._uiHash())
|
})
|
}
|
|
// Check if the items Container has Changed and trigger appropriate
|
// events.
|
if (this !== this.currentContainer) {
|
if (!noPropagation) {
|
delayedTriggers.push(function (event) {
|
this._trigger('remove', event, this._uiHash())
|
})
|
delayedTriggers.push(
|
function (c) {
|
return function (event) {
|
c._trigger('receive', event, this._uiHash(this))
|
}
|
}.call(this, this.currentContainer)
|
)
|
delayedTriggers.push(
|
function (c) {
|
return function (event) {
|
c._trigger('update', event, this._uiHash(this))
|
}
|
}.call(this, this.currentContainer)
|
)
|
}
|
}
|
|
//Post events to containers
|
function delayEvent(type, instance, container) {
|
return function (event) {
|
container._trigger(type, event, instance._uiHash(instance))
|
}
|
}
|
for (i = this.containers.length - 1; i >= 0; i--) {
|
if (!noPropagation) {
|
delayedTriggers.push(delayEvent('deactivate', this, this.containers[i]))
|
}
|
if (this.containers[i].containerCache.over) {
|
delayedTriggers.push(delayEvent('out', this, this.containers[i]))
|
this.containers[i].containerCache.over = 0
|
}
|
}
|
|
//Do what was originally in plugins
|
if (this.storedCursor) {
|
this.document.find('body').css('cursor', this.storedCursor)
|
this.storedStylesheet.remove()
|
}
|
if (this._storedOpacity) {
|
this.helper.css('opacity', this._storedOpacity)
|
}
|
if (this._storedZIndex) {
|
this.helper.css('zIndex', this._storedZIndex === 'auto' ? '' : this._storedZIndex)
|
}
|
|
this.dragging = false
|
|
if (!noPropagation) {
|
this._trigger('beforeStop', event, this._uiHash())
|
}
|
|
//$(this.placeholder[0]).remove(); would have been the jQuery way - unfortunately,
|
// it unbinds ALL events from the original node!
|
this.placeholder[0].parentNode.removeChild(this.placeholder[0])
|
|
if (!this.cancelHelperRemoval) {
|
if (this.helper[0] !== this.currentItem[0]) {
|
this.helper.remove()
|
}
|
this.helper = null
|
}
|
|
if (!noPropagation) {
|
for (i = 0; i < delayedTriggers.length; i++) {
|
// Trigger all delayed events
|
delayedTriggers[i].call(this, event)
|
}
|
this._trigger('stop', event, this._uiHash())
|
}
|
|
this.fromOutside = false
|
return !this.cancelHelperRemoval
|
},
|
|
_trigger: function () {
|
if ($.Widget.prototype._trigger.apply(this, arguments) === false) {
|
this.cancel()
|
}
|
},
|
|
_uiHash: function (_inst) {
|
var inst = _inst || this
|
return {
|
helper: inst.helper,
|
placeholder: inst.placeholder || $([]),
|
position: inst.position,
|
originalPosition: inst.originalPosition,
|
offset: inst.positionAbs,
|
item: inst.currentItem,
|
sender: _inst ? _inst.element : null
|
}
|
}
|
})
|
|
/*!
|
* jQuery UI Spinner 1.12.1
|
* http://jqueryui.com
|
*
|
* Copyright jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*/
|
|
//>>label: Spinner
|
//>>group: Widgets
|
//>>description: Displays buttons to easily input numbers via the keyboard or mouse.
|
//>>docs: http://api.jqueryui.com/spinner/
|
//>>demos: http://jqueryui.com/spinner/
|
//>>css.structure: ../../themes/base/core.css
|
//>>css.structure: ../../themes/base/spinner.css
|
//>>css.theme: ../../themes/base/theme.css
|
|
function spinnerModifer(fn) {
|
return function () {
|
var previous = this.element.val()
|
fn.apply(this, arguments)
|
this._refresh()
|
if (previous !== this.element.val()) {
|
this._trigger('change')
|
}
|
}
|
}
|
|
$.widget('ui.spinner', {
|
version: '1.12.1',
|
defaultElement: '<input>',
|
widgetEventPrefix: 'spin',
|
options: {
|
classes: {
|
'ui-spinner': 'ui-corner-all',
|
'ui-spinner-down': 'ui-corner-br',
|
'ui-spinner-up': 'ui-corner-tr'
|
},
|
culture: null,
|
icons: {
|
down: 'ui-icon-triangle-1-s',
|
up: 'ui-icon-triangle-1-n'
|
},
|
incremental: true,
|
max: null,
|
min: null,
|
numberFormat: null,
|
page: 10,
|
step: 1,
|
|
change: null,
|
spin: null,
|
start: null,
|
stop: null
|
},
|
|
_create: function () {
|
// handle string values that need to be parsed
|
this._setOption('max', this.options.max)
|
this._setOption('min', this.options.min)
|
this._setOption('step', this.options.step)
|
|
// Only format if there is a value, prevents the field from being marked
|
// as invalid in Firefox, see #9573.
|
if (this.value() !== '') {
|
// Format the value, but don't constrain.
|
this._value(this.element.val(), true)
|
}
|
|
this._draw()
|
this._on(this._events)
|
this._refresh()
|
|
// Turning off autocomplete prevents the browser from remembering the
|
// value when navigating through history, so we re-enable autocomplete
|
// if the page is unloaded before the widget is destroyed. #7790
|
this._on(this.window, {
|
beforeunload: function () {
|
this.element.removeAttr('autocomplete')
|
}
|
})
|
},
|
|
_getCreateOptions: function () {
|
var options = this._super()
|
var element = this.element
|
|
$.each(['min', 'max', 'step'], function (i, option) {
|
var value = element.attr(option)
|
if (value != null && value.length) {
|
options[option] = value
|
}
|
})
|
|
return options
|
},
|
|
_events: {
|
keydown: function (event) {
|
if (this._start(event) && this._keydown(event)) {
|
event.preventDefault()
|
}
|
},
|
keyup: '_stop',
|
focus: function () {
|
this.previous = this.element.val()
|
},
|
blur: function (event) {
|
if (this.cancelBlur) {
|
delete this.cancelBlur
|
return
|
}
|
|
this._stop()
|
this._refresh()
|
if (this.previous !== this.element.val()) {
|
this._trigger('change', event)
|
}
|
},
|
mousewheel: function (event, delta) {
|
if (!delta) {
|
return
|
}
|
if (!this.spinning && !this._start(event)) {
|
return false
|
}
|
|
this._spin((delta > 0 ? 1 : -1) * this.options.step, event)
|
clearTimeout(this.mousewheelTimer)
|
this.mousewheelTimer = this._delay(function () {
|
if (this.spinning) {
|
this._stop(event)
|
}
|
}, 100)
|
event.preventDefault()
|
},
|
'mousedown .ui-spinner-button': function (event) {
|
var previous
|
|
// We never want the buttons to have focus; whenever the user is
|
// interacting with the spinner, the focus should be on the input.
|
// If the input is focused then this.previous is properly set from
|
// when the input first received focus. If the input is not focused
|
// then we need to set this.previous based on the value before spinning.
|
previous =
|
this.element[0] === $.ui.safeActiveElement(this.document[0])
|
? this.previous
|
: this.element.val()
|
function checkFocus() {
|
var isActive = this.element[0] === $.ui.safeActiveElement(this.document[0])
|
if (!isActive) {
|
this.element.trigger('focus')
|
this.previous = previous
|
|
// support: IE
|
// IE sets focus asynchronously, so we need to check if focus
|
// moved off of the input because the user clicked on the button.
|
this._delay(function () {
|
this.previous = previous
|
})
|
}
|
}
|
|
// Ensure focus is on (or stays on) the text field
|
event.preventDefault()
|
checkFocus.call(this)
|
|
// Support: IE
|
// IE doesn't prevent moving focus even with event.preventDefault()
|
// so we set a flag to know when we should ignore the blur event
|
// and check (again) if focus moved off of the input.
|
this.cancelBlur = true
|
this._delay(function () {
|
delete this.cancelBlur
|
checkFocus.call(this)
|
})
|
|
if (this._start(event) === false) {
|
return
|
}
|
|
this._repeat(null, $(event.currentTarget).hasClass('ui-spinner-up') ? 1 : -1, event)
|
},
|
'mouseup .ui-spinner-button': '_stop',
|
'mouseenter .ui-spinner-button': function (event) {
|
// button will add ui-state-active if mouse was down while mouseleave and kept down
|
if (!$(event.currentTarget).hasClass('ui-state-active')) {
|
return
|
}
|
|
if (this._start(event) === false) {
|
return false
|
}
|
this._repeat(null, $(event.currentTarget).hasClass('ui-spinner-up') ? 1 : -1, event)
|
},
|
|
// TODO: do we really want to consider this a stop?
|
// shouldn't we just stop the repeater and wait until mouseup before
|
// we trigger the stop event?
|
'mouseleave .ui-spinner-button': '_stop'
|
},
|
|
// Support mobile enhanced option and make backcompat more sane
|
_enhance: function () {
|
this.uiSpinner = this.element
|
.attr('autocomplete', 'off')
|
.wrap('<span>')
|
.parent()
|
|
// Add buttons
|
.append('<a></a><a></a>')
|
},
|
|
_draw: function () {
|
this._enhance()
|
|
this._addClass(this.uiSpinner, 'ui-spinner', 'ui-widget ui-widget-content')
|
this._addClass('ui-spinner-input')
|
|
this.element.attr('role', 'spinbutton')
|
|
// Button bindings
|
this.buttons = this.uiSpinner
|
.children('a')
|
.attr('tabIndex', -1)
|
.attr('aria-hidden', true)
|
.button({
|
classes: {
|
'ui-button': ''
|
}
|
})
|
|
// TODO: Right now button does not support classes this is already updated in button PR
|
this._removeClass(this.buttons, 'ui-corner-all')
|
|
this._addClass(this.buttons.first(), 'ui-spinner-button ui-spinner-up')
|
this._addClass(this.buttons.last(), 'ui-spinner-button ui-spinner-down')
|
this.buttons.first().button({
|
icon: this.options.icons.up,
|
showLabel: false
|
})
|
this.buttons.last().button({
|
icon: this.options.icons.down,
|
showLabel: false
|
})
|
|
// IE 6 doesn't understand height: 50% for the buttons
|
// unless the wrapper has an explicit height
|
if (
|
this.buttons.height() > Math.ceil(this.uiSpinner.height() * 0.5) &&
|
this.uiSpinner.height() > 0
|
) {
|
this.uiSpinner.height(this.uiSpinner.height())
|
}
|
},
|
|
_keydown: function (event) {
|
var options = this.options,
|
keyCode = $.ui.keyCode
|
|
switch (event.keyCode) {
|
case keyCode.UP:
|
this._repeat(null, 1, event)
|
return true
|
case keyCode.DOWN:
|
this._repeat(null, -1, event)
|
return true
|
case keyCode.PAGE_UP:
|
this._repeat(null, options.page, event)
|
return true
|
case keyCode.PAGE_DOWN:
|
this._repeat(null, -options.page, event)
|
return true
|
}
|
|
return false
|
},
|
|
_start: function (event) {
|
if (!this.spinning && this._trigger('start', event) === false) {
|
return false
|
}
|
|
if (!this.counter) {
|
this.counter = 1
|
}
|
this.spinning = true
|
return true
|
},
|
|
_repeat: function (i, steps, event) {
|
i = i || 500
|
|
clearTimeout(this.timer)
|
this.timer = this._delay(function () {
|
this._repeat(40, steps, event)
|
}, i)
|
|
this._spin(steps * this.options.step, event)
|
},
|
|
_spin: function (step, event) {
|
var value = this.value() || 0
|
|
if (!this.counter) {
|
this.counter = 1
|
}
|
|
value = this._adjustValue(value + step * this._increment(this.counter))
|
|
if (!this.spinning || this._trigger('spin', event, { value: value }) !== false) {
|
this._value(value)
|
this.counter++
|
}
|
},
|
|
_increment: function (i) {
|
var incremental = this.options.incremental
|
|
if (incremental) {
|
return $.isFunction(incremental)
|
? incremental(i)
|
: Math.floor((i * i * i) / 50000 - (i * i) / 500 + (17 * i) / 200 + 1)
|
}
|
|
return 1
|
},
|
|
_precision: function () {
|
var precision = this._precisionOf(this.options.step)
|
if (this.options.min !== null) {
|
precision = Math.max(precision, this._precisionOf(this.options.min))
|
}
|
return precision
|
},
|
|
_precisionOf: function (num) {
|
var str = num.toString(),
|
decimal = str.indexOf('.')
|
return decimal === -1 ? 0 : str.length - decimal - 1
|
},
|
|
_adjustValue: function (value) {
|
var base,
|
aboveMin,
|
options = this.options
|
|
// Make sure we're at a valid step
|
// - find out where we are relative to the base (min or 0)
|
base = options.min !== null ? options.min : 0
|
aboveMin = value - base
|
|
// - round to the nearest step
|
aboveMin = Math.round(aboveMin / options.step) * options.step
|
|
// - rounding is based on 0, so adjust back to our base
|
value = base + aboveMin
|
|
// Fix precision from bad JS floating point math
|
value = parseFloat(value.toFixed(this._precision()))
|
|
// Clamp the value
|
if (options.max !== null && value > options.max) {
|
return options.max
|
}
|
if (options.min !== null && value < options.min) {
|
return options.min
|
}
|
|
return value
|
},
|
|
_stop: function (event) {
|
if (!this.spinning) {
|
return
|
}
|
|
clearTimeout(this.timer)
|
clearTimeout(this.mousewheelTimer)
|
this.counter = 0
|
this.spinning = false
|
this._trigger('stop', event)
|
},
|
|
_setOption: function (key, value) {
|
var prevValue, first, last
|
|
if (key === 'culture' || key === 'numberFormat') {
|
prevValue = this._parse(this.element.val())
|
this.options[key] = value
|
this.element.val(this._format(prevValue))
|
return
|
}
|
|
if (key === 'max' || key === 'min' || key === 'step') {
|
if (typeof value === 'string') {
|
value = this._parse(value)
|
}
|
}
|
if (key === 'icons') {
|
first = this.buttons.first().find('.ui-icon')
|
this._removeClass(first, null, this.options.icons.up)
|
this._addClass(first, null, value.up)
|
last = this.buttons.last().find('.ui-icon')
|
this._removeClass(last, null, this.options.icons.down)
|
this._addClass(last, null, value.down)
|
}
|
|
this._super(key, value)
|
},
|
|
_setOptionDisabled: function (value) {
|
this._super(value)
|
|
this._toggleClass(this.uiSpinner, null, 'ui-state-disabled', !!value)
|
this.element.prop('disabled', !!value)
|
this.buttons.button(value ? 'disable' : 'enable')
|
},
|
|
_setOptions: spinnerModifer(function (options) {
|
this._super(options)
|
}),
|
|
_parse: function (val) {
|
if (typeof val === 'string' && val !== '') {
|
val =
|
window.Globalize && this.options.numberFormat
|
? Globalize.parseFloat(val, 10, this.options.culture)
|
: +val
|
}
|
return val === '' || isNaN(val) ? null : val
|
},
|
|
_format: function (value) {
|
if (value === '') {
|
return ''
|
}
|
return window.Globalize && this.options.numberFormat
|
? Globalize.format(value, this.options.numberFormat, this.options.culture)
|
: value
|
},
|
|
_refresh: function () {
|
this.element.attr({
|
'aria-valuemin': this.options.min,
|
'aria-valuemax': this.options.max,
|
|
// TODO: what should we do with values that can't be parsed?
|
'aria-valuenow': this._parse(this.element.val())
|
})
|
},
|
|
isValid: function () {
|
var value = this.value()
|
|
// Null is invalid
|
if (value === null) {
|
return false
|
}
|
|
// If value gets adjusted, it's invalid
|
return value === this._adjustValue(value)
|
},
|
|
// Update the value without triggering change
|
_value: function (value, allowAny) {
|
var parsed
|
if (value !== '') {
|
parsed = this._parse(value)
|
if (parsed !== null) {
|
if (!allowAny) {
|
parsed = this._adjustValue(parsed)
|
}
|
value = this._format(parsed)
|
}
|
}
|
this.element.val(value)
|
this._refresh()
|
},
|
|
_destroy: function () {
|
this.element
|
.prop('disabled', false)
|
.removeAttr('autocomplete role aria-valuemin aria-valuemax aria-valuenow')
|
|
this.uiSpinner.replaceWith(this.element)
|
},
|
|
stepUp: spinnerModifer(function (steps) {
|
this._stepUp(steps)
|
}),
|
_stepUp: function (steps) {
|
if (this._start()) {
|
this._spin((steps || 1) * this.options.step)
|
this._stop()
|
}
|
},
|
|
stepDown: spinnerModifer(function (steps) {
|
this._stepDown(steps)
|
}),
|
_stepDown: function (steps) {
|
if (this._start()) {
|
this._spin((steps || 1) * -this.options.step)
|
this._stop()
|
}
|
},
|
|
pageUp: spinnerModifer(function (pages) {
|
this._stepUp((pages || 1) * this.options.page)
|
}),
|
|
pageDown: spinnerModifer(function (pages) {
|
this._stepDown((pages || 1) * this.options.page)
|
}),
|
|
value: function (newVal) {
|
if (!arguments.length) {
|
return this._parse(this.element.val())
|
}
|
spinnerModifer(this._value).call(this, newVal)
|
},
|
|
widget: function () {
|
return this.uiSpinner
|
}
|
})
|
|
// DEPRECATED
|
// TODO: switch return back to widget declaration at top of file when this is removed
|
if ($.uiBackCompat !== false) {
|
// Backcompat for spinner html extension points
|
$.widget('ui.spinner', $.ui.spinner, {
|
_enhance: function () {
|
this.uiSpinner = this.element
|
.attr('autocomplete', 'off')
|
.wrap(this._uiSpinnerHtml())
|
.parent()
|
|
// Add buttons
|
.append(this._buttonHtml())
|
},
|
_uiSpinnerHtml: function () {
|
return '<span>'
|
},
|
|
_buttonHtml: function () {
|
return '<a></a><a></a>'
|
}
|
})
|
}
|
|
var widgetsSpinner = $.ui.spinner
|
|
/*!
|
* jQuery UI Tabs 1.12.1
|
* http://jqueryui.com
|
*
|
* Copyright jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*/
|
|
//>>label: Tabs
|
//>>group: Widgets
|
//>>description: Transforms a set of container elements into a tab structure.
|
//>>docs: http://api.jqueryui.com/tabs/
|
//>>demos: http://jqueryui.com/tabs/
|
//>>css.structure: ../../themes/base/core.css
|
//>>css.structure: ../../themes/base/tabs.css
|
//>>css.theme: ../../themes/base/theme.css
|
|
$.widget('ui.tabs', {
|
version: '1.12.1',
|
delay: 300,
|
options: {
|
active: null,
|
classes: {
|
'ui-tabs': 'ui-corner-all',
|
'ui-tabs-nav': 'ui-corner-all',
|
'ui-tabs-panel': 'ui-corner-bottom',
|
'ui-tabs-tab': 'ui-corner-top'
|
},
|
collapsible: false,
|
event: 'click',
|
heightStyle: 'content',
|
hide: null,
|
show: null,
|
|
// Callbacks
|
activate: null,
|
beforeActivate: null,
|
beforeLoad: null,
|
load: null
|
},
|
|
_isLocal: (function () {
|
var rhash = /#.*$/
|
|
return function (anchor) {
|
var anchorUrl, locationUrl
|
|
anchorUrl = anchor.href.replace(rhash, '')
|
locationUrl = location.href.replace(rhash, '')
|
|
// Decoding may throw an error if the URL isn't UTF-8 (#9518)
|
try {
|
anchorUrl = decodeURIComponent(anchorUrl)
|
} catch (error) {}
|
try {
|
locationUrl = decodeURIComponent(locationUrl)
|
} catch (error) {}
|
|
return anchor.hash.length > 1 && anchorUrl === locationUrl
|
}
|
})(),
|
|
_create: function () {
|
var that = this,
|
options = this.options
|
|
this.running = false
|
|
this._addClass('ui-tabs', 'ui-widget ui-widget-content')
|
this._toggleClass('ui-tabs-collapsible', null, options.collapsible)
|
|
this._processTabs()
|
options.active = this._initialActive()
|
|
// Take disabling tabs via class attribute from HTML
|
// into account and update option properly.
|
if ($.isArray(options.disabled)) {
|
options.disabled = $.unique(
|
options.disabled.concat(
|
$.map(this.tabs.filter('.ui-state-disabled'), function (li) {
|
return that.tabs.index(li)
|
})
|
)
|
).sort()
|
}
|
|
// Check for length avoids error when initializing empty list
|
if (this.options.active !== false && this.anchors.length) {
|
this.active = this._findActive(options.active)
|
} else {
|
this.active = $()
|
}
|
|
this._refresh()
|
|
if (this.active.length) {
|
this.load(options.active)
|
}
|
},
|
|
_initialActive: function () {
|
var active = this.options.active,
|
collapsible = this.options.collapsible,
|
locationHash = location.hash.substring(1)
|
|
if (active === null) {
|
// check the fragment identifier in the URL
|
if (locationHash) {
|
this.tabs.each(function (i, tab) {
|
if ($(tab).attr('aria-controls') === locationHash) {
|
active = i
|
return false
|
}
|
})
|
}
|
|
// Check for a tab marked active via a class
|
if (active === null) {
|
active = this.tabs.index(this.tabs.filter('.ui-tabs-active'))
|
}
|
|
// No active tab, set to false
|
if (active === null || active === -1) {
|
active = this.tabs.length ? 0 : false
|
}
|
}
|
|
// Handle numbers: negative, out of range
|
if (active !== false) {
|
active = this.tabs.index(this.tabs.eq(active))
|
if (active === -1) {
|
active = collapsible ? false : 0
|
}
|
}
|
|
// Don't allow collapsible: false and active: false
|
if (!collapsible && active === false && this.anchors.length) {
|
active = 0
|
}
|
|
return active
|
},
|
|
_getCreateEventData: function () {
|
return {
|
tab: this.active,
|
panel: !this.active.length ? $() : this._getPanelForTab(this.active)
|
}
|
},
|
|
_tabKeydown: function (event) {
|
var focusedTab = $($.ui.safeActiveElement(this.document[0])).closest('li'),
|
selectedIndex = this.tabs.index(focusedTab),
|
goingForward = true
|
|
if (this._handlePageNav(event)) {
|
return
|
}
|
|
switch (event.keyCode) {
|
case $.ui.keyCode.RIGHT:
|
case $.ui.keyCode.DOWN:
|
selectedIndex++
|
break
|
case $.ui.keyCode.UP:
|
case $.ui.keyCode.LEFT:
|
goingForward = false
|
selectedIndex--
|
break
|
case $.ui.keyCode.END:
|
selectedIndex = this.anchors.length - 1
|
break
|
case $.ui.keyCode.HOME:
|
selectedIndex = 0
|
break
|
case $.ui.keyCode.SPACE:
|
// Activate only, no collapsing
|
event.preventDefault()
|
clearTimeout(this.activating)
|
this._activate(selectedIndex)
|
return
|
case $.ui.keyCode.ENTER:
|
// Toggle (cancel delayed activation, allow collapsing)
|
event.preventDefault()
|
clearTimeout(this.activating)
|
|
// Determine if we should collapse or activate
|
this._activate(selectedIndex === this.options.active ? false : selectedIndex)
|
return
|
default:
|
return
|
}
|
|
// Focus the appropriate tab, based on which key was pressed
|
event.preventDefault()
|
clearTimeout(this.activating)
|
selectedIndex = this._focusNextTab(selectedIndex, goingForward)
|
|
// Navigating with control/command key will prevent automatic activation
|
if (!event.ctrlKey && !event.metaKey) {
|
// Update aria-selected immediately so that AT think the tab is already selected.
|
// Otherwise AT may confuse the user by stating that they need to activate the tab,
|
// but the tab will already be activated by the time the announcement finishes.
|
focusedTab.attr('aria-selected', 'false')
|
this.tabs.eq(selectedIndex).attr('aria-selected', 'true')
|
|
this.activating = this._delay(function () {
|
this.option('active', selectedIndex)
|
}, this.delay)
|
}
|
},
|
|
_panelKeydown: function (event) {
|
if (this._handlePageNav(event)) {
|
return
|
}
|
|
// Ctrl+up moves focus to the current tab
|
if (event.ctrlKey && event.keyCode === $.ui.keyCode.UP) {
|
event.preventDefault()
|
this.active.trigger('focus')
|
}
|
},
|
|
// Alt+page up/down moves focus to the previous/next tab (and activates)
|
_handlePageNav: function (event) {
|
if (event.altKey && event.keyCode === $.ui.keyCode.PAGE_UP) {
|
this._activate(this._focusNextTab(this.options.active - 1, false))
|
return true
|
}
|
if (event.altKey && event.keyCode === $.ui.keyCode.PAGE_DOWN) {
|
this._activate(this._focusNextTab(this.options.active + 1, true))
|
return true
|
}
|
},
|
|
_findNextTab: function (index, goingForward) {
|
var lastTabIndex = this.tabs.length - 1
|
|
function constrain() {
|
if (index > lastTabIndex) {
|
index = 0
|
}
|
if (index < 0) {
|
index = lastTabIndex
|
}
|
return index
|
}
|
|
while ($.inArray(constrain(), this.options.disabled) !== -1) {
|
index = goingForward ? index + 1 : index - 1
|
}
|
|
return index
|
},
|
|
_focusNextTab: function (index, goingForward) {
|
index = this._findNextTab(index, goingForward)
|
this.tabs.eq(index).trigger('focus')
|
return index
|
},
|
|
_setOption: function (key, value) {
|
if (key === 'active') {
|
// _activate() will handle invalid values and update this.options
|
this._activate(value)
|
return
|
}
|
|
this._super(key, value)
|
|
if (key === 'collapsible') {
|
this._toggleClass('ui-tabs-collapsible', null, value)
|
|
// Setting collapsible: false while collapsed; open first panel
|
if (!value && this.options.active === false) {
|
this._activate(0)
|
}
|
}
|
|
if (key === 'event') {
|
this._setupEvents(value)
|
}
|
|
if (key === 'heightStyle') {
|
this._setupHeightStyle(value)
|
}
|
},
|
|
_sanitizeSelector: function (hash) {
|
return hash ? hash.replace(/[!"$%&'()*+,.\/:;<=>?@\[\]\^`{|}~]/g, '\\$&') : ''
|
},
|
|
refresh: function () {
|
var options = this.options,
|
lis = this.tablist.children(':has(a[href])')
|
|
// Get disabled tabs from class attribute from HTML
|
// this will get converted to a boolean if needed in _refresh()
|
options.disabled = $.map(lis.filter('.ui-state-disabled'), function (tab) {
|
return lis.index(tab)
|
})
|
|
this._processTabs()
|
|
// Was collapsed or no tabs
|
if (options.active === false || !this.anchors.length) {
|
options.active = false
|
this.active = $()
|
|
// was active, but active tab is gone
|
} else if (this.active.length && !$.contains(this.tablist[0], this.active[0])) {
|
// all remaining tabs are disabled
|
if (this.tabs.length === options.disabled.length) {
|
options.active = false
|
this.active = $()
|
|
// activate previous tab
|
} else {
|
this._activate(this._findNextTab(Math.max(0, options.active - 1), false))
|
}
|
|
// was active, active tab still exists
|
} else {
|
// make sure active index is correct
|
options.active = this.tabs.index(this.active)
|
}
|
|
this._refresh()
|
},
|
|
_refresh: function () {
|
this._setOptionDisabled(this.options.disabled)
|
this._setupEvents(this.options.event)
|
this._setupHeightStyle(this.options.heightStyle)
|
|
this.tabs.not(this.active).attr({
|
'aria-selected': 'false',
|
'aria-expanded': 'false',
|
tabIndex: -1
|
})
|
this.panels.not(this._getPanelForTab(this.active)).hide().attr({
|
'aria-hidden': 'true'
|
})
|
|
// Make sure one tab is in the tab order
|
if (!this.active.length) {
|
this.tabs.eq(0).attr('tabIndex', 0)
|
} else {
|
this.active.attr({
|
'aria-selected': 'true',
|
'aria-expanded': 'true',
|
tabIndex: 0
|
})
|
this._addClass(this.active, 'ui-tabs-active', 'ui-state-active')
|
this._getPanelForTab(this.active).show().attr({
|
'aria-hidden': 'false'
|
})
|
}
|
},
|
|
_processTabs: function () {
|
var that = this,
|
prevTabs = this.tabs,
|
prevAnchors = this.anchors,
|
prevPanels = this.panels
|
|
this.tablist = this._getList().attr('role', 'tablist')
|
this._addClass(
|
this.tablist,
|
'ui-tabs-nav',
|
'ui-helper-reset ui-helper-clearfix ui-widget-header'
|
)
|
|
// Prevent users from focusing disabled tabs via click
|
this.tablist
|
.on('mousedown' + this.eventNamespace, '> li', function (event) {
|
if ($(this).is('.ui-state-disabled')) {
|
event.preventDefault()
|
}
|
})
|
|
// Support: IE <9
|
// Preventing the default action in mousedown doesn't prevent IE
|
// from focusing the element, so if the anchor gets focused, blur.
|
// We don't have to worry about focusing the previously focused
|
// element since clicking on a non-focusable element should focus
|
// the body anyway.
|
.on('focus' + this.eventNamespace, '.ui-tabs-anchor', function () {
|
if ($(this).closest('li').is('.ui-state-disabled')) {
|
this.blur()
|
}
|
})
|
|
this.tabs = this.tablist.find('> li:has(a[href])').attr({
|
role: 'tab',
|
tabIndex: -1
|
})
|
this._addClass(this.tabs, 'ui-tabs-tab', 'ui-state-default')
|
|
this.anchors = this.tabs
|
.map(function () {
|
return $('a', this)[0]
|
})
|
.attr({
|
role: 'presentation',
|
tabIndex: -1
|
})
|
this._addClass(this.anchors, 'ui-tabs-anchor')
|
|
this.panels = $()
|
|
this.anchors.each(function (i, anchor) {
|
var selector,
|
panel,
|
panelId,
|
anchorId = $(anchor).uniqueId().attr('id'),
|
tab = $(anchor).closest('li'),
|
originalAriaControls = tab.attr('aria-controls')
|
|
// Inline tab
|
if (that._isLocal(anchor)) {
|
selector = anchor.hash
|
panelId = selector.substring(1)
|
panel = that.element.find(that._sanitizeSelector(selector))
|
|
// remote tab
|
} else {
|
// If the tab doesn't already have aria-controls,
|
// generate an id by using a throw-away element
|
panelId = tab.attr('aria-controls') || $({}).uniqueId()[0].id
|
selector = '#' + panelId
|
panel = that.element.find(selector)
|
if (!panel.length) {
|
panel = that._createPanel(panelId)
|
panel.insertAfter(that.panels[i - 1] || that.tablist)
|
}
|
panel.attr('aria-live', 'polite')
|
}
|
|
if (panel.length) {
|
that.panels = that.panels.add(panel)
|
}
|
if (originalAriaControls) {
|
tab.data('ui-tabs-aria-controls', originalAriaControls)
|
}
|
tab.attr({
|
'aria-controls': panelId,
|
'aria-labelledby': anchorId
|
})
|
panel.attr('aria-labelledby', anchorId)
|
})
|
|
this.panels.attr('role', 'tabpanel')
|
this._addClass(this.panels, 'ui-tabs-panel', 'ui-widget-content')
|
|
// Avoid memory leaks (#10056)
|
if (prevTabs) {
|
this._off(prevTabs.not(this.tabs))
|
this._off(prevAnchors.not(this.anchors))
|
this._off(prevPanels.not(this.panels))
|
}
|
},
|
|
// Allow overriding how to find the list for rare usage scenarios (#7715)
|
_getList: function () {
|
return this.tablist || this.element.find('ol, ul').eq(0)
|
},
|
|
_createPanel: function (id) {
|
return $('<div>').attr('id', id).data('ui-tabs-destroy', true)
|
},
|
|
_setOptionDisabled: function (disabled) {
|
var currentItem, li, i
|
|
if ($.isArray(disabled)) {
|
if (!disabled.length) {
|
disabled = false
|
} else if (disabled.length === this.anchors.length) {
|
disabled = true
|
}
|
}
|
|
// Disable tabs
|
for (i = 0; (li = this.tabs[i]); i++) {
|
currentItem = $(li)
|
if (disabled === true || $.inArray(i, disabled) !== -1) {
|
currentItem.attr('aria-disabled', 'true')
|
this._addClass(currentItem, null, 'ui-state-disabled')
|
} else {
|
currentItem.removeAttr('aria-disabled')
|
this._removeClass(currentItem, null, 'ui-state-disabled')
|
}
|
}
|
|
this.options.disabled = disabled
|
|
this._toggleClass(this.widget(), this.widgetFullName + '-disabled', null, disabled === true)
|
},
|
|
_setupEvents: function (event) {
|
var events = {}
|
if (event) {
|
$.each(event.split(' '), function (index, eventName) {
|
events[eventName] = '_eventHandler'
|
})
|
}
|
|
this._off(this.anchors.add(this.tabs).add(this.panels))
|
|
// Always prevent the default action, even when disabled
|
this._on(true, this.anchors, {
|
click: function (event) {
|
event.preventDefault()
|
}
|
})
|
this._on(this.anchors, events)
|
this._on(this.tabs, { keydown: '_tabKeydown' })
|
this._on(this.panels, { keydown: '_panelKeydown' })
|
|
this._focusable(this.tabs)
|
this._hoverable(this.tabs)
|
},
|
|
_setupHeightStyle: function (heightStyle) {
|
var maxHeight,
|
parent = this.element.parent()
|
|
if (heightStyle === 'fill') {
|
maxHeight = parent.height()
|
maxHeight -= this.element.outerHeight() - this.element.height()
|
|
this.element.siblings(':visible').each(function () {
|
var elem = $(this),
|
position = elem.css('position')
|
|
if (position === 'absolute' || position === 'fixed') {
|
return
|
}
|
maxHeight -= elem.outerHeight(true)
|
})
|
|
this.element
|
.children()
|
.not(this.panels)
|
.each(function () {
|
maxHeight -= $(this).outerHeight(true)
|
})
|
|
this.panels
|
.each(function () {
|
$(this).height(Math.max(0, maxHeight - $(this).innerHeight() + $(this).height()))
|
})
|
.css('overflow', 'auto')
|
} else if (heightStyle === 'auto') {
|
maxHeight = 0
|
this.panels
|
.each(function () {
|
maxHeight = Math.max(maxHeight, $(this).height('').height())
|
})
|
.height(maxHeight)
|
}
|
},
|
|
_eventHandler: function (event) {
|
var options = this.options,
|
active = this.active,
|
anchor = $(event.currentTarget),
|
tab = anchor.closest('li'),
|
clickedIsActive = tab[0] === active[0],
|
collapsing = clickedIsActive && options.collapsible,
|
toShow = collapsing ? $() : this._getPanelForTab(tab),
|
toHide = !active.length ? $() : this._getPanelForTab(active),
|
eventData = {
|
oldTab: active,
|
oldPanel: toHide,
|
newTab: collapsing ? $() : tab,
|
newPanel: toShow
|
}
|
|
event.preventDefault()
|
|
if (
|
tab.hasClass('ui-state-disabled') ||
|
// tab is already loading
|
tab.hasClass('ui-tabs-loading') ||
|
// can't switch durning an animation
|
this.running ||
|
// click on active header, but not collapsible
|
(clickedIsActive && !options.collapsible) ||
|
// allow canceling activation
|
this._trigger('beforeActivate', event, eventData) === false
|
) {
|
return
|
}
|
|
options.active = collapsing ? false : this.tabs.index(tab)
|
|
this.active = clickedIsActive ? $() : tab
|
if (this.xhr) {
|
this.xhr.abort()
|
}
|
|
if (!toHide.length && !toShow.length) {
|
$.error('jQuery UI Tabs: Mismatching fragment identifier.')
|
}
|
|
if (toShow.length) {
|
this.load(this.tabs.index(tab), event)
|
}
|
this._toggle(event, eventData)
|
},
|
|
// Handles show/hide for selecting tabs
|
_toggle: function (event, eventData) {
|
var that = this,
|
toShow = eventData.newPanel,
|
toHide = eventData.oldPanel
|
|
this.running = true
|
|
function complete() {
|
that.running = false
|
that._trigger('activate', event, eventData)
|
}
|
|
function show() {
|
that._addClass(eventData.newTab.closest('li'), 'ui-tabs-active', 'ui-state-active')
|
|
if (toShow.length && that.options.show) {
|
that._show(toShow, that.options.show, complete)
|
} else {
|
toShow.show()
|
complete()
|
}
|
}
|
|
// Start out by hiding, then showing, then completing
|
if (toHide.length && this.options.hide) {
|
this._hide(toHide, this.options.hide, function () {
|
that._removeClass(eventData.oldTab.closest('li'), 'ui-tabs-active', 'ui-state-active')
|
show()
|
})
|
} else {
|
this._removeClass(eventData.oldTab.closest('li'), 'ui-tabs-active', 'ui-state-active')
|
toHide.hide()
|
show()
|
}
|
|
toHide.attr('aria-hidden', 'true')
|
eventData.oldTab.attr({
|
'aria-selected': 'false',
|
'aria-expanded': 'false'
|
})
|
|
// If we're switching tabs, remove the old tab from the tab order.
|
// If we're opening from collapsed state, remove the previous tab from the tab order.
|
// If we're collapsing, then keep the collapsing tab in the tab order.
|
if (toShow.length && toHide.length) {
|
eventData.oldTab.attr('tabIndex', -1)
|
} else if (toShow.length) {
|
this.tabs
|
.filter(function () {
|
return $(this).attr('tabIndex') === 0
|
})
|
.attr('tabIndex', -1)
|
}
|
|
toShow.attr('aria-hidden', 'false')
|
eventData.newTab.attr({
|
'aria-selected': 'true',
|
'aria-expanded': 'true',
|
tabIndex: 0
|
})
|
},
|
|
_activate: function (index) {
|
var anchor,
|
active = this._findActive(index)
|
|
// Trying to activate the already active panel
|
if (active[0] === this.active[0]) {
|
return
|
}
|
|
// Trying to collapse, simulate a click on the current active header
|
if (!active.length) {
|
active = this.active
|
}
|
|
anchor = active.find('.ui-tabs-anchor')[0]
|
this._eventHandler({
|
target: anchor,
|
currentTarget: anchor,
|
preventDefault: $.noop
|
})
|
},
|
|
_findActive: function (index) {
|
return index === false ? $() : this.tabs.eq(index)
|
},
|
|
_getIndex: function (index) {
|
// meta-function to give users option to provide a href string instead of a numerical index.
|
if (typeof index === 'string') {
|
index = this.anchors.index(
|
this.anchors.filter("[href$='" + $.ui.escapeSelector(index) + "']")
|
)
|
}
|
|
return index
|
},
|
|
_destroy: function () {
|
if (this.xhr) {
|
this.xhr.abort()
|
}
|
|
this.tablist.removeAttr('role').off(this.eventNamespace)
|
|
this.anchors.removeAttr('role tabIndex').removeUniqueId()
|
|
this.tabs.add(this.panels).each(function () {
|
if ($.data(this, 'ui-tabs-destroy')) {
|
$(this).remove()
|
} else {
|
$(this).removeAttr(
|
'role tabIndex ' +
|
'aria-live aria-busy aria-selected aria-labelledby aria-hidden aria-expanded'
|
)
|
}
|
})
|
|
this.tabs.each(function () {
|
var li = $(this),
|
prev = li.data('ui-tabs-aria-controls')
|
if (prev) {
|
li.attr('aria-controls', prev).removeData('ui-tabs-aria-controls')
|
} else {
|
li.removeAttr('aria-controls')
|
}
|
})
|
|
this.panels.show()
|
|
if (this.options.heightStyle !== 'content') {
|
this.panels.css('height', '')
|
}
|
},
|
|
enable: function (index) {
|
var disabled = this.options.disabled
|
if (disabled === false) {
|
return
|
}
|
|
if (index === undefined) {
|
disabled = false
|
} else {
|
index = this._getIndex(index)
|
if ($.isArray(disabled)) {
|
disabled = $.map(disabled, function (num) {
|
return num !== index ? num : null
|
})
|
} else {
|
disabled = $.map(this.tabs, function (li, num) {
|
return num !== index ? num : null
|
})
|
}
|
}
|
this._setOptionDisabled(disabled)
|
},
|
|
disable: function (index) {
|
var disabled = this.options.disabled
|
if (disabled === true) {
|
return
|
}
|
|
if (index === undefined) {
|
disabled = true
|
} else {
|
index = this._getIndex(index)
|
if ($.inArray(index, disabled) !== -1) {
|
return
|
}
|
if ($.isArray(disabled)) {
|
disabled = $.merge([index], disabled).sort()
|
} else {
|
disabled = [index]
|
}
|
}
|
this._setOptionDisabled(disabled)
|
},
|
|
load: function (index, event) {
|
index = this._getIndex(index)
|
var that = this,
|
tab = this.tabs.eq(index),
|
anchor = tab.find('.ui-tabs-anchor'),
|
panel = this._getPanelForTab(tab),
|
eventData = {
|
tab: tab,
|
panel: panel
|
},
|
complete = function (jqXHR, status) {
|
if (status === 'abort') {
|
that.panels.stop(false, true)
|
}
|
|
that._removeClass(tab, 'ui-tabs-loading')
|
panel.removeAttr('aria-busy')
|
|
if (jqXHR === that.xhr) {
|
delete that.xhr
|
}
|
}
|
|
// Not remote
|
if (this._isLocal(anchor[0])) {
|
return
|
}
|
|
this.xhr = $.ajax(this._ajaxSettings(anchor, event, eventData))
|
|
// Support: jQuery <1.8
|
// jQuery <1.8 returns false if the request is canceled in beforeSend,
|
// but as of 1.8, $.ajax() always returns a jqXHR object.
|
if (this.xhr && this.xhr.statusText !== 'canceled') {
|
this._addClass(tab, 'ui-tabs-loading')
|
panel.attr('aria-busy', 'true')
|
|
this.xhr
|
.done(function (response, status, jqXHR) {
|
// support: jQuery <1.8
|
// http://bugs.jquery.com/ticket/11778
|
setTimeout(function () {
|
panel.html(response)
|
that._trigger('load', event, eventData)
|
|
complete(jqXHR, status)
|
}, 1)
|
})
|
.fail(function (jqXHR, status) {
|
// support: jQuery <1.8
|
// http://bugs.jquery.com/ticket/11778
|
setTimeout(function () {
|
complete(jqXHR, status)
|
}, 1)
|
})
|
}
|
},
|
|
_ajaxSettings: function (anchor, event, eventData) {
|
var that = this
|
return {
|
// Support: IE <11 only
|
// Strip any hash that exists to prevent errors with the Ajax request
|
url: anchor.attr('href').replace(/#.*$/, ''),
|
beforeSend: function (jqXHR, settings) {
|
return that._trigger(
|
'beforeLoad',
|
event,
|
$.extend({ jqXHR: jqXHR, ajaxSettings: settings }, eventData)
|
)
|
}
|
}
|
},
|
|
_getPanelForTab: function (tab) {
|
var id = $(tab).attr('aria-controls')
|
return this.element.find(this._sanitizeSelector('#' + id))
|
}
|
})
|
|
// DEPRECATED
|
// TODO: Switch return back to widget declaration at top of file when this is removed
|
if ($.uiBackCompat !== false) {
|
// Backcompat for ui-tab class (now ui-tabs-tab)
|
$.widget('ui.tabs', $.ui.tabs, {
|
_processTabs: function () {
|
this._superApply(arguments)
|
this._addClass(this.tabs, 'ui-tab')
|
}
|
})
|
}
|
|
var widgetsTabs = $.ui.tabs
|
|
/*!
|
* jQuery UI Tooltip 1.12.1
|
* http://jqueryui.com
|
*
|
* Copyright jQuery Foundation and other contributors
|
* Released under the MIT license.
|
* http://jquery.org/license
|
*/
|
|
//>>label: Tooltip
|
//>>group: Widgets
|
//>>description: Shows additional information for any element on hover or focus.
|
//>>docs: http://api.jqueryui.com/tooltip/
|
//>>demos: http://jqueryui.com/tooltip/
|
//>>css.structure: ../../themes/base/core.css
|
//>>css.structure: ../../themes/base/tooltip.css
|
//>>css.theme: ../../themes/base/theme.css
|
|
$.widget('ui.tooltip', {
|
version: '1.12.1',
|
options: {
|
classes: {
|
'ui-tooltip': 'ui-corner-all ui-widget-shadow'
|
},
|
content: function () {
|
// support: IE<9, Opera in jQuery <1.7
|
// .text() can't accept undefined, so coerce to a string
|
var title = $(this).attr('title') || ''
|
|
// Escape title, since we're going from an attribute to raw HTML
|
return $('<a>').text(title).html()
|
},
|
hide: true,
|
|
// Disabled elements have inconsistent behavior across browsers (#8661)
|
items: '[title]:not([disabled])',
|
position: {
|
my: 'left top+15',
|
at: 'left bottom',
|
collision: 'flipfit flip'
|
},
|
show: true,
|
track: false,
|
|
// Callbacks
|
close: null,
|
open: null
|
},
|
|
_addDescribedBy: function (elem, id) {
|
var describedby = (elem.attr('aria-describedby') || '').split(/\s+/)
|
describedby.push(id)
|
elem.data('ui-tooltip-id', id).attr('aria-describedby', $.trim(describedby.join(' ')))
|
},
|
|
_removeDescribedBy: function (elem) {
|
var id = elem.data('ui-tooltip-id'),
|
describedby = (elem.attr('aria-describedby') || '').split(/\s+/),
|
index = $.inArray(id, describedby)
|
|
if (index !== -1) {
|
describedby.splice(index, 1)
|
}
|
|
elem.removeData('ui-tooltip-id')
|
describedby = $.trim(describedby.join(' '))
|
if (describedby) {
|
elem.attr('aria-describedby', describedby)
|
} else {
|
elem.removeAttr('aria-describedby')
|
}
|
},
|
|
_create: function () {
|
this._on({
|
mouseover: 'open',
|
focusin: 'open'
|
})
|
|
// IDs of generated tooltips, needed for destroy
|
this.tooltips = {}
|
|
// IDs of parent tooltips where we removed the title attribute
|
this.parents = {}
|
|
// Append the aria-live region so tooltips announce correctly
|
this.liveRegion = $('<div>')
|
.attr({
|
role: 'log',
|
'aria-live': 'assertive',
|
'aria-relevant': 'additions'
|
})
|
.appendTo(this.document[0].body)
|
this._addClass(this.liveRegion, null, 'ui-helper-hidden-accessible')
|
|
this.disabledTitles = $([])
|
},
|
|
_setOption: function (key, value) {
|
var that = this
|
|
this._super(key, value)
|
|
if (key === 'content') {
|
$.each(this.tooltips, function (id, tooltipData) {
|
that._updateContent(tooltipData.element)
|
})
|
}
|
},
|
|
_setOptionDisabled: function (value) {
|
this[value ? '_disable' : '_enable']()
|
},
|
|
_disable: function () {
|
var that = this
|
|
// Close open tooltips
|
$.each(this.tooltips, function (id, tooltipData) {
|
var event = $.Event('blur')
|
event.target = event.currentTarget = tooltipData.element[0]
|
that.close(event, true)
|
})
|
|
// Remove title attributes to prevent native tooltips
|
this.disabledTitles = this.disabledTitles.add(
|
this.element
|
.find(this.options.items)
|
.addBack()
|
.filter(function () {
|
var element = $(this)
|
if (element.is('[title]')) {
|
return element.data('ui-tooltip-title', element.attr('title')).removeAttr('title')
|
}
|
})
|
)
|
},
|
|
_enable: function () {
|
// restore title attributes
|
this.disabledTitles.each(function () {
|
var element = $(this)
|
if (element.data('ui-tooltip-title')) {
|
element.attr('title', element.data('ui-tooltip-title'))
|
}
|
})
|
this.disabledTitles = $([])
|
},
|
|
open: function (event) {
|
var that = this,
|
target = $(event ? event.target : this.element)
|
// we need closest here due to mouseover bubbling,
|
// but always pointing at the same event target
|
.closest(this.options.items)
|
|
// No element to show a tooltip for or the tooltip is already open
|
if (!target.length || target.data('ui-tooltip-id')) {
|
return
|
}
|
|
if (target.attr('title')) {
|
target.data('ui-tooltip-title', target.attr('title'))
|
}
|
|
target.data('ui-tooltip-open', true)
|
|
// Kill parent tooltips, custom or native, for hover
|
if (event && event.type === 'mouseover') {
|
target.parents().each(function () {
|
var parent = $(this),
|
blurEvent
|
if (parent.data('ui-tooltip-open')) {
|
blurEvent = $.Event('blur')
|
blurEvent.target = blurEvent.currentTarget = this
|
that.close(blurEvent, true)
|
}
|
if (parent.attr('title')) {
|
parent.uniqueId()
|
that.parents[this.id] = {
|
element: this,
|
title: parent.attr('title')
|
}
|
parent.attr('title', '')
|
}
|
})
|
}
|
|
this._registerCloseHandlers(event, target)
|
this._updateContent(target, event)
|
},
|
|
_updateContent: function (target, event) {
|
var content,
|
contentOption = this.options.content,
|
that = this,
|
eventType = event ? event.type : null
|
|
if (typeof contentOption === 'string' || contentOption.nodeType || contentOption.jquery) {
|
return this._open(event, target, contentOption)
|
}
|
|
content = contentOption.call(target[0], function (response) {
|
// IE may instantly serve a cached response for ajax requests
|
// delay this call to _open so the other call to _open runs first
|
that._delay(function () {
|
// Ignore async response if tooltip was closed already
|
if (!target.data('ui-tooltip-open')) {
|
return
|
}
|
|
// JQuery creates a special event for focusin when it doesn't
|
// exist natively. To improve performance, the native event
|
// object is reused and the type is changed. Therefore, we can't
|
// rely on the type being correct after the event finished
|
// bubbling, so we set it back to the previous value. (#8740)
|
if (event) {
|
event.type = eventType
|
}
|
this._open(event, target, response)
|
})
|
})
|
if (content) {
|
this._open(event, target, content)
|
}
|
},
|
|
_open: function (event, target, content) {
|
var tooltipData,
|
tooltip,
|
delayedShow,
|
a11yContent,
|
positionOption = $.extend({}, this.options.position)
|
|
if (!content) {
|
return
|
}
|
|
// Content can be updated multiple times. If the tooltip already
|
// exists, then just update the content and bail.
|
tooltipData = this._find(target)
|
if (tooltipData) {
|
tooltipData.tooltip.find('.ui-tooltip-content').html(content)
|
return
|
}
|
|
// If we have a title, clear it to prevent the native tooltip
|
// we have to check first to avoid defining a title if none exists
|
// (we don't want to cause an element to start matching [title])
|
//
|
// We use removeAttr only for key events, to allow IE to export the correct
|
// accessible attributes. For mouse events, set to empty string to avoid
|
// native tooltip showing up (happens only when removing inside mouseover).
|
if (target.is('[title]')) {
|
if (event && event.type === 'mouseover') {
|
target.attr('title', '')
|
} else {
|
target.removeAttr('title')
|
}
|
}
|
|
tooltipData = this._tooltip(target)
|
tooltip = tooltipData.tooltip
|
this._addDescribedBy(target, tooltip.attr('id'))
|
tooltip.find('.ui-tooltip-content').html(content)
|
|
// Support: Voiceover on OS X, JAWS on IE <= 9
|
// JAWS announces deletions even when aria-relevant="additions"
|
// Voiceover will sometimes re-read the entire log region's contents from the beginning
|
this.liveRegion.children().hide()
|
a11yContent = $('<div>').html(tooltip.find('.ui-tooltip-content').html())
|
a11yContent.removeAttr('name').find('[name]').removeAttr('name')
|
a11yContent.removeAttr('id').find('[id]').removeAttr('id')
|
a11yContent.appendTo(this.liveRegion)
|
|
function position(event) {
|
positionOption.of = event
|
if (tooltip.is(':hidden')) {
|
return
|
}
|
tooltip.position(positionOption)
|
}
|
if (this.options.track && event && /^mouse/.test(event.type)) {
|
this._on(this.document, {
|
mousemove: position
|
})
|
|
// trigger once to override element-relative positioning
|
position(event)
|
} else {
|
tooltip.position(
|
$.extend(
|
{
|
of: target
|
},
|
this.options.position
|
)
|
)
|
}
|
|
tooltip.hide()
|
|
this._show(tooltip, this.options.show)
|
|
// Handle tracking tooltips that are shown with a delay (#8644). As soon
|
// as the tooltip is visible, position the tooltip using the most recent
|
// event.
|
// Adds the check to add the timers only when both delay and track options are set (#14682)
|
if (this.options.track && this.options.show && this.options.show.delay) {
|
delayedShow = this.delayedShow = setInterval(function () {
|
if (tooltip.is(':visible')) {
|
position(positionOption.of)
|
clearInterval(delayedShow)
|
}
|
}, $.fx.interval)
|
}
|
|
this._trigger('open', event, { tooltip: tooltip })
|
},
|
|
_registerCloseHandlers: function (event, target) {
|
var events = {
|
keyup: function (event) {
|
if (event.keyCode === $.ui.keyCode.ESCAPE) {
|
var fakeEvent = $.Event(event)
|
fakeEvent.currentTarget = target[0]
|
this.close(fakeEvent, true)
|
}
|
}
|
}
|
|
// Only bind remove handler for delegated targets. Non-delegated
|
// tooltips will handle this in destroy.
|
if (target[0] !== this.element[0]) {
|
events.remove = function () {
|
this._removeTooltip(this._find(target).tooltip)
|
}
|
}
|
|
if (!event || event.type === 'mouseover') {
|
events.mouseleave = 'close'
|
}
|
if (!event || event.type === 'focusin') {
|
events.focusout = 'close'
|
}
|
this._on(true, target, events)
|
},
|
|
close: function (event) {
|
var tooltip,
|
that = this,
|
target = $(event ? event.currentTarget : this.element),
|
tooltipData = this._find(target)
|
|
// The tooltip may already be closed
|
if (!tooltipData) {
|
// We set ui-tooltip-open immediately upon open (in open()), but only set the
|
// additional data once there's actually content to show (in _open()). So even if the
|
// tooltip doesn't have full data, we always remove ui-tooltip-open in case we're in
|
// the period between open() and _open().
|
target.removeData('ui-tooltip-open')
|
return
|
}
|
|
tooltip = tooltipData.tooltip
|
|
// Disabling closes the tooltip, so we need to track when we're closing
|
// to avoid an infinite loop in case the tooltip becomes disabled on close
|
if (tooltipData.closing) {
|
return
|
}
|
|
// Clear the interval for delayed tracking tooltips
|
clearInterval(this.delayedShow)
|
|
// Only set title if we had one before (see comment in _open())
|
// If the title attribute has changed since open(), don't restore
|
if (target.data('ui-tooltip-title') && !target.attr('title')) {
|
target.attr('title', target.data('ui-tooltip-title'))
|
}
|
|
this._removeDescribedBy(target)
|
|
tooltipData.hiding = true
|
tooltip.stop(true)
|
this._hide(tooltip, this.options.hide, function () {
|
that._removeTooltip($(this))
|
})
|
|
target.removeData('ui-tooltip-open')
|
this._off(target, 'mouseleave focusout keyup')
|
|
// Remove 'remove' binding only on delegated targets
|
if (target[0] !== this.element[0]) {
|
this._off(target, 'remove')
|
}
|
this._off(this.document, 'mousemove')
|
|
if (event && event.type === 'mouseleave') {
|
$.each(this.parents, function (id, parent) {
|
$(parent.element).attr('title', parent.title)
|
delete that.parents[id]
|
})
|
}
|
|
tooltipData.closing = true
|
this._trigger('close', event, { tooltip: tooltip })
|
if (!tooltipData.hiding) {
|
tooltipData.closing = false
|
}
|
},
|
|
_tooltip: function (element) {
|
var tooltip = $('<div>').attr('role', 'tooltip'),
|
content = $('<div>').appendTo(tooltip),
|
id = tooltip.uniqueId().attr('id')
|
|
this._addClass(content, 'ui-tooltip-content')
|
this._addClass(tooltip, 'ui-tooltip', 'ui-widget ui-widget-content')
|
|
tooltip.appendTo(this._appendTo(element))
|
|
return (this.tooltips[id] = {
|
element: element,
|
tooltip: tooltip
|
})
|
},
|
|
_find: function (target) {
|
var id = target.data('ui-tooltip-id')
|
return id ? this.tooltips[id] : null
|
},
|
|
_removeTooltip: function (tooltip) {
|
tooltip.remove()
|
delete this.tooltips[tooltip.attr('id')]
|
},
|
|
_appendTo: function (target) {
|
var element = target.closest('.ui-front, dialog')
|
|
if (!element.length) {
|
element = this.document[0].body
|
}
|
|
return element
|
},
|
|
_destroy: function () {
|
var that = this
|
|
// Close open tooltips
|
$.each(this.tooltips, function (id, tooltipData) {
|
// Delegate to close method to handle common cleanup
|
var event = $.Event('blur'),
|
element = tooltipData.element
|
event.target = event.currentTarget = element[0]
|
that.close(event, true)
|
|
// Remove immediately; destroying an open tooltip doesn't use the
|
// hide animation
|
$('#' + id).remove()
|
|
// Restore the title
|
if (element.data('ui-tooltip-title')) {
|
// If the title attribute has changed since open(), don't restore
|
if (!element.attr('title')) {
|
element.attr('title', element.data('ui-tooltip-title'))
|
}
|
element.removeData('ui-tooltip-title')
|
}
|
})
|
this.liveRegion.remove()
|
}
|
})
|
|
// DEPRECATED
|
// TODO: Switch return back to widget declaration at top of file when this is removed
|
if ($.uiBackCompat !== false) {
|
// Backcompat for tooltipClass option
|
$.widget('ui.tooltip', $.ui.tooltip, {
|
options: {
|
tooltipClass: null
|
},
|
_tooltip: function () {
|
var tooltipData = this._superApply(arguments)
|
if (this.options.tooltipClass) {
|
tooltipData.tooltip.addClass(this.options.tooltipClass)
|
}
|
return tooltipData
|
}
|
})
|
}
|
|
var widgetsTooltip = $.ui.tooltip
|
})
|